From bb7389e9f17c38088c067e8a21dee5889d09e57c Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Wed, 3 Dec 2025 15:24:58 +0000 Subject: [PATCH 01/67] Winit 0.31 WIP Signed-off-by: Nico Burns --- Cargo.lock | 360 +++++++++++++++++++-- Cargo.toml | 4 +- apps/readme/src/main.rs | 16 +- apps/readme/src/readme_application.rs | 99 +++--- packages/blitz-dom/src/events/ime.rs | 8 + packages/blitz-shell/src/accessibility.rs | 16 +- packages/blitz-shell/src/application.rs | 116 ++++--- packages/blitz-shell/src/convert_events.rs | 46 ++- packages/blitz-shell/src/event.rs | 74 +++-- packages/blitz-shell/src/lib.rs | 33 +- packages/blitz-shell/src/net.rs | 40 ++- packages/blitz-shell/src/window.rs | 78 ++--- packages/blitz-traits/src/events.rs | 23 +- 13 files changed, 667 insertions(+), 246 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 1888413d8..6c010b33b 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -107,7 +107,7 @@ dependencies = [ "accesskit_unix", "accesskit_windows", "raw-window-handle", - "winit", + "winit 0.30.12", ] [[package]] @@ -805,7 +805,7 @@ dependencies = [ "fastrand", "html-escape", "image", - "keyboard-types", + "keyboard-types 0.7.0", "linebender_resource_handle", "markup5ever", "objc2 0.6.3", @@ -913,10 +913,10 @@ dependencies = [ "blitz-traits", "data-url", "futures-util", - "keyboard-types", + "keyboard-types 0.7.0", "rfd", "tracing", - "winit", + "winit 0.31.0-beta.2", ] [[package]] @@ -927,9 +927,9 @@ dependencies = [ "bytes", "cursor-icon", "http", - "keyboard-types", + "keyboard-types 0.7.0", "serde", - "smol_str", + "smol_str 0.3.4", "url", ] @@ -979,6 +979,15 @@ dependencies = [ "piper", ] +[[package]] +name = "borsh" +version = "1.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d1da5ab77c1437701eeff7c88d968729e7766172279eab0676857b3d63af7a6f" +dependencies = [ + "cfg_aliases 0.2.1", +] + [[package]] name = "brotli-decompressor" version = "5.0.0" @@ -1105,14 +1114,27 @@ dependencies = [ "thiserror 1.0.69", ] +[[package]] +name = "calloop" +version = "0.14.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb9f6e1368bd4621d2c86baa7e37de77a938adf5221e5dd3d6133340101b309e" +dependencies = [ + "bitflags 2.10.0", + "polling", + "rustix 1.1.2", + "slab", + "tracing", +] + [[package]] name = "calloop-wayland-source" -version = "0.3.0" +version = "0.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "95a66a987056935f7efce4ab5668920b5d0dac4a7c99991a67395f13702ddd20" +checksum = "138efcf0940a02ebf0cc8d1eff41a1682a46b431630f4c52450d6265876021fa" dependencies = [ - "calloop", - "rustix 0.38.44", + "calloop 0.14.3", + "rustix 1.1.2", "wayland-backend", "wayland-client", ] @@ -2007,7 +2029,7 @@ dependencies = [ "futures-channel", "futures-util", "generational-box", - "keyboard-types", + "keyboard-types 0.7.0", "lazy-js-bundle", "rustversion", "serde", @@ -2085,13 +2107,13 @@ dependencies = [ "dioxus-signals", "dioxus-stores", "futures-util", - "keyboard-types", + "keyboard-types 0.7.0", "manganis", "rustc-hash 1.1.0", "tokio", "tracing", "webbrowser", - "winit", + "winit 0.31.0-beta.2", ] [[package]] @@ -2104,7 +2126,7 @@ dependencies = [ "dioxus-core", "dioxus-html", "futures-util", - "keyboard-types", + "keyboard-types 0.7.0", "rustc-hash 1.1.0", "tracing", ] @@ -3761,6 +3783,16 @@ dependencies = [ "unicode-segmentation", ] +[[package]] +name = "keyboard-types" +version = "0.8.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0fbe853b403ae61a04233030ae8a79d94975281ed9770a1f9e246732b534b28d" +dependencies = [ + "bitflags 2.10.0", + "serde", +] + [[package]] name = "khronos-egl" version = "6.0.0" @@ -4590,6 +4622,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2a180dd8642fa45cdb7dd721cd4c11b1cadd4929ce112ebd8b9f5803cc79d536" dependencies = [ "bitflags 2.10.0", + "block2 0.6.2", "dispatch2", "objc2 0.6.3", ] @@ -4602,6 +4635,7 @@ checksum = "e022c9d066895efa1345f8e33e584b9f958da2fd4cd116792e15e07e4720a807" dependencies = [ "bitflags 2.10.0", "dispatch2", + "libc", "objc2 0.6.3", "objc2-core-foundation", "objc2-io-surface", @@ -4663,6 +4697,17 @@ dependencies = [ "objc2-core-graphics", ] +[[package]] +name = "objc2-core-video" +version = "0.3.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d425caf1df73233f29fd8a5c3e5edbc30d2d4307870f802d18f00d83dc5141a6" +dependencies = [ + "bitflags 2.10.0", + "objc2-core-foundation", + "objc2-core-graphics", +] + [[package]] name = "objc2-encode" version = "4.1.0" @@ -5539,7 +5584,7 @@ dependencies = [ "reqwest", "tokio", "url", - "winit", + "winit 0.31.0-beta.2", ] [[package]] @@ -5892,9 +5937,9 @@ checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49" [[package]] name = "sctk-adwaita" -version = "0.10.1" +version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b6277f0217056f77f1d8f49f2950ac6c278c0d607c45f5ee99328d792ede24ec" +checksum = "1dd3accc0f3f4bbaf2c9e1957a030dc582028130c67660d44c0a0345a22ca69b" dependencies = [ "ab_glyph", "log", @@ -6242,24 +6287,26 @@ checksum = "67b1b7a3b5fe4f1376887184045fcf45c69e92af734b7aaddc05fb777b6fbd03" [[package]] name = "smithay-client-toolkit" -version = "0.19.2" +version = "0.20.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3457dea1f0eb631b4034d61d4d8c32074caa6cd1ab2d59f2327bd8461e2c0016" +checksum = "0512da38f5e2b31201a93524adb8d3136276fa4fe4aafab4e1f727a82b534cc0" dependencies = [ "bitflags 2.10.0", - "calloop", + "calloop 0.14.3", "calloop-wayland-source", "cursor-icon", "libc", "log", "memmap2 0.9.9", - "rustix 0.38.44", - "thiserror 1.0.69", + "rustix 1.1.2", + "thiserror 2.0.17", "wayland-backend", "wayland-client", "wayland-csd-frame", "wayland-cursor", "wayland-protocols", + "wayland-protocols-experimental", + "wayland-protocols-misc", "wayland-protocols-wlr", "wayland-scanner", "xkeysym", @@ -6274,6 +6321,16 @@ dependencies = [ "serde", ] +[[package]] +name = "smol_str" +version = "0.3.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3498b0a27f93ef1402f20eefacfaa1691272ac4eca1cdc8c596cb0a245d6cbf5" +dependencies = [ + "borsh", + "serde_core", +] + [[package]] name = "socket2" version = "0.6.1" @@ -7145,6 +7202,7 @@ version = "0.1.44" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "63e71662fa4b2a2c3a26f570f037eb95bb1f85397f3cd8076caed2f026a6d100" dependencies = [ + "log", "pin-project-lite", "tracing-attributes", "tracing-core", @@ -7771,6 +7829,32 @@ dependencies = [ "wayland-scanner", ] +[[package]] +name = "wayland-protocols-experimental" +version = "20250721.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "40a1f863128dcaaec790d7b4b396cc9b9a7a079e878e18c47e6c2d2c5a8dcbb1" +dependencies = [ + "bitflags 2.10.0", + "wayland-backend", + "wayland-client", + "wayland-protocols", + "wayland-scanner", +] + +[[package]] +name = "wayland-protocols-misc" +version = "0.3.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2dfe33d551eb8bffd03ff067a8b44bb963919157841a99957151299a6307d19c" +dependencies = [ + "bitflags 2.10.0", + "wayland-backend", + "wayland-client", + "wayland-protocols", + "wayland-scanner", +] + [[package]] name = "wayland-protocols-plasma" version = "0.3.9" @@ -8646,13 +8730,11 @@ version = "0.30.12" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "c66d4b9ed69c4009f6321f762d6e61ad8a2389cd431b97cb1e146812e9e6c732" dependencies = [ - "ahash", "android-activity", "atomic-waker", "bitflags 2.10.0", "block2 0.5.1", - "bytemuck", - "calloop", + "calloop 0.13.0", "cfg_aliases 0.2.1", "concurrent-queue", "core-foundation 0.9.4", @@ -8661,32 +8743,247 @@ dependencies = [ "dpi", "js-sys", "libc", - "memmap2 0.9.9", "ndk", "objc2 0.5.2", "objc2-app-kit 0.2.2", "objc2-foundation 0.2.2", "objc2-ui-kit 0.2.2", "orbclient", - "percent-encoding", "pin-project", "raw-window-handle", "redox_syscall 0.4.1", "rustix 0.38.44", - "sctk-adwaita", - "smithay-client-toolkit", - "smol_str", + "smol_str 0.2.2", "tracing", "unicode-segmentation", "wasm-bindgen", "wasm-bindgen-futures", + "web-sys", + "web-time", + "windows-sys 0.52.0", + "xkbcommon-dl", +] + +[[package]] +name = "winit" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2879d2854d1a43e48f67322d4bd097afcb6eb8f8f775c8de0260a71aea1df1aa" +dependencies = [ + "bitflags 2.10.0", + "cfg_aliases 0.2.1", + "cursor-icon", + "dpi", + "libc", + "raw-window-handle", + "rustix 1.1.2", + "smol_str 0.3.4", + "tracing", + "winit-android", + "winit-appkit", + "winit-common", + "winit-core", + "winit-orbital", + "winit-uikit", + "winit-wayland", + "winit-web", + "winit-win32", + "winit-x11", +] + +[[package]] +name = "winit-android" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51d9c0d2cd93efec3a9f9ad819cfaf0834782403af7c0d248c784ec0c61761df" +dependencies = [ + "android-activity", + "bitflags 2.10.0", + "dpi", + "ndk", + "raw-window-handle", + "smol_str 0.3.4", + "tracing", + "winit-core", +] + +[[package]] +name = "winit-appkit" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "21310ca07851a49c348e0c2cc768e36b52ca65afda2c2354d78ed4b90074d8aa" +dependencies = [ + "bitflags 2.10.0", + "block2 0.6.2", + "dispatch2", + "dpi", + "objc2 0.6.3", + "objc2-app-kit 0.3.2", + "objc2-core-foundation", + "objc2-core-graphics", + "objc2-core-video", + "objc2-foundation 0.3.2", + "raw-window-handle", + "smol_str 0.3.4", + "tracing", + "winit-common", + "winit-core", +] + +[[package]] +name = "winit-common" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "45375fbac4cbb77260d83a30b1f9d8105880dbac99a9ae97f56656694680ff69" +dependencies = [ + "memmap2 0.9.9", + "objc2 0.6.3", + "objc2-core-foundation", + "smol_str 0.3.4", + "tracing", + "winit-core", + "x11-dl", + "xkbcommon-dl", +] + +[[package]] +name = "winit-core" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e4f0ccd7abb43740e2c6124ac7cae7d865ecec74eec63783e8922577ac232583" +dependencies = [ + "bitflags 2.10.0", + "cursor-icon", + "dpi", + "keyboard-types 0.8.3", + "raw-window-handle", + "smol_str 0.3.4", + "web-time", +] + +[[package]] +name = "winit-orbital" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "51ea1fb262e7209f265f12bd0cc792c399b14355675e65531e9c8a87db287d46" +dependencies = [ + "bitflags 2.10.0", + "dpi", + "orbclient", + "raw-window-handle", + "redox_syscall 0.5.18", + "smol_str 0.3.4", + "tracing", + "winit-core", +] + +[[package]] +name = "winit-uikit" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "680a356e798837d8eb274d4556e83bceaf81698194e31aafc5cfb8a9f2fab643" +dependencies = [ + "bitflags 2.10.0", + "block2 0.6.2", + "dispatch2", + "dpi", + "objc2 0.6.3", + "objc2-core-foundation", + "objc2-foundation 0.3.2", + "objc2-ui-kit 0.3.2", + "raw-window-handle", + "smol_str 0.3.4", + "tracing", + "winit-common", + "winit-core", +] + +[[package]] +name = "winit-wayland" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8ce5afb2ba07da603f84b722c95f9f9396d2cedae3944fb6c0cda4a6f88de545" +dependencies = [ + "ahash", + "bitflags 2.10.0", + "calloop 0.14.3", + "cursor-icon", + "dpi", + "libc", + "memmap2 0.9.9", + "raw-window-handle", + "rustix 1.1.2", + "sctk-adwaita", + "smithay-client-toolkit", + "smol_str 0.3.4", + "tracing", "wayland-backend", "wayland-client", "wayland-protocols", "wayland-protocols-plasma", + "winit-common", + "winit-core", +] + +[[package]] +name = "winit-web" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8c2490a953fb776fbbd5e295d54f1c3847f4f15b6c3929ec53c09acda6487a92" +dependencies = [ + "atomic-waker", + "bitflags 2.10.0", + "concurrent-queue", + "cursor-icon", + "dpi", + "js-sys", + "pin-project", + "raw-window-handle", + "smol_str 0.3.4", + "tracing", + "wasm-bindgen", + "wasm-bindgen-futures", "web-sys", "web-time", - "windows-sys 0.52.0", + "winit-core", +] + +[[package]] +name = "winit-win32" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "644ea78af0e858aa3b092e5d1c67c41995a98220c81813f1353b28bc8bb91eaa" +dependencies = [ + "bitflags 2.10.0", + "cursor-icon", + "dpi", + "raw-window-handle", + "smol_str 0.3.4", + "tracing", + "unicode-segmentation", + "windows-sys 0.59.0", + "winit-core", +] + +[[package]] +name = "winit-x11" +version = "0.31.0-beta.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "aa5b600756534c7041aa93cd0d244d44b09fca1b89e202bd1cd80dd9f3636c46" +dependencies = [ + "bitflags 2.10.0", + "bytemuck", + "calloop 0.14.3", + "cursor-icon", + "dpi", + "libc", + "percent-encoding", + "raw-window-handle", + "rustix 1.1.2", + "smol_str 0.3.4", + "tracing", + "winit-common", + "winit-core", "x11-dl", "x11rb", "xkbcommon-dl", @@ -8807,6 +9104,7 @@ dependencies = [ "once_cell", "rustix 1.1.2", "x11rb-protocol", + "xcursor", ] [[package]] diff --git a/Cargo.toml b/Cargo.toml index ed1a301b3..7bf0861cc 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -128,7 +128,7 @@ usvg = "0.45.1" # Windowing & Input raw-window-handle = "0.6.0" -winit = { version = "0.30.2", features = ["rwh_06"] } +winit = { version = "=0.31.0-beta.2" } accesskit_winit = "0.23" accesskit = "0.17" arboard = { version = "3.4.1", default-features = false } @@ -167,7 +167,7 @@ tracing-subscriber = "0.3" futures-util = "0.3.30" futures-intrusive = "0.5.0" pollster = "0.4" -smol_str = "0.2" +smol_str = "0.3" bitflags = "2.8.0" bytemuck = "1" fastrand = "2.3.0" diff --git a/apps/readme/src/main.rs b/apps/readme/src/main.rs index 5ecb72773..950bbbd38 100644 --- a/apps/readme/src/main.rs +++ b/apps/readme/src/main.rs @@ -37,18 +37,17 @@ use markdown::{BLITZ_MD_STYLES, GITHUB_MD_STYLES, markdown_to_html}; use notify::{Error as NotifyError, Event as NotifyEvent, RecursiveMode, Watcher as _}; use readme_application::{ReadmeApplication, ReadmeEvent}; -use blitz_shell::{BlitzShellEvent, BlitzShellNetWaker, WindowConfig, create_default_event_loop}; +use blitz_shell::{BlitzShellEvent, BlitzShellProxy, WindowConfig, create_default_event_loop}; use std::env::current_dir; use std::fs; use std::path::{Path, PathBuf}; use std::sync::Arc; use tokio::sync::oneshot; use url::Url; -use winit::event_loop::EventLoopProxy; use winit::window::WindowAttributes; struct ReadmeNavigationProvider { - proxy: EventLoopProxy, + proxy: BlitzShellProxy, } impl NavigationProvider for ReadmeNavigationProvider { @@ -74,9 +73,10 @@ fn main() { let _guard = rt.enter(); let event_loop = create_default_event_loop(); - let proxy = event_loop.create_proxy(); + let winit_proxy = event_loop.create_proxy(); + let (proxy, event_queue) = BlitzShellProxy::new(winit_proxy); - let net_waker = Some(BlitzShellNetWaker::shared(proxy.clone())); + let net_waker = Some(Arc::new(proxy.clone()) as _); let net_provider = Arc::new(Provider::new(net_waker)); let (base_url, contents, is_md, file_path) = @@ -98,7 +98,6 @@ fn main() { // println!("{html}"); - let proxy = event_loop.create_proxy(); let navigation_provider = ReadmeNavigationProvider { proxy: proxy.clone(), }; @@ -121,6 +120,7 @@ fn main() { // Create application let mut application = ReadmeApplication::new( proxy.clone(), + event_queue, raw_url.clone(), net_provider, navigation_provider, @@ -131,7 +131,7 @@ fn main() { let mut watcher = notify::recommended_watcher(move |_: Result| { let event = BlitzShellEvent::Embedder(Arc::new(ReadmeEvent)); - proxy.send_event(event).unwrap(); + proxy.send_event(event); }) .unwrap(); @@ -145,7 +145,7 @@ fn main() { } // Run event loop - event_loop.run_app(&mut application).unwrap() + event_loop.run_app(application).unwrap() } async fn fetch( diff --git a/apps/readme/src/readme_application.rs b/apps/readme/src/readme_application.rs index ce22dd9ea..911d9e8f8 100644 --- a/apps/readme/src/readme_application.rs +++ b/apps/readme/src/readme_application.rs @@ -4,12 +4,12 @@ use crate::WindowRenderer; use blitz_dom::DocumentConfig; use blitz_html::HtmlDocument; use blitz_net::Provider; -use blitz_shell::{BlitzApplication, BlitzShellEvent, View, WindowConfig}; +use blitz_shell::{BlitzApplication, BlitzShellEvent, BlitzShellProxy, View, WindowConfig}; use blitz_traits::navigation::{NavigationOptions, NavigationProvider}; use tokio::runtime::Handle; use winit::application::ApplicationHandler; use winit::event::{Modifiers, StartCause, WindowEvent}; -use winit::event_loop::{ActiveEventLoop, EventLoopProxy}; +use winit::event_loop::ActiveEventLoop; use winit::keyboard::{KeyCode, PhysicalKey}; use winit::window::{Theme, WindowId}; @@ -30,14 +30,15 @@ pub struct ReadmeApplication { impl ReadmeApplication { pub fn new( - proxy: EventLoopProxy, + proxy: BlitzShellProxy, + event_queue: std::sync::mpsc::Receiver, raw_url: String, net_provider: Arc, navigation_provider: Arc, ) -> Self { let handle = Handle::current(); Self { - inner: BlitzApplication::new(proxy.clone()), + inner: BlitzApplication::new(proxy, event_queue), handle, raw_url, net_provider, @@ -63,14 +64,12 @@ impl ReadmeApplication { self.handle.spawn(async move { let url = url; let (base_url, contents, is_md, _file_path) = fetch(&url, net_provider).await; - proxy - .send_event(BlitzShellEvent::NavigationLoad { - url: base_url, - contents, - is_md, - retain_scroll_position, - }) - .unwrap(); + proxy.send_event(BlitzShellEvent::NavigationLoad { + url: base_url, + contents, + is_md, + retain_scroll_position, + }); }); } @@ -81,14 +80,12 @@ impl ReadmeApplication { Box::new(move |result| { let (url, bytes) = result.unwrap(); let contents = std::str::from_utf8(&bytes).unwrap().to_string(); - proxy - .send_event(BlitzShellEvent::NavigationLoad { - url, - contents, - is_md: false, - retain_scroll_position: false, - }) - .unwrap(); + proxy.send_event(BlitzShellEvent::NavigationLoad { + url, + contents, + is_md: false, + retain_scroll_position: false, + }); }), ); } @@ -132,22 +129,30 @@ impl ReadmeApplication { } } -impl ApplicationHandler for ReadmeApplication { - fn resumed(&mut self, event_loop: &ActiveEventLoop) { +impl ApplicationHandler for ReadmeApplication { + fn resumed(&mut self, event_loop: &dyn ActiveEventLoop) { self.inner.resumed(event_loop); } - fn suspended(&mut self, event_loop: &ActiveEventLoop) { + fn suspended(&mut self, event_loop: &dyn ActiveEventLoop) { self.inner.suspended(event_loop); } - fn new_events(&mut self, event_loop: &ActiveEventLoop, cause: StartCause) { + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { + self.inner.can_create_surfaces(event_loop); + } + + fn destroy_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { + self.inner.destroy_surfaces(event_loop); + } + + fn new_events(&mut self, event_loop: &dyn ActiveEventLoop, cause: StartCause) { self.inner.new_events(event_loop, cause); } fn window_event( &mut self, - event_loop: &ActiveEventLoop, + event_loop: &dyn ActiveEventLoop, window_id: WindowId, event: WindowEvent, ) { @@ -157,7 +162,7 @@ impl ApplicationHandler for ReadmeApplication { if let WindowEvent::KeyboardInput { event, .. } = &event { let mods = self.keyboard_modifiers.state(); - if !event.state.is_pressed() && (mods.control_key() || mods.super_key()) { + if !event.state.is_pressed() && (mods.control_key() || mods.meta_key()) { match event.physical_key { PhysicalKey::Code(KeyCode::KeyR) => self.reload_document(true), PhysicalKey::Code(KeyCode::KeyT) => self.toggle_theme(), @@ -175,28 +180,30 @@ impl ApplicationHandler for ReadmeApplication { self.inner.window_event(event_loop, window_id, event); } - fn user_event(&mut self, event_loop: &ActiveEventLoop, event: BlitzShellEvent) { - match event { - BlitzShellEvent::Embedder(event) => { - if let Some(_event) = event.downcast_ref::() { - self.reload_document(true); + fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { + while let Ok(event) = self.inner.event_queue.try_recv() { + match event { + BlitzShellEvent::Embedder(event) => { + if let Some(_event) = event.downcast_ref::() { + self.reload_document(true); + } } + BlitzShellEvent::Navigate(options) => { + let old_url = std::mem::replace(&mut self.raw_url, options.url.to_string()); + self.url_history.push(old_url); + self.reload_document(false); + self.navigate(*options); + } + BlitzShellEvent::NavigationLoad { + url, + contents, + retain_scroll_position, + is_md, + } => { + self.load_document(contents, retain_scroll_position, url, is_md); + } + event => self.inner.handle_blitz_shell_event(event_loop, event), } - BlitzShellEvent::Navigate(options) => { - let old_url = std::mem::replace(&mut self.raw_url, options.url.to_string()); - self.url_history.push(old_url); - self.reload_document(false); - self.navigate(*options); - } - BlitzShellEvent::NavigationLoad { - url, - contents, - retain_scroll_position, - is_md, - } => { - self.load_document(contents, retain_scroll_position, url, is_md); - } - event => self.inner.user_event(event_loop, event), } } } diff --git a/packages/blitz-dom/src/events/ime.rs b/packages/blitz-dom/src/events/ime.rs index 635015681..ad629915a 100644 --- a/packages/blitz-dom/src/events/ime.rs +++ b/packages/blitz-dom/src/events/ime.rs @@ -41,6 +41,14 @@ pub(crate) fn handle_ime_event( } doc.shell_provider.request_redraw(); } + BlitzImeEvent::DeleteSurrounding { + before_bytes, + after_bytes, + } => { + let _ = before_bytes; + let _ = after_bytes; + // TODO + } } println!("Sent ime event to {node_id}"); } diff --git a/packages/blitz-shell/src/accessibility.rs b/packages/blitz-shell/src/accessibility.rs index 07aeb9c8d..17f521611 100644 --- a/packages/blitz-shell/src/accessibility.rs +++ b/packages/blitz-shell/src/accessibility.rs @@ -1,22 +1,22 @@ -use crate::event::BlitzShellEvent; -use accesskit_winit::Adapter; +use crate::event::{BlitzShellEvent, BlitzShellProxy}; +// use accesskit_winit::Adapter; use blitz_dom::BaseDocument; use winit::{event_loop::EventLoopProxy, window::Window}; /// State of the accessibility node tree and platform adapter. pub struct AccessibilityState { - /// Adapter to connect to the [`EventLoop`](`winit::event_loop::EventLoop`). - adapter: accesskit_winit::Adapter, + // /// Adapter to connect to the [`EventLoop`](`winit::event_loop::EventLoop`). + // adapter: accesskit_winit::Adapter, } impl AccessibilityState { - pub fn new(window: &Window, proxy: EventLoopProxy) -> Self { + pub fn new(window: &dyn Window, proxy: BlitzShellProxy) -> Self { Self { - adapter: Adapter::with_event_loop_proxy(window, proxy.clone()), + // adapter: Adapter::with_event_loop_proxy(window, proxy.clone()), } } pub fn update_tree(&mut self, doc: &BaseDocument) { - self.adapter - .update_if_active(|| doc.build_accessibility_tree()); + // self.adapter + // .update_if_active(|| doc.build_accessibility_tree()); } } diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index eb7076a67..215752cfe 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -1,10 +1,11 @@ -use crate::event::BlitzShellEvent; +use crate::event::{BlitzShellEvent, BlitzShellProxy}; use anyrender::WindowRenderer; use std::collections::HashMap; +use std::sync::mpsc::Receiver; use winit::application::ApplicationHandler; use winit::event::WindowEvent; -use winit::event_loop::{ActiveEventLoop, EventLoopProxy}; +use winit::event_loop::ActiveEventLoop; use winit::window::WindowId; use crate::{View, WindowConfig}; @@ -12,15 +13,17 @@ use crate::{View, WindowConfig}; pub struct BlitzApplication { pub windows: HashMap>, pub pending_windows: Vec>, - pub proxy: EventLoopProxy, + pub proxy: BlitzShellProxy, + pub event_queue: Receiver, } impl BlitzApplication { - pub fn new(proxy: EventLoopProxy) -> Self { + pub fn new(proxy: BlitzShellProxy, event_queue: Receiver) -> Self { BlitzApplication { windows: HashMap::new(), pending_windows: Vec::new(), proxy, + event_queue, } } @@ -31,10 +34,56 @@ impl BlitzApplication { fn window_mut_by_doc_id(&mut self, doc_id: usize) -> Option<&mut View> { self.windows.values_mut().find(|w| w.doc.id() == doc_id) } + + pub fn handle_blitz_shell_event( + &mut self, + _event_loop: &dyn ActiveEventLoop, + event: BlitzShellEvent, + ) { + match event { + BlitzShellEvent::Poll { window_id } => { + if let Some(window) = self.windows.get_mut(&window_id) { + window.poll(); + }; + } + BlitzShellEvent::RequestRedraw { doc_id } => { + // TODO: Handle multiple documents per window + if let Some(window) = self.window_mut_by_doc_id(doc_id) { + window.request_redraw(); + } + } + + // #[cfg(feature = "accessibility")] + // BlitzShellEvent::Accessibility { window_id, data } => { + // if let Some(window) = self.windows.get_mut(&window_id) { + // match &*data { + // accesskit_winit::WindowEvent::InitialTreeRequested => { + // window.build_accessibility_tree(); + // } + // accesskit_winit::WindowEvent::AccessibilityDeactivated => { + // // TODO + // } + // accesskit_winit::WindowEvent::ActionRequested(_req) => { + // // TODO + // } + // } + // } + // } + BlitzShellEvent::Embedder(_) => { + // Do nothing. Should be handled by embedders (if required). + } + BlitzShellEvent::Navigate(_opts) => { + // Do nothing. Should be handled by embedders (if required). + } + BlitzShellEvent::NavigationLoad { .. } => { + // Do nothing. Should be handled by embedders (if required). + } + } + } } -impl ApplicationHandler for BlitzApplication { - fn resumed(&mut self, event_loop: &ActiveEventLoop) { +impl ApplicationHandler for BlitzApplication { + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { // Resume existing windows for (_, view) in self.windows.iter_mut() { view.resume(); @@ -51,15 +100,23 @@ impl ApplicationHandler for BlitzApplicat } } - fn suspended(&mut self, _event_loop: &ActiveEventLoop) { + fn destroy_surfaces(&mut self, _event_loop: &dyn ActiveEventLoop) { for (_, view) in self.windows.iter_mut() { view.suspend(); } } + fn resumed(&mut self, _event_loop: &dyn ActiveEventLoop) { + // TODO + } + + fn suspended(&mut self, _event_loop: &dyn ActiveEventLoop) { + // TODO + } + fn window_event( &mut self, - event_loop: &ActiveEventLoop, + event_loop: &dyn ActiveEventLoop, window_id: WindowId, event: WindowEvent, ) { @@ -82,46 +139,9 @@ impl ApplicationHandler for BlitzApplicat let _ = self.proxy.send_event(BlitzShellEvent::Poll { window_id }); } - fn user_event(&mut self, _event_loop: &ActiveEventLoop, event: BlitzShellEvent) { - match event { - BlitzShellEvent::Poll { window_id } => { - if let Some(window) = self.windows.get_mut(&window_id) { - window.poll(); - }; - } - BlitzShellEvent::RequestRedraw { doc_id } => { - // TODO: Handle multiple documents per window - if let Some(window) = self.window_mut_by_doc_id(doc_id) { - window.request_redraw(); - } - } - - #[cfg(feature = "accessibility")] - BlitzShellEvent::Accessibility { window_id, data } => { - if let Some(window) = self.windows.get_mut(&window_id) { - match &*data { - accesskit_winit::WindowEvent::InitialTreeRequested => { - window.build_accessibility_tree(); - } - accesskit_winit::WindowEvent::AccessibilityDeactivated => { - // TODO - } - accesskit_winit::WindowEvent::ActionRequested(_req) => { - // TODO - } - } - } - } - - BlitzShellEvent::Embedder(_) => { - // Do nothing. Should be handled by embedders (if required). - } - BlitzShellEvent::Navigate(_opts) => { - // Do nothing. Should be handled by embedders (if required). - } - BlitzShellEvent::NavigationLoad { .. } => { - // Do nothing. Should be handled by embedders (if required). - } + fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { + while let Ok(event) = self.event_queue.try_recv() { + self.handle_blitz_shell_event(event_loop, event); } } } diff --git a/packages/blitz-shell/src/convert_events.rs b/packages/blitz-shell/src/convert_events.rs index e3971fe34..bec3ba861 100644 --- a/packages/blitz-shell/src/convert_events.rs +++ b/packages/blitz-shell/src/convert_events.rs @@ -32,6 +32,13 @@ pub(crate) fn winit_ime_to_blitz(event: Ime) -> BlitzImeEvent { Ime::Disabled => BlitzImeEvent::Disabled, Ime::Preedit(text, cursor) => BlitzImeEvent::Preedit(text, cursor), Ime::Commit(text) => BlitzImeEvent::Commit(text), + Ime::DeleteSurrounding { + before_bytes, + after_bytes, + } => BlitzImeEvent::DeleteSurrounding { + before_bytes, + after_bytes, + }, } } @@ -65,7 +72,7 @@ pub(crate) fn winit_modifiers_to_kbt_modifiers(winit_modifiers: WinitModifiers) if winit_modifiers.shift_key() { modifiers.insert(Modifiers::SHIFT); } - if winit_modifiers.super_key() { + if winit_modifiers.meta_key() { modifiers.insert(Modifiers::SUPER); } modifiers @@ -80,15 +87,13 @@ pub(crate) fn winit_key_location_to_kbt_location(location: WinitKeyLocation) -> } } +#[allow(deprecated)] // Should cover all variants for conversion pub(crate) fn winit_physical_key_to_kbt_code(physical_key: &WinitPhysicalKey) -> Code { match physical_key { WinitPhysicalKey::Unidentified(_) => Code::Unidentified, WinitPhysicalKey::Code(key_code) => match key_code { - // Variants that don't match 1:1 - WinitKeyCode::Meta => Code::Super, - WinitKeyCode::SuperLeft => Code::Super, - WinitKeyCode::SuperRight => Code::Super, - + WinitKeyCode::MetaLeft => Code::Super, + WinitKeyCode::MetaRight => Code::Super, WinitKeyCode::Backquote => Code::Backquote, WinitKeyCode::Backslash => Code::Backslash, WinitKeyCode::BracketLeft => Code::BracketLeft, @@ -280,12 +285,37 @@ pub(crate) fn winit_physical_key_to_kbt_code(physical_key: &WinitPhysicalKey) -> WinitKeyCode::F33 => Code::F33, WinitKeyCode::F34 => Code::F34, WinitKeyCode::F35 => Code::F35, + WinitKeyCode::Super => Code::Super, + WinitKeyCode::Unidentified => Code::Unidentified, + WinitKeyCode::BrightnessDown => Code::BrightnessDown, + WinitKeyCode::BrightnessUp => Code::BrightnessUp, + WinitKeyCode::DisplayToggleIntExt => Code::DisplayToggleIntExt, + WinitKeyCode::KeyboardLayoutSelect => Code::KeyboardLayoutSelect, + WinitKeyCode::LaunchAssistant => Code::LaunchAssistant, + WinitKeyCode::LaunchControlPanel => Code::LaunchControlPanel, + WinitKeyCode::LaunchScreenSaver => Code::LaunchScreenSaver, + WinitKeyCode::MailForward => Code::MailForward, + WinitKeyCode::MailReply => Code::MailReply, + WinitKeyCode::MailSend => Code::MailSend, + WinitKeyCode::MediaFastForward => Code::MediaFastForward, + WinitKeyCode::MediaPause => Code::MediaPause, + WinitKeyCode::MediaPlay => Code::MediaPlay, + WinitKeyCode::MediaRecord => Code::MediaRecord, + WinitKeyCode::MediaRewind => Code::MediaRewind, + WinitKeyCode::MicrophoneMuteToggle => Code::MicrophoneMuteToggle, + WinitKeyCode::PrivacyScreenToggle => Code::PrivacyScreenToggle, + WinitKeyCode::SelectTask => Code::SelectTask, + WinitKeyCode::ShowAllWindows => Code::ShowAllWindows, + WinitKeyCode::ZoomToggle => Code::ZoomToggle, + + WinitKeyCode::KeyboardBacklightToggle => todo!(), _ => todo!(), }, } } pub(crate) fn winit_key_to_kbt_key(winit_key: &WinitKey) -> Key { + #[allow(deprecated)] // Should cover all variants for conversion match winit_key { WinitKey::Character(c) => Key::Character(c.to_string()), WinitKey::Unidentified(_) => Key::Unidentified, @@ -307,7 +337,6 @@ pub(crate) fn winit_key_to_kbt_key(winit_key: &WinitKey) -> Key { WinitNamedKey::Super => Key::Super, WinitNamedKey::Enter => Key::Enter, WinitNamedKey::Tab => Key::Tab, - WinitNamedKey::Space => Key::Character(" ".to_string()), WinitNamedKey::ArrowDown => Key::ArrowDown, WinitNamedKey::ArrowLeft => Key::ArrowLeft, WinitNamedKey::ArrowRight => Key::ArrowRight, @@ -597,6 +626,9 @@ pub(crate) fn winit_key_to_kbt_key(winit_key: &WinitKey) -> Key { WinitNamedKey::F33 => Key::F33, WinitNamedKey::F34 => Key::F34, WinitNamedKey::F35 => Key::F35, + WinitNamedKey::Unidentified => Key::Unidentified, + WinitNamedKey::Dead => Key::Dead, + _ => Key::Unidentified, }, } diff --git a/packages/blitz-shell/src/event.rs b/packages/blitz-shell/src/event.rs index 6df53ba9a..6b3ce497e 100644 --- a/packages/blitz-shell/src/event.rs +++ b/packages/blitz-shell/src/event.rs @@ -1,10 +1,12 @@ use blitz_traits::navigation::NavigationOptions; +use blitz_traits::net::NetWaker; use futures_util::task::ArcWake; +use std::sync::mpsc::{Receiver, Sender, channel}; use std::{any::Any, sync::Arc}; use winit::{event_loop::EventLoopProxy, window::WindowId}; -#[cfg(feature = "accessibility")] -use accesskit_winit::{Event as AccessKitEvent, WindowEvent as AccessKitWindowEvent}; +// #[cfg(feature = "accessibility")] +// use accesskit_winit::{Event as AccessKitEvent, WindowEvent as AccessKitWindowEvent}; #[derive(Debug, Clone)] pub enum BlitzShellEvent { @@ -17,11 +19,11 @@ pub enum BlitzShellEvent { }, /// An accessibility event from `accesskit`. - #[cfg(feature = "accessibility")] - Accessibility { - window_id: WindowId, - data: Arc, - }, + // #[cfg(feature = "accessibility")] + // Accessibility { + // window_id: WindowId, + // data: Arc, + // }, /// An arbitary event from the Blitz embedder Embedder(Arc), @@ -44,13 +46,48 @@ impl BlitzShellEvent { } } -#[cfg(feature = "accessibility")] -impl From for BlitzShellEvent { - fn from(value: AccessKitEvent) -> Self { - Self::Accessibility { - window_id: value.window_id, - data: Arc::new(value.window_event), - } +// #[cfg(feature = "accessibility")] +// impl From for BlitzShellEvent { +// fn from(value: AccessKitEvent) -> Self { +// Self::Accessibility { +// window_id: value.window_id, +// data: Arc::new(value.window_event), +// } +// } +// } + +#[derive(Clone)] +pub struct BlitzShellProxy(Arc); +pub struct BlitzShellProxyInner { + winit_proxy: EventLoopProxy, + sender: Sender, +} + +impl BlitzShellProxy { + pub fn new(winit_proxy: EventLoopProxy) -> (Self, Receiver) { + let (sender, receiver) = channel(); + let proxy = Self(Arc::new(BlitzShellProxyInner { + winit_proxy, + sender, + })); + (proxy, receiver) + } + + pub fn wake_up(&self) { + self.0.winit_proxy.wake_up(); + } + pub fn send_event(&self, event: impl Into) { + self.send_event_impl(event.into()); + } + fn send_event_impl(&self, event: BlitzShellEvent) { + let _ = self.0.sender.send(event); + self.wake_up(); + } +} + +impl NetWaker for BlitzShellProxy { + fn wake(&self, client_id: usize) { + self.send_event_impl(BlitzShellEvent::RequestRedraw { doc_id: client_id }) } } @@ -59,16 +96,17 @@ impl From for BlitzShellEvent { /// This lets the VirtualDom "come up for air" and process events while the main thread is blocked by the WebView. /// /// All other IO lives in the Tokio runtime, -pub fn create_waker(proxy: &EventLoopProxy, id: WindowId) -> std::task::Waker { +pub fn create_waker(proxy: &BlitzShellProxy, id: WindowId) -> std::task::Waker { struct DomHandle { - proxy: EventLoopProxy, + proxy: BlitzShellProxy, id: WindowId, } impl ArcWake for DomHandle { fn wake_by_ref(arc_self: &Arc) { - _ = arc_self.proxy.send_event(BlitzShellEvent::Poll { + let event = BlitzShellEvent::Poll { window_id: arc_self.id, - }) + }; + arc_self.proxy.send_event(event) } } diff --git a/packages/blitz-shell/src/lib.rs b/packages/blitz-shell/src/lib.rs index a8d442db4..4149085ce 100644 --- a/packages/blitz-shell/src/lib.rs +++ b/packages/blitz-shell/src/lib.rs @@ -18,8 +18,7 @@ mod window; mod accessibility; pub use crate::application::BlitzApplication; -pub use crate::event::BlitzShellEvent; -pub use crate::net::BlitzShellNetWaker; +pub use crate::event::{BlitzShellEvent, BlitzShellProxy}; pub use crate::window::{View, WindowConfig}; #[cfg(feature = "data-uri")] @@ -40,9 +39,11 @@ pub use crate::net::DataUriNetProvider; use blitz_traits::shell::FileDialogFilter; use blitz_traits::shell::ShellProvider; use std::sync::Arc; +use winit::cursor::{Cursor, CursorIcon}; use winit::dpi::{LogicalPosition, LogicalSize}; pub use winit::event_loop::{ControlFlow, EventLoop, EventLoopProxy}; -pub use winit::window::{CursorIcon, Window}; +pub use winit::window::Window; +use winit::window::{ImeCapabilities, ImeEnableRequest, ImeRequest, ImeRequestData}; #[derive(Default)] pub struct Config { @@ -51,8 +52,8 @@ pub struct Config { } /// Build an event loop for the application -pub fn create_default_event_loop() -> EventLoop { - let mut ev_builder = EventLoop::::with_user_event(); +pub fn create_default_event_loop() -> EventLoop { + let mut ev_builder = EventLoop::builder(); #[cfg(target_os = "android")] { use winit::platform::android::EventLoopBuilderExtAndroid; @@ -84,10 +85,10 @@ pub fn current_android_app() -> android_activity::AndroidApp { } pub struct BlitzShellProvider { - window: Arc, + window: Arc, } impl BlitzShellProvider { - pub fn new(window: Arc) -> Self { + pub fn new(window: Arc) -> Self { Self { window } } } @@ -97,17 +98,27 @@ impl ShellProvider for BlitzShellProvider { self.window.request_redraw(); } fn set_cursor(&self, icon: CursorIcon) { - self.window.set_cursor(icon); + self.window.set_cursor(Cursor::Icon(icon)); } fn set_window_title(&self, title: String) { self.window.set_title(&title); } fn set_ime_enabled(&self, is_enabled: bool) { - self.window.set_ime_allowed(is_enabled); + if is_enabled { + let _ = self.window.request_ime_update(ImeRequest::Enable( + ImeEnableRequest::new(ImeCapabilities::new(), ImeRequestData::default()).unwrap(), + )); + } else { + let _ = self.window.request_ime_update(ImeRequest::Disable); + } } fn set_ime_cursor_area(&self, x: f32, y: f32, width: f32, height: f32) { - self.window - .set_ime_cursor_area(LogicalPosition::new(x, y), LogicalSize::new(width, height)); + let _ = self.window.request_ime_update(ImeRequest::Update( + ImeRequestData::default().with_cursor_area( + LogicalPosition::new(x, y).into(), + LogicalSize::new(width, height).into(), + ), + )); } #[cfg(all( diff --git a/packages/blitz-shell/src/net.rs b/packages/blitz-shell/src/net.rs index 986c14c2c..f589ab2b2 100644 --- a/packages/blitz-shell/src/net.rs +++ b/packages/blitz-shell/src/net.rs @@ -1,29 +1,27 @@ -use std::sync::Arc; +// use std::sync::Arc; -use blitz_traits::net::NetWaker; -use winit::event_loop::EventLoopProxy; +// use blitz_traits::net::NetWaker; +// use winit::event_loop::EventLoopProxy; -use crate::BlitzShellEvent; +// use crate::{BlitzShellEvent, event::BlitzShellProxy}; -/// A NetWaker that wakes up our winit event loop -pub struct BlitzShellNetWaker(EventLoopProxy); +// /// A NetWaker that wakes up our winit event loop +// pub struct BlitzShellNetWaker(BlitzShellProxy); -impl BlitzShellNetWaker { - pub fn new(proxy: EventLoopProxy) -> Self { - Self(proxy) - } +// impl BlitzShellNetWaker { +// pub fn new(proxy: BlitzShellProxy) -> Self { +// Self(proxy) +// } - pub fn shared(proxy: EventLoopProxy) -> Arc { - Arc::new(Self(proxy)) - } -} -impl NetWaker for BlitzShellNetWaker { - fn wake(&self, doc_id: usize) { - self.0 - .send_event(BlitzShellEvent::RequestRedraw { doc_id }) - .unwrap() - } -} +// pub fn shared(proxy: BlitzShellProxy) -> Arc { +// Arc::new(Self(proxy)) +// } +// } +// impl NetWaker for BlitzShellNetWaker { +// fn wake(&self, doc_id: usize) { +// self.0.send_event(BlitzShellEvent::RequestRedraw { doc_id }) +// } +// } #[cfg(feature = "data-uri")] mod data_uri_net_provider { diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 4b1eec39d..61856e8fc 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -3,7 +3,7 @@ use crate::convert_events::{ color_scheme_to_theme, theme_to_color_scheme, winit_ime_to_blitz, winit_key_event_to_blitz, winit_modifiers_to_kbt_modifiers, }; -use crate::event::{BlitzShellEvent, create_waker}; +use crate::event::{BlitzShellProxy, create_waker}; use anyrender::WindowRenderer; use blitz_dom::Document; use blitz_paint::paint_scene; @@ -18,8 +18,8 @@ use std::any::Any; use std::sync::Arc; use std::task::Waker; use std::time::Instant; -use winit::event::{ElementState, MouseButton}; -use winit::event_loop::{ActiveEventLoop, EventLoopProxy}; +use winit::event::{ButtonSource, ElementState, MouseButton}; +use winit::event_loop::ActiveEventLoop; use winit::window::{Theme, WindowAttributes, WindowId}; use winit::{event::Modifiers, event::WindowEvent, keyboard::KeyCode, window::Window}; @@ -34,7 +34,7 @@ pub struct WindowConfig { impl WindowConfig { pub fn new(doc: Box, renderer: Rend) -> Self { - Self::with_attributes(doc, renderer, Window::default_attributes()) + Self::with_attributes(doc, renderer, WindowAttributes::default()) } pub fn with_attributes( @@ -56,8 +56,8 @@ pub struct View { pub renderer: Rend, pub waker: Option, - pub event_loop_proxy: EventLoopProxy, - pub window: Arc, + pub proxy: BlitzShellProxy, + pub window: Arc, /// The state of the keyboard modifiers (ctrl, shift, etc). Winit/Tao don't track these for us so we /// need to store them in order to have access to them when processing keypress events @@ -76,13 +76,15 @@ pub struct View { impl View { pub fn init( config: WindowConfig, - event_loop: &ActiveEventLoop, - proxy: &EventLoopProxy, + event_loop: &dyn ActiveEventLoop, + proxy: &BlitzShellProxy, ) -> Self { - let winit_window = Arc::from(event_loop.create_window(config.attributes).unwrap()); + let winit_window: Arc = + Arc::from(event_loop.create_window(config.attributes).unwrap()); // Create viewport - let size = winit_window.inner_size(); + // TODO: account for the "safe area" + let size = winit_window.surface_size(); let scale = winit_window.scale_factor() as f32; let theme = winit_window.theme().unwrap_or(Theme::Light); let color_scheme = theme_to_color_scheme(theme); @@ -111,7 +113,7 @@ impl View { waker: None, animation_timer: None, keyboard_modifiers: Default::default(), - event_loop_proxy: proxy.clone(), + proxy: proxy.clone(), window: winit_window.clone(), doc, theme_override: None, @@ -119,7 +121,7 @@ impl View { mouse_pos: Default::default(), is_visible: winit_window.is_visible().unwrap_or(true), #[cfg(feature = "accessibility")] - accessibility: AccessibilityState::new(&winit_window, proxy.clone()), + accessibility: AccessibilityState::new(&*winit_window, proxy.clone()), } } @@ -189,7 +191,8 @@ impl View { // Resume renderer let (width, height) = inner.viewport().window_size; let scale = inner.viewport().scale_f64(); - self.renderer.resume(self.window.clone(), width, height); + self.renderer + .resume(Arc::new(self.window.clone()), width, height); if !self.renderer.is_active() { panic!("Renderer failed to resume"); }; @@ -199,7 +202,7 @@ impl View { .render(|scene| paint_scene(scene, &inner, scale, width, height)); // Set waker - self.waker = Some(create_waker(&self.event_loop_proxy, window_id)); + self.waker = Some(create_waker(&self.proxy, window_id)); } pub fn suspend(&mut self) { @@ -279,7 +282,6 @@ impl View { pub fn handle_winit_event(&mut self, event: WindowEvent) { match event { - // Window lifecycle events WindowEvent::Destroyed => {} WindowEvent::ActivationTokenDone { .. } => {}, WindowEvent::CloseRequested => { @@ -288,8 +290,6 @@ impl View { WindowEvent::RedrawRequested => { self.redraw(); } - - // Window size/position events WindowEvent::Moved(_) => {} WindowEvent::Occluded(is_occluded) => { self.is_visible = !is_occluded; @@ -297,21 +297,17 @@ impl View { self.request_redraw(); } }, - WindowEvent::Resized(physical_size) => { + WindowEvent::SurfaceResized(physical_size) => { self.with_viewport(|v| v.window_size = (physical_size.width, physical_size.height)); } WindowEvent::ScaleFactorChanged { scale_factor, .. } => { self.with_viewport(|v| v.set_hidpi_scale(scale_factor as f32)); } - - // Theme events WindowEvent::ThemeChanged(theme) => { let color_scheme = theme_to_color_scheme(self.theme_override.unwrap_or(theme)); let mut inner = self.doc.inner_mut(); inner.viewport_mut().color_scheme = color_scheme; } - - // Text / keyboard events WindowEvent::Ime(ime_event) => { self.doc.handle_ui_event(UiEvent::Ime(winit_ime_to_blitz(ime_event))); self.request_redraw(); @@ -327,7 +323,7 @@ impl View { if event.state.is_pressed() { let ctrl = self.keyboard_modifiers.state().control_key(); - let meta = self.keyboard_modifiers.state().super_key(); + let meta = self.keyboard_modifiers.state().meta_key(); let alt = self.keyboard_modifiers.state().alt_key(); // Ctrl/Super keyboard shortcuts @@ -381,12 +377,9 @@ impl View { self.doc.handle_ui_event(event); } - - - // Mouse/pointer events - WindowEvent::CursorEntered { /*device_id*/.. } => {} - WindowEvent::CursorLeft { /*device_id*/.. } => {} - WindowEvent::CursorMoved { position, .. } => { + WindowEvent::PointerEntered { /*device_id*/.. } => {} + WindowEvent::PointerLeft { /*device_id*/.. } => {} + WindowEvent::PointerMoved { position, .. } => { let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); self.mouse_pos = (x, y); let event = UiEvent::MouseMove(BlitzMouseButtonEvent { @@ -398,12 +391,17 @@ impl View { }); self.doc.handle_ui_event(event); } - WindowEvent::MouseInput { button, state, .. } => { + WindowEvent::PointerButton { button, state, .. } => { let button = match button { - MouseButton::Left => MouseEventButton::Main, - MouseButton::Right => MouseEventButton::Secondary, - MouseButton::Middle => MouseEventButton::Auxiliary, + ButtonSource::Mouse(mouse_button) => match mouse_button { + MouseButton::Left => MouseEventButton::Main, + MouseButton::Right => MouseEventButton::Secondary, + MouseButton::Middle => MouseEventButton::Auxiliary, + // TODO: handle other button types + _ => return, + } _ => return, + }; match state { @@ -443,22 +441,16 @@ impl View { self.doc.handle_ui_event(UiEvent::Wheel(event)); } - - // File events - WindowEvent::DroppedFile(_) => {} - WindowEvent::HoveredFile(_) => {} - WindowEvent::HoveredFileCancelled => {} WindowEvent::Focused(_) => {} - - // Touch and motion events - // Todo implement touch scrolling - WindowEvent::Touch(_) => {} WindowEvent::TouchpadPressure { .. } => {} - WindowEvent::AxisMotion { .. } => {} WindowEvent::PinchGesture { .. } => {}, WindowEvent::PanGesture { .. } => {}, WindowEvent::DoubleTapGesture { .. } => {}, WindowEvent::RotationGesture { .. } => {}, + WindowEvent::DragEntered { .. } => {}, + WindowEvent::DragMoved { .. } => {}, + WindowEvent::DragDropped { .. } => {}, + WindowEvent::DragLeft { .. } => {}, } } } diff --git a/packages/blitz-traits/src/events.rs b/packages/blitz-traits/src/events.rs index e9c174e34..9780a0171 100644 --- a/packages/blitz-traits/src/events.rs +++ b/packages/blitz-traits/src/events.rs @@ -439,7 +439,8 @@ pub enum BlitzImeEvent { /// Notifies when the IME was enabled. /// /// After getting this event you could receive [`Preedit`][Self::Preedit] and - /// [`Commit`][Self::Commit] events. + /// [`Commit`][Self::Commit] events. You should also start performing IME related requests + /// like [`Window::set_ime_cursor_area`]. Enabled, /// Notifies when a new composing text should be set at the cursor position. @@ -448,7 +449,7 @@ pub enum BlitzImeEvent { /// position. When it's `None`, the cursor should be hidden. When `String` is an empty string /// this indicates that preedit was cleared. /// - /// The cursor position is byte-wise indexed. + /// The cursor position is byte-wise indexed, assuming UTF-8. Preedit(String, Option<(usize, usize)>), /// Notifies when text should be inserted into the editor widget. @@ -456,9 +457,25 @@ pub enum BlitzImeEvent { /// Right before this event winit will send empty [`Self::Preedit`] event. Commit(String), + /// Delete text surrounding the cursor or selection. + /// + /// This event does not affect either the pre-edit string. + /// This means that the application must first remove the pre-edit, + /// then execute the deletion, then insert the removed text back. + /// + /// This event assumes text is stored in UTF-8. + DeleteSurrounding { + /// Bytes to remove before the selection + before_bytes: usize, + /// Bytes to remove after the selection + after_bytes: usize, + }, + /// Notifies when the IME was disabled. /// /// After receiving this event you won't get any more [`Preedit`][Self::Preedit] or - /// [`Commit`][Self::Commit] events until the next [`Enabled`][Self::Enabled] event. + /// [`Commit`][Self::Commit] events until the next [`Enabled`][Self::Enabled] event. You should + /// also stop issuing IME related requests like [`Window::set_ime_cursor_area`] and clear + /// pending preedit text. Disabled, } From b7c2e5b540851b4de12c592809d722f97fca016a Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Wed, 3 Dec 2025 16:35:20 +0000 Subject: [PATCH 02/67] Fixup Dioxus Native for Winit 0.31 --- apps/readme/src/main.rs | 3 +- packages/blitz-shell/src/application.rs | 2 +- packages/dioxus-native/src/assets.rs | 13 ++-- packages/dioxus-native/src/contexts.rs | 10 +-- .../dioxus-native/src/dioxus_application.rs | 63 +++++++++++-------- packages/dioxus-native/src/lib.rs | 28 ++++----- 6 files changed, 64 insertions(+), 55 deletions(-) diff --git a/apps/readme/src/main.rs b/apps/readme/src/main.rs index 950bbbd38..b1742621a 100644 --- a/apps/readme/src/main.rs +++ b/apps/readme/src/main.rs @@ -52,8 +52,7 @@ struct ReadmeNavigationProvider { impl NavigationProvider for ReadmeNavigationProvider { fn navigate_to(&self, opts: NavigationOptions) { - let _ = self - .proxy + self.proxy .send_event(BlitzShellEvent::Navigate(Box::new(opts))); } } diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index 215752cfe..3648c7298 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -136,7 +136,7 @@ impl ApplicationHandler for BlitzApplication { window.handle_winit_event(event); } - let _ = self.proxy.send_event(BlitzShellEvent::Poll { window_id }); + self.proxy.send_event(BlitzShellEvent::Poll { window_id }); } fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { diff --git a/packages/dioxus-native/src/assets.rs b/packages/dioxus-native/src/assets.rs index 3332c5063..90fbd95a1 100644 --- a/packages/dioxus-native/src/assets.rs +++ b/packages/dioxus-native/src/assets.rs @@ -1,9 +1,7 @@ -use blitz_shell::BlitzShellNetWaker; +use blitz_shell::BlitzShellProxy; use std::sync::Arc; -use blitz_shell::BlitzShellEvent; use blitz_traits::net::{NetHandler, NetProvider, Request}; -use winit::event_loop::EventLoopProxy; pub struct DioxusNativeNetProvider { inner_net_provider: Option>, @@ -11,12 +9,13 @@ pub struct DioxusNativeNetProvider { #[allow(unused)] impl DioxusNativeNetProvider { - pub fn shared(proxy: EventLoopProxy) -> Arc { + pub fn shared(proxy: BlitzShellProxy) -> Arc { Arc::new(Self::new(proxy)) as Arc } - pub fn new(proxy: EventLoopProxy) -> Self { - let net_waker = Some(BlitzShellNetWaker::shared(proxy)); + pub fn new(proxy: BlitzShellProxy) -> Self { + #[cfg(any(feature = "data-uri", feature = "net"))] + let net_waker = Some(Arc::new(proxy) as _); #[cfg(feature = "net")] let inner_net_provider = Some(blitz_net::Provider::shared(net_waker.clone())); @@ -28,7 +27,7 @@ impl DioxusNativeNetProvider { Self { inner_net_provider } } - pub fn with_inner(proxy: EventLoopProxy, inner: Arc) -> Self { + pub fn with_inner(proxy: BlitzShellProxy, inner: Arc) -> Self { Self { inner_net_provider: Some(inner), } diff --git a/packages/dioxus-native/src/contexts.rs b/packages/dioxus-native/src/contexts.rs index 0cc6c5ab3..114186db9 100644 --- a/packages/dioxus-native/src/contexts.rs +++ b/packages/dioxus-native/src/contexts.rs @@ -1,16 +1,16 @@ -use blitz_shell::BlitzShellEvent; +use blitz_shell::{BlitzShellEvent, BlitzShellProxy}; use dioxus_document::{Document, NoOpDocument}; -use winit::{event_loop::EventLoopProxy, window::WindowId}; +use winit::window::WindowId; use crate::DioxusNativeEvent; pub struct DioxusNativeDocument { - pub(crate) proxy: EventLoopProxy, + pub(crate) proxy: BlitzShellProxy, pub(crate) window: WindowId, } impl DioxusNativeDocument { - pub(crate) fn new(proxy: EventLoopProxy, window: WindowId) -> Self { + pub(crate) fn new(proxy: BlitzShellProxy, window: WindowId) -> Self { Self { proxy, window } } } @@ -27,7 +27,7 @@ impl Document for DioxusNativeDocument { contents: Option, ) { let window = self.window; - _ = self.proxy.send_event(BlitzShellEvent::embedder_event( + self.proxy.send_event(BlitzShellEvent::embedder_event( DioxusNativeEvent::CreateHeadElement { name: name.to_string(), attributes: attributes diff --git a/packages/dioxus-native/src/dioxus_application.rs b/packages/dioxus-native/src/dioxus_application.rs index 4622b30a5..1c4b5e3a6 100644 --- a/packages/dioxus-native/src/dioxus_application.rs +++ b/packages/dioxus-native/src/dioxus_application.rs @@ -1,10 +1,10 @@ -use blitz_shell::{BlitzApplication, View}; +use blitz_shell::{BlitzApplication, BlitzShellProxy, View}; use dioxus_core::{provide_context, ScopeId}; use dioxus_history::{History, MemoryHistory}; use std::rc::Rc; use winit::application::ApplicationHandler; use winit::event::{StartCause, WindowEvent}; -use winit::event_loop::{ActiveEventLoop, EventLoopProxy}; +use winit::event_loop::ActiveEventLoop; use winit::window::WindowId; use crate::DioxusNativeWindowRenderer; @@ -30,18 +30,17 @@ pub enum DioxusNativeEvent { pub struct DioxusNativeApplication { pending_window: Option>, inner: BlitzApplication, - proxy: EventLoopProxy, } impl DioxusNativeApplication { pub fn new( - proxy: EventLoopProxy, + proxy: BlitzShellProxy, + event_queue: std::sync::mpsc::Receiver, config: WindowConfig, ) -> Self { Self { pending_window: Some(config), - inner: BlitzApplication::new(proxy.clone()), - proxy, + inner: BlitzApplication::new(proxy, event_queue), } } @@ -49,9 +48,9 @@ impl DioxusNativeApplication { self.inner.add_window(window_config); } - fn handle_blitz_shell_event( + fn handle_dioxus_native_event( &mut self, - event_loop: &ActiveEventLoop, + event_loop: &dyn ActiveEventLoop, event: &DioxusNativeEvent, ) { match event { @@ -105,20 +104,34 @@ impl DioxusNativeApplication { } } -impl ApplicationHandler for DioxusNativeApplication { - fn resumed(&mut self, event_loop: &ActiveEventLoop) { +impl ApplicationHandler for DioxusNativeApplication { + fn resumed(&mut self, event_loop: &dyn ActiveEventLoop) { + self.inner.resumed(event_loop); + } + + fn suspended(&mut self, event_loop: &dyn ActiveEventLoop) { + self.inner.suspended(event_loop); + } + + fn destroy_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { + self.inner.destroy_surfaces(event_loop); + } + + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { #[cfg(feature = "tracing")] tracing::debug!("Injecting document provider into all windows"); if let Some(config) = self.pending_window.take() { - let mut window = View::init(config, event_loop, &self.proxy); + let mut window = View::init(config, event_loop, &self.inner.proxy); let renderer = window.renderer.clone(); let window_id = window.window_id(); let doc = window.downcast_doc_mut::(); doc.vdom.in_scope(ScopeId::ROOT, || { - let shared: Rc = - Rc::new(DioxusNativeDocument::new(self.proxy.clone(), window_id)); + let shared: Rc = Rc::new(DioxusNativeDocument::new( + self.inner.proxy.clone(), + window_id, + )); provide_context(shared); }); @@ -146,34 +159,32 @@ impl ApplicationHandler for DioxusNativeApplication { self.inner.windows.insert(window_id, window); } - self.inner.resumed(event_loop); + self.inner.can_create_surfaces(event_loop); } - fn suspended(&mut self, event_loop: &ActiveEventLoop) { - self.inner.suspended(event_loop); - } - - fn new_events(&mut self, event_loop: &ActiveEventLoop, cause: StartCause) { + fn new_events(&mut self, event_loop: &dyn ActiveEventLoop, cause: StartCause) { self.inner.new_events(event_loop, cause); } fn window_event( &mut self, - event_loop: &ActiveEventLoop, + event_loop: &dyn ActiveEventLoop, window_id: WindowId, event: WindowEvent, ) { self.inner.window_event(event_loop, window_id, event); } - fn user_event(&mut self, event_loop: &ActiveEventLoop, event: BlitzShellEvent) { - match event { - BlitzShellEvent::Embedder(event) => { - if let Some(event) = event.downcast_ref::() { - self.handle_blitz_shell_event(event_loop, event); + fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { + while let Ok(event) = self.inner.event_queue.try_recv() { + match event { + BlitzShellEvent::Embedder(event) => { + if let Some(event) = event.downcast_ref::() { + self.handle_dioxus_native_event(event_loop, event); + } } + event => self.inner.handle_blitz_shell_event(event_loop, event), } - event => self.inner.user_event(event_loop, event), } } } diff --git a/packages/dioxus-native/src/lib.rs b/packages/dioxus-native/src/lib.rs index cc966a617..b4c7d53f6 100644 --- a/packages/dioxus-native/src/lib.rs +++ b/packages/dioxus-native/src/lib.rs @@ -58,7 +58,9 @@ pub use { dioxus_renderer::{use_wgpu, Features, Limits}, }; -use blitz_shell::{create_default_event_loop, BlitzShellEvent, Config, WindowConfig}; +use blitz_shell::{ + create_default_event_loop, BlitzShellEvent, BlitzShellProxy, Config, WindowConfig, +}; use dioxus_core::{ComponentFunction, Element, VirtualDom}; use link_handler::DioxusNativeNavigationProvider; use std::any::Any; @@ -130,7 +132,9 @@ pub fn launch_cfg_with_props( let _ = cfg; } - let event_loop = create_default_event_loop::(); + let event_loop = create_default_event_loop(); + let winit_proxy = event_loop.create_proxy(); + let (proxy, event_queue) = BlitzShellProxy::new(winit_proxy); // Turn on the runtime and enter it #[cfg(feature = "net")] @@ -144,10 +148,10 @@ pub fn launch_cfg_with_props( // Setup hot-reloading if enabled. #[cfg(all(feature = "hot-reload", debug_assertions))] { - let proxy = event_loop.create_proxy(); + let proxy = proxy.clone(); dioxus_devtools::connect(move |event| { let dxn_event = DioxusNativeEvent::DevserverEvent(event); - let _ = proxy.send_event(BlitzShellEvent::embedder_event(dxn_event)); + proxy.send_event(BlitzShellEvent::embedder_event(dxn_event)); }) } @@ -163,22 +167,18 @@ pub fn launch_cfg_with_props( #[cfg(feature = "net")] let net_provider = { - use blitz_shell::BlitzShellNetWaker; - - let proxy = event_loop.create_proxy(); - let net_waker = Some(BlitzShellNetWaker::shared(proxy.clone())); - - let inner_net_provider = Arc::new(blitz_net::Provider::new(net_waker.clone())); + let net_waker = Some(Arc::new(proxy.clone()) as _); + let inner_net_provider = Arc::new(blitz_net::Provider::new(net_waker)); vdom.provide_root_context(Arc::clone(&inner_net_provider)); Arc::new(DioxusNativeNetProvider::with_inner( - proxy, + proxy.clone(), inner_net_provider as _, )) as Arc }; #[cfg(not(feature = "net"))] - let net_provider = DioxusNativeNetProvider::shared(event_loop.create_proxy()); + let net_provider = DioxusNativeNetProvider::shared(proxy.clone()); vdom.provide_root_context(Arc::clone(&net_provider)); @@ -226,8 +226,8 @@ pub fn launch_cfg_with_props( ); // Create application - let mut application = DioxusNativeApplication::new(event_loop.create_proxy(), config); + let application = DioxusNativeApplication::new(proxy, event_queue, config); // Run event loop - event_loop.run_app(&mut application).unwrap(); + event_loop.run_app(application).unwrap(); } From 9577e1e46064802902d474f9b5048aa3b7a1dad0 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Wed, 3 Dec 2025 17:47:45 +0000 Subject: [PATCH 03/67] Add handlers for apple_standard_keybinding --- apps/readme/src/readme_application.rs | 5 +++++ packages/blitz-shell/src/application.rs | 19 ++++++++++++++++++- .../dioxus-native/src/dioxus_application.rs | 5 +++++ 3 files changed, 28 insertions(+), 1 deletion(-) diff --git a/apps/readme/src/readme_application.rs b/apps/readme/src/readme_application.rs index 911d9e8f8..db45cf4c1 100644 --- a/apps/readme/src/readme_application.rs +++ b/apps/readme/src/readme_application.rs @@ -11,6 +11,7 @@ use winit::application::ApplicationHandler; use winit::event::{Modifiers, StartCause, WindowEvent}; use winit::event_loop::ActiveEventLoop; use winit::keyboard::{KeyCode, PhysicalKey}; +use winit::platform::macos::ApplicationHandlerExtMacOS; use winit::window::{Theme, WindowId}; use crate::fetch; @@ -130,6 +131,10 @@ impl ReadmeApplication { } impl ApplicationHandler for ReadmeApplication { + fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { + self.inner.macos_handler() + } + fn resumed(&mut self, event_loop: &dyn ActiveEventLoop) { self.inner.resumed(event_loop); } diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index 3648c7298..d1774f80f 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -3,10 +3,10 @@ use crate::event::{BlitzShellEvent, BlitzShellProxy}; use anyrender::WindowRenderer; use std::collections::HashMap; use std::sync::mpsc::Receiver; -use winit::application::ApplicationHandler; use winit::event::WindowEvent; use winit::event_loop::ActiveEventLoop; use winit::window::WindowId; +use winit::{application::ApplicationHandler, platform::macos::ApplicationHandlerExtMacOS}; use crate::{View, WindowConfig}; @@ -83,6 +83,10 @@ impl BlitzApplication { } impl ApplicationHandler for BlitzApplication { + fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { + Some(self) + } + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { // Resume existing windows for (_, view) in self.windows.iter_mut() { @@ -145,3 +149,16 @@ impl ApplicationHandler for BlitzApplication { } } } + +impl ApplicationHandlerExtMacOS for BlitzApplication { + fn standard_key_binding( + &mut self, + event_loop: &dyn ActiveEventLoop, + window_id: WindowId, + action: &str, + ) { + let _ = event_loop; + let _ = window_id; + let _ = action; + } +} diff --git a/packages/dioxus-native/src/dioxus_application.rs b/packages/dioxus-native/src/dioxus_application.rs index 1c4b5e3a6..83605bd27 100644 --- a/packages/dioxus-native/src/dioxus_application.rs +++ b/packages/dioxus-native/src/dioxus_application.rs @@ -5,6 +5,7 @@ use std::rc::Rc; use winit::application::ApplicationHandler; use winit::event::{StartCause, WindowEvent}; use winit::event_loop::ActiveEventLoop; +use winit::platform::macos::ApplicationHandlerExtMacOS; use winit::window::WindowId; use crate::DioxusNativeWindowRenderer; @@ -105,6 +106,10 @@ impl DioxusNativeApplication { } impl ApplicationHandler for DioxusNativeApplication { + fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { + self.inner.macos_handler() + } + fn resumed(&mut self, event_loop: &dyn ActiveEventLoop) { self.inner.resumed(event_loop); } From b1e0b072da11de159da268462035c61bd7974aaf Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 8 Dec 2025 15:27:36 +0000 Subject: [PATCH 04/67] Disable accesskit_winit dep. This is pulling in Winit 0.30 --- Cargo.lock | 982 ++++---------------------------- packages/blitz-shell/Cargo.toml | 4 +- 2 files changed, 112 insertions(+), 874 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 6c010b33b..1fd05d5b8 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -24,92 +24,6 @@ version = "0.17.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d3d3b8f9bae46a948369bc4a03e815d4ed6d616bd00de4051133a5019dc31c5a" -[[package]] -name = "accesskit_atspi_common" -version = "0.10.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7c5dd55e6e94949498698daf4d48fb5659e824d7abec0d394089656ceaf99d4f" -dependencies = [ - "accesskit", - "accesskit_consumer", - "atspi-common", - "serde", - "thiserror 1.0.69", - "zvariant 4.2.0", -] - -[[package]] -name = "accesskit_consumer" -version = "0.26.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f47983a1084940ba9a39c077a8c63e55c619388be5476ac04c804cfbd1e63459" -dependencies = [ - "accesskit", - "hashbrown 0.15.5", - "immutable-chunkmap", -] - -[[package]] -name = "accesskit_macos" -version = "0.18.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "7329821f3bd1101e03a7d2e03bd339e3ac0dc64c70b4c9f9ae1949e3ba8dece1" -dependencies = [ - "accesskit", - "accesskit_consumer", - "hashbrown 0.15.5", - "objc2 0.5.2", - "objc2-app-kit 0.2.2", - "objc2-foundation 0.2.2", -] - -[[package]] -name = "accesskit_unix" -version = "0.13.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fcee751cc20d88678c33edaf9c07e8b693cd02819fe89053776f5313492273f5" -dependencies = [ - "accesskit", - "accesskit_atspi_common", - "async-channel", - "async-executor", - "async-task", - "atspi", - "futures-lite", - "futures-util", - "serde", - "zbus 4.4.0", -] - -[[package]] -name = "accesskit_windows" -version = "0.24.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "24fcd5d23d70670992b823e735e859374d694a3d12bfd8dd32bd3bd8bedb5d81" -dependencies = [ - "accesskit", - "accesskit_consumer", - "hashbrown 0.15.5", - "paste", - "static_assertions", - "windows 0.58.0", - "windows-core 0.58.0", -] - -[[package]] -name = "accesskit_winit" -version = "0.23.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "6a6a48dad5530b6deb9fc7a52cc6c3bf72cdd9eb8157ac9d32d69f2427a5e879" -dependencies = [ - "accesskit", - "accesskit_macos", - "accesskit_unix", - "accesskit_windows", - "raw-window-handle", - "winit 0.30.12", -] - [[package]] name = "adler2" version = "2.0.1" @@ -277,11 +191,11 @@ dependencies = [ "hashbrown 0.16.1", "kurbo 0.12.0", "oaty", - "objc2 0.6.3", - "objc2-app-kit 0.3.2", + "objc2", + "objc2-app-kit", "objc2-core-foundation", - "objc2-metal 0.3.2", - "objc2-quartz-core 0.3.2", + "objc2-metal", + "objc2-quartz-core", "peniko", "pixels_window_renderer", "raw-window-handle", @@ -371,9 +285,9 @@ checksum = "0348a1c054491f4bfe6ab86a7b6ab1e44e45d899005de92f58b3df180b36ddaf" dependencies = [ "clipboard-win", "log", - "objc2 0.6.3", - "objc2-app-kit 0.3.2", - "objc2-foundation 0.3.2", + "objc2", + "objc2-app-kit", + "objc2-foundation", "parking_lot", "percent-encoding", "windows-sys 0.60.2", @@ -436,7 +350,7 @@ dependencies = [ "enumflags2", "futures-channel", "futures-util", - "rand 0.9.2", + "rand", "raw-window-handle", "serde", "serde_repr", @@ -445,7 +359,7 @@ dependencies = [ "wayland-backend", "wayland-client", "wayland-protocols", - "zbus 5.12.0", + "zbus", ] [[package]] @@ -460,90 +374,6 @@ dependencies = [ "pin-project-lite", ] -[[package]] -name = "async-channel" -version = "2.5.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "924ed96dd52d1b75e9c1a3e6275715fd320f5f9439fb5a4a11fa51f4221158d2" -dependencies = [ - "concurrent-queue", - "event-listener-strategy", - "futures-core", - "pin-project-lite", -] - -[[package]] -name = "async-executor" -version = "1.13.3" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "497c00e0fd83a72a79a39fcbd8e3e2f055d6f6c7e025f3b3d91f4f8e76527fb8" -dependencies = [ - "async-task", - "concurrent-queue", - "fastrand", - "futures-lite", - "pin-project-lite", - "slab", -] - -[[package]] -name = "async-fs" -version = "2.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8034a681df4aed8b8edbd7fbe472401ecf009251c8b40556b304567052e294c5" -dependencies = [ - "async-lock", - "blocking", - "futures-lite", -] - -[[package]] -name = "async-io" -version = "2.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "456b8a8feb6f42d237746d4b3e9a178494627745c3c56c6ea55d92ba50d026fc" -dependencies = [ - "autocfg", - "cfg-if", - "concurrent-queue", - "futures-io", - "futures-lite", - "parking", - "polling", - "rustix 1.1.2", - "slab", - "windows-sys 0.61.2", -] - -[[package]] -name = "async-lock" -version = "3.4.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "290f7f2596bd5b78a9fec8088ccd89180d7f9f55b94b0576823bbbdc72ee8311" -dependencies = [ - "event-listener", - "event-listener-strategy", - "pin-project-lite", -] - -[[package]] -name = "async-process" -version = "2.5.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fc50921ec0055cdd8a16de48773bfeec5c972598674347252c0399676be7da75" -dependencies = [ - "async-channel", - "async-io", - "async-lock", - "async-signal", - "async-task", - "blocking", - "cfg-if", - "event-listener", - "futures-lite", - "rustix 1.1.2", -] - [[package]] name = "async-recursion" version = "1.1.1" @@ -555,30 +385,6 @@ dependencies = [ "syn 2.0.111", ] -[[package]] -name = "async-signal" -version = "0.2.13" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "43c070bbf59cd3570b6b2dd54cd772527c7c3620fce8be898406dd3ed6adc64c" -dependencies = [ - "async-io", - "async-lock", - "atomic-waker", - "cfg-if", - "futures-core", - "futures-io", - "rustix 1.1.2", - "signal-hook-registry", - "slab", - "windows-sys 0.61.2", -] - -[[package]] -name = "async-task" -version = "4.7.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8b75356056920673b02621b35afd0f7dda9306d03c79a30f5c56c44cf256e3de" - [[package]] name = "async-trait" version = "0.1.89" @@ -608,57 +414,6 @@ version = "0.1.13" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "41e67cd8309bbd06cd603a9e693a784ac2e5d1e955f11286e355089fcab3047c" -[[package]] -name = "atspi" -version = "0.22.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "be534b16650e35237bb1ed189ba2aab86ce65e88cc84c66f4935ba38575cecbf" -dependencies = [ - "atspi-common", - "atspi-connection", - "atspi-proxies", -] - -[[package]] -name = "atspi-common" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1909ed2dc01d0a17505d89311d192518507e8a056a48148e3598fef5e7bb6ba7" -dependencies = [ - "enumflags2", - "serde", - "static_assertions", - "zbus 4.4.0", - "zbus-lockstep", - "zbus-lockstep-macros", - "zbus_names 3.0.0", - "zvariant 4.2.0", -] - -[[package]] -name = "atspi-connection" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "430c5960624a4baaa511c9c0fcc2218e3b58f5dbcc47e6190cafee344b873333" -dependencies = [ - "atspi-common", - "atspi-proxies", - "futures-lite", - "zbus 4.4.0", -] - -[[package]] -name = "atspi-proxies" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a5e6c5de3e524cf967569722446bcd458d5032348554d9a17d7d72b041ab7496" -dependencies = [ - "atspi-common", - "serde", - "zbus 4.4.0", - "zvariant 4.2.0", -] - [[package]] name = "autocfg" version = "1.5.0" @@ -808,7 +563,7 @@ dependencies = [ "keyboard-types 0.7.0", "linebender_resource_handle", "markup5ever", - "objc2 0.6.3", + "objc2", "parley", "percent-encoding", "rayon", @@ -904,7 +659,6 @@ name = "blitz-shell" version = "0.2.2" dependencies = [ "accesskit", - "accesskit_winit", "android-activity", "anyrender", "arboard", @@ -916,7 +670,7 @@ dependencies = [ "keyboard-types 0.7.0", "rfd", "tracing", - "winit 0.31.0-beta.2", + "winit", ] [[package]] @@ -929,7 +683,7 @@ dependencies = [ "http", "keyboard-types 0.7.0", "serde", - "smol_str 0.3.4", + "smol_str", "url", ] @@ -948,35 +702,13 @@ dependencies = [ "generic-array", ] -[[package]] -name = "block2" -version = "0.5.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2c132eebf10f5cad5289222520a4a058514204aed6d791f1cf4fe8088b82d15f" -dependencies = [ - "objc2 0.5.2", -] - [[package]] name = "block2" version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "cdeb9d870516001442e364c5220d3574d2da8dc765554b4a617230d33fa58ef5" dependencies = [ - "objc2 0.6.3", -] - -[[package]] -name = "blocking" -version = "1.6.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e83f8d02be6967315521be875afa792a316e28d57b5a2d401897e2a7921b7f21" -dependencies = [ - "async-channel", - "async-task", - "futures-io", - "futures-lite", - "piper", + "objc2", ] [[package]] @@ -1100,20 +832,6 @@ dependencies = [ "walkdir", ] -[[package]] -name = "calloop" -version = "0.13.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b99da2f8558ca23c71f4fd15dc57c906239752dd27ff3c00a1d56b685b7cbfec" -dependencies = [ - "bitflags 2.10.0", - "log", - "polling", - "rustix 0.38.44", - "slab", - "thiserror 1.0.69", -] - [[package]] name = "calloop" version = "0.14.3" @@ -1133,7 +851,7 @@ version = "0.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "138efcf0940a02ebf0cc8d1eff41a1682a46b431630f4c52450d6265876021fa" dependencies = [ - "calloop 0.14.3", + "calloop", "rustix 1.1.2", "wayland-backend", "wayland-client", @@ -2113,7 +1831,7 @@ dependencies = [ "tokio", "tracing", "webbrowser", - "winit 0.31.0-beta.2", + "winit", ] [[package]] @@ -2238,12 +1956,6 @@ dependencies = [ "windows-sys 0.61.2", ] -[[package]] -name = "dispatch" -version = "0.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bd0c93bb4b0c6d9b77f4435b0ae98c24d17f1c45b2ff844c6151a07256ca923b" - [[package]] name = "dispatch2" version = "0.3.0" @@ -2251,9 +1963,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "89a09f22a6c6069a18470eb92d2298acf25463f14256d24778e1230d789a2aec" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", + "block2", "libc", - "objc2 0.6.3", + "objc2", ] [[package]] @@ -2636,10 +2348,10 @@ dependencies = [ "icu_locale_core", "linebender_resource_handle", "memmap2 0.9.9", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", "objc2-core-text", - "objc2-foundation 0.3.2", + "objc2-foundation", "read-fonts", "roxmltree 0.21.1", "smallvec", @@ -2979,10 +2691,10 @@ dependencies = [ "glutin_glx_sys", "glutin_wgl_sys 0.6.1", "libloading 0.8.9", - "objc2 0.6.3", - "objc2-app-kit 0.3.2", + "objc2", + "objc2-app-kit", "objc2-core-foundation", - "objc2-foundation 0.3.2", + "objc2-foundation", "once_cell", "raw-window-handle", "wayland-sys", @@ -3606,15 +3318,6 @@ version = "0.13.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "edcd27d72f2f071c64249075f42e205ff93c9a4c5f6c6da53e79ed9f9832c285" -[[package]] -name = "immutable-chunkmap" -version = "2.1.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9a3e98b1520e49e252237edc238a39869da9f3241f2ec19dc788c1d24694d1e4" -dependencies = [ - "arrayvec", -] - [[package]] name = "indexmap" version = "2.12.1" @@ -4325,19 +4028,6 @@ version = "1.0.6" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "650eef8c711430f1a879fdd01d4745a7deea475becfb90269c06775983bbf086" -[[package]] -name = "nix" -version = "0.29.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "71e2746dc3a24dd78b3cfcb7be93368c6de9963d30f43a6a73998a9cf4b17b46" -dependencies = [ - "bitflags 2.10.0", - "cfg-if", - "cfg_aliases 0.2.1", - "libc", - "memoffset", -] - [[package]] name = "nix" version = "0.30.1" @@ -4502,22 +4192,6 @@ dependencies = [ "objc_exception", ] -[[package]] -name = "objc-sys" -version = "0.3.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cdb91bdd390c7ce1a8607f35f3ca7151b65afc0ff5ff3b34fa350f7d7c7e4310" - -[[package]] -name = "objc2" -version = "0.5.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "46a785d4eeff09c14c487497c162e92766fbb3e4059a71840cecc03d9a50b804" -dependencies = [ - "objc-sys", - "objc2-encode", -] - [[package]] name = "objc2" version = "0.6.3" @@ -4527,22 +4201,6 @@ dependencies = [ "objc2-encode", ] -[[package]] -name = "objc2-app-kit" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e4e89ad9e3d7d297152b17d39ed92cd50ca8063a89a9fa569046d41568891eff" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "libc", - "objc2 0.5.2", - "objc2-core-data 0.2.2", - "objc2-core-image 0.2.2", - "objc2-foundation 0.2.2", - "objc2-quartz-core 0.2.2", -] - [[package]] name = "objc2-app-kit" version = "0.3.2" @@ -4550,25 +4208,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d49e936b501e5c5bf01fda3a9452ff86dc3ea98ad5f283e1455153142d97518c" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", - "objc2 0.6.3", + "block2", + "objc2", "objc2-core-foundation", "objc2-core-graphics", - "objc2-foundation 0.3.2", - "objc2-quartz-core 0.3.2", -] - -[[package]] -name = "objc2-cloud-kit" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "74dd3b56391c7a0596a295029734d3c1c5e7e510a4cb30245f8221ccea96b009" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "objc2 0.5.2", - "objc2-core-location 0.2.2", - "objc2-foundation 0.2.2", + "objc2-foundation", + "objc2-quartz-core", ] [[package]] @@ -4578,31 +4223,8 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "73ad74d880bb43877038da939b7427bba67e9dd42004a18b809ba7d87cee241c" dependencies = [ "bitflags 2.10.0", - "objc2 0.6.3", - "objc2-foundation 0.3.2", -] - -[[package]] -name = "objc2-contacts" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a5ff520e9c33812fd374d8deecef01d4a840e7b41862d849513de77e44aa4889" -dependencies = [ - "block2 0.5.1", - "objc2 0.5.2", - "objc2-foundation 0.2.2", -] - -[[package]] -name = "objc2-core-data" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "617fbf49e071c178c0b24c080767db52958f716d9eabdf0890523aeae54773ef" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "objc2 0.5.2", - "objc2-foundation 0.2.2", + "objc2", + "objc2-foundation", ] [[package]] @@ -4611,8 +4233,8 @@ version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0b402a653efbb5e82ce4df10683b6b28027616a2715e90009947d50b8dd298fa" dependencies = [ - "objc2 0.6.3", - "objc2-foundation 0.3.2", + "objc2", + "objc2-foundation", ] [[package]] @@ -4622,9 +4244,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2a180dd8642fa45cdb7dd721cd4c11b1cadd4929ce112ebd8b9f5803cc79d536" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", + "block2", "dispatch2", - "objc2 0.6.3", + "objc2", ] [[package]] @@ -4636,43 +4258,19 @@ dependencies = [ "bitflags 2.10.0", "dispatch2", "libc", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", "objc2-io-surface", ] -[[package]] -name = "objc2-core-image" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "55260963a527c99f1819c4f8e3b47fe04f9650694ef348ffd2227e8196d34c80" -dependencies = [ - "block2 0.5.1", - "objc2 0.5.2", - "objc2-foundation 0.2.2", - "objc2-metal 0.2.2", -] - [[package]] name = "objc2-core-image" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e5d563b38d2b97209f8e861173de434bd0214cf020e3423a52624cd1d989f006" dependencies = [ - "objc2 0.6.3", - "objc2-foundation 0.3.2", -] - -[[package]] -name = "objc2-core-location" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "000cfee34e683244f284252ee206a27953279d370e309649dc3ee317b37e5781" -dependencies = [ - "block2 0.5.1", - "objc2 0.5.2", - "objc2-contacts", - "objc2-foundation 0.2.2", + "objc2", + "objc2-foundation", ] [[package]] @@ -4681,8 +4279,8 @@ version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ca347214e24bc973fc025fd0d36ebb179ff30536ed1f80252706db19ee452009" dependencies = [ - "objc2 0.6.3", - "objc2-foundation 0.3.2", + "objc2", + "objc2-foundation", ] [[package]] @@ -4692,7 +4290,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0cde0dfb48d25d2b4862161a4d5fcc0e3c24367869ad306b0c9ec0073bfed92d" dependencies = [ "bitflags 2.10.0", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", "objc2-core-graphics", ] @@ -4714,19 +4312,6 @@ version = "4.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ef25abbcd74fb2609453eb695bd2f860d389e457f67dc17cafc8b8cbc89d0c33" -[[package]] -name = "objc2-foundation" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0ee638a5da3799329310ad4cfa62fbf045d5f56e3ef5ba4149e7452dcf89d5a8" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "dispatch", - "libc", - "objc2 0.5.2", -] - [[package]] name = "objc2-foundation" version = "0.3.2" @@ -4734,9 +4319,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e3e0adef53c21f888deb4fa59fc59f7eb17404926ee8a6f59f5df0fd7f9f3272" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", + "block2", "libc", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", ] @@ -4747,34 +4332,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "180788110936d59bab6bd83b6060ffdfffb3b922ba1396b312ae795e1de9d81d" dependencies = [ "bitflags 2.10.0", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", ] -[[package]] -name = "objc2-link-presentation" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a1a1ae721c5e35be65f01a03b6d2ac13a54cb4fa70d8a5da293d7b0020261398" -dependencies = [ - "block2 0.5.1", - "objc2 0.5.2", - "objc2-app-kit 0.2.2", - "objc2-foundation 0.2.2", -] - -[[package]] -name = "objc2-metal" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dd0cba1276f6023976a406a14ffa85e1fdd19df6b0f737b063b95f6c8c7aadd6" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "objc2 0.5.2", - "objc2-foundation 0.2.2", -] - [[package]] name = "objc2-metal" version = "0.3.2" @@ -4782,21 +4343,8 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a0125f776a10d00af4152d74616409f0d4a2053a6f57fa5b7d6aa2854ac04794" dependencies = [ "bitflags 2.10.0", - "objc2 0.6.3", - "objc2-foundation 0.3.2", -] - -[[package]] -name = "objc2-quartz-core" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e42bee7bff906b14b167da2bac5efe6b6a07e6f7c0a21a7308d40c960242dc7a" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "objc2 0.5.2", - "objc2-foundation 0.2.2", - "objc2-metal 0.2.2", + "objc2", + "objc2-foundation", ] [[package]] @@ -4806,41 +4354,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "96c1358452b371bf9f104e21ec536d37a650eb10f7ee379fff67d2e08d537f1f" dependencies = [ "bitflags 2.10.0", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", - "objc2-foundation 0.3.2", - "objc2-metal 0.3.2", -] - -[[package]] -name = "objc2-symbols" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0a684efe3dec1b305badae1a28f6555f6ddd3bb2c2267896782858d5a78404dc" -dependencies = [ - "objc2 0.5.2", - "objc2-foundation 0.2.2", -] - -[[package]] -name = "objc2-ui-kit" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b8bb46798b20cd6b91cbd113524c490f1686f4c4e8f49502431415f3512e2b6f" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "objc2 0.5.2", - "objc2-cloud-kit 0.2.2", - "objc2-core-data 0.2.2", - "objc2-core-image 0.2.2", - "objc2-core-location 0.2.2", - "objc2-foundation 0.2.2", - "objc2-link-presentation", - "objc2-quartz-core 0.2.2", - "objc2-symbols", - "objc2-uniform-type-identifiers", - "objc2-user-notifications 0.2.2", + "objc2-foundation", + "objc2-metal", ] [[package]] @@ -4850,42 +4367,18 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d87d638e33c06f577498cbcc50491496a3ed4246998a7fbba7ccb98b1e7eab22" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", - "objc2 0.6.3", - "objc2-cloud-kit 0.3.2", - "objc2-core-data 0.3.2", + "block2", + "objc2", + "objc2-cloud-kit", + "objc2-core-data", "objc2-core-foundation", "objc2-core-graphics", - "objc2-core-image 0.3.2", - "objc2-core-location 0.3.2", + "objc2-core-image", + "objc2-core-location", "objc2-core-text", - "objc2-foundation 0.3.2", - "objc2-quartz-core 0.3.2", - "objc2-user-notifications 0.3.2", -] - -[[package]] -name = "objc2-uniform-type-identifiers" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "44fa5f9748dbfe1ca6c0b79ad20725a11eca7c2218bceb4b005cb1be26273bfe" -dependencies = [ - "block2 0.5.1", - "objc2 0.5.2", - "objc2-foundation 0.2.2", -] - -[[package]] -name = "objc2-user-notifications" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "76cfcbf642358e8689af64cee815d139339f3ed8ad05103ed5eaf73db8d84cb3" -dependencies = [ - "bitflags 2.10.0", - "block2 0.5.1", - "objc2 0.5.2", - "objc2-core-location 0.2.2", - "objc2-foundation 0.2.2", + "objc2-foundation", + "objc2-quartz-core", + "objc2-user-notifications", ] [[package]] @@ -4894,8 +4387,8 @@ version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9df9128cbbfef73cda168416ccf7f837b62737d748333bfe9ab71c245d76613e" dependencies = [ - "objc2 0.6.3", - "objc2-foundation 0.3.2", + "objc2", + "objc2-foundation", ] [[package]] @@ -5014,10 +4507,10 @@ checksum = "e4022a17595a00d6a369236fdae483f0de7f0a339960a53118b818238e132224" dependencies = [ "android_system_properties", "log", - "nix 0.30.1", - "objc2 0.6.3", - "objc2-foundation 0.3.2", - "objc2-ui-kit 0.3.2", + "nix", + "objc2", + "objc2-foundation", + "objc2-ui-kit", "serde", "windows-sys 0.61.2", ] @@ -5195,17 +4688,6 @@ version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" -[[package]] -name = "piper" -version = "0.2.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "96c8c490f422ef9a4efd2cb5b42b76c8613d7e7dfc1caf667b8a3350a5acc066" -dependencies = [ - "atomic-waker", - "fastrand", - "futures-io", -] - [[package]] name = "pixels" version = "0.15.0" @@ -5415,16 +4897,6 @@ version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a993555f31e5a609f617c12db6250dedcac1b0a85076912c436e6fc9b2c8e6a3" -[[package]] -name = "quick-xml" -version = "0.30.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "eff6510e86862b57b210fd8cbe8ed3f0d7d600b9c2863cd4549a2e033c66e956" -dependencies = [ - "memchr", - "serde", -] - [[package]] name = "quick-xml" version = "0.37.5" @@ -5449,35 +4921,14 @@ version = "5.3.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "69cdb34c158ceb288df11e18b4bd39de994f6657d83847bdffdbd7f346754b0f" -[[package]] -name = "rand" -version = "0.8.5" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "34af8d1a0e25924bc5b7c43c079c942339d8f0a8b57c39049bef581b46327404" -dependencies = [ - "libc", - "rand_chacha 0.3.1", - "rand_core 0.6.4", -] - [[package]] name = "rand" version = "0.9.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6db2770f06117d490610c7488547d543617b21bfa07796d7a12f6f1bd53850d1" dependencies = [ - "rand_chacha 0.9.0", - "rand_core 0.9.3", -] - -[[package]] -name = "rand_chacha" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88" -dependencies = [ - "ppv-lite86", - "rand_core 0.6.4", + "rand_chacha", + "rand_core", ] [[package]] @@ -5487,16 +4938,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d3022b5f1df60f26e1ffddd6c66e8aa15de382ae63b3a0c1bfc0e4d3e3f325cb" dependencies = [ "ppv-lite86", - "rand_core 0.9.3", -] - -[[package]] -name = "rand_core" -version = "0.6.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ec0be4795e2f6a28069bec0b5ff3e2ac9bafc99e6a9a7dc3547996c5c816922c" -dependencies = [ - "getrandom 0.2.16", + "rand_core", ] [[package]] @@ -5584,16 +5026,7 @@ dependencies = [ "reqwest", "tokio", "url", - "winit 0.31.0-beta.2", -] - -[[package]] -name = "redox_syscall" -version = "0.4.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4722d768eff46b75989dd134e5c353f0d6296e5aaa3132e776cbdb56be7731aa" -dependencies = [ - "bitflags 1.3.2", + "winit", ] [[package]] @@ -5740,14 +5173,14 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ef2bee61e6cffa4635c72d7d81a84294e28f0930db0ddcb0f66d10244674ebed" dependencies = [ "ashpd", - "block2 0.6.2", + "block2", "dispatch2", "js-sys", "log", - "objc2 0.6.3", - "objc2-app-kit 0.3.2", + "objc2", + "objc2-app-kit", "objc2-core-foundation", - "objc2-foundation 0.3.2", + "objc2-foundation", "pollster 0.4.0", "raw-window-handle", "urlencoding", @@ -6292,7 +5725,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0512da38f5e2b31201a93524adb8d3136276fa4fe4aafab4e1f727a82b534cc0" dependencies = [ "bitflags 2.10.0", - "calloop 0.14.3", + "calloop", "calloop-wayland-source", "cursor-icon", "libc", @@ -6312,15 +5745,6 @@ dependencies = [ "xkeysym", ] -[[package]] -name = "smol_str" -version = "0.2.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "dd538fb6910ac1099850255cf94a94df6551fbdd602454387d0adb2d1ca6dead" -dependencies = [ - "serde", -] - [[package]] name = "smol_str" version = "0.3.4" @@ -6354,11 +5778,11 @@ dependencies = [ "js-sys", "memmap2 0.9.9", "ndk", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", "objc2-core-graphics", - "objc2-foundation 0.3.2", - "objc2-quartz-core 0.3.2", + "objc2-foundation", + "objc2-quartz-core", "raw-window-handle", "redox_syscall 0.5.18", "rustix 1.1.2", @@ -7295,7 +6719,7 @@ dependencies = [ "http", "httparse", "log", - "rand 0.9.2", + "rand", "sha1", "thiserror 2.0.17", "utf-8", @@ -7888,7 +7312,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "54cb1e9dc49da91950bdfd8b848c49330536d9d1fb03d4bfec8cae50caa50ae3" dependencies = [ "proc-macro2", - "quick-xml 0.37.5", + "quick-xml", "quote", ] @@ -7946,8 +7370,8 @@ dependencies = [ "jni", "log", "ndk-context", - "objc2 0.6.3", - "objc2-foundation 0.3.2", + "objc2", + "objc2-foundation", "url", "web-sys", ] @@ -8724,46 +8148,6 @@ version = "0.53.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d6bbff5f0aada427a1e5a6da5f1f98158182f26556f345ac9e04d36d0ebed650" -[[package]] -name = "winit" -version = "0.30.12" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c66d4b9ed69c4009f6321f762d6e61ad8a2389cd431b97cb1e146812e9e6c732" -dependencies = [ - "android-activity", - "atomic-waker", - "bitflags 2.10.0", - "block2 0.5.1", - "calloop 0.13.0", - "cfg_aliases 0.2.1", - "concurrent-queue", - "core-foundation 0.9.4", - "core-graphics", - "cursor-icon", - "dpi", - "js-sys", - "libc", - "ndk", - "objc2 0.5.2", - "objc2-app-kit 0.2.2", - "objc2-foundation 0.2.2", - "objc2-ui-kit 0.2.2", - "orbclient", - "pin-project", - "raw-window-handle", - "redox_syscall 0.4.1", - "rustix 0.38.44", - "smol_str 0.2.2", - "tracing", - "unicode-segmentation", - "wasm-bindgen", - "wasm-bindgen-futures", - "web-sys", - "web-time", - "windows-sys 0.52.0", - "xkbcommon-dl", -] - [[package]] name = "winit" version = "0.31.0-beta.2" @@ -8777,7 +8161,7 @@ dependencies = [ "libc", "raw-window-handle", "rustix 1.1.2", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-android", "winit-appkit", @@ -8802,7 +8186,7 @@ dependencies = [ "dpi", "ndk", "raw-window-handle", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-core", ] @@ -8814,17 +8198,17 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "21310ca07851a49c348e0c2cc768e36b52ca65afda2c2354d78ed4b90074d8aa" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", + "block2", "dispatch2", "dpi", - "objc2 0.6.3", - "objc2-app-kit 0.3.2", + "objc2", + "objc2-app-kit", "objc2-core-foundation", "objc2-core-graphics", "objc2-core-video", - "objc2-foundation 0.3.2", + "objc2-foundation", "raw-window-handle", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-common", "winit-core", @@ -8837,9 +8221,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "45375fbac4cbb77260d83a30b1f9d8105880dbac99a9ae97f56656694680ff69" dependencies = [ "memmap2 0.9.9", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-core", "x11-dl", @@ -8857,7 +8241,7 @@ dependencies = [ "dpi", "keyboard-types 0.8.3", "raw-window-handle", - "smol_str 0.3.4", + "smol_str", "web-time", ] @@ -8872,7 +8256,7 @@ dependencies = [ "orbclient", "raw-window-handle", "redox_syscall 0.5.18", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-core", ] @@ -8884,15 +8268,15 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "680a356e798837d8eb274d4556e83bceaf81698194e31aafc5cfb8a9f2fab643" dependencies = [ "bitflags 2.10.0", - "block2 0.6.2", + "block2", "dispatch2", "dpi", - "objc2 0.6.3", + "objc2", "objc2-core-foundation", - "objc2-foundation 0.3.2", - "objc2-ui-kit 0.3.2", + "objc2-foundation", + "objc2-ui-kit", "raw-window-handle", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-common", "winit-core", @@ -8906,7 +8290,7 @@ checksum = "8ce5afb2ba07da603f84b722c95f9f9396d2cedae3944fb6c0cda4a6f88de545" dependencies = [ "ahash", "bitflags 2.10.0", - "calloop 0.14.3", + "calloop", "cursor-icon", "dpi", "libc", @@ -8915,7 +8299,7 @@ dependencies = [ "rustix 1.1.2", "sctk-adwaita", "smithay-client-toolkit", - "smol_str 0.3.4", + "smol_str", "tracing", "wayland-backend", "wayland-client", @@ -8939,7 +8323,7 @@ dependencies = [ "js-sys", "pin-project", "raw-window-handle", - "smol_str 0.3.4", + "smol_str", "tracing", "wasm-bindgen", "wasm-bindgen-futures", @@ -8958,7 +8342,7 @@ dependencies = [ "cursor-icon", "dpi", "raw-window-handle", - "smol_str 0.3.4", + "smol_str", "tracing", "unicode-segmentation", "windows-sys 0.59.0", @@ -8973,14 +8357,14 @@ checksum = "aa5b600756534c7041aa93cd0d244d44b09fca1b89e202bd1cd80dd9f3636c46" dependencies = [ "bitflags 2.10.0", "bytemuck", - "calloop 0.14.3", + "calloop", "cursor-icon", "dpi", "libc", "percent-encoding", "raw-window-handle", "rustix 1.1.2", - "smol_str 0.3.4", + "smol_str", "tracing", "winit-common", "winit-core", @@ -9129,16 +8513,6 @@ version = "0.3.10" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "bec9e4a500ca8864c5b47b8b482a73d62e4237670e5b5f1d6b9e3cae50f28f2b" -[[package]] -name = "xdg-home" -version = "1.3.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ec1cdab258fb55c0da61328dc52c8764709b249011b2cad0454c72f0bf10a1f6" -dependencies = [ - "libc", - "windows-sys 0.59.0", -] - [[package]] name = "xkbcommon-dl" version = "0.4.2" @@ -9226,44 +8600,6 @@ dependencies = [ "synstructure", ] -[[package]] -name = "zbus" -version = "4.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bb97012beadd29e654708a0fdb4c84bc046f537aecfde2c3ee0a9e4b4d48c725" -dependencies = [ - "async-broadcast", - "async-executor", - "async-fs", - "async-io", - "async-lock", - "async-process", - "async-recursion", - "async-task", - "async-trait", - "blocking", - "enumflags2", - "event-listener", - "futures-core", - "futures-sink", - "futures-util", - "hex", - "nix 0.29.0", - "ordered-stream", - "rand 0.8.5", - "serde", - "serde_repr", - "sha1", - "static_assertions", - "tracing", - "uds_windows", - "windows-sys 0.52.0", - "xdg-home", - "zbus_macros 4.4.0", - "zbus_names 3.0.0", - "zvariant 4.2.0", -] - [[package]] name = "zbus" version = "5.12.0" @@ -9278,7 +8614,7 @@ dependencies = [ "futures-core", "futures-lite", "hex", - "nix 0.30.1", + "nix", "ordered-stream", "serde", "serde_repr", @@ -9288,46 +8624,9 @@ dependencies = [ "uuid", "windows-sys 0.61.2", "winnow", - "zbus_macros 5.12.0", - "zbus_names 4.2.0", - "zvariant 5.8.0", -] - -[[package]] -name = "zbus-lockstep" -version = "0.4.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4ca2c5dceb099bddaade154055c926bb8ae507a18756ba1d8963fd7b51d8ed1d" -dependencies = [ - "zbus_xml", - "zvariant 4.2.0", -] - -[[package]] -name = "zbus-lockstep-macros" -version = "0.4.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "709ab20fc57cb22af85be7b360239563209258430bccf38d8b979c5a2ae3ecce" -dependencies = [ - "proc-macro2", - "quote", - "syn 2.0.111", - "zbus-lockstep", - "zbus_xml", - "zvariant 4.2.0", -] - -[[package]] -name = "zbus_macros" -version = "4.4.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "267db9407081e90bbfa46d841d3cbc60f59c0351838c4bc65199ecd79ab1983e" -dependencies = [ - "proc-macro-crate", - "proc-macro2", - "quote", - "syn 2.0.111", - "zvariant_utils 2.1.0", + "zbus_macros", + "zbus_names", + "zvariant", ] [[package]] @@ -9340,20 +8639,9 @@ dependencies = [ "proc-macro2", "quote", "syn 2.0.111", - "zbus_names 4.2.0", - "zvariant 5.8.0", - "zvariant_utils 3.2.1", -] - -[[package]] -name = "zbus_names" -version = "3.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "4b9b1fef7d021261cc16cba64c351d291b715febe0fa10dc3a443ac5a5022e6c" -dependencies = [ - "serde", - "static_assertions", - "zvariant 4.2.0", + "zbus_names", + "zvariant", + "zvariant_utils", ] [[package]] @@ -9365,20 +8653,7 @@ dependencies = [ "serde", "static_assertions", "winnow", - "zvariant 5.8.0", -] - -[[package]] -name = "zbus_xml" -version = "4.0.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "ab3f374552b954f6abb4bd6ce979e6c9b38fb9d0cd7cc68a7d796e70c9f3a233" -dependencies = [ - "quick-xml 0.30.0", - "serde", - "static_assertions", - "zbus_names 3.0.0", - "zvariant 4.2.0", + "zvariant", ] [[package]] @@ -9481,19 +8756,6 @@ dependencies = [ "zune-core", ] -[[package]] -name = "zvariant" -version = "4.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2084290ab9a1c471c38fc524945837734fbf124487e105daec2bb57fd48c81fe" -dependencies = [ - "endi", - "enumflags2", - "serde", - "static_assertions", - "zvariant_derive 4.2.0", -] - [[package]] name = "zvariant" version = "5.8.0" @@ -9505,21 +8767,8 @@ dependencies = [ "serde", "url", "winnow", - "zvariant_derive 5.8.0", - "zvariant_utils 3.2.1", -] - -[[package]] -name = "zvariant_derive" -version = "4.2.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "73e2ba546bda683a90652bac4a279bc146adad1386f25379cf73200d2002c449" -dependencies = [ - "proc-macro-crate", - "proc-macro2", - "quote", - "syn 2.0.111", - "zvariant_utils 2.1.0", + "zvariant_derive", + "zvariant_utils", ] [[package]] @@ -9532,18 +8781,7 @@ dependencies = [ "proc-macro2", "quote", "syn 2.0.111", - "zvariant_utils 3.2.1", -] - -[[package]] -name = "zvariant_utils" -version = "2.1.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c51bcff7cc3dbb5055396bcf774748c3dab426b4b8659046963523cee4808340" -dependencies = [ - "proc-macro2", - "quote", - "syn 2.0.111", + "zvariant_utils", ] [[package]] diff --git a/packages/blitz-shell/Cargo.toml b/packages/blitz-shell/Cargo.toml index 89d3416d6..7dfe70e3e 100644 --- a/packages/blitz-shell/Cargo.toml +++ b/packages/blitz-shell/Cargo.toml @@ -14,7 +14,7 @@ rust-version.workspace = true default = ["accessibility", "clipboard", "file_dialog"] accessibility = [ "dep:accesskit", - "dep:accesskit_winit", + # "dep:accesskit_winit", "blitz-dom/accessibility", ] clipboard = ["dep:arboard"] @@ -34,7 +34,7 @@ anyrender = { workspace = true } winit = { workspace = true } keyboard-types = { workspace = true } accesskit = { workspace = true, optional = true } -accesskit_winit = { workspace = true, optional = true } +# accesskit_winit = { workspace = true, optional = true } # Other dependencies tracing = { workspace = true, optional = true } From 47d92e3e614d442dc6156935f333c5cccecfc320 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 8 Dec 2025 15:53:49 +0000 Subject: [PATCH 05/67] cfg ApplicationHandlerExtMacOS to macos --- packages/blitz-shell/src/application.rs | 15 ++++++++++----- 1 file changed, 10 insertions(+), 5 deletions(-) diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index d1774f80f..7984f50f8 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -6,7 +6,10 @@ use std::sync::mpsc::Receiver; use winit::event::WindowEvent; use winit::event_loop::ActiveEventLoop; use winit::window::WindowId; -use winit::{application::ApplicationHandler, platform::macos::ApplicationHandlerExtMacOS}; +use winit::{application::ApplicationHandler}; + +#[cfg(target_os = "macos")] +use winit::platform::macos::ApplicationHandlerExtMacOS; use crate::{View, WindowConfig}; @@ -83,10 +86,6 @@ impl BlitzApplication { } impl ApplicationHandler for BlitzApplication { - fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { - Some(self) - } - fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { // Resume existing windows for (_, view) in self.windows.iter_mut() { @@ -148,8 +147,14 @@ impl ApplicationHandler for BlitzApplication { self.handle_blitz_shell_event(event_loop, event); } } + + #[cfg(target_os = "macos")] + fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { + Some(self) + } } +#[cfg(target_os = "macos")] impl ApplicationHandlerExtMacOS for BlitzApplication { fn standard_key_binding( &mut self, From f655742e3f6a210d6c63e737a9c43c6532665cbe Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 8 Dec 2025 15:56:28 +0000 Subject: [PATCH 06/67] Bump MSRV to 1.89 (required for Winit 0.31) Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 4 ++-- Cargo.toml | 4 ++-- 2 files changed, 4 insertions(+), 4 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index d212e21aa..5d05cffbf 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -23,13 +23,13 @@ jobs: # We only run `cargo build` (not `cargo test`) so as to avoid requiring dev-dependencies to build with the MSRV # version. Building is likely sufficient as runtime errors varying between rust versions is very unlikely. build-msrv: - name: "MSRV Build [Rust 1.88]" + name: "MSRV Build [Rust 1.89]" runs-on: ubuntu-latest steps: - uses: actions/checkout@v4 - uses: dtolnay/rust-toolchain@master with: - toolchain: 1.88 + toolchain: 1.89 - run: perl -pi.bak -e 's/opt-level = 2/opt-level = 0/g' Cargo.toml - uses: awalsh128/cache-apt-pkgs-action@latest with: diff --git a/Cargo.toml b/Cargo.toml index 7bf0861cc..651345e26 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -29,7 +29,7 @@ homepage = "https://github.com/dioxuslabs/blitz" repository = "https://github.com/dioxuslabs/blitz" categories = ["gui"] edition = "2024" -rust-version = "1.88.0" +rust-version = "1.89.0" [workspace.dependencies] # Blitz dependencies(in-repo) @@ -214,7 +214,7 @@ edition = "2024" description = "Top level crate for Blitz" license = "MIT OR Apache-2.0" keywords = ["dom", "ui", "gui", "react", "wasm"] -rust-version = "1.86.0" +rust-version = "1.89.0" publish = false [dev-dependencies] From 1bbd006a4c0ff7e1d83a48458fabcf19ea6c6ea0 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 8 Dec 2025 16:08:53 +0000 Subject: [PATCH 07/67] Fix warnings Signed-off-by: Nico Burns --- packages/blitz-shell/src/accessibility.rs | 7 +++++-- packages/blitz-shell/src/application.rs | 2 +- packages/dioxus-native/src/dioxus_application.rs | 5 ++++- 3 files changed, 10 insertions(+), 4 deletions(-) diff --git a/packages/blitz-shell/src/accessibility.rs b/packages/blitz-shell/src/accessibility.rs index 17f521611..79fc8ac3d 100644 --- a/packages/blitz-shell/src/accessibility.rs +++ b/packages/blitz-shell/src/accessibility.rs @@ -1,7 +1,7 @@ -use crate::event::{BlitzShellEvent, BlitzShellProxy}; +use crate::event::BlitzShellProxy; // use accesskit_winit::Adapter; use blitz_dom::BaseDocument; -use winit::{event_loop::EventLoopProxy, window::Window}; +use winit::window::Window; /// State of the accessibility node tree and platform adapter. pub struct AccessibilityState { @@ -11,11 +11,14 @@ pub struct AccessibilityState { impl AccessibilityState { pub fn new(window: &dyn Window, proxy: BlitzShellProxy) -> Self { + let _ = window; + let _ = proxy; Self { // adapter: Adapter::with_event_loop_proxy(window, proxy.clone()), } } pub fn update_tree(&mut self, doc: &BaseDocument) { + let _ = doc; // self.adapter // .update_if_active(|| doc.build_accessibility_tree()); } diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index 7984f50f8..5a0fbc189 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -3,10 +3,10 @@ use crate::event::{BlitzShellEvent, BlitzShellProxy}; use anyrender::WindowRenderer; use std::collections::HashMap; use std::sync::mpsc::Receiver; +use winit::application::ApplicationHandler; use winit::event::WindowEvent; use winit::event_loop::ActiveEventLoop; use winit::window::WindowId; -use winit::{application::ApplicationHandler}; #[cfg(target_os = "macos")] use winit::platform::macos::ApplicationHandlerExtMacOS; diff --git a/packages/dioxus-native/src/dioxus_application.rs b/packages/dioxus-native/src/dioxus_application.rs index 83605bd27..c03ee7954 100644 --- a/packages/dioxus-native/src/dioxus_application.rs +++ b/packages/dioxus-native/src/dioxus_application.rs @@ -5,9 +5,11 @@ use std::rc::Rc; use winit::application::ApplicationHandler; use winit::event::{StartCause, WindowEvent}; use winit::event_loop::ActiveEventLoop; -use winit::platform::macos::ApplicationHandlerExtMacOS; use winit::window::WindowId; +#[cfg(target_os = "macos")] +use winit::platform::macos::ApplicationHandlerExtMacOS; + use crate::DioxusNativeWindowRenderer; use crate::{contexts::DioxusNativeDocument, BlitzShellEvent, DioxusDocument, WindowConfig}; @@ -106,6 +108,7 @@ impl DioxusNativeApplication { } impl ApplicationHandler for DioxusNativeApplication { + #[cfg(target_os = "macos")] fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { self.inner.macos_handler() } From 6757cc8a3bdf54d2da449ee76c7f285d77b7b35c Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Tue, 9 Dec 2025 13:44:36 +0000 Subject: [PATCH 08/67] Dioxus Native: Add use_window and use_raw_window_handle hooks --- Cargo.lock | 1 + apps/browser/Cargo.toml | 1 + .../dioxus-native/src/dioxus_application.rs | 6 ++++++ packages/dioxus-native/src/lib.rs | 20 +++++++++++++++++-- 4 files changed, 26 insertions(+), 2 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 1fd05d5b8..6ab97f04a 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -742,6 +742,7 @@ dependencies = [ "linebender_resource_handle", "tracing-subscriber", "webbrowser", + "winit", ] [[package]] diff --git a/apps/browser/Cargo.toml b/apps/browser/Cargo.toml index e737a515f..1da6727a2 100644 --- a/apps/browser/Cargo.toml +++ b/apps/browser/Cargo.toml @@ -41,3 +41,4 @@ blitz-html = { workspace = true } linebender_resource_handle = { workspace = true } tracing-subscriber = { workspace = true, optional = true } webbrowser = { workspace = true } +winit = { workspace = true } diff --git a/packages/dioxus-native/src/dioxus_application.rs b/packages/dioxus-native/src/dioxus_application.rs index c03ee7954..cb4617802 100644 --- a/packages/dioxus-native/src/dioxus_application.rs +++ b/packages/dioxus-native/src/dioxus_application.rs @@ -2,6 +2,7 @@ use blitz_shell::{BlitzApplication, BlitzShellProxy, View}; use dioxus_core::{provide_context, ScopeId}; use dioxus_history::{History, MemoryHistory}; use std::rc::Rc; +use std::sync::Arc; use winit::application::ApplicationHandler; use winit::event::{StartCause, WindowEvent}; use winit::event_loop::ActiveEventLoop; @@ -131,6 +132,7 @@ impl ApplicationHandler for DioxusNativeApplication { if let Some(config) = self.pending_window.take() { let mut window = View::init(config, event_loop, &self.inner.proxy); + let winit_window = Arc::clone(&window.window); let renderer = window.renderer.clone(); let window_id = window.window_id(); let doc = window.downcast_doc_mut::(); @@ -157,6 +159,10 @@ impl ApplicationHandler for DioxusNativeApplication { doc.vdom .in_scope(ScopeId::ROOT, move || provide_context(renderer)); + // Add winit window + doc.vdom + .in_scope(ScopeId::ROOT, move || provide_context(winit_window)); + // Queue rebuild doc.initial_build(); diff --git a/packages/dioxus-native/src/lib.rs b/packages/dioxus-native/src/lib.rs index b4c7d53f6..386379915 100644 --- a/packages/dioxus-native/src/lib.rs +++ b/packages/dioxus-native/src/lib.rs @@ -61,11 +61,27 @@ pub use { use blitz_shell::{ create_default_event_loop, BlitzShellEvent, BlitzShellProxy, Config, WindowConfig, }; -use dioxus_core::{ComponentFunction, Element, VirtualDom}; +use dioxus_core::{consume_context, use_hook, ComponentFunction, Element, VirtualDom}; use link_handler::DioxusNativeNavigationProvider; use std::any::Any; use std::sync::Arc; -use winit::window::WindowAttributes; +use winit::{ + raw_window_handle::{HasWindowHandle as _, RawWindowHandle}, + window::{Window, WindowAttributes}, +}; + +pub fn use_window() -> Arc { + use_hook(consume_context::>) +} + +pub fn use_raw_window_handle() -> RawWindowHandle { + use_hook(|| { + consume_context::>() + .window_handle() + .unwrap() + .as_raw() + }) +} /// Launch an interactive HTML/CSS renderer driven by the Dioxus virtualdom pub fn launch(app: fn() -> Element) { From a0da3cef7f403e79d9ada82343479aa6b297d044 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sat, 27 Dec 2025 20:44:29 +0000 Subject: [PATCH 09/67] Fix html example --- examples/wgpu_texture/src/html.rs | 9 +++++---- 1 file changed, 5 insertions(+), 4 deletions(-) diff --git a/examples/wgpu_texture/src/html.rs b/examples/wgpu_texture/src/html.rs index 77f10c244..0a28feeba 100644 --- a/examples/wgpu_texture/src/html.rs +++ b/examples/wgpu_texture/src/html.rs @@ -1,7 +1,7 @@ use anyrender_vello::{VelloRendererOptions, VelloWindowRenderer}; use blitz_dom::{qual_name, DocumentConfig}; use blitz_html::HtmlDocument; -use blitz_shell::{create_default_event_loop, BlitzApplication, BlitzShellEvent, WindowConfig}; +use blitz_shell::{create_default_event_loop, BlitzApplication, BlitzShellProxy, WindowConfig}; use crate::{limits, DemoPaintSource, FEATURES, STYLES}; @@ -30,13 +30,14 @@ pub fn launch_html() { .set_attribute(canvas_node_id, src_attr, &src_str); // Create the Winit application and window - let event_loop = create_default_event_loop::(); - let mut application = BlitzApplication::new(event_loop.create_proxy()); + let event_loop = create_default_event_loop(); + let (proxy, reciever) = BlitzShellProxy::new(event_loop.create_proxy()); + let mut application = BlitzApplication::new(proxy, reciever); let window = WindowConfig::new(Box::new(doc), renderer); application.add_window(window); // Run event loop - event_loop.run_app(&mut application).unwrap() + event_loop.run_app(application).unwrap() } static HTML: &str = r#" From b8594e810c609515c129dedfafbdc4312be77820 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 01:37:33 +0000 Subject: [PATCH 10/67] Implement "safe area" support --- examples/screenshot.rs | 10 +++++++++- packages/blitz-paint/src/lib.rs | 5 ++++- packages/blitz-shell/src/window.rs | 24 +++++++++++++++++++----- wpt/runner/src/test_runners/ref_test.rs | 2 +- 4 files changed, 33 insertions(+), 8 deletions(-) diff --git a/examples/screenshot.rs b/examples/screenshot.rs index 8a05dc25d..df3de74fd 100644 --- a/examples/screenshot.rs +++ b/examples/screenshot.rs @@ -117,7 +117,15 @@ async fn main() { ); // Render document - paint_scene(scene, document.as_ref(), scale, render_width, render_height); + paint_scene( + scene, + document.as_ref(), + scale, + render_width, + render_height, + 0, + 0, + ); }, render_width, render_height, diff --git a/packages/blitz-paint/src/lib.rs b/packages/blitz-paint/src/lib.rs index 62f56008e..9b3c4de91 100644 --- a/packages/blitz-paint/src/lib.rs +++ b/packages/blitz-paint/src/lib.rs @@ -31,8 +31,11 @@ pub fn paint_scene( scale: f64, width: u32, height: u32, + x_offset: u32, + y_offset: u32, ) { - let generator = BlitzDomPainter::new(dom, scale, width, height, 0.0, 0.0); + let generator = + BlitzDomPainter::new(dom, scale, width, height, x_offset as f64, y_offset as f64); generator.paint_scene(scene); // println!( diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 61856e8fc..7a18ccaf4 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -12,6 +12,7 @@ use blitz_traits::events::{ UiEvent, }; use blitz_traits::shell::Viewport; +use winit::dpi::PhysicalInsets; use winit::keyboard::PhysicalKey; use std::any::Any; @@ -67,6 +68,7 @@ pub struct View { pub mouse_pos: (f32, f32), pub animation_timer: Option, pub is_visible: bool, + pub safe_area_insets: PhysicalInsets, #[cfg(feature = "accessibility")] /// Accessibility adapter for `accesskit`. @@ -86,6 +88,7 @@ impl View { // TODO: account for the "safe area" let size = winit_window.surface_size(); let scale = winit_window.scale_factor() as f32; + let safe_area_insets = winit_window.safe_area(); let theme = winit_window.theme().unwrap_or(Theme::Light); let color_scheme = theme_to_color_scheme(theme); let viewport = Viewport::new(size.width, size.height, scale, color_scheme); @@ -118,6 +121,7 @@ impl View { doc, theme_override: None, buttons: MouseEventButtons::None, + safe_area_insets, mouse_pos: Default::default(), is_visible: winit_window.is_visible().unwrap_or(true), #[cfg(feature = "accessibility")] @@ -198,8 +202,10 @@ impl View { }; // Render - self.renderer - .render(|scene| paint_scene(scene, &inner, scale, width, height)); + let insets = self.safe_area_insets; + self.renderer.render(|scene| { + paint_scene(scene, &inner, scale, width, height, insets.left, insets.top) + }); // Set waker self.waker = Some(create_waker(&self.proxy, window_id)); @@ -246,8 +252,10 @@ impl View { let (width, height) = inner.viewport().window_size; let scale = inner.viewport().scale_f64(); let is_animating = inner.is_animating(); - self.renderer - .render(|scene| paint_scene(scene, &inner, scale, width, height)); + let insets = self.safe_area_insets; + self.renderer.render(|scene| { + paint_scene(scene, &inner, scale, width, height, insets.left, insets.top) + }); drop(inner); @@ -298,10 +306,16 @@ impl View { } }, WindowEvent::SurfaceResized(physical_size) => { - self.with_viewport(|v| v.window_size = (physical_size.width, physical_size.height)); + self.safe_area_insets = self.window.safe_area(); + let insets = self.safe_area_insets; + let width = physical_size.width - insets.left - insets.right; + let height = physical_size.height - insets.top - insets.bottom; + self.with_viewport(|v| v.window_size = (width, height)); + self.request_redraw(); } WindowEvent::ScaleFactorChanged { scale_factor, .. } => { self.with_viewport(|v| v.set_hidpi_scale(scale_factor as f32)); + self.request_redraw(); } WindowEvent::ThemeChanged(theme) => { let color_scheme = theme_to_color_scheme(self.theme_override.unwrap_or(theme)); diff --git a/wpt/runner/src/test_runners/ref_test.rs b/wpt/runner/src/test_runners/ref_test.rs index 8a09b2d4d..1154b7519 100644 --- a/wpt/runner/src/test_runners/ref_test.rs +++ b/wpt/runner/src/test_runners/ref_test.rs @@ -118,7 +118,7 @@ fn render_html_to_buffer( ctx.renderer.render_to_vec( |scene| { scene.reset(); - paint_scene(scene, document.as_ref(), SCALE, WIDTH, HEIGHT); + paint_scene(scene, document.as_ref(), SCALE, WIDTH, HEIGHT, 0, 0); }, buf, ); From 920a4d78e973864aba27e8d85ca346d0133fdbb0 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 14:58:37 +0000 Subject: [PATCH 11/67] Fix blitz crate --- packages/blitz/src/lib.rs | 34 +++++++++++++++++----------------- 1 file changed, 17 insertions(+), 17 deletions(-) diff --git a/packages/blitz/src/lib.rs b/packages/blitz/src/lib.rs index 66e085b00..0f89192d5 100644 --- a/packages/blitz/src/lib.rs +++ b/packages/blitz/src/lib.rs @@ -17,7 +17,7 @@ use anyrender_vello::VelloWindowRenderer as WindowRenderer; use blitz_dom::DocumentConfig; use blitz_html::HtmlDocument; use blitz_shell::{ - BlitzApplication, BlitzShellEvent, Config, EventLoop, WindowConfig, create_default_event_loop, + BlitzApplication, BlitzShellProxy, Config, EventLoop, WindowConfig, create_default_event_loop, }; use blitz_traits::net::NetProvider; @@ -55,8 +55,10 @@ pub fn launch_url(url: &str) { .unwrap(); let _guard = rt.enter(); - let event_loop = create_default_event_loop::(); - let net_provider = create_net_provider(&event_loop); + let event_loop = create_default_event_loop(); + let (proxy, reciever) = BlitzShellProxy::new(event_loop.create_proxy()); + let net_provider = create_net_provider(proxy.clone()); + let application = BlitzApplication::new(proxy, reciever); let (url, bytes) = rt .block_on(net_provider.fetch_async(blitz_traits::net::Request::get(url))) @@ -70,6 +72,7 @@ pub fn launch_url(url: &str) { base_url: Some(url), }, event_loop, + application, net_provider, ) } @@ -88,16 +91,19 @@ pub fn launch_static_html_cfg(html: &str, cfg: Config) { #[cfg(feature = "net")] let _guard = rt.enter(); - let event_loop = create_default_event_loop::(); - let net_provider = create_net_provider(&event_loop); + let event_loop = create_default_event_loop(); + let (proxy, reciever) = BlitzShellProxy::new(event_loop.create_proxy()); + let net_provider = create_net_provider(proxy.clone()); + let application = BlitzApplication::new(proxy, reciever); - launch_internal(html, cfg, event_loop, net_provider) + launch_internal(html, cfg, event_loop, application, net_provider) } fn launch_internal( html: &str, cfg: Config, - event_loop: EventLoop, + event_loop: EventLoop, + mut application: BlitzApplication, net_provider: Arc, ) { let doc = HtmlDocument::from_html( @@ -113,11 +119,11 @@ fn launch_internal( let window = WindowConfig::new(Box::new(doc) as _, renderer); // Create application - let mut application = BlitzApplication::new(event_loop.create_proxy()); + application.add_window(window); // Run event loop - event_loop.run_app(&mut application).unwrap() + event_loop.run_app(application).unwrap() } #[cfg(feature = "net")] @@ -125,15 +131,9 @@ type EnabledNetProvider = blitz_net::Provider; #[cfg(not(feature = "net"))] type EnabledNetProvider = blitz_traits::net::DummyNetProvider; -fn create_net_provider( - event_loop: &blitz_shell::EventLoop, -) -> Arc { +fn create_net_provider(proxy: BlitzShellProxy) -> Arc { #[cfg(feature = "net")] - let net_provider = { - let proxy = event_loop.create_proxy(); - let waker = blitz_shell::BlitzShellNetWaker::shared(proxy); - Arc::new(blitz_net::Provider::new(Some(waker))) - }; + let net_provider = Arc::new(blitz_net::Provider::new(Some(Arc::new(proxy)))); #[cfg(not(feature = "net"))] let net_provider = { use blitz_traits::net::DummyNetProvider; From 1cf61e98fc6973e20cecd7bb94507d55f5523bca Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 15:29:31 +0000 Subject: [PATCH 12/67] Fix inner_html example --- examples/inner_html.rs | 9 +++++---- 1 file changed, 5 insertions(+), 4 deletions(-) diff --git a/examples/inner_html.rs b/examples/inner_html.rs index 03df3be4b..d2e4d8268 100644 --- a/examples/inner_html.rs +++ b/examples/inner_html.rs @@ -3,7 +3,7 @@ use std::sync::Arc; use anyrender_vello::VelloWindowRenderer; use blitz_dom::DocumentConfig; use blitz_html::{HtmlDocument, HtmlProvider}; -use blitz_shell::{BlitzApplication, BlitzShellEvent, WindowConfig, create_default_event_loop}; +use blitz_shell::{BlitzApplication, BlitzShellProxy, WindowConfig, create_default_event_loop}; pub fn main() { // Create renderer @@ -22,14 +22,15 @@ pub fn main() { doc.resolve(0.0); // Create the Winit application and window - let event_loop = create_default_event_loop::(); - let mut application = BlitzApplication::new(event_loop.create_proxy()); + let event_loop = create_default_event_loop(); + let (proxy, reciever) = BlitzShellProxy::new(event_loop.create_proxy()); + let mut application = BlitzApplication::new(proxy, reciever); let renderer = VelloWindowRenderer::new(); let window = WindowConfig::new(Box::new(doc), renderer); application.add_window(window); // Run event loop - event_loop.run_app(&mut application).unwrap() + event_loop.run_app(application).unwrap() } static HTML: &str = r#" From bf18c18dee66e05485c8c0f916d243493345e847 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 15:35:40 +0000 Subject: [PATCH 13/67] Rename MouseButton event to PointerEvent Signed-off-by: Nico Burns --- packages/blitz-dom/src/events/driver.rs | 8 +++---- packages/blitz-dom/src/events/mouse.rs | 8 +++---- packages/blitz-dom/src/node/node.rs | 6 ++--- packages/blitz-shell/src/window.rs | 6 ++--- packages/blitz-traits/src/events.rs | 28 ++++++++++++------------ packages/dioxus-native-dom/src/events.rs | 4 ++-- 6 files changed, 30 insertions(+), 30 deletions(-) diff --git a/packages/blitz-dom/src/events/driver.rs b/packages/blitz-dom/src/events/driver.rs index 4daa2e378..a61bcaac5 100644 --- a/packages/blitz-dom/src/events/driver.rs +++ b/packages/blitz-dom/src/events/driver.rs @@ -1,5 +1,5 @@ use crate::Document; -use blitz_traits::events::{BlitzMouseButtonEvent, DomEvent, DomEventData, EventState, UiEvent}; +use blitz_traits::events::{BlitzPointerEvent, DomEvent, DomEventData, EventState, UiEvent}; use std::collections::VecDeque; pub trait EventHandler { @@ -142,17 +142,17 @@ impl<'doc, Handler: EventHandler> EventDriver<'doc, Handler> { }; let data = match event { - UiEvent::MouseMove(data) => DomEventData::MouseMove(BlitzMouseButtonEvent { + UiEvent::MouseMove(data) => DomEventData::MouseMove(BlitzPointerEvent { x: data.x + viewport_scroll.x as f32 / zoom, y: data.y + viewport_scroll.y as f32 / zoom, ..data }), - UiEvent::MouseUp(data) => DomEventData::MouseUp(BlitzMouseButtonEvent { + UiEvent::MouseUp(data) => DomEventData::MouseUp(BlitzPointerEvent { x: data.x + viewport_scroll.x as f32 / zoom, y: data.y + viewport_scroll.y as f32 / zoom, ..data }), - UiEvent::MouseDown(data) => DomEventData::MouseDown(BlitzMouseButtonEvent { + UiEvent::MouseDown(data) => DomEventData::MouseDown(BlitzPointerEvent { x: data.x + viewport_scroll.x as f32 / zoom, y: data.y + viewport_scroll.y as f32 / zoom, ..data diff --git a/packages/blitz-dom/src/events/mouse.rs b/packages/blitz-dom/src/events/mouse.rs index b66441bf4..463b2b84e 100644 --- a/packages/blitz-dom/src/events/mouse.rs +++ b/packages/blitz-dom/src/events/mouse.rs @@ -2,7 +2,7 @@ use std::time::{Duration, Instant}; use blitz_traits::{ events::{ - BlitzInputEvent, BlitzMouseButtonEvent, BlitzWheelDelta, BlitzWheelEvent, DomEvent, + BlitzInputEvent, BlitzPointerEvent, BlitzWheelDelta, BlitzWheelEvent, DomEvent, DomEventData, MouseEventButton, MouseEventButtons, }, navigation::NavigationOptions, @@ -20,7 +20,7 @@ pub(crate) fn handle_mousemove( x: f32, y: f32, buttons: MouseEventButtons, - event: &BlitzMouseButtonEvent, + event: &BlitzPointerEvent, mut dispatch_event: F, ) -> bool { let mut changed = doc.set_hover_to(x, y); @@ -228,7 +228,7 @@ pub(crate) fn handle_mousedown( pub(crate) fn handle_mouseup( doc: &mut BaseDocument, target: usize, - event: &BlitzMouseButtonEvent, + event: &BlitzPointerEvent, mut dispatch_event: F, ) { if doc.devtools().highlight_hover { @@ -266,7 +266,7 @@ pub(crate) fn handle_mouseup( pub(crate) fn handle_click( doc: &mut BaseDocument, target: usize, - event: &BlitzMouseButtonEvent, + event: &BlitzPointerEvent, dispatch_event: &mut dyn FnMut(DomEvent), ) { let double_click_event = event.clone(); diff --git a/packages/blitz-dom/src/node/node.rs b/packages/blitz-dom/src/node/node.rs index 0fdf07d98..de61e9e65 100644 --- a/packages/blitz-dom/src/node/node.rs +++ b/packages/blitz-dom/src/node/node.rs @@ -1,6 +1,6 @@ use atomic_refcell::{AtomicRef, AtomicRefCell, AtomicRefMut}; use bitflags::bitflags; -use blitz_traits::events::{BlitzMouseButtonEvent, DomEventData, HitResult}; +use blitz_traits::events::{BlitzPointerEvent, DomEventData, HitResult}; use blitz_traits::shell::ShellProvider; use html_escape::encode_quoted_attribute_to_string; use keyboard_types::Modifiers; @@ -1047,12 +1047,12 @@ impl Node { DomEventData::Click(self.synthetic_click_event_data(mods)) } - pub fn synthetic_click_event_data(&self, mods: Modifiers) -> BlitzMouseButtonEvent { + pub fn synthetic_click_event_data(&self, mods: Modifiers) -> BlitzPointerEvent { let absolute_position = self.absolute_position(0.0, 0.0); let x = absolute_position.x + (self.final_layout.size.width / 2.0); let y = absolute_position.y + (self.final_layout.size.height / 2.0); - BlitzMouseButtonEvent { + BlitzPointerEvent { x, y, mods, diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 7a18ccaf4..a9dc85acb 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -8,7 +8,7 @@ use anyrender::WindowRenderer; use blitz_dom::Document; use blitz_paint::paint_scene; use blitz_traits::events::{ - BlitzMouseButtonEvent, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, MouseEventButtons, + BlitzPointerEvent, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, MouseEventButtons, UiEvent, }; use blitz_traits::shell::Viewport; @@ -396,7 +396,7 @@ impl View { WindowEvent::PointerMoved { position, .. } => { let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); self.mouse_pos = (x, y); - let event = UiEvent::MouseMove(BlitzMouseButtonEvent { + let event = UiEvent::MouseMove(BlitzPointerEvent { x, y, button: Default::default(), @@ -423,7 +423,7 @@ impl View { ElementState::Released => self.buttons ^= button.into(), } - let event = BlitzMouseButtonEvent { + let event = BlitzPointerEvent { x: self.mouse_pos.0, y: self.mouse_pos.1, button, diff --git a/packages/blitz-traits/src/events.rs b/packages/blitz-traits/src/events.rs index 9780a0171..429a23f7e 100644 --- a/packages/blitz-traits/src/events.rs +++ b/packages/blitz-traits/src/events.rs @@ -47,9 +47,9 @@ impl EventState { #[derive(Debug, Clone)] #[repr(u8)] pub enum UiEvent { - MouseMove(BlitzMouseButtonEvent), - MouseUp(BlitzMouseButtonEvent), - MouseDown(BlitzMouseButtonEvent), + MouseMove(BlitzPointerEvent), + MouseUp(BlitzPointerEvent), + MouseDown(BlitzPointerEvent), Wheel(BlitzWheelEvent), KeyUp(BlitzKeyEvent), KeyDown(BlitzKeyEvent), @@ -157,18 +157,18 @@ impl FromStr for DomEventKind { #[derive(Debug, Clone)] #[repr(u8)] pub enum DomEventData { - MouseMove(BlitzMouseButtonEvent), - MouseDown(BlitzMouseButtonEvent), - MouseUp(BlitzMouseButtonEvent), - MouseEnter(BlitzMouseButtonEvent), - MouseLeave(BlitzMouseButtonEvent), - MouseOver(BlitzMouseButtonEvent), - MouseOut(BlitzMouseButtonEvent), + MouseMove(BlitzPointerEvent), + MouseDown(BlitzPointerEvent), + MouseUp(BlitzPointerEvent), + MouseEnter(BlitzPointerEvent), + MouseLeave(BlitzPointerEvent), + MouseOver(BlitzPointerEvent), + MouseOut(BlitzPointerEvent), Scroll(BlitzScrollEvent), Wheel(BlitzWheelEvent), - Click(BlitzMouseButtonEvent), - ContextMenu(BlitzMouseButtonEvent), - DoubleClick(BlitzMouseButtonEvent), + Click(BlitzPointerEvent), + ContextMenu(BlitzPointerEvent), + DoubleClick(BlitzPointerEvent), KeyPress(BlitzKeyEvent), KeyDown(BlitzKeyEvent), KeyUp(BlitzKeyEvent), @@ -308,7 +308,7 @@ pub struct HitResult { } #[derive(Clone, Debug)] -pub struct BlitzMouseButtonEvent { +pub struct BlitzPointerEvent { pub x: f32, pub y: f32, pub button: MouseEventButton, diff --git a/packages/dioxus-native-dom/src/events.rs b/packages/dioxus-native-dom/src/events.rs index e447e1fc1..90b6abec3 100644 --- a/packages/dioxus-native-dom/src/events.rs +++ b/packages/dioxus-native-dom/src/events.rs @@ -1,6 +1,6 @@ use blitz_dom::{BaseDocument, Node}; use blitz_traits::events::{ - BlitzKeyEvent, BlitzMouseButtonEvent, BlitzScrollEvent, BlitzWheelDelta, BlitzWheelEvent, + BlitzKeyEvent, BlitzPointerEvent, BlitzScrollEvent, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, }; use dioxus_html::{ @@ -297,7 +297,7 @@ impl HasKeyboardData for BlitzKeyboardData { } #[derive(Clone)] -pub struct NativeClickData(pub(crate) BlitzMouseButtonEvent); +pub struct NativeClickData(pub(crate) BlitzPointerEvent); impl InteractionLocation for NativeClickData { fn client_coordinates(&self) -> ClientPoint { From d952c9e8869a16deedd2c7b354962ec26b963434 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 15:37:09 +0000 Subject: [PATCH 14/67] Add PointerId to PointerEvent Signed-off-by: Nico Burns --- packages/blitz-dom/src/node/node.rs | 3 ++- packages/blitz-shell/src/window.rs | 6 ++++-- packages/blitz-traits/src/events.rs | 7 +++++++ 3 files changed, 13 insertions(+), 3 deletions(-) diff --git a/packages/blitz-dom/src/node/node.rs b/packages/blitz-dom/src/node/node.rs index de61e9e65..cef547833 100644 --- a/packages/blitz-dom/src/node/node.rs +++ b/packages/blitz-dom/src/node/node.rs @@ -1,6 +1,6 @@ use atomic_refcell::{AtomicRef, AtomicRefCell, AtomicRefMut}; use bitflags::bitflags; -use blitz_traits::events::{BlitzPointerEvent, DomEventData, HitResult}; +use blitz_traits::events::{BlitzPointerEvent, BlitzPointerId, DomEventData, HitResult}; use blitz_traits::shell::ShellProvider; use html_escape::encode_quoted_attribute_to_string; use keyboard_types::Modifiers; @@ -1053,6 +1053,7 @@ impl Node { let y = absolute_position.y + (self.final_layout.size.height / 2.0); BlitzPointerEvent { + id: BlitzPointerId::Mouse, x, y, mods, diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index a9dc85acb..99c4352f7 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -8,8 +8,8 @@ use anyrender::WindowRenderer; use blitz_dom::Document; use blitz_paint::paint_scene; use blitz_traits::events::{ - BlitzPointerEvent, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, MouseEventButtons, - UiEvent, + BlitzPointerEvent, BlitzPointerId, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, + MouseEventButtons, UiEvent, }; use blitz_traits::shell::Viewport; use winit::dpi::PhysicalInsets; @@ -397,6 +397,7 @@ impl View { let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); self.mouse_pos = (x, y); let event = UiEvent::MouseMove(BlitzPointerEvent { + id: BlitzPointerId::Mouse, x, y, button: Default::default(), @@ -424,6 +425,7 @@ impl View { } let event = BlitzPointerEvent { + id: BlitzPointerId::Mouse, x: self.mouse_pos.0, y: self.mouse_pos.1, button, diff --git a/packages/blitz-traits/src/events.rs b/packages/blitz-traits/src/events.rs index 429a23f7e..dbe41d84d 100644 --- a/packages/blitz-traits/src/events.rs +++ b/packages/blitz-traits/src/events.rs @@ -307,8 +307,15 @@ pub struct HitResult { pub y: f32, } +#[derive(Copy, Clone, Debug)] +pub enum BlitzPointerId { + Mouse, + Finger(u64), +} + #[derive(Clone, Debug)] pub struct BlitzPointerEvent { + pub id: BlitzPointerId, pub x: f32, pub y: f32, pub button: MouseEventButton, From 93333775882add4a0e92dabc8b0cf0146883ce35 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 16:46:12 +0000 Subject: [PATCH 15/67] Touch events WIP Signed-off-by: Nico Burns --- packages/blitz-dom/src/node/node.rs | 1 + packages/blitz-shell/src/convert_events.rs | 32 ++++++++++++++++++++-- packages/blitz-shell/src/window.rs | 23 +++++++++------- packages/blitz-traits/src/events.rs | 16 ++++++++++- packages/dioxus-native-dom/src/events.rs | 8 +----- 5 files changed, 59 insertions(+), 21 deletions(-) diff --git a/packages/blitz-dom/src/node/node.rs b/packages/blitz-dom/src/node/node.rs index cef547833..588f8e294 100644 --- a/packages/blitz-dom/src/node/node.rs +++ b/packages/blitz-dom/src/node/node.rs @@ -1054,6 +1054,7 @@ impl Node { BlitzPointerEvent { id: BlitzPointerId::Mouse, + is_primary: true, x, y, mods, diff --git a/packages/blitz-shell/src/convert_events.rs b/packages/blitz-shell/src/convert_events.rs index bec3ba861..ba0df9b48 100644 --- a/packages/blitz-shell/src/convert_events.rs +++ b/packages/blitz-shell/src/convert_events.rs @@ -1,9 +1,9 @@ -use blitz_traits::events::{BlitzImeEvent, BlitzKeyEvent, KeyState}; +use blitz_traits::events::{BlitzImeEvent, BlitzKeyEvent, BlitzPointerId, KeyState}; use blitz_traits::shell::ColorScheme; use keyboard_types::{Code, Key, Location, Modifiers}; -use winit::event::ElementState; -use winit::event::Ime; use winit::event::KeyEvent as WinitKeyEvent; +use winit::event::{ButtonSource, ElementState}; +use winit::event::{Ime, PointerSource}; use winit::keyboard::Key as WinitKey; use winit::keyboard::KeyCode as WinitKeyCode; use winit::keyboard::KeyLocation as WinitKeyLocation; @@ -61,6 +61,32 @@ pub(crate) fn winit_key_event_to_blitz( } } +pub(crate) fn pointer_source_to_blitz(source: &PointerSource) -> BlitzPointerId { + match source { + PointerSource::Mouse => BlitzPointerId::Mouse, + PointerSource::Touch { finger_id, .. } => { + BlitzPointerId::Finger(finger_id.into_raw() as u64) + } + + // TODO: TabletTool and Unknown events + PointerSource::TabletTool { .. } => BlitzPointerId::Mouse, + PointerSource::Unknown => BlitzPointerId::Mouse, + } +} + +pub(crate) fn button_source_to_blitz(source: &ButtonSource) -> BlitzPointerId { + match source { + ButtonSource::Mouse(_) => BlitzPointerId::Mouse, + ButtonSource::Touch { finger_id, .. } => { + BlitzPointerId::Finger(finger_id.into_raw() as u64) + } + + // TODO: TabletTool and Unknown events + ButtonSource::TabletTool { .. } => BlitzPointerId::Mouse, + ButtonSource::Unknown(_) => BlitzPointerId::Mouse, + } +} + pub(crate) fn winit_modifiers_to_kbt_modifiers(winit_modifiers: WinitModifiers) -> Modifiers { let mut modifiers = Modifiers::default(); if winit_modifiers.control_key() { diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 99c4352f7..4110876f2 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -1,15 +1,15 @@ use crate::BlitzShellProvider; use crate::convert_events::{ - color_scheme_to_theme, theme_to_color_scheme, winit_ime_to_blitz, winit_key_event_to_blitz, - winit_modifiers_to_kbt_modifiers, + button_source_to_blitz, color_scheme_to_theme, pointer_source_to_blitz, theme_to_color_scheme, + winit_ime_to_blitz, winit_key_event_to_blitz, winit_modifiers_to_kbt_modifiers, }; use crate::event::{BlitzShellProxy, create_waker}; use anyrender::WindowRenderer; use blitz_dom::Document; use blitz_paint::paint_scene; use blitz_traits::events::{ - BlitzPointerEvent, BlitzPointerId, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, - MouseEventButtons, UiEvent, + BlitzPointerEvent, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, MouseEventButtons, + UiEvent, }; use blitz_traits::shell::Viewport; use winit::dpi::PhysicalInsets; @@ -393,11 +393,13 @@ impl View { } WindowEvent::PointerEntered { /*device_id*/.. } => {} WindowEvent::PointerLeft { /*device_id*/.. } => {} - WindowEvent::PointerMoved { position, .. } => { + WindowEvent::PointerMoved { position, source, primary, .. } => { + let id = pointer_source_to_blitz(&source); let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); self.mouse_pos = (x, y); let event = UiEvent::MouseMove(BlitzPointerEvent { - id: BlitzPointerId::Mouse, + id, + is_primary: primary, x, y, button: Default::default(), @@ -406,8 +408,9 @@ impl View { }); self.doc.handle_ui_event(event); } - WindowEvent::PointerButton { button, state, .. } => { - let button = match button { + WindowEvent::PointerButton { button, state, primary, .. } => { + let id = button_source_to_blitz(&button); + let button = match &button { ButtonSource::Mouse(mouse_button) => match mouse_button { MouseButton::Left => MouseEventButton::Main, MouseButton::Right => MouseEventButton::Secondary, @@ -425,7 +428,8 @@ impl View { } let event = BlitzPointerEvent { - id: BlitzPointerId::Mouse, + id, + is_primary: primary, x: self.mouse_pos.0, y: self.mouse_pos.1, button, @@ -450,7 +454,6 @@ impl View { delta: blitz_delta, x: self.mouse_pos.0, y: self.mouse_pos.1, - button: MouseEventButton::Main, // Acts as an uninitialized value in this case buttons: self.buttons, mods: winit_modifiers_to_kbt_modifiers(self.keyboard_modifiers.state()), }; diff --git a/packages/blitz-traits/src/events.rs b/packages/blitz-traits/src/events.rs index dbe41d84d..0207fa977 100644 --- a/packages/blitz-traits/src/events.rs +++ b/packages/blitz-traits/src/events.rs @@ -316,6 +316,7 @@ pub enum BlitzPointerId { #[derive(Clone, Debug)] pub struct BlitzPointerEvent { pub id: BlitzPointerId, + pub is_primary: bool, pub x: f32, pub y: f32, pub button: MouseEventButton, @@ -328,7 +329,6 @@ pub struct BlitzWheelEvent { pub delta: BlitzWheelDelta, pub x: f32, pub y: f32, - pub button: MouseEventButton, pub buttons: MouseEventButtons, pub mods: Modifiers, } @@ -349,6 +349,20 @@ pub struct BlitzScrollEvent { pub client_height: i32, } +// struct PointerInputState { +// id: BlitzPointerId, +// pointer_down_x: f32, +// pointer_down_y: f32, +// pointer_down_time: Option, +// click_count: u16, +// } + +// struct PointersInputState { +// initial_finger_active: bool, +// mouse: Option, +// fingers: Vec, +// } + bitflags! { /// The buttons property indicates which buttons are pressed on the mouse /// (or other input device) when a mouse event is triggered. diff --git a/packages/dioxus-native-dom/src/events.rs b/packages/dioxus-native-dom/src/events.rs index 90b6abec3..332f107b2 100644 --- a/packages/dioxus-native-dom/src/events.rs +++ b/packages/dioxus-native-dom/src/events.rs @@ -414,13 +414,7 @@ impl HasMouseData for NativeWheelData { impl PointerInteraction for NativeWheelData { fn trigger_button(&self) -> Option { - Some(match self.0.button { - MouseEventButton::Main => MouseButton::Primary, - MouseEventButton::Auxiliary => MouseButton::Auxiliary, - MouseEventButton::Secondary => MouseButton::Secondary, - MouseEventButton::Fourth => MouseButton::Fourth, - MouseEventButton::Fifth => MouseButton::Fifth, - }) + None } fn held_buttons(&self) -> MouseButtonSet { From 6d2f9eed0b036834e65d43285b1abb4b3a88ba28 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 20:10:31 +0000 Subject: [PATCH 16/67] Setup counter, todomvc, and browser crates for compiling to Android --- Cargo.lock | 3 + apps/browser/Cargo.toml | 4 + apps/browser/Dioxus.toml | 1 + apps/browser/MainActivity.kt.hbs | 4 + apps/browser/src/main.rs | 8 +- examples/counter/Cargo.toml | 13 ++- examples/counter/Dioxus.toml | 2 + examples/counter/MainActivity.kt.hbs | 4 + examples/counter/src/app.rs | 114 +++++++++++++++++++++++++ examples/counter/src/lib.rs | 10 +++ examples/counter/src/main.rs | 122 +++------------------------ examples/todomvc/Cargo.toml | 5 +- examples/todomvc/Dioxus.toml | 2 + examples/todomvc/MainActivity.kt.hbs | 4 + examples/todomvc/src/main.rs | 7 ++ justfile | 5 ++ packages/blitz-shell/Cargo.toml | 2 +- 17 files changed, 193 insertions(+), 117 deletions(-) create mode 100644 apps/browser/MainActivity.kt.hbs create mode 100644 examples/counter/Dioxus.toml create mode 100644 examples/counter/MainActivity.kt.hbs create mode 100644 examples/counter/src/app.rs create mode 100644 examples/counter/src/lib.rs create mode 100644 examples/todomvc/Dioxus.toml create mode 100644 examples/todomvc/MainActivity.kt.hbs diff --git a/Cargo.lock b/Cargo.lock index 6ab97f04a..6094572c5 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -734,6 +734,7 @@ dependencies = [ name = "browser" version = "0.0.0" dependencies = [ + "android-activity", "blitz-dom", "blitz-html", "blitz-net", @@ -1260,6 +1261,7 @@ dependencies = [ name = "counter" version = "0.1.0" dependencies = [ + "android-activity", "blitz-dom", "blitz-paint", "dioxus-native", @@ -6424,6 +6426,7 @@ dependencies = [ name = "todomvc" version = "0.1.0" dependencies = [ + "android-activity", "dioxus-native", "idna_adapter", "tracing-subscriber", diff --git a/apps/browser/Cargo.toml b/apps/browser/Cargo.toml index 1da6727a2..e04eb202b 100644 --- a/apps/browser/Cargo.toml +++ b/apps/browser/Cargo.toml @@ -42,3 +42,7 @@ linebender_resource_handle = { workspace = true } tracing-subscriber = { workspace = true, optional = true } webbrowser = { workspace = true } winit = { workspace = true } + + +[target.'cfg(target_os = "android")'.dependencies] +android-activity = { version = "0.6.0", features = ["native-activity"] } diff --git a/apps/browser/Dioxus.toml b/apps/browser/Dioxus.toml index e389d582f..eaf405d22 100644 --- a/apps/browser/Dioxus.toml +++ b/apps/browser/Dioxus.toml @@ -1,4 +1,5 @@ [application] +android_main_activity = "MainActivity.kt.hbs" [bundle] publisher = "DioxusLabs" diff --git a/apps/browser/MainActivity.kt.hbs b/apps/browser/MainActivity.kt.hbs new file mode 100644 index 000000000..a0ce0e2c3 --- /dev/null +++ b/apps/browser/MainActivity.kt.hbs @@ -0,0 +1,4 @@ +package dev.dioxus.main; + +class MainActivity : android.app.NativeActivity() +//class MainActivity : com.google.androidgamesdk.GameActivity() diff --git a/apps/browser/src/main.rs b/apps/browser/src/main.rs index ca929f40f..535ed5bd7 100644 --- a/apps/browser/src/main.rs +++ b/apps/browser/src/main.rs @@ -25,10 +25,16 @@ use icons::IconButton; static BROWSER_UI_STYLES: Asset = asset!("../assets/browser.css"); +#[unsafe(no_mangle)] +#[cfg(target_os = "android")] +pub fn android_main(android_app: dioxus_native::AndroidApp) { + dioxus_native::set_android_app(android_app); + main() +} + fn main() { #[cfg(feature = "tracing")] tracing_subscriber::fmt::init(); - dioxus_native::launch(app) } diff --git a/examples/counter/Cargo.toml b/examples/counter/Cargo.toml index 111acc388..d4dae0579 100644 --- a/examples/counter/Cargo.toml +++ b/examples/counter/Cargo.toml @@ -5,20 +5,24 @@ edition = "2024" license.workspace = true publish = false +[lib] +crate-type = ["cdylib"] + [features] -default = ["system_fonts", "vello"] +default = ["vello"] system_fonts = ["blitz-dom/system_fonts"] vello = ["dioxus-native/vello"] cpu = ["cpu-pixels"] svg = ["blitz-paint/svg"] cpu-pixels = ["dioxus-native/vello-cpu-pixels"] cpu-softbuffer = ["dioxus-native/vello-cpu-softbuffer"] +skia = ["dioxus-native/skia"] incremental = ["dioxus-native/incremental"] log_frame_times = ["dioxus-native/log-frame-times"] log_phase_times = ["dioxus-native/log-phase-times"] [dependencies] -dioxus-native = { workspace = true, default-features = false, features = ["prelude"]} +dioxus-native = { workspace = true, default-features = false, features = ["prelude", "system-fonts"] } # Control whether system font support is enabled blitz-dom = { workspace = true, default-features = false } @@ -26,4 +30,7 @@ blitz-paint = { workspace = true, default-features = false } # Disable unicode URL support # See https://github.com/hsivonen/idna_adapter -idna_adapter = "=1.0.0" \ No newline at end of file +idna_adapter = "=1.0.0" + +[target.'cfg(target_os = "android")'.dependencies] +android-activity = { version = "0.6.0", features = ["native-activity"] } \ No newline at end of file diff --git a/examples/counter/Dioxus.toml b/examples/counter/Dioxus.toml new file mode 100644 index 000000000..3292650d6 --- /dev/null +++ b/examples/counter/Dioxus.toml @@ -0,0 +1,2 @@ +[application] +android_main_activity = "MainActivity.kt.hbs" \ No newline at end of file diff --git a/examples/counter/MainActivity.kt.hbs b/examples/counter/MainActivity.kt.hbs new file mode 100644 index 000000000..a0ce0e2c3 --- /dev/null +++ b/examples/counter/MainActivity.kt.hbs @@ -0,0 +1,4 @@ +package dev.dioxus.main; + +class MainActivity : android.app.NativeActivity() +//class MainActivity : com.google.androidgamesdk.GameActivity() diff --git a/examples/counter/src/app.rs b/examples/counter/src/app.rs new file mode 100644 index 000000000..1e6613de5 --- /dev/null +++ b/examples/counter/src/app.rs @@ -0,0 +1,114 @@ +//! Drive the renderer from Dioxus +use dioxus_native::prelude::*; + +pub fn app() -> Element { + let mut count = use_signal(|| 0); + + rsx! { + div { class: "container", + style { {CSS} } + h1 { class: "header", "Count: {count}" } + div { class: "buttons", + button { + class: "counter-button btn-green", + onclick: move |_| { count += 1 }, + "Increment" + } + button { + class: "counter-button btn-red", + onclick: move |_| { count -= 1 }, + "Decrement" + } + } + button { + class: "counter-button btn-blue", + onclick: move |_| { count.set(0) }, + "Reset" + } + } + } +} + +const CSS: &str = r#" + +html, body, #main { + padding: 0; + margin: 0; + background-color: green; + height: 100%; +} + +.header { + background-color: pink; + padding: 20px; + line-height: 1; + font-family: sans-serif; +} + +.container { + display: flex; + flex-direction: column; + justify-content: center; + align-items: center; + height: 100%; + width: 100vw; + background: linear-gradient(217deg, rgba(255,0,0,.8), rgba(255,0,0,0) 70.71%), + linear-gradient(127deg, rgba(0,255,0,.8), rgba(0,255,0,0) 70.71%), + linear-gradient(336deg, rgba(0,0,255,.8), rgba(0,0,255,0) 70.71%); +} + +.buttons { + display: flex; + flex-direction: row; + justify-content: center; + align-items: center; + margin: 20px 0; +} + +.counter-button { + margin: 0 10px; + padding: 10px 20px; + border-radius: 5px; + font-size: 1.5rem; + cursor: pointer; + line-height: 1; + font-family: sans-serif; + border-width: 2px; + border-style: solid; +} +.counter-button:focus { + outline: 4px solid black; +} + +.btn-green { + background-color: green; + border-color: green; + color: white; +} +.btn-green:hover { + color: green; + background-color: white; +} + +.btn-red { + background-color: red; + border-color: red; + color: white; +} +.btn-red:hover { + color: red; + background-color: white; +} + +.btn-blue { + background-color: blue; + border-color: blue; + color: white; +} +.btn-blue:hover { + color: blue; + background-color: white; +} + + +"#; diff --git a/examples/counter/src/lib.rs b/examples/counter/src/lib.rs new file mode 100644 index 000000000..98df23332 --- /dev/null +++ b/examples/counter/src/lib.rs @@ -0,0 +1,10 @@ +#![cfg(target_os = "android")] + +mod app; + +/// Run with `cargo apk run` +#[unsafe(no_mangle)] +pub fn android_main(android_app: dioxus_native::AndroidApp) { + dioxus_native::set_android_app(android_app); + dioxus_native::launch(app::app) +} diff --git a/examples/counter/src/main.rs b/examples/counter/src/main.rs index 38e7e65a3..0621c4f51 100644 --- a/examples/counter/src/main.rs +++ b/examples/counter/src/main.rs @@ -1,117 +1,17 @@ -//! Drive the renderer from Dioxus -use dioxus_native::prelude::*; - -fn main() { - dioxus_native::launch(app); -} - -fn app() -> Element { - let mut count = use_signal(|| 0); - - rsx! { - div { class: "container", - style { {CSS} } - h1 { class: "header", "Count: {count}" } - div { class: "buttons", - button { - class: "counter-button btn-green", - onclick: move |_| { count += 1 }, - "Increment" - } - button { - class: "counter-button btn-red", - onclick: move |_| { count -= 1 }, - "Decrement" - } - } - button { - class: "counter-button btn-blue", - onclick: move |_| { count.set(0) }, - "Reset" - } - } - } -} - -const CSS: &str = r#" - -html, body { - padding: 0; - margin: 0; - background-color: white; -} - -.header { - background-color: pink; - padding: 20px; - line-height: 1; - font-family: sans-serif; -} - -.container { - display: flex; - flex-direction: column; - justify-content: center; - align-items: center; - height: 100vh; - width: 100vw; - background: linear-gradient(217deg, rgba(255,0,0,.8), rgba(255,0,0,0) 70.71%), - linear-gradient(127deg, rgba(0,255,0,.8), rgba(0,255,0,0) 70.71%), - linear-gradient(336deg, rgba(0,0,255,.8), rgba(0,0,255,0) 70.71%); -} +// On Windows do NOT show a console window when opening the app +#![cfg_attr(all(not(test), target_os = "windows"), windows_subsystem = "windows")] -.buttons { - display: flex; - flex-direction: row; - justify-content: center; - align-items: center; - margin: 20px 0; -} +//! Drive the renderer from Dioxus -.counter-button { - margin: 0 10px; - padding: 10px 20px; - border-radius: 5px; - font-size: 1.5rem; - cursor: pointer; - line-height: 1; - font-family: sans-serif; - border-width: 2px; - border-style: solid; -} -.counter-button:focus { - outline: 4px solid black; -} +mod app; -.btn-green { - background-color: green; - border-color: green; - color: white; -} -.btn-green:hover { - color: green; - background-color: white; +#[unsafe(no_mangle)] +#[cfg(target_os = "android")] +pub fn android_main(android_app: dioxus_native::AndroidApp) { + dioxus_native::set_android_app(android_app); + dioxus_native::launch(app::app) } -.btn-red { - background-color: red; - border-color: red; - color: white; -} -.btn-red:hover { - color: red; - background-color: white; -} - -.btn-blue { - background-color: blue; - border-color: blue; - color: white; -} -.btn-blue:hover { - color: blue; - background-color: white; +fn main() { + dioxus_native::launch(app::app) } - - -"#; diff --git a/examples/todomvc/Cargo.toml b/examples/todomvc/Cargo.toml index 6fbaaabbc..4de43cef3 100644 --- a/examples/todomvc/Cargo.toml +++ b/examples/todomvc/Cargo.toml @@ -29,4 +29,7 @@ tracing-subscriber = { workspace = true, optional = true} # Disable unicode URL support # See https://github.com/hsivonen/idna_adapter -idna_adapter = "=1.0.0" \ No newline at end of file +idna_adapter = "=1.0.0" + +[target.'cfg(target_os = "android")'.dependencies] +android-activity = { version = "0.6.0", features = ["native-activity"] } \ No newline at end of file diff --git a/examples/todomvc/Dioxus.toml b/examples/todomvc/Dioxus.toml new file mode 100644 index 000000000..3292650d6 --- /dev/null +++ b/examples/todomvc/Dioxus.toml @@ -0,0 +1,2 @@ +[application] +android_main_activity = "MainActivity.kt.hbs" \ No newline at end of file diff --git a/examples/todomvc/MainActivity.kt.hbs b/examples/todomvc/MainActivity.kt.hbs new file mode 100644 index 000000000..a0ce0e2c3 --- /dev/null +++ b/examples/todomvc/MainActivity.kt.hbs @@ -0,0 +1,4 @@ +package dev.dioxus.main; + +class MainActivity : android.app.NativeActivity() +//class MainActivity : com.google.androidgamesdk.GameActivity() diff --git a/examples/todomvc/src/main.rs b/examples/todomvc/src/main.rs index 575086eaa..649a27add 100644 --- a/examples/todomvc/src/main.rs +++ b/examples/todomvc/src/main.rs @@ -5,6 +5,13 @@ mod app; +#[unsafe(no_mangle)] +#[cfg(target_os = "android")] +pub fn android_main(android_app: dioxus_native::AndroidApp) { + dioxus_native::set_android_app(android_app); + dioxus_native::launch(app::app) +} + fn main() { #[cfg(feature = "tracing")] tracing_subscriber::fmt::init(); diff --git a/justfile b/justfile index d1fd010fb..73c539829 100644 --- a/justfile +++ b/justfile @@ -69,6 +69,11 @@ todoandroid *ARGS: export CARGO_APK_RELEASE_KEYSTORE_PASSWORD="android" cargo apk run --lib --no-default-features --features skia -p todomvc +counterandroid *ARGS: + export CARGO_APK_RELEASE_KEYSTORE="$HOME/.android/debug.keystore" + export CARGO_APK_RELEASE_KEYSTORE_PASSWORD="android" + cargo apk run --lib --no-default-features --features skia -p counter + ## Ops bump *ARGS: diff --git a/packages/blitz-shell/Cargo.toml b/packages/blitz-shell/Cargo.toml index 7dfe70e3e..0c959632b 100644 --- a/packages/blitz-shell/Cargo.toml +++ b/packages/blitz-shell/Cargo.toml @@ -42,7 +42,7 @@ futures-util = { workspace = true } data-url = { workspace = true, optional = true } [target.'cfg(target_os = "android")'.dependencies] -android-activity = { version = "0.6.0", features = ["native-activity"] } +android-activity = { version = "0.6.0" } [target.'cfg(any(target_os = "windows",target_os = "macos",target_os = "linux",target_os = "dragonfly", target_os = "freebsd", target_os = "netbsd", target_os = "openbsd"))'.dependencies] arboard = { workspace = true, optional = true } From c8343edffc09ed5016be0c37f09f06ca3a7621ca Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 20:11:15 +0000 Subject: [PATCH 17/67] Make Enter key work on Android/iOS --- examples/todomvc/src/app.rs | 7 ++++++- packages/blitz-dom/src/events/keyboard.rs | 8 ++++++++ 2 files changed, 14 insertions(+), 1 deletion(-) diff --git a/examples/todomvc/src/app.rs b/examples/todomvc/src/app.rs index 300f85a5a..bbbabe6c2 100644 --- a/examples/todomvc/src/app.rs +++ b/examples/todomvc/src/app.rs @@ -113,7 +113,12 @@ fn TodoHeader(mut todos: Signal>) -> Element { let mut todo_id = use_signal(|| 0); let onkeydown = move |evt: KeyboardEvent| { - if evt.key() == Key::Enter && !draft.read().is_empty() { + let is_enter = match evt.key() { + Key::Enter => true, + Key::Character(s) if s == "\n" => true, + _ => false, + }; + if is_enter && !draft.read().is_empty() { let id = todo_id(); let todo = TodoItem { id, diff --git a/packages/blitz-dom/src/events/keyboard.rs b/packages/blitz-dom/src/events/keyboard.rs index ce8145001..d3611384a 100644 --- a/packages/blitz-dom/src/events/keyboard.rs +++ b/packages/blitz-dom/src/events/keyboard.rs @@ -237,6 +237,14 @@ fn apply_keypress_event( } return Some(GeneratedEvent::Input); } + Key::Character(c) if c == "\n" => { + if is_multiline { + driver.insert_or_replace_selection("\n"); + return Some(GeneratedEvent::Input); + } else { + return Some(GeneratedEvent::Submit); + } + } Key::Enter => { if is_multiline { driver.insert_or_replace_selection("\n"); From c5b17c42198591cf2e55a9836f3ff2a6184d1e7e Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 20:11:46 +0000 Subject: [PATCH 18/67] Don't ignore keyboard events with no physical keycode --- packages/blitz-shell/src/window.rs | 89 +++++++++++++++--------------- 1 file changed, 45 insertions(+), 44 deletions(-) diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 4110876f2..3a08bcc51 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -331,54 +331,55 @@ impl View { self.keyboard_modifiers = new_state; } WindowEvent::KeyboardInput { event, .. } => { - let PhysicalKey::Code(key_code) = event.physical_key else { - return; - }; if event.state.is_pressed() { - let ctrl = self.keyboard_modifiers.state().control_key(); - let meta = self.keyboard_modifiers.state().meta_key(); - let alt = self.keyboard_modifiers.state().alt_key(); - - // Ctrl/Super keyboard shortcuts - if ctrl | meta { - match key_code { - KeyCode::Equal => { - self.doc.inner_mut().viewport_mut().zoom_by(0.1); - self.request_redraw(); - }, - KeyCode::Minus => { - self.doc.inner_mut().viewport_mut().zoom_by(-0.1); - self.request_redraw(); - }, - KeyCode::Digit0 => { - self.doc.inner_mut().viewport_mut().set_zoom(1.0); - self.request_redraw(); - } - _ => {} - }; - } - // Alt keyboard shortcuts - if alt { - match key_code { - KeyCode::KeyD => { - let mut inner = self.doc.inner_mut(); - inner.devtools_mut().toggle_show_layout(); - drop(inner); - self.request_redraw(); - } - KeyCode::KeyH => { - let mut inner = self.doc.inner_mut(); - inner.devtools_mut().toggle_highlight_hover(); - drop(inner); - self.request_redraw(); - } - KeyCode::KeyT => self.doc.inner().print_taffy_tree(), - _ => {} - }; - } + if let PhysicalKey::Code(key_code) = event.physical_key { + if event.state.is_pressed() { + let ctrl = self.keyboard_modifiers.state().control_key(); + let meta = self.keyboard_modifiers.state().meta_key(); + let alt = self.keyboard_modifiers.state().alt_key(); + + // Ctrl/Super keyboard shortcuts + if ctrl | meta { + match key_code { + KeyCode::Equal => { + self.doc.inner_mut().viewport_mut().zoom_by(0.1); + self.request_redraw(); + }, + KeyCode::Minus => { + self.doc.inner_mut().viewport_mut().zoom_by(-0.1); + self.request_redraw(); + }, + KeyCode::Digit0 => { + self.doc.inner_mut().viewport_mut().set_zoom(1.0); + self.request_redraw(); + } + _ => {} + }; + } + + // Alt keyboard shortcuts + if alt { + match key_code { + KeyCode::KeyD => { + let mut inner = self.doc.inner_mut(); + inner.devtools_mut().toggle_show_layout(); + drop(inner); + self.request_redraw(); + } + KeyCode::KeyH => { + let mut inner = self.doc.inner_mut(); + inner.devtools_mut().toggle_highlight_hover(); + drop(inner); + self.request_redraw(); + } + KeyCode::KeyT => self.doc.inner().print_taffy_tree(), + _ => {} + }; + } + } } // Unmodified keypresses From 99601096dd62adde8a0683e48a1d02a9580e0e8a Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 20:12:24 +0000 Subject: [PATCH 19/67] fixup safe area --- packages/blitz-paint/src/render.rs | 5 ++++- packages/blitz-shell/src/window.rs | 4 ++-- 2 files changed, 6 insertions(+), 3 deletions(-) diff --git a/packages/blitz-paint/src/render.rs b/packages/blitz-paint/src/render.rs index b395d54e2..d40ef6f14 100644 --- a/packages/blitz-paint/src/render.rs +++ b/packages/blitz-paint/src/render.rs @@ -141,7 +141,10 @@ impl<'dom> BlitzDomPainter<'dom> { if let Some(bg_color) = background_color { let bg_color = bg_color.as_srgb_color(); - let rect = Rect::from_origin_size((0.0, 0.0), (bg_width as f64, bg_height as f64)); + let rect = Rect::from_origin_size( + (self.initial_x * self.scale, self.initial_y * self.scale), + (bg_width as f64, bg_height as f64), + ); scene.fill(Fill::NonZero, Affine::IDENTITY, bg_color, None, &rect); } diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 3a08bcc51..3269ea9bb 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -202,7 +202,7 @@ impl View { }; // Render - let insets = self.safe_area_insets; + let insets = self.safe_area_insets.to_logical(scale); self.renderer.render(|scene| { paint_scene(scene, &inner, scale, width, height, insets.left, insets.top) }); @@ -252,7 +252,7 @@ impl View { let (width, height) = inner.viewport().window_size; let scale = inner.viewport().scale_f64(); let is_animating = inner.is_animating(); - let insets = self.safe_area_insets; + let insets = self.safe_area_insets.to_logical(scale); self.renderer.render(|scene| { paint_scene(scene, &inner, scale, width, height, insets.left, insets.top) }); From c16eae9b88c6b0869ddf96c0a94b01fd25010134 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 20:12:56 +0000 Subject: [PATCH 20/67] Touch events WIP2 --- packages/blitz-shell/src/window.rs | 39 ++++++++++++++++++++++------- packages/blitz-traits/src/events.rs | 2 +- 2 files changed, 31 insertions(+), 10 deletions(-) diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 3269ea9bb..1ff6249a5 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -8,8 +8,8 @@ use anyrender::WindowRenderer; use blitz_dom::Document; use blitz_paint::paint_scene; use blitz_traits::events::{ - BlitzPointerEvent, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, MouseEventButtons, - UiEvent, + BlitzPointerEvent, BlitzPointerId, BlitzWheelDelta, BlitzWheelEvent, MouseEventButton, + MouseEventButtons, UiEvent, }; use blitz_traits::shell::Viewport; use winit::dpi::PhysicalInsets; @@ -394,10 +394,12 @@ impl View { } WindowEvent::PointerEntered { /*device_id*/.. } => {} WindowEvent::PointerLeft { /*device_id*/.. } => {} - WindowEvent::PointerMoved { position, source, primary, .. } => { + WindowEvent::PointerMoved { mut position, source, primary, .. } => { let id = pointer_source_to_blitz(&source); + position.x -= self.safe_area_insets.left as f64; + position.y -= self.safe_area_insets.top as f64; let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); - self.mouse_pos = (x, y); + let event = UiEvent::MouseMove(BlitzPointerEvent { id, is_primary: primary, @@ -409,7 +411,7 @@ impl View { }); self.doc.handle_ui_event(event); } - WindowEvent::PointerButton { button, state, primary, .. } => { + WindowEvent::PointerButton { button, state, primary, mut position, .. } => { let id = button_source_to_blitz(&button); let button = match &button { ButtonSource::Mouse(mouse_button) => match mouse_button { @@ -417,9 +419,9 @@ impl View { MouseButton::Right => MouseEventButton::Secondary, MouseButton::Middle => MouseEventButton::Auxiliary, // TODO: handle other button types - _ => return, + _ => MouseEventButton::Auxiliary, } - _ => return, + _ => MouseEventButton::Main, }; @@ -428,11 +430,29 @@ impl View { ElementState::Released => self.buttons ^= button.into(), } + position.x -= self.safe_area_insets.left as f64; + position.y -= self.safe_area_insets.top as f64; + let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); + + if id != BlitzPointerId::Mouse { + let event = UiEvent::MouseMove(BlitzPointerEvent { + id, + is_primary: primary, + x, + y, + button: Default::default(), + buttons: self.buttons, + mods: winit_modifiers_to_kbt_modifiers(self.keyboard_modifiers.state()), + }); + self.doc.handle_ui_event(event); + } + + let event = BlitzPointerEvent { id, is_primary: primary, - x: self.mouse_pos.0, - y: self.mouse_pos.1, + x, + y, button, buttons: self.buttons, mods: winit_modifiers_to_kbt_modifiers(self.keyboard_modifiers.state()), @@ -442,6 +462,7 @@ impl View { ElementState::Pressed => UiEvent::MouseDown(event), ElementState::Released => UiEvent::MouseUp(event), }; + self.doc.handle_ui_event(event); self.request_redraw(); } diff --git a/packages/blitz-traits/src/events.rs b/packages/blitz-traits/src/events.rs index 0207fa977..e154b682c 100644 --- a/packages/blitz-traits/src/events.rs +++ b/packages/blitz-traits/src/events.rs @@ -307,7 +307,7 @@ pub struct HitResult { pub y: f32, } -#[derive(Copy, Clone, Debug)] +#[derive(Copy, Clone, Debug, PartialEq, Eq)] pub enum BlitzPointerId { Mouse, Finger(u64), From 03a912dbf0dc98a136904d57ab23752f2658aa9d Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 20:25:27 +0000 Subject: [PATCH 21/67] Fixup Enter key --- apps/browser/src/main.rs | 7 ++++++- packages/blitz-shell/src/window.rs | 2 -- 2 files changed, 6 insertions(+), 3 deletions(-) diff --git a/apps/browser/src/main.rs b/apps/browser/src/main.rs index 535ed5bd7..4e4b390a9 100644 --- a/apps/browser/src/main.rs +++ b/apps/browser/src/main.rs @@ -140,7 +140,12 @@ fn app() -> Element { } }, onkeydown: move |evt| { - if evt.key() == Key::Enter { + let is_enter = match evt.key() { + Key::Enter => true, + Key::Character(s) if s == "\n" => true, + _ => false, + }; + if is_enter { evt.prevent_default(); let req = req_from_string(&url_input_value.read()); if let Some(req) = req { diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 1ff6249a5..3df9bad7f 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -332,8 +332,6 @@ impl View { } WindowEvent::KeyboardInput { event, .. } => { - if event.state.is_pressed() { - if let PhysicalKey::Code(key_code) = event.physical_key { if event.state.is_pressed() { let ctrl = self.keyboard_modifiers.state().control_key(); From 5196cb53f697d5665d47f942b1242708143358e3 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 22:01:59 +0000 Subject: [PATCH 22/67] Fixup don't ignore keyboard events --- packages/blitz-shell/src/window.rs | 4 +--- 1 file changed, 1 insertion(+), 3 deletions(-) diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 3df9bad7f..548ffe9d3 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -332,8 +332,7 @@ impl View { } WindowEvent::KeyboardInput { event, .. } => { - if let PhysicalKey::Code(key_code) = event.physical_key { - if event.state.is_pressed() { + if let PhysicalKey::Code(key_code) = event.physical_key && event.state.is_pressed() { let ctrl = self.keyboard_modifiers.state().control_key(); let meta = self.keyboard_modifiers.state().meta_key(); let alt = self.keyboard_modifiers.state().alt_key(); @@ -377,7 +376,6 @@ impl View { }; } - } } // Unmodified keypresses From 2466e709d74cae18a3c34228543f322be2ed8698 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 22:03:17 +0000 Subject: [PATCH 23/67] Initial touch-to-pan support --- packages/blitz-dom/src/document.rs | 35 ++++++++++++- packages/blitz-dom/src/events/driver.rs | 18 ++++--- packages/blitz-dom/src/events/mouse.rs | 65 +++++++++++++++++-------- packages/blitz-dom/src/node/node.rs | 7 +++ packages/blitz-shell/src/window.rs | 54 +++++++++++++------- packages/blitz-traits/src/events.rs | 8 ++- 6 files changed, 141 insertions(+), 46 deletions(-) diff --git a/packages/blitz-dom/src/document.rs b/packages/blitz-dom/src/document.rs index 2ada36754..4c0abc5f1 100644 --- a/packages/blitz-dom/src/document.rs +++ b/packages/blitz-dom/src/document.rs @@ -174,6 +174,23 @@ pub enum DocumentEvent { ResourceLoad(ResourceLoadResponse), } +#[derive(Debug, Clone, PartialEq)] +pub(crate) struct PanState { + pub(crate) target: usize, + pub(crate) last_x: f32, + pub(crate) last_y: f32, +} + +#[derive(Debug, Clone, PartialEq)] +pub(crate) enum DragMode { + /// We are not currently dragging + None, + /// We are currently dragging a selection (probably mouse) + Selecting, + /// We are currently panning the document with a drag (probably touch) + Panning(PanState), +} + pub struct BaseDocument { /// ID of the document id: usize, @@ -234,7 +251,7 @@ pub struct BaseDocument { /// How many clicks have been made in quick succession pub(crate) click_count: u16, /// Whether we're currently in a text selection drag (moved 2px+ from mousedown) - pub(crate) is_selecting: bool, + pub(crate) drag_mode: DragMode, /// Text selection state (for non-input text) pub(crate) text_selection: TextSelection, @@ -401,7 +418,7 @@ impl BaseDocument { last_mousedown_time: None, mousedown_position: taffy::Point::ZERO, click_count: 0, - is_selecting: false, + drag_mode: DragMode::None, text_selection: TextSelection::default(), }; @@ -1372,6 +1389,20 @@ impl BaseDocument { self.viewport_scroll != initial } + pub fn scroll_by( + &mut self, + anchor_node_id: Option, + scroll_x: f64, + scroll_y: f64, + dispatch_event: &mut dyn FnMut(DomEvent), + ) -> bool { + if let Some(anchor_node_id) = anchor_node_id { + self.scroll_node_by_has_changed(anchor_node_id, scroll_x, scroll_y, dispatch_event) + } else { + self.scroll_viewport_by_has_changed(scroll_x, scroll_y) + } + } + pub fn viewport_scroll(&self) -> crate::Point { self.viewport_scroll } diff --git a/packages/blitz-dom/src/events/driver.rs b/packages/blitz-dom/src/events/driver.rs index a61bcaac5..e07b52b8b 100644 --- a/packages/blitz-dom/src/events/driver.rs +++ b/packages/blitz-dom/src/events/driver.rs @@ -143,18 +143,24 @@ impl<'doc, Handler: EventHandler> EventDriver<'doc, Handler> { let data = match event { UiEvent::MouseMove(data) => DomEventData::MouseMove(BlitzPointerEvent { - x: data.x + viewport_scroll.x as f32 / zoom, - y: data.y + viewport_scroll.y as f32 / zoom, + x: data.x / zoom, + y: data.y / zoom, + client_x: data.client_x / zoom, + client_y: data.client_y / zoom, ..data }), UiEvent::MouseUp(data) => DomEventData::MouseUp(BlitzPointerEvent { - x: data.x + viewport_scroll.x as f32 / zoom, - y: data.y + viewport_scroll.y as f32 / zoom, + x: data.x / zoom, + y: data.y / zoom, + client_x: data.client_x / zoom, + client_y: data.client_y / zoom, ..data }), UiEvent::MouseDown(data) => DomEventData::MouseDown(BlitzPointerEvent { - x: data.x + viewport_scroll.x as f32 / zoom, - y: data.y + viewport_scroll.y as f32 / zoom, + x: data.x / zoom, + y: data.y / zoom, + client_x: data.client_x / zoom, + client_y: data.client_y / zoom, ..data }), UiEvent::Wheel(data) => DomEventData::Wheel(data), diff --git a/packages/blitz-dom/src/events/mouse.rs b/packages/blitz-dom/src/events/mouse.rs index 463b2b84e..357f827a2 100644 --- a/packages/blitz-dom/src/events/mouse.rs +++ b/packages/blitz-dom/src/events/mouse.rs @@ -2,15 +2,19 @@ use std::time::{Duration, Instant}; use blitz_traits::{ events::{ - BlitzInputEvent, BlitzPointerEvent, BlitzWheelDelta, BlitzWheelEvent, DomEvent, - DomEventData, MouseEventButton, MouseEventButtons, + BlitzInputEvent, BlitzPointerEvent, BlitzPointerId, BlitzWheelDelta, BlitzWheelEvent, + DomEvent, DomEventData, MouseEventButton, MouseEventButtons, }, navigation::NavigationOptions, }; use keyboard_types::Modifiers; use markup5ever::local_name; -use crate::{BaseDocument, node::SpecialElementData}; +use crate::{ + BaseDocument, + document::{DragMode, PanState}, + node::SpecialElementData, +}; use super::focus::generate_focus_events; @@ -26,14 +30,36 @@ pub(crate) fn handle_mousemove( let mut changed = doc.set_hover_to(x, y); // Check if we've moved enough to be considered a selection drag (2px threshold) - if buttons != MouseEventButtons::None && !doc.is_selecting { - let dx = (x - doc.mousedown_position.x).abs(); - let dy = (y - doc.mousedown_position.y).abs(); - if dx > 2.0 || dy > 2.0 { - doc.is_selecting = true; + if buttons != MouseEventButtons::None && doc.drag_mode == DragMode::None { + let dx = x - doc.mousedown_position.x; + let dy = y - doc.mousedown_position.y; + if dx.abs() > 2.0 || dy.abs() > 2.0 { + match event.id { + BlitzPointerId::Mouse => { + doc.drag_mode = DragMode::Selecting; + } + BlitzPointerId::Finger(_) => { + doc.drag_mode = DragMode::Panning(PanState { + target, + last_x: event.screen_x, + last_y: event.screen_y, + }); + } + } } } + if let DragMode::Panning(state) = &mut doc.drag_mode { + let dx = (event.screen_x - state.last_x) as f64; + let dy = (event.screen_y - state.last_y) as f64; + let target = state.target; + state.last_x = event.screen_x; + state.last_y = event.screen_y; + + let has_changed = doc.scroll_by(Some(target), dx, dy, &mut dispatch_event); + return has_changed; + } + let Some(hit) = doc.hit(x, y) else { return changed; }; @@ -123,7 +149,7 @@ pub(crate) fn handle_mousedown( // Update mousedown tracking for next click and selection drag detection doc.last_mousedown_time = Some(Instant::now()); doc.mousedown_position = taffy::Point { x, y }; - doc.is_selecting = false; + doc.drag_mode = DragMode::None; let Some(hit) = doc.hit(x, y) else { // Clear text selection when clicking outside any element @@ -243,11 +269,12 @@ pub(crate) fn handle_mouseup( return; } - // Don't dispatch click if we were doing a text selection drag - let do_click = !doc.is_selecting; + // Don't dispatch click if we were doing a text selection drag or panning + // the document with a touch + let do_click = doc.drag_mode == DragMode::None; // Reset selection state - doc.is_selecting = false; + doc.drag_mode = DragMode::None; // Dispatch a click event if do_click && event.button == MouseEventButton::Main { @@ -431,19 +458,19 @@ pub(crate) fn handle_wheel( doc: &mut BaseDocument, _: usize, event: BlitzWheelEvent, - dispatch_event: F, + mut dispatch_event: F, ) { let (scroll_x, scroll_y) = match event.delta { BlitzWheelDelta::Lines(x, y) => (x * 20.0, y * 20.0), BlitzWheelDelta::Pixels(x, y) => (x, y), }; - let has_changed = if let Some(hover_node_id) = doc.get_hover_node_id() { - doc.scroll_node_by_has_changed(hover_node_id, scroll_x, scroll_y, dispatch_event) - } else { - doc.scroll_viewport_by_has_changed(scroll_x, scroll_y) - }; - + let has_changed = doc.scroll_by( + doc.get_hover_node_id(), + scroll_x, + scroll_y, + &mut dispatch_event, + ); if has_changed { doc.shell_provider.request_redraw(); } diff --git a/packages/blitz-dom/src/node/node.rs b/packages/blitz-dom/src/node/node.rs index 588f8e294..6c4c145fc 100644 --- a/packages/blitz-dom/src/node/node.rs +++ b/packages/blitz-dom/src/node/node.rs @@ -1057,6 +1057,13 @@ impl Node { is_primary: true, x, y, + + // TODO: should these be different? + screen_x: x, + screen_y: y, + client_x: x, + client_y: y, + mods, button: Default::default(), buttons: Default::default(), diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 548ffe9d3..e54b581cf 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -12,7 +12,7 @@ use blitz_traits::events::{ MouseEventButtons, UiEvent, }; use blitz_traits::shell::Viewport; -use winit::dpi::PhysicalInsets; +use winit::dpi::{LogicalPosition, PhysicalInsets}; use winit::keyboard::PhysicalKey; use std::any::Any; @@ -390,24 +390,33 @@ impl View { } WindowEvent::PointerEntered { /*device_id*/.. } => {} WindowEvent::PointerLeft { /*device_id*/.. } => {} - WindowEvent::PointerMoved { mut position, source, primary, .. } => { + WindowEvent::PointerMoved { position, source, primary, .. } => { let id = pointer_source_to_blitz(&source); - position.x -= self.safe_area_insets.left as f64; - position.y -= self.safe_area_insets.top as f64; - let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); - + + let scale = self.window.scale_factor(); + let LogicalPosition:: { x: screen_x, y: screen_y } = position.to_logical(scale); + let viewport_scroll_offset = self.doc.inner().viewport_scroll(); + let client_x = screen_x - (self.safe_area_insets.left as f64 / scale) as f32; + let client_y = screen_y - (self.safe_area_insets.top as f64 / scale) as f32; + let page_x = client_x + viewport_scroll_offset.x as f32; + let page_y = client_y + viewport_scroll_offset.y as f32; + let event = UiEvent::MouseMove(BlitzPointerEvent { id, is_primary: primary, - x, - y, + x: page_x, + y: page_y, + screen_x, + screen_y, + client_x, + client_y, button: Default::default(), buttons: self.buttons, mods: winit_modifiers_to_kbt_modifiers(self.keyboard_modifiers.state()), }); self.doc.handle_ui_event(event); } - WindowEvent::PointerButton { button, state, primary, mut position, .. } => { + WindowEvent::PointerButton { button, state, primary, position, .. } => { let id = button_source_to_blitz(&button); let button = match &button { ButtonSource::Mouse(mouse_button) => match mouse_button { @@ -426,16 +435,24 @@ impl View { ElementState::Released => self.buttons ^= button.into(), } - position.x -= self.safe_area_insets.left as f64; - position.y -= self.safe_area_insets.top as f64; - let winit::dpi::LogicalPosition:: { x, y } = position.to_logical(self.window.scale_factor()); + let scale = self.window.scale_factor(); + let LogicalPosition:: { x: screen_x, y: screen_y } = position.to_logical(scale); + let viewport_scroll_offset = self.doc.inner().viewport_scroll(); + let client_x = screen_x - (self.safe_area_insets.left as f64 / scale) as f32; + let client_y = screen_y - (self.safe_area_insets.top as f64 / scale) as f32; + let page_x = client_x + viewport_scroll_offset.x as f32; + let page_y = client_y + viewport_scroll_offset.y as f32; if id != BlitzPointerId::Mouse { let event = UiEvent::MouseMove(BlitzPointerEvent { id, is_primary: primary, - x, - y, + x: page_x, + y: page_y, + screen_x, + screen_y, + client_x, + client_y, button: Default::default(), buttons: self.buttons, mods: winit_modifiers_to_kbt_modifiers(self.keyboard_modifiers.state()), @@ -443,12 +460,15 @@ impl View { self.doc.handle_ui_event(event); } - let event = BlitzPointerEvent { id, is_primary: primary, - x, - y, + x: page_x, + y: page_y, + screen_x, + screen_y, + client_x, + client_y, button, buttons: self.buttons, mods: winit_modifiers_to_kbt_modifiers(self.keyboard_modifiers.state()), diff --git a/packages/blitz-traits/src/events.rs b/packages/blitz-traits/src/events.rs index e154b682c..aa4a3c8c6 100644 --- a/packages/blitz-traits/src/events.rs +++ b/packages/blitz-traits/src/events.rs @@ -317,8 +317,12 @@ pub enum BlitzPointerId { pub struct BlitzPointerEvent { pub id: BlitzPointerId, pub is_primary: bool, - pub x: f32, - pub y: f32, + pub x: f32, // page_x TODO: rename + pub y: f32, // page_y TODO: rename + pub screen_x: f32, + pub screen_y: f32, + pub client_x: f32, + pub client_y: f32, pub button: MouseEventButton, pub buttons: MouseEventButtons, pub mods: Modifiers, From 97cbf3a5155c804286bb1050b2992ac9f1845ddf Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 28 Dec 2025 22:31:23 +0000 Subject: [PATCH 24/67] Fixup: safe area texture size --- packages/blitz-shell/src/window.rs | 6 +++++- 1 file changed, 5 insertions(+), 1 deletion(-) diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index e54b581cf..7cf37837d 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -277,7 +277,11 @@ impl View { drop(viewport); drop(inner); if width > 0 && height > 0 { - self.renderer.set_size(width, height); + let insets = self.safe_area_insets; + self.renderer.set_size( + width + insets.left + insets.right, + height + insets.top + insets.bottom, + ); self.request_redraw(); } } From 14c7aad863eb5149d8fc6c728fdd6c6cfb800b75 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 00:07:16 +0000 Subject: [PATCH 25/67] Browser: Hardcode top padding on android due to lack of "safe area" support --- apps/browser/src/main.rs | 9 +++++++++ 1 file changed, 9 insertions(+) diff --git a/apps/browser/src/main.rs b/apps/browser/src/main.rs index 4e4b390a9..3c7cc506a 100644 --- a/apps/browser/src/main.rs +++ b/apps/browser/src/main.rs @@ -89,8 +89,17 @@ fn app() -> Element { } }); + // HACK: Winit doesn't support "safe area" on Android yet. + // So we just hardcode a fallback safe area. + const TOP_PAD: &str = if cfg!(target_os = "android") { + "50px" + } else { + "" + }; + rsx!( div { id: "frame", + padding_top: TOP_PAD, title { "Blitz Browser" } document::Link { rel: "stylesheet", href: BROWSER_UI_STYLES } From 977339d48b95927220a60593518d669f076bc82c Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 15:17:52 +0000 Subject: [PATCH 26/67] Momentum scrolling WIP --- packages/blitz-dom/src/document.rs | 38 +++++++++- packages/blitz-dom/src/events/mod.rs | 10 +-- packages/blitz-dom/src/events/mouse.rs | 99 +++++++++++++++++++++++--- packages/blitz-dom/src/resolve.rs | 28 ++++++++ 4 files changed, 156 insertions(+), 19 deletions(-) diff --git a/packages/blitz-dom/src/document.rs b/packages/blitz-dom/src/document.rs index 4c0abc5f1..56c479d93 100644 --- a/packages/blitz-dom/src/document.rs +++ b/packages/blitz-dom/src/document.rs @@ -29,7 +29,7 @@ use selectors::{Element, matching::QuirksMode}; use slab::Slab; use std::any::Any; use std::cell::RefCell; -use std::collections::{BTreeMap, Bound, HashMap, HashSet}; +use std::collections::{BTreeMap, Bound, HashMap, HashSet, VecDeque}; use std::ops::{Deref, DerefMut}; use std::rc::Rc; use std::str::FromStr; @@ -174,11 +174,33 @@ pub enum DocumentEvent { ResourceLoad(ResourceLoadResponse), } +#[derive(Debug, Clone, PartialEq)] +pub(crate) struct FlingState { + pub(crate) target: usize, + pub(crate) last_seen_time: f64, + pub(crate) x_velocity: f64, + pub(crate) y_velocity: f64, +} + +#[derive(Debug, Clone, PartialEq)] +pub(crate) enum ScrollAnimationState { + None, + Fling(FlingState), +} + #[derive(Debug, Clone, PartialEq)] pub(crate) struct PanState { pub(crate) target: usize, pub(crate) last_x: f32, pub(crate) last_y: f32, + pub(crate) samples: VecDeque, +} + +#[derive(Debug, Clone, PartialEq)] +pub(crate) struct PanSample { + pub(crate) time: u64, + pub(crate) dx: f32, + pub(crate) dy: f32, } #[derive(Debug, Clone, PartialEq)] @@ -191,6 +213,12 @@ pub(crate) enum DragMode { Panning(PanState), } +impl DragMode { + pub(crate) fn take(&mut self) -> DragMode { + std::mem::replace(self, DragMode::None) + } +} + pub struct BaseDocument { /// ID of the document id: usize, @@ -252,6 +280,8 @@ pub struct BaseDocument { pub(crate) click_count: u16, /// Whether we're currently in a text selection drag (moved 2px+ from mousedown) pub(crate) drag_mode: DragMode, + /// Whether and what kind of scroll animation is currently in progress + pub(crate) scroll_animation: ScrollAnimationState, /// Text selection state (for non-input text) pub(crate) text_selection: TextSelection, @@ -419,6 +449,7 @@ impl BaseDocument { mousedown_position: taffy::Point::ZERO, click_count: 0, drag_mode: DragMode::None, + scroll_animation: ScrollAnimationState::None, text_selection: TextSelection::default(), }; @@ -1188,7 +1219,10 @@ impl BaseDocument { } pub fn is_animating(&self) -> bool { - self.has_canvas | self.has_active_animations | self.subdoc_is_animating + self.has_canvas + | self.has_active_animations + | self.subdoc_is_animating + | (self.scroll_animation != ScrollAnimationState::None) } /// Update the device and reset the stylist to process the new size diff --git a/packages/blitz-dom/src/events/mod.rs b/packages/blitz-dom/src/events/mod.rs index 45e4960a8..b6fbdea46 100644 --- a/packages/blitz-dom/src/events/mod.rs +++ b/packages/blitz-dom/src/events/mod.rs @@ -85,15 +85,7 @@ pub(crate) fn handle_dom_event( match &event.data { DomEventData::MouseMove(mouse_event) => { - let changed = handle_mousemove( - doc, - target_node_id, - mouse_event.x, - mouse_event.y, - mouse_event.buttons, - mouse_event, - dispatch_event, - ); + let changed = handle_mousemove(doc, target_node_id, mouse_event, dispatch_event); if changed { doc.shell_provider.request_redraw(); } diff --git a/packages/blitz-dom/src/events/mouse.rs b/packages/blitz-dom/src/events/mouse.rs index 357f827a2..1492ebecf 100644 --- a/packages/blitz-dom/src/events/mouse.rs +++ b/packages/blitz-dom/src/events/mouse.rs @@ -1,4 +1,7 @@ -use std::time::{Duration, Instant}; +use std::{ + collections::VecDeque, + time::{Duration, Instant, SystemTime, UNIX_EPOCH}, +}; use blitz_traits::{ events::{ @@ -12,7 +15,7 @@ use markup5ever::local_name; use crate::{ BaseDocument, - document::{DragMode, PanState}, + document::{DragMode, FlingState, PanSample, PanState, ScrollAnimationState}, node::SpecialElementData, }; @@ -21,12 +24,13 @@ use super::focus::generate_focus_events; pub(crate) fn handle_mousemove( doc: &mut BaseDocument, target: usize, - x: f32, - y: f32, - buttons: MouseEventButtons, event: &BlitzPointerEvent, mut dispatch_event: F, ) -> bool { + let x = event.x; + let y = event.y; + let buttons = event.buttons; + let mut changed = doc.set_hover_to(x, y); // Check if we've moved enough to be considered a selection drag (2px threshold) @@ -43,6 +47,7 @@ pub(crate) fn handle_mousemove( target, last_x: event.screen_x, last_y: event.screen_y, + samples: VecDeque::with_capacity(200), }); } } @@ -52,10 +57,33 @@ pub(crate) fn handle_mousemove( if let DragMode::Panning(state) = &mut doc.drag_mode { let dx = (event.screen_x - state.last_x) as f64; let dy = (event.screen_y - state.last_y) as f64; + let time_ms = SystemTime::now() + .duration_since(UNIX_EPOCH) + .unwrap() + .as_millis() as u64; + let target = state.target; state.last_x = event.screen_x; state.last_y = event.screen_y; + state.samples.push_back(PanSample { + time: time_ms, + // TODO: account for scroll delta not applied due to clamping + dx: dx as f32, + dy: dy as f32, + }); + + // Remove samples older than 100ms + if state.samples.len() > 50 && time_ms - state.samples.front().unwrap().time > 100 { + let idx = state + .samples + .partition_point(|sample| time_ms - sample.time > 100); + // FIXME: use truncate_front once stable + for _ in 0..idx { + state.samples.pop_front(); + } + } + let has_changed = doc.scroll_by(Some(target), dx, dy, &mut dispatch_event); return has_changed; } @@ -150,6 +178,7 @@ pub(crate) fn handle_mousedown( doc.last_mousedown_time = Some(Instant::now()); doc.mousedown_position = taffy::Point { x, y }; doc.drag_mode = DragMode::None; + doc.scroll_animation = ScrollAnimationState::None; let Some(hit) = doc.hit(x, y) else { // Clear text selection when clicking outside any element @@ -269,12 +298,66 @@ pub(crate) fn handle_mouseup( return; } + // Reset Document's drag state to DragMode::None, storing the state + // locally for use within this function + let drag_mode = doc.drag_mode.take(); + // Don't dispatch click if we were doing a text selection drag or panning // the document with a touch - let do_click = doc.drag_mode == DragMode::None; + let do_click = drag_mode == DragMode::None; + + let time_ms = SystemTime::now() + .duration_since(UNIX_EPOCH) + .unwrap() + .as_millis() as u64; + + if let DragMode::Panning(state) = &drag_mode { + // Generate "fling" + if let Some(last_sample) = state.samples.back() + && time_ms - last_sample.time < 100 + { + let idx = state + .samples + .partition_point(|sample| time_ms - sample.time > 100); + + // Compute pan_time. Will always be <= 100ms as we ignore samples older than that. + let pan_start_time = state.samples[idx].time; + let pan_time = (time_ms - pan_start_time) as f32; + + // Avoid division by 0 + if pan_time > 0.0 { + let (pan_x, pan_y) = state + .samples + .iter() + .skip(idx) + .fold((0.0, 0.0), |(dx, dy), sample| { + (dx + sample.dx, dy + sample.dy) + }); - // Reset selection state - doc.drag_mode = DragMode::None; + let x_velocity = if pan_x.abs() > pan_y.abs() { + pan_x / pan_time + } else { + 0.0 + }; + + let y_velocity = if pan_y.abs() > pan_x.abs() { + pan_y / pan_time + } else { + 0.0 + }; + + let fling = FlingState { + target: state.target, + last_seen_time: time_ms as f64, + x_velocity: x_velocity as f64 * 16.6666, + y_velocity: y_velocity as f64 * 16.6666, + }; + + doc.scroll_animation = ScrollAnimationState::Fling(fling); + doc.shell_provider.request_redraw(); + } + } + } // Dispatch a click event if do_click && event.button == MouseEventButton::Main { diff --git a/packages/blitz-dom/src/resolve.rs b/packages/blitz-dom/src/resolve.rs index 37fa16972..69e887cd0 100644 --- a/packages/blitz-dom/src/resolve.rs +++ b/packages/blitz-dom/src/resolve.rs @@ -22,6 +22,7 @@ use taffy::AvailableSpace; use crate::{ BaseDocument, NON_INCREMENTAL, + document::ScrollAnimationState, layout::{ construct::{ ConstructionTask, ConstructionTaskData, ConstructionTaskResult, @@ -46,6 +47,8 @@ impl BaseDocument { // Process messages that have been sent to our message channel (e.g. loaded resource) self.handle_messages(); + self.resolve_scroll_animation(current_time_for_animations); + let root_node_id = self.root_element().id; debug_timer!(timer, feature = "log_phase_times"); @@ -110,6 +113,31 @@ impl BaseDocument { timer.print_times(&format!("Resolve({}): ", self.id())); } + pub fn resolve_scroll_animation(&mut self, animation_time: f64) { + match &mut self.scroll_animation { + ScrollAnimationState::Fling(fling_state) => { + // let time_diff_ms = animation_time - fling_state.last_seen_time; + + // TODO: consider time + fling_state.x_velocity *= 0.95; + fling_state.y_velocity *= 0.95; + fling_state.last_seen_time = animation_time; + let fling_state = fling_state.clone(); + + let dx = fling_state.x_velocity; // * time_diff_ms; + let dy = fling_state.y_velocity; // * time_diff_ms; + + self.scroll_by(Some(fling_state.target), dx, dy, &mut |_| {}); + if fling_state.x_velocity.abs() < 1.0 && fling_state.y_velocity.abs() < 1.0 { + self.scroll_animation = ScrollAnimationState::None; + } + } + ScrollAnimationState::None => { + // Do nothing + } + } + } + /// Ensure that the layout_children field is populated for all nodes pub fn resolve_layout_children(&mut self) { resolve_layout_children_recursive(self, self.root_node().id); From 61722ee7306b474b5b11fd8d777174dd1e5019e1 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 15:20:58 +0000 Subject: [PATCH 27/67] Homepage=wikipedia Signed-off-by: Nico Burns --- apps/browser/src/main.rs | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/apps/browser/src/main.rs b/apps/browser/src/main.rs index 3c7cc506a..758a54a0d 100644 --- a/apps/browser/src/main.rs +++ b/apps/browser/src/main.rs @@ -45,7 +45,7 @@ fn use_sync_store(value: impl FnOnce() -> T) -> SyncSt } fn app() -> Element { - let home_url = use_hook(|| Url::parse("https://html.duckduckgo.com").unwrap()); + let home_url = use_hook(|| Url::parse("https://en.wikipedia.org/wiki/Main_Page").unwrap()); let mut url_input_handle = use_signal(|| None); let mut webview_node_handle: Signal> = use_signal(|| None); From 8c6e3c366be83a426846681549256ab597a32517 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 15:30:33 +0000 Subject: [PATCH 28/67] Fixup momentum scrolling --- packages/blitz-dom/src/events/mouse.rs | 4 ++-- packages/blitz-dom/src/resolve.rs | 32 +++++++++++++++++--------- 2 files changed, 23 insertions(+), 13 deletions(-) diff --git a/packages/blitz-dom/src/events/mouse.rs b/packages/blitz-dom/src/events/mouse.rs index 1492ebecf..4a1396f56 100644 --- a/packages/blitz-dom/src/events/mouse.rs +++ b/packages/blitz-dom/src/events/mouse.rs @@ -349,8 +349,8 @@ pub(crate) fn handle_mouseup( let fling = FlingState { target: state.target, last_seen_time: time_ms as f64, - x_velocity: x_velocity as f64 * 16.6666, - y_velocity: y_velocity as f64 * 16.6666, + x_velocity: x_velocity as f64, // * 16.6666, + y_velocity: y_velocity as f64, // * 16.6666, }; doc.scroll_animation = ScrollAnimationState::Fling(fling); diff --git a/packages/blitz-dom/src/resolve.rs b/packages/blitz-dom/src/resolve.rs index 69e887cd0..ff001ff7e 100644 --- a/packages/blitz-dom/src/resolve.rs +++ b/packages/blitz-dom/src/resolve.rs @@ -1,6 +1,9 @@ //! Resolve style and layout -use std::cell::RefCell; +use std::{ + cell::RefCell, + time::{SystemTime, UNIX_EPOCH}, +}; use debug_timer::debug_timer; use parley::LayoutContext; @@ -47,7 +50,7 @@ impl BaseDocument { // Process messages that have been sent to our message channel (e.g. loaded resource) self.handle_messages(); - self.resolve_scroll_animation(current_time_for_animations); + self.resolve_scroll_animation(); let root_node_id = self.root_element().id; debug_timer!(timer, feature = "log_phase_times"); @@ -113,22 +116,29 @@ impl BaseDocument { timer.print_times(&format!("Resolve({}): ", self.id())); } - pub fn resolve_scroll_animation(&mut self, animation_time: f64) { + pub fn resolve_scroll_animation(&mut self) { match &mut self.scroll_animation { ScrollAnimationState::Fling(fling_state) => { - // let time_diff_ms = animation_time - fling_state.last_seen_time; + let time_ms = SystemTime::now() + .duration_since(UNIX_EPOCH) + .unwrap() + .as_millis() as u64 as f64; + + let time_diff_ms = time_ms - fling_state.last_seen_time; + + // 0.95 @ 60fps normalized to actual frame times + let deceleration = 1.0 - ((0.05 / 16.66666) * time_diff_ms); - // TODO: consider time - fling_state.x_velocity *= 0.95; - fling_state.y_velocity *= 0.95; - fling_state.last_seen_time = animation_time; + fling_state.x_velocity *= deceleration; + fling_state.y_velocity *= deceleration; + fling_state.last_seen_time = time_ms; let fling_state = fling_state.clone(); - let dx = fling_state.x_velocity; // * time_diff_ms; - let dy = fling_state.y_velocity; // * time_diff_ms; + let dx = fling_state.x_velocity * time_diff_ms; + let dy = fling_state.y_velocity * time_diff_ms; self.scroll_by(Some(fling_state.target), dx, dy, &mut |_| {}); - if fling_state.x_velocity.abs() < 1.0 && fling_state.y_velocity.abs() < 1.0 { + if fling_state.x_velocity.abs() < 0.1 && fling_state.y_velocity.abs() < 0.1 { self.scroll_animation = ScrollAnimationState::None; } } From e322348e009c4cdc5258afec26e133842eef8bd1 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 15:41:34 +0000 Subject: [PATCH 29/67] Fix request_redraw on iOS --- packages/blitz-shell/src/application.rs | 9 +++++++++ packages/blitz-shell/src/window.rs | 14 ++++++++++++++ packages/dioxus-native/src/dioxus_application.rs | 4 ++++ 3 files changed, 27 insertions(+) diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index 5a0fbc189..87962fb76 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -152,6 +152,15 @@ impl ApplicationHandler for BlitzApplication { fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { Some(self) } + + #[cfg(target_os = "ios")] + fn about_to_wait(&mut self, event_loop: &dyn ActiveEventLoop) { + for view in self.windows.values_mut() { + if view.ios_request_redraw.get() { + view.window.request_redraw(); + } + } + } } #[cfg(target_os = "macos")] diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 7cf37837d..874139c0b 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -73,6 +73,13 @@ pub struct View { #[cfg(feature = "accessibility")] /// Accessibility adapter for `accesskit`. pub accessibility: AccessibilityState, + + // Calling request_redraw within a WindowEvent doesn't work on iOS. So on iOS we track the state + // with a boolean and call request_redraw in about_to_wait + // + // See https://github.com/rust-windowing/winit/issues/3406 + #[cfg(target_os = "ios")] + pub ios_request_redraw: std::cell::Cell, } impl View { @@ -126,6 +133,9 @@ impl View { is_visible: winit_window.is_visible().unwrap_or(true), #[cfg(feature = "accessibility")] accessibility: AccessibilityState::new(&*winit_window, proxy.clone()), + + #[cfg(target_os = "ios")] + ios_request_redraw: std::cell::Cell::new(false), } } @@ -239,10 +249,14 @@ impl View { pub fn request_redraw(&self) { if self.renderer.is_active() { self.window.request_redraw(); + #[cfg(target_os = "ios")] + self.ios_request_redraw.set(true); } } pub fn redraw(&mut self) { + #[cfg(target_os = "ios")] + self.ios_request_redraw.set(false); let animation_time = self.current_animation_time(); let is_visible = self.is_visible; diff --git a/packages/dioxus-native/src/dioxus_application.rs b/packages/dioxus-native/src/dioxus_application.rs index cb4617802..ee4ac7c8b 100644 --- a/packages/dioxus-native/src/dioxus_application.rs +++ b/packages/dioxus-native/src/dioxus_application.rs @@ -126,6 +126,10 @@ impl ApplicationHandler for DioxusNativeApplication { self.inner.destroy_surfaces(event_loop); } + fn about_to_wait(&mut self, event_loop: &dyn ActiveEventLoop) { + self.inner.about_to_wait(event_loop); + } + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { #[cfg(feature = "tracing")] tracing::debug!("Injecting document provider into all windows"); From 371a1394e504c1fe4c00eefba542ae39bc951d42 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 16:57:39 +0000 Subject: [PATCH 30/67] Fix mouse coordinates for sub documents --- packages/blitz-dom/src/events/driver.rs | 32 +++++-------------------- packages/blitz-dom/src/events/mod.rs | 19 ++++++++++----- 2 files changed, 19 insertions(+), 32 deletions(-) diff --git a/packages/blitz-dom/src/events/driver.rs b/packages/blitz-dom/src/events/driver.rs index e07b52b8b..859914c2b 100644 --- a/packages/blitz-dom/src/events/driver.rs +++ b/packages/blitz-dom/src/events/driver.rs @@ -1,5 +1,5 @@ use crate::Document; -use blitz_traits::events::{BlitzPointerEvent, DomEvent, DomEventData, EventState, UiEvent}; +use blitz_traits::events::{DomEvent, DomEventData, EventState, UiEvent}; use std::collections::VecDeque; pub trait EventHandler { @@ -37,8 +37,6 @@ impl<'doc, Handler: EventHandler> EventDriver<'doc, Handler> { pub fn handle_ui_event(&mut self, event: UiEvent) { let doc = self.doc.inner(); - let viewport_scroll = doc.viewport_scroll(); - let zoom = doc.viewport.zoom(); let mut hover_node_id = doc.hover_node_id; let focussed_node_id = doc.focus_node_id; @@ -48,8 +46,8 @@ impl<'doc, Handler: EventHandler> EventDriver<'doc, Handler> { match &event { UiEvent::MouseMove(event) => { let mut doc = self.doc.inner_mut(); - let dom_x = event.x + viewport_scroll.x as f32 / zoom; - let dom_y = event.y + viewport_scroll.y as f32 / zoom; + let dom_x = event.x; + let dom_y = event.y; let changed = doc.set_hover_to(dom_x, dom_y); let prev_hover_node_id = hover_node_id; @@ -142,27 +140,9 @@ impl<'doc, Handler: EventHandler> EventDriver<'doc, Handler> { }; let data = match event { - UiEvent::MouseMove(data) => DomEventData::MouseMove(BlitzPointerEvent { - x: data.x / zoom, - y: data.y / zoom, - client_x: data.client_x / zoom, - client_y: data.client_y / zoom, - ..data - }), - UiEvent::MouseUp(data) => DomEventData::MouseUp(BlitzPointerEvent { - x: data.x / zoom, - y: data.y / zoom, - client_x: data.client_x / zoom, - client_y: data.client_y / zoom, - ..data - }), - UiEvent::MouseDown(data) => DomEventData::MouseDown(BlitzPointerEvent { - x: data.x / zoom, - y: data.y / zoom, - client_x: data.client_x / zoom, - client_y: data.client_y / zoom, - ..data - }), + UiEvent::MouseMove(data) => DomEventData::MouseMove(data), + UiEvent::MouseUp(data) => DomEventData::MouseUp(data), + UiEvent::MouseDown(data) => DomEventData::MouseDown(data), UiEvent::Wheel(data) => DomEventData::Wheel(data), UiEvent::KeyUp(data) => DomEventData::KeyUp(data), UiEvent::KeyDown(data) => DomEventData::KeyDown(data), diff --git a/packages/blitz-dom/src/events/mod.rs b/packages/blitz-dom/src/events/mod.rs index b6fbdea46..f4d05a982 100644 --- a/packages/blitz-dom/src/events/mod.rs +++ b/packages/blitz-dom/src/events/mod.rs @@ -26,22 +26,29 @@ pub(crate) fn handle_dom_event( let pos = node.absolute_position(0.0, 0.0); let mut set_focus = false; if let Some(sub_doc) = node.subdoc_mut() { + let viewport_scroll = sub_doc.inner().viewport_scroll(); // TODO: eliminate clone let ui_event = match event.data.clone() { DomEventData::MouseMove(mut mouse_event) => { - mouse_event.x -= pos.x; - mouse_event.y -= pos.y; + mouse_event.x -= pos.x - viewport_scroll.x as f32; + mouse_event.y -= pos.y - viewport_scroll.y as f32; + mouse_event.client_x -= pos.x; + mouse_event.client_y -= pos.y; Some(UiEvent::MouseMove(mouse_event)) } DomEventData::MouseDown(mut mouse_event) => { - mouse_event.x -= pos.x; - mouse_event.y -= pos.y; + mouse_event.x -= pos.x - viewport_scroll.x as f32; + mouse_event.y -= pos.y - viewport_scroll.y as f32; + mouse_event.client_x -= pos.x; + mouse_event.client_y -= pos.y; set_focus = true; Some(UiEvent::MouseDown(mouse_event)) } DomEventData::MouseUp(mut mouse_event) => { - mouse_event.x -= pos.x; - mouse_event.y -= pos.y; + mouse_event.x -= pos.x - viewport_scroll.x as f32; + mouse_event.y -= pos.y - viewport_scroll.y as f32; + mouse_event.client_x -= pos.x; + mouse_event.client_y -= pos.y; set_focus = true; Some(UiEvent::MouseUp(mouse_event)) } From 2f6b7ed87e5735b230c4700ec030f54456bd2743 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 17:00:22 +0000 Subject: [PATCH 31/67] Implement client_coordinates, screen_coordinates, and page_coordinates for Dioxus Native click events. --- packages/dioxus-native-dom/src/events.rs | 7 +++---- 1 file changed, 3 insertions(+), 4 deletions(-) diff --git a/packages/dioxus-native-dom/src/events.rs b/packages/dioxus-native-dom/src/events.rs index 332f107b2..2a2a3bf73 100644 --- a/packages/dioxus-native-dom/src/events.rs +++ b/packages/dioxus-native-dom/src/events.rs @@ -301,16 +301,15 @@ pub struct NativeClickData(pub(crate) BlitzPointerEvent); impl InteractionLocation for NativeClickData { fn client_coordinates(&self) -> ClientPoint { - ClientPoint::new(self.0.x as _, self.0.y as _) + ClientPoint::new(self.0.client_x as f64, self.0.client_y as f64) } - // these require blitz to pass them along, or a dom rect fn screen_coordinates(&self) -> ScreenPoint { - unimplemented!() + ScreenPoint::new(self.0.screen_x as f64, self.0.screen_y as f64) } fn page_coordinates(&self) -> PagePoint { - unimplemented!() + PagePoint::new(self.0.x as f64, self.0.y as f64) } } From 584b81d2f3064019aefdd5304308ea70542a3870 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 21:05:41 +0000 Subject: [PATCH 32/67] Bump anyrender_skia to v0.3.1 (iOS support) --- Cargo.lock | 5 +++-- Cargo.toml | 3 ++- 2 files changed, 5 insertions(+), 3 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 6094572c5..d2d6c4d1f 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -178,9 +178,9 @@ dependencies = [ [[package]] name = "anyrender_skia" -version = "0.3.0" +version = "0.3.1" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0cd23fede1c9b592693a3d6213eb8a4c3eb3855c5ccf6cd32c2babbc68c70a31" +checksum = "a462fde618a4394fdb9618a5e4733357f9a1c5b99b17c98704234461449e61b3" dependencies = [ "anyrender", "ash 0.38.0+1.3.281", @@ -196,6 +196,7 @@ dependencies = [ "objc2-core-foundation", "objc2-metal", "objc2-quartz-core", + "objc2-ui-kit", "peniko", "pixels_window_renderer", "raw-window-handle", diff --git a/Cargo.toml b/Cargo.toml index 651345e26..741fca3f4 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -100,7 +100,7 @@ anyrender = { version = "0.6" } anyrender_vello = { version = "0.6" } anyrender_vello_cpu = { version = "0.8" } anyrender_vello_hybrid = { version = "0.1" } -anyrender_skia = { version = "0.3.0" } +anyrender_skia = { version = "0.3.1" } anyrender_svg = { version = "0.6" } wgpu_context = { version = "0.1.2" } @@ -245,6 +245,7 @@ tracing-subscriber = "0.3" # anyrender_skia = { path = "../anyrender/crates/anyrender_skia" } # anyrender_vello = { path = "../anyrender/crates/anyrender_vello" } # anyrender_vello_cpu = { path = "../anyrender/crates/anyrender_vello_cpu" } +# anyrender_vello_hybrid = { path = "../anyrender/crates/anyrender_vello_hybrid" } # anyrender_svg = { path = "../anyrender/crates/anyrender_svg" } # wgpu_context = { path = "../anyrender/crates/wgpu_context" } From 9e522b846e9fe7aa3ac1e147e9054cf5f31439c1 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 21:22:55 +0000 Subject: [PATCH 33/67] Fixup request_redraw unused variable --- packages/blitz-shell/src/application.rs | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index 87962fb76..9b03501c7 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -154,7 +154,7 @@ impl ApplicationHandler for BlitzApplication { } #[cfg(target_os = "ios")] - fn about_to_wait(&mut self, event_loop: &dyn ActiveEventLoop) { + fn about_to_wait(&mut self, _event_loop: &dyn ActiveEventLoop) { for view in self.windows.values_mut() { if view.ios_request_redraw.get() { view.window.request_redraw(); From 97b1f577285bad0c75b77fc9a88ab7f288bf490f Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 21:49:04 +0000 Subject: [PATCH 34/67] Add 2x factor to momentum scroll speed --- packages/blitz-dom/src/events/mouse.rs | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/packages/blitz-dom/src/events/mouse.rs b/packages/blitz-dom/src/events/mouse.rs index 4a1396f56..e3feba3a4 100644 --- a/packages/blitz-dom/src/events/mouse.rs +++ b/packages/blitz-dom/src/events/mouse.rs @@ -349,8 +349,8 @@ pub(crate) fn handle_mouseup( let fling = FlingState { target: state.target, last_seen_time: time_ms as f64, - x_velocity: x_velocity as f64, // * 16.6666, - y_velocity: y_velocity as f64, // * 16.6666, + x_velocity: x_velocity as f64 * 2.0, + y_velocity: y_velocity as f64 * 2.0, }; doc.scroll_animation = ScrollAnimationState::Fling(fling); From d76249dc34cb7a28289a8f4ef3ccab5f0899ab38 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 29 Dec 2025 21:49:21 +0000 Subject: [PATCH 35/67] Tweak hacky android "safe area" --- apps/browser/assets/browser.css | 1 + apps/browser/src/main.rs | 8 +++++++- 2 files changed, 8 insertions(+), 1 deletion(-) diff --git a/apps/browser/assets/browser.css b/apps/browser/assets/browser.css index 88c94b743..a3ad7dc09 100644 --- a/apps/browser/assets/browser.css +++ b/apps/browser/assets/browser.css @@ -12,6 +12,7 @@ html, body, #main, #frame { #frame { display: flex; flex-direction: column; + background: black; } .urlbar { diff --git a/apps/browser/src/main.rs b/apps/browser/src/main.rs index 758a54a0d..23c15a4e5 100644 --- a/apps/browser/src/main.rs +++ b/apps/browser/src/main.rs @@ -92,7 +92,12 @@ fn app() -> Element { // HACK: Winit doesn't support "safe area" on Android yet. // So we just hardcode a fallback safe area. const TOP_PAD: &str = if cfg!(target_os = "android") { - "50px" + "30px" + } else { + "" + }; + const BOTTOM_PAD: &str = if cfg!(target_os = "android") { + "44px" } else { "" }; @@ -100,6 +105,7 @@ fn app() -> Element { rsx!( div { id: "frame", padding_top: TOP_PAD, + padding_bottom: BOTTOM_PAD, title { "Blitz Browser" } document::Link { rel: "stylesheet", href: BROWSER_UI_STYLES } From e0eaa559628e70bf39f4ad3053f8aab9ed9a6912 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 14:47:44 +0000 Subject: [PATCH 36/67] Add accesskit_xplat crate Signed-off-by: Nico Burns --- Cargo.lock | 677 ++++++++++++-- Cargo.toml | 1 + packages/accesskit_xplat/CHANGELOG.md | 885 ++++++++++++++++++ packages/accesskit_xplat/Cargo.toml | 33 + packages/accesskit_xplat/src/lib.rs | 164 ++++ .../src/platform_impl/android.rs | 46 + .../src/platform_impl/macos.rs | 43 + .../accesskit_xplat/src/platform_impl/mod.rs | 50 + .../accesskit_xplat/src/platform_impl/null.rs | 24 + .../accesskit_xplat/src/platform_impl/unix.rs | 43 + .../src/platform_impl/windows.rs | 40 + 11 files changed, 1920 insertions(+), 86 deletions(-) create mode 100644 packages/accesskit_xplat/CHANGELOG.md create mode 100644 packages/accesskit_xplat/Cargo.toml create mode 100644 packages/accesskit_xplat/src/lib.rs create mode 100644 packages/accesskit_xplat/src/platform_impl/android.rs create mode 100644 packages/accesskit_xplat/src/platform_impl/macos.rs create mode 100644 packages/accesskit_xplat/src/platform_impl/mod.rs create mode 100644 packages/accesskit_xplat/src/platform_impl/null.rs create mode 100644 packages/accesskit_xplat/src/platform_impl/unix.rs create mode 100644 packages/accesskit_xplat/src/platform_impl/windows.rs diff --git a/Cargo.lock b/Cargo.lock index d2d6c4d1f..295d69f6f 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -24,6 +24,109 @@ version = "0.17.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d3d3b8f9bae46a948369bc4a03e815d4ed6d616bd00de4051133a5019dc31c5a" +[[package]] +name = "accesskit" +version = "0.22.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3eca13c82f9a5cd813120b2e9b6a5d10532c6e4cd140c295cebd1f770095c8a5" + +[[package]] +name = "accesskit_android" +version = "0.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d28b60a573c7165b1eb346d66c14e85a1f7923fe2e71e396ce936ca6afb519ae" +dependencies = [ + "accesskit 0.22.0", + "accesskit_consumer", + "jni", + "log", +] + +[[package]] +name = "accesskit_atspi_common" +version = "0.15.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3eb9cc46b7fb6987c4f891f0301b230b29d9e69b4854f060a0cf41fbc407ab77" +dependencies = [ + "accesskit 0.22.0", + "accesskit_consumer", + "atspi-common", + "serde", + "zvariant", +] + +[[package]] +name = "accesskit_consumer" +version = "0.32.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "69d880a613f29621c90e801feec40f5dd61d837d7e20bf9b67676d45e7364a36" +dependencies = [ + "accesskit 0.22.0", + "hashbrown 0.16.1", +] + +[[package]] +name = "accesskit_macos" +version = "0.23.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b0ddfc3fe3d457d11cc1c4989105986a03583a1d54d0c25053118944b62e100" +dependencies = [ + "accesskit 0.22.0", + "accesskit_consumer", + "hashbrown 0.16.1", + "objc2 0.5.2", + "objc2-app-kit 0.2.2", + "objc2-foundation 0.2.2", +] + +[[package]] +name = "accesskit_unix" +version = "0.18.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d5d552169ef018149966ed139bb0311c6947b3343e9140d1b9f88d69da9528fd" +dependencies = [ + "accesskit 0.22.0", + "accesskit_atspi_common", + "async-channel", + "async-executor", + "async-task", + "atspi", + "futures-lite", + "futures-util", + "serde", + "tokio", + "tokio-stream", + "zbus", +] + +[[package]] +name = "accesskit_windows" +version = "0.30.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "d277279d0a3b0c0021dd110b55aa1fe326b09ee2cbc338df28f847c7daf94e25" +dependencies = [ + "accesskit 0.22.0", + "accesskit_consumer", + "hashbrown 0.16.1", + "static_assertions", + "windows 0.61.3", + "windows-core 0.61.2", +] + +[[package]] +name = "accesskit_xplat" +version = "0.1.0" +dependencies = [ + "accesskit 0.22.0", + "accesskit_android", + "accesskit_macos", + "accesskit_unix", + "accesskit_windows", + "android-activity", + "raw-window-handle", + "winit-core", +] + [[package]] name = "adler2" version = "2.0.1" @@ -191,11 +294,11 @@ dependencies = [ "hashbrown 0.16.1", "kurbo 0.12.0", "oaty", - "objc2", - "objc2-app-kit", + "objc2 0.6.3", + "objc2-app-kit 0.3.2", "objc2-core-foundation", - "objc2-metal", - "objc2-quartz-core", + "objc2-metal 0.3.2", + "objc2-quartz-core 0.3.2", "objc2-ui-kit", "peniko", "pixels_window_renderer", @@ -286,9 +389,9 @@ checksum = "0348a1c054491f4bfe6ab86a7b6ab1e44e45d899005de92f58b3df180b36ddaf" dependencies = [ "clipboard-win", "log", - "objc2", - "objc2-app-kit", - "objc2-foundation", + "objc2 0.6.3", + "objc2-app-kit 0.3.2", + "objc2-foundation 0.3.2", "parking_lot", "percent-encoding", "windows-sys 0.60.2", @@ -375,6 +478,79 @@ dependencies = [ "pin-project-lite", ] +[[package]] +name = "async-channel" +version = "2.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "924ed96dd52d1b75e9c1a3e6275715fd320f5f9439fb5a4a11fa51f4221158d2" +dependencies = [ + "concurrent-queue", + "event-listener-strategy", + "futures-core", + "pin-project-lite", +] + +[[package]] +name = "async-executor" +version = "1.13.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "497c00e0fd83a72a79a39fcbd8e3e2f055d6f6c7e025f3b3d91f4f8e76527fb8" +dependencies = [ + "async-task", + "concurrent-queue", + "fastrand", + "futures-lite", + "pin-project-lite", + "slab", +] + +[[package]] +name = "async-io" +version = "2.6.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "456b8a8feb6f42d237746d4b3e9a178494627745c3c56c6ea55d92ba50d026fc" +dependencies = [ + "autocfg", + "cfg-if", + "concurrent-queue", + "futures-io", + "futures-lite", + "parking", + "polling", + "rustix 1.1.2", + "slab", + "windows-sys 0.61.2", +] + +[[package]] +name = "async-lock" +version = "3.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "290f7f2596bd5b78a9fec8088ccd89180d7f9f55b94b0576823bbbdc72ee8311" +dependencies = [ + "event-listener", + "event-listener-strategy", + "pin-project-lite", +] + +[[package]] +name = "async-process" +version = "2.5.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fc50921ec0055cdd8a16de48773bfeec5c972598674347252c0399676be7da75" +dependencies = [ + "async-channel", + "async-io", + "async-lock", + "async-signal", + "async-task", + "blocking", + "cfg-if", + "event-listener", + "futures-lite", + "rustix 1.1.2", +] + [[package]] name = "async-recursion" version = "1.1.1" @@ -386,6 +562,30 @@ dependencies = [ "syn 2.0.111", ] +[[package]] +name = "async-signal" +version = "0.2.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "43c070bbf59cd3570b6b2dd54cd772527c7c3620fce8be898406dd3ed6adc64c" +dependencies = [ + "async-io", + "async-lock", + "atomic-waker", + "cfg-if", + "futures-core", + "futures-io", + "rustix 1.1.2", + "signal-hook-registry", + "slab", + "windows-sys 0.61.2", +] + +[[package]] +name = "async-task" +version = "4.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8b75356056920673b02621b35afd0f7dda9306d03c79a30f5c56c44cf256e3de" + [[package]] name = "async-trait" version = "0.1.89" @@ -415,6 +615,43 @@ version = "0.1.13" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "41e67cd8309bbd06cd603a9e693a784ac2e5d1e955f11286e355089fcab3047c" +[[package]] +name = "atspi" +version = "0.29.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c77886257be21c9cd89a4ae7e64860c6f0eefca799bb79127913052bd0eefb3d" +dependencies = [ + "atspi-common", + "atspi-proxies", +] + +[[package]] +name = "atspi-common" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "20c5617155740c98003016429ad13fe43ce7a77b007479350a9f8bf95a29f63d" +dependencies = [ + "enumflags2", + "serde", + "static_assertions", + "zbus", + "zbus-lockstep", + "zbus-lockstep-macros", + "zbus_names", + "zvariant", +] + +[[package]] +name = "atspi-proxies" +version = "0.13.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2230e48787ed3eb4088996eab66a32ca20c0b67bbd4fd6cdfe79f04f1f04c9fc" +dependencies = [ + "atspi-common", + "serde", + "zbus", +] + [[package]] name = "autocfg" version = "1.5.0" @@ -548,7 +785,7 @@ dependencies = [ name = "blitz-dom" version = "0.2.2" dependencies = [ - "accesskit", + "accesskit 0.17.1", "app_units", "atomic_refcell", "bitflags 2.10.0", @@ -564,7 +801,7 @@ dependencies = [ "keyboard-types 0.7.0", "linebender_resource_handle", "markup5ever", - "objc2", + "objc2 0.6.3", "parley", "percent-encoding", "rayon", @@ -659,7 +896,7 @@ dependencies = [ name = "blitz-shell" version = "0.2.2" dependencies = [ - "accesskit", + "accesskit 0.17.1", "android-activity", "anyrender", "arboard", @@ -703,13 +940,35 @@ dependencies = [ "generic-array", ] +[[package]] +name = "block2" +version = "0.5.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2c132eebf10f5cad5289222520a4a058514204aed6d791f1cf4fe8088b82d15f" +dependencies = [ + "objc2 0.5.2", +] + [[package]] name = "block2" version = "0.6.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "cdeb9d870516001442e364c5220d3574d2da8dc765554b4a617230d33fa58ef5" dependencies = [ - "objc2", + "objc2 0.6.3", +] + +[[package]] +name = "blocking" +version = "1.6.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e83f8d02be6967315521be875afa792a316e28d57b5a2d401897e2a7921b7f21" +dependencies = [ + "async-channel", + "async-task", + "futures-io", + "futures-lite", + "piper", ] [[package]] @@ -1967,9 +2226,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "89a09f22a6c6069a18470eb92d2298acf25463f14256d24778e1230d789a2aec" dependencies = [ "bitflags 2.10.0", - "block2", + "block2 0.6.2", "libc", - "objc2", + "objc2 0.6.3", ] [[package]] @@ -2352,10 +2611,10 @@ dependencies = [ "icu_locale_core", "linebender_resource_handle", "memmap2 0.9.9", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", "objc2-core-text", - "objc2-foundation", + "objc2-foundation 0.3.2", "read-fonts", "roxmltree 0.21.1", "smallvec", @@ -2574,7 +2833,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "1bd49230192a3797a9a4d6abe9b3eed6f7fa4c8a8a4947977c6f80025f92cbd8" dependencies = [ "rustix 1.1.2", - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -2695,10 +2954,10 @@ dependencies = [ "glutin_glx_sys", "glutin_wgl_sys 0.6.1", "libloading 0.8.9", - "objc2", - "objc2-app-kit", + "objc2 0.6.3", + "objc2-app-kit 0.3.2", "objc2-core-foundation", - "objc2-foundation", + "objc2-foundation 0.3.2", "once_cell", "raw-window-handle", "wayland-sys", @@ -3594,7 +3853,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d7c4b02199fee7c5d21a5ae7d8cfa79a6ef5bb2fc834d6e9058e89c825efdc55" dependencies = [ "cfg-if", - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -4196,6 +4455,22 @@ dependencies = [ "objc_exception", ] +[[package]] +name = "objc-sys" +version = "0.3.5" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cdb91bdd390c7ce1a8607f35f3ca7151b65afc0ff5ff3b34fa350f7d7c7e4310" + +[[package]] +name = "objc2" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "46a785d4eeff09c14c487497c162e92766fbb3e4059a71840cecc03d9a50b804" +dependencies = [ + "objc-sys", + "objc2-encode", +] + [[package]] name = "objc2" version = "0.6.3" @@ -4205,6 +4480,22 @@ dependencies = [ "objc2-encode", ] +[[package]] +name = "objc2-app-kit" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e4e89ad9e3d7d297152b17d39ed92cd50ca8063a89a9fa569046d41568891eff" +dependencies = [ + "bitflags 2.10.0", + "block2 0.5.1", + "libc", + "objc2 0.5.2", + "objc2-core-data 0.2.2", + "objc2-core-image 0.2.2", + "objc2-foundation 0.2.2", + "objc2-quartz-core 0.2.2", +] + [[package]] name = "objc2-app-kit" version = "0.3.2" @@ -4212,12 +4503,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d49e936b501e5c5bf01fda3a9452ff86dc3ea98ad5f283e1455153142d97518c" dependencies = [ "bitflags 2.10.0", - "block2", - "objc2", + "block2 0.6.2", + "objc2 0.6.3", "objc2-core-foundation", "objc2-core-graphics", - "objc2-foundation", - "objc2-quartz-core", + "objc2-foundation 0.3.2", + "objc2-quartz-core 0.3.2", ] [[package]] @@ -4227,8 +4518,20 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "73ad74d880bb43877038da939b7427bba67e9dd42004a18b809ba7d87cee241c" dependencies = [ "bitflags 2.10.0", - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", +] + +[[package]] +name = "objc2-core-data" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "617fbf49e071c178c0b24c080767db52958f716d9eabdf0890523aeae54773ef" +dependencies = [ + "bitflags 2.10.0", + "block2 0.5.1", + "objc2 0.5.2", + "objc2-foundation 0.2.2", ] [[package]] @@ -4237,8 +4540,8 @@ version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0b402a653efbb5e82ce4df10683b6b28027616a2715e90009947d50b8dd298fa" dependencies = [ - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", ] [[package]] @@ -4248,9 +4551,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2a180dd8642fa45cdb7dd721cd4c11b1cadd4929ce112ebd8b9f5803cc79d536" dependencies = [ "bitflags 2.10.0", - "block2", + "block2 0.6.2", "dispatch2", - "objc2", + "objc2 0.6.3", ] [[package]] @@ -4262,19 +4565,31 @@ dependencies = [ "bitflags 2.10.0", "dispatch2", "libc", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", "objc2-io-surface", ] +[[package]] +name = "objc2-core-image" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "55260963a527c99f1819c4f8e3b47fe04f9650694ef348ffd2227e8196d34c80" +dependencies = [ + "block2 0.5.1", + "objc2 0.5.2", + "objc2-foundation 0.2.2", + "objc2-metal 0.2.2", +] + [[package]] name = "objc2-core-image" version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e5d563b38d2b97209f8e861173de434bd0214cf020e3423a52624cd1d989f006" dependencies = [ - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", ] [[package]] @@ -4283,8 +4598,8 @@ version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ca347214e24bc973fc025fd0d36ebb179ff30536ed1f80252706db19ee452009" dependencies = [ - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", ] [[package]] @@ -4294,7 +4609,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0cde0dfb48d25d2b4862161a4d5fcc0e3c24367869ad306b0c9ec0073bfed92d" dependencies = [ "bitflags 2.10.0", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", "objc2-core-graphics", ] @@ -4316,6 +4631,18 @@ version = "4.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ef25abbcd74fb2609453eb695bd2f860d389e457f67dc17cafc8b8cbc89d0c33" +[[package]] +name = "objc2-foundation" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "0ee638a5da3799329310ad4cfa62fbf045d5f56e3ef5ba4149e7452dcf89d5a8" +dependencies = [ + "bitflags 2.10.0", + "block2 0.5.1", + "libc", + "objc2 0.5.2", +] + [[package]] name = "objc2-foundation" version = "0.3.2" @@ -4323,9 +4650,9 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e3e0adef53c21f888deb4fa59fc59f7eb17404926ee8a6f59f5df0fd7f9f3272" dependencies = [ "bitflags 2.10.0", - "block2", + "block2 0.6.2", "libc", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", ] @@ -4336,10 +4663,22 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "180788110936d59bab6bd83b6060ffdfffb3b922ba1396b312ae795e1de9d81d" dependencies = [ "bitflags 2.10.0", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", ] +[[package]] +name = "objc2-metal" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dd0cba1276f6023976a406a14ffa85e1fdd19df6b0f737b063b95f6c8c7aadd6" +dependencies = [ + "bitflags 2.10.0", + "block2 0.5.1", + "objc2 0.5.2", + "objc2-foundation 0.2.2", +] + [[package]] name = "objc2-metal" version = "0.3.2" @@ -4347,8 +4686,21 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a0125f776a10d00af4152d74616409f0d4a2053a6f57fa5b7d6aa2854ac04794" dependencies = [ "bitflags 2.10.0", - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", +] + +[[package]] +name = "objc2-quartz-core" +version = "0.2.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e42bee7bff906b14b167da2bac5efe6b6a07e6f7c0a21a7308d40c960242dc7a" +dependencies = [ + "bitflags 2.10.0", + "block2 0.5.1", + "objc2 0.5.2", + "objc2-foundation 0.2.2", + "objc2-metal 0.2.2", ] [[package]] @@ -4358,10 +4710,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "96c1358452b371bf9f104e21ec536d37a650eb10f7ee379fff67d2e08d537f1f" dependencies = [ "bitflags 2.10.0", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", - "objc2-foundation", - "objc2-metal", + "objc2-foundation 0.3.2", + "objc2-metal 0.3.2", ] [[package]] @@ -4371,17 +4723,17 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d87d638e33c06f577498cbcc50491496a3ed4246998a7fbba7ccb98b1e7eab22" dependencies = [ "bitflags 2.10.0", - "block2", - "objc2", + "block2 0.6.2", + "objc2 0.6.3", "objc2-cloud-kit", - "objc2-core-data", + "objc2-core-data 0.3.2", "objc2-core-foundation", "objc2-core-graphics", - "objc2-core-image", + "objc2-core-image 0.3.2", "objc2-core-location", "objc2-core-text", - "objc2-foundation", - "objc2-quartz-core", + "objc2-foundation 0.3.2", + "objc2-quartz-core 0.3.2", "objc2-user-notifications", ] @@ -4391,8 +4743,8 @@ version = "0.3.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9df9128cbbfef73cda168416ccf7f837b62737d748333bfe9ab71c245d76613e" dependencies = [ - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", ] [[package]] @@ -4512,8 +4864,8 @@ dependencies = [ "android_system_properties", "log", "nix", - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", "objc2-ui-kit", "serde", "windows-sys 0.61.2", @@ -4560,7 +4912,7 @@ dependencies = [ "libc", "redox_syscall 0.5.18", "smallvec", - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -4692,6 +5044,17 @@ version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" +[[package]] +name = "piper" +version = "0.2.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "96c8c490f422ef9a4efd2cb5b42b76c8613d7e7dfc1caf667b8a3350a5acc066" +dependencies = [ + "atomic-waker", + "fastrand", + "futures-io", +] + [[package]] name = "pixels" version = "0.15.0" @@ -4901,6 +5264,16 @@ version = "2.0.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a993555f31e5a609f617c12db6250dedcac1b0a85076912c436e6fc9b2c8e6a3" +[[package]] +name = "quick-xml" +version = "0.36.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f7649a7b4df05aed9ea7ec6f628c67c9953a43869b8bc50929569b2999d443fe" +dependencies = [ + "memchr", + "serde", +] + [[package]] name = "quick-xml" version = "0.37.5" @@ -5177,14 +5550,14 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ef2bee61e6cffa4635c72d7d81a84294e28f0930db0ddcb0f66d10244674ebed" dependencies = [ "ashpd", - "block2", + "block2 0.6.2", "dispatch2", "js-sys", "log", - "objc2", - "objc2-app-kit", + "objc2 0.6.3", + "objc2-app-kit 0.3.2", "objc2-core-foundation", - "objc2-foundation", + "objc2-foundation 0.3.2", "pollster 0.4.0", "raw-window-handle", "urlencoding", @@ -5782,11 +6155,11 @@ dependencies = [ "js-sys", "memmap2 0.9.9", "ndk", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", "objc2-core-graphics", - "objc2-foundation", - "objc2-quartz-core", + "objc2-foundation 0.3.2", + "objc2-quartz-core 0.3.2", "raw-window-handle", "redox_syscall 0.5.18", "rustix 1.1.2", @@ -7317,7 +7690,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "54cb1e9dc49da91950bdfd8b848c49330536d9d1fb03d4bfec8cae50caa50ae3" dependencies = [ "proc-macro2", - "quick-xml", + "quick-xml 0.37.5", "quote", ] @@ -7375,8 +7748,8 @@ dependencies = [ "jni", "log", "ndk-context", - "objc2", - "objc2-foundation", + "objc2 0.6.3", + "objc2-foundation 0.3.2", "url", "web-sys", ] @@ -7738,16 +8111,38 @@ dependencies = [ "windows-targets 0.52.6", ] +[[package]] +name = "windows" +version = "0.61.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9babd3a767a4c1aef6900409f85f5d53ce2544ccdfaa86dad48c91782c6d6893" +dependencies = [ + "windows-collections 0.2.0", + "windows-core 0.61.2", + "windows-future 0.2.1", + "windows-link 0.1.3", + "windows-numerics 0.2.0", +] + [[package]] name = "windows" version = "0.62.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "527fadee13e0c05939a6a05d5bd6eec6cd2e3dbd648b9f8e447c6518133d8580" dependencies = [ - "windows-collections", + "windows-collections 0.3.2", "windows-core 0.62.2", - "windows-future", - "windows-numerics", + "windows-future 0.3.2", + "windows-numerics 0.3.1", +] + +[[package]] +name = "windows-collections" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3beeceb5e5cfd9eb1d76b381630e82c4241ccd0d27f1a39ed41b2760b255c5e8" +dependencies = [ + "windows-core 0.61.2", ] [[package]] @@ -7781,6 +8176,19 @@ dependencies = [ "windows-targets 0.52.6", ] +[[package]] +name = "windows-core" +version = "0.61.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c0fdd3ddb90610c7638aa2b3a3ab2904fb9e5cdbecc643ddb3647212781c4ae3" +dependencies = [ + "windows-implement 0.60.2", + "windows-interface 0.59.3", + "windows-link 0.1.3", + "windows-result 0.3.4", + "windows-strings 0.4.2", +] + [[package]] name = "windows-core" version = "0.62.2" @@ -7789,11 +8197,22 @@ checksum = "b8e83a14d34d0623b51dce9581199302a221863196a1dde71a7663a4c2be9deb" dependencies = [ "windows-implement 0.60.2", "windows-interface 0.59.3", - "windows-link", + "windows-link 0.2.1", "windows-result 0.4.1", "windows-strings 0.5.1", ] +[[package]] +name = "windows-future" +version = "0.2.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "fc6a41e98427b19fe4b73c550f060b59fa592d7d686537eebf9385621bfbad8e" +dependencies = [ + "windows-core 0.61.2", + "windows-link 0.1.3", + "windows-threading 0.1.0", +] + [[package]] name = "windows-future" version = "0.3.2" @@ -7801,8 +8220,8 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e1d6f90251fe18a279739e78025bd6ddc52a7e22f921070ccdc67dde84c605cb" dependencies = [ "windows-core 0.62.2", - "windows-link", - "windows-threading", + "windows-link 0.2.1", + "windows-threading 0.2.1", ] [[package]] @@ -7849,12 +8268,28 @@ dependencies = [ "syn 2.0.111", ] +[[package]] +name = "windows-link" +version = "0.1.3" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5e6ad25900d524eaabdbbb96d20b4311e1e7ae1699af4fb28c17ae66c80d798a" + [[package]] name = "windows-link" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "f0805222e57f7521d6a62e36fa9163bc891acd422f971defe97d64e70d0a4fe5" +[[package]] +name = "windows-numerics" +version = "0.2.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9150af68066c4c5c07ddc0ce30421554771e528bde427614c61038bc2c92c2b1" +dependencies = [ + "windows-core 0.61.2", + "windows-link 0.1.3", +] + [[package]] name = "windows-numerics" version = "0.3.1" @@ -7862,7 +8297,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "6e2e40844ac143cdb44aead537bbf727de9b044e107a0f1220392177d15b0f26" dependencies = [ "windows-core 0.62.2", - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -7871,7 +8306,7 @@ version = "0.6.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "02752bf7fbdcce7f2a27a742f798510f3e5ad88dbe84871e5168e2120c3d5720" dependencies = [ - "windows-link", + "windows-link 0.2.1", "windows-result 0.4.1", "windows-strings 0.5.1", ] @@ -7885,13 +8320,22 @@ dependencies = [ "windows-targets 0.52.6", ] +[[package]] +name = "windows-result" +version = "0.3.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56f42bd332cc6c8eac5af113fc0c1fd6a8fd2aa08a0119358686e5160d0586c6" +dependencies = [ + "windows-link 0.1.3", +] + [[package]] name = "windows-result" version = "0.4.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "7781fa89eaf60850ac3d2da7af8e5242a5ea78d1a11c49bf2910bb5a73853eb5" dependencies = [ - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -7904,13 +8348,22 @@ dependencies = [ "windows-targets 0.52.6", ] +[[package]] +name = "windows-strings" +version = "0.4.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "56e6c93f3a0c3b36176cb1327a4958a0353d5d166c2a35cb268ace15e91d3b57" +dependencies = [ + "windows-link 0.1.3", +] + [[package]] name = "windows-strings" version = "0.5.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "7837d08f69c77cf6b07689544538e017c1bfcf57e34b4c0ff58e6c2cd3b37091" dependencies = [ - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -7955,7 +8408,7 @@ version = "0.61.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ae137229bcbd6cdf0f7b80a31df61766145077ddf49416a728b02cb3921ff3fc" dependencies = [ - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -7995,7 +8448,7 @@ version = "0.53.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "4945f9f551b88e0d65f3db0bc25c33b8acea4d9e41163edf90dcd0b19f9069f3" dependencies = [ - "windows-link", + "windows-link 0.2.1", "windows_aarch64_gnullvm 0.53.1", "windows_aarch64_msvc 0.53.1", "windows_i686_gnu 0.53.1", @@ -8006,13 +8459,22 @@ dependencies = [ "windows_x86_64_msvc 0.53.1", ] +[[package]] +name = "windows-threading" +version = "0.1.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b66463ad2e0ea3bbf808b7f1d371311c80e115c0b71d60efc142cafbcfb057a6" +dependencies = [ + "windows-link 0.1.3", +] + [[package]] name = "windows-threading" version = "0.2.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3949bd5b99cafdf1c7ca86b43ca564028dfe27d66958f2470940f73d86d75b37" dependencies = [ - "windows-link", + "windows-link 0.2.1", ] [[package]] @@ -8203,15 +8665,15 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "21310ca07851a49c348e0c2cc768e36b52ca65afda2c2354d78ed4b90074d8aa" dependencies = [ "bitflags 2.10.0", - "block2", + "block2 0.6.2", "dispatch2", "dpi", - "objc2", - "objc2-app-kit", + "objc2 0.6.3", + "objc2-app-kit 0.3.2", "objc2-core-foundation", "objc2-core-graphics", "objc2-core-video", - "objc2-foundation", + "objc2-foundation 0.3.2", "raw-window-handle", "smol_str", "tracing", @@ -8226,7 +8688,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "45375fbac4cbb77260d83a30b1f9d8105880dbac99a9ae97f56656694680ff69" dependencies = [ "memmap2 0.9.9", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", "smol_str", "tracing", @@ -8273,12 +8735,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "680a356e798837d8eb274d4556e83bceaf81698194e31aafc5cfb8a9f2fab643" dependencies = [ "bitflags 2.10.0", - "block2", + "block2 0.6.2", "dispatch2", "dpi", - "objc2", + "objc2 0.6.3", "objc2-core-foundation", - "objc2-foundation", + "objc2-foundation 0.3.2", "objc2-ui-kit", "raw-window-handle", "smol_str", @@ -8612,8 +9074,14 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "b622b18155f7a93d1cd2dc8c01d2d6a44e08fb9ebb7b3f9e6ed101488bad6c91" dependencies = [ "async-broadcast", + "async-executor", + "async-io", + "async-lock", + "async-process", "async-recursion", + "async-task", "async-trait", + "blocking", "enumflags2", "event-listener", "futures-core", @@ -8634,6 +9102,30 @@ dependencies = [ "zvariant", ] +[[package]] +name = "zbus-lockstep" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "6998de05217a084b7578728a9443d04ea4cd80f2a0839b8d78770b76ccd45863" +dependencies = [ + "zbus_xml", + "zvariant", +] + +[[package]] +name = "zbus-lockstep-macros" +version = "0.5.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "10da05367f3a7b7553c8cdf8fa91aee6b64afebe32b51c95177957efc47ca3a0" +dependencies = [ + "proc-macro2", + "quote", + "syn 2.0.111", + "zbus-lockstep", + "zbus_xml", + "zvariant", +] + [[package]] name = "zbus_macros" version = "5.12.0" @@ -8661,6 +9153,19 @@ dependencies = [ "zvariant", ] +[[package]] +name = "zbus_xml" +version = "5.0.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "589e9a02bfafb9754bb2340a9e3b38f389772684c63d9637e76b1870377bec29" +dependencies = [ + "quick-xml 0.36.2", + "serde", + "static_assertions", + "zbus_names", + "zvariant", +] + [[package]] name = "zeno" version = "0.3.3" diff --git a/Cargo.toml b/Cargo.toml index 741fca3f4..4c845509c 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -1,5 +1,6 @@ [workspace] members = [ + "packages/accesskit_xplat", "packages/debug_timer", "packages/blitz-traits", "packages/blitz-dom", diff --git a/packages/accesskit_xplat/CHANGELOG.md b/packages/accesskit_xplat/CHANGELOG.md new file mode 100644 index 000000000..3a981878a --- /dev/null +++ b/packages/accesskit_xplat/CHANGELOG.md @@ -0,0 +1,885 @@ +# Changelog + +* The following workspace dependencies were updated + * dependencies + * accesskit_macos bumped from 0.1.4 to 0.1.5 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.8.0 to 0.8.1 + * accesskit_windows bumped from 0.10.0 to 0.10.1 + * accesskit_macos bumped from 0.2.0 to 0.2.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.10.1 to 0.10.2 + * accesskit_macos bumped from 0.2.1 to 0.3.0 + +* The following workspace dependencies were updated + * dependencies + * accesskit_macos bumped from 0.3.0 to 0.4.0 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.10.3 to 0.10.4 + * accesskit_macos bumped from 0.4.1 to 0.4.2 + * accesskit_unix bumped from 0.1.0 to 0.1.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.3.0 to 0.3.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.10.0 to 0.10.1 + * accesskit_windows bumped from 0.13.0 to 0.13.1 + * accesskit_macos bumped from 0.6.0 to 0.6.1 + * accesskit_unix bumped from 0.3.1 to 0.3.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.13.1 to 0.13.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit_macos bumped from 0.6.1 to 0.6.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.10.1 to 0.11.0 + * accesskit_windows bumped from 0.13.2 to 0.13.3 + * accesskit_macos bumped from 0.6.2 to 0.6.3 + * accesskit_unix bumped from 0.3.2 to 0.3.3 + +* The following workspace dependencies were updated + * dependencies + * accesskit_macos bumped from 0.7.0 to 0.7.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.11.0 to 0.11.1 + * accesskit_windows bumped from 0.14.0 to 0.14.1 + * accesskit_macos bumped from 0.7.1 to 0.8.0 + * accesskit_unix bumped from 0.5.0 to 0.5.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.11.1 to 0.11.2 + * accesskit_windows bumped from 0.14.1 to 0.14.2 + * accesskit_macos bumped from 0.8.0 to 0.9.0 + * accesskit_unix bumped from 0.5.1 to 0.5.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.14.2 to 0.14.3 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.16.0 to 0.16.1 + * accesskit_unix bumped from 0.7.1 to 0.7.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.7.2 to 0.7.3 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.16.1 to 0.16.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.12.2 to 0.12.3 + * accesskit_windows bumped from 0.16.2 to 0.16.3 + * accesskit_macos bumped from 0.11.0 to 0.11.1 + * accesskit_unix bumped from 0.7.3 to 0.7.4 + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.7.4 to 0.7.5 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.16.3 to 0.16.4 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.18.0 to 0.18.1 + * accesskit_macos bumped from 0.13.0 to 0.13.1 + * accesskit_unix bumped from 0.9.0 to 0.9.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.18.1 to 0.18.2 + * accesskit_macos bumped from 0.13.1 to 0.13.2 + * accesskit_unix bumped from 0.9.1 to 0.9.2 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.18.2 to 0.19.0 + * accesskit_macos bumped from 0.13.2 to 0.14.0 + * accesskit_unix bumped from 0.9.2 to 0.10.0 + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.19.0 to 0.20.0 + * accesskit_macos bumped from 0.14.0 to 0.15.0 + * accesskit_unix bumped from 0.10.0 to 0.10.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.11.0 to 0.11.1 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.16.2 to 0.16.3 + * accesskit_windows bumped from 0.23.1 to 0.23.2 + * accesskit_macos bumped from 0.17.2 to 0.17.3 + * accesskit_unix bumped from 0.12.2 to 0.12.3 + +* The following workspace dependencies were updated + * dependencies + * accesskit_macos bumped from 0.17.3 to 0.17.4 + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.17.0 to 0.17.1 + * accesskit_windows bumped from 0.24.0 to 0.24.1 + * accesskit_macos bumped from 0.18.0 to 0.18.1 + * accesskit_unix bumped from 0.13.0 to 0.13.1 + +## [0.29.2](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.29.1...accesskit_winit-v0.29.2) (2025-10-20) + + +### Bug Fixes + +* Fix winit examples window not showing up under Wayland ([#625](https://github.com/AccessKit/accesskit/issues/625)) ([87ce769](https://github.com/AccessKit/accesskit/commit/87ce769282b00684f2b2ab6a3410ed6edb894f22)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.29.1 to 0.29.2 + * accesskit_macos bumped from 0.22.1 to 0.22.2 + * accesskit_unix bumped from 0.17.1 to 0.17.2 + * accesskit_android bumped from 0.4.1 to 0.4.2 + +## [0.29.1](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.29.0...accesskit_winit-v0.29.1) (2025-10-02) + + +### Bug Fixes + +* Impl `Clone` and `PartialEq` on `WindowEvent` ([#618](https://github.com/AccessKit/accesskit/issues/618)) ([3a4771b](https://github.com/AccessKit/accesskit/commit/3a4771b87455cc005c18152935535818a3f9f825)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.21.0 to 0.21.1 + * accesskit_windows bumped from 0.29.0 to 0.29.1 + * accesskit_macos bumped from 0.22.0 to 0.22.1 + * accesskit_unix bumped from 0.17.0 to 0.17.1 + * accesskit_android bumped from 0.4.0 to 0.4.1 + +## [0.29.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.28.0...accesskit_winit-v0.29.0) (2025-07-16) + + +### Features + +* Let parents declare actions supported on their children ([#593](https://github.com/AccessKit/accesskit/issues/593)) ([70b534b](https://github.com/AccessKit/accesskit/commit/70b534bed168a84b84cc35199588aa8ab784fb43)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.20.0 to 0.21.0 + * accesskit_windows bumped from 0.28.0 to 0.29.0 + * accesskit_macos bumped from 0.21.0 to 0.22.0 + * accesskit_unix bumped from 0.16.0 to 0.17.0 + * accesskit_android bumped from 0.3.0 to 0.4.0 + +## [0.28.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.27.0...accesskit_winit-v0.28.0) (2025-06-26) + + +### ⚠ BREAKING CHANGES + +* Force a semver-breaking release ([#589](https://github.com/AccessKit/accesskit/issues/589)) + +### Bug Fixes + +* Force a semver-breaking release ([#589](https://github.com/AccessKit/accesskit/issues/589)) ([2887cdd](https://github.com/AccessKit/accesskit/commit/2887cddde817ba3851688068d8d10de5cef7c624)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.19.0 to 0.20.0 + * accesskit_windows bumped from 0.27.0 to 0.28.0 + * accesskit_macos bumped from 0.20.0 to 0.21.0 + * accesskit_unix bumped from 0.15.0 to 0.16.0 + * accesskit_android bumped from 0.2.0 to 0.3.0 + +## [0.27.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.26.0...accesskit_winit-v0.27.0) (2025-05-06) + + +### ⚠ BREAKING CHANGES + +* Simplify the core Android adapter API ([#558](https://github.com/AccessKit/accesskit/issues/558)) +* Drop redundant `HasPopup::True` ([#550](https://github.com/AccessKit/accesskit/issues/550)) + +### Code Refactoring + +* Drop redundant `HasPopup::True` ([#550](https://github.com/AccessKit/accesskit/issues/550)) ([56abf17](https://github.com/AccessKit/accesskit/commit/56abf17356e4c7f13f64aaeaca6a63c8f7ede553)) +* Simplify the core Android adapter API ([#558](https://github.com/AccessKit/accesskit/issues/558)) ([7ac5911](https://github.com/AccessKit/accesskit/commit/7ac5911b11f3d6b8b777b91e6476e7073f6b0e4a)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.18.0 to 0.19.0 + * accesskit_windows bumped from 0.26.0 to 0.27.0 + * accesskit_macos bumped from 0.19.0 to 0.20.0 + * accesskit_unix bumped from 0.14.0 to 0.15.0 + * accesskit_android bumped from 0.1.1 to 0.2.0 + +## [0.26.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.25.0...accesskit_winit-v0.26.0) (2025-03-17) + + +### ⚠ BREAKING CHANGES + +* Panic if the window is visible when the adapter is created, for adapters where this is a problem ([#529](https://github.com/AccessKit/accesskit/issues/529)) + +### Bug Fixes + +* Panic if the window is visible when the adapter is created, for adapters where this is a problem ([#529](https://github.com/AccessKit/accesskit/issues/529)) ([c43c37b](https://github.com/AccessKit/accesskit/commit/c43c37ba2502656fcae4fd726b9b7db0bb520f31)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.25.0 to 0.26.0 + * accesskit_android bumped from 0.1.0 to 0.1.1 + +## [0.25.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.24.0...accesskit_winit-v0.25.0) (2025-03-08) + + +### ⚠ BREAKING CHANGES + +* Make accesskit_android an optional dependency of accesskit_winit ([#524](https://github.com/AccessKit/accesskit/issues/524)) + +### Bug Fixes + +* Make accesskit_android an optional dependency of accesskit_winit ([#524](https://github.com/AccessKit/accesskit/issues/524)) ([bb17d44](https://github.com/AccessKit/accesskit/commit/bb17d449b601eaffad1c7201ec5bf8de241bb8f8)) + +## [0.24.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.23.1...accesskit_winit-v0.24.0) (2025-03-06) + + +### ⚠ BREAKING CHANGES + +* Add event loop parameter to winit adapter constructors ([#517](https://github.com/AccessKit/accesskit/issues/517)) +* Drop `Tree::app_name` ([#492](https://github.com/AccessKit/accesskit/issues/492)) + +### Features + +* Android adapter ([#500](https://github.com/AccessKit/accesskit/issues/500)) ([7e65ac7](https://github.com/AccessKit/accesskit/commit/7e65ac77d7e108ac5b9f3722f488a2fdf2e3b3e0)) + + +### Bug Fixes + +* Update winit to 0.30.9 ([#511](https://github.com/AccessKit/accesskit/issues/511)) ([0be21e6](https://github.com/AccessKit/accesskit/commit/0be21e6a2979af483b573b1c9b07c677286b871d)) + + +### Code Refactoring + +* Add event loop parameter to winit adapter constructors ([#517](https://github.com/AccessKit/accesskit/issues/517)) ([0d15f24](https://github.com/AccessKit/accesskit/commit/0d15f246a301a68af4424f7602c2f3be25da9327)) +* Drop `Tree::app_name` ([#492](https://github.com/AccessKit/accesskit/issues/492)) ([089794c](https://github.com/AccessKit/accesskit/commit/089794c8f74957e91a19ae3df508e2a892f39ebc)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.17.1 to 0.18.0 + * accesskit_windows bumped from 0.24.1 to 0.25.0 + * accesskit_macos bumped from 0.18.1 to 0.19.0 + * accesskit_unix bumped from 0.13.1 to 0.14.0 + +## [0.23.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.22.4...accesskit_winit-v0.23.0) (2024-10-31) + + +### ⚠ BREAKING CHANGES + +* Rename `name` to `label` and use `value` for label content ([#475](https://github.com/AccessKit/accesskit/issues/475)) +* Rename `NodeBuilder` to `Node` and the old `Node` to `FrozenNode` ([#476](https://github.com/AccessKit/accesskit/issues/476)) +* Drop `DefaultActionVerb` ([#472](https://github.com/AccessKit/accesskit/issues/472)) +* Make the core crate no-std ([#468](https://github.com/AccessKit/accesskit/issues/468)) + +### Features + +* Make the core crate no-std ([#468](https://github.com/AccessKit/accesskit/issues/468)) ([2fa0d3f](https://github.com/AccessKit/accesskit/commit/2fa0d3f5b2b7ac11ef1751c133706f29e548bd6d)) + + +### Code Refactoring + +* Drop `DefaultActionVerb` ([#472](https://github.com/AccessKit/accesskit/issues/472)) ([ef3b003](https://github.com/AccessKit/accesskit/commit/ef3b0038224459094f650368412650bc3b69526b)) +* Rename `name` to `label` and use `value` for label content ([#475](https://github.com/AccessKit/accesskit/issues/475)) ([e0053a5](https://github.com/AccessKit/accesskit/commit/e0053a5399929e8e0d4f07aa18de604ed8766ace)) +* Rename `NodeBuilder` to `Node` and the old `Node` to `FrozenNode` ([#476](https://github.com/AccessKit/accesskit/issues/476)) ([7d8910e](https://github.com/AccessKit/accesskit/commit/7d8910e35f7bc0543724cc124941a3bd0304bcc0)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.16.3 to 0.17.0 + * accesskit_windows bumped from 0.23.2 to 0.24.0 + * accesskit_macos bumped from 0.17.4 to 0.18.0 + * accesskit_unix bumped from 0.12.3 to 0.13.0 + +## [0.22.2](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.22.1...accesskit_winit-v0.22.2) (2024-10-07) + + +### Bug Fixes + +* Update minimum supported Rust version to 1.75 ([#457](https://github.com/AccessKit/accesskit/issues/457)) ([fc622fe](https://github.com/AccessKit/accesskit/commit/fc622fe7657c80a4eedad6f6cded11d2538b54d5)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.16.1 to 0.16.2 + * accesskit_windows bumped from 0.23.0 to 0.23.1 + * accesskit_macos bumped from 0.17.1 to 0.17.2 + * accesskit_unix bumped from 0.12.1 to 0.12.2 + +## [0.22.1](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.22.0...accesskit_winit-v0.22.1) (2024-09-24) + + +### Bug Fixes + +* Use the new HWND type on accesskit_winit ([#453](https://github.com/AccessKit/accesskit/issues/453)) ([68a2462](https://github.com/AccessKit/accesskit/commit/68a24629381f0b18f6ed1ee008fe72ce9330092e)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.16.0 to 0.16.1 + * accesskit_windows bumped from 0.22.0 to 0.23.0 + * accesskit_macos bumped from 0.17.0 to 0.17.1 + * accesskit_unix bumped from 0.12.0 to 0.12.1 + +## [0.22.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.21.1...accesskit_winit-v0.22.0) (2024-06-29) + + +### ⚠ BREAKING CHANGES + +* Rename the `StaticText` role to `Label` ([#434](https://github.com/AccessKit/accesskit/issues/434)) + +### Code Refactoring + +* Rename the `StaticText` role to `Label` ([#434](https://github.com/AccessKit/accesskit/issues/434)) ([7086bc0](https://github.com/AccessKit/accesskit/commit/7086bc0fad446d3ed4a0fd5eff641a1e75f6c599)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.15.0 to 0.16.0 + * accesskit_windows bumped from 0.21.0 to 0.22.0 + * accesskit_macos bumped from 0.16.0 to 0.17.0 + * accesskit_unix bumped from 0.11.1 to 0.12.0 + +## [0.21.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.20.4...accesskit_winit-v0.21.0) (2024-06-09) + + +### Features + +* Add `author_id` property ([#424](https://github.com/AccessKit/accesskit/issues/424)) ([0d1c56f](https://github.com/AccessKit/accesskit/commit/0d1c56f0bdde58715e1c69f6015df600cb7cb8c1)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.14.0 to 0.15.0 + * accesskit_windows bumped from 0.20.0 to 0.21.0 + * accesskit_macos bumped from 0.15.0 to 0.16.0 + * accesskit_unix bumped from 0.10.1 to 0.11.0 + +## [0.20.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.19.0...accesskit_winit-v0.20.0) (2024-04-30) + + +### ⚠ BREAKING CHANGES + +* Update winit to 0.30 ([#397](https://github.com/AccessKit/accesskit/issues/397)) +* Drop `NodeClassSet` ([#389](https://github.com/AccessKit/accesskit/issues/389)) + +### Bug Fixes + +* Increase minimum supported Rust version to `1.70` ([#396](https://github.com/AccessKit/accesskit/issues/396)) ([a8398b8](https://github.com/AccessKit/accesskit/commit/a8398b847aa003de91042ac45e33126fc2cae053)) +* Update winit to 0.30 ([#397](https://github.com/AccessKit/accesskit/issues/397)) ([de93be3](https://github.com/AccessKit/accesskit/commit/de93be387c03a438fbf598670207e578686e6bcf)) + + +### Code Refactoring + +* Drop `NodeClassSet` ([#389](https://github.com/AccessKit/accesskit/issues/389)) ([1b153ed](https://github.com/AccessKit/accesskit/commit/1b153ed51f8421cdba2dc98beca2e8f5f8c781bc)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.13.0 to 0.14.0 + * accesskit_windows bumped from 0.17.0 to 0.18.0 + * accesskit_macos bumped from 0.12.0 to 0.13.0 + * accesskit_unix bumped from 0.8.0 to 0.9.0 + +## [0.19.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.18.7...accesskit_winit-v0.19.0) (2024-04-14) + + +### ⚠ BREAKING CHANGES + +* New approach to lazy initialization ([#375](https://github.com/AccessKit/accesskit/issues/375)) + +### Code Refactoring + +* New approach to lazy initialization ([#375](https://github.com/AccessKit/accesskit/issues/375)) ([9baebdc](https://github.com/AccessKit/accesskit/commit/9baebdceed7300389b6768815d7ae48f1ce401e4)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.12.3 to 0.13.0 + * accesskit_windows bumped from 0.16.4 to 0.17.0 + * accesskit_macos bumped from 0.11.1 to 0.12.0 + * accesskit_unix bumped from 0.7.5 to 0.8.0 + +## [0.18.1](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.18.0...accesskit_winit-v0.18.1) (2024-01-11) + + +### Bug Fixes + +* Run our own async executor on Unix ([#337](https://github.com/AccessKit/accesskit/issues/337)) ([8f937ba](https://github.com/AccessKit/accesskit/commit/8f937baaa510dd96da196501822b82f75f05b595)) +* Show an error at compile-time if no raw-window-handle feature is enabled for the winit adapter ([#339](https://github.com/AccessKit/accesskit/issues/339)) ([a24f5fd](https://github.com/AccessKit/accesskit/commit/a24f5fd443a683a6194b54244052ff3e1cc05de6)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.7.0 to 0.7.1 + +## [0.18.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.17.0...accesskit_winit-v0.18.0) (2024-01-03) + + +### ⚠ BREAKING CHANGES + +* Lazily activate Unix adapters ([#324](https://github.com/AccessKit/accesskit/issues/324)) +* Remove `accesskit_winit::Adapter::update` ([#325](https://github.com/AccessKit/accesskit/issues/325)) + +### Bug Fixes + +* Lazily activate Unix adapters ([#324](https://github.com/AccessKit/accesskit/issues/324)) ([54ed036](https://github.com/AccessKit/accesskit/commit/54ed036c99d87428a8eb5bb03fd77e9e31562d4c)) +* Remove `accesskit_winit::Adapter::update` ([#325](https://github.com/AccessKit/accesskit/issues/325)) ([f121bff](https://github.com/AccessKit/accesskit/commit/f121bffe9e651fd2ac6deb882f57e1c9b613b7eb)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.12.1 to 0.12.2 + * accesskit_windows bumped from 0.15.1 to 0.16.0 + * accesskit_macos bumped from 0.10.1 to 0.11.0 + * accesskit_unix bumped from 0.6.2 to 0.7.0 + +## [0.17.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.16.1...accesskit_winit-v0.17.0) (2023-12-14) + + +### ⚠ BREAKING CHANGES + +* Force a semver break for the winit rwh feature additions ([#322](https://github.com/AccessKit/accesskit/issues/322)) + +### Bug Fixes + +* Add a `rwh_05` feature flag to `accesskit_winit` ([#319](https://github.com/AccessKit/accesskit/issues/319)) ([f4d279c](https://github.com/AccessKit/accesskit/commit/f4d279c5ece16df2925c0e31dc82eaf192c40cd0)) +* Force a semver break for the winit rwh feature additions ([#322](https://github.com/AccessKit/accesskit/issues/322)) ([61acdb0](https://github.com/AccessKit/accesskit/commit/61acdb0ea083263c88a00ad4db637b25863852c0)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.6.1 to 0.6.2 + +## [0.16.1](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.16.0...accesskit_winit-v0.16.1) (2023-11-05) + + +### Bug Fixes + +* Account for window decorations when `accesskit_winit::Adapter::process_event` receives a resizing event on Unix ([#312](https://github.com/AccessKit/accesskit/issues/312)) ([e2b264c](https://github.com/AccessKit/accesskit/commit/e2b264c2e5b0fb699576f2ece905509c38ffc9be)) + +## [0.16.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.15.0...accesskit_winit-v0.16.0) (2023-11-04) + + +### ⚠ BREAKING CHANGES + +* Rename `accesskit_winit::Adapter::on_event` to `process_event` ([#307](https://github.com/AccessKit/accesskit/issues/307)) +* Bump winit to 0.29 ([#256](https://github.com/AccessKit/accesskit/issues/256)) + +### deps + +* Bump winit to 0.29 ([#256](https://github.com/AccessKit/accesskit/issues/256)) ([4eb21ff](https://github.com/AccessKit/accesskit/commit/4eb21ff64256fcf0a16ab831554b06b80de9b36e)) + + +### Bug Fixes + +* Add missing semicolons when not returning anything ([#303](https://github.com/AccessKit/accesskit/issues/303)) ([38d4de1](https://github.com/AccessKit/accesskit/commit/38d4de1442247e701047d75122a9638a2ed99b1f)) +* Use raw-window-handle 0.6 ([#310](https://github.com/AccessKit/accesskit/issues/310)) ([3fa69ab](https://github.com/AccessKit/accesskit/commit/3fa69ab4d9216b51b651d3cf2a9c8217a77069f4)) + + +### Code Refactoring + +* Rename `accesskit_winit::Adapter::on_event` to `process_event` ([#307](https://github.com/AccessKit/accesskit/issues/307)) ([6fbebde](https://github.com/AccessKit/accesskit/commit/6fbebdeb9d1e96b1776ed1faf7ad21d9cc0a68df)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.12.0 to 0.12.1 + * accesskit_windows bumped from 0.15.0 to 0.15.1 + * accesskit_macos bumped from 0.10.0 to 0.10.1 + * accesskit_unix bumped from 0.6.0 to 0.6.1 + +## [0.15.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.14.4...accesskit_winit-v0.15.0) (2023-09-27) + + +### ⚠ BREAKING CHANGES + +* Allow providing app_name, toolkit_name and toolkit_version in Tree, remove parameters from unix adapter constructor ([#291](https://github.com/AccessKit/accesskit/issues/291)) +* Make `ActionHandler::do_action` take `&mut self` ([#296](https://github.com/AccessKit/accesskit/issues/296)) +* Decouple in-tree focus from host window/view focus ([#278](https://github.com/AccessKit/accesskit/issues/278)) +* Switch to simple unsigned 64-bit integer for node IDs ([#276](https://github.com/AccessKit/accesskit/issues/276)) + +### Features + +* Allow providing app_name, toolkit_name and toolkit_version in Tree, remove parameters from unix adapter constructor ([#291](https://github.com/AccessKit/accesskit/issues/291)) ([5313860](https://github.com/AccessKit/accesskit/commit/531386023257150f49b5e4be942f359855fb7cb6)) + + +### Bug Fixes + +* Fix doc build for accesskit_winit ([#281](https://github.com/AccessKit/accesskit/issues/281)) ([e3b38b8](https://github.com/AccessKit/accesskit/commit/e3b38b8164d0c5442a5a1904165e2b05847376c2)) + + +### Code Refactoring + +* Decouple in-tree focus from host window/view focus ([#278](https://github.com/AccessKit/accesskit/issues/278)) ([d360d20](https://github.com/AccessKit/accesskit/commit/d360d20cf951e7643b81a5303006c9f7daa5bd56)) +* Make `ActionHandler::do_action` take `&mut self` ([#296](https://github.com/AccessKit/accesskit/issues/296)) ([4fc7846](https://github.com/AccessKit/accesskit/commit/4fc7846d732d61fb45c023060ebab96801a0053e)) +* Switch to simple unsigned 64-bit integer for node IDs ([#276](https://github.com/AccessKit/accesskit/issues/276)) ([3eadd48](https://github.com/AccessKit/accesskit/commit/3eadd48ec47854faa94a94ebf910ec08f514642f)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.11.2 to 0.12.0 + * accesskit_windows bumped from 0.14.3 to 0.15.0 + * accesskit_macos bumped from 0.9.0 to 0.10.0 + * accesskit_unix bumped from 0.5.2 to 0.6.0 + +## [0.14.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.13.0...accesskit_winit-v0.14.0) (2023-05-21) + + +### Features + +* Add features for async runtimes on Unix ([#248](https://github.com/AccessKit/accesskit/issues/248)) ([b56b4ea](https://github.com/AccessKit/accesskit/commit/b56b4ea7c967ee5a1dae21a2fa0dcd385346031e)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_unix bumped from 0.4.0 to 0.5.0 + +## [0.13.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.12.5...accesskit_winit-v0.13.0) (2023-03-30) + + +### ⚠ BREAKING CHANGES + +* Force a semver-breaking version bump in downstream crates ([#234](https://github.com/AccessKit/accesskit/issues/234)) + +### Bug Fixes + +* Force a semver-breaking version bump in downstream crates ([#234](https://github.com/AccessKit/accesskit/issues/234)) ([773389b](https://github.com/AccessKit/accesskit/commit/773389bff857fa18edf15de426e029251fc34591)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.13.3 to 0.14.0 + * accesskit_macos bumped from 0.6.3 to 0.7.0 + * accesskit_unix bumped from 0.3.3 to 0.4.0 + +## [0.12.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.11.0...accesskit_winit-v0.12.0) (2023-02-18) + + +### Features + +* Feature-gate the Unix adapter in accesskit_winit ([#214](https://github.com/AccessKit/accesskit/issues/214)) ([be95807](https://github.com/AccessKit/accesskit/commit/be95807dda64f2a49b4d20cc9084b14a7aa2844e)) + +## [0.11.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.10.0...accesskit_winit-v0.11.0) (2023-02-12) + + +### ⚠ BREAKING CHANGES + +* Move thread synchronization into platform adapters; drop parking_lot ([#212](https://github.com/AccessKit/accesskit/issues/212)) + +### Code Refactoring + +* Move thread synchronization into platform adapters; drop parking_lot ([#212](https://github.com/AccessKit/accesskit/issues/212)) ([5df52e5](https://github.com/AccessKit/accesskit/commit/5df52e5545faddf6a51905409013c2f5be23981e)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.9.0 to 0.10.0 + * accesskit_windows bumped from 0.12.0 to 0.13.0 + * accesskit_macos bumped from 0.5.0 to 0.6.0 + * accesskit_unix bumped from 0.2.0 to 0.3.0 + +## [0.10.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.9.1...accesskit_winit-v0.10.0) (2023-02-05) + + +### ⚠ BREAKING CHANGES + +* Make `Node` opaque and optimize it for size ([#205](https://github.com/AccessKit/accesskit/issues/205)) + +### Code Refactoring + +* Make `Node` opaque and optimize it for size ([#205](https://github.com/AccessKit/accesskit/issues/205)) ([4811152](https://github.com/AccessKit/accesskit/commit/48111521439b76c1a8687418a4b20f9b705eac6d)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.8.1 to 0.9.0 + * accesskit_windows bumped from 0.11.0 to 0.12.0 + * accesskit_macos bumped from 0.4.2 to 0.5.0 + * accesskit_unix bumped from 0.1.1 to 0.2.0 + +## [0.9.1](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.9.0...accesskit_winit-v0.9.1) (2023-02-05) + + +### Bug Fixes + +* Don't force winit's X11 and Wayland features to be enabled ([#209](https://github.com/AccessKit/accesskit/issues/209)) ([a3ed357](https://github.com/AccessKit/accesskit/commit/a3ed35754ad8f69a8ed54adacc30b6d57c19329a)) + +## [0.9.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.8.1...accesskit_winit-v0.9.0) (2023-02-02) + + +### ⚠ BREAKING CHANGES + +* Update winit to 0.28 ([#207](https://github.com/AccessKit/accesskit/issues/207)) + +### Miscellaneous Chores + +* Update winit to 0.28 ([#207](https://github.com/AccessKit/accesskit/issues/207)) ([3ff0cf5](https://github.com/AccessKit/accesskit/commit/3ff0cf59f982af504499142a3804f7aeeb4defe0)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.10.4 to 0.11.0 + +## [0.8.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.7.3...accesskit_winit-v0.8.0) (2023-01-05) + + +### Features + +* Basic Unix platform adapter ([#198](https://github.com/AccessKit/accesskit/issues/198)) ([1cea32e](https://github.com/AccessKit/accesskit/commit/1cea32e44ee743b778ac941ceff9087ae745cb37)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.10.2 to 0.10.3 + * accesskit_macos bumped from 0.4.0 to 0.4.1 + +## [0.7.0](https://github.com/AccessKit/accesskit/compare/accesskit_winit-v0.6.6...accesskit_winit-v0.7.0) (2022-11-29) + + +### ⚠ BREAKING CHANGES + +* Move lazy initialization from the core platform adapter to the caller ([#179](https://github.com/AccessKit/accesskit/issues/179)) + +### Code Refactoring + +* Move lazy initialization from the core platform adapter to the caller ([#179](https://github.com/AccessKit/accesskit/issues/179)) ([f35c941](https://github.com/AccessKit/accesskit/commit/f35c941f395f3162db376a69cfaaaf770d376267)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit_windows bumped from 0.9.3 to 0.10.0 + * accesskit_macos bumped from 0.1.5 to 0.2.0 + +### [0.6.4](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.6.3...accesskit_winit-v0.6.4) (2022-11-25) + + +### Bug Fixes + +* Reduce the winit version requirement to match egui ([#170](https://www.github.com/AccessKit/accesskit/issues/170)) ([1d27482](https://www.github.com/AccessKit/accesskit/commit/1d27482221140c1f3b3e3eaf93e7feaf8105611d)) + +## [0.6.0](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.5.1...accesskit_winit-v0.6.0) (2022-11-23) + + +### Features + +* **platforms/macos:** Basic macOS platform adapter ([#158](https://www.github.com/AccessKit/accesskit/issues/158)) ([a06725e](https://www.github.com/AccessKit/accesskit/commit/a06725e952e6041dbd366944fa793b746c9f195e)) + + +### Bug Fixes + +* **platforms/macos:** Fix macOS crate version number ([#161](https://www.github.com/AccessKit/accesskit/issues/161)) ([e0a6a40](https://www.github.com/AccessKit/accesskit/commit/e0a6a401050cdcaea4efa870ed77ae94388f1ce0)) +* **platforms/windows:** Re-export the windows-rs HWND type ([#159](https://www.github.com/AccessKit/accesskit/issues/159)) ([389187a](https://www.github.com/AccessKit/accesskit/commit/389187ac5e96895ed1763d14d315d2f8f4256460)) + +### [0.5.1](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.5.0...accesskit_winit-v0.5.1) (2022-11-17) + + +### Bug Fixes + +* **platforms/winit:** Eliminate some problematic indirect dependencies ([#154](https://www.github.com/AccessKit/accesskit/issues/154)) ([58048ae](https://www.github.com/AccessKit/accesskit/commit/58048aebedc293eda5c5819ea66db9b40b8926b0)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.7.0 to 0.8.0 + +## [0.5.0](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.4.0...accesskit_winit-v0.5.0) (2022-11-14) + + +### Features + +* **platforms/winit:** Allow a custom action handler ([#149](https://www.github.com/AccessKit/accesskit/issues/149)) ([cdb1a16](https://www.github.com/AccessKit/accesskit/commit/cdb1a164de06f18cad497409a514f270a8336b4c)) + +## [0.4.0](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.3.3...accesskit_winit-v0.4.0) (2022-11-12) + + +### ⚠ BREAKING CHANGES + +* **platforms/windows:** Update to windows-rs 0.42.0 (#148) + +### Bug Fixes + +* **consumer, platforms/windows, platforms/winit:** Update to parking_lot 0.12.1 ([#146](https://www.github.com/AccessKit/accesskit/issues/146)) ([6772855](https://www.github.com/AccessKit/accesskit/commit/6772855a7b540fd728faad15d8d208b05c1bbd8a)) +* **platforms/windows:** Update to windows-rs 0.42.0 ([#148](https://www.github.com/AccessKit/accesskit/issues/148)) ([70d1a89](https://www.github.com/AccessKit/accesskit/commit/70d1a89f51fd6c3a32b7192d9d7f3937db09d196)) + +### [0.3.3](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.3.2...accesskit_winit-v0.3.3) (2022-11-11) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.6.1 to 0.7.0 + +### [0.3.2](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.3.1...accesskit_winit-v0.3.2) (2022-10-11) + + +### Bug Fixes + +* **platforms/winit:** Derive `Debug` on `ActionRequestEvent` ([#141](https://www.github.com/AccessKit/accesskit/issues/141)) ([8b84c75](https://www.github.com/AccessKit/accesskit/commit/8b84c7547c6fdb52cd6d5c6d79f812dc614f08dd)) + +### [0.3.1](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.3.0...accesskit_winit-v0.3.1) (2022-10-10) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.6.0 to 0.6.1 + +## [0.3.0](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.2.1...accesskit_winit-v0.3.0) (2022-10-09) + + +### ⚠ BREAKING CHANGES + +* Wrap `TreeUpdate` nodes in `Arc` (#135) +* Store node ID in `TreeUpdate`, not `accesskit::Node` (#132) + +### Code Refactoring + +* Store node ID in `TreeUpdate`, not `accesskit::Node` ([#132](https://www.github.com/AccessKit/accesskit/issues/132)) ([0bb86dd](https://www.github.com/AccessKit/accesskit/commit/0bb86ddb298cb5a253a91f07be0bad8b84b2fda3)) +* Wrap `TreeUpdate` nodes in `Arc` ([#135](https://www.github.com/AccessKit/accesskit/issues/135)) ([907bc18](https://www.github.com/AccessKit/accesskit/commit/907bc1820b80d95833b6c5c3acaa2a8a4e93a6c2)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.5.1 to 0.6.0 + +### [0.2.1](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.2.0...accesskit_winit-v0.2.1) (2022-10-03) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.5.0 to 0.5.1 + +## [0.2.0](https://www.github.com/AccessKit/accesskit/compare/accesskit_winit-v0.1.0...accesskit_winit-v0.2.0) (2022-09-23) + + +### ⚠ BREAKING CHANGES + +* Basic live regions (#128) +* **platforms/windows:** Bump windows-rs dependency (#126) +* **platforms/winit:** Bump winit dependency (#125) + +### Features + +* Basic live regions ([#128](https://www.github.com/AccessKit/accesskit/issues/128)) ([03d745b](https://www.github.com/AccessKit/accesskit/commit/03d745b891147175bde2693cc10b96a2f6e31f39)) + + +### Miscellaneous Chores + +* **platforms/windows:** Bump windows-rs dependency ([#126](https://www.github.com/AccessKit/accesskit/issues/126)) ([472a75e](https://www.github.com/AccessKit/accesskit/commit/472a75e4214b90396f3282f247df08100ed8362d)) +* **platforms/winit:** Bump winit dependency ([#125](https://www.github.com/AccessKit/accesskit/issues/125)) ([6026c1b](https://www.github.com/AccessKit/accesskit/commit/6026c1b2ecede3ca2f2076075ed158000154b34e)) + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.4.0 to 0.5.0 + +## 0.1.0 (2022-07-22) + + +### Features + +* **platforms/winit:** New winit adapter ([#121](https://www.github.com/AccessKit/accesskit/issues/121)) ([fdc274e](https://www.github.com/AccessKit/accesskit/commit/fdc274e7d3a901873d2ad0c7a4824a19111787ef)) + + + +### Dependencies + +* The following workspace dependencies were updated + * dependencies + * accesskit bumped from 0.3.0 to 0.4.0 diff --git a/packages/accesskit_xplat/Cargo.toml b/packages/accesskit_xplat/Cargo.toml new file mode 100644 index 000000000..f8a13d2d7 --- /dev/null +++ b/packages/accesskit_xplat/Cargo.toml @@ -0,0 +1,33 @@ +[package] +name = "accesskit_xplat" +version = "0.1.0" +license = "Apache-2.0" +description = "AccessKit UI accessibility infrastructure: cross-platform adapter" +keywords = ["gui", "ui", "accessibility"] +repository.workspace = true +edition.workspace = true +rust-version.workspace = true + +[features] +default = ["accesskit_unix", "async-io"] +async-io = ["accesskit_unix/async-io"] +tokio = ["accesskit_unix/tokio"] + +[dependencies] +accesskit = { version = "0.22" } +winit-core = { version = "0.31.0-beta.2", default-features = false } +raw-window-handle = { version = "0.6.2", features = ["std"] } + +[target.'cfg(target_os = "windows")'.dependencies] +accesskit_windows = { version = "0.30.0" } + +[target.'cfg(target_os = "macos")'.dependencies] +accesskit_macos = { version = "0.23.0" } + +[target.'cfg(any(target_os = "linux", target_os = "dragonfly", target_os = "freebsd", target_os = "openbsd", target_os = "netbsd"))'.dependencies] +accesskit_unix = { version = "0.18.0", optional = true, default-features = false } + +[target.'cfg(target_os = "android")'.dependencies] +accesskit_android = { version = "0.5.0", optional = true, features = ["embedded-dex"] } +android-activity = { version = "0.6.0" } + diff --git a/packages/accesskit_xplat/src/lib.rs b/packages/accesskit_xplat/src/lib.rs new file mode 100644 index 000000000..57e8eb926 --- /dev/null +++ b/packages/accesskit_xplat/src/lib.rs @@ -0,0 +1,164 @@ +// Copyright 2022 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +/// ## Compatibility with async runtimes +/// +/// The following only applies on Linux/Unix: +/// +/// While this crate's API is purely blocking, it internally spawns asynchronous tasks on an executor. +/// +/// - If you use tokio, make sure to enable the `tokio` feature of this crate. +/// - If you use another async runtime or if you don't use one at all, the default feature will suit your needs. + +#[cfg(all( + feature = "accesskit_unix", + any( + target_os = "linux", + target_os = "dragonfly", + target_os = "freebsd", + target_os = "netbsd", + target_os = "openbsd" + ), + not(feature = "async-io"), + not(feature = "tokio") +))] +compile_error!("Either \"async-io\" (default) or \"tokio\" feature must be enabled."); + +#[cfg(all( + feature = "accesskit_unix", + any( + target_os = "linux", + target_os = "dragonfly", + target_os = "freebsd", + target_os = "netbsd", + target_os = "openbsd" + ), + feature = "async-io", + feature = "tokio" +))] +compile_error!( + "Both \"async-io\" (default) and \"tokio\" features cannot be enabled at the same time." +); + +use std::sync::Arc; + +use accesskit::{ + ActionHandler, ActionRequest, ActivationHandler, DeactivationHandler, Rect, TreeUpdate, +}; +use raw_window_handle::RawWindowHandle; + +mod platform_impl; + +#[derive(Clone, Debug, PartialEq)] +pub enum WindowEvent { + InitialTreeRequested, + ActionRequested(ActionRequest), + AccessibilityDeactivated, +} + +pub trait EventHandler: Send + 'static { + fn handle_accesskit_event(&self, event: WindowEvent); +} + +#[derive(Clone)] +struct CombinedHandler(Arc); + +impl ActivationHandler for CombinedHandler { + fn request_initial_tree(&mut self) -> Option { + self.0 + .handle_accesskit_event(WindowEvent::InitialTreeRequested); + None + } +} +impl DeactivationHandler for CombinedHandler { + fn deactivate_accessibility(&mut self) { + self.0 + .handle_accesskit_event(WindowEvent::AccessibilityDeactivated); + } +} +impl ActionHandler for CombinedHandler { + fn do_action(&mut self, request: ActionRequest) { + self.0 + .handle_accesskit_event(WindowEvent::ActionRequested(request)); + } +} + +pub struct Adapter { + /// A user-supplied ID that we pass back to + inner: platform_impl::Adapter, +} + +impl Adapter { + /// Creates a new AccessKit adapter for a winit window. This must be done + /// before the window is shown for the first time. This means that you must + /// use [`winit::window::WindowAttributes::with_visible`] to make the window + /// initially invisible, then create the adapter, then show the window. + /// + /// Use this if you want to provide your own AccessKit handler callbacks + /// rather than dispatching requests through the winit event loop. This is + /// especially useful for the activation handler, because depending on + /// your application's architecture, implementing the handler directly may + /// allow you to return an initial tree synchronously, rather than requiring + /// some platform adapters to use a placeholder tree until you send + /// the first update. However, remember that each of these handlers may be + /// called on any thread, depending on the underlying platform adapter. + /// + /// # Panics + /// + /// Panics if the window is already visible. + pub fn with_split_handlers( + #[cfg(target_os = "android")] android_app: &AndroidApp, + #[cfg(not(target_os = "android"))] window: &RawWindowHandle, + activation_handler: impl 'static + ActivationHandler + Send, + action_handler: impl 'static + ActionHandler + Send, + deactivation_handler: impl 'static + DeactivationHandler + Send, + ) -> Self { + let inner = platform_impl::Adapter::new( + #[cfg(target_os = "android")] + android_app, + #[cfg(not(target_os = "android"))] + window, + activation_handler, + action_handler, + deactivation_handler, + ); + Self { inner } + } + + pub fn with_combined_handler( + #[cfg(target_os = "android")] android_app: &AndroidApp, + #[cfg(not(target_os = "android"))] window: &RawWindowHandle, + handler: Arc, + ) -> Self { + let handler = CombinedHandler(handler); + let inner = platform_impl::Adapter::new( + #[cfg(target_os = "android")] + android_app, + #[cfg(not(target_os = "android"))] + window, + handler.clone(), + handler.clone(), + handler, + ); + Self { inner } + } + + /// If and only if the tree has been initialized, call the provided function + /// and apply the resulting update. Note: If the caller's implementation of + /// [`ActivationHandler::request_initial_tree`] initially returned `None`, + /// or if the caller created the adapter using [`EventLoopProxy`], then + /// the [`TreeUpdate`] returned by the provided function must contain + /// a full tree. + pub fn update_if_active(&mut self, updater: impl FnOnce() -> TreeUpdate) { + self.inner.update_if_active(updater); + } + + pub fn set_focus(&mut self, is_focused: bool) { + self.inner.set_focus(is_focused); + } + + pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) { + self.inner.set_window_bounds(outer_bounds, inner_bounds); + } +} diff --git a/packages/accesskit_xplat/src/platform_impl/android.rs b/packages/accesskit_xplat/src/platform_impl/android.rs new file mode 100644 index 000000000..89f2dfd7f --- /dev/null +++ b/packages/accesskit_xplat/src/platform_impl/android.rs @@ -0,0 +1,46 @@ +// Copyright 2025 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, TreeUpdate}; +use accesskit_android::{ + InjectingAdapter, + jni::{JavaVM, objects::JObject}, +}; +use android_activity::AndroidApp; + +pub struct Adapter { + adapter: InjectingAdapter, +} + +impl Adapter { + pub fn new( + android_app: &AndroidApp, + activation_handler: impl 'static + ActivationHandler + Send, + action_handler: impl 'static + ActionHandler + Send, + _deactivation_handler: impl 'static + DeactivationHandler, + ) -> Self { + let vm = unsafe { JavaVM::from_raw(android_app.vm_as_ptr() as *mut _) }.unwrap(); + let mut env = vm.get_env().unwrap(); + let activity = unsafe { JObject::from_raw(android_app.activity_as_ptr() as *mut _) }; + let view = env + .get_field( + &activity, + "mSurfaceView", + "Lcom/google/androidgamesdk/GameActivity$InputEnabledSurfaceView;", + ) + .unwrap() + .l() + .unwrap(); + let adapter = InjectingAdapter::new(&mut env, &view, activation_handler, action_handler); + Self { adapter } + } + + pub fn update_if_active(&mut self, updater: impl FnOnce() -> TreeUpdate) { + self.adapter.update_if_active(updater); + } + + pub fn set_focus(&mut self, is_focused: bool) {} + + pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) {} +} diff --git a/packages/accesskit_xplat/src/platform_impl/macos.rs b/packages/accesskit_xplat/src/platform_impl/macos.rs new file mode 100644 index 000000000..88a565838 --- /dev/null +++ b/packages/accesskit_xplat/src/platform_impl/macos.rs @@ -0,0 +1,43 @@ +// Copyright 2022 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; +use accesskit_macos::SubclassingAdapter; +use raw_window_handle::RawWindowHandle; + +pub struct Adapter { + adapter: SubclassingAdapter, +} + +impl Adapter { + pub fn new( + window_handle: &RawWindowHandle, + activation_handler: impl 'static + ActivationHandler, + action_handler: impl 'static + ActionHandler, + _deactivation_handler: impl 'static + DeactivationHandler, + ) -> Self { + let view = match window_handle { + RawWindowHandle::AppKit(handle) => handle.ns_view.as_ptr(), + RawWindowHandle::UiKit(_) => unimplemented!(), + _ => unreachable!(), + }; + + let adapter = unsafe { SubclassingAdapter::new(view, activation_handler, action_handler) }; + Self { adapter } + } + + pub fn update_if_active(&mut self, updater: impl FnOnce() -> TreeUpdate) { + if let Some(events) = self.adapter.update_if_active(updater) { + events.raise(); + } + } + + pub fn set_focus(&mut self, is_focused: bool) { + if let Some(events) = self.adapter.update_view_focus_state(is_focused) { + events.raise(); + } + } + + pub fn set_window_bounds(&mut self, _outer_bounds: Rect, _inner_bounds: Rect) {} +} diff --git a/packages/accesskit_xplat/src/platform_impl/mod.rs b/packages/accesskit_xplat/src/platform_impl/mod.rs new file mode 100644 index 000000000..27f7df0c5 --- /dev/null +++ b/packages/accesskit_xplat/src/platform_impl/mod.rs @@ -0,0 +1,50 @@ +// Copyright 2022 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +// Based loosely on winit's src/platform_impl/mod.rs. + +pub use self::platform::*; + +#[cfg(target_os = "windows")] +#[path = "windows.rs"] +mod platform; + +#[cfg(target_os = "macos")] +#[path = "macos.rs"] +mod platform; + +#[cfg(all( + feature = "accesskit_unix", + any( + target_os = "linux", + target_os = "dragonfly", + target_os = "freebsd", + target_os = "netbsd", + target_os = "openbsd" + ) +))] +#[path = "unix.rs"] +mod platform; + +#[cfg(all(feature = "accesskit_android", target_os = "android"))] +#[path = "android.rs"] +mod platform; + +#[cfg(not(any( + target_os = "windows", + target_os = "macos", + all( + feature = "accesskit_unix", + any( + target_os = "linux", + target_os = "dragonfly", + target_os = "freebsd", + target_os = "netbsd", + target_os = "openbsd" + ) + ), + all(feature = "accesskit_android", target_os = "android") +)))] +#[path = "null.rs"] +mod platform; diff --git a/packages/accesskit_xplat/src/platform_impl/null.rs b/packages/accesskit_xplat/src/platform_impl/null.rs new file mode 100644 index 000000000..c68c9378a --- /dev/null +++ b/packages/accesskit_xplat/src/platform_impl/null.rs @@ -0,0 +1,24 @@ +// Copyright 2022 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, TreeUpdate}; + +pub struct Adapter; + +impl Adapter { + pub fn new( + _window_handle: &RawWindowHandle, + _activation_handler: impl 'static + ActivationHandler, + _action_handler: impl 'static + ActionHandler, + _deactivation_handler: impl 'static + DeactivationHandler, + ) -> Self { + Self {} + } + + pub fn update_if_active(&mut self, _updater: impl FnOnce() -> TreeUpdate) {} + + pub fn set_focus(&mut self, is_focused: bool) {} + + pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) {} +} diff --git a/packages/accesskit_xplat/src/platform_impl/unix.rs b/packages/accesskit_xplat/src/platform_impl/unix.rs new file mode 100644 index 000000000..50896a2a6 --- /dev/null +++ b/packages/accesskit_xplat/src/platform_impl/unix.rs @@ -0,0 +1,43 @@ +// Copyright 2022 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; +use accesskit_unix::Adapter as UnixAdapter; +use raw_window_handle::RawWindowHandle; + +pub struct Adapter { + adapter: UnixAdapter, +} + +impl Adapter { + pub fn new( + _window_handle: &RawWindowHandle, + activation_handler: impl 'static + ActivationHandler + Send, + action_handler: impl 'static + ActionHandler + Send, + deactivation_handler: impl 'static + DeactivationHandler + Send, + ) -> Self { + let adapter = UnixAdapter::new(activation_handler, action_handler, deactivation_handler); + Self { adapter } + } + + fn set_root_window_bounds(&mut self, outer: Rect, inner: Rect) { + self.adapter.set_root_window_bounds(outer, inner); + } + + pub fn update_if_active(&mut self, updater: impl FnOnce() -> TreeUpdate) { + self.adapter.update_if_active(updater); + } + + fn update_window_focus_state(&mut self, is_focused: bool) { + self.adapter.update_window_focus_state(is_focused); + } + + pub fn set_focus(&mut self, is_focused: bool) { + self.update_window_focus_state(*is_focused); + } + + pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) { + self.set_root_window_bounds(outer_bounds, inner_bounds) + } +} diff --git a/packages/accesskit_xplat/src/platform_impl/windows.rs b/packages/accesskit_xplat/src/platform_impl/windows.rs new file mode 100644 index 000000000..b9475104f --- /dev/null +++ b/packages/accesskit_xplat/src/platform_impl/windows.rs @@ -0,0 +1,40 @@ +// Copyright 2022 The AccessKit Authors. All rights reserved. +// Licensed under the Apache License, Version 2.0 (found in +// the LICENSE-APACHE file). + +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, TreeUpdate}; +use accesskit_windows::{HWND, SubclassingAdapter}; +use raw_window_handle::RawWindowHandle; +use winit::{event::WindowEvent, event_loop::ActiveEventLoop, window::Window}; + +pub struct Adapter { + adapter: SubclassingAdapter, +} + +impl Adapter { + pub fn new( + window_handle: &RawWindowHandle, + activation_handler: impl 'static + ActivationHandler, + action_handler: impl 'static + ActionHandler + Send, + _deactivation_handler: impl 'static + DeactivationHandler, + ) -> Self { + let hwnd = match window_handle { + RawWindowHandle::Win32(handle) => handle.hwnd.get() as *mut _, + RawWindowHandle::WinRt(_) => unimplemented!(), + _ => unreachable!(), + }; + + let adapter = SubclassingAdapter::new(HWND(hwnd), activation_handler, action_handler); + Self { adapter } + } + + pub fn update_if_active(&mut self, updater: impl FnOnce() -> TreeUpdate) { + if let Some(events) = self.adapter.update_if_active(updater) { + events.raise(); + } + } + + pub fn set_focus(&mut self, is_focused: bool) {} + + pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) {} +} From 7688e3eb7830237b5aa6774a9f7eb446b6b6a3da Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:07:30 +0000 Subject: [PATCH 37/67] Re-enable accessibility support based on accesskit_xplat Signed-off-by: Nico Burns --- Cargo.lock | 25 ++++----- Cargo.toml | 4 +- packages/accesskit_xplat/src/lib.rs | 8 +-- packages/blitz-shell/Cargo.toml | 4 +- packages/blitz-shell/src/accessibility.rs | 67 ++++++++++++++++++++--- packages/blitz-shell/src/application.rs | 32 +++++------ packages/blitz-shell/src/event.rs | 24 +++----- packages/blitz-shell/src/window.rs | 5 ++ 8 files changed, 104 insertions(+), 65 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 295d69f6f..73481d095 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -18,12 +18,6 @@ version = "0.1.10" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "366ffbaa4442f4684d91e2cd7c5ea7c4ed8add41959a31447066e279e432b618" -[[package]] -name = "accesskit" -version = "0.17.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d3d3b8f9bae46a948369bc4a03e815d4ed6d616bd00de4051133a5019dc31c5a" - [[package]] name = "accesskit" version = "0.22.0" @@ -36,7 +30,7 @@ version = "0.5.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d28b60a573c7165b1eb346d66c14e85a1f7923fe2e71e396ce936ca6afb519ae" dependencies = [ - "accesskit 0.22.0", + "accesskit", "accesskit_consumer", "jni", "log", @@ -48,7 +42,7 @@ version = "0.15.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "3eb9cc46b7fb6987c4f891f0301b230b29d9e69b4854f060a0cf41fbc407ab77" dependencies = [ - "accesskit 0.22.0", + "accesskit", "accesskit_consumer", "atspi-common", "serde", @@ -61,7 +55,7 @@ version = "0.32.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "69d880a613f29621c90e801feec40f5dd61d837d7e20bf9b67676d45e7364a36" dependencies = [ - "accesskit 0.22.0", + "accesskit", "hashbrown 0.16.1", ] @@ -71,7 +65,7 @@ version = "0.23.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "5b0ddfc3fe3d457d11cc1c4989105986a03583a1d54d0c25053118944b62e100" dependencies = [ - "accesskit 0.22.0", + "accesskit", "accesskit_consumer", "hashbrown 0.16.1", "objc2 0.5.2", @@ -85,7 +79,7 @@ version = "0.18.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d5d552169ef018149966ed139bb0311c6947b3343e9140d1b9f88d69da9528fd" dependencies = [ - "accesskit 0.22.0", + "accesskit", "accesskit_atspi_common", "async-channel", "async-executor", @@ -105,7 +99,7 @@ version = "0.30.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d277279d0a3b0c0021dd110b55aa1fe326b09ee2cbc338df28f847c7daf94e25" dependencies = [ - "accesskit 0.22.0", + "accesskit", "accesskit_consumer", "hashbrown 0.16.1", "static_assertions", @@ -117,7 +111,7 @@ dependencies = [ name = "accesskit_xplat" version = "0.1.0" dependencies = [ - "accesskit 0.22.0", + "accesskit", "accesskit_android", "accesskit_macos", "accesskit_unix", @@ -785,7 +779,7 @@ dependencies = [ name = "blitz-dom" version = "0.2.2" dependencies = [ - "accesskit 0.17.1", + "accesskit", "app_units", "atomic_refcell", "bitflags 2.10.0", @@ -896,7 +890,8 @@ dependencies = [ name = "blitz-shell" version = "0.2.2" dependencies = [ - "accesskit 0.17.1", + "accesskit", + "accesskit_xplat", "android-activity", "anyrender", "arboard", diff --git a/Cargo.toml b/Cargo.toml index 4c845509c..5ab7dcdb8 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -45,6 +45,7 @@ stylo_taffy = { version = "0.2.0", path = "./packages/stylo_taffy", default-feat dioxus-native = { version = "0.7.0", path = "./packages/dioxus-native", default-features = false } dioxus-native-dom = { version = "0.7.0", path = "./packages/dioxus-native-dom", default-features = false } debug_timer = { version = "0.1.2", path = "./packages/debug_timer" } +accesskit_xplat = { version = "0.1", path = "./packages/accesskit_xplat", default-features = false } # Servo dependencies style = { version = "0.9.0", package = "stylo" } @@ -130,8 +131,7 @@ usvg = "0.45.1" # Windowing & Input raw-window-handle = "0.6.0" winit = { version = "=0.31.0-beta.2" } -accesskit_winit = "0.23" -accesskit = "0.17" +accesskit = "0.22" arboard = { version = "3.4.1", default-features = false } rfd = { version = "0.15.3", default-features = false } keyboard-types = "0.7" diff --git a/packages/accesskit_xplat/src/lib.rs b/packages/accesskit_xplat/src/lib.rs index 57e8eb926..f47b57679 100644 --- a/packages/accesskit_xplat/src/lib.rs +++ b/packages/accesskit_xplat/src/lib.rs @@ -109,7 +109,7 @@ impl Adapter { /// Panics if the window is already visible. pub fn with_split_handlers( #[cfg(target_os = "android")] android_app: &AndroidApp, - #[cfg(not(target_os = "android"))] window: &RawWindowHandle, + #[cfg(not(target_os = "android"))] window: RawWindowHandle, activation_handler: impl 'static + ActivationHandler + Send, action_handler: impl 'static + ActionHandler + Send, deactivation_handler: impl 'static + DeactivationHandler + Send, @@ -118,7 +118,7 @@ impl Adapter { #[cfg(target_os = "android")] android_app, #[cfg(not(target_os = "android"))] - window, + &window, activation_handler, action_handler, deactivation_handler, @@ -128,7 +128,7 @@ impl Adapter { pub fn with_combined_handler( #[cfg(target_os = "android")] android_app: &AndroidApp, - #[cfg(not(target_os = "android"))] window: &RawWindowHandle, + #[cfg(not(target_os = "android"))] window: RawWindowHandle, handler: Arc, ) -> Self { let handler = CombinedHandler(handler); @@ -136,7 +136,7 @@ impl Adapter { #[cfg(target_os = "android")] android_app, #[cfg(not(target_os = "android"))] - window, + &window, handler.clone(), handler.clone(), handler, diff --git a/packages/blitz-shell/Cargo.toml b/packages/blitz-shell/Cargo.toml index 0c959632b..bb79569b3 100644 --- a/packages/blitz-shell/Cargo.toml +++ b/packages/blitz-shell/Cargo.toml @@ -14,7 +14,7 @@ rust-version.workspace = true default = ["accessibility", "clipboard", "file_dialog"] accessibility = [ "dep:accesskit", - # "dep:accesskit_winit", + "dep:accesskit_xplat", "blitz-dom/accessibility", ] clipboard = ["dep:arboard"] @@ -34,7 +34,7 @@ anyrender = { workspace = true } winit = { workspace = true } keyboard-types = { workspace = true } accesskit = { workspace = true, optional = true } -# accesskit_winit = { workspace = true, optional = true } +accesskit_xplat = { workspace = true, optional = true } # Other dependencies tracing = { workspace = true, optional = true } diff --git a/packages/blitz-shell/src/accessibility.rs b/packages/blitz-shell/src/accessibility.rs index 79fc8ac3d..ab3f6e333 100644 --- a/packages/blitz-shell/src/accessibility.rs +++ b/packages/blitz-shell/src/accessibility.rs @@ -1,25 +1,74 @@ -use crate::event::BlitzShellProxy; -// use accesskit_winit::Adapter; +use crate::{BlitzShellEvent, event::BlitzShellProxy}; +use accesskit::Rect; +use accesskit_xplat::{Adapter, EventHandler, WindowEvent as AccessKitEvent}; use blitz_dom::BaseDocument; -use winit::window::Window; +use std::sync::Arc; +use winit::{ + event::WindowEvent, + raw_window_handle::HasWindowHandle, + window::{Window, WindowId}, +}; /// State of the accessibility node tree and platform adapter. pub struct AccessibilityState { // /// Adapter to connect to the [`EventLoop`](`winit::event_loop::EventLoop`). - // adapter: accesskit_winit::Adapter, + adapter: Adapter, +} + +struct Handler { + window_id: WindowId, + proxy: BlitzShellProxy, +} +impl EventHandler for Handler { + fn handle_accesskit_event(&self, event: AccessKitEvent) { + self.proxy.send_event(BlitzShellEvent::Accessibility { + window_id: self.window_id, + data: Arc::new(event), + }); + } } impl AccessibilityState { pub fn new(window: &dyn Window, proxy: BlitzShellProxy) -> Self { - let _ = window; - let _ = proxy; + let window_id = window.id(); Self { - // adapter: Adapter::with_event_loop_proxy(window, proxy.clone()), + adapter: Adapter::with_combined_handler( + window.window_handle().unwrap().as_raw(), + Arc::new(Handler { window_id, proxy }), + ), } } pub fn update_tree(&mut self, doc: &BaseDocument) { let _ = doc; - // self.adapter - // .update_if_active(|| doc.build_accessibility_tree()); + self.adapter + .update_if_active(|| doc.build_accessibility_tree()); + } + + /// Allows reacting to window events. + /// + /// This must be called whenever a new window event is received + /// and before it is handled by the application. + pub fn process_window_event(&mut self, window: &dyn Window, event: &WindowEvent) { + match event { + WindowEvent::Focused(is_focused) => { + self.adapter.set_focus(*is_focused); + } + WindowEvent::Moved(_) | WindowEvent::SurfaceResized(_) => { + let outer_position: (_, _) = window + .outer_position() + .unwrap_or_default() + .cast::() + .into(); + let outer_size: (_, _) = window.outer_size().cast::().into(); + let inner_position: (_, _) = window.surface_position().cast::().into(); + let inner_size: (_, _) = window.surface_size().cast::().into(); + + self.adapter.set_window_bounds( + Rect::from_origin_size(outer_position, outer_size), + Rect::from_origin_size(inner_position, inner_size), + ) + } + _ => (), + } } } diff --git a/packages/blitz-shell/src/application.rs b/packages/blitz-shell/src/application.rs index 9b03501c7..2bd6bdd71 100644 --- a/packages/blitz-shell/src/application.rs +++ b/packages/blitz-shell/src/application.rs @@ -56,22 +56,22 @@ impl BlitzApplication { } } - // #[cfg(feature = "accessibility")] - // BlitzShellEvent::Accessibility { window_id, data } => { - // if let Some(window) = self.windows.get_mut(&window_id) { - // match &*data { - // accesskit_winit::WindowEvent::InitialTreeRequested => { - // window.build_accessibility_tree(); - // } - // accesskit_winit::WindowEvent::AccessibilityDeactivated => { - // // TODO - // } - // accesskit_winit::WindowEvent::ActionRequested(_req) => { - // // TODO - // } - // } - // } - // } + #[cfg(feature = "accessibility")] + BlitzShellEvent::Accessibility { window_id, data } => { + if let Some(window) = self.windows.get_mut(&window_id) { + match &*data { + accesskit_xplat::WindowEvent::InitialTreeRequested => { + window.build_accessibility_tree(); + } + accesskit_xplat::WindowEvent::AccessibilityDeactivated => { + // TODO + } + accesskit_xplat::WindowEvent::ActionRequested(_req) => { + // TODO + } + } + } + } BlitzShellEvent::Embedder(_) => { // Do nothing. Should be handled by embedders (if required). } diff --git a/packages/blitz-shell/src/event.rs b/packages/blitz-shell/src/event.rs index 6b3ce497e..1093ba357 100644 --- a/packages/blitz-shell/src/event.rs +++ b/packages/blitz-shell/src/event.rs @@ -5,8 +5,8 @@ use std::sync::mpsc::{Receiver, Sender, channel}; use std::{any::Any, sync::Arc}; use winit::{event_loop::EventLoopProxy, window::WindowId}; -// #[cfg(feature = "accessibility")] -// use accesskit_winit::{Event as AccessKitEvent, WindowEvent as AccessKitWindowEvent}; +#[cfg(feature = "accessibility")] +use accesskit_xplat::WindowEvent as AccessKitEvent; #[derive(Debug, Clone)] pub enum BlitzShellEvent { @@ -19,11 +19,11 @@ pub enum BlitzShellEvent { }, /// An accessibility event from `accesskit`. - // #[cfg(feature = "accessibility")] - // Accessibility { - // window_id: WindowId, - // data: Arc, - // }, + #[cfg(feature = "accessibility")] + Accessibility { + window_id: WindowId, + data: Arc, + }, /// An arbitary event from the Blitz embedder Embedder(Arc), @@ -46,16 +46,6 @@ impl BlitzShellEvent { } } -// #[cfg(feature = "accessibility")] -// impl From for BlitzShellEvent { -// fn from(value: AccessKitEvent) -> Self { -// Self::Accessibility { -// window_id: value.window_id, -// data: Arc::new(value.window_event), -// } -// } -// } - #[derive(Clone)] pub struct BlitzShellProxy(Arc); pub struct BlitzShellProxyInner { diff --git a/packages/blitz-shell/src/window.rs b/packages/blitz-shell/src/window.rs index 874139c0b..f754f3715 100644 --- a/packages/blitz-shell/src/window.rs +++ b/packages/blitz-shell/src/window.rs @@ -307,6 +307,11 @@ impl View { } pub fn handle_winit_event(&mut self, event: WindowEvent) { + // Update accessibility focus and window size state in response to a Winit WindowEvent + #[cfg(feature = "accessibility")] + self.accessibility + .process_window_event(&*self.window, &event); + match event { WindowEvent::Destroyed => {} WindowEvent::ActivationTokenDone { .. } => {}, From 8de27831e224ca4a8b8a68c41675f8cb7d0962f8 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:13:55 +0000 Subject: [PATCH 38/67] Fix clippy linux issues --- packages/accesskit_xplat/src/lib.rs | 2 +- packages/accesskit_xplat/src/platform_impl/unix.rs | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/packages/accesskit_xplat/src/lib.rs b/packages/accesskit_xplat/src/lib.rs index f47b57679..4e4984106 100644 --- a/packages/accesskit_xplat/src/lib.rs +++ b/packages/accesskit_xplat/src/lib.rs @@ -57,7 +57,7 @@ pub enum WindowEvent { AccessibilityDeactivated, } -pub trait EventHandler: Send + 'static { +pub trait EventHandler: Send + Sync + 'static { fn handle_accesskit_event(&self, event: WindowEvent); } diff --git a/packages/accesskit_xplat/src/platform_impl/unix.rs b/packages/accesskit_xplat/src/platform_impl/unix.rs index 50896a2a6..ee320e5c8 100644 --- a/packages/accesskit_xplat/src/platform_impl/unix.rs +++ b/packages/accesskit_xplat/src/platform_impl/unix.rs @@ -34,7 +34,7 @@ impl Adapter { } pub fn set_focus(&mut self, is_focused: bool) { - self.update_window_focus_state(*is_focused); + self.update_window_focus_state(is_focused); } pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) { From f36f14e8f15adfb7c4ff4e30c4f2e33e18f4d4dd Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:17:30 +0000 Subject: [PATCH 39/67] Feature flag MacOS handler Signed-off-by: Nico Burns --- apps/readme/src/readme_application.rs | 2 ++ 1 file changed, 2 insertions(+) diff --git a/apps/readme/src/readme_application.rs b/apps/readme/src/readme_application.rs index db45cf4c1..3e635d910 100644 --- a/apps/readme/src/readme_application.rs +++ b/apps/readme/src/readme_application.rs @@ -11,6 +11,7 @@ use winit::application::ApplicationHandler; use winit::event::{Modifiers, StartCause, WindowEvent}; use winit::event_loop::ActiveEventLoop; use winit::keyboard::{KeyCode, PhysicalKey}; +#[cfg(target_os = "macos")] use winit::platform::macos::ApplicationHandlerExtMacOS; use winit::window::{Theme, WindowId}; @@ -131,6 +132,7 @@ impl ReadmeApplication { } impl ApplicationHandler for ReadmeApplication { + #[cfg(target_os = "macos")] fn macos_handler(&mut self) -> Option<&mut dyn ApplicationHandlerExtMacOS> { self.inner.macos_handler() } From f945d449502a5317579afdcc2194af2eefe66002 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:21:15 +0000 Subject: [PATCH 40/67] Add Android and iOS CI tasks Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 16 ++++++++++++++++ 1 file changed, 16 insertions(+) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 5d05cffbf..cbb56cd69 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -156,6 +156,22 @@ jobs: command: "test", args: "--all --tests", } + - { + name: ios, + target: aarch64-apple-ios, + os: macos-latest, + cross: false, + command: "build", + args: "--all", + } + - { + name: android, + target: aarch64-linux-android, + os: ubuntu-latest, + cross: false, + command: "build", + args: "--all", + } name: Test (${{ matrix.platform.name }}) From 61a1af327c5d26191894935c8ab44dfd43809cd8 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:21:59 +0000 Subject: [PATCH 41/67] Import Rect Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/platform_impl/null.rs | 2 +- packages/accesskit_xplat/src/platform_impl/windows.rs | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/packages/accesskit_xplat/src/platform_impl/null.rs b/packages/accesskit_xplat/src/platform_impl/null.rs index c68c9378a..6e3fe02d9 100644 --- a/packages/accesskit_xplat/src/platform_impl/null.rs +++ b/packages/accesskit_xplat/src/platform_impl/null.rs @@ -2,7 +2,7 @@ // Licensed under the Apache License, Version 2.0 (found in // the LICENSE-APACHE file). -use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, TreeUpdate}; +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; pub struct Adapter; diff --git a/packages/accesskit_xplat/src/platform_impl/windows.rs b/packages/accesskit_xplat/src/platform_impl/windows.rs index b9475104f..2421d2fb9 100644 --- a/packages/accesskit_xplat/src/platform_impl/windows.rs +++ b/packages/accesskit_xplat/src/platform_impl/windows.rs @@ -2,7 +2,7 @@ // Licensed under the Apache License, Version 2.0 (found in // the LICENSE-APACHE file). -use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, TreeUpdate}; +use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; use accesskit_windows::{HWND, SubclassingAdapter}; use raw_window_handle::RawWindowHandle; use winit::{event::WindowEvent, event_loop::ActiveEventLoop, window::Window}; @@ -34,7 +34,7 @@ impl Adapter { } } - pub fn set_focus(&mut self, is_focused: bool) {} + pub fn set_focus(&mut self, _is_focused: bool) {} pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) {} } From f205c08cc7b5f7f7a75f03505a64c77bd03b233b Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:29:40 +0000 Subject: [PATCH 42/67] More null backend fixes Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/platform_impl/null.rs | 5 +++-- 1 file changed, 3 insertions(+), 2 deletions(-) diff --git a/packages/accesskit_xplat/src/platform_impl/null.rs b/packages/accesskit_xplat/src/platform_impl/null.rs index 6e3fe02d9..465342097 100644 --- a/packages/accesskit_xplat/src/platform_impl/null.rs +++ b/packages/accesskit_xplat/src/platform_impl/null.rs @@ -3,6 +3,7 @@ // the LICENSE-APACHE file). use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; +use raw_window_handle::RawWindowHandle; pub struct Adapter; @@ -18,7 +19,7 @@ impl Adapter { pub fn update_if_active(&mut self, _updater: impl FnOnce() -> TreeUpdate) {} - pub fn set_focus(&mut self, is_focused: bool) {} + pub fn set_focus(&mut self, _is_focused: bool) {} - pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) {} + pub fn set_window_bounds(&mut self, _outer_bounds: Rect, _inner_bounds: Rect) {} } From d0d29316429c20e1712e060d415d6b6917cdf9c5 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:30:11 +0000 Subject: [PATCH 43/67] Install libssl-dev for Android Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index cbb56cd69..16d52540f 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -206,7 +206,7 @@ jobs: if: ${{ matrix.platform.os == 'ubuntu-latest' }} uses: awalsh128/cache-apt-pkgs-action@latest with: - packages: libasound2-dev libatk1.0-dev libgtk-3-dev libudev-dev libpango1.0-dev libxdo-dev + packages: libasound2-dev libatk1.0-dev libgtk-3-dev libudev-dev libpango1.0-dev libxdo-dev libssl-dev version: 1.0 - name: Setup From 35c92436cd0fd0f2035149bf8fea7091939e841f Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:42:12 +0000 Subject: [PATCH 44/67] Use rustls for reqwest Signed-off-by: Nico Burns --- Cargo.lock | 268 +++++++++++----------------------- Cargo.toml | 2 +- apps/browser/Cargo.toml | 2 +- packages/blitz-net/Cargo.toml | 3 +- 4 files changed, 90 insertions(+), 185 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 73481d095..26a1efd87 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -1229,7 +1229,7 @@ dependencies = [ "cocoa-foundation", "core-foundation 0.9.4", "core-graphics", - "foreign-types 0.5.0", + "foreign-types", "libc", "objc", ] @@ -1477,7 +1477,7 @@ dependencies = [ "bitflags 1.3.2", "core-foundation 0.9.4", "core-graphics-types 0.1.3", - "foreign-types 0.5.0", + "foreign-types", "libc", ] @@ -2618,15 +2618,6 @@ dependencies = [ "yeslogic-fontconfig-sys", ] -[[package]] -name = "foreign-types" -version = "0.3.2" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "f6f339eb8adc052cd2ca78910fda869aefa38d22d5cb648e6485e4d3fc06f3b1" -dependencies = [ - "foreign-types-shared 0.1.1", -] - [[package]] name = "foreign-types" version = "0.5.0" @@ -2634,7 +2625,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d737d9aa519fb7b749cbc3b962edcf310a8dd1f4b67c91c4f83975dbdd17d965" dependencies = [ "foreign-types-macros", - "foreign-types-shared 0.3.1", + "foreign-types-shared", ] [[package]] @@ -2648,12 +2639,6 @@ dependencies = [ "syn 2.0.111", ] -[[package]] -name = "foreign-types-shared" -version = "0.1.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b" - [[package]] name = "foreign-types-shared" version = "0.3.1" @@ -2847,8 +2832,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "335ff9f135e4384c8150d6f27c6daed433577f86b4750418338c01a1a2528592" dependencies = [ "cfg-if", + "js-sys", "libc", "wasi", + "wasm-bindgen", ] [[package]] @@ -2858,9 +2845,11 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "899def5c37c4fd7b2664648c28120ecec138e4d395b459e5ca34f9cce2dd77fd" dependencies = [ "cfg-if", + "js-sys", "libc", "r-efi", "wasip2", + "wasm-bindgen", ] [[package]] @@ -3387,22 +3376,7 @@ dependencies = [ "tokio", "tokio-rustls", "tower-service", -] - -[[package]] -name = "hyper-tls" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "70206fc6890eaca9fde8a0bf71caa2ddfc9fe045ac9e5c70df101a7dbde866e0" -dependencies = [ - "bytes", - "http-body-util", - "hyper", - "hyper-util", - "native-tls", - "tokio", - "tokio-native-tls", - "tower-service", + "webpki-roots", ] [[package]] @@ -3424,11 +3398,9 @@ dependencies = [ "percent-encoding", "pin-project-lite", "socket2", - "system-configuration", "tokio", "tower-service", "tracing", - "windows-registry", ] [[package]] @@ -3925,6 +3897,12 @@ version = "0.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "b3bd0dd2cd90571056fdb71f6275fada10131182f84899f4b2a916e565d81d86" +[[package]] +name = "lru-slab" +version = "0.1.2" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "112b39cec0b298b6c1999fee3e31427f74f676e4cb9879ed1a121b43661a4154" + [[package]] name = "mac" version = "0.1.1" @@ -4076,7 +4054,7 @@ dependencies = [ "bitflags 2.10.0", "block", "core-graphics-types 0.1.3", - "foreign-types 0.5.0", + "foreign-types", "log", "objc", "paste", @@ -4091,7 +4069,7 @@ dependencies = [ "bitflags 2.10.0", "block", "core-graphics-types 0.2.0", - "foreign-types 0.5.0", + "foreign-types", "log", "objc", "paste", @@ -4224,23 +4202,6 @@ dependencies = [ "unicode-ident", ] -[[package]] -name = "native-tls" -version = "0.2.14" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "87de3442987e9dbec73158d5c715e7ad9072fda936bb03d19d7fa10e00520f0e" -dependencies = [ - "libc", - "log", - "openssl", - "openssl-probe", - "openssl-sys", - "schannel", - "security-framework", - "security-framework-sys", - "tempfile", -] - [[package]] name = "ndk" version = "0.9.0" @@ -4763,50 +4724,6 @@ version = "1.70.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "384b8ab6d37215f3c5301a95a4accb5d64aa607f1fcb26a11b5303878451b4fe" -[[package]] -name = "openssl" -version = "0.10.75" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "08838db121398ad17ab8531ce9de97b244589089e290a384c900cb9ff7434328" -dependencies = [ - "bitflags 2.10.0", - "cfg-if", - "foreign-types 0.3.2", - "libc", - "once_cell", - "openssl-macros", - "openssl-sys", -] - -[[package]] -name = "openssl-macros" -version = "0.1.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "a948666b637a0f465e8564c73e89d4dde00d72d4d473cc972f390fc3dcee7d9c" -dependencies = [ - "proc-macro2", - "quote", - "syn 2.0.111", -] - -[[package]] -name = "openssl-probe" -version = "0.1.6" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d05e27ee213611ffe7d6348b942e8f942b37114c00cc03cec254295a4a17852e" - -[[package]] -name = "openssl-sys" -version = "0.9.111" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "82cab2d520aa75e3c58898289429321eb788c3106963d0dc886ec7a5f4adc321" -dependencies = [ - "cc", - "libc", - "pkg-config", - "vcpkg", -] - [[package]] name = "option-ext" version = "0.2.0" @@ -5278,6 +5195,61 @@ dependencies = [ "memchr", ] +[[package]] +name = "quinn" +version = "0.11.9" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b9e20a958963c291dc322d98411f541009df2ced7b5a4f2bd52337638cfccf20" +dependencies = [ + "bytes", + "cfg_aliases 0.2.1", + "pin-project-lite", + "quinn-proto", + "quinn-udp", + "rustc-hash 2.1.1", + "rustls", + "socket2", + "thiserror 2.0.17", + "tokio", + "tracing", + "web-time", +] + +[[package]] +name = "quinn-proto" +version = "0.11.13" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "f1906b49b0c3bc04b5fe5d86a77925ae6524a19b816ae38ce1e426255f1d8a31" +dependencies = [ + "bytes", + "getrandom 0.3.4", + "lru-slab", + "rand", + "ring", + "rustc-hash 2.1.1", + "rustls", + "rustls-pki-types", + "slab", + "thiserror 2.0.17", + "tinyvec", + "tracing", + "web-time", +] + +[[package]] +name = "quinn-udp" +version = "0.5.14" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "addec6a0dcad8a8d96a771f815f0eaf55f9d1805756410b39f5fa81332574cbd" +dependencies = [ + "cfg_aliases 0.2.1", + "libc", + "once_cell", + "socket2", + "tracing", + "windows-sys 0.52.0", +] + [[package]] name = "quote" version = "1.0.42" @@ -5496,22 +5468,22 @@ dependencies = [ "http-body-util", "hyper", "hyper-rustls", - "hyper-tls", "hyper-util", "js-sys", "log", "mime", "mime_guess", - "native-tls", "percent-encoding", "pin-project-lite", + "quinn", + "rustls", "rustls-pki-types", "serde", "serde_json", "serde_urlencoded", "sync_wrapper", "tokio", - "tokio-native-tls", + "tokio-rustls", "tokio-util", "tower", "tower-http", @@ -5521,6 +5493,7 @@ dependencies = [ "wasm-bindgen-futures", "wasm-streams", "web-sys", + "webpki-roots", ] [[package]] @@ -5645,6 +5618,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "533f54bc6a7d4f647e46ad909549eda97bf5afc1585190ef692b4286b198bd8f" dependencies = [ "once_cell", + "ring", "rustls-pki-types", "rustls-webpki", "subtle", @@ -5657,6 +5631,7 @@ version = "1.13.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "21e6f2ab2928ca4291b86736a8bd920a277a399bba1589409d72154ff87c1282" dependencies = [ + "web-time", "zeroize", ] @@ -5719,15 +5694,6 @@ dependencies = [ "winapi-util", ] -[[package]] -name = "schannel" -version = "0.1.28" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "891d81b926048e76efe18581bf793546b4c0eaf8448d72be8de2bbee5fd166e1" -dependencies = [ - "windows-sys 0.61.2", -] - [[package]] name = "scoped-tls" version = "1.0.1" @@ -5753,29 +5719,6 @@ dependencies = [ "tiny-skia", ] -[[package]] -name = "security-framework" -version = "2.11.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "897b2245f0b511c87893af39b033e5ca9cce68824c4d7e7630b5a1d339658d02" -dependencies = [ - "bitflags 2.10.0", - "core-foundation 0.9.4", - "core-foundation-sys", - "libc", - "security-framework-sys", -] - -[[package]] -name = "security-framework-sys" -version = "2.15.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cc1f0cbffaac4852523ce30d8bd3c5cdc873501d96ff467ca09b6767bb8cd5c0" -dependencies = [ - "core-foundation-sys", - "libc", -] - [[package]] name = "selectors" version = "0.33.0" @@ -6513,27 +6456,6 @@ dependencies = [ "syn 2.0.111", ] -[[package]] -name = "system-configuration" -version = "0.6.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "3c879d448e9d986b661742763247d3693ed13609438cf3d006f51f5368a5ba6b" -dependencies = [ - "bitflags 2.10.0", - "core-foundation 0.9.4", - "system-configuration-sys", -] - -[[package]] -name = "system-configuration-sys" -version = "0.6.0" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "8e1d1b10ced5ca923a1fcb8d03e96b8d3268065d724548c0211415ff6ac6bac4" -dependencies = [ - "core-foundation-sys", - "libc", -] - [[package]] name = "system-deps" version = "7.0.7" @@ -6829,16 +6751,6 @@ dependencies = [ "syn 2.0.111", ] -[[package]] -name = "tokio-native-tls" -version = "0.3.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "bbae76ab933c85776efabc971569dd6119c580d8f5d448769dec1764bf796ef2" -dependencies = [ - "native-tls", - "tokio", -] - [[package]] name = "tokio-rustls" version = "0.26.4" @@ -7318,12 +7230,6 @@ version = "0.1.1" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ba73ea9cf16a25df0c8caa16c51acb937d5712a8429db78a3ee29d5dcacd3a65" -[[package]] -name = "vcpkg" -version = "0.2.15" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "accd4ea62f7bb7a82fe23066fb0957d48ef677f6eeb8215f372f52e48bb32426" - [[package]] name = "vello" version = "0.6.0" @@ -7749,6 +7655,15 @@ dependencies = [ "web-sys", ] +[[package]] +name = "webpki-roots" +version = "1.0.4" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "b2878ef029c47c6e8cf779119f20fcf52bde7ad42a731b2a304bc221df17571e" +dependencies = [ + "rustls-pki-types", +] + [[package]] name = "weezl" version = "0.1.12" @@ -8295,17 +8210,6 @@ dependencies = [ "windows-link 0.2.1", ] -[[package]] -name = "windows-registry" -version = "0.6.1" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "02752bf7fbdcce7f2a27a742f798510f3e5ad88dbe84871e5168e2120c3d5720" -dependencies = [ - "windows-link 0.2.1", - "windows-result 0.4.1", - "windows-strings 0.5.1", -] - [[package]] name = "windows-result" version = "0.2.0" diff --git a/Cargo.toml b/Cargo.toml index 5ab7dcdb8..d8017d9f7 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -142,7 +142,7 @@ url = "2.5.0" http = "1.1.0" data-url = "0.3.1" tokio = "1.42" -reqwest = "0.12" +reqwest = { version = "0.12", default-features = false } reqwest-middleware = { version = "0.4.2", default-features = false } http-cache-reqwest = { version = "=1.0.0-alpha.2", default-features = false } diff --git a/apps/browser/Cargo.toml b/apps/browser/Cargo.toml index e04eb202b..e9d31314c 100644 --- a/apps/browser/Cargo.toml +++ b/apps/browser/Cargo.toml @@ -36,7 +36,7 @@ dioxus-native = { workspace = true, features = [ ] } blitz-traits = { workspace = true } blitz-dom = { workspace = true, features = ["woff-rust", "parallel-construct"] } -blitz-net = { workspace = true } +blitz-net = { workspace = true, features = ["http2"] } blitz-html = { workspace = true } linebender_resource_handle = { workspace = true } tracing-subscriber = { workspace = true, optional = true } diff --git a/packages/blitz-net/Cargo.toml b/packages/blitz-net/Cargo.toml index e79183e10..30d0e6c86 100644 --- a/packages/blitz-net/Cargo.toml +++ b/packages/blitz-net/Cargo.toml @@ -11,6 +11,7 @@ edition.workspace = true rust-version.workspace = true [features] +http2 = ["reqwest/http2"] cookies = ["reqwest/cookies"] multipart = ["reqwest/multipart", "reqwest/stream"] cache = ["dep:reqwest-middleware", "dep:http-cache-reqwest", "dep:directories"] @@ -22,7 +23,7 @@ blitz-traits = { workspace = true } # Networking dependencies tokio = { workspace = true } -reqwest = { workspace = true } +reqwest = { workspace = true, features = ["charset", "rustls-tls"] } data-url = { workspace = true } # Caching From e3cc96048ffa098b642c1d7e6d1c34ffaf95b871 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 15:54:31 +0000 Subject: [PATCH 45/67] Use cross for Android CI Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 6 +++++- 1 file changed, 5 insertions(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 16d52540f..5f9420df4 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -168,7 +168,7 @@ jobs: name: android, target: aarch64-linux-android, os: ubuntu-latest, - cross: false, + cross: true, command: "build", args: "--all", } @@ -209,6 +209,10 @@ jobs: packages: libasound2-dev libatk1.0-dev libgtk-3-dev libudev-dev libpango1.0-dev libxdo-dev libssl-dev version: 1.0 + - name: Install cross + if: ${{ matrix.platform.cross == true }} + uses: taiki-e/install-action@cross + - name: Setup run: ${{ matrix.platform.setup }} shell: bash From 2d4e21f2d38ebd29ecf1cc9d08732abaf397fdb2 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 16:06:04 +0000 Subject: [PATCH 46/67] Install python in Cross container Signed-off-by: Nico Burns --- Cross.toml | 6 ++++++ 1 file changed, 6 insertions(+) create mode 100644 Cross.toml diff --git a/Cross.toml b/Cross.toml new file mode 100644 index 000000000..8f70d451c --- /dev/null +++ b/Cross.toml @@ -0,0 +1,6 @@ +[build] + # additional commands to run prior to building the package +pre-build = [ + "dpkg --add-architecture $CROSS_DEB_ARCH", + "apt-get update && apt-get --assume-yes install python3:$CROSS_DEB_ARCH" +] \ No newline at end of file From ac2208803994fed6d0e9d30ae13aebd900f500b6 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 16:10:51 +0000 Subject: [PATCH 47/67] accesskit_xplat windows fixes Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/platform_impl/windows.rs | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) diff --git a/packages/accesskit_xplat/src/platform_impl/windows.rs b/packages/accesskit_xplat/src/platform_impl/windows.rs index 2421d2fb9..3b001dc1d 100644 --- a/packages/accesskit_xplat/src/platform_impl/windows.rs +++ b/packages/accesskit_xplat/src/platform_impl/windows.rs @@ -5,7 +5,6 @@ use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; use accesskit_windows::{HWND, SubclassingAdapter}; use raw_window_handle::RawWindowHandle; -use winit::{event::WindowEvent, event_loop::ActiveEventLoop, window::Window}; pub struct Adapter { adapter: SubclassingAdapter, @@ -36,5 +35,5 @@ impl Adapter { pub fn set_focus(&mut self, _is_focused: bool) {} - pub fn set_window_bounds(&mut self, outer_bounds: Rect, inner_bounds: Rect) {} + pub fn set_window_bounds(&mut self, _outer_bounds: Rect, _inner_bounds: Rect) {} } From 77bcfb6a317b69bd7c8c3f60c7a5d82fa640ae07 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 16:11:27 +0000 Subject: [PATCH 48/67] Don't fail-fast tests Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 1 + 1 file changed, 1 insertion(+) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index 5f9420df4..f34211177 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -130,6 +130,7 @@ jobs: env: RUST_CARGO_COMMAND: ${{ matrix.platform.cross == true && 'cross' || 'cargo' }} strategy: + fail-fast: false matrix: platform: - { From fc04848827b8640abed695d15ee5484069b13168 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 16:17:06 +0000 Subject: [PATCH 49/67] Import AndroidApp on android Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/lib.rs | 5 +++++ 1 file changed, 5 insertions(+) diff --git a/packages/accesskit_xplat/src/lib.rs b/packages/accesskit_xplat/src/lib.rs index 4e4984106..83d2bc7ea 100644 --- a/packages/accesskit_xplat/src/lib.rs +++ b/packages/accesskit_xplat/src/lib.rs @@ -46,6 +46,11 @@ use std::sync::Arc; use accesskit::{ ActionHandler, ActionRequest, ActivationHandler, DeactivationHandler, Rect, TreeUpdate, }; + + +#[cfg(target_os = "android")] +use android_activity::AndroidApp; +#[cfg(not(target_os = "android"))] use raw_window_handle::RawWindowHandle; mod platform_impl; From 72c1664a6670de618a9c654e53961476bffe596a Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 16:22:45 +0000 Subject: [PATCH 50/67] fmt Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/lib.rs | 1 - 1 file changed, 1 deletion(-) diff --git a/packages/accesskit_xplat/src/lib.rs b/packages/accesskit_xplat/src/lib.rs index 83d2bc7ea..cfcac0827 100644 --- a/packages/accesskit_xplat/src/lib.rs +++ b/packages/accesskit_xplat/src/lib.rs @@ -47,7 +47,6 @@ use accesskit::{ ActionHandler, ActionRequest, ActivationHandler, DeactivationHandler, Rect, TreeUpdate, }; - #[cfg(target_os = "android")] use android_activity::AndroidApp; #[cfg(not(target_os = "android"))] From 474c97e29100ae9d48152398073c461c3d39506d Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Sun, 4 Jan 2026 16:24:27 +0000 Subject: [PATCH 51/67] Fix null backend on android Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/platform_impl/null.rs | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/packages/accesskit_xplat/src/platform_impl/null.rs b/packages/accesskit_xplat/src/platform_impl/null.rs index 465342097..22ffa5dd1 100644 --- a/packages/accesskit_xplat/src/platform_impl/null.rs +++ b/packages/accesskit_xplat/src/platform_impl/null.rs @@ -9,7 +9,8 @@ pub struct Adapter; impl Adapter { pub fn new( - _window_handle: &RawWindowHandle, + #[cfg(target_os = "android")] _android_app: &AndroidApp, + #[cfg(not(target_os = "android"))] _window_handle: RawWindowHandle, _activation_handler: impl 'static + ActivationHandler, _action_handler: impl 'static + ActionHandler, _deactivation_handler: impl 'static + DeactivationHandler, From 771587dc0b08106c3b549bbdaf5300efed48e14d Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 00:50:55 +0000 Subject: [PATCH 52/67] Remove winit-core dep from accesskit_xplat --- Cargo.lock | 1 - packages/accesskit_xplat/Cargo.toml | 1 - 2 files changed, 2 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 26a1efd87..f4f89bd92 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -118,7 +118,6 @@ dependencies = [ "accesskit_windows", "android-activity", "raw-window-handle", - "winit-core", ] [[package]] diff --git a/packages/accesskit_xplat/Cargo.toml b/packages/accesskit_xplat/Cargo.toml index f8a13d2d7..60dba5c2f 100644 --- a/packages/accesskit_xplat/Cargo.toml +++ b/packages/accesskit_xplat/Cargo.toml @@ -15,7 +15,6 @@ tokio = ["accesskit_unix/tokio"] [dependencies] accesskit = { version = "0.22" } -winit-core = { version = "0.31.0-beta.2", default-features = false } raw-window-handle = { version = "0.6.2", features = ["std"] } [target.'cfg(target_os = "windows")'.dependencies] From bc564fab30de4a338cb72310b86c4c81413ed40c Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 00:55:55 +0000 Subject: [PATCH 53/67] Fix: consistently use unreferenced RawWindowHandle Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/lib.rs | 8 ++++---- packages/accesskit_xplat/src/platform_impl/macos.rs | 2 +- packages/accesskit_xplat/src/platform_impl/unix.rs | 2 +- packages/accesskit_xplat/src/platform_impl/windows.rs | 2 +- 4 files changed, 7 insertions(+), 7 deletions(-) diff --git a/packages/accesskit_xplat/src/lib.rs b/packages/accesskit_xplat/src/lib.rs index cfcac0827..3ac7ee768 100644 --- a/packages/accesskit_xplat/src/lib.rs +++ b/packages/accesskit_xplat/src/lib.rs @@ -113,7 +113,7 @@ impl Adapter { /// Panics if the window is already visible. pub fn with_split_handlers( #[cfg(target_os = "android")] android_app: &AndroidApp, - #[cfg(not(target_os = "android"))] window: RawWindowHandle, + #[cfg(not(target_os = "android"))] window_handle: RawWindowHandle, activation_handler: impl 'static + ActivationHandler + Send, action_handler: impl 'static + ActionHandler + Send, deactivation_handler: impl 'static + DeactivationHandler + Send, @@ -122,7 +122,7 @@ impl Adapter { #[cfg(target_os = "android")] android_app, #[cfg(not(target_os = "android"))] - &window, + window_handle, activation_handler, action_handler, deactivation_handler, @@ -132,7 +132,7 @@ impl Adapter { pub fn with_combined_handler( #[cfg(target_os = "android")] android_app: &AndroidApp, - #[cfg(not(target_os = "android"))] window: RawWindowHandle, + #[cfg(not(target_os = "android"))] window_handle: RawWindowHandle, handler: Arc, ) -> Self { let handler = CombinedHandler(handler); @@ -140,7 +140,7 @@ impl Adapter { #[cfg(target_os = "android")] android_app, #[cfg(not(target_os = "android"))] - &window, + window_handle, handler.clone(), handler.clone(), handler, diff --git a/packages/accesskit_xplat/src/platform_impl/macos.rs b/packages/accesskit_xplat/src/platform_impl/macos.rs index 88a565838..6a1ddb37f 100644 --- a/packages/accesskit_xplat/src/platform_impl/macos.rs +++ b/packages/accesskit_xplat/src/platform_impl/macos.rs @@ -12,7 +12,7 @@ pub struct Adapter { impl Adapter { pub fn new( - window_handle: &RawWindowHandle, + window_handle: RawWindowHandle, activation_handler: impl 'static + ActivationHandler, action_handler: impl 'static + ActionHandler, _deactivation_handler: impl 'static + DeactivationHandler, diff --git a/packages/accesskit_xplat/src/platform_impl/unix.rs b/packages/accesskit_xplat/src/platform_impl/unix.rs index ee320e5c8..542461e95 100644 --- a/packages/accesskit_xplat/src/platform_impl/unix.rs +++ b/packages/accesskit_xplat/src/platform_impl/unix.rs @@ -12,7 +12,7 @@ pub struct Adapter { impl Adapter { pub fn new( - _window_handle: &RawWindowHandle, + _window_handle: RawWindowHandle, activation_handler: impl 'static + ActivationHandler + Send, action_handler: impl 'static + ActionHandler + Send, deactivation_handler: impl 'static + DeactivationHandler + Send, diff --git a/packages/accesskit_xplat/src/platform_impl/windows.rs b/packages/accesskit_xplat/src/platform_impl/windows.rs index 3b001dc1d..ada159bac 100644 --- a/packages/accesskit_xplat/src/platform_impl/windows.rs +++ b/packages/accesskit_xplat/src/platform_impl/windows.rs @@ -12,7 +12,7 @@ pub struct Adapter { impl Adapter { pub fn new( - window_handle: &RawWindowHandle, + window_handle: RawWindowHandle, activation_handler: impl 'static + ActivationHandler, action_handler: impl 'static + ActionHandler + Send, _deactivation_handler: impl 'static + DeactivationHandler, From d7bb4847cead7a7b11097eb416996fd0bd1b2b0e Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 00:57:22 +0000 Subject: [PATCH 54/67] Fix reference to AndroidApp in null backend --- packages/accesskit_xplat/src/platform_impl/null.rs | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/packages/accesskit_xplat/src/platform_impl/null.rs b/packages/accesskit_xplat/src/platform_impl/null.rs index 22ffa5dd1..b3a4bb550 100644 --- a/packages/accesskit_xplat/src/platform_impl/null.rs +++ b/packages/accesskit_xplat/src/platform_impl/null.rs @@ -9,7 +9,7 @@ pub struct Adapter; impl Adapter { pub fn new( - #[cfg(target_os = "android")] _android_app: &AndroidApp, + #[cfg(target_os = "android")] _android_app: &android_activity::AndroidApp, #[cfg(not(target_os = "android"))] _window_handle: RawWindowHandle, _activation_handler: impl 'static + ActivationHandler, _action_handler: impl 'static + ActionHandler, From 30ac8705526caa81b0bb2bb4f458775bab420082 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 01:51:37 +0000 Subject: [PATCH 55/67] Fix imports in null module again Signed-off-by: Nico Burns --- packages/accesskit_xplat/src/platform_impl/null.rs | 6 +++++- 1 file changed, 5 insertions(+), 1 deletion(-) diff --git a/packages/accesskit_xplat/src/platform_impl/null.rs b/packages/accesskit_xplat/src/platform_impl/null.rs index b3a4bb550..b4ad34058 100644 --- a/packages/accesskit_xplat/src/platform_impl/null.rs +++ b/packages/accesskit_xplat/src/platform_impl/null.rs @@ -3,13 +3,17 @@ // the LICENSE-APACHE file). use accesskit::{ActionHandler, ActivationHandler, DeactivationHandler, Rect, TreeUpdate}; + +#[cfg(target_os = "android")] +use android_activity::AndroidApp; +#[cfg(not(target_os = "android"))] use raw_window_handle::RawWindowHandle; pub struct Adapter; impl Adapter { pub fn new( - #[cfg(target_os = "android")] _android_app: &android_activity::AndroidApp, + #[cfg(target_os = "android")] _android_app: &AndroidApp, #[cfg(not(target_os = "android"))] _window_handle: RawWindowHandle, _activation_handler: impl 'static + ActivationHandler, _action_handler: impl 'static + ActionHandler, From 42cb6529a10dc092544c804f95fa5222067b0f85 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 01:59:02 +0000 Subject: [PATCH 56/67] Fix blitz_shell initializing accesskit_xplat on android Signed-off-by: Nico Burns --- packages/blitz-shell/src/accessibility.rs | 3 +++ 1 file changed, 3 insertions(+) diff --git a/packages/blitz-shell/src/accessibility.rs b/packages/blitz-shell/src/accessibility.rs index ab3f6e333..dab011027 100644 --- a/packages/blitz-shell/src/accessibility.rs +++ b/packages/blitz-shell/src/accessibility.rs @@ -33,6 +33,9 @@ impl AccessibilityState { let window_id = window.id(); Self { adapter: Adapter::with_combined_handler( + #[cfg(target_os = "android")] + &crate::current_android_app(), + #[cfg(not(target_os = "android"))] window.window_handle().unwrap().as_raw(), Arc::new(Handler { window_id, proxy }), ), From 34a9aabcf281953d9ca22ebfa13de480abc79246 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 02:20:08 +0000 Subject: [PATCH 57/67] Install cross with cargo install Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index f34211177..f78998924 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -185,9 +185,11 @@ jobs: targets: ${{ matrix.platform.target }} components: rustfmt + # Install cross from source. Because latest release doesn't work with recent Rust + # when targeting Android. See https://github.com/cross-rs/cross/issues/1222 - name: Install cross if: ${{ matrix.platform.cross == true }} - uses: taiki-e/install-action@cross + run: cargo install cross --git https://github.com/cross-rs/cross --rev 426e811 - name: Free Disk Space (Ubuntu) if: ${{ matrix.platform.os == 'ubuntu-latest' }} From 5848a103bcd520d038934a4a40b1f1261fd39177 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 02:30:34 +0000 Subject: [PATCH 58/67] Remove duplicate cross install Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 4 ---- 1 file changed, 4 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index f78998924..aab2e5ccb 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -212,10 +212,6 @@ jobs: packages: libasound2-dev libatk1.0-dev libgtk-3-dev libudev-dev libpango1.0-dev libxdo-dev libssl-dev version: 1.0 - - name: Install cross - if: ${{ matrix.platform.cross == true }} - uses: taiki-e/install-action@cross - - name: Setup run: ${{ matrix.platform.setup }} shell: bash From 14a5ab706f35417fbabcd89bce215a91918dcb85 Mon Sep 17 00:00:00 2001 From: Nico Burns Date: Mon, 5 Jan 2026 02:32:01 +0000 Subject: [PATCH 59/67] Disable free disk space task Signed-off-by: Nico Burns --- .github/workflows/ci.yml | 18 +++++++++++------- 1 file changed, 11 insertions(+), 7 deletions(-) diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml index aab2e5ccb..63f74ce65 100644 --- a/.github/workflows/ci.yml +++ b/.github/workflows/ci.yml @@ -191,13 +191,17 @@ jobs: if: ${{ matrix.platform.cross == true }} run: cargo install cross --git https://github.com/cross-rs/cross --rev 426e811 - - name: Free Disk Space (Ubuntu) - if: ${{ matrix.platform.os == 'ubuntu-latest' }} - uses: jlumbroso/free-disk-space@v1.3.1 - with: # speed things up a bit - large-packages: false - docker-images: false - swap-storage: false + # This is currently disabled as Blitz's CI doesn't need the extra disk space. + # So this task is just taking up time for no reason. We will reinstate if our + # disk space requirement increase. + # + # - name: Free Disk Space (Ubuntu) + # if: ${{ matrix.platform.os == 'ubuntu-latest' }} + # uses: jlumbroso/free-disk-space@v1.3.1 + # with: # speed things up a bit + # large-packages: false + # docker-images: false + # swap-storage: false - uses: Swatinem/rust-cache@v2 with: From 88a7a756ba3fb6c33966e538884681809d8ecb46 Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Tue, 6 Jan 2026 00:06:24 -0800 Subject: [PATCH 60/67] oooh it does it work? --- .claude/guides/OBJC2_GUIDE.md | 705 ++++++++++++++++++ .claude/guides/OBJC2_MIGRATION_GUIDE.md | 595 +++++++++++++++ Cargo.lock | 23 + Cargo.toml | 2 +- packages/blitz-dom/src/node/node.rs | 2 +- packages/blitz-ios-uikit/Cargo.toml | 58 ++ .../blitz-ios-uikit/src/elements/button.rs | 146 ++++ .../blitz-ios-uikit/src/elements/checkbox.rs | 117 +++ .../blitz-ios-uikit/src/elements/container.rs | 129 ++++ .../blitz-ios-uikit/src/elements/image.rs | 122 +++ .../blitz-ios-uikit/src/elements/input.rs | 137 ++++ packages/blitz-ios-uikit/src/elements/mod.rs | 130 ++++ packages/blitz-ios-uikit/src/elements/text.rs | 120 +++ packages/blitz-ios-uikit/src/events.rs | 130 ++++ packages/blitz-ios-uikit/src/lib.rs | 178 +++++ packages/blitz-ios-uikit/src/style.rs | 228 ++++++ packages/blitz-ios-uikit/src/sync.rs | 249 +++++++ 17 files changed, 3069 insertions(+), 2 deletions(-) create mode 100644 .claude/guides/OBJC2_GUIDE.md create mode 100644 .claude/guides/OBJC2_MIGRATION_GUIDE.md create mode 100644 packages/blitz-ios-uikit/Cargo.toml create mode 100644 packages/blitz-ios-uikit/src/elements/button.rs create mode 100644 packages/blitz-ios-uikit/src/elements/checkbox.rs create mode 100644 packages/blitz-ios-uikit/src/elements/container.rs create mode 100644 packages/blitz-ios-uikit/src/elements/image.rs create mode 100644 packages/blitz-ios-uikit/src/elements/input.rs create mode 100644 packages/blitz-ios-uikit/src/elements/mod.rs create mode 100644 packages/blitz-ios-uikit/src/elements/text.rs create mode 100644 packages/blitz-ios-uikit/src/events.rs create mode 100644 packages/blitz-ios-uikit/src/lib.rs create mode 100644 packages/blitz-ios-uikit/src/style.rs create mode 100644 packages/blitz-ios-uikit/src/sync.rs diff --git a/.claude/guides/OBJC2_GUIDE.md b/.claude/guides/OBJC2_GUIDE.md new file mode 100644 index 000000000..11cdb9930 --- /dev/null +++ b/.claude/guides/OBJC2_GUIDE.md @@ -0,0 +1,705 @@ +# objc2 Rust Guide for macOS Framework Bindings + +This guide documents patterns and best practices for using `objc2` and related crates (`objc2-foundation`, `objc2-app-kit`, `objc2-virtualization`, etc.) to interface with Apple's Objective-C frameworks from Rust. + +## Table of Contents +1. [Strategy & Workflow](#strategy--workflow) ⭐ **READ THIS FIRST** +2. [Crate Structure](#crate-structure) +3. [Key Types](#key-types) +4. [Allocation and Initialization](#allocation-and-initialization) +5. [Class Inheritance and Type Coercion](#class-inheritance-and-type-coercion) +6. [Defining Custom Objective-C Classes](#defining-custom-objective-c-classes) +7. [Working with NSArray](#working-with-nsarray) +8. [Delegates and Protocols](#delegates-and-protocols) +9. [Main Thread Safety](#main-thread-safety) +10. [Memory Management](#memory-management) +11. [Common Patterns](#common-patterns) +12. [Troubleshooting](#troubleshooting) + +--- + +## Strategy & Workflow + +**This section captures the optimal workflow for writing objc2 code. Follow this process to minimize iteration cycles with the compiler.** + +### Phase 1: Research Before Coding + +1. **Check crate features FIRST** before adding to Cargo.toml: + ```bash + cargo search objc2-av-foundation + # Then check available features: + curl -s https://crates.io/api/v1/crates/objc2-av-foundation/0.3.2 | \ + python3 -c "import sys,json; [print(k) for k in sorted(json.load(sys.stdin)['version']['features'].keys())]" + ``` + +2. **Feature naming patterns**: + - Features usually match class names: `AVCaptureSession`, `VZVirtualMachine` + - Subclasses are often bundled with parent: `AVCaptureDeviceInput` is part of `AVCaptureInput` + - When in doubt, search for the parent class name + +3. **Use documentation lookup tools** to understand available types and method signatures before writing code. + +### Phase 2: Understand Naming Conventions + +The objc2 crates follow consistent naming transformations from Objective-C: + +| Objective-C | Rust | +|------------|------| +| `kCALayerWidthSizable` | `CAAutoresizingMask::LayerWidthSizable` | +| `NSBackingStoreBuffered` | `NSBackingStoreType::Buffered` | +| `AVMediaTypeVideo` | `AVMediaTypeVideo` (extern static, needs unsafe) | +| `-initWithFoo:bar:` | `initWithFoo_bar(alloc, ...)` | + +**Key pattern**: Constants drop their prefix (`kCA`, `NS`) and become associated constants on a type. + +### Phase 3: Handle Extern Statics Correctly + +Global constants like `AVMediaTypeVideo` are extern statics: +```rust +// These are Option<&'static NSString> and need unsafe access +let media_type = unsafe { AVMediaTypeVideo.expect("not available") }; +``` + +### Phase 4: Build Incrementally + +1. **Run `cargo check` early** - after imports, after each function +2. **Don't write the entire file** before checking if it compiles +3. **Trust compiler errors** for API details you couldn't verify upfront +4. **Check if unsafe is actually needed** - many methods are safe with MainThreadMarker + +### Phase 5: Common Gotchas Checklist + +Before your first build, verify: + +- [ ] Imported `AnyThread` trait if using `Type::alloc()` on non-UI types +- [ ] Using `into_super()` on array *elements*, not the array itself +- [ ] `define_class!` struct has semicolon (no inline fields) +- [ ] Thread-local storage set up for state that must stay alive +- [ ] Checked if methods actually need `unsafe` (many are safe) + +### Anti-Patterns to Avoid + +```rust +// DON'T: Wrap everything in unsafe "just in case" +unsafe { app.run() }; // run() is actually safe! + +// DON'T: Guess constant names from Objective-C +objc2_quartz_core::kCALayerWidthSizable // Wrong! + +// DON'T: Assume extern statics are non-optional +AVMediaTypeVideo // This is Option<&NSString>, not &NSString + +// DON'T: Write the whole file before checking compilation +// DO: Build incrementally, let compiler guide you +``` + +### Debugging Strategy + +When the build fails: +1. Read the error message carefully - rustc is usually very helpful +2. Check the suggested type vs expected type +3. Look for `into_super()` issues with NSArray +4. Check if you need `unsafe` or are using it unnecessarily +5. Verify feature flags are enabled for the types you're using + +--- + +## Crate Structure + +The objc2 ecosystem is organized as follows: + +```toml +[dependencies] +# Core runtime +objc2 = "0.6" +block2 = "0.6" # For Objective-C blocks (callbacks) + +# Foundation types (NSString, NSArray, NSURL, etc.) +objc2-foundation = { version = "0.3", features = ["NSString", "NSArray", ...] } + +# AppKit for macOS GUI +objc2-app-kit = { version = "0.3", features = ["NSApplication", "NSWindow", ...] } + +# Framework-specific crates +objc2-virtualization = { version = "0.3", features = ["VZVirtualMachine", ...] } +``` + +**Important**: Each type/class requires its feature to be enabled explicitly. + +--- + +## Key Types + +### `Retained` +Smart pointer for Objective-C objects with automatic reference counting (ARC). + +```rust +use objc2::rc::Retained; + +let obj: Retained = NSString::from_str("hello"); + +// Dereference to get &T +let reference: &NSString = &*obj; +// Or use Deref coercion +some_method(&obj); // If method takes &NSString +``` + +### `MainThreadMarker` +Proof that code is running on the main thread. Required for UI operations. + +```rust +use objc2_foundation::MainThreadMarker; + +fn main() { + let mtm = MainThreadMarker::new().expect("Must run on main thread"); + + // Use mtm to allocate main-thread-only objects + let window = unsafe { NSWindow::initWith...(mtm.alloc(), ...) }; +} +``` + +### `ProtocolObject` +Type-erased protocol object for delegate patterns. + +```rust +use objc2::runtime::ProtocolObject; + +let delegate = MyDelegate::new(mtm); +app.setDelegate(Some(ProtocolObject::from_ref(&*delegate))); +``` + +--- + +## Allocation and Initialization + +### For `MainThreadOnly` types (UI classes) +Use `mtm.alloc::()`: + +```rust +let mtm = MainThreadMarker::new().unwrap(); + +// Allocate main-thread-only types +let window = unsafe { + NSWindow::initWithContentRect_styleMask_backing_defer( + mtm.alloc::(), + rect, + style_mask, + backing_store, + false, + ) +}; +``` + +### For `AnyThread` types (non-UI classes) +Use `T::alloc()` with `AnyThread` trait in scope: + +```rust +use objc2::AnyThread; + +let config = unsafe { + VZMacGraphicsDisplayConfiguration::initWithWidthInPixels_heightInPixels_pixelsPerInch( + VZMacGraphicsDisplayConfiguration::alloc(), + 1920, + 1200, + 80, + ) +}; +``` + +### Using `new()` (when available) +Many types provide a `new()` method that combines alloc+init: + +```rust +let boot_loader = unsafe { VZMacOSBootLoader::new() }; +let config = unsafe { VZVirtualMachineConfiguration::new() }; +``` + +--- + +## Class Inheritance and Type Coercion + +### The Problem +Objective-C uses class inheritance, but Rust's type system is strict. When a method expects `&NSArray` but you have `Retained`, you need to coerce. + +### Solution: `into_super()` +Use `.into_super()` to convert a `Retained` into `Retained`: + +```rust +// VZMacGraphicsDeviceConfiguration inherits from VZGraphicsDeviceConfiguration +let graphics: Retained = create_graphics_config(); + +// Convert to parent type for array that expects the base class +let graphics_base: Retained = graphics.into_super(); + +// Now it works with NSArray +let array = NSArray::from_retained_slice(&[graphics_base]); +unsafe { config.setGraphicsDevices(&array) }; +``` + +### Common inheritance chains: +``` +VZMacGraphicsDeviceConfiguration -> VZGraphicsDeviceConfiguration +VZVirtioBlockDeviceConfiguration -> VZStorageDeviceConfiguration +VZVirtioNetworkDeviceConfiguration -> VZNetworkDeviceConfiguration +VZMacKeyboardConfiguration -> VZKeyboardConfiguration +VZMacTrackpadConfiguration -> VZPointingDeviceConfiguration +VZMacPlatformConfiguration -> VZPlatformConfiguration +``` + +--- + +## Defining Custom Objective-C Classes + +Use `define_class!` macro for custom classes (delegates, subclasses): + +```rust +use objc2::{define_class, msg_send, MainThreadOnly}; +use objc2::rc::Retained; +use objc2::runtime::{NSObject, NSObjectProtocol}; + +define_class!( + // Specify parent class + #[unsafe(super = NSObject)] + + // Thread safety (use MainThreadOnly for UI-related classes) + #[thread_kind = MainThreadOnly] + + // Objective-C class name + #[name = "MyDelegate"] + + // Struct definition (NO inline ivars in objc2 0.6.x!) + struct MyDelegate; + + // Implement NSObjectProtocol (required) + unsafe impl NSObjectProtocol for MyDelegate {} + + // Implement any protocols + unsafe impl SomeDelegate for MyDelegate { + #[unsafe(method(someMethod:))] + fn some_method(&self, arg: &SomeType) { + // Implementation + } + } +); + +impl MyDelegate { + fn new(mtm: MainThreadMarker) -> Retained { + unsafe { msg_send![mtm.alloc::(), init] } + } +} +``` + +### Important: No inline ivars in objc2 0.6.x +The `define_class!` macro does NOT support inline instance variables: + +```rust +// WRONG - won't compile in objc2 0.6.x +struct MyClass { + field: SomeType, // NO! +} + +// CORRECT - use semicolon, no fields +struct MyClass; +``` + +**Workaround for state**: Use thread-local storage: + +```rust +use std::cell::RefCell; + +thread_local! { + static STATE: RefCell> = const { RefCell::new(None) }; +} + +struct MyState { + window: Retained, + // other fields... +} + +// Store state when needed +STATE.with(|s| { + *s.borrow_mut() = Some(MyState { window, ... }); +}); +``` + +--- + +## Working with NSArray + +### Creating arrays +```rust +use objc2_foundation::NSArray; + +// From a slice of Retained objects +let items: Vec> = vec![item1, item2]; +let array = NSArray::from_retained_slice(&items); + +// Or inline +let array = NSArray::from_retained_slice(&[item1, item2]); +``` + +### Type coercion for arrays +When the setter expects a different (parent) type: + +```rust +// Method expects &NSArray +// But we have Retained + +let mac_graphics = create_mac_graphics_config(); +let base_graphics = mac_graphics.into_super(); // Coerce to parent type +let array = NSArray::from_retained_slice(&[base_graphics]); +unsafe { config.setGraphicsDevices(&array) }; +``` + +--- + +## Delegates and Protocols + +### Setting a delegate +```rust +use objc2::runtime::ProtocolObject; + +let delegate = MyDelegate::new(mtm); + +// Convert to protocol object for setDelegate +unsafe { + vm.setDelegate(Some(ProtocolObject::from_ref(&*delegate))); +} + +// IMPORTANT: Keep delegate alive! Store it somewhere. +``` + +### Implementing delegate methods +```rust +define_class!( + #[unsafe(super = NSObject)] + #[thread_kind = MainThreadOnly] + #[name = "VMDelegate"] + struct VMDelegate; + + unsafe impl NSObjectProtocol for VMDelegate {} + + unsafe impl VZVirtualMachineDelegate for VMDelegate { + #[unsafe(method(guestDidStopVirtualMachine:))] + fn guest_did_stop(&self, _vm: &VZVirtualMachine) { + println!("VM stopped"); + // Note: Can access MainThreadMarker here since we're MainThreadOnly + let app = NSApplication::sharedApplication(MainThreadMarker::new().unwrap()); + app.terminate(None); + } + + #[unsafe(method(virtualMachine:didStopWithError:))] + fn vm_did_stop_with_error(&self, _vm: &VZVirtualMachine, error: &NSError) { + eprintln!("VM error: {:?}", error); + } + } +); +``` + +--- + +## Main Thread Safety + +### MainThreadOnly types +Types marked with `MainThreadOnly` can only be created/used on the main thread: +- `NSApplication`, `NSWindow`, `NSView`, `VZVirtualMachineView` +- Custom classes with `#[thread_kind = MainThreadOnly]` + +### Obtaining MainThreadMarker +```rust +// At program start +let mtm = MainThreadMarker::new().expect("Must be on main thread"); + +// In delegate methods (if class is MainThreadOnly) +let mtm = MainThreadMarker::new().unwrap(); // Safe because we know we're on main thread +``` + +### Methods that don't need unsafe +Many methods on `MainThreadOnly` types are safe when you have proof of main thread: +```rust +// These are safe (no unsafe needed) +let app = NSApplication::sharedApplication(mtm); +app.setActivationPolicy(NSApplicationActivationPolicy::Regular); +app.run(); + +window.setTitle(ns_string!("Title")); +window.center(); +window.makeKeyAndOrderFront(None); +``` + +--- + +## Memory Management + +### Retained keeps objects alive +```rust +let delegate = MyDelegate::new(mtm); +app.setDelegate(Some(ProtocolObject::from_ref(&*delegate))); + +// delegate must stay alive! Don't let it drop. +// Store it in thread-local, struct field, or keep in scope. +``` + +### Thread-local storage pattern +```rust +thread_local! { + static APP_STATE: RefCell> = const { RefCell::new(None) }; +} + +struct AppState { + _window: Retained, // Keep window alive + _delegate: Retained, // Keep delegate alive +} + +// Store after creation +APP_STATE.with(|state| { + *state.borrow_mut() = Some(AppState { + _window: window, + _delegate: delegate, + }); +}); +``` + +--- + +## Common Patterns + +### Creating an AppKit application +```rust +fn main() { + let mtm = MainThreadMarker::new().expect("Must run on main thread"); + + let app = NSApplication::sharedApplication(mtm); + app.setActivationPolicy(NSApplicationActivationPolicy::Regular); + + let delegate = AppDelegate::new(mtm); + app.setDelegate(Some(ProtocolObject::from_ref(&*delegate))); + + app.run(); // Blocks until app terminates +} +``` + +### Completion handlers with blocks +```rust +use block2::RcBlock; + +let completion = RcBlock::new(|error: *mut NSError| { + if !error.is_null() { + let err = unsafe { &*error }; + eprintln!("Error: {:?}", err); + } else { + println!("Success!"); + } +}); + +unsafe { + some_async_method(&completion); +} +``` + +### Working with NSString +```rust +use objc2_foundation::{NSString, ns_string}; + +// From &str +let string = NSString::from_str("hello"); + +// Static string (compile-time) +window.setTitle(ns_string!("Window Title")); +``` + +### Working with NSURL +```rust +use objc2_foundation::NSURL; + +let path = "/path/to/file"; +let url = NSURL::fileURLWithPath(&NSString::from_str(path)); +``` + +### Working with NSData +```rust +use objc2_foundation::NSData; + +let bytes: Vec = fs::read("file.bin")?; +let data = NSData::with_bytes(&bytes); +``` + +--- + +## Critical Checklist (Read Before Writing Code!) + +Before writing objc2 code, verify these common pitfalls: + +### 1. Import `AnyThread` for non-UI allocations +If you're calling `.alloc()` on any non-MainThreadOnly type, you MUST import the trait: +```rust +use objc2::AnyThread; // Required for Type::alloc() to work! +``` +Without this, you'll get "no function or associated item named `alloc` found". + +### 2. `into_super()` goes on ELEMENTS, not arrays +When building an NSArray for a setter that expects a parent type: +```rust +// WRONG - calling into_super() on the array +let array = NSArray::from_retained_slice(&[item]); +config.setDevices(&array.into_super()); // NO! + +// CORRECT - call into_super() on each element BEFORE the array +let array = NSArray::from_retained_slice(&[item.into_super()]); +config.setDevices(&array); // YES! +``` + +### 3. No inline ivars in define_class! (objc2 0.6.x) +```rust +// WRONG - will fail with "no rules expected this token" +define_class!( + #[unsafe(super(NSObject))] + struct MyClass { + field: Type, // NO! + } +); + +// CORRECT - empty struct, use thread-local for state +define_class!( + #[unsafe(super(NSObject))] + struct MyClass; // Semicolon, no body! +); +``` + +### 4. Always use parentheses in #[unsafe(super(...))] +```rust +// CORRECT syntax +#[unsafe(super(NSObject))] + +// NOT this (older syntax) +#[unsafe(super = NSObject)] +``` + +### 5. Retain objects that must stay alive +Delegates, windows, and other objects passed to Objective-C must be kept alive: +```rust +thread_local! { + static STATE: RefCell> = const { RefCell::new(None) }; +} + +// Store BEFORE the function returns +STATE.with(|s| *s.borrow_mut() = Some(AppState { delegate, window, ... })); +``` + +### 6. Only import the types you actually use +Don't import parent classes if you only use subclasses: +```rust +// If you only create VZMacGraphicsDeviceConfiguration, +// you don't need to import VZGraphicsDeviceConfiguration +// (into_super() handles the conversion) +``` + +### 7. Check method safety +Some methods are safe with MainThreadMarker proof, others always need unsafe: +```rust +// Safe (takes mtm as proof) +let app = NSApplication::sharedApplication(mtm); +app.setActivationPolicy(...); // Safe +app.run(); // Safe + +// Unsafe (framework-specific operations) +unsafe { config.setBootLoader(...) }; +unsafe { vm.startWithCompletionHandler(...) }; +``` + +--- + +## Troubleshooting + +### "no rules expected this token" in define_class! +You're trying to use inline ivars. Remove them: +```rust +// Wrong +struct MyClass { field: Type } + +// Correct +struct MyClass; +``` + +### "no function or associated item named `alloc` found" +Import the `AnyThread` trait: +```rust +use objc2::AnyThread; // For non-MainThreadOnly types +// MainThreadOnly types use mtm.alloc::() +``` + +### "mismatched types" with NSArray +Use `.into_super()` to coerce subclass to parent class: +```rust +let array = NSArray::from_retained_slice(&[subclass_item.into_super()]); +``` + +### "expected &T, found &Retained" +Dereference with `&*`: +```rust +// Wrong +method(&retained_obj); + +// Correct (if method takes &T) +method(&*retained_obj); +// Or let Deref coercion work +method(&retained_obj); // Sometimes works +``` + +### Delegate/callback not being called +Make sure the delegate object stays alive: +```rust +// Store in thread-local or struct field +let delegate = MyDelegate::new(mtm); +app.setDelegate(Some(ProtocolObject::from_ref(&*delegate))); +// delegate MUST NOT be dropped here! +``` + +### NSBackingStoreType variants +Use `NSBackingStoreType::Buffered` (not `NSBackingStoreBuffered`). + +--- + +## Virtualization Framework Specifics + +### Required entitlements +Create `entitlements.plist`: +```xml + + + + + com.apple.security.virtualization + + + +``` + +Sign binary: +```bash +codesign --entitlements entitlements.plist --force -s - target/release/myapp +``` + +### VM Bundle structure +``` +~/VM.bundle/ +├── AuxiliaryStorage # Boot data +├── Disk.img # Virtual disk +├── HardwareModel # Hardware model data +├── MachineIdentifier # Machine ID data +└── SaveFile.vzvmsave # Optional saved state +``` + +### Loading persisted hardware identity +```rust +fn load_hardware_model(path: &Path) -> Retained { + let data = fs::read(path).expect("Failed to read"); + let ns_data = NSData::with_bytes(&data); + unsafe { + VZMacHardwareModel::initWithDataRepresentation( + VZMacHardwareModel::alloc(), + &ns_data, + ).expect("Invalid hardware model") + } +} +``` diff --git a/.claude/guides/OBJC2_MIGRATION_GUIDE.md b/.claude/guides/OBJC2_MIGRATION_GUIDE.md new file mode 100644 index 000000000..3a442aa66 --- /dev/null +++ b/.claude/guides/OBJC2_MIGRATION_GUIDE.md @@ -0,0 +1,595 @@ +# objc2 0.5 → 0.6 Migration Guide + +A comprehensive guide based on practical experience porting Swift/Objective-C code to Rust using objc2 0.6+. + +## Table of Contents +- [Major Changes Overview](#major-changes-overview) +- [Memory Management](#memory-management) +- [Class Declaration](#class-declaration) +- [Method Calls](#method-calls) +- [Collections](#collections) +- [Foundation Types](#foundation-types) +- [Common Patterns](#common-patterns) +- [Troubleshooting](#troubleshooting) + +--- + +## Major Changes Overview + +### What Changed in objc2 0.6 + +1. **`Retained` replaces `Id`** + - All owned Objective-C objects now use `Retained` + - Better semantics around object ownership + +2. **Simplified `unsafe` usage** + - Many APIs that were safe are now exposed without `unsafe` + - Framework-specific safe wrappers (e.g., `NSApplication::sharedApplication()`) + +3. **`ClassType` trait method changes** + - `::alloc()` now requires the trait to be in scope + - Use `MainThreadMarker::alloc::()` for main-thread classes + +4. **`NSArray` API changes** + - `from_vec()` → `from_slice()` + - Requires references now, not owned values + +5. **Auto-generated bindings** + - `objc2-virtualization`, `objc2-app-kit`, etc. are now auto-generated + - Consistent API across all frameworks + +--- + +## Memory Management + +### Retained vs Id + +**objc2 0.5:** +```rust +use objc2::rc::Id; + +let obj: Id = unsafe { NSObject::new() }; +``` + +**objc2 0.6:** +```rust +use objc2::rc::Retained; + +let obj: Retained = unsafe { NSObject::new() }; +``` + +### Object Allocation + +**objc2 0.5:** +```rust +use objc2::ClassType; + +let obj = unsafe { MyClass::alloc() }; +``` + +**objc2 0.6:** +```rust +use objc2::ClassType; // Must import trait for ::alloc() + +let obj = unsafe { MyClass::alloc() }; +``` + +**For Main-Thread Classes:** +```rust +use objc2_foundation::MainThreadMarker; + +let mtm = MainThreadMarker::new().unwrap(); +let obj = mtm.alloc::(); // Preferred for AppKit classes +``` + +### Casting Between Types + +**Downcasting (child → parent):** +```rust +// objc2 0.5 +let parent: Retained = unsafe { Retained::cast(child) }; + +// objc2 0.6 +let parent: Retained = child.downcast().unwrap(); +``` + +**Upcasting (to super type):** +```rust +let parent_ref: &Parent = child.as_super(); +``` + +--- + +## Class Declaration + +### Basic Class Declaration + +**objc2 0.5:** +```rust +objc2::declare_class!( + struct MyClass; + + unsafe impl ClassType for MyClass { + type Super = NSObject; + const NAME: &'static str = "MyClass"; + } +); +``` + +**objc2 0.6:** +```rust +use objc2::declare_class; +use objc2::mutability::MainThreadOnly; // If needed + +declare_class!( + struct MyClass; + + unsafe impl ClassType for MyClass { + type Super = NSObject; + type Mutability = MainThreadOnly; // NEW: Required + const NAME: &'static str = "MyClass"; + } +); +``` + +### Protocol Implementation + +**objc2 0.6 Pattern:** +```rust +// 1. Declare the class +declare_class!( + struct AppDelegate; + + unsafe impl ClassType for AppDelegate { + type Super = NSObject; + type Mutability = MainThreadOnly; + const NAME: &'static str = "AppDelegate"; + } +); + +// 2. Implement protocol OUTSIDE declare_class! +unsafe impl NSApplicationDelegate for AppDelegate {} + +// 3. Regular Rust impl block for Rust-side methods +impl AppDelegate { + fn new(mtm: MainThreadMarker) -> Retained { + unsafe { msg_send_id![mtm.alloc::(), init] } + } +} +``` + +### ⚠️ What Doesn't Work + +**DO NOT put method implementations inside `declare_class!`:** +```rust +// ❌ This will NOT compile in objc2 0.6 +declare_class!( + struct MyClass; + + unsafe impl ClassType for MyClass { ... } + + impl MyClass { // ❌ ERROR: no rules expected `MyClass` + #[method(myMethod)] + fn my_method(&self) { ... } + } +); +``` + +**The macro expects a specific structure and doesn't support custom impl blocks inside.** + +--- + +## Method Calls + +### msg_send! vs msg_send_id! + +**For methods returning primitives or void:** +```rust +use objc2::msg_send; + +let count: usize = unsafe { msg_send![obj, count] }; +let _: () = unsafe { msg_send![obj, doSomething] }; +``` + +**For methods returning objects:** +```rust +use objc2::msg_send_id; + +let obj: Retained = unsafe { + msg_send_id![ + NSString::alloc(), + initWithUTF8String: c"Hello".as_ptr() + ] +}; +``` + +### Window/View Creation Pattern + +**Creating NSWindow (objc2 0.6):** +```rust +use objc2::msg_send; +use objc2_foundation::{MainThreadMarker, NSRect, NSPoint, NSSize}; +use objc2_app_kit::{NSWindow, NSWindowStyleMask, NSBackingStoreType}; + +let mtm = MainThreadMarker::new().unwrap(); + +let frame = NSRect { + origin: NSPoint { x: 0.0, y: 0.0 }, + size: NSSize { width: 800.0, height: 600.0 }, +}; + +let style = NSWindowStyleMask::Titled + | NSWindowStyleMask::Closable + | NSWindowStyleMask::Resizable; + +let window: Retained = unsafe { + msg_send![ + mtm.alloc::(), + initWithContentRect: frame, + styleMask: style, + backing: NSBackingStoreType::Buffered, + defer: false + ] +}; +``` + +--- + +## Collections + +### NSArray + +**objc2 0.5:** +```rust +let array = NSArray::from_vec(vec![obj1, obj2, obj3]); +``` + +**objc2 0.6:** +```rust +// Takes slice of references now, not owned values +let array = NSArray::from_slice(&[&*obj1, &*obj2, &*obj3]); + +// OR use as_super() for protocol types +let array = NSArray::from_slice(&[obj1.as_super(), obj2.as_super()]); +``` + +### Creating Arrays of Different Types + +When you have different types that share a common supertype: + +```rust +let input: Retained = ...; +let output: Retained = ...; + +// Downcast to common parent type +let input_stream: Retained = + input.downcast().unwrap(); +let output_stream: Retained = + output.downcast().unwrap(); + +// Now create array with references +let streams = NSArray::from_slice(&[&*input_stream, &*output_stream]); +``` + +--- + +## Foundation Types + +### Geometry Types + +**objc2 0.5:** Often used `CGRect`, `CGPoint`, `CGSize` + +**objc2 0.6:** Use `NS*` variants for AppKit + +```rust +use objc2_foundation::{NSRect, NSPoint, NSSize}; + +let rect = NSRect { + origin: NSPoint { x: 0.0, y: 0.0 }, + size: NSSize { width: 100.0, height: 100.0 }, +}; +``` + +### String Literals + +**Creating NSString from Rust string:** +```rust +use objc2_foundation::NSString; + +// From &str +let ns_str = NSString::from_str("Hello, World!"); + +// String literal macro +use objc2_foundation::ns_string; +let ns_str = ns_string!("Hello, World!"); +``` + +### URLs + +```rust +use objc2_foundation::{NSString, NSURL}; +use std::path::PathBuf; + +let path = PathBuf::from("/path/to/file"); +let ns_path = NSString::from_str(&path.to_string_lossy()); +let url = NSURL::fileURLWithPath(&ns_path); +``` + +### MainThreadMarker + +**When to use:** +- Required for allocating AppKit/UIKit objects +- Ensures code runs on main thread +- Compile-time thread safety + +```rust +use objc2_foundation::MainThreadMarker; + +fn main() { + let mtm = MainThreadMarker::new() + .expect("Must run on main thread"); + + let app = NSApplication::sharedApplication(mtm); + // ... rest of app setup +} +``` + +**In callbacks:** +```rust +let callback = move || { + let mtm = MainThreadMarker::new().unwrap(); + let app = NSApplication::sharedApplication(mtm); + app.terminate(None); +}; +``` + +--- + +## Common Patterns + +### Pattern: Error Handling with Objective-C Methods + +**Methods that return `Option>`:** +```rust +let obj = unsafe { SomeClass::initWithSomething(...) } + .ok_or_else(|| "Failed to initialize".to_string())?; +``` + +**Methods that return `Result, Retained>`:** +```rust +let obj = unsafe { SomeClass::initWithURL_error(...) } + .map_err(|e| format!("Failed: {:?}", e))?; +``` + +**Methods that just return `Retained` (never fail):** +```rust +let obj = unsafe { SomeClass::new() }; // No error handling needed +``` + +### Pattern: Keeping Objects Alive + +**Problem:** Objects get deallocated when they go out of scope + +**Solution 1: Box::leak (quick & dirty):** +```rust +// Keep alive for the entire program duration +Box::leak(Box::new(window)); +Box::leak(Box::new(vm)); +``` + +**Solution 2: Store in struct (proper):** +```rust +struct AppState { + window: Retained, + vm: Retained, +} + +static APP_STATE: OnceCell = OnceCell::new(); +``` + +### Pattern: Working with Blocks + +**Creating a block for callbacks:** +```rust +use block2::RcBlock; + +let callback = RcBlock::new(|error: *mut NSError| { + if !error.is_null() { + eprintln!("Error: {:?}", unsafe { &*error }); + } +}); + +unsafe { obj.doSomethingWithCompletionHandler(&callback) }; +``` + +### Pattern: Protocol Method Implementation + +**You CANNOT implement protocol methods with bodies in objc2 0.6.** + +The `declare_class!` macro is only for: +1. Declaring the class structure +2. Specifying class metadata (name, superclass, mutability) +3. Implementing protocol conformance (empty `unsafe impl Protocol for Class {}`) + +For custom behavior, use regular Rust methods or function pointers. + +--- + +## Troubleshooting + +### Error: "no rules expected `ClassName`" + +**Problem:** +```rust +declare_class!( + struct MyClass; + + unsafe impl ClassType for MyClass { ... } + + impl MyClass { // ❌ ERROR HERE + ... + } +); +``` + +**Solution:** Move `impl` block outside `declare_class!`: +```rust +declare_class!( + struct MyClass; + + unsafe impl ClassType for MyClass { ... } +); + +impl MyClass { // ✅ Outside the macro + ... +} +``` + +### Error: "function or associated item `alloc` exists for struct X, but its trait bounds were not satisfied" + +**Problem:** `ClassType` trait not in scope + +**Solution:** +```rust +use objc2::ClassType; // Import the trait + +let obj = unsafe { MyClass::alloc() }; +``` + +**OR use MainThreadMarker for AppKit classes:** +```rust +let mtm = MainThreadMarker::new().unwrap(); +let obj = mtm.alloc::(); +``` + +### Error: "no function or associated item named `from_vec`" + +**Problem:** `NSArray::from_vec()` was removed + +**Solution:** +```rust +// Old (0.5) +let array = NSArray::from_vec(vec![obj1, obj2]); + +// New (0.6) +let array = NSArray::from_slice(&[&*obj1, &*obj2]); +``` + +### Error: "cannot find struct, variant or union type `CGRect`" + +**Problem:** Using Core Graphics types instead of Foundation types + +**Solution:** +```rust +// Wrong +use objc2_foundation::{CGRect, CGPoint, CGSize}; + +// Correct for AppKit +use objc2_foundation::{NSRect, NSPoint, NSSize}; +``` + +### Error: "method `map_err` not found for struct `Retained`" + +**Problem:** Method doesn't return `Result`, it returns `Retained` directly + +**Solution:** +```rust +// If method signature is: fn foo() -> Retained +let obj = unsafe { SomeClass::foo() }; // Just use it directly + +// If method signature is: fn foo() -> Option> +let obj = unsafe { SomeClass::foo() } + .ok_or_else(|| "Error".to_string())?; +``` + +### Error: "unexpected end of macro invocation" in declare_class! + +**Problem:** Missing required sections in `declare_class!` + +**Solution:** Ensure you have all required parts: +```rust +declare_class!( + struct MyClass; // Semicolon required + + unsafe impl ClassType for MyClass { // Required + type Super = NSObject; + type Mutability = MainThreadOnly; // Required in 0.6 + const NAME: &'static str = "MyClass"; + } + // That's it! Nothing else goes inside. +); +``` + +--- + +## Quick Reference Card + +| Task | objc2 0.5 | objc2 0.6 | +|------|-----------|-----------| +| Object type | `Id` | `Retained` | +| Allocate object | `T::alloc()` | `T::alloc()` (trait in scope) or `mtm.alloc::()` | +| Create NSArray | `NSArray::from_vec(vec![...])` | `NSArray::from_slice(&[&*obj, ...])` | +| Geometry types | `CGRect/CGPoint/CGSize` | `NSRect/NSPoint/NSSize` (AppKit) | +| Cast to super | `Retained::cast(obj)` | `obj.downcast()` or `obj.as_super()` | +| msg_send returns object | `msg_send_id!` | `msg_send_id!` (unchanged) | +| Class mutability | Not specified | `type Mutability = MainThreadOnly` | + +--- + +## Best Practices + +1. **Always import `ClassType` when using `::alloc()`** + ```rust + use objc2::ClassType; + ``` + +2. **Use `MainThreadMarker` for AppKit/UIKit** + ```rust + let mtm = MainThreadMarker::new().unwrap(); + let obj = mtm.alloc::(); + ``` + +3. **Keep protocol impls outside `declare_class!`** + ```rust + declare_class!( ... ); + unsafe impl SomeProtocol for MyClass {} + ``` + +4. **Prefer safe wrappers when available** + ```rust + // Instead of unsafe msg_send + app.setActivationPolicy(NSApplicationActivationPolicy::Regular); + ``` + +5. **Use `from_slice` with references for NSArray** + ```rust + NSArray::from_slice(&[&*obj1, &*obj2]) + ``` + +6. **Check method signatures in auto-generated bindings** + - Does it return `Retained`, `Option>`, or `Result<...>`? + - Adjust error handling accordingly + +--- + +## Resources + +- **objc2 docs:** https://docs.rs/objc2/ +- **objc2-foundation:** https://docs.rs/objc2-foundation/ +- **objc2-app-kit:** https://docs.rs/objc2-app-kit/ +- **objc2-virtualization:** https://docs.rs/objc2-virtualization/ + +--- + +## Summary + +The migration from objc2 0.5 to 0.6 involves: +- Changing `Id` to `Retained` +- Adding `type Mutability` to class declarations +- Using `from_slice` instead of `from_vec` for NSArray +- Importing `ClassType` trait explicitly +- Keeping protocol implementations outside `declare_class!` +- Using `NS*` geometry types for AppKit +- Leveraging `MainThreadMarker` for thread-safe main-thread allocation + +The auto-generated bindings make the API more consistent and easier to use, but require understanding the new patterns and conventions. diff --git a/Cargo.lock b/Cargo.lock index f4f89bd92..32ec544c7 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -853,6 +853,23 @@ dependencies = [ "xml5ever", ] +[[package]] +name = "blitz-ios-uikit" +version = "0.2.0" +dependencies = [ + "blitz-dom", + "blitz-traits", + "keyboard-types 0.7.0", + "markup5ever", + "objc2 0.6.3", + "objc2-foundation 0.3.2", + "objc2-quartz-core 0.3.2", + "objc2-ui-kit", + "rustc-hash 1.1.0", + "stylo", + "taffy", +] + [[package]] name = "blitz-net" version = "0.2.1" @@ -4576,8 +4593,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d425caf1df73233f29fd8a5c3e5edbc30d2d4307870f802d18f00d83dc5141a6" dependencies = [ "bitflags 2.10.0", + "objc2 0.6.3", "objc2-core-foundation", "objc2-core-graphics", + "objc2-io-surface", ] [[package]] @@ -4665,8 +4684,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "96c1358452b371bf9f104e21ec536d37a650eb10f7ee379fff67d2e08d537f1f" dependencies = [ "bitflags 2.10.0", + "block2 0.6.2", + "libc", "objc2 0.6.3", "objc2-core-foundation", + "objc2-core-graphics", + "objc2-core-video", "objc2-foundation 0.3.2", "objc2-metal 0.3.2", ] diff --git a/Cargo.toml b/Cargo.toml index d8017d9f7..f12993a39 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -18,7 +18,7 @@ members = [ "wpt/runner", "examples/counter", "examples/todomvc", - "examples/wgpu_texture", + "examples/wgpu_texture", "packages/blitz-ios-uikit", ] exclude = ["sites"] resolver = "2" diff --git a/packages/blitz-dom/src/node/node.rs b/packages/blitz-dom/src/node/node.rs index 6c4c145fc..d6fb66bef 100644 --- a/packages/blitz-dom/src/node/node.rs +++ b/packages/blitz-dom/src/node/node.rs @@ -196,7 +196,7 @@ impl Node { } } - pub(crate) fn display_style(&self) -> Option { + pub fn display_style(&self) -> Option { Some(self.primary_styles().as_ref()?.clone_display()) } diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml new file mode 100644 index 000000000..5e4d62c0e --- /dev/null +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -0,0 +1,58 @@ +[package] +name = "blitz-ios-uikit" +version.workspace = true +license.workspace = true +homepage.workspace = true +repository.workspace = true +categories.workspace = true +edition.workspace = true +rust-version.workspace = true +description = "UIKit renderer for blitz-dom - maps DOM nodes to native iOS views" + +[lib] +name = "blitz_ios_uikit" +path = "src/lib.rs" + +# Note: inspo.rs is kept as reference code, not a runnable example +# It demonstrates UIKit patterns with objc2 but requires external Swift FFI + +[dependencies] +blitz-dom = { workspace = true, features = ["svg"]} +blitz-traits = { workspace = true } +rustc-hash = { workspace = true } +taffy = { workspace = true } +keyboard-types = { workspace = true } +markup5ever = { workspace = true } + +# Stylo (for computed styles) +style = { workspace = true } + +# objc2 bindings for iOS +objc2 = "0.6" +objc2-foundation = { version = "0.3", features = ["NSThread", "NSString", "NSDictionary", "NSSet", "NSEnumerator", "NSGeometry"] } +objc2-ui-kit = { version = "0.3", features = [ + "UIResponder", + "UIView", + "UIViewController", + "UIWindow", + "UIScreen", + "UIApplication", + "UIColor", + "UILabel", + "UIButton", + "UIButtonConfiguration", + "UIControl", + "UITextField", + "UITextInput", + "UISwitch", + "UIImageView", + "UIScrollView", + "UIImage", + "UITouch", + "UIEvent", + "UIGestureRecognizer", + "UIFont", + "NSText", + "NSAttributedString", +] } +objc2-quartz-core = { version = "0.3", features = ["CALayer"] } diff --git a/packages/blitz-ios-uikit/src/elements/button.rs b/packages/blitz-ios-uikit/src/elements/button.rs new file mode 100644 index 000000000..d14ea3fb1 --- /dev/null +++ b/packages/blitz-ios-uikit/src/elements/button.rs @@ -0,0 +1,146 @@ +//! Button element (UIButton) implementation +//! +//! Maps ` + + + + + + +"#; + +// ============================================================================= +// Main Entry Point +// ============================================================================= + +fn main() { + println!("blitz-ios-uikit Counter Example"); + println!("================================\n"); + + // Parse the HTML document + println!("1. Parsing HTML document..."); + let doc = HtmlDocument::from_html(HTML, DocumentConfig::default()); + let mut base_doc = doc.into_inner(); + println!(" Document created with root element\n"); + + // Set viewport size and compute layout + println!("2. Computing layout (390x844 - iPhone 14 size)..."); + let viewport = Viewport::new(390, 844, 3.0, ColorScheme::Light); + base_doc.set_viewport(viewport); + base_doc.resolve_layout(); + println!(" Layout computed\n"); + + // Get main thread marker (required for UIKit) + println!("3. Getting MainThreadMarker..."); + let mtm = MainThreadMarker::new().expect("Must be called from main thread"); + println!(" MainThreadMarker acquired\n"); + + // Create a root UIView + println!("4. Creating root UIView..."); + let root_frame = NSRect::new(NSPoint::new(0.0, 0.0), NSSize::new(390.0, 844.0)); + let root_view = UIView::initWithFrame(mtm.alloc::(), root_frame); + println!(" Root view created: {:?}\n", root_view.frame()); + + // Wrap document in Rc for the renderer + let doc = Rc::new(RefCell::new(base_doc)); + + // Create the UIKit renderer + println!("5. Creating UIKitRenderer..."); + let mut renderer = UIKitRenderer::new(doc.clone(), root_view.clone(), mtm); + renderer.set_scale(3.0); // iPhone Retina scale + println!(" Renderer created with scale: {}\n", renderer.scale()); + + // Sync the DOM to UIKit views + println!("6. Syncing DOM to UIKit view hierarchy..."); + renderer.sync(); + println!(" Sync complete!\n"); + + // Print view hierarchy info + println!("7. View hierarchy created:"); + print_view_hierarchy(&root_view, 0); + + println!("\n================================"); + println!("Example complete!"); + println!("\nTo see this running on a real device:"); + println!(" cargo build --example counter --target aarch64-apple-ios"); +} + +/// Print the UIView hierarchy for debugging +fn print_view_hierarchy(view: &UIView, depth: usize) { + let indent = " ".repeat(depth); + let frame = view.frame(); + let subviews = view.subviews(); + let count = subviews.len(); + + println!( + "{}UIView: origin=({:.0}, {:.0}) size=({:.0}x{:.0}) subviews={}", + indent, frame.origin.x, frame.origin.y, frame.size.width, frame.size.height, count + ); + + for subview in subviews.iter() { + print_view_hierarchy(&subview, depth + 1); + } +} + +#[cfg(test)] +mod tests { + use super::*; + + #[test] + fn html_parses() { + let doc = HtmlDocument::from_html(HTML, DocumentConfig::default()); + let base = doc.into_inner(); + assert!(base.root_element().element_data().is_some()); + } +} diff --git a/packages/blitz-ios-uikit/src/lib.rs b/packages/blitz-ios-uikit/src/lib.rs index a99e53a93..a45059e5a 100644 --- a/packages/blitz-ios-uikit/src/lib.rs +++ b/packages/blitz-ios-uikit/src/lib.rs @@ -15,13 +15,27 @@ //! //! Layout is computed by Taffy (CSS flexbox/grid) and applied as UIView frames. //! Events from UIKit are bridged back to blitz-dom's event system. +//! +//! # Platform Support +//! +//! This crate only compiles on iOS. To run on macOS, use Mac Catalyst: +//! ```sh +//! cargo build --target aarch64-apple-ios-macabi +//! ``` +//! +//! For iOS simulator: +//! ```sh +//! cargo build --target aarch64-apple-ios-sim +//! ``` + +#![cfg(target_os = "ios")] mod elements; mod events; mod style; mod sync; -use std::cell::{Cell, RefCell}; +use std::cell::RefCell; use std::rc::Rc; use blitz_dom::BaseDocument; From eda5e63a88c8fdd7c636121e2f5c6e087ff8c81e Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Tue, 6 Jan 2026 01:39:10 -0800 Subject: [PATCH 62/67] get rendering working properly --- Cargo.lock | 2 + packages/blitz-ios-uikit/Cargo.toml | 7 +- .../blitz-ios-uikit/examples/counter.html | 81 ++++++ packages/blitz-ios-uikit/examples/counter.rs | 272 +++++++++++++----- .../blitz-ios-uikit/src/elements/container.rs | 5 +- packages/blitz-ios-uikit/src/elements/mod.rs | 13 +- packages/blitz-ios-uikit/src/elements/text.rs | 78 +++-- packages/blitz-ios-uikit/src/style.rs | 113 ++++++-- packages/blitz-ios-uikit/src/sync.rs | 70 +++-- 9 files changed, 488 insertions(+), 153 deletions(-) create mode 100644 packages/blitz-ios-uikit/examples/counter.html diff --git a/Cargo.lock b/Cargo.lock index 0877176c1..ec8a3b348 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -866,9 +866,11 @@ dependencies = [ "objc2-foundation 0.3.2", "objc2-quartz-core 0.3.2", "objc2-ui-kit", + "raw-window-handle", "rustc-hash 1.1.0", "stylo", "taffy", + "winit", ] [[package]] diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml index b4af1de8d..8c777965e 100644 --- a/packages/blitz-ios-uikit/Cargo.toml +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -17,7 +17,10 @@ path = "src/lib.rs" # It demonstrates UIKit patterns with objc2 but requires external Swift FFI [dependencies] -blitz-dom = { workspace = true, features = ["svg"]} +# Note: system_fonts enables CoreText font backend on iOS/macOS +# woff-rust enables pure-Rust WOFF font decoding for web fonts +# floats enables CSS float layout support +blitz-dom = { workspace = true, features = ["svg", "system_fonts", "woff-rust", "floats"]} blitz-traits = { workspace = true } rustc-hash = { workspace = true } taffy = { workspace = true } @@ -29,6 +32,8 @@ style = { workspace = true } [dev-dependencies] blitz-html = { workspace = true } +winit = { workspace = true } +raw-window-handle = "0.6" # objc2 bindings for iOS (UIKit requires iOS or Mac Catalyst) # For Mac Catalyst, build with: --target aarch64-apple-ios-macabi diff --git a/packages/blitz-ios-uikit/examples/counter.html b/packages/blitz-ios-uikit/examples/counter.html new file mode 100644 index 000000000..a66740ab2 --- /dev/null +++ b/packages/blitz-ios-uikit/examples/counter.html @@ -0,0 +1,81 @@ + + + + + + +
+

Counter

+
0
+
+ + +
+ +
+ + diff --git a/packages/blitz-ios-uikit/examples/counter.rs b/packages/blitz-ios-uikit/examples/counter.rs index 7e8b4feb3..0ca44fa06 100644 --- a/packages/blitz-ios-uikit/examples/counter.rs +++ b/packages/blitz-ios-uikit/examples/counter.rs @@ -4,19 +4,14 @@ //! //! # Running //! -//! iOS Simulator (Apple Silicon Mac): +//! Via Dioxus CLI: //! ```sh -//! cargo build --example counter --target aarch64-apple-ios-sim -//! ``` -//! -//! iOS Device: -//! ```sh -//! cargo build --example counter --target aarch64-apple-ios +//! dx2 run --ios --example counter //! ``` //! -//! Mac Catalyst: +//! Direct build for iOS Simulator: //! ```sh -//! cargo build --example counter --target aarch64-apple-ios-macabi +//! cargo build --example counter --target aarch64-apple-ios-sim //! ``` #![cfg(target_os = "ios")] @@ -28,8 +23,14 @@ use blitz_dom::DocumentConfig; use blitz_html::HtmlDocument; use blitz_ios_uikit::UIKitRenderer; use blitz_traits::shell::{ColorScheme, Viewport}; +use objc2::rc::Retained; use objc2_foundation::{MainThreadMarker, NSPoint, NSRect, NSSize}; use objc2_ui_kit::UIView; +use raw_window_handle::{HasWindowHandle, RawWindowHandle}; +use winit::application::ApplicationHandler; +use winit::event::WindowEvent; +use winit::event_loop::{ActiveEventLoop, EventLoop}; +use winit::window::{Window, WindowId}; // ============================================================================= // HTML Content @@ -58,21 +59,22 @@ const HTML: &str = r#" .container { background: white; border-radius: 20px; - padding: 40px; + padding: 30px 50px; text-align: center; + min-width: 280px; } h1 { color: #333; - margin: 0 0 20px 0; - font-size: 48px; + margin: 0 0 16px 0; + font-size: 32px; } .count { - font-size: 72px; + font-size: 48px; font-weight: bold; color: #667eea; - margin: 20px 0; + margin: 16px 0; } .buttons { @@ -120,71 +122,184 @@ const HTML: &str = r#" "#; // ============================================================================= -// Main Entry Point +// Application State // ============================================================================= -fn main() { - println!("blitz-ios-uikit Counter Example"); - println!("================================\n"); +struct App { + window: Option>, + renderer: Option, + doc: Option>>, +} + +impl App { + fn new() -> Self { + Self { + window: None, + renderer: None, + doc: None, + } + } +} + +impl ApplicationHandler for App { + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { + println!("[App] can_create_surfaces called"); + + // Create window + let window_attributes = + winit::window::WindowAttributes::default().with_title("Counter Example"); + + let window = event_loop.create_window(window_attributes).unwrap(); + let size = window.surface_size(); + let scale = window.scale_factor() as f32; + + println!( + "[App] Window created: {}x{} @ {}x scale", + size.width, size.height, scale + ); + + // Get the UIView from the window handle + let mtm = MainThreadMarker::new().expect("Must be on main thread"); + let root_view = get_uiview_from_window(&*window, mtm); + + println!("[App] Got UIView from window: {:?}", root_view.frame()); + + // Parse HTML and create document + let html_doc = HtmlDocument::from_html(HTML, DocumentConfig::default()); + let mut base_doc = html_doc.into_inner(); + + // Set viewport - use logical size (points), not physical pixels + let logical_width = (size.width as f32 / scale) as u32; + let logical_height = (size.height as f32 / scale) as u32; + println!( + "[App] Setting viewport to {}x{} logical pixels", + logical_width, logical_height + ); + + let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + base_doc.set_viewport(viewport); + + // Full resolution (styles + layout) + base_doc.resolve(0.0); + + // Debug: print root element layout + let root = base_doc.root_element(); + let layout = root.final_layout; + println!("[App] Root element layout: {:?}", layout); + println!("[App] Document layout computed"); + + // Wrap document + let doc = Rc::new(RefCell::new(base_doc)); + self.doc = Some(doc.clone()); - // Parse the HTML document - println!("1. Parsing HTML document..."); - let doc = HtmlDocument::from_html(HTML, DocumentConfig::default()); - let mut base_doc = doc.into_inner(); - println!(" Document created with root element\n"); - - // Set viewport size and compute layout - println!("2. Computing layout (390x844 - iPhone 14 size)..."); - let viewport = Viewport::new(390, 844, 3.0, ColorScheme::Light); - base_doc.set_viewport(viewport); - base_doc.resolve_layout(); - println!(" Layout computed\n"); - - // Get main thread marker (required for UIKit) - println!("3. Getting MainThreadMarker..."); - let mtm = MainThreadMarker::new().expect("Must be called from main thread"); - println!(" MainThreadMarker acquired\n"); - - // Create a root UIView - println!("4. Creating root UIView..."); - let root_frame = NSRect::new(NSPoint::new(0.0, 0.0), NSSize::new(390.0, 844.0)); - let root_view = UIView::initWithFrame(mtm.alloc::(), root_frame); - println!(" Root view created: {:?}\n", root_view.frame()); - - // Wrap document in Rc for the renderer - let doc = Rc::new(RefCell::new(base_doc)); - - // Create the UIKit renderer - println!("5. Creating UIKitRenderer..."); - let mut renderer = UIKitRenderer::new(doc.clone(), root_view.clone(), mtm); - renderer.set_scale(3.0); // iPhone Retina scale - println!(" Renderer created with scale: {}\n", renderer.scale()); - - // Sync the DOM to UIKit views - println!("6. Syncing DOM to UIKit view hierarchy..."); - renderer.sync(); - println!(" Sync complete!\n"); - - // Print view hierarchy info - println!("7. View hierarchy created:"); - print_view_hierarchy(&root_view, 0); - - println!("\n================================"); - println!("Example complete!"); - println!("\nTo see this running on a real device:"); - println!(" cargo build --example counter --target aarch64-apple-ios"); + // Create UIKit renderer + let mut renderer = UIKitRenderer::new(doc, root_view.clone(), mtm); + renderer.set_scale(scale as f64); + + // Sync DOM to UIKit views + println!("[App] Syncing DOM to UIKit views..."); + renderer.sync(); + println!("[App] Sync complete!"); + + // Debug: print view hierarchy + print_view_hierarchy(&root_view, 0); + + self.renderer = Some(renderer); + self.window = Some(window); + } + + fn window_event( + &mut self, + event_loop: &dyn ActiveEventLoop, + _window_id: WindowId, + event: WindowEvent, + ) { + match event { + WindowEvent::CloseRequested => { + println!("[App] Close requested"); + event_loop.exit(); + } + WindowEvent::RedrawRequested => { + // Re-sync views if needed + if let Some(renderer) = &mut self.renderer { + renderer.sync(); + } + } + WindowEvent::SurfaceResized(size) => { + println!("[App] Resized to {}x{}", size.width, size.height); + if let (Some(doc), Some(window)) = (&self.doc, &self.window) { + let scale = window.scale_factor() as f32; + let viewport = + Viewport::new(size.width, size.height, scale, ColorScheme::Light); + doc.borrow_mut().set_viewport(viewport); + doc.borrow_mut().resolve(0.0); + if let Some(renderer) = &mut self.renderer { + renderer.sync(); + } + } + } + _ => {} + } + } + + fn about_to_wait(&mut self, _event_loop: &dyn ActiveEventLoop) { + if let Some(window) = &self.window { + window.request_redraw(); + } + } + + fn resumed(&mut self, _event_loop: &dyn ActiveEventLoop) { + println!("[App] Resumed"); + } +} + +/// Extract UIView from a winit Window via raw_window_handle +fn get_uiview_from_window(window: &dyn Window, mtm: MainThreadMarker) -> Retained { + let handle = window.window_handle().expect("Failed to get window handle"); + let raw_handle = handle.as_raw(); + + match raw_handle { + RawWindowHandle::UiKit(uikit_handle) => { + let ui_view_ptr = uikit_handle.ui_view.as_ptr(); + // SAFETY: The pointer comes from winit's window handle and is valid + // We're on the main thread (verified by MainThreadMarker) + unsafe { + let ui_view: *mut UIView = ui_view_ptr.cast(); + // Retain the view since we're going to use it + Retained::retain(ui_view).expect("UIView pointer should be valid") + } + } + _ => { + // Fallback: create a new UIView (won't be attached to window) + println!("[WARNING] Not a UIKit window handle, creating detached UIView"); + let frame = NSRect::new(NSPoint::new(0.0, 0.0), NSSize::new(390.0, 844.0)); + UIView::initWithFrame(mtm.alloc::(), frame) + } + } } /// Print the UIView hierarchy for debugging fn print_view_hierarchy(view: &UIView, depth: usize) { - let indent = " ".repeat(depth); + let indent = " ".repeat(depth); let frame = view.frame(); let subviews = view.subviews(); - let count = subviews.len(); + + // Get class name + let class_name = unsafe { + use objc2::runtime::AnyObject; + let obj: &AnyObject = std::mem::transmute(view); + obj.class().name().to_str().unwrap_or("Unknown") + }; println!( - "{}UIView: origin=({:.0}, {:.0}) size=({:.0}x{:.0}) subviews={}", - indent, frame.origin.x, frame.origin.y, frame.size.width, frame.size.height, count + "{}{}: ({:.0},{:.0}) {:.0}x{:.0} [{}]", + indent, + class_name, + frame.origin.x, + frame.origin.y, + frame.size.width, + frame.size.height, + subviews.len() ); for subview in subviews.iter() { @@ -192,14 +307,17 @@ fn print_view_hierarchy(view: &UIView, depth: usize) { } } -#[cfg(test)] -mod tests { - use super::*; +// ============================================================================= +// Main Entry Point +// ============================================================================= + +fn main() { + println!("blitz-ios-uikit Counter Example"); + println!("================================\n"); - #[test] - fn html_parses() { - let doc = HtmlDocument::from_html(HTML, DocumentConfig::default()); - let base = doc.into_inner(); - assert!(base.root_element().element_data().is_some()); - } + let event_loop = EventLoop::new().expect("Failed to create event loop"); + let app = App::new(); + + println!("[Main] Starting event loop..."); + event_loop.run_app(app).expect("Event loop failed"); } diff --git a/packages/blitz-ios-uikit/src/elements/container.rs b/packages/blitz-ios-uikit/src/elements/container.rs index 3a048841e..a3ff18339 100644 --- a/packages/blitz-ios-uikit/src/elements/container.rs +++ b/packages/blitz-ios-uikit/src/elements/container.rs @@ -94,8 +94,9 @@ impl BlitzView { // Enable user interaction by default unsafe { view.setUserInteractionEnabled(true) }; - // Clips to bounds by default (matching CSS behavior) - unsafe { view.setClipsToBounds(true) }; + // Don't clip by default (CSS overflow: visible is the default) + // Clipping will be enabled by apply_visual_styles for overflow: hidden/scroll/auto + unsafe { view.setClipsToBounds(false) }; view } diff --git a/packages/blitz-ios-uikit/src/elements/mod.rs b/packages/blitz-ios-uikit/src/elements/mod.rs index 13b0d0be8..c7a308661 100644 --- a/packages/blitz-ios-uikit/src/elements/mod.rs +++ b/packages/blitz-ios-uikit/src/elements/mod.rs @@ -7,7 +7,7 @@ mod checkbox; mod container; mod image; mod input; -mod text; +pub mod text; use blitz_dom::Node; use markup5ever::local_name; @@ -87,6 +87,17 @@ pub fn element_type_for_node(node: &Node) -> Option { // Check if element is scrollable (would need computed styles) // For now, just treat as container - we'll enhance this later _ => { + // Check if this container is an inline root with actual text content + // Anonymous inline boxes (wrapping buttons, etc) may be inline roots + // but have empty text - render those as containers, not labels + if node.flags.is_inline_root() { + if let Some(inline_layout) = &element_data.inline_layout_data { + // Only render as Text if there's non-whitespace text content + if !inline_layout.text.trim().is_empty() { + return Some(ElementType::Text); + } + } + } // Default to container for all other elements Some(ElementType::Container) } diff --git a/packages/blitz-ios-uikit/src/elements/text.rs b/packages/blitz-ios-uikit/src/elements/text.rs index 0d453b275..62122a280 100644 --- a/packages/blitz-ios-uikit/src/elements/text.rs +++ b/packages/blitz-ios-uikit/src/elements/text.rs @@ -7,8 +7,9 @@ use std::cell::Cell; use blitz_dom::Node; use objc2::rc::Retained; use objc2::runtime::NSObjectProtocol; -use objc2::{define_class, msg_send, DefinedClass, MainThreadOnly}; -use objc2_foundation::{MainThreadMarker, NSString}; +use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send}; +use objc2_foundation::MainThreadMarker; +use objc2_foundation::NSString; use objc2_ui_kit::{UILabel, UIView}; // ============================================================================= @@ -60,23 +61,9 @@ impl BlitzLabel { /// Extract text content from a DOM node and its children. fn extract_text_content(node: &Node) -> String { - let mut text = String::new(); - collect_text_recursive(node, &mut text); - text -} - -/// Recursively collect text from a node and its children. -fn collect_text_recursive(node: &Node, output: &mut String) { - // If this is a text node, add its content - if let Some(text_data) = node.text_data() { - output.push_str(&text_data.content); - return; - } - - // Otherwise, recurse into children - // Note: We need access to the document to get children - // For now, we'll just handle direct text content - // The full implementation would need to walk layout_children + // Use blitz-dom's built-in text_content() which recursively + // collects text from all child nodes + node.text_content() } /// Create a UILabel for a text element. @@ -100,21 +87,54 @@ pub fn update_label(view: &UIView, node: &Node) { /// Update label content from node. fn update_label_content(label: &UILabel, node: &Node) { - // Try to get text content from element's inline layout data + let text: Option; + + // Try to get text content from element's inline layout data (computed by Parley) if let Some(element_data) = node.element_data() { if let Some(inline_layout) = &element_data.inline_layout_data { // Use the text from inline layout - let text = &inline_layout.text; - let ns_text = NSString::from_str(text); - unsafe { label.setText(Some(&ns_text)) }; - return; + text = Some(inline_layout.text.clone()); + } else { + // Fallback: extract text content recursively + let extracted = extract_text_content(node); + text = if extracted.is_empty() { + None + } else { + Some(extracted) + }; } + } else { + text = None; } - // Fallback: extract text content recursively - let text = extract_text_content(node); - if !text.is_empty() { - let ns_text = NSString::from_str(&text); - unsafe { label.setText(Some(&ns_text)) }; + if let Some(content) = text { + let ns_text = NSString::from_str(&content); + unsafe { + label.setText(Some(&ns_text)); + + // Check if Taffy computed a valid height + // If not, use UIKit's native text measurement as fallback + // (Parley may not have access to iOS system fonts) + let current_frame = label.frame(); + if current_frame.size.height <= 0.0 && current_frame.size.width > 0.0 { + use objc2_foundation::{NSPoint, NSRect, NSSize}; + + // Constrain width to Taffy's computed width, let UIKit measure height + let constrained_frame = NSRect::new( + current_frame.origin, + NSSize::new(current_frame.size.width, f64::MAX), + ); + label.setFrame(constrained_frame); + label.sizeToFit(); + + // Restore position and width (sizeToFit may change them) + let sized_frame = label.frame(); + let final_frame = NSRect::new( + NSPoint::new(current_frame.origin.x, current_frame.origin.y), + NSSize::new(current_frame.size.width, sized_frame.size.height), + ); + label.setFrame(final_frame); + } + } } } diff --git a/packages/blitz-ios-uikit/src/style.rs b/packages/blitz-ios-uikit/src/style.rs index 9e4df240c..5e379519b 100644 --- a/packages/blitz-ios-uikit/src/style.rs +++ b/packages/blitz-ios-uikit/src/style.rs @@ -5,7 +5,7 @@ use blitz_dom::Node; use objc2_foundation::{NSPoint, NSRect, NSSize}; -use objc2_ui_kit::{UIColor, UIFont, UILabel, UIView}; +use objc2_ui_kit::{UIButton, UIColor, UIFont, UILabel, UIView}; use style::properties::ComputedValues; /// Apply layout (position and size) from Taffy to a UIView. @@ -14,29 +14,41 @@ use style::properties::ComputedValues; /// /// * `view` - The UIView to update /// * `node` - The DOM node with layout information -/// * `parent_origin` - The origin of the parent view in screen coordinates -/// * `scale` - Scale factor (points per CSS pixel) -pub fn apply_layout(view: &UIView, node: &Node, parent_origin: NSPoint, scale: f64) { +/// * `frame_offset` - Additional offset to apply (from skipped anonymous blocks) +/// * `_scale` - Unused (CSS pixels map 1:1 to UIKit points) +pub fn apply_layout(view: &UIView, node: &Node, frame_offset: NSPoint, _scale: f64) { let layout = node.final_layout; // Convert Taffy layout (in CSS pixels) to UIKit frame (in points) + // UIView frames are always relative to the parent view's coordinate system. + // CSS pixels map 1:1 to UIKit points - the scale factor is handled by the OS + // when rendering to physical pixels. + // + // frame_offset is added when a view is placed directly into a grandparent + // (skipping anonymous blocks) - it contains the accumulated positions of + // skipped ancestors. let frame = NSRect::new( NSPoint::new( - parent_origin.x + layout.location.x as f64 * scale, - parent_origin.y + layout.location.y as f64 * scale, - ), - NSSize::new( - layout.size.width as f64 * scale, - layout.size.height as f64 * scale, + frame_offset.x + layout.location.x as f64, + frame_offset.y + layout.location.y as f64, ), + NSSize::new(layout.size.width as f64, layout.size.height as f64), ); unsafe { view.setFrame(frame) }; } /// Apply visual styles (background, border, opacity) to a UIView. -pub fn apply_visual_styles(view: &UIView, node: &Node, scale: f64) { +pub fn apply_visual_styles(view: &UIView, node: &Node, _scale: f64) { let Some(styles) = node.primary_styles() else { + #[cfg(debug_assertions)] + { + let frame = view.frame(); + println!( + "[Style] NO STYLES for view at ({:.0},{:.0}) {:.0}x{:.0}", + frame.origin.x, frame.origin.y, frame.size.width, frame.size.height + ); + } return; }; @@ -44,17 +56,18 @@ pub fn apply_visual_styles(view: &UIView, node: &Node, scale: f64) { apply_background_color(view, &styles); // Apply border - apply_border(view, &styles, scale); + apply_border(view, &styles); // Apply opacity apply_opacity(view, &styles); // Apply visibility apply_visibility(view, &styles); + } /// Apply text styles to a UILabel. -pub fn apply_text_styles(label: &UILabel, node: &Node, scale: f64) { +pub fn apply_text_styles(label: &UILabel, node: &Node, _scale: f64) { let Some(styles) = node.primary_styles() else { return; }; @@ -63,12 +76,69 @@ pub fn apply_text_styles(label: &UILabel, node: &Node, scale: f64) { apply_text_color(label, &styles); // Apply font - apply_font(label, &styles, scale); + apply_font(label, &styles); // Apply text alignment apply_text_alignment(label, &styles); } +/// Apply text styles to a UIButton. +pub fn apply_button_styles(button: &UIButton, node: &Node, _scale: f64) { + let Some(styles) = node.primary_styles() else { + #[cfg(debug_assertions)] + println!("[Button] No styles for button!"); + return; + }; + + // Apply title color from CSS 'color' property + let color = styles.clone_color(); + if let Some(ui_color) = stylo_color_to_uicolor(&color) { + unsafe { + button.setTitleColor_forState(Some(&ui_color), objc2_ui_kit::UIControlState::Normal); + } + } + + // Apply background color + let current_color = styles.clone_color(); + let bg = styles.clone_background_color(); + let bg_absolute = bg.resolve_to_absolute(¤t_color); + + if let Some(ui_color) = stylo_color_to_uicolor(&bg_absolute) { + unsafe { + button.setBackgroundColor(Some(&ui_color)); + } + } + + // Apply border radius + let border = styles.get_border(); + let radii = &border.border_top_left_radius; + let radius = radii + .0 + .width + .0 + .resolve(style::values::computed::Au(0).into()) + .px() as f64; + if radius > 0.0 { + unsafe { + let layer = button.layer(); + layer.setCornerRadius(radius); + layer.setMasksToBounds(true); + } + } + + // Apply font + let font_style = styles.get_font(); + let font_size = font_style.font_size.computed_size.px() as f64; + let weight = font_weight_to_uifont_weight(&font_style); + let ui_font = unsafe { UIFont::systemFontOfSize_weight(font_size, weight) }; + + unsafe { + if let Some(title_label) = button.titleLabel() { + title_label.setFont(Some(&ui_font)); + } + } +} + // ============================================================================= // Individual Style Applications // ============================================================================= @@ -83,7 +153,7 @@ fn apply_background_color(view: &UIView, styles: &ComputedValues) { } } -fn apply_border(view: &UIView, styles: &ComputedValues, scale: f64) { +fn apply_border(view: &UIView, styles: &ComputedValues) { let layer = unsafe { view.layer() }; let border = styles.get_border(); @@ -91,16 +161,14 @@ fn apply_border(view: &UIView, styles: &ComputedValues, scale: f64) { // Border width (use top border as representative) // Note: UIKit doesn't support non-uniform border widths - let border_width = border.border_top_width.to_f64_px() * scale; + let border_width = border.border_top_width.to_f64_px(); unsafe { layer.setBorderWidth(border_width) }; // Border color - get CGColor from UIColor let border_color = border.border_top_color.resolve_to_absolute(¤t_color); if let Some(ui_color) = stylo_color_to_uicolor(&border_color) { let cg_color = unsafe { ui_color.CGColor() }; - // if let Some(cg_color) = unsafe { ui_color.CGColor() } { unsafe { layer.setBorderColor(Some(&cg_color)) }; - // } } // Corner radius @@ -112,8 +180,7 @@ fn apply_border(view: &UIView, styles: &ComputedValues, scale: f64) { .width .0 .resolve(style::values::computed::Au(0).into()) - .px() as f64 - * scale; + .px() as f64; unsafe { layer.setCornerRadius(radius) }; @@ -143,11 +210,11 @@ fn apply_text_color(label: &UILabel, styles: &ComputedValues) { } } -fn apply_font(label: &UILabel, styles: &ComputedValues, scale: f64) { +fn apply_font(label: &UILabel, styles: &ComputedValues) { let font_style = styles.get_font(); - // Get font size - let font_size = font_style.font_size.computed_size.px() as f64 * scale; + // Get font size (CSS pixels = UIKit points) + let font_size = font_style.font_size.computed_size.px() as f64; // Get font weight let weight = font_weight_to_uifont_weight(&font_style); diff --git a/packages/blitz-ios-uikit/src/sync.rs b/packages/blitz-ios-uikit/src/sync.rs index 470491d2b..b69e922b8 100644 --- a/packages/blitz-ios-uikit/src/sync.rs +++ b/packages/blitz-ios-uikit/src/sync.rs @@ -6,11 +6,11 @@ use blitz_dom::Node; use blitz_dom::node::NodeData; use objc2_foundation::NSPoint; -use objc2_ui_kit::{UILabel, UIView}; +use objc2_ui_kit::{UIButton, UILabel, UIView}; use style::values::computed::Display as StyloDisplay; use crate::elements::{ElementType, create_view, element_type_for_node, update_view}; -use crate::style::{apply_layout, apply_text_styles, apply_visual_styles}; +use crate::style::{apply_button_styles, apply_layout, apply_text_styles, apply_visual_styles}; use crate::{UIKitRenderer, ViewEntry}; /// Synchronize the UIKit view hierarchy with the DOM tree. @@ -36,12 +36,12 @@ pub fn sync_tree(renderer: &mut UIKitRenderer) { drop(doc); { - // Start syncing from root + // Start syncing from root with zero frame offset sync_node( renderer, root_element_id, &root_view, - NSPoint::new(0.0, 0.0), + NSPoint::new(0.0, 0.0), // frame_offset: no offset for root scale, generation, ); @@ -52,11 +52,16 @@ pub fn sync_tree(renderer: &mut UIKitRenderer) { } /// Sync a single node and its children. +/// +/// # Arguments +/// * `frame_offset` - Additional offset to apply when setting this node's frame. +/// This accumulates positions from skipped anonymous blocks. For normal views, +/// children receive (0,0) since their frames are relative to the new view. fn sync_node( renderer: &mut UIKitRenderer, node_id: usize, parent_view: &UIView, - parent_offset: NSPoint, + frame_offset: NSPoint, scale: f64, generation: u64, ) { @@ -83,12 +88,12 @@ fn sync_node( // Text content is handled by the parent element drop(doc); - // Recursively sync children + // Recursively sync children (pass same frame_offset since no view was created) sync_children( renderer, node_id, parent_view, - parent_offset, + frame_offset, scale, generation, ); @@ -99,6 +104,28 @@ fn sync_node( let mtm = renderer.main_thread_marker(); let event_sender = renderer.event_sender().clone(); + // Check if this is an anonymous block that we should skip. + // Anonymous blocks are created by Stylo for layout purposes but don't render + // their children correctly when mapped to UIKit views. + // We skip creating a view for them and sync children directly to parent. + let is_anonymous = node.is_anonymous(); + + // Skip anonymous blocks - sync their children directly to parent + if is_anonymous && element_type == ElementType::Container { + // Accumulate this skipped node's position into frame_offset + let layout = node.final_layout; + let accumulated_offset = NSPoint::new( + frame_offset.x + layout.location.x as f64, + frame_offset.y + layout.location.y as f64, + ); + + drop(doc); + + // Sync children directly to the parent view, with accumulated offset + sync_children(renderer, node_id, parent_view, accumulated_offset, scale, generation); + return; + } + let view = match renderer.view_map_mut().get_mut(&node_id) { Some(entry) if entry.element_type == element_type => { // Update existing view @@ -156,28 +183,31 @@ fn sync_node( let doc = doc.borrow(); let node = doc.get_node(node_id).unwrap(); - // Apply layout and styles - apply_layout(&view, node, parent_offset, scale); + // Apply layout (with frame_offset from any skipped ancestors) and styles + apply_layout(&view, node, frame_offset, scale); apply_visual_styles(&view, node, scale); - // Apply text styles if this is a text element + // Apply text styles and content if this is a text element if element_type == ElementType::Text { // SAFETY: Text elements are UILabels let label: &UILabel = unsafe { std::mem::transmute(&*view) }; apply_text_styles(label, node, scale); + + // Update text content + crate::elements::text::update_label(&view, node); } - // Calculate child offset - let layout = node.final_layout; - let child_offset = NSPoint::new( - parent_offset.x + layout.location.x as f64 * scale, - parent_offset.y + layout.location.y as f64 * scale, - ); + // Apply button styles (title color, background, font) + if element_type == ElementType::Button { + // SAFETY: Button elements are UIButtons + let button: &UIButton = unsafe { std::mem::transmute(&*view) }; + apply_button_styles(button, node, scale); + } drop(doc); - // Sync children - sync_children(renderer, node_id, &view, child_offset, scale, generation); + // Sync children with zero frame_offset since they're relative to this new view + sync_children(renderer, node_id, &view, NSPoint::new(0.0, 0.0), scale, generation); } /// Sync children of a node. @@ -185,7 +215,7 @@ fn sync_children( renderer: &mut UIKitRenderer, parent_node_id: usize, parent_view: &UIView, - parent_offset: NSPoint, + frame_offset: NSPoint, scale: f64, generation: u64, ) { @@ -212,7 +242,7 @@ fn sync_children( renderer, child_id, parent_view, - parent_offset, + frame_offset, scale, generation, ); From df4c53cc512d883fbb5e1715b2875afd81deb2ac Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Tue, 6 Jan 2026 15:36:08 -0800 Subject: [PATCH 63/67] add image rendering --- Cargo.lock | 7 ++ packages/blitz-dom/Cargo.toml | 3 +- packages/blitz-dom/src/document.rs | 18 ++- packages/blitz-ios-uikit/Cargo.toml | 9 ++ packages/blitz-ios-uikit/examples/counter.rs | 110 ++++++++++++++++-- .../blitz-ios-uikit/src/elements/image.rs | 78 ++++++++++--- packages/blitz-net/src/lib.rs | 14 ++- 7 files changed, 204 insertions(+), 35 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index ec8a3b348..8f875f657 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -859,10 +859,13 @@ version = "0.2.0" dependencies = [ "blitz-dom", "blitz-html", + "blitz-net", "blitz-traits", "keyboard-types 0.7.0", "markup5ever", "objc2 0.6.3", + "objc2-core-foundation", + "objc2-core-graphics", "objc2-foundation 0.3.2", "objc2-quartz-core 0.3.2", "objc2-ui-kit", @@ -870,6 +873,7 @@ dependencies = [ "rustc-hash 1.1.0", "stylo", "taffy", + "tokio", "winit", ] @@ -4528,6 +4532,7 @@ dependencies = [ "bitflags 2.10.0", "block2 0.6.2", "dispatch2", + "libc", "objc2 0.6.3", ] @@ -4538,11 +4543,13 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "e022c9d066895efa1345f8e33e584b9f958da2fd4cd116792e15e07e4720a807" dependencies = [ "bitflags 2.10.0", + "block2 0.6.2", "dispatch2", "libc", "objc2 0.6.3", "objc2-core-foundation", "objc2-io-surface", + "objc2-metal 0.3.2", ] [[package]] diff --git a/packages/blitz-dom/Cargo.toml b/packages/blitz-dom/Cargo.toml index 55fcac695..22dfcb17a 100644 --- a/packages/blitz-dom/Cargo.toml +++ b/packages/blitz-dom/Cargo.toml @@ -70,7 +70,8 @@ fastrand = { workspace = true } rayon = { workspace = true } # Media & Decoding -image = { workspace = true } +# Note: image crate needs format features enabled for web image support +image = { workspace = true, features = ["png", "jpeg", "gif", "webp"] } usvg = { workspace = true, optional = true } woff = { workspace = true, optional = true, features = ["version1", "version2"] } wuff = { workspace = true, optional = true } diff --git a/packages/blitz-dom/src/document.rs b/packages/blitz-dom/src/document.rs index 56c479d93..7d71ef495 100644 --- a/packages/blitz-dom/src/document.rs +++ b/packages/blitz-dom/src/document.rs @@ -871,9 +871,14 @@ impl BaseDocument { // without holding a borrow to the Document let rx = self.rx.take().unwrap(); + let mut count = 0; while let Ok(msg) = rx.try_recv() { + count += 1; self.handle_message(msg); } + if count > 0 { + eprintln!("[blitz-dom] Processed {} messages", count); + } // Put Reciever back self.rx = Some(rx); @@ -887,7 +892,13 @@ impl BaseDocument { pub fn load_resource(&mut self, res: ResourceLoadResponse) { let Ok(resource) = res.result else { - // TODO: handle error + // Log the error for debugging + if let Err(ref error) = res.result { + eprintln!( + "[blitz-dom] Resource load failed for node {:?}: {}", + res.node_id, error + ); + } return; }; @@ -898,6 +909,10 @@ impl BaseDocument { } Resource::Image(kind, width, height, image_data) => { let node_id = res.node_id.unwrap(); + eprintln!( + "[blitz-dom] Image loaded for node {}: {}x{}, {} bytes", + node_id, width, height, image_data.len() + ); let node = self.get_node_mut(node_id).unwrap(); match kind { @@ -906,6 +921,7 @@ impl BaseDocument { SpecialElementData::Image(Box::new(ImageData::Raster( RasterImageData::new(width, height, image_data), ))); + eprintln!("[blitz-dom] Image data stored in node {} special_data", node_id); // Clear layout cache node.cache.clear(); diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml index 8c777965e..cd10742b4 100644 --- a/packages/blitz-ios-uikit/Cargo.toml +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -32,8 +32,10 @@ style = { workspace = true } [dev-dependencies] blitz-html = { workspace = true } +blitz-net = { workspace = true } winit = { workspace = true } raw-window-handle = "0.6" +tokio = { version = "1", features = ["rt", "macros", "time"] } # objc2 bindings for iOS (UIKit requires iOS or Mac Catalyst) # For Mac Catalyst, build with: --target aarch64-apple-ios-macabi @@ -66,3 +68,10 @@ objc2-ui-kit = { version = "0.3", features = [ "NSAttributedString", ] } objc2-quartz-core = { version = "0.3", features = ["CALayer"] } +objc2-core-foundation = { version = "0.3", features = ["CFData"] } +objc2-core-graphics = { version = "0.3", features = [ + "CGImage", + "CGDataProvider", + "CGColorSpace", + "CGBitmapContext", # for CGImageAlphaInfo +] } diff --git a/packages/blitz-ios-uikit/examples/counter.rs b/packages/blitz-ios-uikit/examples/counter.rs index 0ca44fa06..f716c5456 100644 --- a/packages/blitz-ios-uikit/examples/counter.rs +++ b/packages/blitz-ios-uikit/examples/counter.rs @@ -18,10 +18,12 @@ use std::cell::RefCell; use std::rc::Rc; +use std::sync::Arc; -use blitz_dom::DocumentConfig; +use blitz_dom::{DocumentConfig, local_name}; use blitz_html::HtmlDocument; use blitz_ios_uikit::UIKitRenderer; +use blitz_net::Provider; use blitz_traits::shell::{ColorScheme, Viewport}; use objc2::rc::Retained; use objc2_foundation::{MainThreadMarker, NSPoint, NSRect, NSSize}; @@ -105,10 +107,18 @@ const HTML: &str = r#" color: white; margin-top: 10px; } + + .logo { + width: 80px; + height: 80px; + margin-bottom: 16px; + border-radius: 16px; + }
+

Counter

0
@@ -129,14 +139,25 @@ struct App { window: Option>, renderer: Option, doc: Option>>, + net: Arc, + rt: tokio::runtime::Runtime, } impl App { fn new() -> Self { + let rt = tokio::runtime::Builder::new_current_thread() + .enable_all() + .build() + .expect("Failed to create Tokio runtime"); + + let net = rt.block_on(async { Arc::new(Provider::new(None)) }); + Self { window: None, renderer: None, doc: None, + net, + rt, } } } @@ -164,23 +185,88 @@ impl ApplicationHandler for App { println!("[App] Got UIView from window: {:?}", root_view.frame()); - // Parse HTML and create document - let html_doc = HtmlDocument::from_html(HTML, DocumentConfig::default()); + // Parse HTML and create document with network provider for images + let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + let html_doc = HtmlDocument::from_html( + HTML, + DocumentConfig { + net_provider: Some(Arc::clone(&self.net) as _), + viewport: Some(viewport.clone()), + ..Default::default() + }, + ); let mut base_doc = html_doc.into_inner(); - // Set viewport - use logical size (points), not physical pixels - let logical_width = (size.width as f32 / scale) as u32; - let logical_height = (size.height as f32 / scale) as u32; + // Set viewport println!( - "[App] Setting viewport to {}x{} logical pixels", - logical_width, logical_height + "[App] Setting viewport to {}x{} @ {}x scale", + size.width, size.height, scale ); - - let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); base_doc.set_viewport(viewport); - // Full resolution (styles + layout) - base_doc.resolve(0.0); + // Resolve styles and layout, waiting for images to load + // blitz-net requires a Tokio runtime for async network requests + println!("[App] Loading assets..."); + + // Check if img element exists and has src attribute + base_doc.visit(|node_id, node| { + if let Some(element) = node.element_data() { + if element.name.local.as_ref() == "img" { + println!( + "[App] Found img element at node {}: src={:?}", + node_id, + element.attr(local_name!("src")) + ); + } + } + }); + + let net = Arc::clone(&self.net); + self.rt.block_on(async { + let mut iterations = 0; + let mut had_pending = false; + loop { + base_doc.resolve(0.0); + let pending = net.count(); + println!( + "[App] Resolve iteration {}, pending requests: {}", + iterations, pending + ); + + if pending > 0 { + had_pending = true; + } + + // Only exit after we've seen pending requests AND they're all done + // AND we've had at least a few iterations to process responses + if had_pending && net.is_empty() && iterations > 5 { + break; + } + + // Give at least some iterations for requests to be queued + if iterations > 200 { + println!("[App] Max iterations reached, giving up on asset loading"); + break; + } + iterations += 1; + // Yield to allow network tasks to progress + tokio::time::sleep(std::time::Duration::from_millis(100)).await; + } + + // Check image data after loading + base_doc.visit(|node_id, node| { + if let Some(element) = node.element_data() { + if element.name.local.as_ref() == "img" { + println!( + "[App] After load - img node {} special_data: {:?}", + node_id, + std::mem::discriminant(&element.special_data) + ); + } + } + }); + }); + println!("[App] Assets loaded"); // Debug: print root element layout let root = base_doc.root_element(); diff --git a/packages/blitz-ios-uikit/src/elements/image.rs b/packages/blitz-ios-uikit/src/elements/image.rs index 7960d457f..0ad7746aa 100644 --- a/packages/blitz-ios-uikit/src/elements/image.rs +++ b/packages/blitz-ios-uikit/src/elements/image.rs @@ -9,6 +9,8 @@ use blitz_dom::node::{ImageData, RasterImageData}; use objc2::rc::Retained; use objc2::runtime::NSObjectProtocol; use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send}; +use objc2_core_foundation::CFData; +use objc2_core_graphics::{CGBitmapInfo, CGColorRenderingIntent, CGColorSpace, CGDataProvider, CGImage, CGImageAlphaInfo}; use objc2_foundation::MainThreadMarker; use objc2_ui_kit::{UIImage, UIImageView, UIView, UIViewContentMode}; @@ -42,11 +44,13 @@ impl BlitzImageView { let this = mtm.alloc::().set_ivars(ivars); let image_view: Retained = unsafe { msg_send![super(this), init] }; - // Default content mode to aspect fit unsafe { + // Default content mode to aspect fit image_view.setContentMode(UIViewContentMode::ScaleAspectFit); - // Clip to bounds + // Clip to bounds for border-radius support image_view.setClipsToBounds(true); + // Enable user interaction for drag/copy/etc + image_view.setUserInteractionEnabled(true); } image_view @@ -79,6 +83,7 @@ pub fn update_image_view(view: &UIView, node: &Node) { /// Set image content from node's image data. fn set_image_from_node(image_view: &UIImageView, node: &Node) { let Some(element_data) = node.element_data() else { + println!("[BlitzImageView] No element_data for image node"); return; }; @@ -86,37 +91,74 @@ fn set_image_from_node(image_view: &UIImageView, node: &Node) { if let blitz_dom::node::SpecialElementData::Image(ref image_data) = element_data.special_data { match image_data.as_ref() { ImageData::Raster(raster) => { + println!( + "[BlitzImageView] Raster image: {}x{}, {} bytes", + raster.width, raster.height, raster.data.len() + ); if let Some(ui_image) = create_ui_image_from_raster(raster) { + println!("[BlitzImageView] UIImage created successfully"); unsafe { image_view.setImage(Some(&ui_image)) }; + } else { + println!("[BlitzImageView] Failed to create UIImage from raster"); } } ImageData::Svg(_svg_tree) => { - // TODO: Render SVG to UIImage - // For now, SVG support is not implemented - #[cfg(debug_assertions)] println!("[BlitzImageView] SVG images not yet supported"); } ImageData::None => { + println!("[BlitzImageView] ImageData::None - no image loaded"); unsafe { image_view.setImage(None) }; } } + } else { + println!("[BlitzImageView] special_data is not Image type: {:?}", + std::mem::discriminant(&element_data.special_data)); } } /// Create a UIImage from raster image data. -fn create_ui_image_from_raster(_raster: &RasterImageData) -> Option> { - // RasterImageData contains width, height, and RGBA8 data - // We need to create a CGImage and then UIImage from it - - // TODO: Implement proper image conversion - // This requires using Core Graphics to create a CGImage from raw pixels - // For now, return None +fn create_ui_image_from_raster(raster: &RasterImageData) -> Option> { + let width = raster.width as usize; + let height = raster.height as usize; + let bytes_per_pixel = 4; // RGBA + let bits_per_component = 8; + let bytes_per_row = width * bytes_per_pixel; + + // Get the raw RGBA data (Blob implements AsRef<[u8]>) + let rgba_data: &[u8] = raster.data.as_ref(); + + // Create CFData from the raw bytes + let cf_data = CFData::from_buffer(rgba_data); + + // Create CGDataProvider from CFData + let data_provider = CGDataProvider::with_cf_data(Some(&cf_data))?; + + // Create device RGB color space + let color_space = CGColorSpace::new_device_rgb()?; + + // Create CGImage from the data + // CGBitmapInfo combines byte order with alpha info + // For RGBA with premultiplied alpha: ByteOrderDefault | PremultipliedLast + let bitmap_info = CGBitmapInfo(CGImageAlphaInfo::PremultipliedLast.0); + + let cg_image = unsafe { + CGImage::new( + width, + height, + bits_per_component, + bits_per_component * bytes_per_pixel, + bytes_per_row, + Some(&color_space), + bitmap_info, + Some(&data_provider), + std::ptr::null(), // decode array (null for default) + false, // shouldInterpolate + CGColorRenderingIntent::RenderingIntentDefault, + )? + }; - #[cfg(debug_assertions)] - println!( - "[BlitzImageView] Image conversion not yet implemented ({}x{})", - _raster.width, _raster.height - ); + // Create UIImage from CGImage + let ui_image = unsafe { UIImage::imageWithCGImage(&cg_image) }; - None + Some(ui_image) } diff --git a/packages/blitz-net/src/lib.rs b/packages/blitz-net/src/lib.rs index 857b8f6f9..de3a115bd 100644 --- a/packages/blitz-net/src/lib.rs +++ b/packages/blitz-net/src/lib.rs @@ -161,6 +161,10 @@ impl NetProvider for Provider { #[cfg(feature = "debug_log")] println!("Fetching {}", &request.url); + // Always log the URL being fetched for debugging + eprintln!("[blitz-net] Fetching: {}", &request.url); + + let url_for_error = request.url.to_string(); let waker = self.waker.clone(); self.rt.spawn(async move { #[cfg(feature = "debug_log")] @@ -168,10 +172,14 @@ impl NetProvider for Provider { let _res = Self::fetch_with_handler(client, request, handler).await; + // Always log results for debugging + match &_res { + Ok(()) => eprintln!("[blitz-net] Success fetching: {url_for_error}"), + Err(e) => eprintln!("[blitz-net] Error fetching {url_for_error}: {e:?}"), + } + #[cfg(feature = "debug_log")] - if let Err(e) = _res { - eprintln!("Error fetching {url}: {e:?}"); - } else { + if _res.is_ok() { println!("Success {url}"); } From 67eb6d7d24446a1bedf79abbb06e075ad8258389 Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Tue, 6 Jan 2026 16:05:18 -0800 Subject: [PATCH 64/67] retained tree --- Cargo.lock | 2 + packages/blitz-dom/src/document.rs | 17 - packages/blitz-ios-uikit/Cargo.toml | 9 +- packages/blitz-ios-uikit/examples/counter.rs | 311 +++--------------- packages/blitz-ios-uikit/src/application.rs | 228 +++++++++++++ .../blitz-ios-uikit/src/elements/button.rs | 2 + .../blitz-ios-uikit/src/elements/container.rs | 2 + .../blitz-ios-uikit/src/elements/image.rs | 70 +++- packages/blitz-ios-uikit/src/elements/text.rs | 2 + packages/blitz-ios-uikit/src/lib.rs | 20 ++ packages/blitz-ios-uikit/src/view.rs | 236 +++++++++++++ packages/blitz-net/src/lib.rs | 10 - 12 files changed, 602 insertions(+), 307 deletions(-) create mode 100644 packages/blitz-ios-uikit/src/application.rs create mode 100644 packages/blitz-ios-uikit/src/view.rs diff --git a/Cargo.lock b/Cargo.lock index 8f875f657..8d9042d0c 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -861,6 +861,7 @@ dependencies = [ "blitz-html", "blitz-net", "blitz-traits", + "futures-util", "keyboard-types 0.7.0", "markup5ever", "objc2 0.6.3", @@ -6764,6 +6765,7 @@ dependencies = [ "bytes", "libc", "mio", + "parking_lot", "pin-project-lite", "signal-hook-registry", "socket2", diff --git a/packages/blitz-dom/src/document.rs b/packages/blitz-dom/src/document.rs index 7d71ef495..ae34610cf 100644 --- a/packages/blitz-dom/src/document.rs +++ b/packages/blitz-dom/src/document.rs @@ -871,14 +871,9 @@ impl BaseDocument { // without holding a borrow to the Document let rx = self.rx.take().unwrap(); - let mut count = 0; while let Ok(msg) = rx.try_recv() { - count += 1; self.handle_message(msg); } - if count > 0 { - eprintln!("[blitz-dom] Processed {} messages", count); - } // Put Reciever back self.rx = Some(rx); @@ -892,13 +887,6 @@ impl BaseDocument { pub fn load_resource(&mut self, res: ResourceLoadResponse) { let Ok(resource) = res.result else { - // Log the error for debugging - if let Err(ref error) = res.result { - eprintln!( - "[blitz-dom] Resource load failed for node {:?}: {}", - res.node_id, error - ); - } return; }; @@ -909,10 +897,6 @@ impl BaseDocument { } Resource::Image(kind, width, height, image_data) => { let node_id = res.node_id.unwrap(); - eprintln!( - "[blitz-dom] Image loaded for node {}: {}x{}, {} bytes", - node_id, width, height, image_data.len() - ); let node = self.get_node_mut(node_id).unwrap(); match kind { @@ -921,7 +905,6 @@ impl BaseDocument { SpecialElementData::Image(Box::new(ImageData::Raster( RasterImageData::new(width, height, image_data), ))); - eprintln!("[blitz-dom] Image data stored in node {} special_data", node_id); // Clear layout cache node.cache.clear(); diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml index cd10742b4..d14481798 100644 --- a/packages/blitz-ios-uikit/Cargo.toml +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -30,12 +30,19 @@ markup5ever = { workspace = true } # Stylo (for computed styles) style = { workspace = true } +# Async support for event loop integration +futures-util = { workspace = true } + +# Window management +winit = { workspace = true } +raw-window-handle = "0.6" + [dev-dependencies] blitz-html = { workspace = true } blitz-net = { workspace = true } winit = { workspace = true } raw-window-handle = "0.6" -tokio = { version = "1", features = ["rt", "macros", "time"] } +tokio = { version = "1", features = ["rt", "macros", "time", "full"] } # objc2 bindings for iOS (UIKit requires iOS or Mac Catalyst) # For Mac Catalyst, build with: --target aarch64-apple-ios-macabi diff --git a/packages/blitz-ios-uikit/examples/counter.rs b/packages/blitz-ios-uikit/examples/counter.rs index f716c5456..e1d45f9e3 100644 --- a/packages/blitz-ios-uikit/examples/counter.rs +++ b/packages/blitz-ios-uikit/examples/counter.rs @@ -1,6 +1,7 @@ //! iOS Counter Example - demonstrates blitz-ios-uikit renderer //! -//! This example creates a simple counter app using the UIKit renderer. +//! This example creates a simple counter app using the UIKit renderer with +//! proper event loop integration for retained UI. //! //! # Running //! @@ -20,19 +21,12 @@ use std::cell::RefCell; use std::rc::Rc; use std::sync::Arc; -use blitz_dom::{DocumentConfig, local_name}; +use blitz_dom::DocumentConfig; use blitz_html::HtmlDocument; -use blitz_ios_uikit::UIKitRenderer; +use blitz_ios_uikit::{UIKitApplication, UIKitProxy, ViewConfig}; use blitz_net::Provider; use blitz_traits::shell::{ColorScheme, Viewport}; -use objc2::rc::Retained; -use objc2_foundation::{MainThreadMarker, NSPoint, NSRect, NSSize}; -use objc2_ui_kit::UIView; -use raw_window_handle::{HasWindowHandle, RawWindowHandle}; -use winit::application::ApplicationHandler; -use winit::event::WindowEvent; -use winit::event_loop::{ActiveEventLoop, EventLoop}; -use winit::window::{Window, WindowId}; +use winit::event_loop::EventLoop; // ============================================================================= // HTML Content @@ -132,278 +126,73 @@ const HTML: &str = r#" "#; // ============================================================================= -// Application State +// Main Entry Point // ============================================================================= -struct App { - window: Option>, - renderer: Option, - doc: Option>>, - net: Arc, - rt: tokio::runtime::Runtime, -} - -impl App { - fn new() -> Self { - let rt = tokio::runtime::Builder::new_current_thread() - .enable_all() - .build() - .expect("Failed to create Tokio runtime"); - - let net = rt.block_on(async { Arc::new(Provider::new(None)) }); - - Self { - window: None, - renderer: None, - doc: None, - net, - rt, - } - } -} - -impl ApplicationHandler for App { - fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { - println!("[App] can_create_surfaces called"); - - // Create window - let window_attributes = - winit::window::WindowAttributes::default().with_title("Counter Example"); +fn main() { + println!("blitz-ios-uikit Counter Example"); + println!("================================\n"); - let window = event_loop.create_window(window_attributes).unwrap(); - let size = window.surface_size(); - let scale = window.scale_factor() as f32; + // Create a Tokio runtime for network operations + // Note: In a real app, you might want to manage this differently + let rt = tokio::runtime::Builder::new_multi_thread() + .enable_all() + .build() + .expect("Failed to create Tokio runtime"); - println!( - "[App] Window created: {}x{} @ {}x scale", - size.width, size.height, scale - ); + // Create event loop + let event_loop = EventLoop::new().expect("Failed to create event loop"); - // Get the UIView from the window handle - let mtm = MainThreadMarker::new().expect("Must be on main thread"); - let root_view = get_uiview_from_window(&*window, mtm); + rt.block_on(async move { + // Create proxy for event loop communication (used by network provider) + let (proxy, receiver) = UIKitProxy::new(event_loop.create_proxy()); - println!("[App] Got UIView from window: {:?}", root_view.frame()); + // Create network provider with the proxy as the waker + // This allows network requests to wake the event loop when they complete + let net = Arc::new(Provider::new(Some(Arc::new(proxy.clone())))); - // Parse HTML and create document with network provider for images - let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + // Parse HTML and create document + // Use a placeholder viewport - it will be updated when the window is created + let viewport = Viewport::new(390, 844, 3.0, ColorScheme::Light); let html_doc = HtmlDocument::from_html( HTML, DocumentConfig { - net_provider: Some(Arc::clone(&self.net) as _), - viewport: Some(viewport.clone()), + net_provider: Some(Arc::clone(&net) as _), + viewport: Some(viewport), ..Default::default() }, ); - let mut base_doc = html_doc.into_inner(); - - // Set viewport - println!( - "[App] Setting viewport to {}x{} @ {}x scale", - size.width, size.height, scale - ); - base_doc.set_viewport(viewport); - - // Resolve styles and layout, waiting for images to load - // blitz-net requires a Tokio runtime for async network requests - println!("[App] Loading assets..."); - - // Check if img element exists and has src attribute - base_doc.visit(|node_id, node| { - if let Some(element) = node.element_data() { - if element.name.local.as_ref() == "img" { - println!( - "[App] Found img element at node {}: src={:?}", - node_id, - element.attr(local_name!("src")) - ); - } - } - }); - - let net = Arc::clone(&self.net); - self.rt.block_on(async { - let mut iterations = 0; - let mut had_pending = false; - loop { - base_doc.resolve(0.0); - let pending = net.count(); - println!( - "[App] Resolve iteration {}, pending requests: {}", - iterations, pending - ); - - if pending > 0 { - had_pending = true; - } - - // Only exit after we've seen pending requests AND they're all done - // AND we've had at least a few iterations to process responses - if had_pending && net.is_empty() && iterations > 5 { - break; - } - - // Give at least some iterations for requests to be queued - if iterations > 200 { - println!("[App] Max iterations reached, giving up on asset loading"); - break; - } - iterations += 1; - // Yield to allow network tasks to progress - tokio::time::sleep(std::time::Duration::from_millis(100)).await; - } - - // Check image data after loading - base_doc.visit(|node_id, node| { - if let Some(element) = node.element_data() { - if element.name.local.as_ref() == "img" { - println!( - "[App] After load - img node {} special_data: {:?}", - node_id, - std::mem::discriminant(&element.special_data) - ); - } - } - }); - }); - println!("[App] Assets loaded"); - - // Debug: print root element layout - let root = base_doc.root_element(); - let layout = root.final_layout; - println!("[App] Root element layout: {:?}", layout); - println!("[App] Document layout computed"); + let base_doc = html_doc.into_inner(); - // Wrap document + // Pre-load assets (images, fonts, etc.) using the Tokio runtime + // This is optional but provides a smoother initial render let doc = Rc::new(RefCell::new(base_doc)); - self.doc = Some(doc.clone()); - // Create UIKit renderer - let mut renderer = UIKitRenderer::new(doc, root_view.clone(), mtm); - renderer.set_scale(scale as f64); + let mut iterations = 0; + loop { + doc.borrow_mut().resolve(0.0); + let pending = net.count(); - // Sync DOM to UIKit views - println!("[App] Syncing DOM to UIKit views..."); - renderer.sync(); - println!("[App] Sync complete!"); - - // Debug: print view hierarchy - print_view_hierarchy(&root_view, 0); - - self.renderer = Some(renderer); - self.window = Some(window); - } - - fn window_event( - &mut self, - event_loop: &dyn ActiveEventLoop, - _window_id: WindowId, - event: WindowEvent, - ) { - match event { - WindowEvent::CloseRequested => { - println!("[App] Close requested"); - event_loop.exit(); - } - WindowEvent::RedrawRequested => { - // Re-sync views if needed - if let Some(renderer) = &mut self.renderer { - renderer.sync(); - } + if pending == 0 && iterations > 2 { + break; } - WindowEvent::SurfaceResized(size) => { - println!("[App] Resized to {}x{}", size.width, size.height); - if let (Some(doc), Some(window)) = (&self.doc, &self.window) { - let scale = window.scale_factor() as f32; - let viewport = - Viewport::new(size.width, size.height, scale, ColorScheme::Light); - doc.borrow_mut().set_viewport(viewport); - doc.borrow_mut().resolve(0.0); - if let Some(renderer) = &mut self.renderer { - renderer.sync(); - } - } + if iterations > 50 { + println!("[App] Max iterations reached for asset loading"); + break; } - _ => {} - } - } - - fn about_to_wait(&mut self, _event_loop: &dyn ActiveEventLoop) { - if let Some(window) = &self.window { - window.request_redraw(); - } - } - - fn resumed(&mut self, _event_loop: &dyn ActiveEventLoop) { - println!("[App] Resumed"); - } -} - -/// Extract UIView from a winit Window via raw_window_handle -fn get_uiview_from_window(window: &dyn Window, mtm: MainThreadMarker) -> Retained { - let handle = window.window_handle().expect("Failed to get window handle"); - let raw_handle = handle.as_raw(); - - match raw_handle { - RawWindowHandle::UiKit(uikit_handle) => { - let ui_view_ptr = uikit_handle.ui_view.as_ptr(); - // SAFETY: The pointer comes from winit's window handle and is valid - // We're on the main thread (verified by MainThreadMarker) - unsafe { - let ui_view: *mut UIView = ui_view_ptr.cast(); - // Retain the view since we're going to use it - Retained::retain(ui_view).expect("UIView pointer should be valid") - } - } - _ => { - // Fallback: create a new UIView (won't be attached to window) - println!("[WARNING] Not a UIKit window handle, creating detached UIView"); - let frame = NSRect::new(NSPoint::new(0.0, 0.0), NSSize::new(390.0, 844.0)); - UIView::initWithFrame(mtm.alloc::(), frame) + iterations += 1; + tokio::time::sleep(std::time::Duration::from_millis(50)).await; } - } -} - -/// Print the UIView hierarchy for debugging -fn print_view_hierarchy(view: &UIView, depth: usize) { - let indent = " ".repeat(depth); - let frame = view.frame(); - let subviews = view.subviews(); - // Get class name - let class_name = unsafe { - use objc2::runtime::AnyObject; - let obj: &AnyObject = std::mem::transmute(view); - obj.class().name().to_str().unwrap_or("Unknown") - }; + println!("[App] Initial assets loaded"); - println!( - "{}{}: ({:.0},{:.0}) {:.0}x{:.0} [{}]", - indent, - class_name, - frame.origin.x, - frame.origin.y, - frame.size.width, - frame.size.height, - subviews.len() - ); - - for subview in subviews.iter() { - print_view_hierarchy(&subview, depth + 1); - } -} + // Create the application with the proxy and receiver + let mut app = UIKitApplication::new(proxy, receiver); -// ============================================================================= -// Main Entry Point -// ============================================================================= - -fn main() { - println!("blitz-ios-uikit Counter Example"); - println!("================================\n"); - - let event_loop = EventLoop::new().expect("Failed to create event loop"); - let app = App::new(); + // Add the view configuration + app.add_view(ViewConfig::new(doc)); - println!("[Main] Starting event loop..."); - event_loop.run_app(app).expect("Event loop failed"); + println!("[Main] Starting event loop..."); + event_loop.run_app(app).expect("Event loop failed"); + }); } diff --git a/packages/blitz-ios-uikit/src/application.rs b/packages/blitz-ios-uikit/src/application.rs new file mode 100644 index 000000000..f18d6c12d --- /dev/null +++ b/packages/blitz-ios-uikit/src/application.rs @@ -0,0 +1,228 @@ +//! UIKit Application - manages the winit event loop and views +//! +//! This provides proper integration with the winit event loop, using custom wakers +//! to ensure the UI only updates when the DOM actually changes. + +use crate::{UIKitRenderer, UIKitView, ViewConfig}; +use std::cell::Cell; +use std::collections::HashMap; +use std::sync::mpsc::{Receiver, Sender, channel}; +use std::sync::Arc; + +use blitz_traits::net::NetWaker; +use futures_util::task::ArcWake; +use winit::application::ApplicationHandler; +use winit::event::WindowEvent; +use winit::event_loop::{ActiveEventLoop, EventLoopProxy}; +use winit::window::WindowId; + +// ============================================================================= +// Events +// ============================================================================= + +/// Events that can be sent to wake up the event loop +#[derive(Debug, Clone)] +pub enum UIKitEvent { + /// Poll a specific window for updates + Poll { window_id: WindowId }, + /// Request a redraw for a document + RequestRedraw { doc_id: usize }, +} + +// ============================================================================= +// Proxy +// ============================================================================= + +/// Proxy for sending events to the winit event loop. +/// +/// This implements `NetWaker` so it can be used with blitz-net to wake up +/// the event loop when network requests complete. +#[derive(Clone)] +pub struct UIKitProxy(Arc); + +struct UIKitProxyInner { + winit_proxy: EventLoopProxy, + sender: Sender, +} + +impl UIKitProxy { + /// Create a new proxy and event receiver. + pub fn new(winit_proxy: EventLoopProxy) -> (Self, Receiver) { + let (sender, receiver) = channel(); + let proxy = Self(Arc::new(UIKitProxyInner { + winit_proxy, + sender, + })); + (proxy, receiver) + } + + /// Wake up the event loop. + pub fn wake_up(&self) { + self.0.winit_proxy.wake_up(); + } + + /// Send an event to the application. + pub fn send_event(&self, event: UIKitEvent) { + let _ = self.0.sender.send(event); + self.wake_up(); + } +} + +impl NetWaker for UIKitProxy { + fn wake(&self, doc_id: usize) { + self.send_event(UIKitEvent::RequestRedraw { doc_id }); + } +} + +/// Create a waker that sends Poll events to the event loop. +/// +/// This allows async tasks in the VirtualDom to wake up the event loop +/// when they complete. +pub fn create_waker(proxy: &UIKitProxy, window_id: WindowId) -> std::task::Waker { + struct WakerHandle { + proxy: UIKitProxy, + window_id: WindowId, + } + + impl ArcWake for WakerHandle { + fn wake_by_ref(arc_self: &Arc) { + arc_self.proxy.send_event(UIKitEvent::Poll { + window_id: arc_self.window_id, + }); + } + } + + futures_util::task::waker(Arc::new(WakerHandle { + proxy: proxy.clone(), + window_id, + })) +} + +// ============================================================================= +// Application +// ============================================================================= + +/// The main application handler for UIKit-based Blitz apps. +/// +/// This integrates with the winit event loop and manages one or more UIKitViews. +pub struct UIKitApplication { + /// Active views by window ID + pub views: HashMap, + /// Pending view configurations to create on resume + pub pending_views: Vec, + /// Proxy for sending events + pub proxy: UIKitProxy, + /// Receiver for application events + pub event_queue: Receiver, +} + +impl UIKitApplication { + /// Create a new application with the given proxy and event queue. + pub fn new(proxy: UIKitProxy, event_queue: Receiver) -> Self { + Self { + views: HashMap::new(), + pending_views: Vec::new(), + proxy, + event_queue, + } + } + + /// Add a view configuration to be created when the event loop starts. + pub fn add_view(&mut self, config: ViewConfig) { + self.pending_views.push(config); + } + + /// Find a view by document ID. + fn view_by_doc_id(&mut self, doc_id: usize) -> Option<&mut UIKitView> { + self.views.values_mut().find(|v| v.doc_id() == doc_id) + } + + /// Handle a UIKit application event. + pub fn handle_event(&mut self, _event_loop: &dyn ActiveEventLoop, event: UIKitEvent) { + match event { + UIKitEvent::Poll { window_id } => { + if let Some(view) = self.views.get_mut(&window_id) { + view.poll(); + } + } + UIKitEvent::RequestRedraw { doc_id } => { + if let Some(view) = self.view_by_doc_id(doc_id) { + view.request_redraw(); + } + } + } + } +} + +impl ApplicationHandler for UIKitApplication { + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { + // Resume existing views + for view in self.views.values_mut() { + view.resume(); + } + + // Create pending views + for config in self.pending_views.drain(..) { + let view = UIKitView::init(config, event_loop, &self.proxy); + self.views.insert(view.window_id(), view); + } + } + + fn destroy_surfaces(&mut self, _event_loop: &dyn ActiveEventLoop) { + for view in self.views.values_mut() { + view.suspend(); + } + } + + fn resumed(&mut self, _event_loop: &dyn ActiveEventLoop) { + // Called when app comes to foreground on iOS + for view in self.views.values_mut() { + view.request_redraw(); + } + } + + fn suspended(&mut self, _event_loop: &dyn ActiveEventLoop) { + // Called when app goes to background on iOS + } + + fn window_event( + &mut self, + event_loop: &dyn ActiveEventLoop, + window_id: WindowId, + event: WindowEvent, + ) { + // Handle close requests + if matches!(event, WindowEvent::CloseRequested) { + self.views.remove(&window_id); + if self.views.is_empty() { + event_loop.exit(); + } + return; + } + + // Forward event to the appropriate view + if let Some(view) = self.views.get_mut(&window_id) { + view.handle_window_event(event); + } + + // Queue a poll for this window + self.proxy.send_event(UIKitEvent::Poll { window_id }); + } + + fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { + // Process all queued events + while let Ok(event) = self.event_queue.try_recv() { + self.handle_event(event_loop, event); + } + } + + fn about_to_wait(&mut self, _event_loop: &dyn ActiveEventLoop) { + // On iOS, we need to call request_redraw here due to winit limitations + // But we only do it if the view has pending updates + for view in self.views.values() { + if view.needs_redraw() { + view.request_redraw(); + } + } + } +} diff --git a/packages/blitz-ios-uikit/src/elements/button.rs b/packages/blitz-ios-uikit/src/elements/button.rs index d14ea3fb1..24f4fb480 100644 --- a/packages/blitz-ios-uikit/src/elements/button.rs +++ b/packages/blitz-ios-uikit/src/elements/button.rs @@ -104,6 +104,8 @@ pub fn create_button( node_id: usize, _event_sender: &EventSender, ) -> Retained { + println!("[BlitzButton] Creating button for node_id={}", node_id); + let button = BlitzButton::new(mtm, node_id); // Set initial title diff --git a/packages/blitz-ios-uikit/src/elements/container.rs b/packages/blitz-ios-uikit/src/elements/container.rs index a3ff18339..460af0439 100644 --- a/packages/blitz-ios-uikit/src/elements/container.rs +++ b/packages/blitz-ios-uikit/src/elements/container.rs @@ -118,6 +118,8 @@ pub fn create_container( node_id: usize, _event_sender: &EventSender, ) -> Retained { + println!("[BlitzView] Creating container for node_id={}", node_id); + let frame = NSRect::new( NSPoint::new(0.0, 0.0), NSSize::new(0.0, 0.0), diff --git a/packages/blitz-ios-uikit/src/elements/image.rs b/packages/blitz-ios-uikit/src/elements/image.rs index 0ad7746aa..200414d79 100644 --- a/packages/blitz-ios-uikit/src/elements/image.rs +++ b/packages/blitz-ios-uikit/src/elements/image.rs @@ -10,7 +10,9 @@ use objc2::rc::Retained; use objc2::runtime::NSObjectProtocol; use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send}; use objc2_core_foundation::CFData; -use objc2_core_graphics::{CGBitmapInfo, CGColorRenderingIntent, CGColorSpace, CGDataProvider, CGImage, CGImageAlphaInfo}; +use objc2_core_graphics::{ + CGBitmapInfo, CGColorRenderingIntent, CGColorSpace, CGDataProvider, CGImage, CGImageAlphaInfo, +}; use objc2_foundation::MainThreadMarker; use objc2_ui_kit::{UIImage, UIImageView, UIView, UIViewContentMode}; @@ -22,6 +24,8 @@ use objc2_ui_kit::{UIImage, UIImageView, UIView, UIViewContentMode}; #[derive(Default)] pub struct BlitzImageViewIvars { pub node_id: Cell, + /// Hash of the current image data to detect changes + pub image_hash: Cell, } define_class!( @@ -40,6 +44,7 @@ impl BlitzImageView { pub fn new(mtm: MainThreadMarker, node_id: usize) -> Retained { let ivars = BlitzImageViewIvars { node_id: Cell::new(node_id), + image_hash: Cell::new(0), }; let this = mtm.alloc::().set_ivars(ivars); let image_view: Retained = unsafe { msg_send![super(this), init] }; @@ -60,6 +65,16 @@ impl BlitzImageView { pub fn node_id(&self) -> usize { self.ivars().node_id.get() } + + /// Get the current image hash. + pub fn image_hash(&self) -> u64 { + self.ivars().image_hash.get() + } + + /// Set the image hash. + pub fn set_image_hash(&self, hash: u64) { + self.ivars().image_hash.set(hash); + } } /// Create a UIImageView for an img element. @@ -75,15 +90,29 @@ pub fn create_image_view(mtm: MainThreadMarker, node: &Node, node_id: usize) -> /// Update a UIImageView with new node data. pub fn update_image_view(view: &UIView, node: &Node) { - // SAFETY: We only call this for ImageView element types - let image_view: &UIImageView = unsafe { std::mem::transmute(view) }; + // SAFETY: We only call this for ImageView element types, which are BlitzImageView + let image_view: &BlitzImageView = unsafe { std::mem::transmute(view) }; set_image_from_node(image_view, node); } +/// Compute a simple hash of image data for change detection. +fn compute_image_hash(raster: &RasterImageData) -> u64 { + use std::collections::hash_map::DefaultHasher; + use std::hash::{Hash, Hasher}; + + let mut hasher = DefaultHasher::new(); + raster.width.hash(&mut hasher); + raster.height.hash(&mut hasher); + // Hash a sample of the data for performance (first 1KB + length) + raster.data.len().hash(&mut hasher); + let sample_size = raster.data.len().min(1024); + raster.data.as_ref()[..sample_size].hash(&mut hasher); + hasher.finish() +} + /// Set image content from node's image data. -fn set_image_from_node(image_view: &UIImageView, node: &Node) { +fn set_image_from_node(image_view: &BlitzImageView, node: &Node) { let Some(element_data) = node.element_data() else { - println!("[BlitzImageView] No element_data for image node"); return; }; @@ -91,28 +120,33 @@ fn set_image_from_node(image_view: &UIImageView, node: &Node) { if let blitz_dom::node::SpecialElementData::Image(ref image_data) = element_data.special_data { match image_data.as_ref() { ImageData::Raster(raster) => { - println!( - "[BlitzImageView] Raster image: {}x{}, {} bytes", - raster.width, raster.height, raster.data.len() - ); + // Compute hash and check if image changed + let new_hash = compute_image_hash(raster); + if new_hash == image_view.image_hash() { + // Image hasn't changed, skip update + println!("[BlitzImageView] Skipping image update (unchanged)"); + return; + } + if let Some(ui_image) = create_ui_image_from_raster(raster) { - println!("[BlitzImageView] UIImage created successfully"); + println!( + "[BlitzImageView] Creating UIImage: {}x{} ({} bytes)", + raster.width, raster.height, raster.data.len() + ); unsafe { image_view.setImage(Some(&ui_image)) }; - } else { - println!("[BlitzImageView] Failed to create UIImage from raster"); + image_view.set_image_hash(new_hash); } } ImageData::Svg(_svg_tree) => { - println!("[BlitzImageView] SVG images not yet supported"); + // SVG images not yet supported } ImageData::None => { - println!("[BlitzImageView] ImageData::None - no image loaded"); - unsafe { image_view.setImage(None) }; + if image_view.image_hash() != 0 { + unsafe { image_view.setImage(None) }; + image_view.set_image_hash(0); + } } } - } else { - println!("[BlitzImageView] special_data is not Image type: {:?}", - std::mem::discriminant(&element_data.special_data)); } } diff --git a/packages/blitz-ios-uikit/src/elements/text.rs b/packages/blitz-ios-uikit/src/elements/text.rs index 62122a280..09cf1f9de 100644 --- a/packages/blitz-ios-uikit/src/elements/text.rs +++ b/packages/blitz-ios-uikit/src/elements/text.rs @@ -68,6 +68,8 @@ fn extract_text_content(node: &Node) -> String { /// Create a UILabel for a text element. pub fn create_label(mtm: MainThreadMarker, node: &Node, node_id: usize) -> Retained { + println!("[BlitzLabel] Creating label for node_id={}", node_id); + let label = BlitzLabel::new(mtm, node_id); // Set initial text content diff --git a/packages/blitz-ios-uikit/src/lib.rs b/packages/blitz-ios-uikit/src/lib.rs index a45059e5a..c204c986d 100644 --- a/packages/blitz-ios-uikit/src/lib.rs +++ b/packages/blitz-ios-uikit/src/lib.rs @@ -16,6 +16,22 @@ //! Layout is computed by Taffy (CSS flexbox/grid) and applied as UIView frames. //! Events from UIKit are bridged back to blitz-dom's event system. //! +//! # Usage +//! +//! For a retained UI with proper event loop integration, use `UIKitApplication`: +//! +//! ```ignore +//! use blitz_ios_uikit::{UIKitApplication, UIKitProxy, ViewConfig}; +//! +//! let event_loop = EventLoop::new().unwrap(); +//! let (proxy, receiver) = UIKitProxy::new(event_loop.create_proxy()); +//! +//! let mut app = UIKitApplication::new(proxy, receiver); +//! app.add_view(ViewConfig::new(doc)); +//! +//! event_loop.run_app(app).unwrap(); +//! ``` +//! //! # Platform Support //! //! This crate only compiles on iOS. To run on macOS, use Mac Catalyst: @@ -30,10 +46,12 @@ #![cfg(target_os = "ios")] +mod application; mod elements; mod events; mod style; mod sync; +mod view; use std::cell::RefCell; use std::rc::Rc; @@ -44,8 +62,10 @@ use objc2_foundation::MainThreadMarker; use objc2_ui_kit::UIView; use rustc_hash::FxHashMap; +pub use application::{UIKitApplication, UIKitEvent, UIKitProxy, create_waker}; pub use elements::ElementType; pub use events::EventSender; +pub use view::{UIKitView, ViewConfig}; /// Entry in the view map tracking a UIView and its metadata pub struct ViewEntry { diff --git a/packages/blitz-ios-uikit/src/view.rs b/packages/blitz-ios-uikit/src/view.rs new file mode 100644 index 000000000..0c5deff06 --- /dev/null +++ b/packages/blitz-ios-uikit/src/view.rs @@ -0,0 +1,236 @@ +//! UIKitView - manages a document and its UIKit rendering +//! +//! This is the iOS equivalent of blitz-shell's View struct. It wraps a document, +//! renderer, and waker to provide proper async integration with the event loop. + +use crate::application::{UIKitProxy, create_waker}; +use crate::UIKitRenderer; + +use std::cell::{Cell, RefCell}; +use std::rc::Rc; +use std::sync::Arc; +use std::task::Waker; + +use blitz_dom::BaseDocument; +use blitz_traits::shell::{ColorScheme, Viewport}; +use objc2::rc::Retained; +use objc2_foundation::{MainThreadMarker, NSPoint, NSRect, NSSize}; +use objc2_ui_kit::UIView; +use raw_window_handle::{HasWindowHandle, RawWindowHandle}; +use winit::event::WindowEvent; +use winit::event_loop::ActiveEventLoop; +use winit::window::{Window, WindowAttributes, WindowId}; + +// ============================================================================= +// ViewConfig +// ============================================================================= + +/// Configuration for creating a UIKitView. +pub struct ViewConfig { + /// The document to render + pub doc: Rc>, + /// Window attributes + pub attributes: WindowAttributes, +} + +impl ViewConfig { + /// Create a new view configuration. + pub fn new(doc: Rc>) -> Self { + Self { + doc, + attributes: WindowAttributes::default(), + } + } + + /// Create a view configuration with custom window attributes. + pub fn with_attributes(doc: Rc>, attributes: WindowAttributes) -> Self { + Self { doc, attributes } + } +} + +// ============================================================================= +// UIKitView +// ============================================================================= + +/// A view that renders a document using UIKit. +/// +/// This manages the window, document, renderer, and async waker integration. +pub struct UIKitView { + /// The winit window + window: Arc, + /// The document being rendered + doc: Rc>, + /// The UIKit renderer + renderer: UIKitRenderer, + /// Waker for async integration + waker: Option, + /// Proxy for event loop communication + proxy: UIKitProxy, + /// MainThreadMarker for UIKit operations + mtm: MainThreadMarker, + /// Whether a redraw is needed + needs_redraw: Cell, + /// Whether the view has been initialized + initialized: Cell, +} + +impl UIKitView { + /// Initialize a new view from configuration. + pub fn init( + config: ViewConfig, + event_loop: &dyn ActiveEventLoop, + proxy: &UIKitProxy, + ) -> Self { + let mtm = MainThreadMarker::new().expect("UIKitView must be created on main thread"); + + // Create window + let window: Arc = Arc::from( + event_loop.create_window(config.attributes).unwrap() + ); + + // Get window metrics + let size = window.surface_size(); + let scale = window.scale_factor() as f32; + + // Set viewport on document + let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + config.doc.borrow_mut().set_viewport(viewport); + + // Get root UIView from window + let root_view = get_uiview_from_window(&*window, mtm); + + // Create renderer + let mut renderer = UIKitRenderer::new(config.doc.clone(), root_view, mtm); + renderer.set_scale(scale as f64); + + // Create waker + let waker = create_waker(proxy, window.id()); + + Self { + window, + doc: config.doc, + renderer, + waker: Some(waker), + proxy: proxy.clone(), + mtm, + needs_redraw: Cell::new(true), // Initial render needed + initialized: Cell::new(false), + } + } + + /// Get the window ID. + pub fn window_id(&self) -> WindowId { + self.window.id() + } + + /// Get the document ID. + pub fn doc_id(&self) -> usize { + self.doc.borrow().id() + } + + /// Check if the view needs a redraw. + pub fn needs_redraw(&self) -> bool { + self.needs_redraw.get() + } + + /// Request a redraw of this view. + pub fn request_redraw(&self) { + self.needs_redraw.set(true); + self.window.request_redraw(); + } + + /// Resume rendering (called when surface is available). + pub fn resume(&mut self) { + if !self.initialized.get() { + // Initial sync + self.doc.borrow_mut().resolve(0.0); + self.renderer.sync(); + self.initialized.set(true); + self.needs_redraw.set(false); + } + } + + /// Suspend rendering (called when surface is lost). + pub fn suspend(&mut self) { + self.waker = None; + } + + /// Poll the document for updates. + /// + /// Returns true if the document had changes that require a redraw. + /// + /// For HtmlDocument/BaseDocument, this always returns false since there's + /// no async work to poll. DioxusDocument would override this to poll the VirtualDom. + pub fn poll(&mut self) -> bool { + // For now, BaseDocument doesn't have async work to poll. + // When we integrate with DioxusDocument, we'll use the Document trait's poll method. + // Network messages are handled automatically in resolve() via handle_messages(). + false + } + + /// Perform a redraw if needed. + pub fn redraw(&mut self) { + if !self.needs_redraw.get() { + return; + } + + self.needs_redraw.set(false); + + // Resolve layout + self.doc.borrow_mut().resolve(0.0); + + // Sync UIKit views with DOM + self.renderer.sync(); + } + + /// Handle a winit window event. + pub fn handle_window_event(&mut self, event: WindowEvent) { + match event { + WindowEvent::RedrawRequested => { + self.redraw(); + } + WindowEvent::SurfaceResized(size) => { + let scale = self.window.scale_factor() as f32; + let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + self.doc.borrow_mut().set_viewport(viewport); + self.request_redraw(); + } + WindowEvent::ScaleFactorChanged { scale_factor, .. } => { + self.renderer.set_scale(scale_factor); + let mut doc = self.doc.borrow_mut(); + let (width, height) = doc.viewport().window_size; + let viewport = Viewport::new(width, height, scale_factor as f32, ColorScheme::Light); + doc.set_viewport(viewport); + drop(doc); + self.request_redraw(); + } + _ => { + // Other events could be handled here (touch, keyboard, etc.) + } + } + } +} + +/// Extract the root UIView from a winit window. +fn get_uiview_from_window(window: &dyn Window, mtm: MainThreadMarker) -> Retained { + let handle = window.window_handle().expect("Failed to get window handle"); + let raw_handle = handle.as_raw(); + + match raw_handle { + RawWindowHandle::UiKit(uikit_handle) => { + let ui_view_ptr = uikit_handle.ui_view.as_ptr(); + // SAFETY: The pointer comes from winit's window handle and is valid. + // We're on the main thread (verified by MainThreadMarker). + unsafe { + let ui_view: *mut UIView = ui_view_ptr.cast(); + Retained::retain(ui_view).expect("UIView pointer should be valid") + } + } + _ => { + // Fallback: create a new UIView (won't be attached to window) + eprintln!("[WARNING] Not a UIKit window handle, creating detached UIView"); + let frame = NSRect::new(NSPoint::new(0.0, 0.0), NSSize::new(390.0, 844.0)); + UIView::initWithFrame(mtm.alloc::(), frame) + } + } +} diff --git a/packages/blitz-net/src/lib.rs b/packages/blitz-net/src/lib.rs index de3a115bd..deae21e7f 100644 --- a/packages/blitz-net/src/lib.rs +++ b/packages/blitz-net/src/lib.rs @@ -161,10 +161,6 @@ impl NetProvider for Provider { #[cfg(feature = "debug_log")] println!("Fetching {}", &request.url); - // Always log the URL being fetched for debugging - eprintln!("[blitz-net] Fetching: {}", &request.url); - - let url_for_error = request.url.to_string(); let waker = self.waker.clone(); self.rt.spawn(async move { #[cfg(feature = "debug_log")] @@ -172,12 +168,6 @@ impl NetProvider for Provider { let _res = Self::fetch_with_handler(client, request, handler).await; - // Always log results for debugging - match &_res { - Ok(()) => eprintln!("[blitz-net] Success fetching: {url_for_error}"), - Err(e) => eprintln!("[blitz-net] Error fetching {url_for_error}: {e:?}"), - } - #[cfg(feature = "debug_log")] if _res.is_ok() { println!("Success {url}"); From bbbbd8b158bc9d050cc9a6e7843f8d279a67e21b Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Tue, 6 Jan 2026 16:19:15 -0800 Subject: [PATCH 65/67] dioxus entrypoint --- Cargo.lock | 2 + packages/blitz-ios-uikit/Cargo.toml | 8 + packages/blitz-ios-uikit/src/dioxus.rs | 486 ++++++++++++++++++ .../blitz-ios-uikit/src/elements/input.rs | 65 ++- packages/blitz-ios-uikit/src/events.rs | 72 ++- packages/blitz-ios-uikit/src/lib.rs | 6 + packages/blitz-ios-uikit/src/view.rs | 89 +++- .../dioxus-native-dom/src/dioxus_document.rs | 15 + 8 files changed, 735 insertions(+), 8 deletions(-) create mode 100644 packages/blitz-ios-uikit/src/dioxus.rs diff --git a/Cargo.lock b/Cargo.lock index 8d9042d0c..1672d54fe 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -861,6 +861,8 @@ dependencies = [ "blitz-html", "blitz-net", "blitz-traits", + "dioxus-core", + "dioxus-native-dom", "futures-util", "keyboard-types 0.7.0", "markup5ever", diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml index d14481798..d601dfb4a 100644 --- a/packages/blitz-ios-uikit/Cargo.toml +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -16,6 +16,10 @@ path = "src/lib.rs" # Note: inspo.rs is kept as reference code, not a runnable example # It demonstrates UIKit patterns with objc2 but requires external Swift FFI +[features] +default = ["dioxus"] +dioxus = ["dep:dioxus-native-dom", "dep:dioxus-core"] + [dependencies] # Note: system_fonts enables CoreText font backend on iOS/macOS # woff-rust enables pure-Rust WOFF font decoding for web fonts @@ -27,6 +31,10 @@ taffy = { workspace = true } keyboard-types = { workspace = true } markup5ever = { workspace = true } +# Dioxus integration (optional) +dioxus-native-dom = { workspace = true, optional = true } +dioxus-core = { workspace = true, optional = true } + # Stylo (for computed styles) style = { workspace = true } diff --git a/packages/blitz-ios-uikit/src/dioxus.rs b/packages/blitz-ios-uikit/src/dioxus.rs new file mode 100644 index 000000000..e41787756 --- /dev/null +++ b/packages/blitz-ios-uikit/src/dioxus.rs @@ -0,0 +1,486 @@ +//! Dioxus integration for UIKit renderer +//! +//! This module provides a `launch` function similar to `dioxus-native` that: +//! - Creates a VirtualDom from a Dioxus component +//! - Wraps it in a DioxusDocument +//! - Renders to native UIKit views +//! - Handles events and async tasks + +use crate::application::{create_waker, UIKitEvent, UIKitProxy}; +use crate::events::{drain_input_events, InputEvent}; +use crate::UIKitRenderer; + +use std::cell::Cell; +use std::collections::HashMap; +use std::sync::mpsc::Receiver; +use std::sync::Arc; +use std::task::{Context as TaskContext, Waker}; + +use blitz_dom::Document; +use blitz_traits::events::{ + BlitzFocusEvent, BlitzInputEvent, BlitzPointerId, BlitzPointerEvent, DomEvent, DomEventData, + MouseEventButton, MouseEventButtons, UiEvent, +}; +use blitz_traits::shell::{ColorScheme, Viewport}; +use dioxus_core::{ComponentFunction, Element, VirtualDom}; +use dioxus_native_dom::{DioxusDocument, DocumentConfig}; +use keyboard_types::Modifiers; +use objc2::rc::Retained; +use objc2_foundation::{MainThreadMarker, NSPoint, NSRect, NSSize}; +use objc2_ui_kit::UIView; +use raw_window_handle::{HasWindowHandle, RawWindowHandle}; +use winit::application::ApplicationHandler; +use winit::event::{ElementState, WindowEvent}; +use winit::event_loop::{ActiveEventLoop, EventLoop}; +use winit::window::{Window, WindowAttributes, WindowId}; + +// ============================================================================= +// DioxusUIKitView +// ============================================================================= + +/// A view that renders a DioxusDocument using UIKit. +/// +/// This is the Dioxus-aware version of UIKitView. It polls the VirtualDom +/// and handles events through the Dioxus event system. +pub struct DioxusUIKitView { + /// The winit window + window: Arc, + /// The Dioxus document (wraps VirtualDom + BaseDocument) + doc: DioxusDocument, + /// The UIKit renderer + renderer: UIKitRenderer, + /// Waker for async integration + waker: Option, + /// Proxy for event loop communication + proxy: UIKitProxy, + /// MainThreadMarker for UIKit operations + mtm: MainThreadMarker, + /// Whether a redraw is needed + needs_redraw: Cell, + /// Whether the view has been initialized + initialized: Cell, +} + +impl DioxusUIKitView { + /// Initialize a new Dioxus view. + pub fn init( + mut doc: DioxusDocument, + attributes: WindowAttributes, + event_loop: &dyn ActiveEventLoop, + proxy: &UIKitProxy, + ) -> Self { + let mtm = MainThreadMarker::new().expect("DioxusUIKitView must be created on main thread"); + + // Create window + let window: Arc = Arc::from( + event_loop.create_window(attributes).unwrap() + ); + + // Get window metrics + let size = window.surface_size(); + let scale = window.scale_factor() as f32; + + // Set viewport on document + let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + doc.inner.borrow_mut().set_viewport(viewport); + + // Get root UIView from window + let root_view = get_uiview_from_window(&*window, mtm); + + // Create renderer using the inner BaseDocument + let mut renderer = UIKitRenderer::new(doc.inner.clone(), root_view, mtm); + renderer.set_scale(scale as f64); + + // Create waker + let waker = create_waker(proxy, window.id()); + + // Run initial build of the VirtualDom + doc.initial_build(); + + Self { + window, + doc, + renderer, + waker: Some(waker), + proxy: proxy.clone(), + mtm, + needs_redraw: Cell::new(true), + initialized: Cell::new(false), + } + } + + /// Get the window ID. + pub fn window_id(&self) -> WindowId { + self.window.id() + } + + /// Get the document ID. + pub fn doc_id(&self) -> usize { + self.doc.id() + } + + /// Check if the view needs a redraw. + pub fn needs_redraw(&self) -> bool { + self.needs_redraw.get() + } + + /// Request a redraw of this view. + pub fn request_redraw(&self) { + self.needs_redraw.set(true); + self.window.request_redraw(); + } + + /// Resume rendering (called when surface is available). + pub fn resume(&mut self) { + if !self.initialized.get() { + self.doc.inner.borrow_mut().resolve(0.0); + self.renderer.sync(); + self.initialized.set(true); + self.needs_redraw.set(false); + } + } + + /// Suspend rendering (called when surface is lost). + pub fn suspend(&mut self) { + self.waker = None; + } + + /// Poll the VirtualDom for updates. + /// + /// Returns true if there were changes that require a redraw. + pub fn poll(&mut self) -> bool { + // Create task context from waker + let cx = self.waker.as_ref().map(|w| TaskContext::from_waker(w)); + + // Poll the DioxusDocument (this drives the VirtualDom) + let has_changes = self.doc.poll(cx); + + if has_changes { + self.request_redraw(); + } + + has_changes + } + + /// Process queued input events from UIKit native controls. + /// + /// This converts InputEvents from native UIKit controls (UITextField, etc.) + /// to DomEvents and dispatches them through the Dioxus event system. + pub fn process_input_events(&mut self) { + let events = drain_input_events(); + for event in events { + let dom_event = match event { + InputEvent::TextChanged { node_id, value } => { + DomEvent::new(node_id, DomEventData::Input(BlitzInputEvent { value })) + } + InputEvent::FocusGained { node_id } => { + DomEvent::new(node_id, DomEventData::Focus(BlitzFocusEvent)) + } + InputEvent::FocusLost { node_id } => { + DomEvent::new(node_id, DomEventData::Blur(BlitzFocusEvent)) + } + }; + // Dispatch through Dioxus event handler + self.doc.handle_dom_event(dom_event); + } + } + + /// Perform a redraw if needed. + pub fn redraw(&mut self) { + if !self.needs_redraw.get() { + return; + } + + self.needs_redraw.set(false); + + // Process any queued input events + self.process_input_events(); + + // Resolve layout + self.doc.inner.borrow_mut().resolve(0.0); + + // Sync UIKit views with DOM + self.renderer.sync(); + } + + /// Handle a winit window event. + pub fn handle_window_event(&mut self, event: WindowEvent) { + match event { + WindowEvent::RedrawRequested => { + self.redraw(); + } + WindowEvent::SurfaceResized(size) => { + let scale = self.window.scale_factor() as f32; + let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); + self.doc.inner.borrow_mut().set_viewport(viewport); + self.request_redraw(); + } + WindowEvent::ScaleFactorChanged { scale_factor, .. } => { + self.renderer.set_scale(scale_factor); + let mut inner = self.doc.inner.borrow_mut(); + let (width, height) = inner.viewport().window_size; + let viewport = Viewport::new(width, height, scale_factor as f32, ColorScheme::Light); + inner.set_viewport(viewport); + drop(inner); + self.request_redraw(); + } + WindowEvent::PointerMoved { position, primary, .. } => { + let scale = self.window.scale_factor(); + let x = (position.x / scale) as f32; + let y = (position.y / scale) as f32; + + let event = UiEvent::MouseMove(BlitzPointerEvent { + id: BlitzPointerId::Finger(0), + is_primary: primary, + x, + y, + screen_x: x, + screen_y: y, + client_x: x, + client_y: y, + button: MouseEventButton::Main, + buttons: MouseEventButtons::Primary, + mods: Modifiers::empty(), + }); + + self.doc.handle_ui_event(event); + } + WindowEvent::PointerButton { state, position, primary, .. } => { + let scale = self.window.scale_factor(); + let x = (position.x / scale) as f32; + let y = (position.y / scale) as f32; + + let (event_type, buttons) = match state { + ElementState::Pressed => (true, MouseEventButtons::Primary), + ElementState::Released => (false, MouseEventButtons::None), + }; + + let pointer_event = BlitzPointerEvent { + id: BlitzPointerId::Finger(0), + is_primary: primary, + x, + y, + screen_x: x, + screen_y: y, + client_x: x, + client_y: y, + button: MouseEventButton::Main, + buttons, + mods: Modifiers::empty(), + }; + + let event = if event_type { + println!("[DioxusUIKitView] Pointer down at ({}, {})", x, y); + UiEvent::MouseDown(pointer_event) + } else { + println!("[DioxusUIKitView] Pointer up at ({}, {})", x, y); + UiEvent::MouseUp(pointer_event) + }; + + self.doc.handle_ui_event(event); + self.request_redraw(); + } + _ => {} + } + } +} + +/// Extract the root UIView from a winit window. +fn get_uiview_from_window(window: &dyn Window, mtm: MainThreadMarker) -> Retained { + let handle = window.window_handle().expect("Failed to get window handle"); + let raw_handle = handle.as_raw(); + + match raw_handle { + RawWindowHandle::UiKit(uikit_handle) => { + let ui_view_ptr = uikit_handle.ui_view.as_ptr(); + unsafe { + let ui_view: *mut UIView = ui_view_ptr.cast(); + Retained::retain(ui_view).expect("UIView pointer should be valid") + } + } + _ => { + eprintln!("[WARNING] Not a UIKit window handle, creating detached UIView"); + let frame = NSRect::new(NSPoint::new(0.0, 0.0), NSSize::new(390.0, 844.0)); + UIView::initWithFrame(mtm.alloc::(), frame) + } + } +} + +// ============================================================================= +// DioxusUIKitApplication +// ============================================================================= + +/// Application handler for Dioxus UIKit apps. +pub struct DioxusUIKitApplication { + /// Active views by window ID + views: HashMap, + /// Pending document to create on resume + pending_doc: Option<(DioxusDocument, WindowAttributes)>, + /// Proxy for sending events + proxy: UIKitProxy, + /// Receiver for application events + event_queue: Receiver, +} + +impl DioxusUIKitApplication { + /// Create a new application. + pub fn new( + doc: DioxusDocument, + attributes: WindowAttributes, + proxy: UIKitProxy, + event_queue: Receiver, + ) -> Self { + Self { + views: HashMap::new(), + pending_doc: Some((doc, attributes)), + proxy, + event_queue, + } + } + + fn view_by_doc_id(&mut self, doc_id: usize) -> Option<&mut DioxusUIKitView> { + self.views.values_mut().find(|v| v.doc_id() == doc_id) + } + + fn handle_event(&mut self, _event_loop: &dyn ActiveEventLoop, event: UIKitEvent) { + match event { + UIKitEvent::Poll { window_id } => { + if let Some(view) = self.views.get_mut(&window_id) { + view.poll(); + } + } + UIKitEvent::RequestRedraw { doc_id } => { + if let Some(view) = self.view_by_doc_id(doc_id) { + view.request_redraw(); + } + } + } + } +} + +impl ApplicationHandler for DioxusUIKitApplication { + fn can_create_surfaces(&mut self, event_loop: &dyn ActiveEventLoop) { + // Resume existing views + for view in self.views.values_mut() { + view.resume(); + } + + // Create pending view + if let Some((doc, attributes)) = self.pending_doc.take() { + let view = DioxusUIKitView::init(doc, attributes, event_loop, &self.proxy); + self.views.insert(view.window_id(), view); + } + } + + fn destroy_surfaces(&mut self, _event_loop: &dyn ActiveEventLoop) { + for view in self.views.values_mut() { + view.suspend(); + } + } + + fn resumed(&mut self, _event_loop: &dyn ActiveEventLoop) { + for view in self.views.values_mut() { + view.request_redraw(); + } + } + + fn suspended(&mut self, _event_loop: &dyn ActiveEventLoop) {} + + fn window_event( + &mut self, + event_loop: &dyn ActiveEventLoop, + window_id: WindowId, + event: WindowEvent, + ) { + if matches!(event, WindowEvent::CloseRequested) { + self.views.remove(&window_id); + if self.views.is_empty() { + event_loop.exit(); + } + return; + } + + if let Some(view) = self.views.get_mut(&window_id) { + view.handle_window_event(event); + } + + self.proxy.send_event(UIKitEvent::Poll { window_id }); + } + + fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { + while let Ok(event) = self.event_queue.try_recv() { + self.handle_event(event_loop, event); + } + } + + fn about_to_wait(&mut self, _event_loop: &dyn ActiveEventLoop) { + for view in self.views.values() { + if view.needs_redraw() { + view.request_redraw(); + } + } + } +} + +// ============================================================================= +// Launch function +// ============================================================================= + +/// Launch a Dioxus app with UIKit rendering. +/// +/// This is the main entry point for Dioxus apps on iOS using native UIKit views. +/// +/// # Example +/// +/// ```ignore +/// use blitz_ios_uikit::launch; +/// use dioxus::prelude::*; +/// +/// fn app() -> Element { +/// rsx! { +/// div { +/// h1 { "Hello, iOS!" } +/// button { +/// onclick: |_| println!("Clicked!"), +/// "Click me" +/// } +/// } +/// } +/// } +/// +/// fn main() { +/// launch(app); +/// } +/// ``` +pub fn launch(app: fn() -> Element) { + launch_cfg(app, WindowAttributes::default()) +} + +/// Launch a Dioxus app with custom window configuration. +pub fn launch_cfg(app: fn() -> Element, attributes: WindowAttributes) { + launch_cfg_with_props(app, (), attributes) +} + +/// Launch a Dioxus app with props and custom window configuration. +pub fn launch_cfg_with_props( + app: impl ComponentFunction, + props: P, + attributes: WindowAttributes, +) { + // Create event loop + let event_loop = EventLoop::new().expect("Failed to create event loop"); + let winit_proxy = event_loop.create_proxy(); + let (proxy, event_queue) = UIKitProxy::new(winit_proxy); + + // Create VirtualDom + let vdom = VirtualDom::new_with_props(app, props); + + // Create DioxusDocument + let doc = DioxusDocument::new(vdom, DocumentConfig::default()); + + // Create application + let application = DioxusUIKitApplication::new(doc, attributes, proxy, event_queue); + + // Run event loop + event_loop.run_app(application).expect("Event loop failed"); +} diff --git a/packages/blitz-ios-uikit/src/elements/input.rs b/packages/blitz-ios-uikit/src/elements/input.rs index 44804564b..2d4cb64a3 100644 --- a/packages/blitz-ios-uikit/src/elements/input.rs +++ b/packages/blitz-ios-uikit/src/elements/input.rs @@ -8,11 +8,11 @@ use blitz_dom::Node; use markup5ever::local_name; use objc2::rc::Retained; use objc2::runtime::NSObjectProtocol; -use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send}; +use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send, sel}; use objc2_foundation::{MainThreadMarker, NSString}; -use objc2_ui_kit::{UITextBorderStyle, UITextField, UITextInputTraits, UIView}; +use objc2_ui_kit::{UIControlEvents, UITextBorderStyle, UITextField, UITextInputTraits, UIView}; -use crate::events::EventSender; +use crate::events::{queue_focus_gained, queue_focus_lost, queue_text_changed, EventSender}; // ============================================================================= // BlitzTextField - Custom UITextField with event bridging @@ -33,6 +33,40 @@ define_class!( pub struct BlitzTextField; unsafe impl NSObjectProtocol for BlitzTextField {} + + impl BlitzTextField { + /// Called when the text field's text changes. + #[unsafe(method(handleEditingChanged:))] + fn handle_editing_changed(&self, _sender: &UITextField) { + let node_id = self.ivars().node_id.get(); + + // Get the current text value + let value = unsafe { + self.text() + .map(|s| s.to_string()) + .unwrap_or_default() + }; + + println!("[BlitzTextField] EditingChanged node_id={} value={:?}", node_id, value); + queue_text_changed(node_id, value); + } + + /// Called when the text field begins editing (gains focus). + #[unsafe(method(handleEditingDidBegin:))] + fn handle_editing_did_begin(&self, _sender: &UITextField) { + let node_id = self.ivars().node_id.get(); + println!("[BlitzTextField] EditingDidBegin (focus) node_id={}", node_id); + queue_focus_gained(node_id); + } + + /// Called when the text field ends editing (loses focus). + #[unsafe(method(handleEditingDidEnd:))] + fn handle_editing_did_end(&self, _sender: &UITextField) { + let node_id = self.ivars().node_id.get(); + println!("[BlitzTextField] EditingDidEnd (blur) node_id={}", node_id); + queue_focus_lost(node_id); + } + } ); impl BlitzTextField { @@ -50,6 +84,30 @@ impl BlitzTextField { text_field.setBorderStyle(UITextBorderStyle::RoundedRect); } + // Wire up event handlers using target-action pattern + unsafe { + // Text changed event + text_field.addTarget_action_forControlEvents( + Some(&*text_field), + sel!(handleEditingChanged:), + UIControlEvents::EditingChanged, + ); + + // Focus gained event + text_field.addTarget_action_forControlEvents( + Some(&*text_field), + sel!(handleEditingDidBegin:), + UIControlEvents::EditingDidBegin, + ); + + // Focus lost event + text_field.addTarget_action_forControlEvents( + Some(&*text_field), + sel!(handleEditingDidEnd:), + UIControlEvents::EditingDidEnd, + ); + } + text_field } @@ -66,6 +124,7 @@ pub fn create_text_field( node_id: usize, _event_sender: &EventSender, ) -> Retained { + println!("[BlitzTextField] Creating text field for node_id={}", node_id); let text_field = BlitzTextField::new(mtm, node_id); // Apply initial attributes diff --git a/packages/blitz-ios-uikit/src/events.rs b/packages/blitz-ios-uikit/src/events.rs index 9d9e0fd48..564c1f9ce 100644 --- a/packages/blitz-ios-uikit/src/events.rs +++ b/packages/blitz-ios-uikit/src/events.rs @@ -6,13 +6,81 @@ use std::cell::RefCell; use std::collections::VecDeque; use std::rc::Rc; +use std::sync::Mutex; use blitz_traits::events::{ - BlitzInputEvent, BlitzPointerId, BlitzPointerEvent, DomEvent, DomEventData, MouseEventButton, - MouseEventButtons, UiEvent, + BlitzFocusEvent, BlitzInputEvent, BlitzPointerId, BlitzPointerEvent, DomEvent, DomEventData, + MouseEventButton, MouseEventButtons, UiEvent, }; use keyboard_types::Modifiers; +// ============================================================================= +// Global Input Event Queue +// ============================================================================= + +/// Thread-safe queue for input events from native UIKit controls. +/// This allows objc2 code to queue events that will be processed by the Rust event loop. +static INPUT_EVENT_QUEUE: Mutex> = Mutex::new(VecDeque::new()); + +/// An input event from a native UIKit control. +#[derive(Debug, Clone)] +pub enum InputEvent { + /// Text input changed + TextChanged { node_id: usize, value: String }, + /// Input gained focus + FocusGained { node_id: usize }, + /// Input lost focus + FocusLost { node_id: usize }, +} + +/// Queue a text change event from a UITextField. +pub fn queue_text_changed(node_id: usize, value: String) { + if let Ok(mut queue) = INPUT_EVENT_QUEUE.lock() { + println!("[InputEvent] TextChanged node_id={} value={:?}", node_id, value); + queue.push_back(InputEvent::TextChanged { node_id, value }); + } +} + +/// Queue a focus gained event. +pub fn queue_focus_gained(node_id: usize) { + if let Ok(mut queue) = INPUT_EVENT_QUEUE.lock() { + println!("[InputEvent] FocusGained node_id={}", node_id); + queue.push_back(InputEvent::FocusGained { node_id }); + } +} + +/// Queue a focus lost event. +pub fn queue_focus_lost(node_id: usize) { + if let Ok(mut queue) = INPUT_EVENT_QUEUE.lock() { + println!("[InputEvent] FocusLost node_id={}", node_id); + queue.push_back(InputEvent::FocusLost { node_id }); + } +} + +/// Drain all pending input events. +pub fn drain_input_events() -> Vec { + if let Ok(mut queue) = INPUT_EVENT_QUEUE.lock() { + queue.drain(..).collect() + } else { + Vec::new() + } +} + +/// Convert an InputEvent to a DomEvent. +pub fn input_event_to_dom_event(event: InputEvent) -> DomEvent { + match event { + InputEvent::TextChanged { node_id, value } => { + DomEvent::new(node_id, DomEventData::Input(BlitzInputEvent { value })) + } + InputEvent::FocusGained { node_id } => { + DomEvent::new(node_id, DomEventData::Focus(BlitzFocusEvent)) + } + InputEvent::FocusLost { node_id } => { + DomEvent::new(node_id, DomEventData::Blur(BlitzFocusEvent)) + } + } +} + /// Sender for events from UIKit to blitz-dom. /// /// UIKit views use this to queue events that will be processed by the document. diff --git a/packages/blitz-ios-uikit/src/lib.rs b/packages/blitz-ios-uikit/src/lib.rs index c204c986d..abc8e1e00 100644 --- a/packages/blitz-ios-uikit/src/lib.rs +++ b/packages/blitz-ios-uikit/src/lib.rs @@ -53,6 +53,9 @@ mod style; mod sync; mod view; +#[cfg(feature = "dioxus")] +mod dioxus; + use std::cell::RefCell; use std::rc::Rc; @@ -67,6 +70,9 @@ pub use elements::ElementType; pub use events::EventSender; pub use view::{UIKitView, ViewConfig}; +#[cfg(feature = "dioxus")] +pub use dioxus::{launch, launch_cfg, launch_cfg_with_props, DioxusUIKitApplication, DioxusUIKitView}; + /// Entry in the view map tracking a UIView and its metadata pub struct ViewEntry { /// The actual UIView (retained) diff --git a/packages/blitz-ios-uikit/src/view.rs b/packages/blitz-ios-uikit/src/view.rs index 0c5deff06..aeef31358 100644 --- a/packages/blitz-ios-uikit/src/view.rs +++ b/packages/blitz-ios-uikit/src/view.rs @@ -4,6 +4,7 @@ //! renderer, and waker to provide proper async integration with the event loop. use crate::application::{UIKitProxy, create_waker}; +use crate::events::{drain_input_events, input_event_to_dom_event}; use crate::UIKitRenderer; use std::cell::{Cell, RefCell}; @@ -11,13 +12,15 @@ use std::rc::Rc; use std::sync::Arc; use std::task::Waker; -use blitz_dom::BaseDocument; +use blitz_dom::{BaseDocument, Document, EventDriver, NoopEventHandler}; +use blitz_traits::events::{BlitzPointerId, BlitzPointerEvent, MouseEventButton, MouseEventButtons, UiEvent}; use blitz_traits::shell::{ColorScheme, Viewport}; +use keyboard_types::Modifiers; use objc2::rc::Retained; use objc2_foundation::{MainThreadMarker, NSPoint, NSRect, NSSize}; use objc2_ui_kit::UIView; use raw_window_handle::{HasWindowHandle, RawWindowHandle}; -use winit::event::WindowEvent; +use winit::event::{ElementState, WindowEvent}; use winit::event_loop::ActiveEventLoop; use winit::window::{Window, WindowAttributes, WindowId}; @@ -168,6 +171,18 @@ impl UIKitView { false } + /// Process queued input events from UIKit native controls. + pub fn process_input_events(&mut self) { + let events = drain_input_events(); + for event in events { + let dom_event = input_event_to_dom_event(event); + // Dispatch through the document's event system + let mut doc = self.doc.borrow_mut(); + let mut driver = EventDriver::new(&mut *doc, NoopEventHandler); + driver.handle_dom_event(dom_event); + } + } + /// Perform a redraw if needed. pub fn redraw(&mut self) { if !self.needs_redraw.get() { @@ -176,6 +191,9 @@ impl UIKitView { self.needs_redraw.set(false); + // Process any queued input events + self.process_input_events(); + // Resolve layout self.doc.borrow_mut().resolve(0.0); @@ -204,11 +222,76 @@ impl UIKitView { drop(doc); self.request_redraw(); } + // Handle pointer/touch moved + WindowEvent::PointerMoved { position, primary, .. } => { + let scale = self.window.scale_factor(); + let x = (position.x / scale) as f32; + let y = (position.y / scale) as f32; + + let event = UiEvent::MouseMove(BlitzPointerEvent { + id: BlitzPointerId::Finger(0), + is_primary: primary, + x, + y, + screen_x: x, + screen_y: y, + client_x: x, + client_y: y, + button: MouseEventButton::Main, + buttons: MouseEventButtons::Primary, + mods: Modifiers::empty(), + }); + + self.dispatch_event(event); + } + // Handle pointer/touch button (down/up) + WindowEvent::PointerButton { state, position, primary, .. } => { + let scale = self.window.scale_factor(); + let x = (position.x / scale) as f32; + let y = (position.y / scale) as f32; + + let (event_type, buttons) = match state { + ElementState::Pressed => (true, MouseEventButtons::Primary), + ElementState::Released => (false, MouseEventButtons::None), + }; + + let pointer_event = BlitzPointerEvent { + id: BlitzPointerId::Finger(0), + is_primary: primary, + x, + y, + screen_x: x, + screen_y: y, + client_x: x, + client_y: y, + button: MouseEventButton::Main, + buttons, + mods: Modifiers::empty(), + }; + + let event = if event_type { + println!("[UIKitView] Pointer down at ({}, {})", x, y); + UiEvent::MouseDown(pointer_event) + } else { + println!("[UIKitView] Pointer up at ({}, {})", x, y); + UiEvent::MouseUp(pointer_event) + }; + + self.dispatch_event(event); + self.request_redraw(); + } _ => { - // Other events could be handled here (touch, keyboard, etc.) + // Other events (keyboard, etc.) can be added here } } } + + /// Dispatch a UI event to the document's event handler. + fn dispatch_event(&mut self, event: UiEvent) { + let mut doc = self.doc.borrow_mut(); + let mut driver = EventDriver::new(&mut *doc, NoopEventHandler); + driver.handle_ui_event(event); + } } /// Extract the root UIView from a winit window. diff --git a/packages/dioxus-native-dom/src/dioxus_document.rs b/packages/dioxus-native-dom/src/dioxus_document.rs index 16a2e3a32..3bf761d8f 100644 --- a/packages/dioxus-native-dom/src/dioxus_document.rs +++ b/packages/dioxus-native-dom/src/dioxus_document.rs @@ -250,6 +250,21 @@ impl Document for DioxusDocument { } } +impl DioxusDocument { + /// Handle a DOM event directly (e.g., from native platform controls). + /// + /// This is used for events that don't originate from pointer/keyboard input, + /// such as text input changes from native UITextField on iOS. + pub fn handle_dom_event(&mut self, event: DomEvent) { + let handler = DioxusEventHandler { + vdom: &mut self.vdom, + vdom_state: &mut self.vdom_state, + }; + let mut driver = EventDriver::new(&mut self.inner, handler); + driver.handle_dom_event(event); + } +} + pub struct DioxusEventHandler<'v> { vdom: &'v mut VirtualDom, vdom_state: &'v mut DioxusState, From 02aac660d96d567481e3506905a5c7920e2c0651 Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Tue, 6 Jan 2026 16:47:56 -0800 Subject: [PATCH 66/67] input handling --- Cargo.lock | 1 + packages/blitz-ios-uikit/Cargo.toml | 7 +- packages/blitz-ios-uikit/examples/counter.rs | 395 ++++++++++-------- packages/blitz-ios-uikit/src/dioxus.rs | 87 +++- .../blitz-ios-uikit/src/elements/button.rs | 8 +- .../blitz-ios-uikit/src/elements/image.rs | 9 +- .../blitz-ios-uikit/src/elements/input.rs | 43 +- packages/blitz-ios-uikit/src/elements/mod.rs | 10 +- .../src/elements/scrollview.rs | 131 ++++++ packages/blitz-ios-uikit/src/events.rs | 39 ++ packages/blitz-ios-uikit/src/sync.rs | 42 +- 11 files changed, 578 insertions(+), 194 deletions(-) create mode 100644 packages/blitz-ios-uikit/src/elements/scrollview.rs diff --git a/Cargo.lock b/Cargo.lock index 1672d54fe..ef62db699 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -861,6 +861,7 @@ dependencies = [ "blitz-html", "blitz-net", "blitz-traits", + "dioxus", "dioxus-core", "dioxus-native-dom", "futures-util", diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml index d601dfb4a..fa72918ed 100644 --- a/packages/blitz-ios-uikit/Cargo.toml +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -18,7 +18,7 @@ path = "src/lib.rs" [features] default = ["dioxus"] -dioxus = ["dep:dioxus-native-dom", "dep:dioxus-core"] +dioxus = ["dep:dioxus-native-dom", "dep:dioxus-core", "dep:blitz-net", "dep:tokio"] [dependencies] # Note: system_fonts enables CoreText font backend on iOS/macOS @@ -35,6 +35,10 @@ markup5ever = { workspace = true } dioxus-native-dom = { workspace = true, optional = true } dioxus-core = { workspace = true, optional = true } +# Networking for image loading (optional, enabled with dioxus feature) +blitz-net = { workspace = true, optional = true } +tokio = { version = "1", features = ["rt", "macros"], optional = true } + # Stylo (for computed styles) style = { workspace = true } @@ -51,6 +55,7 @@ blitz-net = { workspace = true } winit = { workspace = true } raw-window-handle = "0.6" tokio = { version = "1", features = ["rt", "macros", "time", "full"] } +dioxus = { workspace = true } # objc2 bindings for iOS (UIKit requires iOS or Mac Catalyst) # For Mac Catalyst, build with: --target aarch64-apple-ios-macabi diff --git a/packages/blitz-ios-uikit/examples/counter.rs b/packages/blitz-ios-uikit/examples/counter.rs index e1d45f9e3..f30f1c470 100644 --- a/packages/blitz-ios-uikit/examples/counter.rs +++ b/packages/blitz-ios-uikit/examples/counter.rs @@ -1,13 +1,14 @@ -//! iOS Counter Example - demonstrates blitz-ios-uikit renderer +//! iOS Counter Example - demonstrates blitz-ios-uikit with Dioxus //! //! This example creates a simple counter app using the UIKit renderer with -//! proper event loop integration for retained UI. +//! Dioxus for reactive UI. It also includes various input types for testing +//! text input and IME interaction. //! //! # Running //! //! Via Dioxus CLI: //! ```sh -//! dx2 run --ios --example counter +//! dx serve --example counter --platform ios //! ``` //! //! Direct build for iOS Simulator: @@ -17,182 +18,232 @@ #![cfg(target_os = "ios")] -use std::cell::RefCell; -use std::rc::Rc; -use std::sync::Arc; - -use blitz_dom::DocumentConfig; -use blitz_html::HtmlDocument; -use blitz_ios_uikit::{UIKitApplication, UIKitProxy, ViewConfig}; -use blitz_net::Provider; -use blitz_traits::shell::{ColorScheme, Viewport}; -use winit::event_loop::EventLoop; - -// ============================================================================= -// HTML Content -// ============================================================================= - -const HTML: &str = r#" - - - - - - -
- -

Counter

-
0
-
- - -
- -
- - -"#; + div { class: "input-group", + label { "Email Input:" } + input { + r#type: "email", + placeholder: "Enter email...", + value: "{email_value}", + oninput: move |e| email_value.set(e.value()), + } + span { class: "input-value", "Value: {email_value}" } + } -// ============================================================================= -// Main Entry Point -// ============================================================================= + div { class: "input-group", + label { "Password Input:" } + input { + r#type: "password", + placeholder: "Enter password...", + value: "{password_value}", + oninput: move |e| password_value.set(e.value()), + } + span { class: "input-value", "Value: {password_value}" } + } -fn main() { - println!("blitz-ios-uikit Counter Example"); - println!("================================\n"); - - // Create a Tokio runtime for network operations - // Note: In a real app, you might want to manage this differently - let rt = tokio::runtime::Builder::new_multi_thread() - .enable_all() - .build() - .expect("Failed to create Tokio runtime"); - - // Create event loop - let event_loop = EventLoop::new().expect("Failed to create event loop"); - - rt.block_on(async move { - // Create proxy for event loop communication (used by network provider) - let (proxy, receiver) = UIKitProxy::new(event_loop.create_proxy()); - - // Create network provider with the proxy as the waker - // This allows network requests to wake the event loop when they complete - let net = Arc::new(Provider::new(Some(Arc::new(proxy.clone())))); - - // Parse HTML and create document - // Use a placeholder viewport - it will be updated when the window is created - let viewport = Viewport::new(390, 844, 3.0, ColorScheme::Light); - let html_doc = HtmlDocument::from_html( - HTML, - DocumentConfig { - net_provider: Some(Arc::clone(&net) as _), - viewport: Some(viewport), - ..Default::default() - }, - ); - let base_doc = html_doc.into_inner(); - - // Pre-load assets (images, fonts, etc.) using the Tokio runtime - // This is optional but provides a smoother initial render - let doc = Rc::new(RefCell::new(base_doc)); - - let mut iterations = 0; - loop { - doc.borrow_mut().resolve(0.0); - let pending = net.count(); - - if pending == 0 && iterations > 2 { - break; + div { class: "input-group", + label { "Search Input:" } + input { + r#type: "search", + placeholder: "Search...", + value: "{search_value}", + oninput: move |e| search_value.set(e.value()), + } + span { class: "input-value", "Value: {search_value}" } } - if iterations > 50 { - println!("[App] Max iterations reached for asset loading"); - break; + + // Checkbox test + div { class: "input-group", + label { "Checkbox:" } + input { + r#type: "checkbox", + onchange: move |e| { + println!("Checkbox changed: {:?}", e.checked()); + }, + } } - iterations += 1; - tokio::time::sleep(std::time::Duration::from_millis(50)).await; } - - println!("[App] Initial assets loaded"); - - // Create the application with the proxy and receiver - let mut app = UIKitApplication::new(proxy, receiver); - - // Add the view configuration - app.add_view(ViewConfig::new(doc)); - - println!("[Main] Starting event loop..."); - event_loop.run_app(app).expect("Event loop failed"); - }); + } } + +const CSS: &str = r#" + html, body { + margin: 0; + padding: 0; + height: 100%; + font-family: -apple-system, BlinkMacSystemFont, sans-serif; + } + + body { + display: flex; + flex-direction: column; + justify-content: center; + align-items: center; + background: linear-gradient(135deg, #667eea 0%, #764ba2 100%); + padding: 20px; + } + + .container { + background: white; + border-radius: 20px; + padding: 30px; + text-align: center; + min-width: 300px; + max-width: 400px; + } + + h1 { + color: #333; + margin: 0 0 16px 0; + font-size: 32px; + } + + h2 { + color: #333; + margin: 24px 0 16px 0; + font-size: 20px; + border-top: 1px solid #eee; + padding-top: 16px; + } + + .count { + font-size: 48px; + font-weight: bold; + color: #667eea; + margin: 16px 0; + } + + .buttons { + display: flex; + gap: 10px; + justify-content: center; + } + + button { + padding: 15px 30px; + font-size: 24px; + border: none; + border-radius: 10px; + } + + .btn-increment { + background: #4CAF50; + color: white; + } + + .btn-decrement { + background: #f44336; + color: white; + } + + .btn-reset { + background: #2196F3; + color: white; + margin-top: 10px; + } + + .logo { + width: 80px; + height: 80px; + margin-bottom: 16px; + border-radius: 16px; + } + + .input-group { + display: flex; + flex-direction: column; + align-items: flex-start; + margin: 12px 0; + width: 100%; + } + + .input-group label { + font-size: 14px; + color: #666; + margin-bottom: 4px; + } + + .input-group input[type="text"], + .input-group input[type="number"], + .input-group input[type="email"], + .input-group input[type="password"], + .input-group input[type="search"] { + width: 100%; + padding: 12px; + font-size: 16px; + border: 1px solid #ddd; + border-radius: 8px; + box-sizing: border-box; + } + + .input-group input:focus { + border-color: #667eea; + outline: none; + } + + .input-value { + font-size: 12px; + color: #999; + margin-top: 4px; + } + + .input-group input[type="checkbox"] { + width: 24px; + height: 24px; + } +"#; diff --git a/packages/blitz-ios-uikit/src/dioxus.rs b/packages/blitz-ios-uikit/src/dioxus.rs index e41787756..1ab95a483 100644 --- a/packages/blitz-ios-uikit/src/dioxus.rs +++ b/packages/blitz-ios-uikit/src/dioxus.rs @@ -7,7 +7,7 @@ //! - Handles events and async tasks use crate::application::{create_waker, UIKitEvent, UIKitProxy}; -use crate::events::{drain_input_events, InputEvent}; +use crate::events::{drain_input_events, has_pending_input_events, InputEvent}; use crate::UIKitRenderer; use std::cell::Cell; @@ -21,7 +21,7 @@ use blitz_traits::events::{ BlitzFocusEvent, BlitzInputEvent, BlitzPointerId, BlitzPointerEvent, DomEvent, DomEventData, MouseEventButton, MouseEventButtons, UiEvent, }; -use blitz_traits::shell::{ColorScheme, Viewport}; +use blitz_traits::shell::{ColorScheme, ShellProvider, Viewport}; use dioxus_core::{ComponentFunction, Element, VirtualDom}; use dioxus_native_dom::{DioxusDocument, DocumentConfig}; use keyboard_types::Modifiers; @@ -34,6 +34,27 @@ use winit::event::{ElementState, WindowEvent}; use winit::event_loop::{ActiveEventLoop, EventLoop}; use winit::window::{Window, WindowAttributes, WindowId}; +// ============================================================================= +// UIKitShellProvider - for triggering redraws when resources load +// ============================================================================= + +/// Shell provider that triggers window redraws when resources (images, fonts) load. +pub struct UIKitShellProvider { + window: Arc, +} + +impl UIKitShellProvider { + pub fn new(window: Arc) -> Self { + Self { window } + } +} + +impl ShellProvider for UIKitShellProvider { + fn request_redraw(&self) { + self.window.request_redraw(); + } +} + // ============================================================================= // DioxusUIKitView // ============================================================================= @@ -80,6 +101,10 @@ impl DioxusUIKitView { let size = window.surface_size(); let scale = window.scale_factor() as f32; + // Set up shell provider for resource loading callbacks (images, fonts) + let shell_provider = Arc::new(UIKitShellProvider::new(window.clone())); + doc.inner.borrow_mut().set_shell_provider(shell_provider); + // Set viewport on document let viewport = Viewport::new(size.width, size.height, scale, ColorScheme::Light); doc.inner.borrow_mut().set_viewport(viewport); @@ -166,10 +191,32 @@ impl DioxusUIKitView { /// /// This converts InputEvents from native UIKit controls (UITextField, etc.) /// to DomEvents and dispatches them through the Dioxus event system. - pub fn process_input_events(&mut self) { + /// + /// Returns true if any events were processed. + pub fn process_input_events(&mut self) -> bool { let events = drain_input_events(); + let had_events = !events.is_empty(); + for event in events { let dom_event = match event { + InputEvent::Click { node_id } => { + DomEvent::new( + node_id, + DomEventData::Click(BlitzPointerEvent { + id: BlitzPointerId::Finger(0), + is_primary: true, + x: 0.0, + y: 0.0, + screen_x: 0.0, + screen_y: 0.0, + client_x: 0.0, + client_y: 0.0, + button: MouseEventButton::Main, + buttons: MouseEventButtons::None, + mods: Modifiers::empty(), + }), + ) + } InputEvent::TextChanged { node_id, value } => { DomEvent::new(node_id, DomEventData::Input(BlitzInputEvent { value })) } @@ -183,6 +230,8 @@ impl DioxusUIKitView { // Dispatch through Dioxus event handler self.doc.handle_dom_event(dom_event); } + + had_events } /// Perform a redraw if needed. @@ -194,7 +243,13 @@ impl DioxusUIKitView { self.needs_redraw.set(false); // Process any queued input events - self.process_input_events(); + let had_events = self.process_input_events(); + + // If we had events, poll the VirtualDom to process them and get mutations + if had_events { + // Poll with no waker since we're already in redraw + let _ = self.doc.poll(None); + } // Resolve layout self.doc.inner.borrow_mut().resolve(0.0); @@ -414,8 +469,12 @@ impl ApplicationHandler for DioxusUIKitApplication { } fn about_to_wait(&mut self, _event_loop: &dyn ActiveEventLoop) { + // Check if there are pending input events from native controls (buttons, text fields) + let has_pending = has_pending_input_events(); + for view in self.views.values() { - if view.needs_redraw() { + // Request redraw if view needs it OR if there are pending input events + if view.needs_redraw() || has_pending { view.request_redraw(); } } @@ -467,6 +526,16 @@ pub fn launch_cfg_with_props( props: P, attributes: WindowAttributes, ) { + // Create tokio runtime for async networking + let rt = tokio::runtime::Builder::new_multi_thread() + .enable_all() + .build() + .expect("Failed to create tokio runtime"); + let _guard = rt.enter(); + + // Create net provider for image/font loading + let net_provider = blitz_net::Provider::shared(None); + // Create event loop let event_loop = EventLoop::new().expect("Failed to create event loop"); let winit_proxy = event_loop.create_proxy(); @@ -475,8 +544,12 @@ pub fn launch_cfg_with_props( // Create VirtualDom let vdom = VirtualDom::new_with_props(app, props); - // Create DioxusDocument - let doc = DioxusDocument::new(vdom, DocumentConfig::default()); + // Create DioxusDocument with net provider + let config = DocumentConfig { + net_provider: Some(net_provider), + ..Default::default() + }; + let doc = DioxusDocument::new(vdom, config); // Create application let application = DioxusUIKitApplication::new(doc, attributes, proxy, event_queue); diff --git a/packages/blitz-ios-uikit/src/elements/button.rs b/packages/blitz-ios-uikit/src/elements/button.rs index 24f4fb480..d0c463338 100644 --- a/packages/blitz-ios-uikit/src/elements/button.rs +++ b/packages/blitz-ios-uikit/src/elements/button.rs @@ -12,7 +12,7 @@ use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send, sel}; use objc2_foundation::{MainThreadMarker, NSString}; use objc2_ui_kit::{UIButton, UIButtonConfiguration, UIControlEvents, UIView}; -use crate::events::EventSender; +use crate::events::{queue_click, EventSender}; // ============================================================================= // BlitzButton - Custom UIButton with event bridging @@ -38,12 +38,8 @@ define_class!( #[unsafe(method(handleTouchUpInside:))] fn handle_touch_up_inside(&self, _sender: &UIButton) { let node_id = self.ivars().node_id.get(); - - #[cfg(debug_assertions)] println!("[BlitzButton] tap event for node_id={}", node_id); - - // TODO: Send click event via EventSender - // This will be wired up when we implement the full event system + queue_click(node_id); } } ); diff --git a/packages/blitz-ios-uikit/src/elements/image.rs b/packages/blitz-ios-uikit/src/elements/image.rs index 200414d79..77f041162 100644 --- a/packages/blitz-ios-uikit/src/elements/image.rs +++ b/packages/blitz-ios-uikit/src/elements/image.rs @@ -79,9 +79,10 @@ impl BlitzImageView { /// Create a UIImageView for an img element. pub fn create_image_view(mtm: MainThreadMarker, node: &Node, node_id: usize) -> Retained { + println!("[BlitzImageView] Creating image view for node_id={}", node_id); let image_view = BlitzImageView::new(mtm, node_id); - // Try to set initial image + // Try to set initial image (may not be loaded yet) set_image_from_node(&image_view, node); // Cast to UIView @@ -112,12 +113,15 @@ fn compute_image_hash(raster: &RasterImageData) -> u64 { /// Set image content from node's image data. fn set_image_from_node(image_view: &BlitzImageView, node: &Node) { + let node_id = image_view.node_id(); let Some(element_data) = node.element_data() else { + println!("[BlitzImageView] node_id={} no element data", node_id); return; }; // Check for image data in special_data if let blitz_dom::node::SpecialElementData::Image(ref image_data) = element_data.special_data { + println!("[BlitzImageView] node_id={} has image data", node_id); match image_data.as_ref() { ImageData::Raster(raster) => { // Compute hash and check if image changed @@ -141,12 +145,15 @@ fn set_image_from_node(image_view: &BlitzImageView, node: &Node) { // SVG images not yet supported } ImageData::None => { + println!("[BlitzImageView] node_id={} image data is None (not loaded yet)", node_id); if image_view.image_hash() != 0 { unsafe { image_view.setImage(None) }; image_view.set_image_hash(0); } } } + } else { + println!("[BlitzImageView] node_id={} special_data is not Image type", node_id); } } diff --git a/packages/blitz-ios-uikit/src/elements/input.rs b/packages/blitz-ios-uikit/src/elements/input.rs index 2d4cb64a3..4e98b3d69 100644 --- a/packages/blitz-ios-uikit/src/elements/input.rs +++ b/packages/blitz-ios-uikit/src/elements/input.rs @@ -9,6 +9,7 @@ use markup5ever::local_name; use objc2::rc::Retained; use objc2::runtime::NSObjectProtocol; use objc2::{DefinedClass, MainThreadOnly, define_class, msg_send, sel}; +use objc2_core_foundation::{CGRect, CGSize}; use objc2_foundation::{MainThreadMarker, NSString}; use objc2_ui_kit::{UIControlEvents, UITextBorderStyle, UITextField, UITextInputTraits, UIView}; @@ -57,6 +58,36 @@ define_class!( let node_id = self.ivars().node_id.get(); println!("[BlitzTextField] EditingDidBegin (focus) node_id={}", node_id); queue_focus_gained(node_id); + + // Scroll the text field into view to avoid keyboard overlap + // Find parent scroll view and scroll to make this field visible + unsafe { + let mut current_view: Option> = self.superview(); + while let Some(view) = current_view { + // Check if this is a UIScrollView by trying to call scrollRectToVisible + // We use the class name check since we can't easily do dynamic casting + let class_name = view.class().name().to_string_lossy(); + if class_name.contains("ScrollView") { + // Found a scroll view - scroll to make this text field visible + let frame = self.frame(); + // Convert frame to scroll view coordinates + let converted = view.convertRect_fromView(frame, Some(self.superview().as_deref().unwrap_or(&*view))); + // Add some padding for the keyboard (rough estimate) + let visible_rect = CGRect { + origin: converted.origin, + size: CGSize { + width: converted.size.width, + height: converted.size.height + 300.0, // Extra space for keyboard + }, + }; + // Cast to UIScrollView and scroll + let scroll_view: &objc2_ui_kit::UIScrollView = std::mem::transmute(&*view); + scroll_view.scrollRectToVisible_animated(visible_rect, true); + break; + } + current_view = view.superview(); + } + } } /// Called when the text field ends editing (loses focus). @@ -186,11 +217,21 @@ fn apply_text_field_attributes(text_field: &UITextField, node: &Node) { unsafe { let keyboard_type = match input_type.as_deref() { Some("email") => objc2_ui_kit::UIKeyboardType::EmailAddress, - Some("number") => objc2_ui_kit::UIKeyboardType::NumberPad, + Some("number") => objc2_ui_kit::UIKeyboardType::DecimalPad, Some("tel") => objc2_ui_kit::UIKeyboardType::PhonePad, Some("url") => objc2_ui_kit::UIKeyboardType::URL, + Some("search") => objc2_ui_kit::UIKeyboardType::WebSearch, _ => objc2_ui_kit::UIKeyboardType::Default, }; text_field.setKeyboardType(keyboard_type); } + + // Set return key type for search inputs + unsafe { + let return_key_type = match input_type.as_deref() { + Some("search") => objc2_ui_kit::UIReturnKeyType::Search, + _ => objc2_ui_kit::UIReturnKeyType::Default, + }; + text_field.setReturnKeyType(return_key_type); + } } diff --git a/packages/blitz-ios-uikit/src/elements/mod.rs b/packages/blitz-ios-uikit/src/elements/mod.rs index c7a308661..d816f690f 100644 --- a/packages/blitz-ios-uikit/src/elements/mod.rs +++ b/packages/blitz-ios-uikit/src/elements/mod.rs @@ -7,6 +7,7 @@ mod checkbox; mod container; mod image; mod input; +mod scrollview; pub mod text; use blitz_dom::Node; @@ -21,6 +22,7 @@ pub use button::BlitzButton; pub use checkbox::BlitzSwitch; pub use container::BlitzView; pub use input::BlitzTextField; +pub use scrollview::{BlitzScrollView, update_scroll_view_content_size}; pub use text::BlitzLabel; /// Categories of UIKit views we create @@ -69,6 +71,9 @@ pub fn element_type_for_node(node: &Node) -> Option { // Check for other specific elements match tag.as_ref() { + // Body is always scrollable to handle overflow + "body" => Some(ElementType::ScrollView), + "button" => Some(ElementType::Button), "img" => Some(ElementType::ImageView), "textarea" => Some(ElementType::TextField), @@ -119,10 +124,7 @@ pub fn create_view( ElementType::TextField => input::create_text_field(mtm, node, node_id, event_sender), ElementType::Switch => checkbox::create_switch(mtm, node, node_id, event_sender), ElementType::ImageView => image::create_image_view(mtm, node, node_id), - ElementType::ScrollView => { - // For now, create a regular container - we'll add scroll support later - container::create_container(mtm, node_id, event_sender) - } + ElementType::ScrollView => scrollview::create_scroll_view(mtm, node_id, event_sender) } } diff --git a/packages/blitz-ios-uikit/src/elements/scrollview.rs b/packages/blitz-ios-uikit/src/elements/scrollview.rs new file mode 100644 index 000000000..a82330915 --- /dev/null +++ b/packages/blitz-ios-uikit/src/elements/scrollview.rs @@ -0,0 +1,131 @@ +//! Scroll view element (UIScrollView) implementation +//! +//! Used for scrollable containers (body, overflow: scroll/auto). +//! Handles keyboard avoidance and dismissal. + +use std::cell::Cell; + +use objc2::rc::Retained; +use objc2::runtime::NSObjectProtocol; +use objc2::{define_class, msg_send, sel, DefinedClass, MainThreadOnly}; +use objc2_foundation::{MainThreadMarker, NSSize}; +use objc2_ui_kit::{ + UIGestureRecognizer, UIScrollView, UIScrollViewKeyboardDismissMode, UITapGestureRecognizer, + UIView, +}; + +use crate::events::EventSender; + +// ============================================================================= +// BlitzScrollView - Custom UIScrollView with keyboard handling +// ============================================================================= + +/// Ivars for BlitzScrollView +#[derive(Default)] +pub struct BlitzScrollViewIvars { + /// The blitz-dom node ID this view represents + pub node_id: Cell, +} + +define_class!( + /// A UIScrollView subclass for scrollable containers. + #[unsafe(super(UIScrollView))] + #[thread_kind = MainThreadOnly] + #[name = "BlitzScrollView"] + #[ivars = BlitzScrollViewIvars] + pub struct BlitzScrollView; + + unsafe impl NSObjectProtocol for BlitzScrollView {} + + impl BlitzScrollView { + /// Handle tap gesture to dismiss keyboard + #[unsafe(method(handleTapToDismissKeyboard:))] + fn handle_tap_to_dismiss_keyboard(&self, _gesture: &UITapGestureRecognizer) { + // End editing on the entire view hierarchy, which dismisses the keyboard + unsafe { + self.endEditing(true); + } + } + } +); + +impl BlitzScrollView { + /// Create a new BlitzScrollView. + pub fn new(mtm: MainThreadMarker, node_id: usize) -> Retained { + let ivars = BlitzScrollViewIvars { + node_id: Cell::new(node_id), + }; + let this = mtm.alloc::().set_ivars(ivars); + let scroll_view: Retained = unsafe { msg_send![super(this), init] }; + + // Enable scrolling + unsafe { + scroll_view.setScrollEnabled(true); + scroll_view.setBounces(true); + scroll_view.setShowsVerticalScrollIndicator(true); + scroll_view.setShowsHorizontalScrollIndicator(false); + + // Dismiss keyboard when dragging + scroll_view.setKeyboardDismissMode(UIScrollViewKeyboardDismissMode::Interactive); + + // Enable automatic keyboard avoidance + // This tells iOS to automatically adjust content insets for safe areas + scroll_view.setContentInsetAdjustmentBehavior( + objc2_ui_kit::UIScrollViewContentInsetAdjustmentBehavior::Always, + ); + + // Ensure scroll indicators also adjust + scroll_view.setAutomaticallyAdjustsScrollIndicatorInsets(true); + } + + // Add tap gesture recognizer to dismiss keyboard when tapping outside inputs + unsafe { + let tap_gesture = + UITapGestureRecognizer::initWithTarget_action( + mtm.alloc(), + Some(&*scroll_view), + Some(sel!(handleTapToDismissKeyboard:)), + ); + + // Don't cancel touches in view - allow buttons/inputs to still work + tap_gesture.setCancelsTouchesInView(false); + + scroll_view.addGestureRecognizer(&tap_gesture); + } + + scroll_view + } + + /// Get the node ID. + pub fn node_id(&self) -> usize { + self.ivars().node_id.get() + } + + /// Set the content size for scrolling. + pub fn set_content_size(&self, width: f64, height: f64) { + unsafe { + self.setContentSize(NSSize::new(width, height)); + } + } +} + +/// Create a scroll view for a scrollable container. +pub fn create_scroll_view( + mtm: MainThreadMarker, + node_id: usize, + _event_sender: &EventSender, +) -> Retained { + println!("[BlitzScrollView] Creating scroll view for node_id={}", node_id); + + let scroll_view = BlitzScrollView::new(mtm, node_id); + + // Cast to UIView + unsafe { Retained::cast(scroll_view) } +} + +/// Update scroll view content size based on children's layout. +pub fn update_scroll_view_content_size(view: &UIView, content_width: f64, content_height: f64) { + // SAFETY: We only call this for scroll view types + let scroll_view: &BlitzScrollView = unsafe { std::mem::transmute(view) }; + scroll_view.set_content_size(content_width, content_height); +} diff --git a/packages/blitz-ios-uikit/src/events.rs b/packages/blitz-ios-uikit/src/events.rs index 564c1f9ce..e6b567921 100644 --- a/packages/blitz-ios-uikit/src/events.rs +++ b/packages/blitz-ios-uikit/src/events.rs @@ -25,6 +25,8 @@ static INPUT_EVENT_QUEUE: Mutex> = Mutex::new(VecDeque::new /// An input event from a native UIKit control. #[derive(Debug, Clone)] pub enum InputEvent { + /// Button/element clicked + Click { node_id: usize }, /// Text input changed TextChanged { node_id: usize, value: String }, /// Input gained focus @@ -33,6 +35,14 @@ pub enum InputEvent { FocusLost { node_id: usize }, } +/// Queue a click event from a UIButton or other tappable element. +pub fn queue_click(node_id: usize) { + if let Ok(mut queue) = INPUT_EVENT_QUEUE.lock() { + println!("[InputEvent] Click node_id={}", node_id); + queue.push_back(InputEvent::Click { node_id }); + } +} + /// Queue a text change event from a UITextField. pub fn queue_text_changed(node_id: usize, value: String) { if let Ok(mut queue) = INPUT_EVENT_QUEUE.lock() { @@ -66,9 +76,38 @@ pub fn drain_input_events() -> Vec { } } +/// Check if there are pending input events without draining them. +pub fn has_pending_input_events() -> bool { + if let Ok(queue) = INPUT_EVENT_QUEUE.lock() { + !queue.is_empty() + } else { + false + } +} + /// Convert an InputEvent to a DomEvent. pub fn input_event_to_dom_event(event: InputEvent) -> DomEvent { match event { + InputEvent::Click { node_id } => { + // Create a click event with dummy pointer data + // The actual position doesn't matter for native button clicks + DomEvent::new( + node_id, + DomEventData::Click(BlitzPointerEvent { + id: BlitzPointerId::Finger(0), + is_primary: true, + x: 0.0, + y: 0.0, + screen_x: 0.0, + screen_y: 0.0, + client_x: 0.0, + client_y: 0.0, + button: MouseEventButton::Main, + buttons: MouseEventButtons::None, + mods: Modifiers::empty(), + }), + ) + } InputEvent::TextChanged { node_id, value } => { DomEvent::new(node_id, DomEventData::Input(BlitzInputEvent { value })) } diff --git a/packages/blitz-ios-uikit/src/sync.rs b/packages/blitz-ios-uikit/src/sync.rs index b69e922b8..303d884f3 100644 --- a/packages/blitz-ios-uikit/src/sync.rs +++ b/packages/blitz-ios-uikit/src/sync.rs @@ -3,13 +3,13 @@ //! This module handles walking the DOM tree and creating/updating/removing //! UIKit views to match the current DOM state. -use blitz_dom::Node; +use blitz_dom::{BaseDocument, Node}; use blitz_dom::node::NodeData; use objc2_foundation::NSPoint; use objc2_ui_kit::{UIButton, UILabel, UIView}; use style::values::computed::Display as StyloDisplay; -use crate::elements::{ElementType, create_view, element_type_for_node, update_view}; +use crate::elements::{ElementType, create_view, element_type_for_node, update_scroll_view_content_size, update_view}; use crate::style::{apply_button_styles, apply_layout, apply_text_styles, apply_visual_styles}; use crate::{UIKitRenderer, ViewEntry}; @@ -208,6 +208,16 @@ fn sync_node( // Sync children with zero frame_offset since they're relative to this new view sync_children(renderer, node_id, &view, NSPoint::new(0.0, 0.0), scale, generation); + + // For scroll views, calculate and set content size from children + if element_type == ElementType::ScrollView { + let doc = renderer.doc(); + let doc = doc.borrow(); + if let Some(node) = doc.get_node(node_id) { + let content_size = calculate_content_size(node, &doc); + update_scroll_view_content_size(&view, content_size.0, content_size.1); + } + } } /// Sync children of a node. @@ -277,3 +287,31 @@ fn cleanup_stale_views(renderer: &mut UIKitRenderer, current_generation: u64) { } } } + +/// Calculate the content size for a scroll view based on its children's layout. +fn calculate_content_size(node: &Node, doc: &BaseDocument) -> (f64, f64) { + let mut max_x: f64 = 0.0; + let mut max_y: f64 = 0.0; + + // Get layout children + let children = node + .layout_children + .borrow(); + + if let Some(children) = children.as_ref() { + for &child_id in children.iter() { + if let Some(child) = doc.get_node(child_id) { + let layout = child.final_layout; + let child_right = layout.location.x as f64 + layout.size.width as f64; + let child_bottom = layout.location.y as f64 + layout.size.height as f64; + + max_x = max_x.max(child_right); + max_y = max_y.max(child_bottom); + } + } + } + + // Add some padding at the bottom for better scrolling experience + let padding = 20.0; + (max_x, max_y + padding) +} From 604c151a2403e3f4dde12d0a0940be083b1ceb5a Mon Sep 17 00:00:00 2001 From: Jonathan Kelley Date: Wed, 14 Jan 2026 23:04:30 -0800 Subject: [PATCH 67/67] wip --- packages/blitz-ios-uikit/Cargo.toml | 6 +- packages/blitz-ios-uikit/examples/counter.rs | 46 +---- packages/blitz-ios-uikit/src/dioxus.rs | 171 +++++++++++++++++-- 3 files changed, 168 insertions(+), 55 deletions(-) diff --git a/packages/blitz-ios-uikit/Cargo.toml b/packages/blitz-ios-uikit/Cargo.toml index fa72918ed..81211e61a 100644 --- a/packages/blitz-ios-uikit/Cargo.toml +++ b/packages/blitz-ios-uikit/Cargo.toml @@ -17,8 +17,9 @@ path = "src/lib.rs" # It demonstrates UIKit patterns with objc2 but requires external Swift FFI [features] -default = ["dioxus"] +default = ["dioxus", "hot-reload"] dioxus = ["dep:dioxus-native-dom", "dep:dioxus-core", "dep:blitz-net", "dep:tokio"] +hot-reload = ["dep:dioxus-devtools"] [dependencies] # Note: system_fonts enables CoreText font backend on iOS/macOS @@ -39,6 +40,9 @@ dioxus-core = { workspace = true, optional = true } blitz-net = { workspace = true, optional = true } tokio = { version = "1", features = ["rt", "macros"], optional = true } +# Hot reload support (optional) +dioxus-devtools = { workspace = true, optional = true } + # Stylo (for computed styles) style = { workspace = true } diff --git a/packages/blitz-ios-uikit/examples/counter.rs b/packages/blitz-ios-uikit/examples/counter.rs index f30f1c470..65cc2a641 100644 --- a/packages/blitz-ios-uikit/examples/counter.rs +++ b/packages/blitz-ios-uikit/examples/counter.rs @@ -62,49 +62,15 @@ fn app() -> Element { } span { class: "input-value", "Value: {text_value}" } } - - div { class: "input-group", - label { "Number Input:" } - input { - r#type: "number", - placeholder: "Enter number...", - value: "{number_value}", - oninput: move |e| number_value.set(e.value()), - } - span { class: "input-value", "Value: {number_value}" } - } - - div { class: "input-group", - label { "Email Input:" } - input { - r#type: "email", - placeholder: "Enter email...", - value: "{email_value}", - oninput: move |e| email_value.set(e.value()), - } - span { class: "input-value", "Value: {email_value}" } - } - div { class: "input-group", - label { "Password Input:" } - input { - r#type: "password", - placeholder: "Enter password...", - value: "{password_value}", - oninput: move |e| password_value.set(e.value()), - } - span { class: "input-value", "Value: {password_value}" } - } - - div { class: "input-group", - label { "Search Input:" } + label { "Text Input:" } input { - r#type: "search", - placeholder: "Search...", - value: "{search_value}", - oninput: move |e| search_value.set(e.value()), + r#type: "text", + placeholder: "Enter text...", + value: "{text_value}", + oninput: move |e| text_value.set(e.value()), } - span { class: "input-value", "Value: {search_value}" } + span { class: "input-value", "Value: {text_value}" } } // Checkbox test diff --git a/packages/blitz-ios-uikit/src/dioxus.rs b/packages/blitz-ios-uikit/src/dioxus.rs index 1ab95a483..9494da9f7 100644 --- a/packages/blitz-ios-uikit/src/dioxus.rs +++ b/packages/blitz-ios-uikit/src/dioxus.rs @@ -5,8 +5,8 @@ //! - Wraps it in a DioxusDocument //! - Renders to native UIKit views //! - Handles events and async tasks +//! - Supports hot-reloading when the `hot-reload` feature is enabled -use crate::application::{create_waker, UIKitEvent, UIKitProxy}; use crate::events::{drain_input_events, has_pending_input_events, InputEvent}; use crate::UIKitRenderer; @@ -34,6 +34,90 @@ use winit::event::{ElementState, WindowEvent}; use winit::event_loop::{ActiveEventLoop, EventLoop}; use winit::window::{Window, WindowAttributes, WindowId}; +// ============================================================================= +// UIKit Dioxus Events +// ============================================================================= + +/// Events for Dioxus UIKit application +#[derive(Debug, Clone)] +pub enum UIKitDioxusEvent { + /// Poll a specific window for updates + Poll { window_id: WindowId }, + /// Request a redraw for a document + RequestRedraw { doc_id: usize }, + /// Hot reload event from devserver + #[cfg(all(feature = "hot-reload", debug_assertions))] + HotReload(dioxus_devtools::DevserverMsg), +} + +/// Proxy for sending Dioxus UIKit events to the event loop. +#[derive(Clone)] +pub struct DioxusUIKitProxy { + inner: Arc, +} + +struct DioxusUIKitProxyInner { + winit_proxy: winit::event_loop::EventLoopProxy, + sender: std::sync::mpsc::Sender, +} + +impl DioxusUIKitProxy { + /// Create a new proxy and event receiver. + pub fn new(winit_proxy: winit::event_loop::EventLoopProxy) -> (Self, Receiver) { + let (sender, receiver) = std::sync::mpsc::channel(); + let proxy = Self { + inner: Arc::new(DioxusUIKitProxyInner { + winit_proxy, + sender, + }), + }; + (proxy, receiver) + } + + /// Wake up the event loop. + pub fn wake_up(&self) { + self.inner.winit_proxy.wake_up(); + } + + /// Send an event to the application. + pub fn send_event(&self, event: UIKitDioxusEvent) { + let _ = self.inner.sender.send(event); + self.wake_up(); + } +} + +impl blitz_traits::net::NetWaker for DioxusUIKitProxy { + fn wake(&self, doc_id: usize) { + self.send_event(UIKitDioxusEvent::RequestRedraw { doc_id }); + } +} + +/// Create a waker that sends Poll events to the event loop. +/// +/// This allows async tasks in the VirtualDom to wake up the event loop +/// when they complete. +fn create_dioxus_waker(proxy: &DioxusUIKitProxy, window_id: WindowId) -> Waker { + use futures_util::task::ArcWake; + + struct WakerHandle { + proxy: DioxusUIKitProxy, + window_id: WindowId, + } + + impl ArcWake for WakerHandle { + fn wake_by_ref(arc_self: &Arc) { + arc_self.proxy.send_event(UIKitDioxusEvent::Poll { + window_id: arc_self.window_id, + }); + } + } + + futures_util::task::waker(Arc::new(WakerHandle { + proxy: proxy.clone(), + window_id, + })) +} + // ============================================================================= // UIKitShellProvider - for triggering redraws when resources load // ============================================================================= @@ -73,7 +157,7 @@ pub struct DioxusUIKitView { /// Waker for async integration waker: Option, /// Proxy for event loop communication - proxy: UIKitProxy, + proxy: DioxusUIKitProxy, /// MainThreadMarker for UIKit operations mtm: MainThreadMarker, /// Whether a redraw is needed @@ -88,7 +172,7 @@ impl DioxusUIKitView { mut doc: DioxusDocument, attributes: WindowAttributes, event_loop: &dyn ActiveEventLoop, - proxy: &UIKitProxy, + proxy: &DioxusUIKitProxy, ) -> Self { let mtm = MainThreadMarker::new().expect("DioxusUIKitView must be created on main thread"); @@ -116,8 +200,8 @@ impl DioxusUIKitView { let mut renderer = UIKitRenderer::new(doc.inner.clone(), root_view, mtm); renderer.set_scale(scale as f64); - // Create waker - let waker = create_waker(proxy, window.id()); + // Create waker for async tasks + let waker = create_dioxus_waker(proxy, window.id()); // Run initial build of the VirtualDom doc.initial_build(); @@ -134,6 +218,23 @@ impl DioxusUIKitView { } } + /// Apply hot-reload changes to the document. + #[cfg(all(feature = "hot-reload", debug_assertions))] + pub fn apply_hot_reload(&mut self, msg: &dioxus_devtools::HotReloadMsg) { + // Apply changes to the vdom + dioxus_devtools::apply_changes(&self.doc.vdom, msg); + + // Reload changed assets + for asset_path in &msg.assets { + if let Some(url) = asset_path.to_str() { + self.doc.inner.borrow_mut().reload_resource_by_href(url); + } + } + + // Request redraw + self.request_redraw(); + } + /// Get the window ID. pub fn window_id(&self) -> WindowId { self.window.id() @@ -372,9 +473,9 @@ pub struct DioxusUIKitApplication { /// Pending document to create on resume pending_doc: Option<(DioxusDocument, WindowAttributes)>, /// Proxy for sending events - proxy: UIKitProxy, + proxy: DioxusUIKitProxy, /// Receiver for application events - event_queue: Receiver, + event_queue: Receiver, } impl DioxusUIKitApplication { @@ -382,8 +483,8 @@ impl DioxusUIKitApplication { pub fn new( doc: DioxusDocument, attributes: WindowAttributes, - proxy: UIKitProxy, - event_queue: Receiver, + proxy: DioxusUIKitProxy, + event_queue: Receiver, ) -> Self { Self { views: HashMap::new(), @@ -397,18 +498,50 @@ impl DioxusUIKitApplication { self.views.values_mut().find(|v| v.doc_id() == doc_id) } - fn handle_event(&mut self, _event_loop: &dyn ActiveEventLoop, event: UIKitEvent) { + fn handle_event(&mut self, event_loop: &dyn ActiveEventLoop, event: UIKitDioxusEvent) { match event { - UIKitEvent::Poll { window_id } => { + UIKitDioxusEvent::Poll { window_id } => { if let Some(view) = self.views.get_mut(&window_id) { view.poll(); } } - UIKitEvent::RequestRedraw { doc_id } => { + UIKitDioxusEvent::RequestRedraw { doc_id } => { if let Some(view) = self.view_by_doc_id(doc_id) { view.request_redraw(); } } + #[cfg(all(feature = "hot-reload", debug_assertions))] + UIKitDioxusEvent::HotReload(msg) => { + self.handle_hot_reload(event_loop, msg); + } + } + } + + /// Handle hot-reload messages from the devserver. + #[cfg(all(feature = "hot-reload", debug_assertions))] + fn handle_hot_reload(&mut self, event_loop: &dyn ActiveEventLoop, msg: dioxus_devtools::DevserverMsg) { + match msg { + dioxus_devtools::DevserverMsg::HotReload(hotreload_msg) => { + // Apply hot-reload to all views + for view in self.views.values_mut() { + view.apply_hot_reload(&hotreload_msg); + view.poll(); + } + } + dioxus_devtools::DevserverMsg::Shutdown => { + println!("[HotReload] Devserver shutdown, exiting..."); + event_loop.exit(); + } + dioxus_devtools::DevserverMsg::FullReloadStart => { + println!("[HotReload] Full reload starting..."); + } + dioxus_devtools::DevserverMsg::FullReloadFailed => { + println!("[HotReload] Full reload failed"); + } + dioxus_devtools::DevserverMsg::FullReloadCommand => { + println!("[HotReload] Full reload command received"); + } + _ => {} } } } @@ -459,7 +592,7 @@ impl ApplicationHandler for DioxusUIKitApplication { view.handle_window_event(event); } - self.proxy.send_event(UIKitEvent::Poll { window_id }); + self.proxy.send_event(UIKitDioxusEvent::Poll { window_id }); } fn proxy_wake_up(&mut self, event_loop: &dyn ActiveEventLoop) { @@ -539,7 +672,17 @@ pub fn launch_cfg_with_props( // Create event loop let event_loop = EventLoop::new().expect("Failed to create event loop"); let winit_proxy = event_loop.create_proxy(); - let (proxy, event_queue) = UIKitProxy::new(winit_proxy); + let (proxy, event_queue) = DioxusUIKitProxy::new(winit_proxy); + + // Setup hot-reloading if enabled + #[cfg(all(feature = "hot-reload", debug_assertions))] + { + let proxy = proxy.clone(); + dioxus_devtools::connect(move |event| { + proxy.send_event(UIKitDioxusEvent::HotReload(event)); + }); + println!("[HotReload] Connected to devtools server"); + } // Create VirtualDom let vdom = VirtualDom::new_with_props(app, props);