diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsefx index af09d0e8..39a44703 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsefx +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsefx @@ -18,7 +18,7 @@ - + @@ -27,7 +27,7 @@ - + @@ -37,7 +37,7 @@ - + @@ -21961,17 +21961,17 @@ - + - + - + @@ -23433,17 +23433,17 @@ - + - + - + @@ -24905,17 +24905,17 @@ - + - + - + @@ -26377,17 +26377,17 @@ - + - + - + @@ -26878,24 +26878,24 @@ - + - - - - - + + + + + - + - - - - - + + + + + @@ -27277,17 +27277,17 @@ - + - + - + @@ -28778,7 +28778,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsefx index 282838a9..1fa591c3 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsefx +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsefx @@ -37,7 +37,7 @@ - + @@ -2192,8 +2192,8 @@ - - + + @@ -3231,8 +3231,8 @@ - - + + @@ -8467,8 +8467,8 @@ - - + + @@ -8481,8 +8481,8 @@ - - + + @@ -10288,8 +10288,8 @@ - - + + @@ -10303,8 +10303,8 @@ - - + + @@ -11766,8 +11766,8 @@ - - + + @@ -11781,8 +11781,8 @@ - - + + @@ -14968,7 +14968,7 @@ - + @@ -16830,8 +16830,8 @@ - - + + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_Geyser_AuraFX.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_Geyser_AuraFX.lsefx new file mode 100644 index 00000000..fff20361 --- /dev/null +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_Geyser_AuraFX.lsefx @@ -0,0 +1,8693 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsefx index df73f71a..8f7c05ef 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsefx +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsefx @@ -37,12 +37,12 @@ - + - + @@ -2348,16 +2348,16 @@ - + - - + + - + - - + + @@ -4774,17 +4774,17 @@ - + - + - + @@ -5062,12 +5062,12 @@ - + - + @@ -5526,7 +5526,7 @@ - + @@ -6622,17 +6622,17 @@ - + - + - + @@ -6721,8 +6721,8 @@ - - + + @@ -7262,8 +7262,8 @@ - - + + @@ -8747,8 +8747,8 @@ - - + + @@ -10144,16 +10144,16 @@ - + - - + + - + - - + + @@ -10595,7 +10595,7 @@ - + @@ -10605,7 +10605,7 @@ - + @@ -10645,8 +10645,8 @@ - - + + @@ -10703,8 +10703,8 @@ - - + + @@ -11132,8 +11132,8 @@ - - + + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsefx index 86c65ba5..7c8d4b14 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsefx +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsefx @@ -37,12 +37,12 @@ - + - + @@ -528,16 +528,16 @@ - + - - + + - + - - + + @@ -2160,8 +2160,8 @@ - - + + @@ -3080,8 +3080,8 @@ - - + + @@ -3575,14 +3575,14 @@ - + - - + + @@ -10256,8 +10256,8 @@ - - + + @@ -10271,8 +10271,8 @@ - - + + @@ -11734,8 +11734,8 @@ - - + + @@ -11749,8 +11749,8 @@ - - + + @@ -15564,8 +15564,8 @@ - - + + @@ -15575,7 +15575,7 @@ - + @@ -16971,8 +16971,8 @@ - - + + @@ -16982,7 +16982,7 @@ - + @@ -18400,8 +18400,8 @@ - - + + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura.lsefx index 8df6f18b..ff60623a 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura.lsefx +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura.lsefx @@ -37,7 +37,7 @@ - + @@ -976,16 +976,16 @@ - + - - + + - + - - + + @@ -12954,17 +12954,17 @@ - + - + - + @@ -15870,7 +15870,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura_Extended.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura_Extended.lsefx index 2080d19a..ee16af4a 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura_Extended.lsefx +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_ChampionsAura_Extended.lsefx @@ -37,7 +37,7 @@ - + @@ -976,18 +976,18 @@ - + - - - + + + - + - - - + + + @@ -12956,7 +12956,7 @@ - + @@ -12966,7 +12966,7 @@ - + @@ -14403,7 +14403,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_Flicker.lsefx b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_Flicker.lsefx new file mode 100644 index 00000000..0f4a0009 --- /dev/null +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Status/VFX_Status_Flicker.lsefx @@ -0,0 +1,16979 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.mei index 2fca7842..71f9f668 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.mei +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.mei @@ -1,4 +1,4 @@  - + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.mei index 0d66b737..fd74d8ba 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.mei +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.mei @@ -1,4 +1,4 @@  - + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.mei index 2ec7da84..52f1eeda 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.mei +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.mei @@ -1,4 +1,4 @@  - + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.mei index f4d88bd2..f29f83da 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.mei +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.mei @@ -1,4 +1,4 @@  - + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.mei index 045db1c4..eaa443dd 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.mei +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.mei @@ -1,4 +1,4 @@  - + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e3cc6ce6-133d-4d76-84c4-e656cd61ec69.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e3cc6ce6-133d-4d76-84c4-e656cd61ec69.mei new file mode 100644 index 00000000..6b2140f7 --- /dev/null +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e3cc6ce6-133d-4d76-84c4-e656cd61ec69.mei @@ -0,0 +1,4 @@ + + + + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e749054e-38db-43fb-ab99-216f3287fae2.mei b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e749054e-38db-43fb-ab99-216f3287fae2.mei new file mode 100644 index 00000000..3d918ee1 --- /dev/null +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e749054e-38db-43fb-ab99-216f3287fae2.mei @@ -0,0 +1,4 @@ + + + + \ No newline at end of file diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.tbl b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.tbl index 6fcd0261..59fffeb0 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.tbl +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.tbl @@ -8818,7 +8818,7 @@ - + @@ -8885,7 +8885,7 @@ - + @@ -9004,7 +9004,7 @@ - + @@ -9079,7 +9079,7 @@ - + @@ -9177,7 +9177,7 @@ - + @@ -9301,7 +9301,7 @@ - + @@ -9369,7 +9369,7 @@ - + @@ -9426,7 +9426,7 @@ - + @@ -9582,7 +9582,7 @@ - + @@ -9636,7 +9636,7 @@ - + @@ -9978,7 +9978,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Projectile.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Projectile.stats index 254015e0..c4d9cab4 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Projectile.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Projectile.stats @@ -76,7 +76,7 @@ - + @@ -111,7 +111,7 @@ - + @@ -143,7 +143,7 @@ - + @@ -162,7 +162,7 @@ - + @@ -189,7 +189,7 @@ - + @@ -244,7 +244,7 @@ - + @@ -276,7 +276,7 @@ - + @@ -295,7 +295,7 @@ - + @@ -305,7 +305,7 @@ - + @@ -315,7 +315,7 @@ - + @@ -325,7 +325,7 @@ - + @@ -335,7 +335,7 @@ - + @@ -347,7 +347,7 @@ - + @@ -799,7 +799,7 @@ - + @@ -873,7 +873,7 @@ - + @@ -1170,7 +1170,7 @@ - + @@ -1253,7 +1253,7 @@ - + @@ -1391,7 +1391,7 @@ - + @@ -1424,7 +1424,7 @@ - + @@ -1463,7 +1463,7 @@ - + @@ -1490,7 +1490,7 @@ - + @@ -1515,7 +1515,7 @@ - + @@ -1527,7 +1527,7 @@ - + @@ -1539,7 +1539,7 @@ - + @@ -1551,7 +1551,7 @@ - + @@ -1563,7 +1563,7 @@ - + @@ -1575,7 +1575,7 @@ - + @@ -1631,7 +1631,7 @@ - + @@ -1658,7 +1658,7 @@ - + @@ -1698,7 +1698,7 @@ - + @@ -1736,7 +1736,7 @@ - + @@ -1774,7 +1774,7 @@ - + @@ -1826,7 +1826,7 @@ - + @@ -1860,7 +1860,7 @@ - + @@ -1903,7 +1903,7 @@ - + @@ -1938,7 +1938,7 @@ - + @@ -2006,10 +2006,10 @@ - + - - + + @@ -2047,8 +2047,8 @@ - - + + @@ -2062,7 +2062,7 @@ - + @@ -2092,7 +2092,7 @@ - + @@ -2366,7 +2366,7 @@ - + @@ -2439,9 +2439,9 @@ - + - + @@ -2474,9 +2474,9 @@ - + - + @@ -2510,9 +2510,9 @@ - + - + @@ -2549,9 +2549,9 @@ - + - + @@ -2582,9 +2582,9 @@ - + - + @@ -2619,9 +2619,9 @@ - + - + @@ -2649,7 +2649,7 @@ - + @@ -2694,9 +2694,9 @@ - - - + + + @@ -2820,7 +2820,7 @@ - + @@ -3076,7 +3076,7 @@ - + @@ -3345,7 +3345,7 @@ - + @@ -3376,7 +3376,7 @@ - + @@ -3445,8 +3445,8 @@ - - + + @@ -3487,7 +3487,7 @@ - + @@ -3526,7 +3526,7 @@ - + @@ -3769,7 +3769,7 @@ - + @@ -3814,11 +3814,11 @@ - + - - - + + + @@ -3859,7 +3859,7 @@ - + @@ -3873,7 +3873,7 @@ - + @@ -4005,7 +4005,7 @@ - + @@ -4160,7 +4160,7 @@ - + @@ -4186,7 +4186,7 @@ - + @@ -4202,7 +4202,7 @@ - + @@ -4263,8 +4263,8 @@ - - + + @@ -4278,8 +4278,8 @@ - - + + @@ -4506,7 +4506,7 @@ - + @@ -4518,7 +4518,7 @@ - + @@ -4554,7 +4554,7 @@ - + @@ -4567,7 +4567,7 @@ - + @@ -4717,7 +4717,7 @@ - + @@ -5023,7 +5023,7 @@ - + @@ -5104,10 +5104,10 @@ - - + + - + @@ -5234,7 +5234,7 @@ - + @@ -5308,7 +5308,7 @@ - + @@ -5359,10 +5359,10 @@ - + - - + + @@ -5390,7 +5390,7 @@ - + @@ -5427,7 +5427,7 @@ - + @@ -5464,7 +5464,7 @@ - + @@ -5574,7 +5574,7 @@ - + @@ -5589,7 +5589,7 @@ - + @@ -5781,9 +5781,9 @@ - + - + @@ -5811,7 +5811,7 @@ - + @@ -5861,7 +5861,7 @@ - + @@ -6003,7 +6003,7 @@ - + @@ -6050,7 +6050,7 @@ - + @@ -6062,7 +6062,7 @@ - + @@ -6078,7 +6078,7 @@ - + @@ -6098,7 +6098,7 @@ - + @@ -6116,7 +6116,7 @@ - + @@ -6172,7 +6172,7 @@ - + @@ -6204,7 +6204,7 @@ - + @@ -6238,10 +6238,10 @@ - + - + @@ -6270,7 +6270,7 @@ - + @@ -6284,10 +6284,10 @@ - + - + @@ -6316,7 +6316,7 @@ - + @@ -6329,7 +6329,7 @@ - + @@ -6347,7 +6347,7 @@ - + @@ -6365,7 +6365,7 @@ - + @@ -6410,7 +6410,7 @@ - + @@ -6492,7 +6492,7 @@ - + @@ -6573,7 +6573,7 @@ - + @@ -6618,7 +6618,7 @@ - + @@ -6727,7 +6727,7 @@ - + @@ -6765,7 +6765,7 @@ - + @@ -6774,7 +6774,7 @@ - + @@ -6811,7 +6811,7 @@ - + @@ -6852,7 +6852,7 @@ - + @@ -6861,7 +6861,7 @@ - + @@ -6906,7 +6906,7 @@ - + @@ -6989,8 +6989,8 @@ - - + + @@ -7026,7 +7026,7 @@ - + @@ -7070,7 +7070,7 @@ - + @@ -7105,7 +7105,7 @@ - + @@ -7152,7 +7152,7 @@ - + @@ -7257,7 +7257,7 @@ - + @@ -7288,7 +7288,7 @@ - + @@ -7311,7 +7311,7 @@ - + @@ -7364,7 +7364,7 @@ - + @@ -7426,14 +7426,14 @@ - + - + @@ -7512,7 +7512,7 @@ - + @@ -7548,9 +7548,9 @@ - - - + + + @@ -7567,7 +7567,7 @@ - + @@ -7600,7 +7600,7 @@ - + @@ -7628,7 +7628,7 @@ - + @@ -7718,7 +7718,7 @@ - + @@ -7783,7 +7783,7 @@ - + @@ -7860,7 +7860,7 @@ - + @@ -7877,7 +7877,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Rush.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Rush.stats index 389fc71d..f00b26a9 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Rush.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Rush.stats @@ -13,7 +13,7 @@ - + @@ -27,7 +27,7 @@ - + @@ -52,7 +52,7 @@ - + @@ -60,13 +60,14 @@ + - + @@ -76,7 +77,7 @@ - + @@ -116,7 +117,7 @@ - + @@ -124,7 +125,7 @@ - + @@ -153,7 +154,7 @@ - + @@ -165,8 +166,9 @@ - + + @@ -175,6 +177,7 @@ + @@ -184,7 +187,7 @@ - + @@ -197,6 +200,7 @@ + @@ -212,7 +216,7 @@ - + @@ -222,7 +226,7 @@ - + @@ -236,7 +240,7 @@ - + @@ -266,7 +270,7 @@ - + @@ -296,7 +300,7 @@ - + @@ -305,7 +309,7 @@ - + @@ -416,7 +420,7 @@ - + @@ -446,7 +450,7 @@ - + @@ -493,7 +497,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Shout.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Shout.stats index 031d82ae..ca4cf3a5 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Shout.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Shout.stats @@ -149,7 +149,7 @@ - + @@ -377,7 +377,7 @@ - + @@ -1080,7 +1080,7 @@ - + @@ -1098,7 +1098,7 @@ - + @@ -1235,7 +1235,7 @@ - + @@ -1275,7 +1275,7 @@ - + @@ -1360,7 +1360,7 @@ - + @@ -1440,7 +1440,7 @@ - + @@ -1470,7 +1470,7 @@ - + @@ -1526,7 +1526,7 @@ - + @@ -1552,7 +1552,7 @@ - + @@ -1637,7 +1637,7 @@ - + @@ -1652,7 +1652,7 @@ - + @@ -1681,7 +1681,7 @@ - + @@ -1729,7 +1729,7 @@ - + @@ -1760,7 +1760,7 @@ - + @@ -1831,7 +1831,7 @@ - + @@ -1954,7 +1954,7 @@ - + @@ -2112,7 +2112,7 @@ - + @@ -2164,7 +2164,7 @@ - + @@ -3561,48 +3561,63 @@ - + + + + + + + - + - - - - - - + - - - - - + + + + + + + + + + + + + + + + + + - + + @@ -4442,7 +4457,7 @@ - + @@ -4555,7 +4570,7 @@ - + @@ -5698,7 +5713,7 @@ - + @@ -5789,7 +5804,7 @@ - + @@ -5807,7 +5822,7 @@ - + @@ -5816,7 +5831,7 @@ - + @@ -5825,7 +5840,7 @@ - + @@ -5834,7 +5849,7 @@ - + @@ -5843,7 +5858,7 @@ - + @@ -5852,7 +5867,7 @@ - + @@ -5861,7 +5876,7 @@ - + @@ -5870,7 +5885,7 @@ - + @@ -5880,7 +5895,7 @@ - + @@ -5964,7 +5979,7 @@ - + @@ -5981,7 +5996,7 @@ - + @@ -5990,7 +6005,7 @@ - + @@ -5999,7 +6014,7 @@ - + @@ -6008,7 +6023,7 @@ - + @@ -6017,7 +6032,7 @@ - + @@ -6026,7 +6041,7 @@ - + @@ -6035,7 +6050,7 @@ - + @@ -6044,7 +6059,7 @@ - + @@ -6081,7 +6096,7 @@ - + @@ -6107,7 +6122,7 @@ - + @@ -6116,7 +6131,7 @@ - + @@ -6125,7 +6140,7 @@ - + @@ -6134,7 +6149,7 @@ - + @@ -6143,7 +6158,7 @@ - + @@ -6168,7 +6183,7 @@ - + @@ -6184,7 +6199,7 @@ - + @@ -6200,7 +6215,7 @@ - + @@ -6216,7 +6231,7 @@ - + @@ -6232,7 +6247,7 @@ - + @@ -6246,7 +6261,7 @@ - + @@ -6268,7 +6283,7 @@ - + @@ -6277,7 +6292,7 @@ - + @@ -6286,7 +6301,7 @@ - + @@ -6295,7 +6310,7 @@ - + @@ -6304,7 +6319,7 @@ - + @@ -6313,7 +6328,7 @@ - + @@ -6322,7 +6337,7 @@ - + @@ -6331,7 +6346,7 @@ - + @@ -6489,7 +6504,7 @@ - + @@ -6640,7 +6655,7 @@ - + @@ -6690,7 +6705,7 @@ - + @@ -6766,7 +6781,7 @@ - + @@ -6815,7 +6830,7 @@ - + @@ -6846,7 +6861,7 @@ - + @@ -6999,7 +7014,7 @@ - + @@ -7372,7 +7387,7 @@ - + @@ -7418,13 +7433,13 @@ - + - + - + @@ -7443,6 +7458,7 @@ + @@ -7452,7 +7468,7 @@ - + @@ -7499,7 +7515,7 @@ - + @@ -7675,7 +7691,7 @@ - + @@ -7708,7 +7724,7 @@ - + @@ -7720,7 +7736,7 @@ - + @@ -7731,7 +7747,7 @@ - + @@ -7742,7 +7758,7 @@ - + @@ -7753,7 +7769,7 @@ - + @@ -7764,7 +7780,7 @@ - + @@ -7775,7 +7791,7 @@ - + @@ -7785,7 +7801,7 @@ - + @@ -7859,7 +7875,7 @@ - + @@ -7890,7 +7906,7 @@ - + @@ -8009,7 +8025,7 @@ - + @@ -8332,7 +8348,7 @@ - + @@ -8382,7 +8398,7 @@ - + @@ -8406,7 +8422,7 @@ - + @@ -8886,7 +8902,7 @@ - + @@ -8934,7 +8950,7 @@ - + @@ -8960,7 +8976,7 @@ - + @@ -9019,7 +9035,7 @@ - + @@ -9049,7 +9065,7 @@ - + @@ -9280,7 +9296,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Target.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Target.stats index 43697343..626816d0 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Target.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Target.stats @@ -77,7 +77,7 @@ - + @@ -150,7 +150,7 @@ - + @@ -181,7 +181,7 @@ - + @@ -209,7 +209,7 @@ - + @@ -259,7 +259,7 @@ - + @@ -282,7 +282,7 @@ - + @@ -300,7 +300,7 @@ - + @@ -324,7 +324,7 @@ - + @@ -390,7 +390,7 @@ - + @@ -433,7 +433,7 @@ - + @@ -468,7 +468,7 @@ - + @@ -493,7 +493,7 @@ - + @@ -521,7 +521,7 @@ - + @@ -622,7 +622,7 @@ - + @@ -652,7 +652,7 @@ - + @@ -684,8 +684,8 @@ - - + + @@ -723,8 +723,8 @@ - - + + @@ -743,7 +743,7 @@ - + @@ -765,7 +765,7 @@ - + @@ -854,7 +854,7 @@ - + @@ -912,7 +912,7 @@ - + @@ -968,6 +968,33 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + @@ -982,7 +1009,7 @@ - + @@ -1217,7 +1244,7 @@ - + @@ -1248,7 +1275,7 @@ - + @@ -1281,7 +1308,7 @@ - + @@ -1427,7 +1454,7 @@ - + @@ -1444,7 +1471,7 @@ - + @@ -1463,7 +1490,7 @@ - + @@ -1484,7 +1511,7 @@ - + @@ -1511,7 +1538,7 @@ - + @@ -2039,7 +2066,7 @@ - + @@ -2163,7 +2190,7 @@ - + @@ -2189,7 +2216,7 @@ - + @@ -2291,7 +2318,7 @@ - + @@ -2303,7 +2330,7 @@ - + @@ -2378,7 +2405,7 @@ - + @@ -2411,7 +2438,7 @@ - + @@ -2425,7 +2452,7 @@ - + @@ -2530,7 +2557,7 @@ - + @@ -2595,7 +2622,7 @@ - + @@ -2627,7 +2654,7 @@ - + @@ -2663,8 +2690,8 @@ - - + + @@ -2715,7 +2742,7 @@ - + @@ -2750,7 +2777,7 @@ - + @@ -2765,7 +2792,7 @@ - + @@ -2874,7 +2901,7 @@ - + @@ -3028,7 +3055,7 @@ - + @@ -3080,7 +3107,7 @@ - + @@ -3132,7 +3159,7 @@ - + @@ -3182,7 +3209,7 @@ - + @@ -3211,7 +3238,7 @@ - + @@ -3240,7 +3267,7 @@ - + @@ -3295,7 +3322,7 @@ - + @@ -3349,7 +3376,7 @@ - + @@ -3404,7 +3431,7 @@ - + @@ -3456,7 +3483,7 @@ - + @@ -3484,7 +3511,7 @@ - + @@ -3512,7 +3539,7 @@ - + @@ -3527,7 +3554,7 @@ - + @@ -3554,7 +3581,7 @@ - + @@ -3592,7 +3619,7 @@ - + @@ -3602,7 +3629,7 @@ - + @@ -3627,7 +3654,7 @@ - + @@ -3652,7 +3679,7 @@ - + @@ -3665,7 +3692,7 @@ - + @@ -3726,7 +3753,7 @@ - + @@ -3777,7 +3804,7 @@ - + @@ -3803,7 +3830,7 @@ - + @@ -4031,7 +4058,7 @@ - + @@ -4247,12 +4274,11 @@ - + - - + @@ -4278,7 +4304,7 @@ - + @@ -4327,7 +4353,7 @@ - + @@ -4514,7 +4540,7 @@ - + @@ -4569,7 +4595,7 @@ - + @@ -4603,7 +4629,7 @@ - + @@ -4652,7 +4678,7 @@ - + @@ -4664,7 +4690,7 @@ - + @@ -4696,7 +4722,7 @@ - + @@ -4722,7 +4748,7 @@ - + @@ -4758,7 +4784,7 @@ - + @@ -4774,7 +4800,7 @@ - + @@ -4828,7 +4854,7 @@ - + @@ -4869,7 +4895,7 @@ - + @@ -4916,7 +4942,7 @@ - + @@ -4942,7 +4968,7 @@ - + @@ -4955,7 +4981,7 @@ - + @@ -4986,7 +5012,7 @@ - + @@ -5000,7 +5026,7 @@ - + @@ -5013,7 +5039,7 @@ - + @@ -5056,10 +5082,10 @@ - + - + @@ -5071,7 +5097,7 @@ - + @@ -5103,7 +5129,7 @@ - + @@ -5130,7 +5156,7 @@ - + @@ -5155,7 +5181,7 @@ - + @@ -5179,7 +5205,7 @@ - + @@ -5213,7 +5239,7 @@ - + @@ -5242,7 +5268,7 @@ - + @@ -5331,7 +5357,7 @@ - + @@ -5445,7 +5471,7 @@ - + @@ -5505,7 +5531,7 @@ - + @@ -5548,7 +5574,7 @@ - + @@ -5578,7 +5604,7 @@ - + @@ -5651,7 +5677,7 @@ - + @@ -5690,7 +5716,7 @@ - + @@ -5727,7 +5753,7 @@ - + @@ -5752,7 +5778,7 @@ - + @@ -5777,7 +5803,7 @@ - + @@ -5800,7 +5826,7 @@ - + @@ -5824,7 +5850,7 @@ - + @@ -5848,7 +5874,7 @@ - + @@ -5859,7 +5885,7 @@ - + @@ -5903,7 +5929,7 @@ - + @@ -6067,7 +6093,7 @@ - + @@ -6096,7 +6122,7 @@ - + @@ -6120,7 +6146,7 @@ - + @@ -6153,7 +6179,7 @@ - + @@ -6171,7 +6197,7 @@ - + @@ -6366,7 +6392,7 @@ - + @@ -6396,7 +6422,7 @@ - + @@ -6489,7 +6515,7 @@ - + @@ -6522,7 +6548,7 @@ - + @@ -6594,7 +6620,7 @@ - + @@ -6650,7 +6676,7 @@ - + @@ -6969,8 +6995,8 @@ - - + + @@ -7149,7 +7175,7 @@ - + @@ -7265,7 +7291,7 @@ - + @@ -7382,7 +7408,7 @@ - + @@ -7425,13 +7451,13 @@ - + - + - + @@ -7465,7 +7491,7 @@ - + @@ -7996,7 +8022,7 @@ - + @@ -8026,7 +8052,7 @@ - + @@ -8037,7 +8063,7 @@ - + @@ -8074,8 +8100,8 @@ - - + + @@ -8184,7 +8210,7 @@ - + @@ -8254,7 +8280,7 @@ - + @@ -8274,7 +8300,7 @@ - + @@ -8285,7 +8311,7 @@ - + @@ -8371,7 +8397,7 @@ - + @@ -8411,7 +8437,7 @@ - + @@ -8444,7 +8470,7 @@ - + @@ -8484,7 +8510,7 @@ - + @@ -8567,7 +8593,7 @@ - + @@ -8659,7 +8685,7 @@ - + @@ -8749,7 +8775,7 @@ - + @@ -8773,7 +8799,7 @@ - + @@ -8784,7 +8810,7 @@ - + @@ -8810,7 +8836,7 @@ - + @@ -8844,7 +8870,7 @@ - + @@ -8870,7 +8896,7 @@ - + @@ -8904,7 +8930,7 @@ - + @@ -8920,7 +8946,7 @@ - + @@ -8935,7 +8961,7 @@ - + @@ -8973,7 +8999,7 @@ - + @@ -9001,7 +9027,7 @@ - + @@ -9017,7 +9043,7 @@ - + @@ -9393,7 +9419,7 @@ - + @@ -9474,7 +9500,7 @@ - + @@ -9504,7 +9530,7 @@ - + @@ -9525,7 +9551,7 @@ - + @@ -9601,7 +9627,7 @@ - + @@ -9631,7 +9657,7 @@ - + @@ -9676,7 +9702,7 @@ - + @@ -9768,7 +9794,7 @@ - + @@ -9785,12 +9811,12 @@ - + - + @@ -9812,7 +9838,7 @@ - + @@ -9830,7 +9856,7 @@ - + @@ -9887,7 +9913,7 @@ - + @@ -9924,7 +9950,7 @@ - + @@ -9954,7 +9980,7 @@ - + @@ -10011,7 +10037,7 @@ - + @@ -10048,7 +10074,7 @@ - + @@ -10113,7 +10139,7 @@ - + @@ -10137,7 +10163,7 @@ - + @@ -10173,7 +10199,7 @@ - + @@ -10185,7 +10211,7 @@ - + @@ -10293,7 +10319,7 @@ - + @@ -10366,7 +10392,7 @@ - + @@ -10426,7 +10452,7 @@ - + @@ -10456,7 +10482,7 @@ - + @@ -10582,7 +10608,7 @@ - + @@ -10615,7 +10641,7 @@ - + @@ -10711,7 +10737,7 @@ - + @@ -10746,7 +10772,7 @@ - + @@ -10796,7 +10822,7 @@ - + @@ -10821,7 +10847,7 @@ - + @@ -10864,8 +10890,8 @@ - - + + @@ -10904,7 +10930,7 @@ - + @@ -10945,7 +10971,7 @@ - + @@ -10966,8 +10992,8 @@ - - + + @@ -10995,8 +11021,8 @@ - - + + @@ -11022,8 +11048,8 @@ - - + + @@ -11035,8 +11061,8 @@ - - + + @@ -11049,7 +11075,7 @@ - + @@ -11058,7 +11084,7 @@ - + @@ -11067,7 +11093,7 @@ - + @@ -11077,7 +11103,7 @@ - + @@ -11144,13 +11170,13 @@ - + - + @@ -11274,7 +11300,7 @@ - + @@ -11283,12 +11309,12 @@ - + - + @@ -11371,7 +11397,7 @@ - + @@ -11391,7 +11417,7 @@ - + @@ -11440,7 +11466,7 @@ - + @@ -11490,7 +11516,7 @@ - + @@ -11520,7 +11546,7 @@ - + @@ -11553,7 +11579,7 @@ - + @@ -11583,7 +11609,7 @@ - + @@ -11629,7 +11655,7 @@ - + @@ -11659,7 +11685,7 @@ - + @@ -11692,7 +11718,7 @@ - + @@ -11726,7 +11752,7 @@ - + @@ -11758,7 +11784,7 @@ - + @@ -11861,7 +11887,7 @@ - + @@ -11893,7 +11919,7 @@ - + @@ -11955,7 +11981,7 @@ - + @@ -11993,7 +12019,7 @@ - + @@ -12064,7 +12090,7 @@ - + @@ -12102,7 +12128,7 @@ - + @@ -12128,7 +12154,7 @@ - + @@ -12316,7 +12342,7 @@ - + @@ -12402,9 +12428,9 @@ - + - + @@ -12447,7 +12473,7 @@ - + @@ -12471,8 +12497,8 @@ - - + + @@ -12511,8 +12537,8 @@ - - + + @@ -12673,7 +12699,7 @@ - + @@ -12705,7 +12731,7 @@ - + @@ -12852,7 +12878,7 @@ - + @@ -13224,9 +13250,9 @@ - - - + + + @@ -13253,7 +13279,7 @@ - + @@ -13279,7 +13305,7 @@ - + @@ -13383,8 +13409,8 @@ - - + + @@ -13574,7 +13600,7 @@ - + @@ -13649,7 +13675,7 @@ - + @@ -13677,7 +13703,7 @@ - + @@ -13704,7 +13730,7 @@ - + @@ -13731,7 +13757,7 @@ - + @@ -13759,7 +13785,7 @@ - + @@ -13796,7 +13822,7 @@ - + @@ -13822,7 +13848,7 @@ - + @@ -13848,7 +13874,7 @@ - + @@ -13875,7 +13901,7 @@ - + @@ -13901,7 +13927,7 @@ - + @@ -13914,7 +13940,7 @@ - + @@ -14019,7 +14045,7 @@ - + @@ -14062,7 +14088,7 @@ - + @@ -14077,7 +14103,7 @@ - + @@ -14094,7 +14120,7 @@ - + @@ -14121,7 +14147,7 @@ - + @@ -14204,9 +14230,9 @@ - - - + + + @@ -14241,7 +14267,7 @@ - + @@ -14277,7 +14303,7 @@ - + @@ -14310,7 +14336,7 @@ - + @@ -14340,7 +14366,7 @@ - + @@ -14380,8 +14406,8 @@ - - + + @@ -14394,8 +14420,8 @@ - - + + @@ -14435,8 +14461,8 @@ - - + + @@ -14448,8 +14474,8 @@ - - + + @@ -14488,8 +14514,8 @@ - - + + @@ -14501,8 +14527,8 @@ - - + + @@ -14523,7 +14549,7 @@ - + @@ -14595,7 +14621,7 @@ - + @@ -14627,9 +14653,9 @@ - - - + + + @@ -14649,7 +14675,7 @@ - + @@ -14660,7 +14686,7 @@ - + @@ -14671,7 +14697,7 @@ - + @@ -14682,7 +14708,7 @@ - + @@ -14693,11 +14719,11 @@ - + - + @@ -14709,7 +14735,6 @@ - @@ -14742,7 +14767,7 @@ - + @@ -14824,8 +14849,8 @@ - - + + @@ -14840,7 +14865,7 @@ - + @@ -14871,8 +14896,8 @@ - - + + @@ -14964,7 +14989,7 @@ - + @@ -14981,8 +15006,8 @@ - - + + @@ -15059,7 +15084,7 @@ - + @@ -15091,7 +15116,7 @@ - + @@ -15124,7 +15149,7 @@ - + @@ -15157,7 +15182,7 @@ - + @@ -15190,7 +15215,7 @@ - + @@ -15223,7 +15248,7 @@ - + @@ -15319,8 +15344,8 @@ - - + + @@ -15412,7 +15437,7 @@ - + @@ -15464,7 +15489,7 @@ - + @@ -15541,7 +15566,7 @@ - + @@ -15555,9 +15580,9 @@ - - - + + + @@ -15673,7 +15698,7 @@ - + @@ -15700,7 +15725,7 @@ - + @@ -15734,11 +15759,11 @@ - - + + - - + + @@ -15816,7 +15841,7 @@ - + @@ -15891,7 +15916,7 @@ - + @@ -15937,8 +15962,8 @@ - - + + @@ -15999,8 +16024,8 @@ - - + + @@ -16070,7 +16095,7 @@ - + @@ -16136,9 +16161,9 @@ - - - + + + @@ -16176,7 +16201,7 @@ - + @@ -16213,7 +16238,7 @@ - + @@ -16222,7 +16247,7 @@ - + @@ -16269,7 +16294,7 @@ - + @@ -16299,7 +16324,7 @@ - + @@ -16392,7 +16417,7 @@ - + @@ -16473,7 +16498,7 @@ - + @@ -16507,9 +16532,9 @@ - - - + + + @@ -16564,8 +16589,8 @@ - - + + @@ -16629,7 +16654,7 @@ - + @@ -16659,7 +16684,7 @@ - + @@ -16716,8 +16741,8 @@ - - + + @@ -16773,7 +16798,7 @@ - + @@ -16857,7 +16882,7 @@ - + @@ -16922,8 +16947,8 @@ - - + + @@ -16966,8 +16991,8 @@ - - + + @@ -16987,7 +17012,7 @@ - + @@ -17021,8 +17046,8 @@ - - + + @@ -17067,7 +17092,7 @@ - + @@ -17098,7 +17123,7 @@ - + @@ -17134,8 +17159,8 @@ - - + + @@ -17180,8 +17205,8 @@ - - + + @@ -17196,8 +17221,8 @@ - - + + @@ -17218,9 +17243,9 @@ - - - + + + @@ -17249,9 +17274,9 @@ - - - + + + @@ -17280,7 +17305,7 @@ - + @@ -17366,7 +17391,7 @@ - + @@ -17430,8 +17455,8 @@ - - + + @@ -17526,8 +17551,8 @@ - - + + @@ -17562,9 +17587,9 @@ - - - + + + @@ -17590,9 +17615,9 @@ - - - + + + @@ -17624,8 +17649,8 @@ - - + + @@ -17641,7 +17666,7 @@ - + @@ -17682,7 +17707,7 @@ - + @@ -17758,9 +17783,9 @@ - - - + + + @@ -17802,8 +17827,8 @@ - - + + @@ -17859,8 +17884,8 @@ - - + + @@ -17910,8 +17935,8 @@ - - + + @@ -17981,8 +18006,8 @@ - - + + @@ -17991,7 +18016,7 @@ - + @@ -18037,8 +18062,8 @@ - - + + @@ -18079,8 +18104,8 @@ - - + + @@ -18116,7 +18141,7 @@ - + @@ -18178,8 +18203,8 @@ - - + + @@ -18222,7 +18247,7 @@ - + @@ -18302,8 +18327,8 @@ - - + + @@ -18716,7 +18741,7 @@ - + @@ -18779,7 +18804,7 @@ - + @@ -18795,7 +18820,7 @@ - + @@ -18804,11 +18829,10 @@ - + - @@ -18821,7 +18845,7 @@ - + @@ -18830,7 +18854,7 @@ - + @@ -18843,7 +18867,7 @@ - + @@ -18856,7 +18880,7 @@ - + @@ -18870,11 +18894,11 @@ - + - + @@ -18890,7 +18914,7 @@ - + @@ -18900,7 +18924,7 @@ - + @@ -18910,7 +18934,7 @@ - + @@ -18920,7 +18944,7 @@ - + @@ -18929,7 +18953,7 @@ - + @@ -18988,7 +19012,7 @@ - + @@ -19250,7 +19274,7 @@ - + @@ -19262,7 +19286,7 @@ - + @@ -19274,7 +19298,7 @@ - + @@ -19286,7 +19310,7 @@ - + @@ -19298,7 +19322,7 @@ - + @@ -19310,7 +19334,7 @@ - + @@ -19323,7 +19347,7 @@ - + @@ -19386,7 +19410,7 @@ - + @@ -19495,7 +19519,7 @@ - + @@ -19522,7 +19546,7 @@ - + @@ -19562,7 +19586,7 @@ - + @@ -19616,7 +19640,7 @@ - + @@ -19637,7 +19661,7 @@ - + @@ -19667,7 +19691,7 @@ - + @@ -19699,7 +19723,7 @@ - + @@ -19733,7 +19757,7 @@ - + @@ -19756,7 +19780,7 @@ - + @@ -19789,7 +19813,7 @@ - + @@ -19807,7 +19831,7 @@ - + @@ -19846,7 +19870,7 @@ - + @@ -19878,7 +19902,7 @@ - + @@ -19918,7 +19942,7 @@ - + @@ -19952,7 +19976,7 @@ - + @@ -20025,8 +20049,8 @@ - - + + @@ -20037,7 +20061,7 @@ - + @@ -20064,7 +20088,7 @@ - + @@ -20150,7 +20174,7 @@ - + @@ -20183,7 +20207,7 @@ - + @@ -20202,8 +20226,8 @@ - - + + @@ -20233,7 +20257,7 @@ - + @@ -20247,9 +20271,9 @@ - - - + + + @@ -20281,8 +20305,8 @@ - - + + @@ -20345,8 +20369,8 @@ - - + + @@ -20387,7 +20411,7 @@ - + @@ -20430,7 +20454,7 @@ - + @@ -20469,7 +20493,7 @@ - + @@ -20510,8 +20534,8 @@ - - + + @@ -20544,7 +20568,7 @@ - + @@ -20584,8 +20608,8 @@ - - + + @@ -20614,7 +20638,7 @@ - + @@ -20644,7 +20668,7 @@ - + @@ -20674,7 +20698,7 @@ - + @@ -20731,8 +20755,8 @@ - - + + @@ -20757,8 +20781,8 @@ - - + + @@ -20784,8 +20808,8 @@ - - + + @@ -20811,8 +20835,8 @@ - - + + @@ -20838,8 +20862,8 @@ - - + + @@ -20865,8 +20889,8 @@ - - + + @@ -20892,8 +20916,8 @@ - - + + @@ -20919,8 +20943,8 @@ - - + + @@ -20946,8 +20970,8 @@ - - + + @@ -20973,8 +20997,8 @@ - - + + @@ -21000,8 +21024,8 @@ - - + + @@ -21147,8 +21171,8 @@ - - + + @@ -21173,7 +21197,7 @@ - + @@ -21199,8 +21223,8 @@ - - + + @@ -21243,8 +21267,8 @@ - - + + @@ -21271,8 +21295,8 @@ - - + + @@ -21291,9 +21315,9 @@ - - - + + + @@ -21322,7 +21346,7 @@ - + @@ -21345,7 +21369,7 @@ - + @@ -21373,7 +21397,7 @@ - + @@ -21417,8 +21441,8 @@ - - + + @@ -21444,9 +21468,9 @@ - - - + + + @@ -21470,8 +21494,8 @@ - - + + @@ -21481,8 +21505,8 @@ - - + + @@ -21493,7 +21517,7 @@ - + @@ -21525,7 +21549,7 @@ - + @@ -21553,7 +21577,7 @@ - + @@ -21586,7 +21610,7 @@ - + @@ -21622,7 +21646,7 @@ - + @@ -21657,7 +21681,7 @@ - + @@ -21693,7 +21717,7 @@ - + @@ -21735,7 +21759,7 @@ - + @@ -21752,7 +21776,7 @@ - + @@ -21779,8 +21803,8 @@ - - + + @@ -21810,7 +21834,7 @@ - + @@ -21848,9 +21872,9 @@ - - - + + + @@ -21881,9 +21905,9 @@ - - - + + + @@ -21916,7 +21940,7 @@ - + @@ -21947,7 +21971,7 @@ - + @@ -21998,7 +22022,7 @@ - + @@ -22010,9 +22034,9 @@ - + - + @@ -22047,7 +22071,7 @@ - + @@ -22062,9 +22086,9 @@ - + - + @@ -22092,7 +22116,7 @@ - + @@ -22125,9 +22149,9 @@ - + - + @@ -22161,7 +22185,7 @@ - + @@ -22177,7 +22201,7 @@ - + @@ -22189,7 +22213,7 @@ - + @@ -22234,7 +22258,7 @@ - + @@ -22292,7 +22316,7 @@ - + @@ -22338,7 +22362,7 @@ - + @@ -22350,7 +22374,7 @@ - + @@ -22408,7 +22432,7 @@ - + @@ -22454,7 +22478,7 @@ - + @@ -22466,7 +22490,7 @@ - + @@ -22511,7 +22535,7 @@ - + @@ -22574,7 +22598,7 @@ - + @@ -22663,7 +22687,7 @@ - + @@ -22675,7 +22699,7 @@ - + @@ -22716,7 +22740,7 @@ - + @@ -22726,7 +22750,7 @@ - + @@ -22768,7 +22792,7 @@ - + @@ -22796,7 +22820,7 @@ - + @@ -22837,7 +22861,7 @@ - + @@ -22848,7 +22872,7 @@ - + @@ -22860,7 +22884,7 @@ - + @@ -22909,7 +22933,7 @@ - + @@ -22968,7 +22992,7 @@ - + @@ -23017,9 +23041,9 @@ - - - + + + @@ -23049,7 +23073,7 @@ - + @@ -23077,7 +23101,7 @@ - + @@ -23104,7 +23128,7 @@ - + @@ -23129,9 +23153,9 @@ - - - + + + @@ -23173,7 +23197,7 @@ - + @@ -23275,7 +23299,7 @@ - + @@ -23289,7 +23313,7 @@ - + @@ -23308,7 +23332,7 @@ - + @@ -23360,7 +23384,7 @@ - + @@ -23392,7 +23416,7 @@ - + @@ -23423,8 +23447,8 @@ - - + + @@ -23485,7 +23509,7 @@ - + @@ -23535,7 +23559,7 @@ - + @@ -23939,7 +23963,7 @@ - + @@ -24091,7 +24115,7 @@ - + @@ -24119,7 +24143,7 @@ - + @@ -24267,7 +24291,7 @@ - + @@ -24280,7 +24304,7 @@ - + @@ -24371,7 +24395,7 @@ - + @@ -24455,7 +24479,7 @@ - + @@ -24571,7 +24595,7 @@ - + @@ -24595,7 +24619,7 @@ - + @@ -24767,7 +24791,7 @@ - + @@ -24799,7 +24823,7 @@ - + @@ -24827,7 +24851,7 @@ - + @@ -24843,7 +24867,7 @@ - + @@ -24855,7 +24879,7 @@ - + @@ -24864,7 +24888,7 @@ - + @@ -24876,7 +24900,7 @@ - + @@ -24892,7 +24916,7 @@ - + @@ -24916,7 +24940,7 @@ - + @@ -24992,8 +25016,8 @@ - - + + @@ -25024,7 +25048,7 @@ - + @@ -25042,7 +25066,7 @@ - + @@ -25069,8 +25093,8 @@ - - + + @@ -25086,8 +25110,8 @@ - - + + @@ -25168,8 +25192,8 @@ - - + + @@ -25282,8 +25306,8 @@ - - + + @@ -25345,10 +25369,10 @@ - + - + @@ -25494,7 +25518,7 @@ - + @@ -25587,7 +25611,7 @@ - + @@ -25658,7 +25682,7 @@ - + @@ -25854,7 +25878,7 @@ - + @@ -25888,7 +25912,7 @@ - + @@ -25916,7 +25940,7 @@ - + @@ -26192,7 +26216,7 @@ - + @@ -26474,7 +26498,7 @@ - + @@ -26608,7 +26632,7 @@ - + @@ -26655,7 +26679,7 @@ - + @@ -26673,7 +26697,7 @@ - + @@ -26684,7 +26708,7 @@ - + @@ -26729,7 +26753,7 @@ - + @@ -26742,8 +26766,8 @@ - - + + @@ -26780,7 +26804,7 @@ - + @@ -26868,7 +26892,7 @@ - + @@ -26918,9 +26942,9 @@ - - - + + + @@ -26950,7 +26974,7 @@ - + @@ -26962,7 +26986,7 @@ - + @@ -26977,7 +27001,7 @@ - + @@ -26998,7 +27022,7 @@ - + @@ -27141,7 +27165,7 @@ - + @@ -27177,7 +27201,7 @@ - + @@ -27225,7 +27249,7 @@ - + @@ -27285,7 +27309,7 @@ - + @@ -27364,7 +27388,7 @@ - + @@ -27445,7 +27469,7 @@ - + @@ -27603,7 +27627,7 @@ - + @@ -27612,7 +27636,7 @@ - + @@ -27660,7 +27684,7 @@ - + @@ -27680,12 +27704,12 @@ - + - + - + @@ -27699,7 +27723,7 @@ - + @@ -27805,10 +27829,10 @@ - + - + @@ -27938,9 +27962,9 @@ - + - + @@ -27951,7 +27975,7 @@ - + @@ -27973,7 +27997,7 @@ - + @@ -28084,7 +28108,7 @@ - + @@ -28166,7 +28190,7 @@ - + @@ -28278,7 +28302,7 @@ - + @@ -28297,8 +28321,8 @@ - - + + @@ -28345,7 +28369,7 @@ - + @@ -28366,7 +28390,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Teleportation.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Teleportation.stats index e7d85bd1..4eb612dd 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Teleportation.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Teleportation.stats @@ -7,7 +7,7 @@ - + @@ -35,31 +35,96 @@ - - - - + + + + - - - + + + - + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Throw.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Throw.stats index 0f62817f..8368694a 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Throw.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Throw.stats @@ -21,8 +21,8 @@ - - + + @@ -33,7 +33,7 @@ - + @@ -83,7 +83,7 @@ - + @@ -140,7 +140,7 @@ - + @@ -149,7 +149,7 @@ - + @@ -169,8 +169,8 @@ - - + + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Wall.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Wall.stats index 0eeba39b..3459eac0 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Wall.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Wall.stats @@ -35,8 +35,8 @@ - - + + @@ -71,8 +71,8 @@ - - + + @@ -115,8 +115,8 @@ - - + + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Zone.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Zone.stats index 1322b5f3..145910f9 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Zone.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/SpellData/Zone.stats @@ -74,7 +74,7 @@ - + @@ -121,7 +121,7 @@ - + @@ -146,7 +146,7 @@ - + @@ -161,7 +161,7 @@ - + @@ -184,7 +184,7 @@ - + @@ -279,7 +279,7 @@ - + @@ -299,7 +299,7 @@ - + @@ -319,7 +319,7 @@ - + @@ -339,7 +339,7 @@ - + @@ -359,7 +359,7 @@ - + @@ -541,7 +541,7 @@ - + @@ -575,7 +575,7 @@ - + @@ -594,7 +594,7 @@ - + @@ -838,7 +838,7 @@ - + @@ -1142,7 +1142,7 @@ - + @@ -1179,7 +1179,7 @@ - + @@ -1265,7 +1265,7 @@ - + @@ -1295,7 +1295,7 @@ - + @@ -1395,7 +1395,7 @@ - + @@ -1493,7 +1493,7 @@ - + @@ -1516,7 +1516,7 @@ - + @@ -1527,7 +1527,7 @@ - + @@ -1538,7 +1538,7 @@ - + @@ -1549,7 +1549,7 @@ - + @@ -1560,7 +1560,7 @@ - + @@ -1592,7 +1592,7 @@ - + @@ -1652,7 +1652,7 @@ - + @@ -1713,7 +1713,7 @@ - + @@ -1794,7 +1794,7 @@ - + @@ -1863,7 +1863,7 @@ - + @@ -1929,7 +1929,7 @@ - + @@ -2031,7 +2031,7 @@ - + @@ -2082,7 +2082,7 @@ - + @@ -2120,7 +2120,7 @@ - + @@ -2158,7 +2158,7 @@ - + @@ -2197,7 +2197,7 @@ - + @@ -2239,7 +2239,7 @@ - + @@ -2282,7 +2282,7 @@ - + @@ -2317,7 +2317,7 @@ - + @@ -2354,7 +2354,7 @@ - + @@ -2390,7 +2390,7 @@ - + @@ -2428,7 +2428,7 @@ - + @@ -2463,7 +2463,7 @@ - + @@ -2501,7 +2501,7 @@ - + @@ -2536,7 +2536,7 @@ - + @@ -2676,7 +2676,7 @@ - + @@ -2719,7 +2719,7 @@ - + @@ -2752,7 +2752,7 @@ - + @@ -2785,7 +2785,7 @@ - + @@ -2818,7 +2818,7 @@ - + @@ -2851,7 +2851,7 @@ - + @@ -2884,7 +2884,7 @@ - + @@ -2917,7 +2917,7 @@ - + @@ -2950,7 +2950,7 @@ - + @@ -2983,7 +2983,7 @@ - + @@ -3016,7 +3016,7 @@ - + @@ -3042,7 +3042,7 @@ - + @@ -3063,7 +3063,7 @@ - + @@ -3084,7 +3084,7 @@ - + @@ -3105,7 +3105,7 @@ - + @@ -3126,7 +3126,7 @@ - + @@ -3147,7 +3147,7 @@ - + @@ -3168,7 +3168,7 @@ - + @@ -3189,7 +3189,7 @@ - + @@ -3210,7 +3210,7 @@ - + @@ -3231,7 +3231,7 @@ - + @@ -3516,7 +3516,7 @@ - + @@ -3549,7 +3549,7 @@ - + @@ -3595,7 +3595,7 @@ - + @@ -3661,7 +3661,7 @@ - + @@ -3704,7 +3704,7 @@ - + @@ -3746,7 +3746,7 @@ - + @@ -3772,7 +3772,7 @@ - + @@ -3810,7 +3810,7 @@ - + @@ -3847,7 +3847,7 @@ - + @@ -3887,7 +3887,7 @@ - + @@ -3924,7 +3924,7 @@ - + @@ -4017,7 +4017,7 @@ - + @@ -4167,7 +4167,7 @@ - + @@ -4296,7 +4296,7 @@ - + @@ -4394,7 +4394,7 @@ - + @@ -4483,7 +4483,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Character.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Character.stats index 97a96f34..3de642d1 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Character.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Character.stats @@ -18,7 +18,7 @@ - + @@ -343,7 +343,7 @@ - + @@ -625,7 +625,7 @@ - + @@ -849,7 +849,7 @@ - + @@ -2722,7 +2722,7 @@ - + @@ -2863,7 +2863,7 @@ - + @@ -3502,7 +3502,7 @@ - + @@ -3664,7 +3664,7 @@ - + @@ -4147,7 +4147,7 @@ - + @@ -4550,7 +4550,7 @@ - + @@ -4844,7 +4844,7 @@ - + @@ -4976,7 +4976,7 @@ - + @@ -5212,7 +5212,7 @@ - + @@ -5441,7 +5441,7 @@ - + @@ -5453,7 +5453,7 @@ - + @@ -5468,7 +5468,7 @@ - + @@ -5477,7 +5477,7 @@ - + @@ -5497,7 +5497,7 @@ - + @@ -5537,7 +5537,7 @@ - + @@ -5590,7 +5590,7 @@ - + @@ -5641,7 +5641,7 @@ - + @@ -5656,7 +5656,7 @@ - + @@ -5679,7 +5679,7 @@ - + @@ -5713,7 +5713,7 @@ - + @@ -5769,7 +5769,7 @@ - + @@ -5821,7 +5821,7 @@ - + @@ -5837,7 +5837,7 @@ - + @@ -5857,7 +5857,7 @@ - + @@ -5875,7 +5875,7 @@ - + @@ -5892,7 +5892,7 @@ - + @@ -5912,7 +5912,7 @@ - + @@ -5929,7 +5929,7 @@ - + @@ -5946,7 +5946,7 @@ - + @@ -5964,7 +5964,7 @@ - + @@ -5994,7 +5994,7 @@ - + @@ -6218,7 +6218,7 @@ - + @@ -6357,7 +6357,7 @@ - + @@ -6677,7 +6677,7 @@ - + @@ -6696,7 +6696,7 @@ - + @@ -7423,7 +7423,7 @@ - + @@ -8017,7 +8017,7 @@ - + @@ -8641,7 +8641,7 @@ - + @@ -8659,7 +8659,7 @@ - + @@ -8787,7 +8787,7 @@ - + @@ -9055,7 +9055,7 @@ - + @@ -9691,7 +9691,7 @@ - + @@ -10493,7 +10493,7 @@ - + @@ -10508,7 +10508,7 @@ - + @@ -10555,7 +10555,7 @@ - + @@ -10767,7 +10767,7 @@ - + @@ -10819,7 +10819,7 @@ - + @@ -10896,7 +10896,7 @@ - + @@ -10980,7 +10980,7 @@ - + @@ -11198,7 +11198,7 @@ - + @@ -11225,7 +11225,7 @@ - + @@ -11315,7 +11315,7 @@ - + @@ -11332,7 +11332,7 @@ - + @@ -11348,7 +11348,7 @@ - + @@ -11466,7 +11466,7 @@ - + @@ -11493,7 +11493,7 @@ - + @@ -11533,7 +11533,7 @@ - + @@ -11549,7 +11549,7 @@ - + @@ -11912,7 +11912,7 @@ - + @@ -11994,7 +11994,7 @@ - + @@ -12313,7 +12313,7 @@ - + @@ -12653,7 +12653,7 @@ - + @@ -12673,7 +12673,7 @@ - + @@ -13136,7 +13136,7 @@ - + @@ -13353,7 +13353,7 @@ - + @@ -13367,7 +13367,7 @@ - + @@ -13390,7 +13390,7 @@ - + @@ -13407,7 +13407,7 @@ - + @@ -13437,7 +13437,7 @@ - + @@ -13526,7 +13526,7 @@ - + @@ -13560,7 +13560,7 @@ - + @@ -13595,7 +13595,7 @@ - + @@ -13765,7 +13765,7 @@ - + @@ -13777,7 +13777,7 @@ - + @@ -13813,7 +13813,7 @@ - + @@ -13985,7 +13985,7 @@ - + @@ -14035,7 +14035,7 @@ - + @@ -14065,7 +14065,7 @@ - + @@ -14198,7 +14198,7 @@ - + @@ -14207,7 +14207,7 @@ - + @@ -14410,7 +14410,7 @@ - + @@ -15632,7 +15632,7 @@ - + @@ -15646,7 +15646,7 @@ - + @@ -15796,7 +15796,7 @@ - + @@ -16325,7 +16325,7 @@ - + @@ -16549,7 +16549,7 @@ - + @@ -16613,7 +16613,7 @@ - + @@ -16913,7 +16913,7 @@ - + @@ -16930,7 +16930,7 @@ - + @@ -17535,7 +17535,7 @@ - + @@ -18069,7 +18069,7 @@ - + @@ -18137,7 +18137,7 @@ - + @@ -18355,7 +18355,7 @@ - + @@ -18555,7 +18555,7 @@ - + @@ -19483,7 +19483,7 @@ - + @@ -19527,7 +19527,7 @@ - + @@ -20069,7 +20069,7 @@ - + @@ -20126,7 +20126,7 @@ - + @@ -20202,7 +20202,7 @@ - + @@ -20651,7 +20651,7 @@ - + @@ -20698,7 +20698,7 @@ - + @@ -20876,7 +20876,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Interrupt.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Interrupt.stats index 4ec79daf..0dc4e35a 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Interrupt.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Interrupt.stats @@ -26,7 +26,7 @@ - + @@ -142,6 +142,22 @@ + + + + + + + + + + + + + + + + @@ -294,7 +310,7 @@ - + @@ -383,7 +399,7 @@ - + @@ -415,7 +431,7 @@ - + @@ -537,7 +553,7 @@ - + @@ -604,7 +620,7 @@ - + @@ -690,7 +706,7 @@ - + @@ -759,7 +775,7 @@ - + @@ -792,7 +808,7 @@ - + @@ -1106,7 +1122,7 @@ - + @@ -1147,7 +1163,7 @@ - + @@ -1413,8 +1429,8 @@ - - + + @@ -1436,7 +1452,7 @@ - + @@ -1724,7 +1740,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Passive.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Passive.stats index ad867b43..5d419293 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Passive.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Passive.stats @@ -62,7 +62,7 @@ - + @@ -118,12 +118,13 @@ - - - - - - + + + + + + + @@ -954,6 +955,19 @@ + + + + + + + + + + + + + @@ -1028,10 +1042,10 @@ - + - + @@ -1601,13 +1615,14 @@ - + - + + @@ -2797,7 +2812,7 @@ - + @@ -3358,7 +3373,7 @@ - + @@ -3439,7 +3454,7 @@ - + @@ -3773,11 +3788,12 @@ - + - + + @@ -3796,7 +3812,7 @@ - + @@ -3841,7 +3857,7 @@ - + @@ -3979,6 +3995,7 @@ + @@ -3987,6 +4004,7 @@ + @@ -3995,6 +4013,7 @@ + @@ -4123,13 +4142,14 @@ - + + @@ -4244,7 +4264,7 @@ - + @@ -4511,7 +4531,7 @@ - + @@ -4525,7 +4545,7 @@ - + @@ -5790,7 +5810,7 @@ - + @@ -7718,7 +7738,7 @@ - + @@ -8406,6 +8426,15 @@ + + + + + + + + + @@ -9362,9 +9391,10 @@ - + + @@ -9669,8 +9699,9 @@ - + + @@ -10433,8 +10464,8 @@ - - + + @@ -10443,8 +10474,8 @@ - - + + @@ -11207,7 +11238,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Weapon.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Weapon.stats index 4170d705..8b7f04d1 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Weapon.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Stats/Weapon.stats @@ -1,6 +1,27 @@  + + + + + + + + + + + + + + + + + + + + + @@ -80,10 +101,10 @@ - + - + @@ -115,7 +136,7 @@ - + @@ -189,7 +210,7 @@ - + @@ -222,11 +243,11 @@ - + - + @@ -244,11 +265,11 @@ - + - + @@ -290,11 +311,11 @@ - + - + @@ -325,11 +346,11 @@ - + - + @@ -337,7 +358,7 @@ - + @@ -418,7 +439,7 @@ - + @@ -503,11 +524,11 @@ - + - + @@ -560,11 +581,11 @@ - + - + @@ -1471,7 +1492,7 @@ - + @@ -3187,7 +3208,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/StatusData/Status_BOOST.stats b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/StatusData/Status_BOOST.stats index ca597f4c..a0f1d4c5 100644 --- a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/StatusData/Status_BOOST.stats +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/StatusData/Status_BOOST.stats @@ -1723,9 +1723,9 @@ - + - + @@ -1735,9 +1735,9 @@ - + - + @@ -1747,9 +1747,9 @@ - + - + @@ -1759,9 +1759,9 @@ - + - + @@ -1773,7 +1773,7 @@ - + @@ -1783,9 +1783,9 @@ - + - + @@ -1796,10 +1796,10 @@ - + - + @@ -2162,13 +2162,21 @@ - - + + + + + + + + + + @@ -2212,7 +2220,7 @@ - + @@ -2235,6 +2243,16 @@ + + + + + + + + + + @@ -2784,14 +2802,14 @@ - + - + @@ -3596,7 +3614,7 @@ - + @@ -3840,7 +3858,7 @@ - + @@ -4202,7 +4220,7 @@ - + @@ -4221,7 +4239,7 @@ - + @@ -4239,7 +4257,7 @@ - + @@ -4291,7 +4309,7 @@ - + @@ -4311,7 +4329,7 @@ - + @@ -4330,7 +4348,7 @@ - + @@ -4368,7 +4386,7 @@ - + @@ -4386,7 +4404,7 @@ - + @@ -4403,7 +4421,7 @@ - + @@ -4442,7 +4460,7 @@ - + @@ -4469,7 +4487,7 @@ - + @@ -4515,11 +4533,10 @@ - - + - + @@ -4541,6 +4558,7 @@ + @@ -4549,10 +4567,11 @@ - + + @@ -4590,7 +4609,7 @@ - + @@ -4669,7 +4688,7 @@ - + @@ -4703,7 +4722,7 @@ - + @@ -4712,8 +4731,8 @@ - - + + @@ -4767,7 +4786,7 @@ - + @@ -4837,7 +4856,7 @@ - + @@ -5139,22 +5158,12 @@ - - + + - - - - - - - - - - @@ -5180,17 +5189,18 @@ - + - + + @@ -5243,7 +5253,7 @@ - + @@ -5332,10 +5342,11 @@ - + + @@ -5491,7 +5502,7 @@ - + @@ -5504,7 +5515,7 @@ - + @@ -5594,7 +5605,7 @@ - + @@ -5607,7 +5618,7 @@ - + @@ -5616,7 +5627,7 @@ - + @@ -5625,7 +5636,7 @@ - + @@ -5634,7 +5645,7 @@ - + @@ -5643,7 +5654,7 @@ - + @@ -5652,7 +5663,7 @@ - + @@ -5661,7 +5672,7 @@ - + @@ -5670,7 +5681,7 @@ - + @@ -5679,7 +5690,7 @@ - + @@ -5724,7 +5735,7 @@ - + @@ -5733,7 +5744,7 @@ - + @@ -5742,7 +5753,7 @@ - + @@ -5751,7 +5762,7 @@ - + @@ -5760,7 +5771,7 @@ - + @@ -5793,7 +5804,7 @@ - + @@ -5807,7 +5818,7 @@ - + @@ -5816,7 +5827,7 @@ - + @@ -5825,7 +5836,7 @@ - + @@ -5834,7 +5845,7 @@ - + @@ -5843,7 +5854,7 @@ - + @@ -5852,7 +5863,7 @@ - + @@ -5861,7 +5872,7 @@ - + @@ -5870,7 +5881,7 @@ - + @@ -5879,7 +5890,7 @@ - + @@ -5970,7 +5981,7 @@ - + @@ -6030,7 +6041,7 @@ - + @@ -6124,7 +6135,7 @@ - + @@ -6137,7 +6148,7 @@ - + @@ -6146,7 +6157,7 @@ - + @@ -6155,7 +6166,7 @@ - + @@ -6164,7 +6175,7 @@ - + @@ -6173,7 +6184,7 @@ - + @@ -6182,7 +6193,7 @@ - + @@ -6191,7 +6202,7 @@ - + @@ -6200,7 +6211,7 @@ - + @@ -6209,7 +6220,7 @@ - + @@ -6600,12 +6611,12 @@ - + - + @@ -6620,7 +6631,7 @@ - + @@ -6632,7 +6643,7 @@ - + @@ -6644,7 +6655,7 @@ - + @@ -6672,9 +6683,9 @@ - + - + @@ -6848,7 +6859,7 @@ - + @@ -6902,7 +6913,7 @@ - + @@ -7113,7 +7124,7 @@ - + @@ -7744,8 +7755,8 @@ - - + + @@ -7787,7 +7798,7 @@ - + @@ -8367,7 +8378,7 @@ - + @@ -8541,7 +8552,7 @@ - + @@ -8600,7 +8611,7 @@ - + @@ -8663,7 +8674,7 @@ - + @@ -9162,7 +9173,7 @@ - + @@ -9415,7 +9426,7 @@ - + @@ -9435,6 +9446,7 @@ + @@ -9479,7 +9491,7 @@ - + @@ -10085,12 +10097,13 @@ - - + + + @@ -10171,7 +10184,7 @@ - + @@ -10181,14 +10194,14 @@ - - + + - + @@ -10211,7 +10224,7 @@ - + @@ -10245,7 +10258,7 @@ - + @@ -10289,7 +10302,7 @@ - + @@ -10304,7 +10317,7 @@ - + @@ -10316,7 +10329,7 @@ - + @@ -10325,7 +10338,7 @@ - + @@ -10334,7 +10347,7 @@ - + @@ -10470,12 +10483,12 @@ - + - - + + @@ -10486,7 +10499,7 @@ - + @@ -10499,11 +10512,11 @@ - + - - + + @@ -10673,8 +10686,9 @@ - + + @@ -11398,7 +11412,7 @@ - + @@ -12068,7 +12082,7 @@ - + @@ -12084,7 +12098,7 @@ - + @@ -12136,7 +12150,7 @@ - + @@ -12730,7 +12744,7 @@ - + @@ -12762,7 +12776,7 @@ - + @@ -12779,7 +12793,7 @@ - + @@ -12825,7 +12839,7 @@ - + @@ -12852,7 +12866,7 @@ - + @@ -12876,7 +12890,7 @@ - + @@ -12929,7 +12943,7 @@ - + @@ -13042,7 +13056,7 @@ - + @@ -13168,11 +13182,10 @@ - + - @@ -13184,11 +13197,22 @@ - - + + + + + + + + + + + + + @@ -13270,13 +13294,13 @@ - + - - + + @@ -13292,7 +13316,7 @@ - + @@ -13303,7 +13327,7 @@ - + @@ -13319,9 +13343,9 @@ - + - + @@ -13337,7 +13361,7 @@ - + @@ -13351,7 +13375,7 @@ - + @@ -13395,7 +13419,7 @@ - + @@ -13584,7 +13608,7 @@ - + @@ -13598,7 +13622,7 @@ - + @@ -14191,11 +14215,12 @@ - + - + + @@ -14625,9 +14650,10 @@ - - + + + @@ -14693,7 +14719,7 @@ - + @@ -14712,11 +14738,11 @@ - + - - + + @@ -14883,7 +14909,7 @@ - + diff --git a/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/TooltipExtras/TooltipUpcastDescriptions.tbl b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/TooltipExtras/TooltipUpcastDescriptions.tbl new file mode 100644 index 00000000..265e9cd1 --- /dev/null +++ b/Editor/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/TooltipExtras/TooltipUpcastDescriptions.tbl @@ -0,0 +1,13 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Localization/English/english.xml b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Localization/English/english.xml index eec15dfe..c7d25193 100644 --- a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Localization/English/english.xml +++ b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Localization/English/english.xml @@ -684,7 +684,7 @@ Lesser Restoration Cure a creature from disease, poison, paralysis or blindness. Tailwind - 2 Actions<br>Duration 1 hour<br>The wind at your back pushes you to find new horizons. You gain a +10-foot status bonus to your Speed. + The wind at your back pushes you to find new horizons. You gain a [1] status bonus to your Speed for 1 hour. Increase two creatures' <LSTag Tooltip="MovementSpeed">movement speed</LSTag> by [1]. Tailwind Increase three creatures' <LSTag Tooltip="MovementSpeed">movement speed</LSTag> by [1]. @@ -1969,7 +1969,7 @@ Disarmed Affected entity has dropped its weapon to the ground. Crane Stance - 1 Action <br> Your arms flutter like a crane’s wings. You gain a +1 circumstance bonus to AC, but the only Strikes you can make are crane wing attacks. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, finesse, nonlethal, and unarmed traits. While in Crane Stance, reduce the DC for High Jump and Long Jump by 5, and when you Leap, you can move an additional 5 feet horizontally or 2 feet vertically. + 1 Action <br> Your arms flutter like a crane’s wings. You gain a +1 circumstance bonus to AC, but the only Strikes you can make are crane wing attacks. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, finesse, nonlethal, and unarmed traits. While in Crane Stance, reduce the DC for High Jump and Long Jump by [1], and when you Leap, you can move an additional 5 feet horizontally or 2 feet vertically. Crane Stance 1 Action <br> <b>Prerequisites You are unarmored <b> Your arms flutter like a crane’s wings. You gain a +1 circumstance bonus to AC, but the only Strikes you can make are crane wing attacks. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, finesse, nonlethal, and unarmed traits. While in Crane Stance, reduce the DC for High Jump and Long Jump by 5, and when you Leap, you can move an additional 5 feet horizontally or 2 feet vertically. Martial Arts: Bonus Unarmed Strike @@ -2027,7 +2027,7 @@ Monastic Archer Stance 1 Action <br><b>Requirements<b> You are unarmored and wielding a longbow, a shortbow, or a bow with the monk trait. <br>You enter a specialized stance for a unique martial art centered around the use of a bow. While in this stance, the only Strikes you can make are those using longbows, shortbows, or bows with the monk trait. You can use Flurry of Blows with these bows. You can use your other monk feats or monk abilities that normally require unarmed attacks with these bows when attacking within half the first range increment (normally 50 feet for a longbow and 30 feet for a shortbow), so long as the feat or ability doesn’t require a single, specific Strike Monastic Archer Stance - 1 Action <br><b>Requirements<b> You are unarmored and wielding a longbow, a shortbow, or a bow with the monk trait. <br>You enter a specialized stance for a unique martial art centered around the use of a bow. While in this stance, the only Strikes you can make are those using longbows, shortbows, or bows with the monk trait. You can use Flurry of Blows with these bows. You can use your other monk feats or monk abilities that normally require unarmed attacks with these bows when attacking within half the first range increment (normally 50 feet for a longbow and 30 feet for a shortbow), so long as the feat or ability doesn’t require a single, specific Strike + 1 Action <br><b>Requirements<b> You are unarmored and wielding a longbow, a shortbow, or a bow with the monk trait. <br>You enter a specialized stance for a unique martial art centered around the use of a bow. While in this stance, the only Strikes you can make are those using longbows, shortbows, or bows with the monk trait. You can use Flurry of Blows with these bows. You can use your other monk feats or monk abilities that normally require unarmed attacks with these bows, so long as the feat or ability doesn’t require a single, specific Strike Monastic Archer Flurry Monastic Archer Stance 1 Action <br><b>Requirements<b> You are unarmored and wielding a longbow, a shortbow, or a bow with the monk trait. <br>You enter a specialized stance for a unique martial art centered around the use of a bow. While in this stance, the only Strikes you can make are those using longbows, shortbows, or bows with the monk trait. You can use Flurry of Blows with these bows. You can use your other monk feats or monk abilities that normally require unarmed attacks with these bows when attacking within half the first range increment (normally 50 feet for a longbow and 30 feet for a shortbow), so long as the feat or ability doesn’t require a single, specific Strike @@ -2058,7 +2058,7 @@ Flurry of Maneuvers Your flurry is a combination of maneuvers. You can replace one or both of your attacks during a Flurry of Blows with Grapples, Repositions, Shoves, or Trips Flying Kick - 2 Actions <br> You launch yourself at a foe. Make a Leap or attempt a High Jump or Long Jump. At the end of the jump, if you’re adjacent to a foe, you can immediately Strike that foe with an unarmed attack, even if the foe is in midair. You fall to the ground after the Strike. If the distance you fall is no more than the height of your jump, you land upright and take no damage. + 2 Actions <br> You launch yourself at a foe. Make a Leap or attempt a High Jump or Long Jump. At the end of the jump, if you’re adjacent to a foe, you can immediately Strike that foe with an unarmed attack. * Harmonize Self * You heal yourself. You regain 8 Hit Points. <br><b>Heightened (+1)<b> If you choose to regain Hit Points, the Hit Points regained increase by 8. * Qi Blast * @@ -2096,7 +2096,7 @@ Wolf Jaw Wolf Jaw Dancing Leaf - You increase your Leap distance by 5 and no longer take falling damage. + You increase your Leap distance by [1] and no longer take falling damage. Qi Blast (1 action) Deal [1] force damage in a 15-foot cone. Qi Blast (2 actions) @@ -2104,7 +2104,7 @@ Qi Blast (3 actions) Deal [1] force damage in a 60-foot cone. Shrink the Span - Teleport yourself to a place you can see. + Teleport yourself to a place you can see within [1]. Dimension Door You instantly transport yourself and any items you're wearing and holding from your current space to an unoccupied space within range you can see. If this would bring another creature with you—even if you're carrying it in an extradimensional container—the spell is lost. Deflect Projectile @@ -3280,7 +3280,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Quick Shield Block You can bring your shield into place with hardly a thought. At the start of each of your turns, you gain an additional reaction that you can use only to Shield Block. Sudden Leap - 2 Actions <br>You make an impressive leap and swing while you soar. Make a Leap, High Jump, or Long Jump and attempt one melee Strike. Immediately after the Strike, you fall to the ground if you’re in the air, even if you haven’t reached the maximum distance of your jump. You take half of normal falling damage during this activity. + You make an impressive leap and swing while you soar. Make a Leap, High Jump, or Long Jump and attempt one melee Strike. Agile Grace Your graceful moves with agile weapons are beyond compare. Your multiple attack penalty with agile weapons and agile unarmed attacks becomes –3 for your second attack and –6 for subsequent attacks (rather than –4 and –8). Certain Strike @@ -3866,12 +3866,12 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Tangled Forest Stance Requirements You are unarmored<br>You extend your arms like gnarled branches to interfere with your foes' movements. You can make lashing branch unarmed attacks. These deal 1d8 slashing damage; are in the brawling group; and have the agile, finesse, nonlethal, and unarmed traits.<br>While you're in Tangled Forest Stance and can act, every enemy in your reach that tries to move away from you must succeed at a Reflex save, Acrobatics check, or Athletics check against your class DC or be immobilized for that action. * Wild Winds Stance * - 1 Action<br>Focus, Stance<br>You take on the stance of the flowing winds, sending out waves of energy at a distance. You can make wind crash unarmed Strikes as ranged Strikes against targets within 30 feet. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, nonlethal, propulsive, and unarmed traits. Wind crash Strikes ignore concealment and all cover. + 1 Action<br>Focus, Stance<br>You take on the stance of the flowing winds, sending out waves of energy at a distance. You can make wind crash unarmed Strikes as ranged Strikes against targets within [1]. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, nonlethal, propulsive, and unarmed traits. Wind crash Strikes ignore concealment and all cover. Wild Winds Stance 1 Action<br>Focus, Stance<br>You take on the stance of the flowing winds, sending out waves of energy at a distance. You can make wind crash unarmed Strikes as ranged Strikes against targets within 30 feet. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, nonlethal, propulsive, and unarmed traits. Wind crash Strikes ignore concealment and all cover. Wind Crash Wild Winds Stance - 1 Action<br>Focus, Stance<br>You take on the stance of the flowing winds, sending out waves of energy at a distance. You can make wind crash unarmed Strikes as ranged Strikes against targets within 30 feet. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, nonlethal, propulsive, and unarmed traits. Wind crash Strikes ignore concealment and all cover. + 1 Action<br>Focus, Stance<br>You take on the stance of the flowing winds, sending out waves of energy at a distance. You can make wind crash unarmed Strikes as ranged Strikes against targets within [1]. These deal 1d6 bludgeoning damage; are in the brawling group; and have the agile, nonlethal, propulsive, and unarmed traits. Wind crash Strikes ignore concealment and all cover. Cobra Envenom 1 Action<br>Frequency once per minute<br>Prerequisites Cobra Stance<br>Requirements You are in Cobra Stance<br>You slightly dislocate your joints to lash out with devious intent and the power to envenom your foe. Make a cobra fang Strike. Your reach with this Strike is 5 feet greater than normal. If this Strike hits, the persistent poison damage from your venomous trait increases to 1d4 persistent poison damage per weapon damage die. Knockback Strike @@ -4288,7 +4288,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Create an illusory wall that blocks line of sight, but not movement. Helpful Steps Animated Assault (Sustain) - Cloud of Daggers + Cloud of Daggers Animated Assault Animated Assault (Sustain) Sustaining this spell. @@ -5154,7 +5154,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Spike Stones 3 Actions<br>Range 60 feet<br>Area 20-foot burst<br>Duration 1 hour<br>Long, sharp spikes of solid rock thrust up from the ground in the area. The area becomes difficult terrain and hazardous terrain. A creature that moves on the ground through the area takes 2d4 piercing damage for every square of that area it moves into. Darkvision - Grant a creature the ability to see in the dark out to a range of [1]. + Grant a creature the ability to see in the dark. Heal (2 Action) You channel vital energy to heal the living [1] + [2] Hit Points. The number of actions you spend when Casting this Spell determines its targets, range, area, and other parameters. <br>[one-action] The spell has a range of touch. Harm (2 Action) @@ -5290,7 +5290,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Animated Assault Conjure a chaotic flurry of debris. The assault deals [1] when cast, and [2] when sustained. Darkvision - Grant a creature the ability to see in the dark out to a range of [1]. + Grant a creature the ability to see in the dark. Elf Wood Elf Drow @@ -5504,7 +5504,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Quicken Time You speed up the time stream in an area, stretching and pulling it until time flows swift and wild. Any creature that begins its turn in the area is quickened and can use the extra action each round to Stride or Strike. Unfortunately, speeding up time is much more difficult than slowing it down, and the effect is uneven and jittery, making accuracy between times painfully difficult; creatures inside the area are concealed to those outside it, and vice versa. Repelling Pulse - 2 Actions<br>You unleash a powerful pulse of telekinetic power, and the pulse violently hurls creatures away from you. Each creature in the area takes 7d10 force damage depending on its Reflex save.<br>Success The creature takes half damage.<br>Failure The creature takes full damage and is pushed 10 feet away from you. + 2 Actions<br>You unleash a powerful pulse of telekinetic power, and the pulse violently hurls creatures away from you. Each creature in the area takes 7d10 force damage depending on its Reflex save.<br>Success The creature takes half damage.<br>Failure The creature takes full damage and is pushed [1] away from you. Rip The Spirit (3 Actions) You supernaturally rip the spirit from a living creature's body, dooming the target to pain and death. The target takes 5d6 negative damage, depending on its basic Fortitude save, and is drained 1 if it fails its save. The spell's effect is based on how many actions you spend when Casting the Spell.<br>The spell targets all living creatures in a 30-foot emanation. Ancestral Resistance (Acid) @@ -6003,7 +6003,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo 2 Actions<br>Overflow<br>A fusillade of jagged splinters flies from you. Creatures in a 30-foot cone take 1d4 piercing damage and 1d4 persistent bleed damage with a basic Reflex save against your class DC.<br>Level (+2) Each type of damage increases by 1d4. 2 Actions<br>Jagged metal shards form in the air and lash out from you. You choose shards or spines, which changes the area, damage type, and critical failure effect. Each creature in the area attempts a basic Reflex save against your class DC. Shards deal 1d6 slashing damage in a 15-foot cone, and a creature that critically fails takes 1d6 persistent bleed damage. Spines deal 1d6 piercing damage in a 30-foot line, and a creature that critically fails is clumsy 1 until the start of your next turn.<br>Level (+2) The damage increases by 1d6. 2 Actions<br>With an emphatic gesture, you create waves that rush out from you in the shape of your hands. You form one 30-foot cone. Each creature in a wave takes 1d8 bludgeoning damage with a basic Reflex save against your class DC - 2 Actions<br>A condensed burst of flame shoots behind you, propelling you forward with its sheer force. Stride up to 40 feet in a straight line. Movement from this impulse ignores difficult terrain and doesn't trigger reactions.<br>Level (6th) The maximum distance of the Stride is 60 feet. You can choose to Leap up to 40 feet in any direction instead of Striding. If you're in the air at the end of this Leap, you fall normally. + 2 Actions<br>A condensed burst of flame shoots behind you, propelling you forward with its sheer force. Stride up to [1] in a straight line. Movement from this impulse ignores difficult terrain and doesn't trigger reactions.<br>Level (6th) The maximum distance of the Stride is [2]. You can choose to Leap in any direction instead of Striding. 3 Actions<br>Overflow<br>Small pieces of metal fly from you, propelled with magnetism at great velocity. Make ranged impulse attack rolls against up to three creatures within 60 feet of you; you gain a +1 circumstance bonus to your attack roll against any target wearing metal armor or made of metal. All three attacks count toward your multiple attack penalty, but it doesn't increase until after all the attacks. The metal pieces deal 1d4 bludgeoning damage and 1d4 piercing damage on a hit (or double damage on a critical hit).<br>Level (+2) Each type of damage increases by 1d4. Reaction<br>Trigger You would take acid, bludgeoning, fire, or slashing damage from an enemy's attack, spell, or other hostile effect<br>A cascade of water blunts or disperses the incoming attack. You gain resistance to damage from the triggering effect equal to your level if it's bludgeoning or slashing, or double your level if it's acid or fire damage. If the effect deals more than one applicable type of damage, apply the highest resistance, but apply it only once. 2 Actions<br>Mimicking the anemoi—monarchs of the four winds—you propel four creatures. Target up to four willing creatures within 30 feet of you. Each of those creatures can take a free Stride action on their turn. @@ -6319,7 +6319,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Lightning Rod 3 Actions<br>You smash a metal rod into your foe and call lightning to it. Attempt a 2-action melee or ranged Elemental Blast using the metal element. On a hit, the target takes an additional 1d12 electricity damage and is skewered with a metal rod, which gives it a –1 circumstance penalty to AC and saves against electricity; the penalty is –2 if the creature also has the metal trait, is made of metal, or is wearing metal armor. The creature can attempt to pull the rod free using an Interact action, but must succeed at a DC 10 Athletics check. Flinging Updraft - 2 Actions<br>A speeding wind heeds your call, picking someone up and depositing them nearby. Choose a creature within 60 feet of you. The target jumps in any direction, up to a maximum of 30 feet. If the target doesn't land on a space of solid ground within 30 feet of where it started, it falls unless it has a fly Speed but doesn't take any damage from the fall. You choose the distance and direction of the jump.<br>If you target an unwilling creature, it attempts a Reflex save against your class DC with the following results.<br>Failure You make the creature jump up to half the maximum distance. + 2 Actions<br>A speeding wind heeds your call, picking someone up and depositing them nearby. Choose a creature within [1] of you. The target jumps in any direction, up to a maximum of [2]. You choose the distance and direction of the jump.<br>If you target an unwilling creature, it attempts a Reflex save against your class DC. On a failure the creature jumps to half the distance, and on a critical failure jumps the entire distance. Fireball A roaring blast of fire detonates at a spot you designate, dealing 6d6 fire damage. Fireball Test @@ -6341,7 +6341,7 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Loose Time's Arrow 2 Actions<br>Range 30 feet<br>Targets up to 6 creatures<br>Duration until the end of your next turn<br>You pluck the time stream like a bow—pull one string back, release, and watch a creature fly. All affected targets are quickened. They can use the extra action onlky for Strike and Stride actions. Darkvision - Can see in the dark out to a range of [1]. + Can see in the dark. Moonmote Illuminate a [1] radius. Shar's Aegis @@ -6368,13 +6368,13 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Bestow Curse: Dread Curse a creature with your touch. It fills with dread, possibly skipping its turn. Flicker - You flicker quickly between your current plane and another. You gain resistance 5 to all damage, except force and radiant. + You flicker quickly between your current plane and another. You gain resistance [2] to all damage, except force and radiant. At the end of each of your turns, you automatically teleport [1] in a random direction. You can Sustain the spell to teleport in this way. Flicker You flicker quickly between your current plane and another. You gain resistance 5 to all damage, except force and radiant. Flicker You flicker quickly between your current plane and another. You gain resistance 5 to all damage, except force and radiant. Flicker - You flicker quickly between your current plane and another. You gain resistance 5 to all damage, except force and radiant. + You flicker quickly between your current plane and another. You gain resistance [2] to all damage, except force and radiant. At the end of each of your turns, you automatically teleport [1] in a random direction. You can Sustain the spell to teleport in this way. Blistering Invective 2 Actions<br>Range 30 feet<br>Targets 1 creature<br>Defense Will<br>A heap of insults and invectives spew from your mouth—words so devastating your foes burn from the intensity of your diatribe. Your words deal 2d6 persistent fire damage, and the target must attempt a Will save.<br>Success The target takes half the persistent fire damage.<br>Failure The target becomes frightened 1 and takes the full persistent fire damage.<br>Critical Failure The target becomes frightened 2 and takes double the persistent fire damage.<br>Heightened (+2) You can target two additional creatures, and the persistent damage increases by 2d6. Scroll of Bless @@ -6503,9 +6503,9 @@ Because this is Pathfinder 2nd Edition, Short Rests are unlimited and restore fo Stupefied 3 %%% EMPTY Wall of Fire: Aura - Engulfed in a wall of blazing flames. The affected entity takes [2] per turn it stays within [1] of the fire. + Engulfed in a wall of blazing flames. The affected entity takes [1] per turn it stays within the fire. Wall of Fire - A blazing wall of fire that deals [2] to anyone within [1]. + A blazing wall of fire that deals [1] to anyone who passes through it. Wall of Fire 3 Actions<br>You raise a blazing wall that burns creatures passing through it. You create either a 5-foot-thick wall of flame in a straight line up to 60 feet long and 10 feet high, or a 5-foot-thick, 10-foot-radius ring of flame with the same height. The wall stands vertically in either form; if you wish, the wall can be of a shorter length or height. Everything on each side of the wall is concealed from creatures on the opposite side. Any creature that crosses the wall or is occupying the wall's area at the start of its turn takes 4d6 fire damage. Shield of Devotion: Heroism @@ -6697,8 +6697,8 @@ If you regain any hit points, the condition is removed. If an ally <LSTag Typ 2 Actions<br>Overflow<br>Massive waves spiral around you, with you as the eye of the hurricane. The waves appear in a 20-foot emanation, or a 30-foot emanation if you're in a body of water. Each creature in the area takes 6d8 bludgeoning damage with a basic Reflex save against your class DC. A creature that fails its save is battered by the waves and pushed 10 feet (or 20 feet on a critical failure).<br>Level (+2) The damage increases by 1d8. Anchored Movement Choosing to immobilize yourself. - Anchor Position - Toggle this on to immobilize yourself. + Manual Stride + When turned on, your characters will start their turn with 0 movement, and you will have to manually stride to move. * Brilliant Flash * Prerequisites grandeur cause<br>Your light cleanses souls of fear. When you use Flash of Grandeur, the attacker is also off-guard for 1 round. * Iron Repercussions * @@ -6739,7 +6739,7 @@ If you regain any hit points, the condition is removed. If an ally <LSTag Typ Dealing an additional 1 radiant damage on Strikes. Iron Repercussion Disobeying your Iron Command has lasting consequences. If an enemy refuses to kneel to you, you can deal persistent mental damage instead of normal mental damage. You must decide whether the mental damage will be persistent before your enemy chooses whether to kneel or not. The amount of damage is unchanged. - Nimble Retribution + Nimble Reprisal Glimpse of Redemption (Weighted Guilt) Trigger An enemy damages your ally, and both are in your champion’s aura; <br>Effect Your enemy hesitates under the weight of sin as visions of redemption play in their mind’s eye. <br>The ally gains resistance to all damage against the triggering damage equal to 2 + your level. <br>Guilt clouds the minds of those who ignore your Glimpse of Redemption. Instead of making an enemy who refuses redemption enfeebled 2, you can make it stupefied 2 for the same duration. Shield Warden @@ -30865,9 +30865,9 @@ Really? Just like that? All right, but if she reaches for that lute, it's firewo Silence Flame Vortex Flame Vortex - Petal Storm - Flame Vortex - Field of Life + Petal Storm + Flame Vortex + Field of Life Flame Vortex Sustained Flame Vortex Cleanup Flame Vortex Damage @@ -30914,7 +30914,7 @@ Really? Just like that? All right, but if she reaches for that lute, it's firewo You gain a +1 circumstance bonus to your Intimidation check to Demoralize, or +2 if your Strength modifier is +5 and you're a master in Intimidation. You ignore the penalty for not sharing a language. * Powerful Leap* Requires <LSTag Tooltip="Proficiency">Expert</LSTag> in <LSTag Tooltip="Athletics">Athletics</LSTag>. - Your Leap and Long Jump distances are increased by 5ft. + Your Leap and Long Jump distances are increased by [1]. Skill Training (Arcana) Skill Training (Lore) Skill Training (Occultism) @@ -31017,13 +31017,33 @@ Really? Just like that? All right, but if she reaches for that lute, it's firewo You can move Floating Flame to a new position. Floating Flame (Sustain) You can move the flame up to [2] in a straight line. It deals [1] to each creature it passed through during its flight with a basic Reflex save. A creature can take damage from a floating flame only once per round. - Floating Flame + Floating Flame Flat Check Immunity Stupefied Flat Check When you are targetted by an attack or spell from a Stupefied enemy, that enemy attempts a flat check. On a failure, they fail to cast the spell. Also handles some other flat check triggers. Flat Check Immunity Source Oversized Throw Requirements You have one or more hands free.<br>With a great heave, you seize a piece of your surroundings, such as a boulder, log, table, wagon, or chunk of earth, and hurl it at your foes. The object must be your size or one size smaller than you, and it must not have too much Bulk for you to lift it in the first place. Make a ranged Strike with the object. The object is a simple ranged weapon that deals 1d10 bludgeoning damage, has a range increment of 20 feet, and has the thrown weapon trait. The damage increases to 2d10 if you have weapon specialization in simple weapons. + Manual Stride + Shrink The Span + Shrink the Span + Teleport yourself to a place you can see within [1]. + Shrink the Span + Teleport yourself up to your movement speed to a place you can see. + Has a [1] status bonus to speed. + Volley + Attempting a ranged attack with this weapon within [1] incurs a -2 penalty + Volley + Attempting a ranged attack with this weapon within volley range incurs a -2 penalty + Volley + Attempting a ranged attack within a weapon's volley range incurs a -2 penalty + Resistance increases by [1] every two levels. + Flicker + Random teleport within [1] + Flicker (Sustain) + Teleport [1] in a random direction. + Critical Specialization: Polearm + Move the target anywhere within [1]. Difficult terrain - <LSTag Tooltip="MovementSpeed">movement speed</LSTag> is halved and creatures may fall Prone. Flammable. Grease \ No newline at end of file diff --git a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Scripts/thoth/helpers/PF2_Conditions.khn b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Scripts/thoth/helpers/PF2_Conditions.khn index 375423b1..a80e5281 100644 --- a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Scripts/thoth/helpers/PF2_Conditions.khn +++ b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Scripts/thoth/helpers/PF2_Conditions.khn @@ -7,7 +7,7 @@ local __util = require 'larian.util' function AutoStride() local canMove = ~Immobilized() | HasStatus('SG_Prone') local hasActions = HasActionResource('ActionPoint', 1 , 0, false, false) | QuickenedStride() - local automaticStride = ~HasStatus('MANUAL_STRIDE') + local automaticStride = ~HasStatus('MANUAL_STRIDE') | HasStatus('SG_Mad') | HasStatus('SG_Dominated') | HasStatus('SG_Fleeing') | HasStatus('SG_Approaching') | HasStatus('SG_Taunted') | HasStatus('SG_Confused') return canMove & hasActions & automaticStride end @@ -203,6 +203,19 @@ function Flanking(target, source) return ConditionResult(false, errorFalse, errorTrue) end +-- Volley Penalty +function Volley(distance, targetPosition, sourcePosition) + targetPosition = targetPosition or context.TargetPosition + sourcePosition = sourcePosition or context.SourcePosition + local errorTrue = {ConditionError("VolleyRange", {ConditionErrorData.MakeFromNumber(distance, EErrorDataType.Distance)})} + local errorFalse = {ConditionError("NotVolleyRange", {ConditionErrorData.MakeFromNumber(distance, EErrorDataType.Distance)})} + + if Distance(sourcePosition, targetPosition) < distance then + return ConditionResult(true, errorFalse, errorTrue) + end + return ConditionResult(false, errorFalse, errorTrue) +end + -- Status MAP_X_ATTACKS --~functional for Stats. @@ -315,8 +328,8 @@ function RetributiveStrikeRange() local target = context.Target local ranged = WieldingWeapon('Ammunition', false, false, source).Result & ~WieldingWeapon('Melee', false, false, source) - local reach_nimble = WieldingWeapon('Reach', false, false, source).Result & DistanceToTargetLessThan(5) - local melee_nimble = ~WieldingWeapon('Ammunition', false, false, source) & ~DistanceToTargetLessThan(3.5) + local reach_nimble = WieldingWeapon('Reach', false, false, source).Result & DistanceToTargetLessThan(5.5) + local melee_nimble = ~WieldingWeapon('Ammunition', false, false, source) & ~DistanceToTargetLessThan(4) local nimble_reprisal = (ranged|reach_nimble|melee_nimble) & HasPassive('NimbleReprisal',source) local reach = WieldingWeapon('Reach', false, false, source) & DistanceToTargetLessThan(3.5) @@ -782,7 +795,7 @@ end function CanPrecisionDamage(target) target = target or context.Target - local result = ~HasAnyTags({'OOZE','SHADOW','GHOST','DISPLACER_BEAST','SCRYING_EYE','GASEOUS_FORM','Ethereal'}, target) + local result = ~HasAnyTags({'OOZE','SHADOW','GHOST','DISPLACER_BEAST','SCRYING_EYE','GASEOUS_FORM'}, target) & ~HasPassive('Ethereal', target) return ConditionResult( result.Result,{ConditionError("PrecisionImmune")}) end diff --git a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_BonusStacking.txt b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_BonusStacking.txt index ff733b10..da7c20f7 100644 --- a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_BonusStacking.txt +++ b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_BonusStacking.txt @@ -345,26 +345,37 @@ DB_IntrinsicResistance("Thunder","ThnResist_5",5); DB_IntrinsicResistance("Thunder","ThnResist_10",10); DB_IntrinsicResistance("Bludgeoning","GhostResist_5",5); +DB_IntrinsicResistance("Bludgeoning","GhostResist_8",8); DB_IntrinsicResistance("Bludgeoning","GhostResist_10",10); DB_IntrinsicResistance("Slashing","GhostResist_5",5); +DB_IntrinsicResistance("Slashing","GhostResist_8",8); DB_IntrinsicResistance("Slashing","GhostResist_10",10); DB_IntrinsicResistance("Piercing","GhostResist_5",5); +DB_IntrinsicResistance("Piercing","GhostResist_8",8); DB_IntrinsicResistance("Piercing","GhostResist_10",10); DB_IntrinsicResistance("Acid","GhostResist_5",5); +DB_IntrinsicResistance("Acid","GhostResist_8",8); DB_IntrinsicResistance("Acid","GhostResist_10",10); DB_IntrinsicResistance("Cold","GhostResist_5",5); +DB_IntrinsicResistance("Cold","GhostResist_8",8); DB_IntrinsicResistance("Cold","GhostResist_10",10); DB_IntrinsicResistance("Fire","GhostResist_5",5); +DB_IntrinsicResistance("Fire","GhostResist_8",8); DB_IntrinsicResistance("Fire","GhostResist_10",10); DB_IntrinsicResistance("Lightning","GhostResist_5",5); +DB_IntrinsicResistance("Lightning","GhostResist_8",8); DB_IntrinsicResistance("Lightning","GhostResist_10",10); DB_IntrinsicResistance("Necrotic","GhostResist_5",5); +DB_IntrinsicResistance("Necrotic","GhostResist_8",8); DB_IntrinsicResistance("Necrotic","GhostResist_10",10); DB_IntrinsicResistance("Poison","GhostResist_5",5); +DB_IntrinsicResistance("Poison","GhostResist_8",8); DB_IntrinsicResistance("Poison","GhostResist_10",10); DB_IntrinsicResistance("Psychic","GhostResist_5",5); +DB_IntrinsicResistance("Psychic","GhostResist_8",8); DB_IntrinsicResistance("Psychic","GhostResist_10",10); DB_IntrinsicResistance("Thunder","GhostResist_5",5); +DB_IntrinsicResistance("Thunder","GhostResist_8",8); DB_IntrinsicResistance("Thunder","GhostResist_10",10); //Vanilla weaknesses/resistances diff --git a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_Flicker.txt b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_Flicker.txt new file mode 100644 index 00000000..a5b118a0 --- /dev/null +++ b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_Flicker.txt @@ -0,0 +1,72 @@ +Version 1 +SubGoalCombiner SGC_AND +INITSECTION +DB_FlickerStatus("BLINK"); +DB_FlickerStatus("BLINK_6"); + +DB_RandomVectors(4.0, 0.0); +DB_RandomVectors(3.7, 1.5); +DB_RandomVectors(2.8, 2.8); +DB_RandomVectors(1.5, 3.7); +DB_RandomVectors(-4.0, 0.0); +DB_RandomVectors(-3.7, 1.5); +DB_RandomVectors(-2.8, 2.8); +DB_RandomVectors(-1.5, 3.7); +DB_RandomVectors(4.0, -0.0); +DB_RandomVectors(3.7, -1.5); +DB_RandomVectors(2.8, -2.8); +DB_RandomVectors(1.5, -3.7); +DB_RandomVectors(-4.0, -0.0); +DB_RandomVectors(-3.7, -1.5); +DB_RandomVectors(-2.8, -2.8); +DB_RandomVectors(-1.5, -3.7); +KBSECTION +// At the end of a character's turn, if they have the BLINK status, +// teleport them in a random direction by 10 feet. +IF +TurnEnded((GUIDSTRING)_Character) +AND +DB_FlickerStatus((STRING)_Status) +AND +HasActiveStatus(_Character, _Status, 1) +THEN +PROC_FlickerTeleport(_Character); + +// If a character sustains the flicker spell, also telepor them +// randomly. +IF +CastedSpell((GUIDSTRING)_Character, "Shout_Blink_Sustain", _, _, _) +THEN +PROC_FlickerTeleport(_Character); + +// Logic to choose a random direction and teleport. +PROC +PROC_FlickerTeleport((GUIDSTRING)_Character) +AND +GetPosition(_Character, (REAL)_XO, (REAL)_YO, (REAL)_ZO) +AND +QRY_GetRandom("DB_RandomVectors", 2, "DB_ChosenVector") +AND +DB_ChosenVector((REAL)_XD, (REAL)_ZD) +AND +RealSum(_XO, _XD, (REAL)_XN) +AND +RealSum(_ZO, _ZD, (REAL)_ZN) +AND +FindValidPosition(_XN, _YO, _ZN, 4.0, _Character, 0, (REAL)_XSafe, (REAL)_YSafe, (REAL)_ZSafe) +THEN +PlayEffectAtPosition(VFX_Cinematic_Daisy_Disappear_Flash_01_c6caf9c3-c787-f49f-838f-aef5f568270d, _XO, _YO, _ZO, 0.7); +TeleportToPosition(_Character, _XSafe, _YSafe, _ZSafe, "FlickerTeleport", 0, 0, 0, 0, 1); +PlayEffectAtPosition(VFX_Cinematic_Gale_Recruitment_Portal_Flash_01_a1f850e5-746a-0b0a-78b8-22b5a45dd809, _XSafe, _YSafe, _ZSafe, 1.0); +NOT DB_ChosenVector(_XD, _ZD); + +// Dummy to hide warning about unused DB. +PROC +PROC_FlickerTeleport((GUIDSTRING)_Character) +AND +DB_RandomVectors((REAL)_X, (REAL)_Z) +THEN +DB_NOOP(1); +EXITSECTION + +ENDEXITSECTION diff --git a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_MovableSpells.txt b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_MovableSpells.txt index 2320b85b..1389fc40 100644 --- a/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_MovableSpells.txt +++ b/Mods/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Story/RawFiles/Goals/PF2e_MovableSpells.txt @@ -1,12 +1,12 @@ Version 1 SubGoalCombiner SGC_AND INITSECTION -DB_MovableSpells("FLAME_VORTEX_AURA", 7.0, "Target_FlameVortex_Sustain", "FLAME_VORTEX_MOVE_COMPLETE"); -DB_MovableSpells("FLOATING_FLAME_AURA", 3.5, "Target_FlamingSphere_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); -DB_MovableSpells("FLOATING_FLAME_3_AURA", 3.5, "Target_FlamingSphere_3_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); -DB_MovableSpells("FLOATING_FLAME_4_AURA", 3.5, "Target_FlamingSphere_4_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); -DB_MovableSpells("FLOATING_FLAME_5_AURA", 3.5, "Target_FlamingSphere_5_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); -DB_MovableSpells("FLOATING_FLAME_6_AURA", 3.5, "Target_FlamingSphere_6_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); +DB_MovableSpells("FLAME_VORTEX_AURA", 8.0, "Target_FlameVortex_Sustain", "FLAME_VORTEX_MOVE_COMPLETE"); +DB_MovableSpells("FLOATING_FLAME_AURA", 4.0, "Target_FlamingSphere_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); +DB_MovableSpells("FLOATING_FLAME_3_AURA", 4.0, "Target_FlamingSphere_3_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); +DB_MovableSpells("FLOATING_FLAME_4_AURA", 4.0, "Target_FlamingSphere_4_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); +DB_MovableSpells("FLOATING_FLAME_5_AURA", 4.0, "Target_FlamingSphere_5_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); +DB_MovableSpells("FLOATING_FLAME_6_AURA", 4.0, "Target_FlamingSphere_6_Sustain", "FLOATING_FLAME_MOVE_COMPLETE"); KBSECTION // Using the BloodCloud surface, we can make spells that have summons // that move when sustained, passing through the battlefield applying diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsfx index 59e68915..a7224281 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsfx and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Spells/Cast/VFX_Spells_HypnoticPattern_AuraFX.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsfx index 49607624..74f06a37 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsfx and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_AshCloud_AuraFX.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_Geyser_AuraFX.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_Geyser_AuraFX.lsfx new file mode 100644 index 00000000..f19fdb30 Binary files /dev/null and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_Geyser_AuraFX.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsfx index 07852c18..0be6955a 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsfx and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_PetalStorm_AuraFX.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsfx index 744ca6bf..3661570f 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsfx and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Effects/Status/VFX_Spell_RustCloud_AuraFX.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura.lsfx index 88ad0443..e51489f1 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura.lsfx and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura_Extended.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura_Extended.lsfx index e6a7c2cc..f7ff2ad5 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura_Extended.lsfx and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_ChampionsAura_Extended.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_Flicker.lsfx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_Flicker.lsfx new file mode 100644 index 00000000..5ff0523e Binary files /dev/null and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Assets/Effects/Effects_Banks/Status/VFX_Status_Flicker.lsfx differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/4f04c929-ffa2-1830-378c-df88872a605e.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/4f04c929-ffa2-1830-378c-df88872a605e.lsf index e7e38ac4..f25fa074 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/4f04c929-ffa2-1830-378c-df88872a605e.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/4f04c929-ffa2-1830-378c-df88872a605e.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/6c0ea1b5-4dd3-974c-e818-5fbf2278b510.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/6c0ea1b5-4dd3-974c-e818-5fbf2278b510.lsf index 7343d723..6541fd80 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/6c0ea1b5-4dd3-974c-e818-5fbf2278b510.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/6c0ea1b5-4dd3-974c-e818-5fbf2278b510.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/921623e9-01a0-65d6-716d-aa8e80df1025.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/921623e9-01a0-65d6-716d-aa8e80df1025.lsf index f9f78be1..129dbbfd 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/921623e9-01a0-65d6-716d-aa8e80df1025.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/921623e9-01a0-65d6-716d-aa8e80df1025.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/c9a30e31-683a-0006-3814-2925ef8d45da.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/c9a30e31-683a-0006-3814-2925ef8d45da.lsf new file mode 100644 index 00000000..a25ebb95 Binary files /dev/null and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/c9a30e31-683a-0006-3814-2925ef8d45da.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/ec61966e-59b6-28b3-73a8-c18bc3a604ad.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/ec61966e-59b6-28b3-73a8-c18bc3a604ad.lsf index 855b89f7..612dfa37 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/ec61966e-59b6-28b3-73a8-c18bc3a604ad.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/ec61966e-59b6-28b3-73a8-c18bc3a604ad.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/f218bb65-f7c2-69ed-6845-1f8383fae9e0.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/f218bb65-f7c2-69ed-6845-1f8383fae9e0.lsf index b2dd3177..da255aff 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/f218bb65-f7c2-69ed-6845-1f8383fae9e0.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Projectiles/f218bb65-f7c2-69ed-6845-1f8383fae9e0.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/48d767dd-9c9a-5783-f859-aa519289d8ac.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/48d767dd-9c9a-5783-f859-aa519289d8ac.lsf new file mode 100644 index 00000000..6ce20edb Binary files /dev/null and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/48d767dd-9c9a-5783-f859-aa519289d8ac.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/be3eba3f-cdf1-ee74-d2a4-54ce173bb2df.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/be3eba3f-cdf1-ee74-d2a4-54ce173bb2df.lsf index 62ba49a3..2024130a 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/be3eba3f-cdf1-ee74-d2a4-54ce173bb2df.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/be3eba3f-cdf1-ee74-d2a4-54ce173bb2df.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/cea32ed0-f4ac-987f-65f0-e99c39f4ac8e.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/cea32ed0-f4ac-987f-65f0-e99c39f4ac8e.lsf index 9c3908d1..7d2040a6 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/cea32ed0-f4ac-987f-65f0-e99c39f4ac8e.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Content/Assets/Effects/Effects/[PAK]_Status/cea32ed0-f4ac-987f-65f0-e99c39f4ac8e.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.lsf index 08857221..2ff67d47 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/088ec2fe-91c6-41af-9836-1934985a7f08.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.lsf index e62e099c..98b5c02e 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/300a9a5a-26af-48b7-9a6d-3b9d0c27352f.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.lsf index d1608786..5863235b 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/5470483e-f1cf-413b-9a41-93f16b58a30b.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.lsf index 0aefd6ec..251a4faf 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a16194ff-34ad-4f70-8521-e848475d30ef.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.lsf index fcb26e48..8957b231 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/a4aefae4-51ce-4e67-afa1-c329e6357f31.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e3cc6ce6-133d-4d76-84c4-e656cd61ec69.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e3cc6ce6-133d-4d76-84c4-e656cd61ec69.lsf new file mode 100644 index 00000000..c1a9300a Binary files /dev/null and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e3cc6ce6-133d-4d76-84c4-e656cd61ec69.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e749054e-38db-43fb-ab99-216f3287fae2.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e749054e-38db-43fb-ab99-216f3287fae2.lsf new file mode 100644 index 00000000..d4d5bd5a Binary files /dev/null and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/MultiEffectInfos/e749054e-38db-43fb-ab99-216f3287fae2.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.lsx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.lsx index 49bec9a0..f1406020 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.lsx +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Progressions/Progressions.lsx @@ -6731,7 +6731,7 @@ - + @@ -6780,7 +6780,7 @@ - + @@ -6865,7 +6865,7 @@ - + @@ -6919,7 +6919,7 @@ - + @@ -6990,7 +6990,7 @@ - + @@ -7079,7 +7079,7 @@ - + @@ -7129,7 +7129,7 @@ - + @@ -7171,7 +7171,7 @@ - + @@ -7281,7 +7281,7 @@ - + @@ -7321,7 +7321,7 @@ - + @@ -7570,7 +7570,7 @@ - + diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/045576d9-1095-4b16-bd6e-5dc31316df65.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/045576d9-1095-4b16-bd6e-5dc31316df65.lsf index 35571a2f..21ebb3ee 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/045576d9-1095-4b16-bd6e-5dc31316df65.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/045576d9-1095-4b16-bd6e-5dc31316df65.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/0ba4af65-19d0-4a31-9a42-2c365462841b.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/0ba4af65-19d0-4a31-9a42-2c365462841b.lsf index 157b2b4b..787f01ec 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/0ba4af65-19d0-4a31-9a42-2c365462841b.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/0ba4af65-19d0-4a31-9a42-2c365462841b.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/4c29f8ec-1806-40f4-925a-5ed58bfc1848.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/4c29f8ec-1806-40f4-925a-5ed58bfc1848.lsf index a23a802f..a1c8291b 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/4c29f8ec-1806-40f4-925a-5ed58bfc1848.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/4c29f8ec-1806-40f4-925a-5ed58bfc1848.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/b80e9a49-3de8-4fc9-8fe2-1012a4f3fd85.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/b80e9a49-3de8-4fc9-8fe2-1012a4f3fd85.lsf index a18b0dc2..25aa3229 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/b80e9a49-3de8-4fc9-8fe2-1012a4f3fd85.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/b80e9a49-3de8-4fc9-8fe2-1012a4f3fd85.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/d0790c39-0dbc-4c92-b0c7-5719db4dad0d.lsf b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/d0790c39-0dbc-4c92-b0c7-5719db4dad0d.lsf index 7c471310..4abe8cfa 100644 Binary files a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/d0790c39-0dbc-4c92-b0c7-5719db4dad0d.lsf and b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/RootTemplates/d0790c39-0dbc-4c92-b0c7-5719db4dad0d.lsf differ diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Character.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Character.txt index 4604573f..193404e7 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Character.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Character.txt @@ -22,7 +22,7 @@ data "ProficiencyBonus" "2" data "SpellCastingAbility" "Intelligence" data "UnarmedAttackAbility" "Strength" data "UnarmedRangedAttackAbility" "Dexterity" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules" data "MinimumDetectionRange" "2" data "DarkvisionRange" "0" @@ -251,7 +251,7 @@ using "_Base" data "Vitality" "8" data "Weight" "50" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules" new entry "_Human" @@ -468,7 +468,7 @@ new entry "_Elf" type "Character" using "_Humanoid" data "Weight" "75" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;FeyAncestry;DarknessRules;Darkvision" data "DarkvisionRange" "9" @@ -650,7 +650,7 @@ new entry "_Elf_Drow" type "Character" using "_Humanoid" data "Weight" "75" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;FeyAncestry;SunlightSensitivity;DarknessRules;Darkvision;NPCIntimidation" data "DarkvisionRange" "16" @@ -2152,7 +2152,7 @@ data "Vitality" "16" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "ActionResource(SpellSlot,3,1);BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" data "SpellCastingAbility" "Intelligence" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1;ActionResource(SpellSlot,3,1)" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1;ActionResource(SpellSlot,3,1)" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Darkvision;DarknessRules;NPC_Arcane;SpellExpert;ReflexExpert;WillExpert;PerceptionIncrease" data "ArmorType" "Cloth" data "Proficiency Group" "SimpleWeapons;LightArmor" @@ -2265,7 +2265,7 @@ type "Character" using "Gnoll" data "Strength" "14" data "Vitality" "20" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:16;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;PackTactics;Rampage;Darkvision;DarknessRules;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;" data "ArmorType" "None" @@ -2745,7 +2745,7 @@ data "StepsType" "Clawed" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "SpellCastingAbility" "Dexterity" data "UnarmedAttackAbility" "Dexterity" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;PackTactics;DarknessRules;ReflexExpert;FortitudeExpert;WeaponExpert;PerceptionIncrease;NPCAthletics;" new entry "Wolf_Dire" @@ -2882,7 +2882,7 @@ data "Vitality" "2" data "Weight" "5" data "StepsType" "Clawed" data "DefaultBoosts" "ProficiencyBonus(Skill, Stealth);BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:6;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:8;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;FelineFall;DarknessRules;Darkvision;ReflexExpert;WillExpert;PerceptionIncrease;" new entry "Chicken" @@ -3262,7 +3262,7 @@ data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking;Floating" data "PersonalStatusImmunities" "SG_Prone;PRONE_FALLEN;CRIPPLED" data "PathInfluence" "PoisonCloud,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;SporeBlackCloud,100;SporeGreenCloud,40;DarknessCloud,30;FogCloud,30;SporePinkCloud,40;StinkingCloud,40;WaterCloudElectrified,40" data "UnarmedAttackAbility" "Strength" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1;EyeStalkActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1;EyeStalkActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Darkvision;DarknessRules;Spectator_FallResist;ReflexExpert;WillMaster;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;PerceptionIncrease2;NPCIntimidation" data "DarkvisionRange" "18" data "ArmorType" "None" @@ -3599,7 +3599,7 @@ using "_Base" data "XPReward" "" data "Weight" "0.01" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking;Floating" -data "ActionResources" "Movement:7.5" +data "ActionResources" "Movement:10" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Ethereal;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -3838,7 +3838,7 @@ data "Wisdom" "14" data "Vitality" "27" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:2" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:2" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Darkvision;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;NPC_Primal;WillExpert;WeaponExpert;SpellExpert;PerceptionIncrease;" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: REDCAP_CASTER_HARDCORE" @@ -3938,7 +3938,7 @@ data "PersonalStatusImmunities" "SG_Charmed;SG_Frightened;DIFFICULT_TERRAIN_VINE data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;Lava,700;Fire,40;HolyFire,40;Hellfire,100;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,30;Grease,30;Web,30;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" data "ProficiencyBonus" "2" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "BldResist_5;PieResist_5;ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "BldResist_5;PieResist_5;ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;WoodWoad_MagicClub;Regeneration_WoodWoad;Darkvision;DarknessRules;Regeneration_WoodWoad_Cooldown_Technical;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;NPCAthletics;" data "BludgeoningResistance" "None" data "PiercingResistance" "None" @@ -4138,7 +4138,7 @@ new entry "Companion_Worg" type "Character" using "Worg" data "XPReward" "" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" new entry "Worg_Lesser" type "Character" @@ -4329,7 +4329,7 @@ data "Vitality" "22" data "XPReward" "c1d87aaa-7548-44da-b9dd-d17b027a3885" data "PersonalStatusImmunities" "SG_Poisoned;BLEEDING;GAPING_WOUND;CHEST_TRAUMA;DAZED" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;NPCAthletics;" data "PoisonResistance" "Immune" data "PsychicResistance" "Immune" @@ -4341,7 +4341,7 @@ using "_Base" data "XPReward" "" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Living;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Minion" new entry "AnimateDead_Zombie__Horde" @@ -4351,7 +4351,7 @@ data "Level" "4" data "Vitality" "10" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "PersonalStatusImmunities" "SG_Poisoned;BLEEDING;GAPING_WOUND;CHEST_TRAUMA;DAZED;SCL_SHADOW_CURSE;SCL_SHADOW_CURSE_1;SCL_SHADOW_CURSE_2;SCL_SHADOW_CURSE_4;SCL_SHADOW_CURSE_3" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;Minion;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4362,7 +4362,7 @@ data "Level" "5" data "Dexterity" "16" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "PersonalStatusImmunities" "SG_Poisoned;BLEEDING;SLEEPING;GAPING_WOUND;CHEST_TRAUMA;DAZED;SCL_SHADOW_CURSE;SCL_SHADOW_CURSE_1;SCL_SHADOW_CURSE_2;SCL_SHADOW_CURSE_3;SCL_SHADOW_CURSE_4" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;ImmuneToDisarm;SkeletonDeath_Check;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;ShortResting;Minion;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;AcrobaticsIncrease;AthleticsIncrease;" data "PsychicResistance" "Immune" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4373,7 +4373,7 @@ using "Zombie" data "Level" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "PersonalStatusImmunities" "SG_Poisoned;BLEEDING;GAPING_WOUND;CHEST_TRAUMA;DAZED;SCL_SHADOW_CURSE;SCL_SHADOW_CURSE_1;SCL_SHADOW_CURSE_2;SCL_SHADOW_CURSE_3;SCL_SHADOW_CURSE_4" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;ShortResting;Minion;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4413,7 +4413,7 @@ data "Weight" "250" data "SoundSize" "Large" data "ProficiencyBonusScaling" "" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;CompanionScaler" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4472,7 +4472,7 @@ data "Vitality" "8" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "ProficiencyBonusScaling" "" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;CompanionScaler" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4523,7 +4523,7 @@ data "Vitality" "8" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "ProficiencyBonusScaling" "" data "ProficiencyBonus" "0" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;Minion;CompanionScaler" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4541,7 +4541,7 @@ data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" data "ProficiencyBonusScaling" "" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;CompanionScaler" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4558,7 +4558,7 @@ data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "SoundSize" "Huge" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);ExpertiseBonus(Acrobatics);" data "ProficiencyBonusScaling" "265d62c4-9b82-4ed6-9a86-da675b4ef8fe" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;CompanionScaler;MatureCompanionBoosts;ReflexExpert;WillExpert;WeaponExpert;" new entry "Companion_GiantSpider_7" @@ -4603,7 +4603,7 @@ data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "ProficiencyBonusScaling" "" data "ProficiencyBonus" "2" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;Minion;CompanionScaler" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4665,7 +4665,7 @@ data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" data "ProficiencyBonusScaling" "" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;HuntersMark_RangerCompanion;ShortResting;MultipleAttackPenalty;DarknessRules;Minion;CompanionScaler" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4718,7 +4718,7 @@ data "Wisdom" "12" data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DevilsSight;ShortResting;Darkvision;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4734,7 +4734,7 @@ data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);ExpertiseBonus(Acrobatics);ExpertiseBonus(Athletics);" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;ShortResting;Darkvision;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;DeathSavingThrows;Minion;IsFamiliar;ReflexMaster;WillMaster;FortitudeMaster;WeaponMaster;SpellMaster;ACMaster;PerceptionIncrease;PerceptionIncrease2;AcrobaticsIncrease;AthleticsIncrease;" data "PoisonResistance" "None" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4749,7 +4749,7 @@ data "Armor" "12" data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);DialogueBlock();" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;ShortResting;Darkvision;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4764,7 +4764,7 @@ data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;FelineFall;ShortResting;MultipleAttackPenalty;Darkvision;DarknessRules;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4779,7 +4779,7 @@ data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4795,7 +4795,7 @@ data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" data "SpellCastingAbility" "Dexterity" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4809,7 +4809,7 @@ data "Armor" "12" data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);ExpertiseBonus(Acrobatics);ExpertiseBonus(Athletics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;SpiderWalk;ShortResting;MultipleAttackPenalty;Darkvision;DarknessRules;DeathSavingThrows;Minion;IsFamiliar;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4824,7 +4824,7 @@ data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4838,7 +4838,7 @@ data "Vitality" "5" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking;Floating" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;ShortResting;MultipleAttackPenalty;DarknessRules;DeathSavingThrows;Minion;IsFamiliar" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -4865,7 +4865,7 @@ data "Weight" "199" data "DefaultBoosts" "DialogueBlock();BlockRegainHP(Undead;Construct;Living);" data "PersonalStatusImmunities" "SILENCED;BLEEDING;GAPING_WOUND;CHEST_TRAUMA;DAZED;CRIPPLED;OFF_BALANCED;SHOCKED;BURNING;SG_Condition;WILD_MAGIC_BURNING" data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;Lava,700;HolyFire,40;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,30;Grease,30;Web,30;Vines,40;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" -data "ActionResources" "BonusActionPoint:1;Movement:9" +data "ActionResources" "BonusActionPoint:1;Movement:12" data "Passives" "DarknessRules;ShortResting;Minion" data "BludgeoningResistance" "Resistant" data "SlashingResistance" "Resistant" @@ -5048,7 +5048,7 @@ type "Character" using "_HalfOrc" data "Vitality" "8" data "XPReward" "c83d6caa-c5c3-4356-b55c-8d634535976c" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;ReactionActionPoint:1;Movement:7.5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;ReactionActionPoint:1;Movement:10" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;NPCIntimidation" new entry "HalfOrc_Caster" @@ -5141,7 +5141,7 @@ data "Strength" "16" data "Intelligence" "18" data "Wisdom" "16" data "Vitality" "85" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:2:2:3;SpellSlot:3:3:4;SpellSlot:1:1:5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:2:2:3;SpellSlot:3:3:4;SpellSlot:1:1:5" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;WarMagic_Githyanki;DarknessRules;NPC_Occult;WeaponExpert;NPCAthletics;" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: GITHYANKI_GISH_VETERAN_HARDCORE" @@ -5409,7 +5409,7 @@ data "Intelligence" "18" data "Charisma" "12" data "Vitality" "67" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:1:1:3" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:1:1:3" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;NPC_Divine" data "Progressions" "36c3f8de-3293-4d7b-92bc-ceb3c569244b" data "ArmorType" "None" @@ -5425,7 +5425,7 @@ data "Intelligence" "18" data "Charisma" "12" data "Vitality" "67" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:1:1:3" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:1:1:3" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Gnome_Cunning;Gnome_Speed;DarknessRules;Darkvision;NPC_Divine" data "Progressions" "36c3f8de-3293-4d7b-92bc-ceb3c569244b" data "ArmorType" "None" @@ -6056,7 +6056,7 @@ type "Character" using "GaseousForm" data "Vitality" "1" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking;Floating" -data "ActionResources" "Movement:7.5" +data "ActionResources" "Movement:10" data "Passives" "Ethereal;DarknessRules" new entry "Blight_Needle" @@ -6582,7 +6582,7 @@ data "Strength" "16" data "Dexterity" "16" data "Vitality" "32" data "Weight" "60" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;ReactionActionPoint:1;Movement:12" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;ReactionActionPoint:1;Movement:16" new entry "Ghast" type "Character" @@ -7073,7 +7073,7 @@ data "Armor" "14" data "Vitality" "35" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "PersonalStatusImmunities" "SG_Charmed;SG_Poisoned;SCL_SHADOW_CURSE;SCL_SHADOW_CURSE_1;SCL_SHADOW_CURSE_2;SCL_SHADOW_CURSE_3;SCL_SHADOW_CURSE_4" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "PoisonResistance" "Immune" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -7088,7 +7088,7 @@ data "Armor" "12" data "Vitality" "30" data "XPReward" "40806669-8c6b-4068-8bc4-07e4981bb020" data "PersonalStatusImmunities" "SG_Charmed;SG_Poisoned;SCL_SHADOW_CURSE;SCL_SHADOW_CURSE_1;SCL_SHADOW_CURSE_2;SCL_SHADOW_CURSE_3;SCL_SHADOW_CURSE_4" -data "ActionResources" "ActionPoint:2;BonusActionPoint:1;ReactionActionPoint:1;Movement:12" +data "ActionResources" "ActionPoint:2;BonusActionPoint:1;ReactionActionPoint:1;Movement:16" data "PoisonResistance" "Immune" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -7108,7 +7108,7 @@ new entry "FindFamiliar_Dog" type "Character" using "Dog" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" -data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:2;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Minion" data "DifficultyStatuses" "STATUS_EASY:PLAYER_BONUSES_EASYMODE" @@ -7321,7 +7321,7 @@ data "Flags" "Grounded;Floating;EnableObscurityEvents;ObscurityWithoutSneaking" data "DefaultBoosts" "DialogueBlock();AttackSpellOverride(Target_MainHandAttack_SpiritualWeapon_Greataxe, Target_MainHandAttack);BlockRegainHP(Undead;Construct;Living);Tag(ACT2_SHADOW_CURSE_IMMUNE);" data "PersonalStatusImmunities" "SG_Condition;SG_Blinded;SG_Charmed;SG_Cursed;SG_Disease;SG_Exhausted;SG_Frightened;SG_Incapacitated;SG_Invisible;SG_Poisoned;SG_Prone;SG_Restrained;SG_Stunned;SG_Unconscious;SG_Polymorph;SG_Paralyzed;SG_Petrified;SG_Drunk;SG_Sleeping;SG_CanBePickedUp;SG_Approaching;SG_Taunted;SG_Dominated;SG_Fleeing;SG_Confused;SG_Mad" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "Ethereal;PathfinderDCBoost;Minion" data "BludgeoningResistance" "Resistant" data "SlashingResistance" "Resistant" @@ -7792,7 +7792,7 @@ data "XPReward" "c1d87aaa-7548-44da-b9dd-d17b027a3885" new entry "ANIM_Test_Sorcerer" type "Character" using "POC_Player_Sorcerer" -data "ActionResources" "Movement:99" +data "ActionResources" "Movement:129" new entry "Skeleton_Hound" type "Character" @@ -8416,7 +8416,7 @@ data "Intelligence" "12" data "Wisdom" "15" data "Charisma" "16" data "Vitality" "85" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:5" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Tactical_Discipline;DarknessRules;NPC_Divine;NPCAthletics;" data "Progressions" "0e6da493-5a37-423b-8c28-629462b22faa" @@ -8429,7 +8429,7 @@ data "Intelligence" "12" data "Wisdom" "15" data "Charisma" "18" data "Vitality" "77" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:5" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Tactical_Discipline;DarknessRules;NPC_Divine;DivineFontHarm;NPCAthletics;" data "Progressions" "36c3f8de-3293-4d7b-92bc-ceb3c569244b" @@ -8461,7 +8461,7 @@ new entry "Banite_IronConsul_Dwarf" type "Character" using "Banite_IronConsul" data "Weight" "75" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:5" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Tactical_Discipline;Dwarf_DwarvenResilience;Darkvision;DarknessRules;NPC_Divine;NPCIntimidation" data "DarkvisionRange" "9" @@ -8627,7 +8627,7 @@ data "ProficiencyBonus" "2" data "SpellCastingAbility" "Charisma" data "UnarmedAttackAbility" "Strength" data "UnarmedRangedAttackAbility" "Dexterity" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;NPCIntimidation" data "LightningResistance" "Immune" data "ThunderResistance" "None" @@ -8673,7 +8673,7 @@ data "ProficiencyBonus" "2" data "SpellCastingAbility" "Intelligence" data "UnarmedAttackAbility" "Strength" data "UnarmedRangedAttackAbility" "Dexterity" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;ShortResting;NPCIntimidation" data "MinimumDetectionRange" "2" data "DarkvisionRange" "0" @@ -8737,7 +8737,7 @@ data "ProficiencyBonus" "2" data "SpellCastingAbility" "Intelligence" data "UnarmedAttackAbility" "Dexterity" data "UnarmedRangedAttackAbility" "Dexterity" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Ethereal;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;ShortResting" data "FireResistance" "Immune" data "MinimumDetectionRange" "2" @@ -8806,7 +8806,7 @@ data "ProficiencyBonus" "2" data "SpellCastingAbility" "Strength" data "UnarmedAttackAbility" "Strength" data "UnarmedRangedAttackAbility" "Dexterity" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;ShortResting" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -8986,7 +8986,7 @@ type "Character" using "WYR_Circus_Elf_Caster" data "Wisdom" "14" data "Vitality" "52" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SorceryPoint:8" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SorceryPoint:8" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;FeyAncestry;DarknessRules;Darkvision;DraconicResilience;DraconicAncestry_Green;Metamagic_Distant_NPC;ElementalAffinity_Resistance_Check;ElementalAffinity_Damage;NPCIntimidation" new entry "DEN_Bard_Backup" @@ -9010,7 +9010,7 @@ data "Charisma" "14" data "Vitality" "75" data "XPReward" "206b753f-bc3b-46af-98b9-0c711d98c678" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Class" "Druid" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;ShortResting;NonLethal;WeaponThrow;Perform;DarknessRules;CombatStartAttack" data "Progressions" "7e76da16-650c-4a6e-85b0-f9e23a7f5a60" @@ -9020,7 +9020,7 @@ new entry "DEN_Archdruid_Boss_Revenge" type "Character" using "DEN_Archdruid_Boss" data "Vitality" "56" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;ShortResting;NonLethal;WeaponThrow;Perform;DarknessRules;CombatStartAttack;HalsinSpells" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE" @@ -9095,7 +9095,7 @@ data "Charisma" "20" data "Vitality" "120" data "Flags" "ObscurityWithoutSneaking;EnableObscurityEvents" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;ChannelOath:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;ChannelOath:1;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;TWN_PlaquePuzzle_Charisma;SunlightSensitivity;SHA_VisionOfShar;LivingShadow;AttackOfOpportunity;Darkvision;DarknessRules;NPC_Divine;WillExpert;ACExpert;WeaponExpert;WeaponSpecialization;CriticalSpecialization;NPCIntimidation;NPCAthletics;" data "Progressions" "" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: PLAQUEPUZZLE_PALADIN_HARDCORE" @@ -9108,7 +9108,7 @@ data "Charisma" "12" data "Vitality" "117" data "Flags" "ObscurityWithoutSneaking;EnableObscurityEvents" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:3:3:3;SpellSlot:1:1:4" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:3:3:3;SpellSlot:1:1:4" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;TWN_PlaquePuzzle_Wisdom;SunlightSensitivity;SHA_VisionOfShar;LivingShadow;AttackOfOpportunity;Darkvision;DarknessRules;NPC_Divine;WillExpert;CritConvert_Resolve;ACExpert;WeaponExpert;NPCAthletics;" data "Progressions" "" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: PLAQUEPUZZLE_CLERIC_HARDCORE" @@ -9121,7 +9121,7 @@ data "Dexterity" "12" data "Intelligence" "20" data "Charisma" "12" data "Vitality" "109" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:3:3:3;SpellSlot:1:1:4" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:3:3:3;SpellSlot:1:1:4" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;TWN_PlaquePuzzle_Intelligence;SunlightSensitivity;SHA_VisionOfShar;LivingShadow;AttackOfOpportunity;Darkvision;DarknessRules;NPC_Divine;WillExpert;ACExpert;WeaponExpert;SpellExpert;NPCAthletics;" data "Progressions" "" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: PLAQUEPUZZLE_WIZARD_HARDCORE" @@ -9222,7 +9222,7 @@ data "Vitality" "112" data "XPReward" "4ee02692-eb98-43a6-803f-2da645364568" data "PersonalStatusImmunities" "" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:6:6:4;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:6:6:4;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;SHA_VisionOfShar;SHA_Lyrthindor_UnlockExtraSpellSlots;AttackOfOpportunity;Darkvision;DarknessRules;NPC_Divine;TouchOfTheVoid;Cruelty;NPCIntimidation;NPCAthletics;" data "NecroticResistance" "" data "RadiantResistance" "" @@ -9239,7 +9239,7 @@ data "Intelligence" "16" data "Charisma" "14" data "Vitality" "76" data "XPReward" "4ee02692-eb98-43a6-803f-2da645364568" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:1;SpellSlot:1:1:2;SpellSlot:1:1:3" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:1;SpellSlot:1:1:2;SpellSlot:1:1:3" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;MistyEscape_ShadarKai_GloomWeaver;FeyAncestry;Darkvision;DarknessRules;NPC_Occult;NPCIntimidation" data "RadiantResistance" "None" @@ -9267,7 +9267,7 @@ data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Surprise_ new entry "SCL_Oliver_Mom" type "Character" using "Wraith" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:2:2:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:2:2:1" data "Passives" "GhostResist_10;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AuraOfVileOblivion_Technical;VileOblivion;Ethereal;SunlightSensitivity;Darkvision;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;NPC_Occult;NPCIntimidation" new entry "SCL_Oliver_Mom_NoShadowblend" @@ -9277,7 +9277,7 @@ using "SCL_Oliver_Mom" new entry "SCL_Oliver_Dad" type "Character" using "Wraith" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:2:2:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:2:2:1" data "Passives" "GhostResist_10;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AuraOfVileOblivion_Technical;VileOblivion;Ethereal;SunlightSensitivity;Darkvision;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;NPC_Occult;NPCIntimidation" new entry "SCL_Oliver_Dad_NoShadowblend" @@ -9530,7 +9530,7 @@ data "Level" "5" data "Constitution" "16" data "Intelligence" "18" data "Vitality" "80" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:1;SpellSlot:3:3:2;SpellSlot:2:2:3;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:1;SpellSlot:3:3:2;SpellSlot:2:2:3;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;WarMagic_Githyanki;Parry_Githyanki;AttackOfOpportunity;DarknessRules;Surprise_Immunity;Parry_Githyanki_EquipTrigger;ACExpert;WeaponExpert;WeaponSpecialization;CriticalSpecialization" data "Proficiency Group" "Darts;Daggers;Slings;LightCrossbows;Quarterstaffs;Greatswords;LightArmor;Longswords;Shortswords;MediumArmor;HeavyArmor" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: GITHYANKI_CAPTAIN_HARDCORE" @@ -9601,7 +9601,7 @@ data "Charisma" "17" data "Vitality" "281" data "XPReward" "206b753f-bc3b-46af-98b9-0c711d98c678" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:5:5:1;SpellSlot:4:4:2;SpellSlot:3:3:3;SpellSlot:3:3:4;SpellSlot:3:3:5;SpellSlot:3:3:6;SpellSlot:3:3:7;SpellSlot:2:2:8;SpellSlot:2:2:9;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:5:5:1;SpellSlot:4:4:2;SpellSlot:3:3:3;SpellSlot:3:3:4;SpellSlot:3:3:5;SpellSlot:3:3:6;SpellSlot:3:3:7;SpellSlot:2:2:8;SpellSlot:2:2:9;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Alert;EmpoweredEvocation;FocusedConjuration;MagicResistance;SpellSniper_Critical;DarknessRules;NPC_Arcane;ReflexMaster;WillLegend;FortitudeMaster;WeaponMaster;SpellLegend;ACMaster;PerceptionIncrease;PerceptionIncrease2;AcrobaticsIncrease;AthleticsIncrease;NPCIntimidation;ElminsterSpells" data "Progressions" "" @@ -9843,7 +9843,7 @@ data "Weight" "0.01" data "SoundSize" "Large" data "Flags" "Grounded;EnableObscurityEvents;ObscurityWithoutSneaking" data "PersonalStatusImmunities" "SG_Poisoned;EXHAUSTED;PARALYZED;HOLD_PERSON;PETRIFIED;PRONE;RESTRAINED;POISONED;KNOCKED_DOWN;ABJURE_ENEMY_FRIGHT;NET;BLEEDING;GAPING_WOUND;GRAPPLED;FEARED" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "GhostResist_5;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;SunlightWeakness;DarknessRules;Darkvision;Ethereal;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -10113,7 +10113,7 @@ data "Vitality" "135" data "XPReward" "4ee02692-eb98-43a6-803f-2da645364568" data "StepsType" "Metal" data "PersonalStatusImmunities" "SG_Frightened" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:2:2:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:2:2:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;GreatWeaponMaster_BonusAttack;DivineGrace;FeralInstinct;AttackOfOpportunity;DarknessRules;NPCAthletics;" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: HAV_FLAMINGSPY_HARDCORE" @@ -10129,7 +10129,7 @@ data "Charisma" "15" data "Vitality" "64" data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;Lava,700;Fire,40;HolyFire,40;Hellfire,100;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,70;Grease,30;Web,30;Vines,40;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Class" "Druid" data "Progressions" "9dc4240b-cd1a-4905-afbb-d2718477f617" data "Proficiency Group" "SimpleWeapons;MediumArmor;LightArmor" @@ -10470,7 +10470,7 @@ data "Intelligence" "11" data "Wisdom" "14" data "Charisma" "13" data "Vitality" "93" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SuperiorityDie:4" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SuperiorityDie:4" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Ruffian;DarknessRules;NPCAthletics;" new entry "LOW_Guildhall_Phase" @@ -10634,7 +10634,7 @@ data "Intelligence" "18" data "Wisdom" "16" data "Charisma" "18" data "Vitality" "24" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" new entry "LOW_TheLodge_Warlock" type "Character" @@ -10642,7 +10642,7 @@ using "GOB_Dwarf_Warlock" data "Intelligence" "16" data "Vitality" "87" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:2:2:5;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:2:2:5;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Darkvision;Dwarf_DwarvenResilience;AgonizingBlast;EldritchSpear;NPCIntimidation" data "Proficiency Group" "Darts;Daggers;Slings;LightCrossbows;Quarterstaffs;Battleaxes;Warhammers;Handaxes" @@ -10654,7 +10654,7 @@ data "Intelligence" "14" data "Charisma" "18" data "Vitality" "79" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Dwarf_DwarvenResilience;Duergar_DuergarResilience;SunlightSensitivity;SuperiorDarkvision;DarknessRules;NPC_Arcane;NPCIntimidation" data "Progressions" "229c98da-2cd1-4a5e-8051-9d90ec7931e7" data "Proficiency Group" "SimpleWeapons;HandCrossbows;Longbows;Rapiers;Shortswords;MusicalInstrument" @@ -10671,7 +10671,7 @@ using "Elf_Drow_Caster" data "Dexterity" "11" data "Intelligence" "18" data "Vitality" "60" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;WildShape:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;WildShape:1" new entry "UND_KC_Duergar_Caster" type "Character" @@ -10690,7 +10690,7 @@ data "Wisdom" "13" data "Charisma" "11" data "Armor" "10" data "Vitality" "90" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:3:3:3;SpellSlot:3:3:4;SpellSlot:2:2:5;SpellSlot:1:1:6;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:4:4:1;SpellSlot:3:3:2;SpellSlot:3:3:3;SpellSlot:3:3:4;SpellSlot:2:2:5;SpellSlot:1:1:6;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;SuperiorDarkvision;Dwarf_DwarvenResilience;Duergar_DuergarResilience;SunlightSensitivity;DraconicResilience;ElementalAffinity_Damage;DraconicAncestry_Silver;NPC_Primal;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "Progressions" "" @@ -10717,7 +10717,7 @@ new entry "LOW_HagsSurvivors_Jatlo" type "Character" using "LOW_BlushingMermaid_Redcap_Melee" data "Dexterity" "16" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:20:20:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:20:20:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;LOW_HagSurvivors_Bloodlust;DarknessRules;Darkvision;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;ReflexExpert;WillMaster;FortitudeMaster;WeaponExpert;ACExpert;PerceptionIncrease;PerceptionIncrease2;NPCAthletics;" new entry "LOW_Masked_Barbarian" @@ -10783,7 +10783,7 @@ data "SoundSize" "Medium" data "Flags" "Floating;EnableObscurityEvents;ObscurityWithoutSneaking" data "PersonalStatusImmunities" "GAPING_WOUND;CHEST_TRAUMA;BLEEDING;SG_Charmed;SG_Exhausted;SG_Frightened;GRAPPLED;SG_Paralyzed;SG_Petrified;SG_Poisoned;SG_Prone;SG_Restrained;DISARM;HEAT_METAL;HEAT_METAL_DISADVANTAGE;HEAT_METAL_REAPPLY;HEAT_METAL_TECHNICAL;HEAT_METAL_3;HEAT_METAL_TECHNICAL_3;HEAT_METAL_REAPPLY_3;HEAT_METAL_4;HEAT_METAL_REAPPLY_4;HEAT_METAL_TECHNICAL_4;HEAT_METAL_5;HEAT_METAL_6;HEAT_METAL_TECHNICAL_5;HEAT_METAL_TECHNICAL_6;HEAT_METAL_REAPPLY_5;HEAT_METAL_REAPPLY_6" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SorceryPoint:12" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SorceryPoint:12" data "Passives" "GhostResist_5;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Ethereal;TurnResistance;IncorporealMovement;FeyAncestry;SunlightSensitivity;DarknessRules;Darkvision;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;Metamagic_Distant_NPC;NPCIntimidation" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -10815,7 +10815,7 @@ data "SoundSize" "Medium" data "Flags" "Floating;EnableObscurityEvents;ObscurityWithoutSneaking" data "PersonalStatusImmunities" "GAPING_WOUND;CHEST_TRAUMA;BLEEDING;SG_Charmed;SG_Exhausted;SG_Frightened;GRAPPLED;SG_Paralyzed;SG_Petrified;SG_Poisoned;SG_Prone;SG_Restrained;DISARM;HEAT_METAL;HEAT_METAL_DISADVANTAGE;HEAT_METAL_REAPPLY;HEAT_METAL_TECHNICAL;HEAT_METAL_3;HEAT_METAL_TECHNICAL_3;HEAT_METAL_REAPPLY_3;HEAT_METAL_4;HEAT_METAL_REAPPLY_4;HEAT_METAL_TECHNICAL_4;HEAT_METAL_5;HEAT_METAL_6;HEAT_METAL_TECHNICAL_5;HEAT_METAL_TECHNICAL_6;HEAT_METAL_REAPPLY_5;HEAT_METAL_REAPPLY_6" data "SpellCastingAbility" "Wisdom" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SorceryPoint:12" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SorceryPoint:12" data "Passives" "GhostResist_5;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Ethereal;TurnResistance;IncorporealMovement;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;Metamagic_Distant_NPC;NPCIntimidation" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -10846,7 +10846,7 @@ data "GameSize" "Medium" data "SoundSize" "Medium" data "Flags" "Floating;EnableObscurityEvents;ObscurityWithoutSneaking" data "PersonalStatusImmunities" "GAPING_WOUND;CHEST_TRAUMA;BLEEDING;SG_Charmed;SG_Exhausted;SG_Frightened;GRAPPLED;SG_Paralyzed;SG_Petrified;SG_Poisoned;SG_Prone;SG_Restrained;DISARM;HEAT_METAL;HEAT_METAL_DISADVANTAGE;HEAT_METAL_REAPPLY;HEAT_METAL_TECHNICAL;HEAT_METAL_3;HEAT_METAL_TECHNICAL_3;HEAT_METAL_REAPPLY_3;HEAT_METAL_4;HEAT_METAL_REAPPLY_4;HEAT_METAL_TECHNICAL_4;HEAT_METAL_5;HEAT_METAL_6;HEAT_METAL_TECHNICAL_5;HEAT_METAL_TECHNICAL_6;HEAT_METAL_REAPPLY_5;HEAT_METAL_REAPPLY_6" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SorceryPoint:12" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SorceryPoint:12" data "Passives" "GhostResist_5;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Ethereal;TurnResistance;IncorporealMovement;FeyAncestry;DarknessRules;Darkvision;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;Metamagic_Distant_NPC;" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -10993,7 +10993,7 @@ using "Raven_Dire" data "Strength" "8" data "Dexterity" "18" data "Vitality" "19" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Darkvision;" new entry "LOW_GreaseWizard_Elemental" @@ -11002,7 +11002,7 @@ using "Elemental_Mud" data "Strength" "18" data "PersonalStatusImmunities" "SG_Poisoned;MEPHIT_MUD_RESTRAINED;DIFFICULT_TERRAIN_MUD;BLEEDING;GAPING_WOUND;CHEST_TRAUMA;PRONE_GREASE;SG_DifficultTerrain" data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;Lava,700;Fire,40;HolyFire,40;Hellfire,100;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,30;Web,30;Vines,40;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "FireResistance" "Vulnerable" new entry "LOW_GreaseWizard_Mephit" @@ -11028,7 +11028,7 @@ data "Strength" "18" data "Constitution" "16" data "Charisma" "11" data "Vitality" "94" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AttackOfOpportunity;FeyAncestry;DarknessRules;Darkvision;FightingStyle_Dueling;ImprovedCombatSuperiority;Alert;NPCAthletics;" new entry "LOW_FlorrickGoon_Caster" @@ -11178,7 +11178,7 @@ data "PersonalStatusImmunities" "SG_Poisoned;BURNING;BURNING_LAVA;BURNING_TRIAL; data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;Lava,700;HolyFire,40;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,30;Grease,30;Web,30;Vines,40;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" data "ProficiencyBonus" "2" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:0:9:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:0:9:1;" data "Passives" "BldResist_10;SlaResist_10;PrcResist_10;CldResist_5;LgtResist_5;PoiResist_5;LegendaryAction_LOW_Raphael;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Darkvision;FiendishBlessing;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;MagicResistance;DevilsSight;LOW_Raphael_SoulSiphon_Passive;LOW_Raphael_SoulSiphon_Passive_2;LOW_Raphael_SoulSiphon_Passive_3;LOW_Raphael_SoulSiphon_Passive_4;LOW_Raphael_SoulSiphon_Passive_5;LOW_Raphael_SoulSiphon_Passive_6;LOW_Raphael_SoulSiphon_Passive_7;LOW_Raphael_SoulSiphon_Passive_8;LOW_Raphael_SoulSiphon_Passive_9;LOW_Raphael_Reaper;MAG_Infernal_Plate_Armor_Passive;LOW_Raphael_Set_Pillar_Status;LOW_Raphael_ArchfiendWill;NPC_Divine;ReflexExpert;WillLegend;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "ColdResistance" "None" data "FireResistance" "Immune" @@ -11200,7 +11200,7 @@ data "Armor" "14" data "Vitality" "500" data "StepsType" "Clawed" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:0:9:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:0:9:1;" data "Passives" "BldResist_10;SlaResist_10;PrcResist_10;CldResist_5;LgtResist_5;PoiResist_5;LegendaryAction_LOW_Raphael_Ascended;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AttackOfOpportunity;DarknessRules;Darkvision;FiendishBlessing;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;MagicResistance;DevilsSight;LOW_Raphael_SoulSiphon_Passive;LOW_Raphael_SoulSiphon_Passive_2;LOW_Raphael_SoulSiphon_Passive_3;LOW_Raphael_SoulSiphon_Passive_4;LOW_Raphael_SoulSiphon_Passive_5;LOW_Raphael_SoulSiphon_Passive_6;LOW_Raphael_SoulSiphon_Passive_7;LOW_Raphael_SoulSiphon_Passive_8;LOW_Raphael_SoulSiphon_Passive_9;LOW_Raphael_Reaper;MAG_Infernal_Plate_Armor_Passive;LOW_Raphael_Set_Pillar_Status;LOW_Raphael_ArchfiendWill;NPC_Divine;ReflexExpert;WillLegend;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;NPCIntimidation" data "RadiantResistance" "None" @@ -11247,7 +11247,7 @@ data "Vitality" "161" data "PersonalStatusImmunities" "BURNING;DIFFICULT_TERRAIN_MUD;SG_DifficultTerrain;PRONE_GREASE" data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;Lava,700;HolyFire,40;Hellfire,100;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,30;Web,30;Vines,40;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:5:5:2;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:5:5:2;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;FeyAncestry;DarknessRules;Darkvision;SunlightSensitivity;DraconicAncestry_Red;DraconicResilience;LOW_GreaseWizard_ElementalAffinity;NPC_Arcane;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;NPCIntimidation" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE;STATUS_HARD:SEWERS_GREASEWIZARD_HARDCORE;STATUS_HARD:FIRE_SHIELD_WARM;" @@ -11266,7 +11266,7 @@ type "Character" using "DarkJusticiar_Caster" data "Vitality" "74" data "XPReward" "810b5510-6748-4c8e-bef0-d990880ed1dd" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:3;SpellSlot:3:3:2;SpellSlot:4:4:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:3;SpellSlot:3:3:2;SpellSlot:4:4:1;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;Darkvision;DarknessRules;LOW_HouseOfGrief_Cultists_Sight;NPCIntimidation" data "NecroticResistance" "" data "RadiantResistance" "" @@ -11358,14 +11358,14 @@ type "Character" using "Human_Cultist_Bhaal_DeathsHead" data "Wisdom" "16" data "Vitality" "99" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SneakAttack_Charge:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SneakAttack_Charge:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;MagicResistance;MurderHungry;Darkvision;DarknessRules;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;NPCIntimidation" data "ArmorType" "" new entry "LOW_UnholyAssassin_Rycke" type "Character" using "LOW_UnholyAssassin" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;MagicResistance;MurderHungry;Darkvision;DarknessRules;FastHands;FightingStyle_TwoWeaponFighting;DualWielder_PassiveBonuses;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;NPCIntimidation" new entry "LOW_Golbraith" @@ -11510,7 +11510,7 @@ data "Intelligence" "9" data "Wisdom" "16" data "Charisma" "14" data "Vitality" "96" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;Interrupt_HellishRebukeTiefling_Charge:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;Interrupt_HellishRebukeTiefling_Charge:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AttackOfOpportunity;Tiefling_HellishResistance;DarknessRules;Darkvision;Mobile_PassiveBonuses;Mobile_CounterAttackOfOpportunity;Mobile_DashAcrossDifficultTerrain;FightingStyle_Archery;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;NPCIntimidation;NPCAthletics;" data "Proficiency Group" "MediumArmor;LightArmor;Shields;SimpleWeapons;MartialWeapons;HeavyArmor" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE;STATUS_HARD: MOO_WARDEN_HARDCORE" @@ -12481,7 +12481,7 @@ using "Dragonborn_Melee" data "Strength" "20" data "Dexterity" "10" data "Vitality" "86" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SuperiorityDie:5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SuperiorityDie:5" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;NPCIntimidation;NPCAthletics;" data "Progressions" "0e6da493-5a37-423b-8c28-629462b22faa" @@ -12493,7 +12493,7 @@ data "Constitution" "16" data "Intelligence" "8" data "Charisma" "6" data "Vitality" "84" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SuperiorityDie:5" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SuperiorityDie:5" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;NPCAthletics;" new entry "WYR_MessHallBodyguard_08" @@ -12598,7 +12598,7 @@ data "Strength" "18" data "Dexterity" "14" data "Vitality" "42" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:1;SpellSlot:2:2:2;SpellSlot:2:2:3;SpellSlot:1:1:6;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:1;SpellSlot:2:2:2;SpellSlot:2:2:3;SpellSlot:1:1:6;" data "FireResistance" "Immune" new entry "WYR_SmugglersCave_Guild_Gnome" @@ -12974,7 +12974,7 @@ data "Wisdom" "9" data "Charisma" "15" data "Vitality" "79" data "XPReward" "4ee02692-eb98-43a6-803f-2da645364568" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" new entry "WYR_Dribbles_FeyMastiff" type "Character" @@ -13138,7 +13138,7 @@ data "StepsType" "Metal" data "DefaultBoosts" "BlockRegainHP(Living;Construct);ProficiencyBonus(Skill, Athletics);ProficiencyBonus(Skill, Acrobatics);ExpertiseBonus(Acrobatics);ExpertiseBonus(Athletics);" data "PersonalStatusImmunities" "SG_Poisoned;BLEEDING;SLEEPING;GAPING_WOUND;CHEST_TRAUMA;DAZED;SG_Exhausted;FRIGHTENED" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:2:2:5;SpellSlot:3:3:4;SpellSlot:3:3:3;SpellSlot:3:3:2;SpellSlot:4:4:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:2:2:5;SpellSlot:3:3:4;SpellSlot:3:3:3;SpellSlot:3:3:2;SpellSlot:4:4:1;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AttackOfOpportunity;DarknessRules;Darkvision;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;MagicResistance;Parry;WeaponMaster;NecroticAttacks_DeathKnight;Riposte;HellfireDamagePierce_Technical;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;WeaponSpecialization;CriticalSpecialization;SpellExpert;ACExpert;PerceptionIncrease;NPCIntimidation" data "BludgeoningResistance" "" data "NecroticResistance" "Immune" @@ -13190,7 +13190,7 @@ type "Character" using "FlamingSphere" data "Vitality" "199" data "XPReward" "810b5510-6748-4c8e-bef0-d990880ed1dd" -data "ActionResources" "BonusActionPoint:1;Movement:12" +data "ActionResources" "BonusActionPoint:1;Movement:16" data "Passives" "AttackOfOpportunity;DarknessRules;HellfireDamagePierce_Technical" data "ColdResistance" "None" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE" @@ -13413,7 +13413,7 @@ data "Wisdom" "18" data "Charisma" "11" data "Vitality" "88" data "PersonalStatusImmunities" "GAPING_WOUND;CHEST_TRAUMA;BLEEDING;SG_Charmed;SG_Exhausted;SG_Frightened;GRAPPLED;SG_Paralyzed;SG_Petrified;SG_Poisoned;SG_Prone;SG_Restrained;DISARM;HEAT_METAL;HEAT_METAL_3;HEAT_METAL_4;HEAT_METAL_5;HEAT_METAL_6" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;DispelEvilAndGood_Charm_Check;DispelEvilAndGood_Frightened_Check;DispelEvilAndGood_Possessed_Check;Ethereal;Darkvision;IncorporealMovement;LOW_Houndmaster_CompanionsBond;FightingStyle_Archery;CrossbowExpert_PointBlank;CrossbowExpert_Wounding" data "Progressions" "f0ede459-8b86-48fd-ac11-4432573566a5" data "Proficiency Group" "SimpleWeapons;MartialWeapons" @@ -13428,7 +13428,7 @@ data "Intelligence" "11" data "Wisdom" "12" data "Charisma" "16" data "Vitality" "88" -data "ActionResources" "ActionPoint:3;BonusActionPoint:2;Movement:7.5;ReactionActionPoint:1;SneakAttack_Charge:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:2;Movement:10;ReactionActionPoint:1;SneakAttack_Charge:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Darkvision;Dwarf_DwarvenResilience;Evasion;ReliableTalent;Assassinate_Initiative;Alert;LOW_Potion_Master;Resilient_Wisdom;NPCIntimidation" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE;STATUS_HARD:LOW_DOLOR_HARDCORE" @@ -13858,7 +13858,7 @@ using "GOB_Dwarf_Warlock" data "Vitality" "96" data "GameSize" "Medium" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Darkvision;Dwarf_DwarvenResilience;LOW_DevilsFee_Bounty;AgonizingBlast;RepellingBlast;DevilsSight;EldritchSpear;DarkOnesOwnLuck;NPCIntimidation" data "Progressions" "51274504-865d-46d1-a3b6-c72e9384904a" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE;STATUS_HARD:DEVILSFEE_HELSIK_HARDCORE" @@ -14263,7 +14263,7 @@ data "Flags" "Grounded" data "DefaultBoosts" "BlockRegainHP(Undead;Construct);Initiative(-20);" data "PersonalStatusImmunities" "SG_Stunned;PARALYZED;SG_Prone;SG_Blinded;SG_Frightened;SG_Charmed;SG_Charmed_Subtle;SG_Paralyzed;SG_Polymorph;SG_Incapacitated;SG_Fleeing;SG_Dominated;SG_Sleeping;SG_Unconscious;SG_Confused;SG_Taunted;SG_Drunk;SG_Exhausted;SG_Mad;SG_Petrified;SG_Poisoned" data "ProficiencyBonus" "2" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "DarknessRules;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;ReflexExpert;WillExpert;FortitudeExpert;WeaponExpert;SpellExpert;ACExpert;PerceptionIncrease;" data "BludgeoningResistance" "Immune" data "SlashingResistance" "Immune" @@ -14323,7 +14323,7 @@ data "Strength" "20" data "Constitution" "17" data "Charisma" "15" data "Vitality" "99" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SpellSlot:3:3:2;SpellSlot:4:4:1;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SpellSlot:3:3:2;SpellSlot:4:4:1;" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;BloodFrenzy_Sahuagin;WeaponExpert;DarknessRules;Smite_Divine_NPC;Smite_Divine_2_NPC;ChampionsAura;IniquityCause;TouchOfTheVoid;Domain_Pain;NPCIntimidation" data "Proficiency Group" "Spears;Longbows;Glaives" @@ -14490,7 +14490,7 @@ data "Charisma" "17" data "Vitality" "36" data "XPReward" "4ee02692-eb98-43a6-803f-2da645364568" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;Interrupt_HellishRebukeTiefling_Charge:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;Interrupt_HellishRebukeTiefling_Charge:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AttackOfOpportunity;DarknessRules;Tiefling_HellishResistance;FightingStyle_Defense;Tough;RedemptionCause;ShieldsOfTheSpirit;NPCIntimidation;NPCAthletics;" data "Progressions" "8726b2c4-edc0-4905-b82f-60a4baba0733" data "Proficiency Group" "MartialWeapons;MediumArmor;SimpleWeapons;LightArmor;HeavyArmor" @@ -15312,7 +15312,7 @@ using "Githyanki_Rogue" data "Strength" "15" data "Dexterity" "18" data "Vitality" "65" -data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:9;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:0;Movement:12;ReactionActionPoint:1" data "Proficiency Group" "HeavyArmor;LightArmor;MediumArmor;SimpleWeapons;MartialWeapons" new entry "PLA_Githyanki_Ranger" @@ -15349,7 +15349,7 @@ data "Armor" "10" data "Vitality" "250" data "ProficiencyBonus" "2" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;AttackOfOpportunity;DarknessRules;PsychicStrikes_Githyanki;Parry_Githyanki_Supreme;Parry_Githyanki_Supreme_EquipTrigger;" data "Proficiency Group" "MartialWeapons;MediumArmor;SimpleWeapons;HeavyArmor;LightArmor" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: VOSS_HARDCORE" @@ -15751,7 +15751,7 @@ data "Intelligence" "18" data "Wisdom" "14" data "Charisma" "14" data "Vitality" "70" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;MartialAdvantage;Darkvision;DarknessRules;" data "Progressions" "44bdbc5e-a003-4d61-87f0-5ced20d3804e" @@ -15806,7 +15806,7 @@ data "Intelligence" "18" data "Wisdom" "16" data "Charisma" "16" data "Vitality" "62" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "Passives" "PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;" data "Progressions" "44bdbc5e-a003-4d61-87f0-5ced20d3804e" @@ -16114,7 +16114,7 @@ data "Charisma" "20" data "Vitality" "89" data "Flags" "EnableObscurityEvents;ObscurityWithoutSneaking" data "SpellCastingAbility" "Charisma" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1;SorceryPoint:12;" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1;SorceryPoint:12;" data "Passives" "BldResist_10;SlaResist_10;PrcResist_10;CldResist_10;FirResist_10;LgtResist_10;PoiResist_10;PathfinderDCBoost;OffGuardRules;MultipleAttackPenalty;DarknessRules;Metamagic_Quickened;Metamagic_Twinned;Metamagic_Extended;Metamagic_Distant;Metamagic_Heightened;MagicResistance" data "BludgeoningResistance" "ResistantToNonMagical" data "SlashingResistance" "ResistantToNonMagical" @@ -16254,7 +16254,7 @@ data "Sight" "2000" data "Weight" "5000" data "PersonalStatusImmunities" "PETRIFIED;SG_Charmed;SG_Frightened;PARALYZED;SG_Poisoned;UNCONSCIOUS;KNOCKED_OUT;BURNING;BURNING_LAVA;STUNNED;BLEEDING;GAPING_WOUND;CHEST_TRAUMA;DAZED;WILD_MAGIC_BURNING;DAZED;DIFFICULT_TERRAIN_LAVA" data "PathInfluence" "BloodElectrified,100;BloodFrozen,30;PoisonCloud,70;WyvernPoison,70;DrowPoisonCloud,70;PurpleWormPoison,70;SerpentVenom,70;InvisibleGithAcid,70;CloudkillCloud,70;MaliceCloud,70;CrawlerMucusCloud,70;WaterElectrified,100;WaterFrozen,30;Grease,30;Web,30;Vines,40;SporeBlackCloud,100;WaterCloudElectrified,40;SporeGreenCloud,40;Acid,30;CausticBrine,40;DarknessCloud,30;FogCloud,30;Mud,30;Oil,30;Poison,30;SpikeGrowth,40;SporePinkCloud,40;StinkingCloud,40" -data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:7.5;ReactionActionPoint:1" +data "ActionResources" "ActionPoint:3;BonusActionPoint:1;Movement:10;ReactionActionPoint:1" data "RadiantResistance" "Immune" data "DarkvisionRange" "20" data "DifficultyStatuses" "STATUS_EASY: HEALTHREDUCTION_EASYMODE; STATUS_HARD: HEALTHBOOST_HARDCORE; STATUS_HARD: UND_ADAMANTINEGOLEM_HARDCORE" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Interrupt.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Interrupt.txt index f97f05c8..fd44ab0a 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Interrupt.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Interrupt.txt @@ -21,7 +21,7 @@ data "Icon" "PassiveFeature_AttackOfOpportunity" data "InterruptContext" "OnSpellCast;OnPostRoll" data "InterruptContextScope" "Nearby" data "Container" "YesNoDecision" -data "Conditions" "IsAbleToReact(context.Observer) and not Self(context.Source, context.Observer) and Enemy(context.Source, context.Observer) and not Uninterruptible() and not DistanceToEntityGreaterThan(2, context.ObserverPosition, context.Source) and not AnyEntityIsItem() and ((IsSpell() and HasSpellFlag(SpellFlags.Somatic)) or IsRangedAttack());" +data "Conditions" "IsAbleToReact(context.Observer) and not Self(context.Source, context.Observer) and Enemy(context.Source, context.Observer) and not Uninterruptible() and not DistanceToEntityGreaterThan(2.5, context.ObserverPosition, context.Source) and not AnyEntityIsItem() and ((IsSpell() and HasSpellFlag(SpellFlags.Somatic)) or IsRangedAttack());" data "Roll" "Attack(AttackType.MeleeWeaponAttack)" data "Success" "IF(IsCritical()):Counterspell();ApplyStatus(OBSERVER_OBSERVER,INTERRUPT_RIPOSTE,100,0);UseSpell(OBSERVER_SOURCE,Target_AttackOfOpportunity_Crit,true,true,true);" data "Failure" "UseAttack(OBSERVER_SOURCE);" @@ -128,6 +128,19 @@ data "InterruptDefaultValue" "Ask;Enabled" data "EnableCondition" "not HasStatus('SG_Polymorph') or Tagged('MINDFLAYER') or HasStatus('SG_Disguise')" data "EnableContext" "OnStatusApplied;OnStatusRemoved" +new entry "VolleyReaction" +type "InterruptData" +data "DisplayName" "had44ddafg1e58g731ag0f68gfcd6bb92336c;1" +data "Description" "h18ede37eg241cgc067gd729g0f7712d8a235;2" +data "Icon" "PassiveFeature_FightingStyle_Archery" +data "InterruptContext" "OnPostRoll" +data "InterruptContextScope" "Far" +data "Container" "YesNoDecision" +data "Conditions" "HasPassive('Volley30',context.Source) and Volley(12,context.SourcePosition,context.TargetPosition) and IsRangedWeaponAttack() and SpellTypeIs(SpellType.Projectile) and not Self(context.Observer, context.Source) and Self(context.Observer, context.Target);" +data "Properties" "AdjustRoll(-2);" +data "InterruptDefaultValue" "Ask;Enabled" +data "EnableContext" "OnStatusApplied;OnStatusRemoved" + new entry "DeflectProjectileInterrupt" type "InterruptData" data "DisplayName" "h41c21140g9eccg9045g2e3fgb66df9f11b69;1" @@ -236,7 +249,7 @@ using "GlimpseOfRedemptionInterrupt" data "DisplayName" "h61ad8513g425cgf293g5de4g75182741982f;1" data "Description" "h0b5b2ee0g7b09g675dgc3d7g35e83402acd7;2" data "Icon" "Action_RighteousClarity" -data "Conditions" "IsAbleToReact(context.Observer) and not DistanceToEntityGreaterThan(2, context.ObserverPosition, context.Source) and not Self(context.Target,context.Observer) and Enemy(context.Source, context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Target,context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Source,context.Observer) and not AnyEntityIsItem();" +data "Conditions" "IsAbleToReact(context.Observer) and not DistanceToEntityGreaterThan(2.5, context.ObserverPosition, context.Source) and not Self(context.Target,context.Observer) and Enemy(context.Source, context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Target,context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Source,context.Observer) and not AnyEntityIsItem();" data "Properties" "AdjustRoll(OBSERVER_TARGET,-(LevelMapValue(CharacterLevel)+2));ApplyStatus(OBSERVER_TARGET,WAR_GODS_BLESSING,100,0);UseAttack(OBSERVER_SOURCE);" data "TooltipDamageList" "RestoreHitPoints(MainMeleeWeapon, MainMeleeWeaponDamageType);RestoreHitPoints(LevelMapValue(CharacterLevel)+2)" data "TooltipStatusApply" "" @@ -309,7 +322,7 @@ data "DisplayName" "h76f9f748g31bbgb119g1903g2cfdb3d48f17;1" data "Description" "ha621b52eg9e4bg6cd3g5c1cg7fee9c8a367d;1" data "Icon" "Spell_Cleric_TurnUndead" data "InterruptContextScope" "Nearby" -data "Conditions" "not Dead(context.Observer) and HasInterruptedSavingThrow() and Ally(context.Observer,context.Target) and not AnyEntityIsItem() and not DistanceToEntityGreaterThan(2, context.ObserverPosition, context.Source);" +data "Conditions" "not Dead(context.Observer) and HasInterruptedSavingThrow() and Ally(context.Observer,context.Target) and not AnyEntityIsItem() and not DistanceToEntityGreaterThan(2.5, context.ObserverPosition, context.Source);" data "Properties" "AdjustRoll(OBSERVER_TARGET,2);UseAttack(OBSERVER_SOURCE)" new entry "DeathCallInterrupt" @@ -333,7 +346,7 @@ using "GlimpseOfRedemptionInterrupt" data "DisplayName" "h8c7ae051gedcdgf7fcg141dgba6603c89cd1;2" data "Description" "h80410f33g989bg7a32g173cgbde178e57270;1" data "Icon" "PassiveFeature_ProjectedWard" -data "Conditions" "IsAbleToReact(context.Observer) and not Self(context.Target,context.Observer) and Enemy(context.Source, context.Observer) and not AnyEntityIsItem() and not DistanceToEntityGreaterThan(9, context.ObserverPosition, context.Source);" +data "Conditions" "IsAbleToReact(context.Observer) and not Self(context.Target,context.Observer) and Enemy(context.Source, context.Observer) and not AnyEntityIsItem() and not DistanceToEntityGreaterThan(12, context.ObserverPosition, context.Source);" data "Properties" "AdjustRoll(OBSERVER_TARGET,-(LevelMapValue(ProtectorsSacrifice)));ApplyStatus(OBSERVER_TARGET,WAR_GODS_BLESSING,100,0);DealDamage(OBSERVER_OBSERVER,LevelMapValue(ProtectorsSacrifice),Necrotic);ApplyStatus(OBSERVER_OBSERVER,DIVINESTRIKE_MELEE_VFX,100,1);" data "Cost" "ReactionActionPoint:1;KiPoint:1" data "EnableCondition" "not HasStatus('SG_Polymorph') or Tagged('MINDFLAYER') or HasStatus('SG_Disguise')" @@ -433,7 +446,7 @@ type "InterruptData" using "Interrupt_Riposte" data "DisplayName" "h72d4cd23gfcdbg494bg554bg36c6a96000e1;1" data "Description" "hf16a4a62g4777gc6c6ge587gb167f71efb70;1" -data "Conditions" "IsAbleToReact(context.Observer) and Enemy(context.Source,context.Observer) and IsMeleeAttack() and IsMiss() and IsCriticalMiss() and not HasStatus('INVISIBILITY') and not AnyEntityIsItem() and not DistanceToEntityGreaterThan(2, context.ObserverPosition, context.Source) and HasLastAttackTriggered();" +data "Conditions" "IsAbleToReact(context.Observer) and Enemy(context.Source,context.Observer) and IsMeleeAttack() and IsMiss() and IsCriticalMiss() and not HasStatus('INVISIBILITY') and not AnyEntityIsItem() and not DistanceToEntityGreaterThan(2.5, context.ObserverPosition, context.Source) and HasLastAttackTriggered();" data "Properties" "UseAttack(OBSERVER_SOURCE);ApplyStatus(OBSERVER_OBSERVER,INTERRUPT_RIPOSTE,100,0)" data "Cost" "ReactionActionPoint:1" data "InterruptDefaultValue" "Ask;Enabled" @@ -484,7 +497,7 @@ type "InterruptData" using "Interrupt_Critspec_Knife" data "DisplayName" "h0f92bae1g0c70g59e2g79f4gc83bee98c91e;1" data "Description" "hfeea3dc6gf4d6gde75g8a91g97114dc30d49;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "Action_PushingAttack_Melee" data "Conditions" "IsAbleToReact(context.Observer) and (IsWeaponOfProficiencyGroup('Clubs|Greatclubs|Maces|Morningstars|Quarterstaffs', GetAttackWeapon()) and IsMeleeAttack() and IsWeaponAttack()) and not Item() and Self(context.Source,context.Observer) and HasDamageEffectFlag(DamageFlags.Hit) and IsCritical() and not IsKillingBlow() and not AnyEntityIsItem();" data "Properties" "ApplyStatus(CRITSPEC_CLUB,100,1)" @@ -547,7 +560,7 @@ type "InterruptData" using "Interrupt_Critspec_Knife" data "DisplayName" "h13fe6950g8133g1af6ge1begee321886d267;1" data "Description" "h8878f354g7e5fgaeacge196gb7f7516f428d;2" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "Icon" "Action_Monster_Gortash_ReelIn" data "Conditions" "IsAbleToReact(context.Observer) and (IsWeaponOfProficiencyGroup('Glaives|Halberds', GetAttackWeapon()) and IsMeleeAttack() and IsWeaponAttack()) and not Item() and Self(context.Source,context.Observer) and HasDamageEffectFlag(DamageFlags.Hit) and IsCritical() and not IsKillingBlow() and not AnyEntityIsItem();" data "Properties" "ApplyStatus(CRITSPEC_POLE_TARGET,100,1);ApplyStatus(OBSERVER_OBSERVER,CRITSPEC_POLE_UNLOCK,100,1)" @@ -600,7 +613,7 @@ new entry "Interrupt_FreezingRime" type "InterruptData" data "DisplayName" "hb6ee701cgc4c3g7c8ag0ee1gd1db09a81a66;1" data "Description" "h9680e04cg69cbgdfffg7054g8491af930bea;1" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "Icon" "Action_Monster_ElementalWater_WintersBreath" data "InterruptContext" "OnStatusApplied" data "InterruptContextScope" "Self" @@ -627,7 +640,7 @@ new entry "Interrupt_Debilitation_Speed" type "InterruptData" data "DisplayName" "h32a52a1cg0d5dg2f9bg816dg1dc9164d9b67;1" data "Description" "h8fb325f9g8353g6668gb33cg52450dc11d02;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "PassiveFeature_Sentinel_ZeroSpeed" data "InterruptContext" "OnStatusApplied" data "InterruptContextScope" "Nearby" @@ -881,7 +894,7 @@ new entry "Interrupt_CounterPerformance" type "InterruptData" data "DisplayName" "h49da0680g66f2g6140g4e57gbd0af8be2bce;1" data "Description" "h6a8d63cagd0cagdf35gd869gdd2520366fc4;2" -data "DescriptionParams" "Distance(18)" +data "DescriptionParams" "Distance(24)" data "Icon" "PassiveFeature_MagicInitiateBard" data "InterruptContext" "OnPostRoll" data "InterruptContextScope" "Self;Nearby;Far" @@ -922,7 +935,7 @@ data "DisplayName" "h5d8bd820g05e7ga357ge758gc2822ac2f4a9;1" data "Description" "h406f41bcg1b65g0594g8a35g4d6db184d973;1" data "InterruptContext" "OnPostRoll" data "InterruptContextScope" "Nearby" -data "Conditions" "IsAbleToReact(context.Observer) and not Self(context.Source,context.Observer) and HasInterruptedAttack() and IsMeleeAttack() and Ally(context.Source, context.Observer) and not DistanceToEntityGreaterThan(2, context.ObserverPosition, context.Source);" +data "Conditions" "IsAbleToReact(context.Observer) and not Self(context.Source,context.Observer) and HasInterruptedAttack() and IsMeleeAttack() and Ally(context.Source, context.Observer) and not DistanceToEntityGreaterThan(2.5, context.ObserverPosition, context.Source);" data "Properties" "UseAttack(OBSERVER_TARGET);" new entry "NimbleStrike_Interrupt" @@ -1137,8 +1150,8 @@ data "TooltipStatusApply" "ApplyStatus(IronCommandPersistent_Rank1,100,1);" new entry "NimbleRetribution" type "InterruptData" using "RetributiveStrikeInterrupt" -data "DisplayName" "h3a48df64g596bgc4a1gbd62gf543b6016d70;1" -data "Conditions" "IsAbleToReact(context.Observer) and not DistanceToEntityGreaterThan(4, context.ObserverPosition, context.Source) and not Self(context.Target,context.Observer) and Enemy(context.Source, context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Target,context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Source,context.Observer) and not AnyEntityIsItem();" +data "DisplayName" "h3a48df64g596bgc4a1gbd62gf543b6016d70;2" +data "Conditions" "IsAbleToReact(context.Observer) and not DistanceToEntityGreaterThan(4.5, context.ObserverPosition, context.Source) and not Self(context.Target,context.Observer) and Enemy(context.Source, context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Target,context.Observer) and HasStatus('CHAMPION_AURA_STATUS',context.Source,context.Observer) and not AnyEntityIsItem();" new entry "WeightedGuilt" type "InterruptData" @@ -1154,7 +1167,7 @@ using "Interrupt_ShieldBlock" data "DisplayName" "h3f18a6a3g621cg38fdga14cg96bd5fef8b0e;1" data "Description" "he296e1c6g6c73ge48ag1138g008853ec5ef2;3" data "InterruptContextScope" "Nearby" -data "Conditions" "IsAbleToReact(context.Observer) and not DistanceToEntityGreaterThan(2, context.ObserverPosition, context.Source) and not Self(context.Target,context.Observer) and not Eenmy(context.Target,context.Observer) and IsAttack() and not IsSpell() and (HasStatus('RAISE_SHIELD',context.Observer) or HasStatus('RAISE_SHIELD_SPIRIT',context.Observer) or HasStatus('ParagonShield',context.Observer));" +data "Conditions" "IsAbleToReact(context.Observer) and not DistanceToEntityGreaterThan(2.5, context.ObserverPosition, context.Source) and not Self(context.Target,context.Observer) and not Eenmy(context.Target,context.Observer) and IsAttack() and not IsSpell() and (HasStatus('RAISE_SHIELD',context.Observer) or HasStatus('RAISE_SHIELD_SPIRIT',context.Observer) or HasStatus('ParagonShield',context.Observer));" new entry "BloodMagic_EerieVeil_Offensive" type "InterruptData" @@ -1370,7 +1383,7 @@ type "InterruptData" using "BloodMagic_EerieVeil_Offensive" data "DisplayName" "h20f9f5a6gc915g30ecg8c08ge151e9e9cba3;1" data "Description" "he50cca36g2ec9g2a29ge14egba4a3cfe5cb7;1" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "Icon" "PassiveFeature_RepellingBlast" data "Conditions" "IsAbleToReact(context.Observer) and Self(context.Source,context.Observer) and IsSpell() and HasUseCosts('SorceryPoint',true) and not Item() and not AnyEntityIsItem() and not Self(context.Target,context.Observer) and (IsHit() or HasDamageEffectFlag(DamageFlags.SavingThrow)) and not IsKillingBlow();" data "Properties" "ApplyStatus(BARB_KNOCKBACK,100,1);ApplyStatus(PASSIVE_REPELLING_BLAST,100,1);ApplyStatus(OBSERVER_SOURCE,BloodMagicSelf,100,1);" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Passive.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Passive.txt index aab74061..ef6e0fb1 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Passive.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Passive.txt @@ -44,7 +44,7 @@ data "DisplayName" "hdff3f897gdee6g3ed9g0b28gd06945f0f08f;2" data "Description" "h07f7b560gf34dgdf73g3d1dg9a5369f5689e;3" data "Icon" "PassiveFeature_Skilled" data "Properties" "IsHidden" -data "Boosts" "ProficiencyBonus(SavingThrow, Constitution);ProficiencyBonus(SavingThrow, Dexterity);ProficiencyBonus(SavingThrow, Wisdom);ProficiencyBonus(Skill, Perception);IF(IsProficientWith(context.Source, GetActiveArmor()) or not (IsOfProficiencyGroup('LightArmor', GetActiveArmor()) or IsOfProficiencyGroup('MediumArmor', GetActiveArmor()) or IsOfProficiencyGroup('HeavyArmor', GetActiveArmor()))):AddProficiencyToAC();UnlockSpellVariant(HasUseCosts('BonusActionPoint'),ModifyUseCosts(Replace,ActionPoint,1,0,BonusActionPoint));ActionResource(Stride,9,0);ActionResource(Flourish,1,0);IF((IsMeleeWeaponAttack() or IsUnarmedAttack()) and IsCritical() and not HasPassive('Thief_Finesse',context.Source)):DamageBonus(StrengthModifier);UnlockInterrupt(CriticalHit_10);UnlockInterrupt(CriticalMiss_10);UnlockSpell(Target_SkillActions);UnlockSpell(Target_AidAnother);" +data "Boosts" "ProficiencyBonus(SavingThrow, Constitution);ProficiencyBonus(SavingThrow, Dexterity);ProficiencyBonus(SavingThrow, Wisdom);ProficiencyBonus(Skill, Perception);IF(IsProficientWith(context.Source, GetActiveArmor()) or not (IsOfProficiencyGroup('LightArmor', GetActiveArmor()) or IsOfProficiencyGroup('MediumArmor', GetActiveArmor()) or IsOfProficiencyGroup('HeavyArmor', GetActiveArmor()))):AddProficiencyToAC();UnlockSpellVariant(HasUseCosts('BonusActionPoint'),ModifyUseCosts(Replace,ActionPoint,1,0,BonusActionPoint));ActionResource(Stride,9,0);ActionResource(Flourish,1,0);IF((IsMeleeWeaponAttack() or IsUnarmedAttack()) and IsCritical() and not HasPassive('Thief_Finesse',context.Source)):DamageBonus(StrengthModifier);UnlockInterrupt(CriticalHit_10);UnlockInterrupt(CriticalMiss_10);UnlockInterrupt(VolleyReaction);UnlockSpell(Target_SkillActions);UnlockSpell(Target_AidAnother);" data "StatsFunctorContext" "OnTurn" data "Conditions" "TurnBased()" data "StatsFunctors" "AI_IGNORE:IF( not HasAnyMovementStatus() ):ApplyStatus(DEBUG_RESET_MOVE,100,-1); IF( HasDashStatus() ):UseActionResource(ActionPoint,1,0)" @@ -83,12 +83,13 @@ data "Properties" "IsHidden" new entry "AnchorPosition" type "PassiveData" -data "DisplayName" "hff4dccccga326gffc1gc9d5gcf857e440291;1" -data "Description" "h1fed3a89g9f65g95ddg1173gbeb0ccc7395a;1" -data "Icon" "statIcons_Ensnared" -data "Properties" "IsToggled" -data "ToggleOnFunctors" "ApplyStatus(AnchorMovementStatus,100,-1)" -data "ToggleOffFunctors" "RemoveStatus(AnchorMovementStatus)" +data "DisplayName" "hff4dccccga326gffc1gc9d5gcf857e440291;2" +data "Description" "h1fed3a89g9f65g95ddg1173gbeb0ccc7395a;2" +data "Icon" "Action_Fighter_EvasiveFootwork" +data "Properties" "IsToggled;ToggleForParty" +data "ToggleOnFunctors" "ApplyStatus(MANUAL_STRIDE,100,-1)" +data "ToggleOffFunctors" "RemoveStatus(MANUAL_STRIDE)" +data "ToggleGroup" "AnchorPosition" new entry "PathfinderStatBoosts" type "PassiveData" @@ -659,6 +660,15 @@ using "OffGuardRules" data "DisplayName" "h1b6d9aa9g518eg9fe4g7273gc44efcdc9a90;1" data "Boosts" "IF( OffGuardFlanking() and not OffGuardNoFlanking() and not (Tagged('CIRC_PEN_1AC',context.Target) or Tagged('CIRC_PEN_2AC',context.Target)) ):RollBonus(Attack, 2);IF( OffGuardFlanking() and not OffGuardNoFlanking() and Tagged('CIRC_PEN_1AC',context.Target) ):RollBonus(Attack, 1);" +new entry "Volley30" +type "PassiveData" +using "OffGuardRules" +data "DisplayName" "h1232dcc1gc03dg22a6g5149g40de9ac719bb;1" +data "Description" "h98913f5cg31c5g4439g88a0g9f8c53020979;1" +data "DescriptionParams" "Distance(12)" +data "Properties" "DisplayBoostInTooltip" +data "Boosts" "IF(Volley(12)):RollBonus(RangedWeaponAttack, -2);" + new entry "InitiativeRules" type "PassiveData" data "Icon" "PassiveFeature_Generic_Threat" @@ -710,10 +720,10 @@ new entry "FastMovement" type "PassiveData" data "DisplayName" "h43db7592g593fga3e2gbfc5g8d5273d1a48a;1" data "Description" "h3115f521g6d08g83aag7773gefdcc2b13c26;1" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "Icon" "PassiveFeature_FastMovement" data "Properties" "Highlighted;ForceShowInCC" -data "Boosts" "ActionResource(Movement, 1.5, 0);" +data "Boosts" "ActionResource(Movement, 2, 0);" new entry "HeavilyArmored" type "PassiveData" @@ -1139,13 +1149,14 @@ data "Boosts" "IF(not (IsSkillMaster('Intimidation', 'Charisma') and ConditionRe new entry "PowerfulLeap" type "PassiveData" data "DisplayName" "hdc0f2d58g0e35g5d73g3573gbd6b6706e4a6;1" -data "Description" "h006122c7ga470g9868g638cgdeba6c59ead5;1" +data "Description" "h006122c7ga470g9868g638cgdeba6c59ead5;2" +data "DescriptionParams" "Distance(2)" data "TooltipPermanentWarnings" "c6570d93-ba27-4b25-9bef-0834d78a1d30" data "Icon" "Spell_Transmutation_LongJump" data "Properties" "Highlighted" data "BoostContext" "OnCreate;OnTurn" data "BoostConditions" "IsSkillExpert('Athletics', 'Strength');" -data "Boosts" "JumpMaxDistanceBonus(1.5);" +data "Boosts" "JumpMaxDistanceBonus(2);" new entry "BattleCry" type "PassiveData" @@ -1992,7 +2003,7 @@ data "Icon" "Action_Bard_Countercharm" data "Properties" "Highlighted" data "Boosts" "ActionResource(KiPoint,1,0);" data "StatsFunctorContext" "OnCombatStarted" -data "StatsFunctors" "ApplyStatus(COUNTER_PERFORMANCE_SOURCE,100,-1);ApplyStatus(COUNTER_PERFORMANCE_ROLL,100,1d20);ApplyStatus(COUNTER_PERFORMANCE_ALLY,100,-1);" +data "StatsFunctors" "IF(HasActionResource('KiPoint', 1, 0, false, false, context.Source)):ApplyStatus(COUNTER_PERFORMANCE_SOURCE,100,-1);IF(HasActionResource('KiPoint', 1, 0, false, false, context.Source)):ApplyStatus(COUNTER_PERFORMANCE_ROLL,100,1d20);IF(HasActionResource('KiPoint', 1, 0, false, false, context.Source)):ApplyStatus(COUNTER_PERFORMANCE_ALLY,100,-1);" new entry "CounterPerformanceTechnical" type "PassiveData" @@ -2422,7 +2433,7 @@ type "PassiveData" using "FastMovement" data "DisplayName" "h63890dccg8acag4cf0g732eg01544e4a478a;1" data "Description" "hdf7893ceg957eg32fcg1ab9g1a9590528516;2" -data "DescriptionParams" "Distance(1.5);Distance(3)" +data "DescriptionParams" "Distance(2);Distance(4)" data "Icon" "PassiveFeature_UnarmoredMovement" data "Boosts" "Tag(STAT_BON_SPEED_05);" @@ -2483,7 +2494,7 @@ data "Boosts" "UnlockInterrupt(QuickShieldBlockInterrupt)" new entry "SuddenLeap" type "PassiveData" data "DisplayName" "hbaea5660gb726g7b59g201egb01a560c3715;1" -data "Description" "hba0a644eg24d4g9affg4509g797de1e57765;1" +data "Description" "hba0a644eg24d4g9affg4509g797de1e57765;2" data "TooltipUseCosts" "ActionPoint:2" data "Icon" "PassiveFeature_RemarkableAthlete_Jump" data "Boosts" "UnlockSpell(Projectile_SuddenLeap)" @@ -2733,10 +2744,11 @@ data "DynamicAnimationTag" "c4598bdb-fc07-40dd-a62c-90cc138bd76f" new entry "DancingLeaf" type "PassiveData" data "DisplayName" "h799fd177gc44egdf66g6140g9ccdbc700db2;1" -data "Description" "he8d2ce5dg60bfg9062gcc0bgfa2db0ddafc7;1" +data "Description" "he8d2ce5dg60bfg9062gcc0bgfa2db0ddafc7;2" +data "DescriptionParams" "Distance(2)" data "Icon" "Spell_Transmutation_FeatherFall" data "Properties" "Highlighted" -data "Boosts" "IgnoreFallDamage();JumpMaxDistanceBonus(1.5)" +data "Boosts" "IgnoreFallDamage();JumpMaxDistanceBonus(2);" data "DynamicAnimationTag" "c4598bdb-fc07-40dd-a62c-90cc138bd76f" new entry "FlurryOfManuevers" @@ -2750,7 +2762,7 @@ data "DynamicAnimationTag" "c4598bdb-fc07-40dd-a62c-90cc138bd76f" new entry "FlyingKick" type "PassiveData" data "DisplayName" "he1b77b10ge2d7g73bdgbb03g346b16eaddca;1" -data "Description" "h9cdefe28g1fc6g84e9ga19cg74d93b27a17b;1" +data "Description" "h9cdefe28g1fc6g84e9ga19cg74d93b27a17b;2" data "TooltipUseCosts" "ActionPoint:2" data "Icon" "Action_IronboundPursuit" data "Boosts" "UnlockSpell(Projectile_FlyingKick)" @@ -2789,7 +2801,7 @@ data "TooltipPermanentWarnings" "ec0375a8-9d94-40f9-8a5c-220f9ab7b879" data "Icon" "Spell_Conjuration_DimensionDoor" data "BoostContext" "OnCreate;OnLongRest" data "BoostConditions" "QiSpellsInitiate()" -data "Boosts" "UnlockSpell(Teleportation_ShrinkTheSpan);ActionResource(KiPoint,1,0)" +data "Boosts" "IF(not HasActionResource('Movement',7,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_6);IF(HasActionResource('Movement',7,0,false,true,context.Source) and not HasActionResource('Movement',9,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_8);IF(HasActionResource('Movement',9,0,false,true,context.Source) and not HasActionResource('Movement',11,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_10);IF(HasActionResource('Movement',11,0,false,true,context.Source) and not HasActionResource('Movement',13,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_12);IF(HasActionResource('Movement',13,0,false,true,context.Source) and not HasActionResource('Movement',15,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_14);IF(HasActionResource('Movement',15,0,false,true,context.Source) and not HasActionResource('Movement',17,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_16);IF(HasActionResource('Movement',17,0,false,true,context.Source) and not HasActionResource('Movement',19,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_18);IF(HasActionResource('Movement',19,0,false,true,context.Source)):UnlockSpell(Teleportation_ShrinkTheSpan_20);ActionResource(KiPoint,1,0);" new entry "CraneFlutter" type "PassiveData" @@ -2886,17 +2898,20 @@ data "Boosts" "MonkWeaponAttackOverride();CharacterUnarmedDamage(StrengthModifie new entry "IncredibleMovement" type "PassiveData" using "UnarmoredMovement_1" +data "DescriptionParams" "Distance(4)" data "BoostConditions" "not WearingArmor(context.Source)" data "Boosts" "Tag(STAT_BON_SPEED_10);" new entry "UnarmoredMovement_2" type "PassiveData" using "UnarmoredMovement_2" +data "DescriptionParams" "Distance(6)" data "Boosts" "Tag(STAT_BON_SPEED_15);" new entry "UnarmoredMovement_3" type "PassiveData" using "UnarmoredMovement_3" +data "DescriptionParams" "Distance(8)" data "Boosts" "Tag(STAT_BON_SPEED_20);" new entry "PathToPerfectionFort" @@ -2993,7 +3008,8 @@ data "Boosts" "UnlockSpell(Projectile_WallRun)" new entry "WildWindsInitiate" type "PassiveData" data "DisplayName" "he64082e7gbda9g7571g2438g40ae52f3d13c;2" -data "Description" "h693a637cgf507g47edg2e7bg2f71cf26467e;1" +data "Description" "h693a637cgf507g47edg2e7bg2f71cf26467e;2" +data "DescriptionParams" "Distance(12)" data "TooltipUseCosts" "ActionPoint:1;KiPoint:1" data "TooltipPermanentWarnings" "ec0375a8-9d94-40f9-8a5c-220f9ab7b879;73c08de0-7999-41ec-9968-df81908d42fe" data "Icon" "Action_Monk_FangsOfTheFireSnake" @@ -3081,7 +3097,7 @@ new entry "ChampionsAura" type "PassiveData" data "DisplayName" "h84ade156g2154ga0c8g3ebcgb90fbaf0c887;1" data "Description" "h8ab946a4g35f0g47d9ga7e2g64799f69991d;1" -data "DescriptionParams" "Distance(4.5)" +data "DescriptionParams" "Distance(6)" data "Icon" "Action_Paladin_AuraOfProtection" data "Properties" "ForceShowInCC;IsToggled;ToggledDefaultOn" data "StatsFunctorContext" "OnCombatStarted;OnStatusRemoved" @@ -3279,7 +3295,7 @@ new entry "NimbleReprisal" type "PassiveData" data "DisplayName" "he0c78d6egd4eeg7fb5g60d1g58f7948fa5b9;1" data "Description" "he43bc9bfgebe8g5e71gcfa7g9083373a35d9;2" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "Icon" "Action_Mag_UndeadTurningAmmunition" data "Properties" "Highlighted" data "BoostContext" "OnCreate;OnLongRest" @@ -3290,7 +3306,7 @@ new entry "ExpandAura" type "PassiveData" data "DisplayName" "hbac9c46dg4739gcb6ag0af8g0e7ef74c9c96;1" data "Description" "hf5302167g705bgf8fag4656gdddf2a510d56;1" -data "DescriptionParams" "Distance(9)" +data "DescriptionParams" "Distance(12)" data "ExtraDescription" "hefdc7ce0g7c49g255bg0997g7408f3670771;1" data "TooltipUseCosts" "ActionPoint:1" data "Icon" "Action_Paladin_AuraOfDevotion" @@ -4214,7 +4230,7 @@ data "DisplayName" "h3062b1d9g94cfg0bb6g4ffcg8d7a167a6779;1" data "Description" "hdd87ae8dgfcc0g13bfge8fag3e06efd3304e;1" data "Icon" "Action_Fighter_EvasiveFootwork" data "Properties" "Highlighted;IsToggled;ToggledDefaultAddToHotbar;Temporary" -data "Boosts" "IgnoreLeaveAttackRange();IF(not HasStatus('SNEAKING') and not HasStatus('DISENGAGE')):ActionResourceConsumeMultiplier(Movement, 2,0)" +data "Boosts" "IgnoreLeaveAttackRange();IF(not HasStatus('SNEAKING') and not HasStatus('HIDDEN') and not HasStatus('DISENGAGE')):ActionResourceConsumeMultiplier(Movement, 2,0);" data "ToggleOffFunctors" "ApplyStatus(DEBUG_RESET_MOVE,100,-1);RemoveStatus(STRIDE);RemoveStatus(DASH);RemoveStatus(DASH_STACKED);RemoveStatus(DASH_STACKED_2);" data "ToggleGroup" "RogueMobility" @@ -5587,7 +5603,7 @@ new entry "OngoingMisery" type "PassiveData" data "DisplayName" "hd83e0451g9f61g0aabgba82g519e375d75b2;1" data "Description" "hb37d1d91gd9bbg0dbdgb0e5g5ae84935ef5b;1" -data "DescriptionParams" "Distance(4.5)" +data "DescriptionParams" "Distance(6)" data "Icon" "Spell_Enchantment_Hex" data "Properties" "Highlighted" data "BoostContext" "OnStatusApplied;OnStatusRemoved" @@ -6074,6 +6090,12 @@ data "StatsFunctorContext" "OnDamaged" data "Conditions" "not IsDamageTypeRadiant() or not IsDamageTypeForce();" data "StatsFunctors" "ApplyStatus(SELF,ResistanceDisplay,100,0);" +new entry "GhostResist_8" +type "PassiveData" +using "GhostResist_5" +data "DescriptionParams" "8" +data "Boosts" "DamageReduction(Bludgeoning,Flat,8);DamageReduction(Slashing,Flat,8);DamageReduction(Piercing,Flat,8);DamageReduction(Acid,Flat,8);DamageReduction(Fire,Flat,8);DamageReduction(Lightning,Flat,8);DamageReduction(Necrotic,Flat,8);DamageReduction(Poison,Flat,8);DamageReduction(Psychic,Flat,8);DamageReduction(Thunder,Flat,8);" + new entry "GhostResist_10" type "PassiveData" using "GhostResist_5" @@ -6731,7 +6753,8 @@ data "Boosts" "UnlockSpell(Zone_TidalHands);" new entry "BurningJet" type "PassiveData" data "DisplayName" "h7f3c7932g6e9agfcddgb511g86ffd58948b0;1" -data "Description" "h241b54aag6b19g2e5dgde9bgeb46af546202;1" +data "Description" "h241b54aag6b19g2e5dgde9bgeb46af546202;2" +data "DescriptionParams" "Distance(16);Distance(24)" data "BoostContext" "OnCreate;OnLongRest" data "Boosts" "UnlockSpell(Rush_BurningJet_Level1);IF(CharacterLevelGreaterThan(5)):UnlockSpell(Rush_BurningJet_Level6);" @@ -6939,7 +6962,8 @@ data "Boosts" "UnlockSpell(Projectile_ElementalArtillery);" new entry "FlingingUpdraft" type "PassiveData" data "DisplayName" "h5dfd6a33g3153gba6cg2fbag46fa844e2499;1" -data "Description" "h8fd878edgf6a5geeeeg8254ga06be4db3169;1" +data "Description" "h8fd878edgf6a5geeeeg8254ga06be4db3169;2" +data "DescriptionParams" "Distance(24);Distance(12)" data "Boosts" "UnlockSpell(Throw_FlingingUpdraft);" new entry "LightningRod" @@ -7469,15 +7493,15 @@ new entry "Armor_SpeedPenalty_5" type "PassiveData" data "DisplayName" "h9dee4acbg35abg0546gc9fbg75973d0a63ca;1" data "Description" "h15db22bcg4e08g3026g41a3g45b71c97edb9;1" -data "DescriptionParams" "Distance(1.5)" -data "Boosts" "IF(ArmorCheck() and not HasPassive('UnburdenedIron',context.Source)):ActionResource(Movement,-1.5,0);" +data "DescriptionParams" "Distance(2)" +data "Boosts" "IF(ArmorCheck() and not HasPassive('UnburdenedIron',context.Source)):ActionResource(Movement,-2,0);" new entry "Armor_SpeedPenalty_10" type "PassiveData" using "Armor_SpeedPenalty_5" data "Description" "h3de85d87gf6ecgc006gbf0egb82f17cb18af;1" -data "DescriptionParams" "Distance(3);Distance(1.5)" -data "Boosts" "IF(ArmorCheck() and not HasPassive('UnburdenedIron',context.Source)):ActionResource(Movement,-3,0);IF(not ArmorCheck() and not HasPassive('UnburdenedIron',context.Source)):ActionResource(Movement,-1.5,0);" +data "DescriptionParams" "Distance(4);Distance(2)" +data "Boosts" "IF(ArmorCheck() and not HasPassive('UnburdenedIron',context.Source)):ActionResource(Movement,-4,0);IF(not ArmorCheck() and not HasPassive('UnburdenedIron',context.Source)):ActionResource(Movement,-2,0);" new entry "Trait_Bulwark" type "PassiveData" @@ -7991,7 +8015,7 @@ new entry "MAG_Frightened_Passive" type "PassiveData" data "DisplayName" "h0be041d2g265cg64e0gb4begaf25c48acafe;1" data "Description" "h3bf421c8g7272g7f2agd740g5d49086d263d;1" -data "DescriptionParams" "Distance(5)" +data "DescriptionParams" "Distance(4)" new entry "MAG_Paladin_LayOnHandsSupport_Gloves_Passive" type "PassiveData" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Projectile.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Projectile.txt index d7f9ef80..83a57e32 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Projectile.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Projectile.txt @@ -68,7 +68,7 @@ type "SpellData" data "SpellType" "Projectile" data "TargetCeiling" "0.8" data "TargetFloor" "-1" -data "TargetRadius" "4.5" +data "TargetRadius" "6" data "AddRangeFromAbility" "Strength,1" data "ProjectileCount" "1" data "Trajectories" "rules:861d0046-1858-401e-b97b-28f7b3e3e89a,d5e54f29-f80f-4105-96b2-23b5af9321c7,bac38aab-dfa7-4a5a-9c2a-552b0b626ee3" @@ -99,7 +99,7 @@ type "SpellData" data "SpellType" "Projectile" data "TargetCeiling" "0.8" data "TargetFloor" "-1" -data "TargetRadius" "3" +data "TargetRadius" "4" data "ProjectileCount" "1" data "Trajectories" "rules:861d0046-1858-401e-b97b-28f7b3e3e89a,d5e54f29-f80f-4105-96b2-23b5af9321c7,bac38aab-dfa7-4a5a-9c2a-552b0b626ee3" data "Icon" "Action_Jump" @@ -129,7 +129,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_Jump" data "Cooldown" "None" -data "TargetRadius" "4.5" +data "TargetRadius" "6" new entry "Projectile_Jump_NoFallDamage" type "SpellData" @@ -144,7 +144,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_Jump" data "Cooldown" "OncePerTurn" -data "TargetRadius" "18" +data "TargetRadius" "24" data "Trajectories" "8daba69c-347d-419e-a9de-efacd82d7e51,6ff3928f-3ec8-48cd-1a61-fc7c0c97c2c7,17772b1c-eed7-a1fc-bc65-082d30f44edd" data "DisplayName" "h5f66a46egbdafgcbcdg6768ge854526c7b0b;1" data "ExtraDescription" "" @@ -166,7 +166,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_Fly" data "SpellProperties" ";" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Icon" "Action_TempestuousMagic" data "PrepareSound" "Action_Prepare_Sorcerer_TempestuousMagic" data "CastSound" "Action_Cast_Sorcerer_TempestuousMagic" @@ -216,7 +216,7 @@ type "SpellData" data "SpellType" "Projectile" data "Cooldown" "OncePerTurn" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Constitution,12)" data "SpellSuccess" "DealDamage(1d6, Radiant,Magical);ApplyStatus(WILD_MAGIC_BARBARIAN_LIGHT_BOLT_BLINDED,100,1)" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" @@ -246,7 +246,7 @@ new entry "Projectile_OversizedThrow" type "SpellData" data "SpellType" "Projectile" using "Projectile_StoneThrow_Ogre" -data "TargetRadius" "7" +data "TargetRadius" "8" data "SpellSuccess" "IF(not HasPassive('WeaponSpecialization',context.Source)):DealDamage(1d10+StrengthModifier,Bludgeoning);IF(HasPassive('WeaponSpecialization',context.Source)):DealDamage(2d10+StrengthModifier,Bludgeoning);" data "TargetConditions" "not Self()" data "DisplayName" "h87537a39g7669g9b47gd7f6gbcb391818f62;1" @@ -264,9 +264,9 @@ data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Air_Container" data "SpellProperties" "GROUND:SurfaceChange(Electrify);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TargetConditions" "RageConcentrateSpell();" data "Trajectories" "f3e80d36-e158-4e4a-b79b-07e5d794ae32" data "Icon" "Item_ARR_Arrow_Of_Lightning" @@ -293,7 +293,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Electric" data "SpellContainerID" "Target_ElementalBlast_Air_Dedi" -data "SpellSuccess" "DealDamage(1d6,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(1d6,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(1d6,Lightning);" new entry "Projectile_ElementalBlast_Air_Electric_2Action" @@ -301,7 +301,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Electric" data "SpellProperties" "GROUND:SurfaceChange(Electrify);GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Lightning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Lightning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "Icon" "Item_ARR_Arrow_Of_Lightning" data "DisplayName" "h3256b413g9232g04edg4391g8396b0a7a9e0;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Lightning);" @@ -313,7 +313,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Electric_2Action" data "SpellContainerID" "Target_ElementalBlast_Air_Dedi" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(1d6+ConstitutionModifier,Lightning,Magical);IF(IsCritical()):DealDamage(1d6+ConstitutionModifier+ConstitutionModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(1d6+ConstitutionModifier,Lightning,Magical);IF(IsCritical()):DealDamage(1d6+ConstitutionModifier+ConstitutionModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(1d6+ConstitutionModifier,Lightning);" new entry "Projectile_ElementalBlast_Air_Slashing" @@ -321,9 +321,9 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Air_Container" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TargetConditions" "RageConcentrateSpell();" data "Trajectories" "3eaf2c46-46a9-4b52-8e05-fae7dc4e548b" data "Icon" "Item_ARR_Arrow_Of_Slaying" @@ -351,7 +351,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Slashing" data "SpellContainerID" "Target_ElementalBlast_Air_Dedi" -data "SpellSuccess" "DealDamage(1d6,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(1d6,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(1d6,Slashing);" new entry "Projectile_ElementalBlast_Air_Slashing_2Action" @@ -359,7 +359,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Slashing" data "SpellProperties" "GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Slashing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Slashing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "DisplayName" "h887c2861g2077g8c4dg2abbg1132c18c05be;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Slashing);" data "UseCosts" "ActionPoint:2;" @@ -370,7 +370,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Slashing_2Action" data "SpellContainerID" "Target_ElementalBlast_Air_Dedi" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(1d6+ConstitutionModifier,Slashing,Magical);IF(IsCritical()):DealDamage(1d6+ConstitutionModifier+ConstitutionModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(1d6+ConstitutionModifier,Slashing,Magical);IF(IsCritical()):DealDamage(1d6+ConstitutionModifier+ConstitutionModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(1d6+ConstitutionModifier,Slashing);" new entry "Projectile_ElementalBlast_Air_Cold" @@ -378,7 +378,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Slashing" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);" -data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "Trajectories" "47ac1e9a-3b62-4010-bde9-0dc602edd114" data "Icon" "Item_ARR_Arrow_Of_Ice" data "DisplayName" "h54b86ef1gd96fg3bd5gf595g0353e62cb1b5;1" @@ -394,7 +394,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Cold" data "SpellContainerID" "Target_ElementalBlast_Air_Dedi" -data "SpellSuccess" "DealDamage(1d6,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(1d6,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TargetConditions" "RageConcentrateSpell();" data "TooltipDamageList" "DealDamage(1d6,Cold);" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Air',false) and RageConcentrateSpell();" @@ -404,7 +404,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Slashing_2Action" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "Trajectories" "47ac1e9a-3b62-4010-bde9-0dc602edd114" data "Icon" "Item_ARR_Arrow_Of_Ice" data "DisplayName" "hedc38996gda4cga62eg31dfg230da641c859;1" @@ -420,7 +420,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Air_Cold_2Action" data "SpellContainerID" "Target_ElementalBlast_Air_Dedi" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(1d6+ConstitutionModifier,Cold,Magical);IF(IsCritical()):DealDamage(1d6+ConstitutionModifier+ConstitutionModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(1d6+ConstitutionModifier,Cold,Magical);IF(IsCritical()):DealDamage(1d6+ConstitutionModifier+ConstitutionModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(1d6+ConstitutionModifier,Cold);" new entry "Projectile_ElementalBlast_Fire_Fire" @@ -429,7 +429,7 @@ data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Fire_Container" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast),Fire,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Fire',context.Source)):ApplyStatus(PersistentFire_1d6,100,1);" data "TargetConditions" "RageConcentrateSpell();" @@ -535,7 +535,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Earth_Container" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Earth',context.Source)):ApplyStatus(PRONE_PF2,100,-1);" data "TargetConditions" "RageConcentrateSpell();" @@ -592,7 +592,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Earth_Container" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Piercing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Earth',context.Source)):ApplyStatus(PRONE_PF2,100,-1);" data "TargetConditions" "RageConcentrateSpell();" @@ -701,7 +701,7 @@ data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Water_Container" data "SpellProperties" "GROUND:SurfaceChange(Douse);" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Bludgeoning,Magical);" data "TargetConditions" "RageConcentrateSpell();" @@ -738,7 +738,7 @@ new entry "Projectile_ElementalBlast_Water_Bludgeoning_2Action" type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Water_Bludgeoning" -data "SpellProperties" "GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellProperties" "GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" data "SpellSuccess" "IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Bludgeoning,Magical);IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier,Bludgeoning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+ConstitutionModifier,Bludgeoning,Magical);" data "Icon" "Item_ARR_Arrow_Of_Detonation" data "DisplayName" "h03ad14c0g0e16g3cc0g1e75gabc0b0acfbca;1" @@ -760,7 +760,7 @@ data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Water_Container" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Cold,Magical);" data "TargetConditions" "RageConcentrateSpell();" @@ -796,7 +796,7 @@ new entry "Projectile_ElementalBlast_Water_Cold_2Action" type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Water_Cold" -data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" data "SpellSuccess" "IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Cold,Magical);IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+ConstitutionModifier,Cold,Magical);" data "Icon" "Item_ARR_Arrow_Of_Ice" data "DisplayName" "heb8be1c2gf50fg1fc2g8a8eg78295e5731a3;1" @@ -842,7 +842,7 @@ new entry "Projectile_ElementalBlast_Water_Acid_2Action" type "SpellData" data "SpellType" "Projectile" using "Projectile_ElementalBlast_Water_Cold_2Action" -data "SpellProperties" "IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellProperties" "IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" data "SpellSuccess" "IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Acid,Magical);IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier,Acid,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+ConstitutionModifier,Acid,Magical);" data "Trajectories" "45e6cc9f-7ec9-4e1b-aa2f-95568173ed40" data "Icon" "Item_ARR_Arrow_Of_Acid" @@ -870,7 +870,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Metal_Container" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Piercing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Metal',context.Source)):ApplyStatus(PersistentAcid_1d6,100,1);" data "TargetConditions" "RageConcentrateSpell();" @@ -927,7 +927,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Metal_Container" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Metal',context.Source)):ApplyStatus(PersistentAcid_1d6,100,1);" data "TargetConditions" "RageConcentrateSpell();" @@ -1038,7 +1038,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Wood_Container" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Wood',context.Source)):ApplyStatus(ENSNARED,100,1);" data "TargetConditions" "RageConcentrateSpell();" @@ -1095,7 +1095,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellContainerID" "Target_ElementalBlast_Wood_Container" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8AoeCantrip),Radiant,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Wood',context.Source)):ApplyStatus(ENSNARED,100,1);" data "TargetConditions" "RageConcentrateSpell();" @@ -1393,7 +1393,7 @@ data "SpellType" "Projectile" using "Projectile_FlyingKick" data "SpellProperties" "GROUND:DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(MainHand);" data "TargetCeiling" "1.6" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AddRangeFromAbility" "Strength,2" data "SpellRoll" "Attack2e(AttackType.MeleeWeaponAttack)" data "SpellSuccess" "DealDamage(MainMeleeWeapon);ExecuteWeaponFunctors(MainHand);" @@ -1439,7 +1439,7 @@ data "SpellType" "Projectile" using "Projectile_Jump" data "TargetCeiling" "15" data "TargetFloor" "-15" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "AddRangeFromAbility" ";" data "Icon" "PassiveFeature_SlowFall" data "DisplayName" "ha283271bgc405g9ed8g490fg628b803c0a24;1" @@ -1600,9 +1600,9 @@ data "Level" "3" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "TargetFloor" "-1" -data "TargetRadius" "18" -data "AreaRadius" "6" -data "ExplodeRadius" "6" +data "TargetRadius" "24" +data "AreaRadius" "8" +data "ExplodeRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Fire,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Fire,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d6)/2,Fire,Magical);" @@ -1692,7 +1692,7 @@ data "SpellType" "Projectile" data "Level" "1" data "SpellSchool" "Necromancy" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" data "SpellSuccess" "ApplyStatus(FungalPersistent_Half_Rank2,100,-1);DealDamage(1d8,Poison,Magical);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -1760,7 +1760,7 @@ data "SpellType" "Projectile" data "Cooldown" "OncePerRestPerItem" data "SpellProperties" "" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AmountOfTargets" "3" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(1d4,Piercing);DealDamage(1d4,Bludgeoning);" @@ -1837,7 +1837,7 @@ data "ContainerSpells" "Projectile_ScorchingRay_CircletOfBlasting_1Action;Projec data "Cooldown" "OncePerRestPerItem" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(2d6,Fire,Magical)" data "TargetConditions" "not Self() and not Dead()" @@ -1871,7 +1871,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Projectile_BlazingBolt_Container_Rank2" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(2d6,Fire,Magical)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -1964,7 +1964,7 @@ data "SpellSchool" "Evocation" data "ContainerSpells" "Projectile_MagicMissile_Rank1_1Action;Projectile_MagicMissile_Rank1_2Action;Projectile_MagicMissile_Rank1_3Action" data "SpellProperties" "DealDamage(1d4+1,Force,Magical)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AmountOfTargets" "1" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" @@ -2078,7 +2078,7 @@ data "SpellType" "Projectile" data "Level" "0" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D4Cantrip),Piercing,Magical)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2112,7 +2112,7 @@ data "Level" "0" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Electrify)" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "2" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D4AoeCantrip),Lightning,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D4AoeCantrip))*2,Lightning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -2146,7 +2146,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_NeedleDarts" data "SpellProperties" "GROUND:CreateSurface(2,10,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,SCATTER_SCREE);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "ExplodeRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" @@ -2171,7 +2171,7 @@ data "Level" "0" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D4AoeCantrip),Cold,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D4AoeCantrip))*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(BLD_WEAK_INPUT,100,LevelMapValue(H1Plus1));IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "DealDamage((LevelMapValue(D4AoeCantrip))/2,Cold,Magical)" @@ -2204,7 +2204,7 @@ using "Projectile_RayOfFrost" data "Level" "1" data "SpellProperties" "ApplyStatus(WET,100,1);" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(3d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(3d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "SpellFail" ";" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" data "Icon" "Spell_Conjuration_IceKnife" @@ -2227,7 +2227,7 @@ new entry "Projectile_HydraulicPush_2" type "SpellData" data "SpellType" "Projectile" using "Projectile_HydraulicPush_1" -data "SpellSuccess" "DealDamage(5d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(5d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TooltipDamageList" "DealDamage(5d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:2" data "RootSpellID" "Projectile_HydraulicPush_1" @@ -2237,7 +2237,7 @@ new entry "Projectile_HydraulicPush_3" type "SpellData" data "SpellType" "Projectile" using "Projectile_HydraulicPush_1" -data "SpellSuccess" "DealDamage(7d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(7d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TooltipDamageList" "DealDamage(7d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "RootSpellID" "Projectile_HydraulicPush_1" @@ -2247,7 +2247,7 @@ new entry "Projectile_HydraulicPush_4" type "SpellData" data "SpellType" "Projectile" using "Projectile_HydraulicPush_1" -data "SpellSuccess" "DealDamage(9d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(9d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TooltipDamageList" "DealDamage(9d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4" data "RootSpellID" "Projectile_HydraulicPush_1" @@ -2257,7 +2257,7 @@ new entry "Projectile_HydraulicPush_5" type "SpellData" data "SpellType" "Projectile" using "Projectile_HydraulicPush_1" -data "SpellSuccess" "DealDamage(11d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(11d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TooltipDamageList" "DealDamage(11d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" data "RootSpellID" "Projectile_HydraulicPush_1" @@ -2267,7 +2267,7 @@ new entry "Projectile_HydraulicPush_6" type "SpellData" data "SpellType" "Projectile" using "Projectile_HydraulicPush_1" -data "SpellSuccess" "DealDamage(13d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(13d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TooltipDamageList" "DealDamage(13d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" data "RootSpellID" "Projectile_HydraulicPush_1" @@ -2279,7 +2279,7 @@ data "SpellType" "Projectile" data "Level" "2" data "SpellSchool" "Necromancy" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "ApplyStatus(RAY_OF_ENFEEBLEMENT,100,10)" data "TargetConditions" "Character() and not Self() and ConcentrateSpell();" @@ -2309,7 +2309,7 @@ new entry "Projectile_ChillingDarkness_3" type "SpellData" data "SpellType" "Projectile" using "Projectile_RayOfEnfeeblement" -data "TargetRadius" "36" +data "TargetRadius" "48" data "SpellSuccess" "DealDamage(5d6,Cold,Magical);IF(Tagged('CELESTIAL')):DealDamage(5d6,Necrotic,Magical);" data "DisplayName" "h1e74d63ag6abfgeb39g28a7gf7ae8ddeee8c;1" data "Description" "hb92f98acg8166g5fa5g4b84g3b03b3077cd7;2" @@ -2357,7 +2357,7 @@ using "Projectile_Jump" data "Level" "1" data "TargetCeiling" "9" data "TargetFloor" "-9" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AddRangeFromAbility" ";" data "Icon" "Spell_Transmutation_LongJump" data "DisplayName" "hbb139911g6f41gd9f1gda71g9c4bbdfbfb0b;1" @@ -2380,7 +2380,7 @@ data "SpellType" "Projectile" data "Level" "0" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D4AoeCantrip),Radiant,Magical);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2419,7 +2419,7 @@ data "Level" "0" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_SlashingGust;Target_SlashingGust_Double" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D4AoeCantrip),Slashing,Magical);IF(IsCritical()):ApplyStatus(BLEEDING,100,10);IF(IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(GougingClawBleed_Rank1,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(GougingClawBleed_Rank2,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(GougingClawBleed_Rank3,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(GougingClawBleed_Rank4,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(GougingClawBleed_Rank5,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(GougingClawBleed_Rank6,100,-1);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2454,7 +2454,7 @@ data "Level" "0" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D4Cantrip),Fire,Magical);IF(IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(IgnitionPersistent_Rank1,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(IgnitionPersistent_Rank2,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(IgnitionPersistent_Rank3,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(IgnitionPersistent_Rank4,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(IgnitionPersistent_Rank5,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(IgnitionPersistent_Rank6,100,-1);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2489,7 +2489,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_IgnitionContainer" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(IgnitionDamage),Fire,Magical);IF(IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(IgnitionPersistent_Rank1,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(IgnitionPersistent_Rank2,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(IgnitionPersistent_Rank3,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(IgnitionPersistent_Rank4,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(IgnitionPersistent_Rank5,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(IgnitionPersistent_Rank6,100,-1);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2536,7 +2536,7 @@ data "SpellType" "Projectile" data "Level" "0" data "SpellSchool" "Conjuration" data "TargetFloor" "-1" -data "TargetRadius" "3" +data "TargetRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC(),AdvantageOnPoisoned())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D8Cantrip),Poison,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D8Cantrip))*2,Poison,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "DealDamage((LevelMapValue(D8Cantrip))/2,Poison,Magical)" @@ -2568,7 +2568,7 @@ data "Level" "0" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:RemoveStatus(SELF,PRODUCE_FLAME);GROUND:RemoveStatus(SELF,PRODUCE_FLAME_HURL);GROUND:RemoveStatus(SELF,PRODUCE_FLAME_HURL_FREE);GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(IgnitionDamage),Fire,Magical);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2607,7 +2607,7 @@ data "SpellType" "Projectile" data "Level" "0" data "SpellSchool" "Conjuration" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AreaRadius" "2" data "ExplodeRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" @@ -2668,10 +2668,10 @@ data "Level" "2" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:CreateSurface(2,0,Acid)" data "TargetFloor" "-1" -data "TargetRadius" "36" +data "TargetRadius" "48" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "45e6cc9f-7ec9-4e1b-aa2f-95568173ed40" @@ -2704,8 +2704,8 @@ new entry "Projectile_AcidArrow_3" type "SpellData" data "SpellType" "Projectile" using "Projectile_AcidArrow" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "Description" "h24e4b96dg3dcegf609ged97g5e6457218742;2" data "ExtraDescription" "" data "TooltipDamageList" "DealDamage(2d8,Acid)" @@ -2721,7 +2721,7 @@ data "SpellSchool" "Evocation" data "ContainerSpells" "Projectile_ChromaticOrb_Acid;Projectile_ChromaticOrb_Cold;Projectile_ChromaticOrb_Fire;Projectile_ChromaticOrb_Lightning;Projectile_ChromaticOrb_Poison;Projectile_ChromaticOrb_Thunder" data "SpellProperties" "GROUND:CreateSurface(2,2,Acid)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "f77c14be-cc25-40d6-a7dd-99b2e0a2df1c" @@ -2748,7 +2748,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Projectile_ChromaticOrb" data "SpellProperties" "GROUND:CreateSurface(2,2,Acid)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(2d8,Acid,Magical)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -2985,7 +2985,7 @@ data "SpellType" "Projectile" data "Level" "1" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(2d6,Radiant,Magical);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -3047,9 +3047,9 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(WET,100,1);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(3d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(3d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" @@ -3081,9 +3081,9 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(WET,100,1);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(5d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(5d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" @@ -3115,9 +3115,9 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(WET,100,1);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(7d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(7d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" @@ -3149,9 +3149,9 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(WET,100,1);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(3d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(3d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" @@ -3183,9 +3183,9 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(WET,100,1);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(5d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(5d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" @@ -3217,9 +3217,9 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(WET,100,1);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(7d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5)" +data "SpellSuccess" "DealDamage(7d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2)" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "116b48b6-7396-4055-872f-f44256537bcf" @@ -3333,7 +3333,7 @@ new entry "Projectile_GlyphOfWarding_Detonation_Trap" type "SpellData" data "SpellType" "Projectile" using "Projectile_GlyphOfWarding_Acid_Trap" -data "SpellSuccess" "Force(6,TargetToEntity)" +data "SpellSuccess" "Force(8,TargetToEntity)" data "SpellFail" "" data "Icon" "Spell_Abjuration_GlyphOfWarding_Detonation" data "DisplayName" "h22d85808gf18fg91f8g5b73gedd8c48703c5;1" @@ -3703,7 +3703,7 @@ data "SpellType" "Projectile" data "Level" "1" data "SpellProperties" "DealDamage(((LevelMapValue(H2D4))+(LevelMapValue(H2P1))),Force,Magical)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AmountOfTargets" "1" data "TargetConditions" "not Self() and not Dead()" data "ProjectileCount" "1" @@ -3761,8 +3761,8 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_AcidArrow" data "Level" "4" -data "SpellSuccess" "DealDamage(4d8,Acid,Magical);IF(IsCritical()):DealDamage(4d8,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);Force(-3, OriginToEntity, Neutral, false, true);IF(IsCritical()):Force(-3, OriginToEntity, Neutral, false, true)" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(4d8,Acid,Magical);IF(IsCritical()):DealDamage(4d8,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);Force(-4, OriginToEntity, Neutral, false, true);IF(IsCritical()):Force(-4, OriginToEntity, Neutral, false, true)" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(4d8,Acid)" data "TooltipStatusApply" "ApplyStatus(AcidGrip_Rank4,100,-1)" data "PrepareSound" "Spell_Prepare_Damage_Acid_Gen_L1to3" @@ -3778,7 +3778,7 @@ data "Level" "1" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);RemoveStatus(BURNING);GROUND:CreateSurface(2,2,WaterFrozen)" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AreaRadius" "2" data "ExplodeRadius" "2" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" @@ -3841,7 +3841,7 @@ data "Level" "6" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Electrify)" data "TargetFloor" "-1" -data "TargetRadius" "100" +data "TargetRadius" "200" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d12,Lightning,Magical);IF(SaveCrit()):DealDamage((8d12)*2,Lightning,Magical);SpawnExtraProjectiles(Projectile_ChainLightning_Explosion);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((8d12)/2,Lightning,Magical);IF(not SaveCritMiss('Reflex')):SpawnExtraProjectiles(Projectile_ChainLightning_Explosion);" @@ -3876,7 +3876,7 @@ new entry "Projectile_ChainLightning_Explosion" type "SpellData" data "SpellType" "Projectile" using "Projectile_ChainLightning" -data "TargetRadius" "100" +data "TargetRadius" "200" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d12,Lightning,Magical);IF(SaveCrit()):DealDamage((8d12)*2,Lightning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((10d8)/2,Lightning,Magical);" data "TargetConditions" "not Self() and not Dead() and Enemy() and ConcentrateSpell();" @@ -4091,7 +4091,7 @@ type "SpellData" data "SpellType" "Projectile" data "Level" "6" data "SpellSchool" "Transmutation" -data "TargetRadius" "36" +data "TargetRadius" "48" data "DeathType" "Disintegrate" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(12d10,Force,Magical);" @@ -4133,11 +4133,11 @@ data "SpellType" "Projectile" data "Level" "6" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_FreezingSphere" -data "SpellProperties" "GROUND:CreateSurface(6,10,WaterFrozen);RemoveStatus(BURNING)" +data "SpellProperties" "GROUND:CreateSurface(8,10,WaterFrozen);RemoveStatus(BURNING)" data "TargetFloor" "-1" -data "TargetRadius" "18" -data "AreaRadius" "6" -data "ExplodeRadius" "6" +data "TargetRadius" "24" +data "AreaRadius" "8" +data "ExplodeRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(10d6,Cold,Magical);IF(SaveCrit()):DealDamage((10d6)*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((10d6)/2,Cold,Magical);" @@ -4173,7 +4173,7 @@ new entry "Projectile_HailOfThorns_4" type "SpellData" data "SpellType" "Projectile" using "Projectile_HailOfThorns" -data "SpellSuccess" "DealDamage(9d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5);" +data "SpellSuccess" "DealDamage(9d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2);" data "TooltipDamageList" "DealDamage(9d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4;" data "SpellAnimationIntentType" "Aggressive" @@ -4265,7 +4265,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_WitchBolt" data "Level" "4" -data "SpellSuccess" "DealDamage(9d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5);" +data "SpellSuccess" "DealDamage(9d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2);" data "TooltipDamageList" "DealDamage(9d6,Bludgeoning)" data "PrepareSound" "Spell_Prepare_Damage_Lightning_Gen_L1to3" data "PrepareLoopSound" "Spell_Prepare_Damage_Lightning_Gen_L1to3_Loop" @@ -4398,7 +4398,7 @@ using "Projectile_Fireball" data "Level" "" data "SpellSchool" "" data "Cooldown" "OncePerTurn" -data "TargetRadius" "30" +data "TargetRadius" "40" data "AreaRadius" "6" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(14d6,Fire,Magical);IF(SaveCrit()):DealDamage((14d6)*2,Fire,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((14d6)/2,Fire,Magical);" @@ -4421,7 +4421,7 @@ new entry "Projectile_MagicMissile_MindFlayer" type "SpellData" data "SpellType" "Projectile" using "Projectile_MagicMissile_4_AI" -data "TargetRadius" "30" +data "TargetRadius" "40" data "TargetConditions" "not Self() and not Dead() and Enemy()" data "UseCosts" "ActionPoint:3" data "SpellAnimation" "8b8bb757-21ce-4e02-a2f3-97d55cf2f90b,,;,,;cd5e5d4a-38e1-4d4d-b346-3fbc1e4c3c90,,;141f48d9-9615-496a-8737-9240f0dba60d,,;7bb52cd4-0b1c-4926-9165-fa92b75876a3,,;,,;0b07883a-08b8-43b6-ac18-84dc9e84ff50,,;,,;,," @@ -4437,7 +4437,7 @@ data "Level" "" data "SpellSchool" "None" data "Cooldown" "None" data "SpellProperties" "" -data "TargetRadius" "4" +data "TargetRadius" "5" data "DeathType" "Physical" data "SpellRoll" "Attack2e(AttackType.RangedWeaponAttack)" data "SpellSuccess" "DealDamage(2d8+UnarmedMeleeAbilityModifier,Piercing);DealDamage(1d4,Necrotic)" @@ -4491,8 +4491,8 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_AcidArrow" data "Level" "5" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d8,Acid,Magical);IF(SaveCrit()):DealDamage((4d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d8,Acid,Magical);IF(SaveCrit()):DealDamage((4d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(4d8,Acid)" data "TooltipStatusApply" "ApplyStatus(AcidGrip_Rank4,100,-1)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" @@ -4504,8 +4504,8 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_AcidArrow" data "Level" "6" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "TooltipDamageList" "DealDamage(6d8,Acid)" data "TooltipStatusApply" "ApplyStatus(AcidGrip_Rank6,100,-1)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" @@ -4691,7 +4691,7 @@ new entry "Projectile_HailOfThorns_5" type "SpellData" data "SpellType" "Projectile" using "Projectile_HailOfThorns" -data "SpellSuccess" "DealDamage(11d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5);" +data "SpellSuccess" "DealDamage(11d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2);" data "TooltipDamageList" "DealDamage(11d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "RootSpellID" "Projectile_HailOfThorns" @@ -4701,7 +4701,7 @@ new entry "Projectile_HailOfThorns_6" type "SpellData" data "SpellType" "Projectile" using "Projectile_HailOfThorns" -data "SpellSuccess" "DealDamage(13d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5);" +data "SpellSuccess" "DealDamage(13d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2);" data "TooltipDamageList" "DealDamage(13d6,Bludgeoning,Magical)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6;" data "RootSpellID" "Projectile_HailOfThorns" @@ -4732,7 +4732,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_WitchBolt" data "Level" "5" -data "SpellSuccess" "DealDamage(11d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5);" +data "SpellSuccess" "DealDamage(11d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2);" data "TooltipDamageList" "DealDamage(11d6,Bludgeoning)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" data "RootSpellID" "Projectile_WitchBolt" @@ -4743,7 +4743,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_WitchBolt" data "Level" "6" -data "SpellSuccess" "DealDamage(13d6,Bludgeoning,Magical);Force(1.5);IF(IsCritical()):Force(1.5);" +data "SpellSuccess" "DealDamage(13d6,Bludgeoning,Magical);Force(2);IF(IsCritical()):Force(2);" data "TooltipDamageList" "DealDamage(13d6,Bludgeoning)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" data "RootSpellID" "Projectile_WitchBolt" @@ -5080,7 +5080,7 @@ data "SpellType" "Projectile" data "Level" "2" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AreaRadius" "2" data "ExplodeRadius" "2" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" @@ -5151,10 +5151,10 @@ using "Projectile_Jump_NoFallDamage" data "Level" "3" data "SpellSchool" "Evocation" data "TargetCeiling" "5" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "AddRangeFromAbility" ";" -data "ExplodeRadius" "3" +data "ExplodeRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC()) " data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d4,Bludgeoning,Magical);IF(not SaveCrit()):DealDamage(3d6,Fire,Magical);IF(SaveCrit()):DealDamage((3d4)*2,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Fire,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((3d4)/2,Bludgeoning,Magical);IF(not SaveCritMiss('Reflex')):DealDamage((3d6)/2,Fire,Magical);" @@ -5211,9 +5211,9 @@ data "PowerLevel" "6" new entry "Projectile_HurtlingStone" type "SpellData" data "SpellType" "Projectile" -data "TargetRadius" "36" +data "TargetRadius" "48" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" -data "SpellSuccess" "DealDamage(LevelMapValue(D6Cantrip),Bludgeoning);Force(1.5)" +data "SpellSuccess" "DealDamage(LevelMapValue(D6Cantrip),Bludgeoning);Force(2)" data "TargetConditions" "not Self() and not Dead()" data "ProjectileCount" "1" data "Trajectories" "c7cd4b0a-2b2e-47ae-a4e8-849ad5d448f8" @@ -5239,7 +5239,7 @@ new entry "Projectile_FireRayDomain" type "SpellData" data "SpellType" "Projectile" using "Projectile_HurtlingStone" -data "SpellProperties" "GROUND:CreateSurface(1.5,1,Fire);GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" +data "SpellProperties" "GROUND:CreateSurface(2,1,Fire);GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" data "SpellSuccess" "DealDamage(LevelMapValue(2d6H2d6),Fire);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" data "Trajectories" "76dc68a0-5bc5-4ffc-be02-547f690af36b" @@ -5335,7 +5335,7 @@ data "SpellType" "Projectile" data "Level" "3" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "36" +data "TargetRadius" "48" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(3d6,Piercing,Magical);DealDamage(3d6,Bludgeoning,Magical);" data "TargetConditions" "not Self() and not Dead() and ConcentrateSpell();" @@ -5401,7 +5401,7 @@ data "SpellType" "Projectile" data "Level" "3" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AreaRadius" "2" data "ExplodeRadius" "2" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" @@ -5447,11 +5447,11 @@ type "SpellData" data "SpellType" "Projectile" data "Level" "4" data "SpellSchool" "Evocation" -data "SpellProperties" "GROUND:CreateSurface(6,0,Water);ApplyStatus(WET,100, 3);" +data "SpellProperties" "GROUND:CreateSurface(8,0,Water);ApplyStatus(WET,100, 3);" data "TargetFloor" "-1" -data "TargetRadius" "36" -data "AreaRadius" "6" -data "ExplodeRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" +data "ExplodeRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC()) " data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d6,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Bludgeoning,Magical);IF(Tagged('UNDEAD') or Tagged('FIEND') and not SaveCrit()):DealDamage(6d6,Radiant,Magical);IF(Tagged('UNDEAD') or Tagged('FIEND') and SaveCrit()):DealDamage((6d6)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((3d6)/2,Bludgeoning,Magical);IF(Tagged('UNDEAD') or Tagged('FIEND') and not SaveCritMiss('Reflex')):DealDamage((6d6)/2,Radiant,Magical);" @@ -5509,7 +5509,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellSchool" "Evocation" data "TargetFloor" "-1" -data "TargetRadius" "100" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D8Unarmed)+IntelligenceModifier,Bludgeoning,Magical);" data "TargetConditions" "not Dead();" @@ -5544,7 +5544,7 @@ data "SpellType" "Projectile" data "Level" "3" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:TeleportSource();" -data "TargetRadius" "12" +data "TargetRadius" "16" data "ExplodeRadius" "2" data "AmountOfTargets" "1" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC()) " @@ -5642,7 +5642,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_Jump" data "TargetCeiling" "32" -data "TargetRadius" "9" +data "TargetRadius" "12" data "CastSound" "Steelwatcher_Biped_Foley_Jump" data "UseCosts" "ActionPoint:1;Movement:9" data "SpellFlags" "IsJump;HasHighGroundRangeExtension;IgnoreVisionBlock;Stealth;Invisible;CannotTargetCharacter;CannotTargetItems" @@ -5693,7 +5693,7 @@ using "Projectile_EnsnaringStrike" data "SpellSchool" "" data "SpellContainerID" "" data "SpellProperties" "" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "IF(not SavingThrow(Ability.Dexterity,16)):ApplyStatus(BOLA,100,2);DealDamage(2d12,Bludgeoning);" data "SpellFail" "" @@ -5835,7 +5835,7 @@ data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "DealDamage(LevelMapValue(H2D4)+LevelMapValue(H2P1),Force,Magical);" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "1" data "TargetConditions" "not Self() and not Dead()" data "ProjectileCount" "1" @@ -5930,7 +5930,7 @@ type "SpellData" data "SpellType" "Projectile" data "ContainerSpells" "Projectile_FaerieDust1Action;Projectile_FaerieDust2Action;Projectile_FaerieDust3Action" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "ExplodeRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" @@ -5971,7 +5971,7 @@ data "SpellType" "Projectile" using "Projectile_FaerieDust" data "SpellContainerID" "Projectile_FaerieDust" data "AreaRadius" "3" -data "ExplodeRadius" "3" +data "ExplodeRadius" "4" data "DisplayName" "h1a5ff543gc415g1cb1g43a8gd08e0aa3e709;1" data "UseCosts" "ActionPoint:2;KiPoint:1;SorceryPoint:1;" @@ -5981,7 +5981,7 @@ data "SpellType" "Projectile" using "Projectile_FaerieDust" data "SpellContainerID" "Projectile_FaerieDust" data "AreaRadius" "4" -data "ExplodeRadius" "4" +data "ExplodeRadius" "6" data "DisplayName" "h572a185fgeef9gef86gb23bg28dfef1b2cfb;1" data "UseCosts" "ActionPoint:3;KiPoint:1;SorceryPoint:1;" @@ -5995,7 +5995,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_Jump" data "TargetCeiling" "LevelMapValue(RisingSurfHeight)" -data "TargetRadius" "9.5" +data "TargetRadius" "12" data "AddRangeFromAbility" ";" data "DisplayName" "h604e0fe7g1ef4g2db5ga5ffg6dc2d18c2af4;1" data "Description" "ha1ca7fb8g39a1g8b51g9d9cgb1daf5132c9c;1" @@ -6011,7 +6011,7 @@ new entry "Projectile_ClingingIce" type "SpellData" data "SpellType" "Projectile" using "Projectile_RayOfFrost" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D4Bonus),Cold,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D4Bonus))*2,Cold,Magical);ApplyStatus(RAY_OF_FROST,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((LevelMapValue(D4Bonus))/2,Cold,Magical);" @@ -6027,7 +6027,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_OversizedThrow" data "Cooldown" "None" -data "TargetRadius" "5" +data "TargetRadius" "6" data "SpellSuccess" "DealDamage(LevelMapValue(AnimalSecondaryFrog)+StrengthModifier,Piercing);" data "Icon" "Spell_Conjuration_HailOfThorns" data "DisplayName" "h0be1efb0g7db6g7057g1759gc336f3cdc006;1" @@ -6075,7 +6075,7 @@ type "SpellData" data "SpellType" "Projectile" data "TargetCeiling" "12" data "TargetFloor" "-12" -data "TargetRadius" "12" +data "TargetRadius" "16" data "TargetConditions" "RageConcentrateSpell();" data "ProjectileCount" "1" data "Trajectories" "rules:861d0046-1858-401e-b97b-28f7b3e3e89a,d5e54f29-f80f-4105-96b2-23b5af9321c7,bac38aab-dfa7-4a5a-9c2a-552b0b626ee3" @@ -6106,7 +6106,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellProperties" "GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" data "TargetFloor" "-1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AmountOfTargets" "3" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D4Bonus),Piercing,Magical);DealDamage(LevelMapValue(D4Bonus),Bludgeoning,Magical);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);" @@ -6160,8 +6160,8 @@ data "SpellType" "Projectile" data "SpellProperties" "ApplyStatus(SELF,CircumstanceBonus2AC,100,1);GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);ApplyStatus(SELF,KineticistOverflow,100,0);" data "TargetCeiling" "0.8" data "TargetFloor" "-1" -data "TargetRadius" "9" -data "ExplodeRadius" "3" +data "TargetRadius" "12" +data "ExplodeRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" data "SpellSuccess" "IF(not HasPassive('FireJunction',context.Source)):DealDamage(LevelMapValue(LavaLeapDamage),Fire,Magical);IF(HasPassive('FireJunction',context.Source)):DealDamage(LevelMapValue(LavaLeapDamageJunction),Fire,Magical);DealDamage(LevelMapValue(LavaLeapBludgeoning),Bludgeoning,Magical);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);" data "SpellFail" "IF(not HasPassive('FireJunction',context.Source)):DealDamage(LevelMapValue(LavaLeapDamage)/2,Fire,Magical);IF(HasPassive('FireJunction',context.Source)):DealDamage(LevelMapValue(LavaLeapDamageJunction)/2,Fire,Magical);DealDamage(LevelMapValue(LavaLeapBludgeoning)/2,Bludgeoning,Magical);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);" @@ -6196,7 +6196,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellProperties" "ApplyStatus(SELF,GrindstoneRecast,100,10);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(GrindstoneSlashing),Slashing,Magical);DealDamage(LevelMapValue(GrindstoneFire),Fire,Magical);" data "TargetConditions" "RageConcentrateSpell();" @@ -6236,7 +6236,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellProperties" "ApplyStatus(ArtilleryReload,100,2);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);GROUND:IF(HasStatus('WOOD_JUNCTION',context.Source)):ApplyStatus(SELF,WoodTempJunction);" data "TargetFloor" "-1" -data "TargetRadius" "36" +data "TargetRadius" "48" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(ArtilleryDamage),Piercing,Magical);" data "TargetConditions" "RageConcentrateSpell();" @@ -6270,7 +6270,7 @@ type "SpellData" data "SpellType" "Projectile" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);" data "TargetFloor" "-1" -data "TargetRadius" "4" +data "TargetRadius" "6" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(MoltenWireSlashing),Slashing,Magical);ApplyStatus(WireStatus,100,-1);IF(not CharacterLevelGreaterThan(9)):ApplyStatus(IgnitionPersistent_Rank2,100,-1);IF(CharacterLevelGreaterThan(9)):ApplyStatus(IgnitionPersistent_Rank3,100,-1);ApplyStatus(CLUMSY,100,3);" data "TargetConditions" "RageConcentrateSpell();" @@ -6330,7 +6330,7 @@ new entry "Projectile_LOW_Hag_RayOfSickness_Explosion" type "SpellData" data "SpellType" "Projectile" using "Projectile_LOW_Hag_RayOfSickness" -data "TargetRadius" "8" +data "TargetRadius" "10" data "SpellFail" "" data "TargetConditions" "Character() and not Dead() and Enemy() and not Self();" data "RequirementConditions" "" @@ -6406,7 +6406,7 @@ using "Projectile_TAD_ShieldOfThralls_Explosion" data "Level" "" data "SpellSchool" "" data "SpellProperties" "" -data "TargetRadius" "3" +data "TargetRadius" "4" data "AreaRadius" "3" data "ExplodeRadius" "3" data "SpellRoll" "not SavingThrow(Ability.Wisdom, 12);" @@ -6433,7 +6433,7 @@ using "Projectile_WitchBolt" data "Level" "" data "SpellSchool" "" data "SpellProperties" "AI_ONLY:ApplyStatus(MENTALSLAM,100,4);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_SMAL,100,1);" -data "TargetRadius" "20" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(CRE_MINDSTEAL_LINK_TARGET,100,-1); ApplyStatus(CRE_MINDSTEAL_LINK,100,-1);" data "TargetConditions" "not Self() and not Dead() and not HasStatus('CRE_MINDSTEAL_LINK_TARGET') and not HasStatus('SPIRITUAL_WEAPON') and ConcentrateSpell() and Character();" @@ -6470,7 +6470,7 @@ data "SpellType" "Projectile" using "Projectile_CRE_GithyankiInquisitor_Mindsteal_Link" data "Cooldown" "OncePerCombat" data "SpellProperties" "" -data "TargetRadius" "10" +data "TargetRadius" "16" data "AreaRadius" "20" data "ExplodeRadius" "40" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" @@ -6499,7 +6499,7 @@ data "SpellType" "Projectile" using "Projectile_Jump" data "SpellProperties" "IF(Party() or Ally() and not Dead()):RegainHitPoints(foreach(1+BLADESONG_HEALING_CHARGE.Duration, 1d6));IF(Party() or Ally() and not Dead()):ApplyStatus(BLADESONGFINISHER_ALLY,100,0);" data "TargetFloor" "-1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "ExplodeRadius" "3" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(Enemy() and not Dead()):DealDamage(foreach(1+BLADESONG_DAMAGE_CHARGE.Duration, 1d6), Force, Magical);IF(Enemy() and not Dead()):ApplyStatus(BLADESONGFINISHER_ENEMY,100,0);IF(Self()):RemoveStatus(BLADESONG);" @@ -6556,7 +6556,7 @@ new entry "Projectile_ArrowOfDetonation" type "SpellData" data "SpellType" "Projectile" using "Projectile_MainHandAttack" -data "SpellProperties" "IF(not SavingThrow(Ability.Constitution,12)):Force(5, TargetToEntity);" +data "SpellProperties" "IF(not SavingThrow(Ability.Constitution,12)):Force(4, TargetToEntity);" data "ExplodeRadius" "2" data "SpellSuccess" "TARGET:DealDamage(MainRangedWeapon, MainRangedWeaponDamageType); TARGET:ExecuteWeaponFunctors(MainHand)" data "SpellFail" "IF(HasStatus('YSRSLIDFWWADNIWHWIHLY')):SpawnExtraProjectiles(Projectile_ArrowOfDetonation);ApplyStatus(YSRSLIDFWWADNIWHWIHLY_YWNK,100,1)" @@ -6564,7 +6564,7 @@ data "Trajectories" "46de315c-71f5-4848-818a-dbec9c93583b,101c0773-4de6-7fb3-142 data "Icon" "Item_ARR_Arrow_Of_Detonation" data "DisplayName" "h78d4ab19g92f1ga0ccg6136g41f8e8e02552;1" data "Description" "hbb6c8d12g8c90g46a9g7699g78e01d0823e9;1" -data "DescriptionParams" "Distance(5)" +data "DescriptionParams" "Distance(4)" data "TooltipAttackSave" "RangedWeaponAttack;Strength" data "CastSound" "Proj_Arr_Cast_ArrowOfDetonation" data "SpellFlags" "HasHighGroundRangeExtension;RangeIgnoreVerticalThreshold;IsHarmful;AddFallDamageOnLand;DisplayInItemTooltip" @@ -6639,7 +6639,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ArrowOfDetonation" data "Cooldown" "OncePerTurn" -data "TargetRadius" "14" +data "TargetRadius" "16" data "SpellRoll" "Attack2e(AttackType.RangedUnarmedAttack)" data "SpellSuccess" "DealDamage(1d6+2,Piercing)" data "SpellFail" "" @@ -6670,9 +6670,9 @@ new entry "Projectile_Jump_Knockdown_AOE" type "SpellData" data "SpellType" "Projectile" using "Projectile_Jump" -data "TargetRadius" "3" -data "AreaRadius" "3" -data "ExplodeRadius" "3" +data "TargetRadius" "4" +data "AreaRadius" "4" +data "ExplodeRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC())" data "SpellSuccess" "ApplyStatus(PRONE_PF2,100,-1);" data "TargetConditions" "not Self() and Enemy() and not Dead()" @@ -6685,7 +6685,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_PushingAttack" data "Cooldown" "OncePerCombat" -data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(5);DealDamage(MainRangedWeapon + LevelMapValue(SuperiorityDie), MainRangedWeaponDamageType);ExecuteWeaponFunctors(MainHand);" +data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(4);DealDamage(MainRangedWeapon + LevelMapValue(SuperiorityDie), MainRangedWeaponDamageType);ExecuteWeaponFunctors(MainHand);" data "HitCosts" "" data "SpellAnimationIntentType" "Aggressive" @@ -6716,7 +6716,7 @@ new entry "Projectile_ArrowOfDetonation_Trap" type "SpellData" data "SpellType" "Projectile" using "Projectile_ArrowOfDetonation" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Dexterity, 12)" data "SpellSuccess" "DealDamage(2d6,Force,Magical)" data "SpellFail" "" @@ -6731,7 +6731,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_Jump" data "Cooldown" "OncePerTurn" -data "TargetRadius" "4.5" +data "TargetRadius" "6" data "AreaRadius" "18" data "ExplodeRadius" "5" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC(), AdvantageOnOrinFear())" @@ -6822,7 +6822,7 @@ using "Projectile_Jump_HookHorror" data "SpellProperties" "GROUND:CreateExplosion(Projectile_Jump_Knockdown_AOE_Alioramus)" data "TargetCeiling" "0.8" data "TargetFloor" "-1" -data "TargetRadius" "6" +data "TargetRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC())" data "SpellSuccess" "DealDamage(1d4+UnarmedMeleeAbilityModifier,Bludgeoning)" data "ProjectileCount" "1" @@ -6877,7 +6877,7 @@ data "SpellType" "Projectile" using "Projectile_ThrowMissile" data "Cooldown" "OncePerTurn" data "SpellProperties" "AI_ONLY:DealDamage(2d8+3,Fire,Magical);AI_ONLY:DealDamage(2d8+3,Thunder,Magical);GROUND:Spawn(29d32b36-390f-4fe8-b27b-931393d76c2a,,EXPLOSIVE_MINE_ORTHON,,,,true);GROUND:Spawn(29d32b36-390f-4fe8-b27b-931393d76c2a,,EXPLOSIVE_MINE_ORTHON,,,,true);GROUND:Spawn(29d32b36-390f-4fe8-b27b-931393d76c2a,,EXPLOSIVE_MINE_ORTHON,,,,true);" -data "TargetRadius" "14" +data "TargetRadius" "12" data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, SourceSpellDC())):ApplyStatus(PRONE_PF2,100,-1);DealDamage(2d4+2,Bludgeoning);" data "TargetConditions" "not Self()" data "Trajectories" "fd85ba28-6ceb-4601-bad0-3addcdc5db32" @@ -6944,7 +6944,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_FireBolt" data "SpellProperties" "" -data "TargetRadius" "8" +data "TargetRadius" "10" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(1d4,Fire,Magical);IF(SaveCrit()):DealDamage((1d4)*2,Fire,Magical);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((1d4)/2,Fire,Magical);" @@ -6965,7 +6965,7 @@ type "SpellData" data "SpellType" "Projectile" using "Projectile_ThrowMissile" data "Cooldown" "OncePerTurn" -data "TargetRadius" "18" +data "TargetRadius" "24" data "DeathType" "Electrocution" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(1d4,Psychic,Magical);IF(SaveCrit()):DealDamage((1d4)*2,Psychic,Magical);" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Rush.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Rush.txt index 0540ade3..fff1f399 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Rush.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Rush.txt @@ -7,7 +7,7 @@ new entry "Rush_SuddenCharge" type "SpellData" data "SpellType" "Rush" data "Cooldown" "OncePerTurn" -data "TargetRadius" "18" +data "TargetRadius" "24" data "HitRadius" "1" data "MovementSpeed" "40000" data "SpellRoll" "Attack(AttackType.MeleeWeaponAttack)" @@ -21,7 +21,7 @@ data "TooltipAttackSave" "MeleeWeaponAttack" data "CastSound" "Action_Cast_SpringAttack" data "PreviewCursor" "Melee" data "CastTextEvent" "Cast" -data "Requirements" "not HasStatus('Grappled') and not HasStatus('ENSNARED') and not HasStatus('WEB')" +data "Requirements" "!Immobile" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:1;Movement:Distance*0.5;Stride:1;" data "SpellAnimation" "e4c33fe4-af36-47b7-9f61-51f2f6924210,,;7bfeb9dd-1348-45c7-bff9-ed42f8cd43a1,,;b780092c-cc12-43d5-b60e-acbac3fdceed,,;abbeb7de-2128-4b16-95e5-7b9d7b1af2f9,,;6574bfb9-d601-4760-bd53-867747514006,,;,,;a28c0e11-6dc4-4f40-8e58-14e0d7ae4172,,;,,;,," @@ -44,12 +44,13 @@ type "SpellData" data "SpellType" "Rush" using "Rush_SuddenCharge" data "SpellProperties" "ApplyStatus(SELF,RAISE_SHIELD,100,1)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Icon" "PassiveFeature_RelentlessAvenger" data "DisplayName" "h97145663g07e7g6c72gb261g6610a4a2f92d;1" data "Description" "he7c48925gec52g55f6g8b10g6fdcc0eed6e9;1" data "TooltipDamageList" "DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType)" data "CastSound" "PassiveFeature_RelentlessAvenger" +data "Requirements" "!Immobile" data "UseCosts" "ActionPoint:2;Movement:Distance;Stride:1;" data "RequirementConditions" "CanUseWeaponActions() and HasShieldEquipped(context.Source);" @@ -59,7 +60,7 @@ data "SpellType" "Rush" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(SELF,BLUR,100,1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "HitRadius" "1" data "MovementSpeed" "80000" data "SpellSuccess" "ApplyStatus(SELF,BLUR,100,1)" @@ -71,7 +72,7 @@ data "TooltipStatusApply" "ApplyStatus(BLUR,100,1)" data "PrepareSound" "Vocal_Component_Shadow_Monk" data "CastSound" "Spell_Cast_Monk_FistofFourThunders_L1to3" data "CastTextEvent" "Cast" -data "Requirements" "not HasStatus('Grappled') and not HasStatus('ENSNARED') and not HasStatus('WEB')" +data "Requirements" "!Immobile" data "Stealth" "Yes" data "UseCosts" "Stride:1;Movement:Distance*0.5;KiPoint:1" data "SpellAnimation" "0319ca29-4024-4649-9278-3c1f20c5f023,,;e329fa49-fa97-41a5-9b37-5157bb17d398,,;5527380a-aa1c-4b96-9321-c9da23af7396,,;,,;b24b3f23-6d3a-43ce-ae3a-abfb44d26082,,;,,;d13e9dce-8866-4833-98e3-f2e8cad0d790,,;,,;,," @@ -88,7 +89,7 @@ new entry "Rush_SpringAttack" type "SpellData" data "SpellType" "Rush" data "Cooldown" "OncePerShortRest" -data "TargetRadius" "9" +data "TargetRadius" "12" data "HitRadius" "1.5" data "MovementSpeed" "40000" data "SpellRoll" "Attack(AttackType.MeleeWeaponAttack)" @@ -139,7 +140,7 @@ data "Description" "hcd4adf35g3632ga9cdg36bbg8eb91f8c4d6e;1" data "TooltipDamageList" "DealDamage(MainMeleeWeapon+5, MainMeleeWeaponDamageType)" data "TooltipAttackSave" "MeleeWeaponAttack" data "TooltipStatusApply" "" -data "Requirements" "not HasStatus('Grappled') and not HasStatus('ENSNARED') and not HasStatus('WEB')" +data "Requirements" "!Immobile" data "UseCosts" "ActionPoint:2" data "SpellFlags" "IsHarmful" data "VerbalIntent" "Damage" @@ -153,7 +154,7 @@ data "SpellType" "Rush" using "Rush_SpringAttack" data "Cooldown" "" data "SpellProperties" "RemoveStatus(SLEEP);RemoveStatus(SLEEPING);RemoveStatus(SG_Sleeping);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "HitRadius" "1.5" data "MovementSpeed" "40000" data "SpellRoll" "Dead() or SkillCheck(Skill.Athletics,math.max(context.Target.GetPassiveSkill(Skill.Athletics),context.Target.GetPassiveSkill(Skill.Acrobatics)))" @@ -169,7 +170,7 @@ data "TooltipAttackSave" "" data "TooltipStatusApply" "" data "PreviewCursor" "Melee" data "CastTextEvent" "Cast" -data "Requirements" "not HasStatus('Grappled') and not HasStatus('ENSNARED') and not HasStatus('WEB')" +data "Requirements" "!Immobile" data "CycleConditions" "CanShoveWeight() and not Grounded()" data "UseCosts" "ActionPoint:2" data "SpellFlags" "IsHarmful;AddFallDamageOnLand" @@ -190,13 +191,15 @@ data "Requirement" "MeleeWeapon" data "Cooldown" "None" data "DisplayName" "hda5a616ag7313g41c0g2095g87766fcb3176;1" data "Description" "h1ba22ab7g744fga232g6f91g28149ddecb64;1" -data "Requirements" "CanUseWeaponActions() and (HasStatus('MAP_PENALTY_2ND') or HasStatus('MAP_PENALTY_3RD'))" +data "Requirements" "!Immobile" data "UseCosts" "ActionPoint:1;Movement:Distance*1;Stride:1;" +data "RequirementConditions" "CanUseWeaponActions() and IsProficientWithEquippedWeapon() and (HasStatus('MAP_PENALTY_2ND') or HasStatus('MAP_PENALTY_3RD'))" new entry "Rush_PredatorsPounce" type "SpellData" data "SpellType" "Rush" data "Cooldown" "OncePerTurn" +data "Requirements" "!Immobile" data "SpellAnimation" "e4c33fe4-af36-47b7-9f61-51f2f6924210,,;7bfeb9dd-1348-45c7-bff9-ed42f8cd43a1,,;b780092c-cc12-43d5-b60e-acbac3fdceed,,;abbeb7de-2128-4b16-95e5-7b9d7b1af2f9,,;6574bfb9-d601-4760-bd53-867747514006,,;,,;a28c0e11-6dc4-4f40-8e58-14e0d7ae4172,,;,,;,," new entry "Rush_SwireEscape" @@ -205,7 +208,7 @@ data "SpellType" "Rush" using "Rush_DefensiveAdvance" data "Cooldown" "OncePerShortRestPerItem" data "AIFlags" "CanNotUse" -data "TargetRadius" "9" +data "TargetRadius" "12" data "HitRadius" "1" data "SpellSuccess" "DealDamage(2d4,Force);ExecuteWeaponFunctors(MainHand);" data "Icon" "Action_Barbarian_PrimalStampede" @@ -213,6 +216,7 @@ data "DisplayName" "hf1ff4d27gc99fg1713g9159g9393c6c11158;1" data "Description" "h186ef1acg5f29ga138g0177g048431426bc7;1" data "DescriptionParams" "Distance(9)" data "TooltipDamageList" "DealDamage(2d4, Force)" +data "Requirements" "!Immobile" data "UseCosts" "ActionPoint:2;" data "SpellFlags" "IsHarmful" data "RequirementConditions" "CanUseWeaponActions();" @@ -229,7 +233,7 @@ type "SpellData" data "SpellType" "Rush" using "Rush_ForceTunnel" data "Cooldown" "" -data "TargetRadius" "12" +data "TargetRadius" "16" data "SpellRoll" "Attack(AttackType.MeleeSpellAttack)" data "SpellSuccess" "DealDamage(3d10+4,Force,Magical);TARGET:IF(not SavingThrow(Ability.Constitution,17)):ApplyStatus(PRONE,100,2);" data "DisplayName" "h73e5ab49gc5d2gc1c6g9dd0g756c3d506f96;1" @@ -237,7 +241,7 @@ data "DescriptionParams" "Distance(12)" data "TooltipDamageList" "DealDamage(3d10+4,Force)" data "TooltipAttackSave" "MeleeUnarmedAttack;Strength" data "TooltipStatusApply" "ApplyStatus(PRONE,100,2)" -data "Requirements" "not HasStatus('Grappled') and not HasStatus('ENSNARED') and not HasStatus('WEB')" +data "Requirements" "!Immobile" data "UseCosts" "ActionPoint:1" data "SpellFlags" "IsHarmful;AddFallDamageOnLand;Wildshape" @@ -249,7 +253,7 @@ data "SpellAnimation" "b94b9184-9bd0-4840-be7d-003700173b37,,;,,;5df11e35-f081-4 new entry "Rush_BurningJet_Level1" type "SpellData" data "SpellType" "Rush" -data "TargetRadius" "12" +data "TargetRadius" "16" data "HitRadius" "1" data "MovementSpeed" "80000" data "TargetConditions" "RageConcentrateSpell();" @@ -277,7 +281,7 @@ new entry "Rush_BurningJet_Level1_Real" type "SpellData" data "SpellType" "Rush" data "SpellContainerID" "Rush_BurningJet_Level1" -data "TargetRadius" "12" +data "TargetRadius" "16" data "HitRadius" "1" data "MovementSpeed" "80000" data "TargetConditions" "RageConcentrateSpell();" @@ -305,7 +309,7 @@ new entry "Rush_BurningJet_Level6" type "SpellData" data "SpellType" "Rush" using "Rush_BurningJet_Level1" -data "TargetRadius" "18" +data "TargetRadius" "24" data "DisplayName" "h8c68ecadg934fge6f5g8b30g03b6431dbbf6;1" data "RequirementConditions" "CanCastImpulse('Fire') and not HasStatus('Grappled') and not HasStatus('ENSNARED') and not HasStatus('WEB') and CharacterLevelGreaterThan(5) and RageConcentrateSpell();" @@ -313,7 +317,7 @@ new entry "Rush_LightningDash" type "SpellData" data "SpellType" "Rush" data "SpellProperties" "GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "HitRadius" "1.5" data "MovementSpeed" "99999" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" @@ -407,7 +411,7 @@ data "DamageType" "Piercing" new entry "Rush_Primal_Stampede" type "SpellData" data "SpellType" "Rush" -data "TargetRadius" "9" +data "TargetRadius" "12" data "HitRadius" "2" data "MovementSpeed" "12000" data "SpellRoll" "Attack(AttackType.MeleeUnarmedAttack)" @@ -446,7 +450,7 @@ data "SpellType" "Rush" using "Rush_Rush" data "Cooldown" "OncePerTurn" data "AIFlags" "" -data "TargetRadius" "12" +data "TargetRadius" "16" data "HitRadius" "2" data "SpellRoll" "Attack(AttackType.MeleeUnarmedAttack)" data "SpellSuccess" "DealDamage(4d8+UnarmedMeleeAbilityModifier,Piercing);IF(not SavingThrow(Ability.Constitution,14)):ApplyStatus(PRONE,100,2);AI_IGNORE:Force(2);" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Shout.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Shout.txt index a2ef318c..49e0d600 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Shout.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Shout.txt @@ -129,7 +129,7 @@ new entry "Shout_Disengage" type "SpellData" data "SpellType" "Shout" using "Shout_Disengage" -data "SpellProperties" "AI_IGNORE:IF( not HasStatus('DISENGAGE')):UseActionResource(Movement,100%,0,true);AI_IGNORE:RestoreResource(Movement,3,0);AI_IGNORE:IF(not Tagged('DOUBLE_STEP')):UseActionResource(Movement,1.5,0,true); AI_IGNORE:ApplyStatus(DISENGAGE,100,1);AI_ONLY:IF(HasStatus('FLANKED_AOO')):ApplyStatus(DISENGAGE,100,1);" +data "SpellProperties" "AI_IGNORE:IF( not HasStatus('DISENGAGE')):UseActionResource(Movement,100%,0,true);AI_IGNORE:RestoreResource(Movement,4,0);AI_IGNORE:IF(not Tagged('DOUBLE_STEP')):UseActionResource(Movement,2,0,true);AI_IGNORE:ApplyStatus(DISENGAGE,100,1);AI_ONLY:IF(HasStatus('FLANKED_AOO')):ApplyStatus(DISENGAGE,100,1);" data "DisplayName" "hfa510585g605fg9622ga9a6g1174817faaa0;1" data "SpellFlags" "IgnoreSilence;Stealth;Invisible;NoCameraMove" data "RechargeValues" "1-2" @@ -330,7 +330,7 @@ data "SpellAnimation" "03496c4a-49e0-4132-b585-3e5ecd1ad8e5,,;,,;5e7e63e1-0e69-4 data "VerbalIntent" "Utility" data "SpellFlags" "HasSomaticComponent;NoCameraMove" data "Requirements" "not Combat" -data "RequirementConditions" "ConcentrateSpell();" +data "RequirementConditions" "ConcentrateSpell() and not Combat()" data "PrepareEffect" "d10ebb45-0780-46d7-8975-0e2f1a78bc8e" data "CastEffect" "d822f332-8213-49a1-bc48-4668a89199ad" data "Sheathing" "Somatic" @@ -959,7 +959,7 @@ type "SpellData" data "SpellType" "Shout" data "Cooldown" "OncePerShortRest" data "SpellProperties" "ApplyStatus(MAGIC_AWARENESS,100,1)" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "Self()" data "Icon" "Action_Barbarian_MagicAwareness" data "DisplayName" "h8f0ff2c9g31f8g54b7gdb12g7e693f32249a;1" @@ -978,7 +978,7 @@ type "SpellData" data "SpellType" "Shout" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(WILD_MAGIC_BARBARIAN_TELEPORT,100,10);ApplyStatus(SELF,RAGE_MUTE,100,10)" -data "AreaRadius" "18" +data "AreaRadius" "24" data "Icon" "Action_WildMagic_Barbarian_Teleport" data "DisplayName" "hfef8dbf3gd864g9674gd842g8005c97049bd;1" data "Description" "h2d7fe362gdf77g0c94gcdb7g6ae23d5633a3;1" @@ -1108,7 +1108,7 @@ data "SpellType" "Shout" data "Level" "0" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(CourageousAnthem,100,1)" -data "AreaRadius" "18" +data "AreaRadius" "24" data "TargetConditions" "not Enemy() and not Dead() and not Item() and EmotionSpell() and MentalSpell() and ConcentrateSpell();" data "Icon" "Action_Bard_GrantBardicInspiration" data "DisplayName" "h141245d3g7cd2g05c4g1179g61d81aa15db6;1" @@ -1138,7 +1138,7 @@ data "SpellType" "Shout" data "Level" "1" data "SpellSchool" "Enchantment" data "ContainerSpells" "Shout_CourageousAnthem_Lingering;Shout_SongOfStrength_Lingering;Shout_RallyingAnthem_Lingering;Shout_TripleTime_Lingering;Shout_DirgeOfDoom_Lingering" -data "AreaRadius" "18" +data "AreaRadius" "24" data "SpellRoll" "SkillCheck(Skill.Performance,15);" data "Icon" "PassiveFeature_BardicInspiration_AttackRollOrAbilityCheck" data "DisplayName" "h3dfe533dgaa4bg50f1g6ce2gcfbbd1759e56;1" @@ -1262,7 +1262,7 @@ data "SpellType" "Shout" data "Level" "0" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(SELF,DIRGE_OF_DOOM,100,1)" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Action_MagicItem_HowlOfTheDead" data "DisplayName" "he5cc3497g2f67g8ce6g6e36g4969988fbac9;1" @@ -1298,7 +1298,7 @@ new entry "Shout_DazzlingDisplay" type "SpellData" data "SpellType" "Shout" data "SpellProperties" "ApplyStatus(DemoralizeImmune,100,100)" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "SkillCheck(Skill.Intimidation,WillDC());" data "SpellSuccess" "IF(SkillCrit()):ApplyStatus(FRIGHTENED,100,2);ApplyStatus(FRIGHTENED,100,1);" data "TargetConditions" "not HasStatus('DemoralizeImmune',context.Target,context.Source) and Character() and not Ally()" @@ -1326,7 +1326,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_DazzlingDisplay" data "SpellProperties" "ApplyStatus(SnarlingImmune,100,100)" -data "AreaRadius" "36" +data "AreaRadius" "48" data "SpellRoll" "SkillCheck(Skill.Performance,WillDC());" data "SpellSuccess" "IF(not SkillCrit()):ApplyStatus(FRIGHTENED,100,1);IF(SkillCrit()):ApplyStatus(FRIGHTENED,100,2);IF(Tagged('BEAST')):ApplyStatus(FRIGHTENED,100,2);" data "TargetConditions" "not HasStatus('SnarlingImmune',context.Target,context.Source) and Character() and not Ally() and (AdjacentToBeastMinion() or not DistanceToTargetGreaterThan(2)) and AuditorySpell() and FearSpell() and EmotionSpell() and MentalSpell();" @@ -1346,7 +1346,7 @@ data "SpellType" "Shout" data "Level" "0" data "SpellSchool" "Enchantment" data "SpellProperties" "IF(Combat()):ApplyStatus(UpliftingStatus,100,1);IF(not Combat()):ApplyStatus(UpliftingStatus_RP,100,-1);" -data "AreaRadius" "18" +data "AreaRadius" "24" data "TargetConditions" "not Enemy() and not Dead() and not Item() and AuditorySpell() and EmotionSpell() and MentalSpell() and ConcentrateSpell();" data "Icon" "PassiveFeature_WildMagicSurge" data "DisplayName" "h05c566e0gf8fbg357eg288dg643413543788;1" @@ -1398,7 +1398,7 @@ new entry "Shout_SongbirdsCall" type "SpellData" data "SpellType" "Shout" data "SpellProperties" "ApplyStatus(SONGBIRDS_CALL,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Spell_Conjuration_SpiritGuardians" data "DisplayName" "h8cbb9701gad36g6fc3gf738gaf8ffa521cea;1" @@ -1422,7 +1422,7 @@ data "SpellType" "Shout" data "Level" "4" data "SpellSchool" "Enchantment" data "ContainerSpells" "Shout_CourageousAnthem_Forte;Shout_SongOfStrength_Forte;Shout_RallyingAnthem_Forte" -data "AreaRadius" "18" +data "AreaRadius" "24" data "SpellRoll" "SkillCheck(Skill.Performance,15);" data "TargetConditions" "ConcentrateSpell();" data "Icon" "PassiveFeature_BardicInspiration_Damage" @@ -1486,7 +1486,7 @@ new entry "Shout_HealingRadiance" type "SpellData" data "SpellType" "Shout" data "SpellProperties" "RegainHitPoints(ClassLevel(Paladin)+Cause.CharismaModifier+ProficiencyBonus);ApplyStatus(SELF,HEALING_RADIANCE,100,1)" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "not Enemy() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and Character() " data "Icon" "Action_Paladin_HealingRadiance" data "DisplayName" "hc27f7ccbgb904gde2eg5d97gf0da07c98964;1" @@ -1510,7 +1510,7 @@ data "TargetEffect" "1dcca477-79be-4e15-bb70-8680a6dc49e5" new entry "Shout_Dreadful_Aspect" type "SpellData" data "SpellType" "Shout" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(FRIGHTENED,100,2)" data "TargetConditions" "Character() and Enemy() and not Dead() and FearSpell() and EmotionSpell() and MentalSpell() and VisualSpell();" @@ -1539,7 +1539,7 @@ data "SpellType" "Shout" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(SELF,RAISE_SHIELD_SPIRIT,100,1);ApplyStatus(SELF,CHAMPION_AURA,100,-1);AI_ONLY:ApplyStatus(StatusBonus1AC,100,1);AI_ONLY:ApplyStatus(SpiritShields,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "TargetConditions" "Ally() and not Dead() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ShieldOfFaith" data "DisplayName" "h124e3bcfgdfa3gad35gd1b4gf76af74bd509;1" @@ -1581,7 +1581,7 @@ new entry "Shout_ExpandAura" type "SpellData" data "SpellType" "Shout" data "SpellProperties" "IF(not CharacterLevelGreaterThan(9)):ApplyStatus(EXPAND_AURA,100,1);IF(CharacterLevelGreaterThan(9)):ApplyStatus(EXPAND_AURA,100,10);ApplyStatus(SELF,CHAMPION_AURA,100,-1)" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Action_Paladin_AuraOfDevotion" data "DisplayName" "h53744f11gc81fg8d07g6e17g8ec5305a571c;1" @@ -1608,7 +1608,7 @@ data "SpellAnimation" "5e57443f-284e-47b2-915e-5b6417db269c,,;,,;3b1ecad1-dd85-4 new entry "Shout_CharmAnimalsAndPlants" type "SpellData" data "SpellType" "Shout" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC(),AdvantageOnCharmed());" data "SpellSuccess" "ApplyStatus(CHARM_ANIMALS_AND_PLANTS, 100, 10)" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL_CHARM_SUBTLE, 100, 0)" @@ -1673,7 +1673,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HealBase1" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(1d8);IF(HealLive(10)):RegainHitPoints(1d10);IF(AngelicHalo()):RegainHitPoints(2);" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "HealSavingThrow()" data "SpellSuccess" "IF(not SaveCrit() and HealVoid(8)):DealDamage(1d8,Radiant,Magical);IF(not SaveCrit() and HealVoid(10)):DealDamage(1d10,Radiant,Magical);IF(SaveCrit() and HealVoid(8)):DealDamage((1d8)*2,Radiant,Magical);IF(SaveCrit() and HealVoid(10)):DealDamage((1d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((1d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((1d10)/2,Radiant,Magical);" @@ -1783,7 +1783,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HarmBase1" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(1d8,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(1d10,Guaranteed);GROUND:IF(SapLife()):RegainHitPoints(SELF,1);" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "HarmSavingThrow();" data "SpellSuccess" "IF(not SaveCrit() and HarmLive(8)):DealDamage(1d8,Necrotic,Magical);IF(not SaveCrit() and HarmLive(10)):DealDamage(1d10,Necrotic,Magical);IF(SaveCrit() and HarmLive(8)):DealDamage((1d8)*2,Necrotic,Magical);IF(SaveCrit() and HarmLive(10)):DealDamage((1d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((1d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((1d10)/2,Necrotic,Magical);" @@ -1893,7 +1893,7 @@ data "SpellType" "Shout" data "Level" "1" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(BLESS_AURA,100,10);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_Bless" data "DisplayName" "h4931b8e0g1df4g1268ga5beg4d8dc607a47c;1" @@ -1942,7 +1942,7 @@ data "SpellType" "Shout" data "Level" "1" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(BANE_AURA,100,10);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_Bane" data "DisplayName" "h05bda940gebafg190fg2340ga789ce6b0b89;1" @@ -1979,7 +1979,7 @@ type "SpellData" data "SpellType" "Shout" data "Level" "4" data "SpellSchool" "Transmutation" -data "AreaRadius" "5" +data "AreaRadius" "6" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(4d6Rank4),Bludgeoning,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(4d6Rank4))*2,Bludgeoning,Magical);ApplyStatus(PRONE_PF2,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMis()):DealDamage((LevelMapValue(4d6Rank4))/2,Bludgeoning,Magical);" @@ -2025,7 +2025,7 @@ using "Shout_AuraOf_Protection" data "Level" "4" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(PROTECTOR_SPHERE_AURA,100,10);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "Icon" "Action_Monster_Duergar_MindMastery" data "DisplayName" "h6b63384fg0b7fge54cgea77gdd9cfcdc6f8b;1" data "Description" "h1a996067g0519g759fgdefcg840118ab0f8b;1" @@ -3175,7 +3175,7 @@ data "SpellType" "Shout" data "Level" "3" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BEACON_OF_HOPE,100,10)" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "Ally() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_BeaconOfHope" data "DisplayName" "hcc1c7b29g7fbfg761ag52edgdfb51fd47960;1" @@ -3268,23 +3268,24 @@ new entry "Shout_Blink" type "SpellData" data "SpellType" "Shout" using "Shout_Blink" +data "Level" "4" data "TargetConditions" "Self() and ConcentrateSpell();" data "DisplayName" "h96a78973g1857g627fg4f74gacdfa9a9813b;1" -data "Description" "ha834ac64g0e4fg2c97g76bfgb3c044435c4b;1" +data "Description" "ha834ac64g0e4fg2c97g76bfgb3c044435c4b;3" +data "DescriptionParams" "Distance(4);5" +data "ExtraDescriptionParams" "Distance(4)" +data "TooltipUpcastDescription" "e3cdd4a5-394e-41be-adb3-048a148e8c9e" +data "TooltipUpcastDescriptionParams" "3" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "SpellFlags" "IsSpell;HasVerbalComponent;HasSomaticComponent" +data "Requirements" "" data "RequirementConditions" "ConcentrateSpell();" new entry "Shout_Blink_5" type "SpellData" data "SpellType" "Shout" using "Shout_Blink" -data "TargetConditions" "Self() and ConcentrateSpell();" -data "DisplayName" "h07d47a62gda21ge8ebgf829g5bcd7b219b2d;1" -data "Description" "hd21ad471g262eg5e58gd1e6g06b829ed3a52;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" -data "SpellFlags" "IsSpell;HasVerbalComponent;HasSomaticComponent" -data "RequirementConditions" "ConcentrateSpell();" data "RootSpellID" "Shout_Blink" data "PowerLevel" "5" @@ -3292,19 +3293,31 @@ new entry "Shout_Blink_6" type "SpellData" data "SpellType" "Shout" using "Shout_Blink" -data "TargetConditions" "Self() and ConcentrateSpell();" -data "DisplayName" "h2da2bfc4g506agaba4g08eagcae31c833645;1" -data "Description" "h6310f75bg227eg7411gf896g4df931b93e6c;1" +data "SpellProperties" "ApplyStatus(BLINK_6,100,10);" +data "DescriptionParams" "Distance(4);8" +data "TooltipStatusApply" "ApplyStatus(BLINK_6,100,10)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" -data "SpellFlags" "IsSpell;HasVerbalComponent;HasSomaticComponent" -data "RequirementConditions" "ConcentrateSpell();" data "RootSpellID" "Shout_Blink" data "PowerLevel" "6" +new entry "Shout_Blink_Sustain" +type "SpellData" +data "SpellType" "Shout" +using "Shout_Blink" +data "SpellProperties" "" +data "DisplayName" "h7a430520g0f04g4de5g6a05g495339fb3a9c;1" +data "Description" "h98aeacdcg9cd8g7295ga2d3gf69ed6c7b3e3;1" +data "TooltipStatusApply" "" +data "TooltipUpcastDescription" "" +data "TooltipUpcastDescriptionParams" "" +data "UseCosts" "ActionPoint:1;" +data "SpellFlags" "HasSomaticComponent;Temporary" + new entry "Shout_MAG_Blink" type "SpellData" data "SpellType" "Shout" -using "Shout_MAG_Blink" +using "Shout_Blink" +data "Cooldown" "OncePerShortRestPerItem" data "UseCosts" "ActionPoint:2;" new entry "Shout_DestructiveWave" @@ -4001,7 +4014,7 @@ data "SpellType" "Shout" data "SpellSchool" "Divination" data "AIFlags" "UseAsSeekActionOnly" data "SpellProperties" "ApplyStatus(SEE_INVISIBILITY,100,10);" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "Self() and Ally() and ConcentrateSpell();" data "Icon" "Spell_Divination_SeeInvisibility" data "DisplayName" "h09713ba1g7835g92f7ge310gc04e5cc1c224;1" @@ -4103,7 +4116,7 @@ data "SpellType" "Shout" data "Level" "4" data "SpellSchool" "Necromancy" data "SpellProperties" "ApplyStatus(CommunityHP,100,10);" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "Self() and Ally() and ConcentrateSpell();" data "Icon" "Spell_Necromancy_FalseLife" data "DisplayName" "hb2be66a4ge055ga1eegcfc9g28a8c31d3610;1" @@ -5151,7 +5164,7 @@ using "Shout_Bane" data "Level" "0" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(BANE_AURA_2,100,BANE_AURA.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "6" +data "AreaRadius" "8" data "DisplayName" "hf8879bcbgb975ge05ag6164g26330228cb22;2" data "Description" "h5487b0b0g5043g9bf2g9118gf058cdb79442;1" data "UseCosts" "ActionPoint:1;" @@ -5166,56 +5179,56 @@ type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_3,100,BANE_AURA_2.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "9" +data "AreaRadius" "12" new entry "Shout_Bane_Sustain_3" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_4,100,BANE_AURA_3.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "12" +data "AreaRadius" "16" new entry "Shout_Bane_Sustain_4" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_5,100,BANE_AURA_4.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "15" +data "AreaRadius" "20" new entry "Shout_Bane_Sustain_5" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_6,100,BANE_AURA_5.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "18" +data "AreaRadius" "24" new entry "Shout_Bane_Sustain_6" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_7,100,BANE_AURA_6.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "21" +data "AreaRadius" "28" new entry "Shout_Bane_Sustain_7" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_8,100,BANE_AURA_7.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "24" +data "AreaRadius" "32" new entry "Shout_Bane_Sustain_8" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_9,100,BANE_AURA_8.Duration);ApplyStatus(BANE_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "27" +data "AreaRadius" "36" new entry "Shout_Bane_Sustain_9" type "SpellData" data "SpellType" "Shout" using "Shout_Bane_Sustain" data "SpellProperties" "ApplyStatus(BANE_AURA_10,100,BANE_AURA_9.Duration);" -data "AreaRadius" "30" +data "AreaRadius" "40" new entry "Shout_Bless_Rank2" type "SpellData" @@ -5268,7 +5281,7 @@ data "SpellType" "Shout" using "Shout_Bless" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(BLESS_AURA_2,100,BLESS_AURA.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "7" +data "AreaRadius" "10" data "DisplayName" "hacbb10c1g6ceeg2f94g1aedgf3487565730a;2" data "Description" "h90e21753g24d7g8232g204eg0f78871a80d0;1" data "UseCosts" "ActionPoint:1;" @@ -5282,56 +5295,56 @@ type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_3,100,BLESS_AURA_2.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "10" +data "AreaRadius" "14" new entry "Shout_Bless_Sustain_3" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_4,100,BLESS_AURA_3.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "13" +data "AreaRadius" "18" new entry "Shout_Bless_Sustain_4" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_5,100,BLESS_AURA_4.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "16" +data "AreaRadius" "22" new entry "Shout_Bless_Sustain_5" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_6,100,BLESS_AURA_5.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "19" +data "AreaRadius" "26" new entry "Shout_Bless_Sustain_6" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_7,100,BLESS_AURA_6.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "22" +data "AreaRadius" "30" new entry "Shout_Bless_Sustain_7" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_8,100,BLESS_AURA_7.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "25" +data "AreaRadius" "34" new entry "Shout_Bless_Sustain_8" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_9,100,BLESS_AURA_8.Duration);ApplyStatus(BLESS_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "28" +data "AreaRadius" "38" new entry "Shout_Bless_Sustain_9" type "SpellData" data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellProperties" "ApplyStatus(BLESS_AURA_10,100,BLESS_AURA_9.Duration);" -data "AreaRadius" "31" +data "AreaRadius" "42" new entry "Shout_ProtectiveWards" type "SpellData" @@ -5364,7 +5377,7 @@ data "SpellType" "Shout" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(ProtectiveWards_AURA_2,100,ProtectiveWards_AURA.Duration);" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "hba092750g3148gf24bg2116gc2406069ef66;3" @@ -5388,28 +5401,28 @@ type "SpellData" data "SpellType" "Shout" using "Shout_ProtectiveWardsSustain_1" data "SpellProperties" "ApplyStatus(ProtectiveWards_AURA_3,100,ProtectiveWards_AURA_2.Duration);" -data "AreaRadius" "5" +data "AreaRadius" "6" new entry "Shout_ProtectiveWardsSustain_3" type "SpellData" data "SpellType" "Shout" using "Shout_ProtectiveWardsSustain_1" data "SpellProperties" "ApplyStatus(ProtectiveWards_AURA_4,100,ProtectiveWards_AURA_3.Duration);" -data "AreaRadius" "6" +data "AreaRadius" "8" new entry "Shout_ProtectiveWardsSustain_4" type "SpellData" data "SpellType" "Shout" using "Shout_ProtectiveWardsSustain_1" data "SpellProperties" "ApplyStatus(ProtectiveWards_AURA_5,100,ProtectiveWards_AURA_4.Duration);" -data "AreaRadius" "7" +data "AreaRadius" "10" new entry "Shout_ProtectiveWardsSustain_5" type "SpellData" data "SpellType" "Shout" using "Shout_ProtectiveWardsSustain_1" data "SpellProperties" "ApplyStatus(ProtectiveWards_AURA_6,100,ProtectiveWards_AURA_5.Duration);" -data "AreaRadius" "9" +data "AreaRadius" "12" new entry "Shout_Benediction_Rank1" type "SpellData" @@ -5417,7 +5430,7 @@ data "SpellType" "Shout" using "Shout_Bless" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA,100,10);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "h3eca8a27g2efbgdb6eg3ecbg14502029312b;1" @@ -5439,7 +5452,7 @@ using "Shout_Benediction_Rank1" data "Level" "2" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA,100,10);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "he0d8546dgc466gdeb3g149fg752b4a188716;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:2;" @@ -5453,7 +5466,7 @@ using "Shout_Benediction_Rank1" data "Level" "3" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA,100,10);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "he3816ad0ga360g41dagdbdcgdd5489179ef7;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3;" @@ -5467,7 +5480,7 @@ using "Shout_Benediction_Rank1" data "Level" "4" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA,100,10);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "h73613929g445cga268g87afgf805131272f6;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4;" @@ -5481,7 +5494,7 @@ using "Shout_Benediction_Rank1" data "Level" "5" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA,100,10);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "h4024677eg6ae1g35efged26g624b340e9ae9;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" @@ -5495,7 +5508,7 @@ using "Shout_Benediction_Rank1" data "Level" "6" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA,100,10);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "h1665e98ag3e61gc378g0da3g993e4031e593;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6;" @@ -5508,7 +5521,7 @@ data "SpellType" "Shout" using "Shout_Bless_Sustain" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_2,100,BENEDICTION_AURA.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "7" +data "AreaRadius" "10" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "PassiveAction_WardingFlare" data "DisplayName" "h21465dcag4b8fg75b8gd38cgd6a79518449b;2" @@ -5527,56 +5540,56 @@ type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_3,100,BENEDICTION_AURA_2.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "10" +data "AreaRadius" "14" new entry "Shout_Benediction_Sustain_3" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_4,100,BENEDICTION_AURA_3.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "13" +data "AreaRadius" "18" new entry "Shout_Benediction_Sustain_4" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_5,100,BENEDICTION_AURA_4.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "16" +data "AreaRadius" "22" new entry "Shout_Benediction_Sustain_5" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_6,100,BENEDICTION_AURA_5.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "19" +data "AreaRadius" "26" new entry "Shout_Benediction_Sustain_6" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_7,100,BENEDICTION_AURA_6.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "22" +data "AreaRadius" "30" new entry "Shout_Benediction_Sustain_7" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_8,100,BENEDICTION_AURA_7.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "25" +data "AreaRadius" "34" new entry "Shout_Benediction_Sustain_8" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_9,100,BENEDICTION_AURA_8.Duration);ApplyStatus(BENEDICTION_SUSTAIN_BLOCKED,100,1);" -data "AreaRadius" "28" +data "AreaRadius" "38" new entry "Shout_Benediction_Sustain_9" type "SpellData" data "SpellType" "Shout" using "Shout_Benediction_Sustain_1" data "SpellProperties" "ApplyStatus(BENEDICTION_AURA_10,100,BLESS_AURA_9.Duration);" -data "AreaRadius" "31" +data "AreaRadius" "42" new entry "Shout_RANGER" type "SpellData" @@ -5799,7 +5812,7 @@ new entry "Shout_AngelicHalo" type "SpellData" data "SpellType" "Shout" data "SpellProperties" "ApplyStatus(AngelicHaloStatus,100,10)" -data "AreaRadius" "5" +data "AreaRadius" "6" data "TargetConditions" "Ally() and ConcentrateSpell();" data "Icon" "Action_Paladin_DivineSense" data "DisplayName" "h55c7be23ge987g5703gfdc5gdaa442ef4dbd;1" @@ -5845,7 +5858,7 @@ new entry "Shout_ArcaneTap" type "SpellData" data "SpellType" "Shout" using "Shout_Disengage" -data "SpellProperties" "AI_IGNORE:IF( not HasStatus('DISENGAGE_TAP')):UseActionResource(Movement,100%,0,true);AI_IGNORE:RestoreResource(Movement,3,0);AI_IGNORE:ApplyStatus(DISENGAGE_TAP,100,1);AI_ONLY:IF(HasStatus('FLANKED_AOO')):ApplyStatus(DISENGAGE_TAP,100,1);" +data "SpellProperties" "AI_IGNORE:IF( not HasStatus('DISENGAGE_TAP')):UseActionResource(Movement,100%,0,true);AI_IGNORE:RestoreResource(Movement,4,0);AI_IGNORE:ApplyStatus(DISENGAGE_TAP,100,1);AI_ONLY:IF(HasStatus('FLANKED_AOO')):ApplyStatus(DISENGAGE_TAP,100,1);" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Action_Disengage_Bonus" data "DisplayName" "h0d847bddge89ag1a97g4152gf13d691e89a5;1" @@ -5914,7 +5927,7 @@ type "SpellData" data "SpellType" "Shout" data "Level" "3" data "SpellSchool" "Enchantment" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(CharacterLevelGreaterThan(8)):ApplyStatus(FRIGHTENED,100,2);IF(not CharacterLevelGreaterThan(8)):ApplyStatus(FRIGHTENED,100,1);" data "SpellFail" "IF(CharacterLevelGreaterThan(8) and not SaveCritMiss('Fear')):ApplyStatus(FRIGHTENED,100,1);" @@ -5956,7 +5969,7 @@ type "SpellData" data "SpellType" "Shout" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(SELF,WITCH_HEX,100,1);SetStatusDuration(NeedleVengeance_Owner,2,ForceSet);SetStatusDuration(NeedleVengeance_Enemy,2,ForceSet);SetStatusDuration(NeedleVengeance_Ally_1,2,ForceSet);SetStatusDuration(NeedleVengeance_Ally_2,2,ForceSet);SetStatusDuration(NeedleVengeance_Ally_3,2,ForceSet);SetStatusDuration(NeedleVengeance_Ally_4,2,ForceSet);SetStatusDuration(NeedleVengeance_Ally_5,2,ForceSet);SetStatusDuration(NeedleVengeance_Ally_6,2,ForceSet)" -data "AreaRadius" "36" +data "AreaRadius" "48" data "TargetConditions" "Self() or HasAnyStatus({'NeedleVengeance_Enemy','NeedleVengeance_Ally_1','NeedleVengeance_Ally_2','NeedleVengeance_Ally_3','NeedleVengeance_Ally_4','NeedleVengeance_Ally_5','NeedleVengeance_Ally_6'}, {}, {},context.Target,context.Source) and ConcentrateSpell();" data "Icon" "Action_Monster_Duergar_MindSpike" data "DisplayName" "hef5007f6gf698g136dg7ed4g8984307536a4;2" @@ -5983,7 +5996,7 @@ type "SpellData" data "SpellType" "Shout" data "Cooldown" "OncePerTurn" data "SpellProperties" "GROUND:ApplyStatus(SELF,AnimatedAssault_Owner, 100, 2)" -data "AreaRadius" "36" +data "AreaRadius" "48" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(1d10,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((1d10)*2,Bludgeoning,Magical);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage(1d10/2,Bludgeoning,Magical);" @@ -6119,7 +6132,7 @@ data "SpellType" "Shout" data "Level" "1" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ConcordantChoir_Base" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d4,Thunder,Magical);IF(SaveCrit()):DealDamage((2d4)*2,Thunder,Magical);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((2d4)/2,Thunder,Magical);" @@ -6445,7 +6458,7 @@ type "SpellData" data "SpellType" "Shout" data "Level" "5" data "SpellSchool" "Enchantment" -data "AreaRadius" "6" +data "AreaRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(Confusion,100,10);" data "SpellFail" "IF(not SaveCritMiss('Will')):ApplyStatus(STUNNED1,100,1);" @@ -6487,14 +6500,15 @@ type "SpellData" data "SpellType" "Shout" data "Level" "5" data "SpellSchool" "Enchantment" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(7d10,Force,Magical);IF(SaveCrit()):DealDamage((7d10)*2,Force,Magical);Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(7d10,Force,Magical);IF(SaveCrit()):DealDamage((7d10)*2,Force,Magical);Force(4, OriginToEntity, Neutral, false, true);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((7d10)/2,Force,Magical);" data "TargetConditions" "not Self() and ConcentrateSpell();" data "Icon" "GenericIcon_Intent_Control" data "DisplayName" "h0293408ag97a9ga74cg1a36g35b34959695a;1" -data "Description" "h6a7ea780gf869gd137g181ag6e71360c024e;1" +data "Description" "h6a7ea780gf869gd137g181ag6e71360c024e;2" +data "DescriptionParams" "Distance(4)" data "TooltipDamageList" "DealDamage(7d10,Force)" data "TooltipAttackSave" "Dexterity" data "PrepareSound" "Spell_Prepare_Damage_Necrotic_ArmsOfHadar_L1to3" @@ -6519,7 +6533,7 @@ data "SpellType" "Shout" data "Level" "5" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_RipTheSpirit_Container" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(5d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((5d6)*2,Necrotic,Magical);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((5d6)/2,Necrotic,Magical);" @@ -6562,7 +6576,7 @@ type "SpellData" data "SpellType" "Shout" data "Level" "5" data "SpellSchool" "Enchantment" -data "AreaRadius" "9" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(STUNNED2,100,1);" data "SpellFail" "IF(not SaveCritMiss('Will')):ApplyStatus(STUNNED1,100,1);" @@ -6724,7 +6738,7 @@ data "SpellType" "Shout" data "Level" "6" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_30,100,2);" -data "AreaRadius" "6" +data "AreaRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d4,Piercing,Magical);IF(SaveCrit()):DealDamage((6d4)*2,Piercing,Magical);" data "SpellFail" "IF(not Ally() and not SaveCritMiss('Reflex')):DealDamage((6d4)/2,Piercing,Magical);" @@ -6755,7 +6769,7 @@ using "Shout_PoltergeistsFury" data "Level" "6" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_40,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_30);" -data "AreaRadius" "9" +data "AreaRadius" "12" data "DisplayName" "h6366d954g9990g0b64gd08fg30b570a8a6b4;1" data "Description" "h93fbabaag637dg817bgd2e6ga063cd3c6a6f;1" data "UseCosts" "ActionPoint:1" @@ -6765,7 +6779,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_50,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_40);" -data "AreaRadius" "12" +data "AreaRadius" "16" data "DisplayName" "hca327fc0g4235g4a43gc1dbg6714cfe21826;1" data "Description" "hd135fc82g0899g6607g941ag812b6b382e0e;1" @@ -6774,7 +6788,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_60,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_50);" -data "AreaRadius" "15" +data "AreaRadius" "20" data "DisplayName" "h9bae2338g35ddgc308g9079g2f0181fb37c1;1" data "Description" "h00385e5bgffb2gbbb6gbab2g959a3e04fde5;1" @@ -6783,7 +6797,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_70,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_60);" -data "AreaRadius" "18" +data "AreaRadius" "24" data "DisplayName" "hceb06784ga4ccgd5e0g7419gbb477fa54af0;1" data "Description" "h8e0eda64g65cbg7941g2819gd09b40e6aae6;1" @@ -6792,7 +6806,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_80,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_70);" -data "AreaRadius" "21" +data "AreaRadius" "28" data "DisplayName" "h3bc1cfd1gb594g56efg2fcag8c3fd22c9364;1" data "Description" "hf5787f4dgf09bgf268g3ee7g79f987a0603f;1" @@ -6801,7 +6815,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_90,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_80);" -data "AreaRadius" "24" +data "AreaRadius" "32" data "DisplayName" "h4c57f568g702cg1b78g830eg4c7fdc00f478;1" data "Description" "hc6cbf881ga8d9g17d8gb648ge5dbe6d077f1;1" @@ -6810,7 +6824,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:ApplyStatus(SELF,PoltergeistFury_Recast_100,100,2);GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_90);" -data "AreaRadius" "27" +data "AreaRadius" "36" data "DisplayName" "hd803ae21g0ecdg3755ga791g773fa2abaa42;1" data "Description" "hab2a097dg019dgc402g444ag1676f9e04c1f;1" @@ -6819,7 +6833,7 @@ type "SpellData" data "SpellType" "Shout" using "Shout_PoltergeistsFuryRecast_30" data "SpellProperties" "GROUND:RemoveStatus(SELF,PoltergeistFury_Recast_100);" -data "AreaRadius" "30" +data "AreaRadius" "40" data "DisplayName" "h46966481g04f2geabegaaf0g41ba5aff86a3;1" data "Description" "h7b1233c1g3f38g64e9g1a16gbff06bdfa5be;1" @@ -6886,7 +6900,7 @@ type "SpellData" data "SpellType" "Shout" data "SpellSchool" "Enchantment" data "SpellContainerID" "Shout_AberrantWhispers_Container" -data "AreaRadius" "3" +data "AreaRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(STUPEFIED_2,100,1);" data "TargetConditions" "not Self() and not Ally() and AuditorySpell() and MentalSpell() and ConcentrateSpell();" @@ -6915,7 +6929,7 @@ type "SpellData" data "SpellType" "Shout" data "SpellSchool" "Enchantment" data "SpellContainerID" "Shout_AberrantWhispers_Container" -data "AreaRadius" "5" +data "AreaRadius" "6" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(STUPEFIED_2,100,1);" data "TargetConditions" "not Self() and not Ally() and AuditorySpell() and MentalSpell() and ConcentrateSpell();" @@ -7022,7 +7036,7 @@ new entry "Shout_AirCushion" type "SpellData" data "SpellType" "Shout" data "SpellProperties" "ApplyStatus(FEATHER_FALL,100,10)" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "Ally() and RageConcentrateSpell();" data "Icon" "Spell_Transmutation_FeatherFall" data "DisplayName" "h44637b56g9580g8abcgddebg228976f7f676;1" @@ -7309,7 +7323,7 @@ data "DescriptionParams" "6d4;26" new entry "Shout_UmbraEntangle" type "SpellData" data "SpellType" "Shout" -data "AreaRadius" "3" +data "AreaRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(UMBRA_ENTANGLED,100,3);DealDamage(2d6,Necrotic)" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage(2d6/2,Necrotic);" @@ -7355,8 +7369,8 @@ data "CastEffect" "0ed6eeea-fb80-45e5-a190-d72579f7e3d6" new entry "Shout_CallTheHurricane" type "SpellData" data "SpellType" "Shout" -data "SpellProperties" "GROUND:CreateSurface(6,0,Water);ApplyStatus(WET,100,3);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,0,Water);ApplyStatus(WET,100,3);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" +data "AreaRadius" "8" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(CallHurricaneDamage),Bludgeoning,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(CallHurricaneDamage))*2,Bludgeoning,Magical);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((LevelMapValue(CallHurricaneDamage))/2,Bludgeoning,Magical);" @@ -7808,7 +7822,7 @@ type "SpellData" data "SpellType" "Shout" data "AreaRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Constitution, 17);" -data "SpellSuccess" "IF(not HasPassive('PrimalStrike',context.Source)):DealDamage(2d8+LevelMapValue(WildShapeDamageLow),Bludgeoning);IF(HasPassive('PrimalStrike',context.Source)):DealDamage(2d8+LevelMapValue(WildShapeDamageLow),Bludgeoning,Magical);Force(3, OriginToTarget);" +data "SpellSuccess" "IF(not HasPassive('PrimalStrike',context.Source)):DealDamage(2d8+LevelMapValue(WildShapeDamageLow),Bludgeoning);IF(HasPassive('PrimalStrike',context.Source)):DealDamage(2d8+LevelMapValue(WildShapeDamageLow),Bludgeoning,Magical);Force(4, OriginToTarget);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((2d8+LevelMapValue(WildShapeDamageLow))/2,Bludgeoning,Magical);" data "TargetConditions" "not Self() and not Dead() and not Item()" data "Icon" "GenericIcon_Intent_Damage" @@ -7843,7 +7857,7 @@ data "SpellProperties" "AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_SMALL,100,1)" data "AreaRadius" "50" data "DeathType" "Necrotic" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" -data "SpellSuccess" "AI_IGNORE:DealDamage(3d10+SpellCastingAbilityModifier, Necrotic,Magical);AI_IGNORE:Force(-9,OriginToEntity,Friendly,false,true);" +data "SpellSuccess" "AI_IGNORE:DealDamage(3d10+SpellCastingAbilityModifier, Necrotic,Magical);AI_IGNORE:Force(-12,OriginToEntity,Friendly,false,true);" data "SpellFail" "AI_IGNORE:DealDamage((3d10+SpellCastingAbilityModifier)/2, Necrotic,Magical)" data "TargetConditions" "Character() and not Self() and not Dead()" data "Icon" "PassiveFeature_Generic_Death" @@ -7874,7 +7888,7 @@ data "SpellProperties" "GROUND:ApplyStatus(SELF,SHA_NECROMANCER_FLESH_BERSERK,10 data "AreaRadius" "2" data "DeathType" "Physical" data "SpellRoll" "not SavingThrow(Ability.Constitution, 13);" -data "SpellSuccess" "Force(3);DealDamage(2d4,Thunder)" +data "SpellSuccess" "Force(4);DealDamage(2d4,Thunder);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" data "TargetConditions" "not Self()" data "Icon" "Action_Barbarian_Frenzy" @@ -7933,7 +7947,7 @@ using "Shout_ActionSurge" data "Cooldown" "" data "AIFlags" "" data "SpellProperties" "AI_ONLY:ApplyStatus(SELF,AI_STATUS_FAKE,100,2);" -data "AreaRadius" "12" +data "AreaRadius" "16" data "DeathType" "KnockedDown" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "AI_IGNORE:ApplyStatus(PRONE_PF2,100,1);AI_IGNORE:DealDamage(3d4,Bludgeoning);" @@ -8105,7 +8119,7 @@ data "SpellType" "Shout" using "Shout_ActionSurge" data "Cooldown" "OncePerRestPerItem" data "SpellProperties" "" -data "AreaRadius" "6" +data "AreaRadius" "8" data "SpellRoll" "" data "SpellSuccess" "AOE:IF(not SavingThrow(Ability.Dexterity,SourceSpellDC())):DealDamage(1d6, Lightning,Magical);" data "AoEConditions" "Enemy() and Character()" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Target.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Target.txt index bb0d225a..ad3b6fe7 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Target.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Target.txt @@ -4,7 +4,7 @@ data "SpellType" "Target" data "SpellSchool" "None" data "SpellContainerID" "Target_SkillActions" data "SpellProperties" "ApplyStatus(DemoralizeImmune,100,100);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "HasPassive('RagingIntimidation') or ConcentrateSpell() and LinguisticSpell(context.Source);" data "SpellRoll" "SkillCheck(Skill.Intimidation,DemoralizeDC());" data "SpellSuccess" "IF(SkillCrit()):ApplyStatus(FRIGHTENED,100,2);ApplyStatus(FRIGHTENED,100,1);AI_ONLY:IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and HasPassive('NPCIntimidation',context.Source) and HasHPPercentageMoreThan(50,context.Target)):DealDamage(2d6,Psychic);" @@ -37,7 +37,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Demoralize" data "SpellContainerID" "" -data "TargetRadius" "18" +data "TargetRadius" "24" data "UseCosts" "ReactionActionPoint:1" data "SpellAnimation" "ff78157b-f004-4813-b6d7-83744a7a56e4,,;,,;af73cecb-e6e2-432e-bb91-aa14769b9f84,,;b68f8e77-c0fb-4b1c-b9aa-5bb585e7f182,,;34da5af5-71b6-4278-9cc0-d5266ca98876,,;,,;32eb3c27-cd2c-49c1-a6c6-b21b2cccf050,,;,,;,," data "SpellFlags" "HasVerbalComponent;IsHarmful;Temporary" @@ -46,7 +46,7 @@ new entry "Target_DemoralizePerformance" type "SpellData" data "SpellType" "Target" using "Target_FreeDemoralize" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "SkillCheck(Skill.Performance,WillDC());" data "Description" "hc56e99ecg5bbcgdbdbg05c8g4551d34c1c55;2" data "UseCosts" "ActionPoint:1" @@ -128,7 +128,7 @@ data "SpellType" "Target" data "SpellProperties" "IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack)" data "SpellSuccess" "DealDamage(UnarmedDamage , Bludgeoning)" data "TargetConditions" "not Self() and not Dead()" @@ -193,7 +193,7 @@ data "SpellContainerID" "Target_SkillActions" data "SpellProperties" "RemoveStatus(SLEEP);RemoveStatus(SLEEPING);RemoveStatus(SG_Sleeping);" data "RequirementConditions" "HasFreeHand();" data "SpellRoll" "SkillCheck(Skill.Athletics,FortitudeDC());" -data "SpellSuccess" "IF(not SkillCrit()):ApplyStatus(GRABBED,100,2);AI_ONLY:ApplyStatus(StatusPenalty2Attack,100,2);IF(SkillCrit()):ApplyStatus(RESTRAINED,100,2);ApplyStatus(SELF,GRAPPLE_SOURCE,100,2);SetStatusDuration(SELF,GRAPPLE_SOURCE,2,ForceSet);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);IF(HasPassive('CrushingGrab',context.Source)):DealDamage(StrengthModifier,Bludgeoning,Magical);AI_ONLY:IF(HasStatus('FLANKED') and FightingStyle_Dueling() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',9) and HasPassive(NPCAthletics,context.Source)):DealDamage((MainMeleeWeapon)*2, MainMeleeWeaponDamageType);AI_ONLY:IF(HasStatus('FLANKED') and Unarmed() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',9) and HasPassive(NPCAthletics,context.Source)):DealDamage((UnarmedDamage)*2, Bludgeoning);" +data "SpellSuccess" "IF(not SkillCrit()):ApplyStatus(GRABBED,100,2);AI_ONLY:ApplyStatus(StatusPenalty2Attack,100,2);IF(SkillCrit()):ApplyStatus(RESTRAINED,100,2);ApplyStatus(SELF,GRAPPLE_SOURCE,100,2);SetStatusDuration(SELF,GRAPPLE_SOURCE,2,ForceSet);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);IF(HasPassive('CrushingGrab',context.Source)):DealDamage(StrengthModifier,Bludgeoning,Magical);AI_ONLY:IF(HasStatus('FLANKED') and FightingStyle_Dueling() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',12) and HasPassive(NPCAthletics,context.Source)):DealDamage((MainMeleeWeapon)*2, MainMeleeWeaponDamageType);AI_ONLY:IF(HasStatus('FLANKED') and Unarmed() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',12) and HasPassive(NPCAthletics,context.Source)):DealDamage((UnarmedDamage)*2, Bludgeoning);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0);RemoveStatus(GRABBED);RemoveStatus(RESTRAINED);IF(SkillCritMiss()):ApplyStatus(SELF,PRONE_PF2,100,-1);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);" data "TargetConditions" "not Self() and IsMovable() and not Grounded() and not Tagged('GASEOUS_FORM') and not (not Player(context.Source) and Combat(context.Source) and Character() and not (Enemy() or HasStatus('SG_Unconscious'))) and not Tagged('CANT_SHOVE_THROW') and TargetSizeGrapple();" data "Icon" "Action_Monster_NetherTentacle_Grapple" @@ -221,7 +221,7 @@ using "Target_Shove" data "SpellContainerID" "Target_SkillActions" data "SpellProperties" "RemoveStatus(SLEEP);RemoveStatus(SLEEPING);RemoveStatus(SG_Sleeping);" data "SpellRoll" "SkillCheck(Skill.Athletics,ReflexDC());" -data "SpellSuccess" "ApplyStatus(PRONE_PF2,100,-1);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);IF(SkillCrit()):DealDamage(1d6,Bludgeoning);IF(HasPassive('TheHarderTheyFall',context.Source)):DealDamage(1d6,Bludgeoning);IF(SkillCrit() and HasPassive('TheHarderTheyFall',context.Source)):DealDamage(LevelMapValue(SneakAttack),Bludgeoning);AI_ONLY:IF(HasStatus('FLANKED') and FightingStyle_Dueling() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',9) and HasPassive(NPCAthletics,context.Source)):DealDamage((MainMeleeWeapon)*2, MainMeleeWeaponDamageType);AI_ONLY:IF(HasStatus('FLANKED') and Unarmed() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',9) and HasPassive(NPCAthletics,context.Source)):DealDamage((UnarmedDamage)*2, Bludgeoning);" +data "SpellSuccess" "ApplyStatus(PRONE_PF2,100,-1);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);IF(SkillCrit()):DealDamage(1d6,Bludgeoning);IF(HasPassive('TheHarderTheyFall',context.Source)):DealDamage(1d6,Bludgeoning);IF(SkillCrit() and HasPassive('TheHarderTheyFall',context.Source)):DealDamage(LevelMapValue(SneakAttack),Bludgeoning);AI_ONLY:IF(HasStatus('FLANKED') and FightingStyle_Dueling() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',12) and HasPassive(NPCAthletics,context.Source)):DealDamage((MainMeleeWeapon)*2, MainMeleeWeaponDamageType);AI_ONLY:IF(HasStatus('FLANKED') and Unarmed() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and not HasStatus('OFF_BALANCED',context.Target) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',12) and HasPassive(NPCAthletics,context.Source)):DealDamage((UnarmedDamage)*2, Bludgeoning);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);" data "TargetConditions" "not Self() and not HasStatus('PRONE_PF2') and not HasStatus('PRONE') and IsMovable() and not Grounded() and not Tagged('GASEOUS_FORM') and not (not Player(context.Source) and Combat(context.Source) and Character() and not (Enemy() or HasStatus('SG_Unconscious'))) and not Tagged('CANT_SHOVE_THROW');" data "Icon" "Action_Trip" @@ -246,7 +246,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Trip" data "SpellContainerID" ";" -data "TargetRadius" "3" +data "TargetRadius" "2" data "UseCosts" "ActionPoint:0" data "SpellFlags" "IsMelee;AddFallDamageOnLand;IsHarmful;Temporary" @@ -291,10 +291,10 @@ new entry "Target_Disarm" type "SpellData" data "SpellType" "Target" data "SpellContainerID" "Target_SkillActions" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasFreeHand();" data "SpellRoll" "SkillCheck(Skill.Athletics,ReflexDC());" -data "SpellSuccess" "IF(SkillCrit()):ApplyStatus(DISARM, 100, 1);ApplyStatus(HINDERED,100,1);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);AI_ONLY:IF(HasStatus('FLANKED') and FightingStyle_Dueling() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',9) and HasPassive(NPCAthletics,context.Source)):DealDamage((MainMeleeWeapon)*2, MainMeleeWeaponDamageType);AI_ONLY:IF(HasStatus('FLANKED') and Unarmed() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',9) and HasPassive(NPCAthletics,context.Source)):DealDamage((UnarmedDamage)*2, Bludgeoning);" +data "SpellSuccess" "IF(SkillCrit()):ApplyStatus(DISARM, 100, 1);ApplyStatus(HINDERED,100,1);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);AI_ONLY:IF(HasStatus('FLANKED') and FightingStyle_Dueling() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',12) and HasPassive(NPCAthletics,context.Source)):DealDamage((MainMeleeWeapon)*2, MainMeleeWeaponDamageType);AI_ONLY:IF(HasStatus('FLANKED') and Unarmed() and not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and HasHPPercentageMoreThan(50,context.Target) and HasAllyWithinRange('SG_Incapacitated',12) and HasPassive(NPCAthletics,context.Source)):DealDamage((UnarmedDamage)*2, Bludgeoning);" data "SpellFail" "IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);" data "TargetConditions" "not Self() and HasWeaponInMainHand();" data "Icon" "Action_HinderingStrike" @@ -330,7 +330,7 @@ data "SpellType" "Target" data "ContainerSpells" "Target_EscapeGrapple_Athletics;Target_EscapeGrapple_Acrobatics;Target_EscapeGrapple_UnarmedAttack;" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Icon" "Action_Monster_NetherTentacle_Grapple" data "DisplayName" "h07a26580gf137g764dg33eag4d5c6d6d5b54;1" data "Description" "h66f30f28gbceag8e83g0144g72f43a4226dd;1" @@ -352,7 +352,7 @@ data "SpellType" "Target" data "SpellContainerID" "Target_EscapeGrapple_Container" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "SkillCheck(Skill.Athletics,ReflexDC());" data "SpellSuccess" "RemoveStatus(GRAPPLE_SOURCE);AI_ONLY:ApplyStatus(StatusBonus2Attack,100,2);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0);IF(HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(SELF,MAP_PENALTY_2ND,100,1);" @@ -413,7 +413,7 @@ data "Level" "" data "SpellSchool" "None" data "SpellContainerID" "Target_SkillActions" data "SpellProperties" "ApplyStatus(DemoralizeImmune,100,100);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "HasPassive('RagingIntimidation') or ConcentrateSpell() and LinguisticSpell(context.Source);" data "SpellRoll" "SkillCheck(Skill.Intimidation,DemoralizeDC());" data "SpellSuccess" "IF(SkillCrit()):ApplyStatus(FRIGHTENED,100,2);ApplyStatus(FRIGHTENED,100,1);AI_ONLY:IF(not HasStatus('MAP_PENALTY_3RD', context.Source) and not HasStatus('MAP_PENALTY_2ND', context.Source) and HasPassive('NPCIntimidation',context.Source) and HasHPPercentageMoreThan(50,context.Target)):DealDamage(2d6,Psychic);" @@ -461,7 +461,7 @@ new entry "Target_Help" type "SpellData" data "SpellType" "Target" data "SpellProperties" "RemoveStatus(SG_Sleeping);RemoveStatus(SG_Helpable_Condition);RemoveStatus(BURNING);RemoveStatus(SG_Prone);RemoveStatus(SG_Restrained);RemoveStatus(PRONE);RemoveStatus(PRONE_PF2);RemoveStatus(SLEEPING);RemoveStatus(SLEEP);RemoveStatus(ENSNARING_STRIKE);RemoveStatus(WEB);IF(IsDowned()):RegainHitPoints(1);RemoveStatus(HYPNOTIC_PATTERN);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Self() and (not Enemy() or Player()) and HasHelpableCondition()" data "Icon" "Action_Help" data "DisplayName" "h0c061df2g0bcaga2b6g4874ge6b0828535a5;1" @@ -487,7 +487,7 @@ new entry "Target_AidAnother" type "SpellData" data "SpellType" "Target" data "SpellProperties" "AI_IGNORE:ApplyStatus(GUIDANCE, 100, 1);AI_ONLY:IF(HasStatus('MAP_PENALTY_3RD', context.Source) and HasStatus('MAP_PENALTY_2ND', context.Source)):RegainHitPoints(15);AI_ONLY:IF(HasStatus('MAP_PENALTY_3RD', context.Source) and HasStatus('MAP_PENALTY_2ND', context.Source)):ApplyStatus(GUIDANCE, 100, 1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "not Self() and not Enemy();" data "Icon" "Action_Help" data "DisplayName" "hee3b37dfg5bcdgf0e5gf61ag3697a21bbf3e;1" @@ -572,7 +572,7 @@ data "TooltipDamageList" "RegainHitPoints(2d8+30)" new entry "Target_BonMot" type "SpellData" data "SpellType" "Target" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "SkillCheck(Skill.Persuasion,WillDC());" data "SpellSuccess" "IF(IsCriticalSkill()):ApplyStatus(BON_MOT_3,100,10);IF(not IsCriticalSkill()):ApplyStatus(BON_MOT_2,100,10);RemoveStatus(SELF,BON_MOT_2);RemoveStatus(SELF,BON_MOT_2_SELF);RemoveStatus(SELF,BON_MOT_3);" data "SpellFail" "IF(IsCriticalMissSkill()):ApplyStatus(SELF,BON_MOT_2_SELF,100,10);" @@ -600,7 +600,7 @@ type "SpellData" data "SpellType" "Target" data "TargetCeiling" "0" data "TargetFloor" "0.25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasFreeHand();" data "RequirementEvents" "OnEquip;OnUnequip" data "SpellRoll" "SkillCheck(Skill.SleightOfHand,ReflexDC());" @@ -631,8 +631,8 @@ type "SpellData" data "SpellType" "Target" data "SpellContainerID" "Target_SkillActions" data "AIFlags" "CanNotUse" -data "TargetRadius" "9" -data "AreaRadius" "6" +data "TargetRadius" "12" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "RequirementEvents" "OnStatusApplied;OnStatusRemoved" data "SpellRoll" "SkillCheck(Skill.Perception,context.Target.GetPassiveSkill(Skill.Stealth))" @@ -665,8 +665,8 @@ new entry "Target_PointOut_NPC" type "SpellData" data "SpellType" "Target" data "SpellProperties" "RemoveStatus(UNDETECTED);AI_ONLY:AOE:ApplyStatus(AI_HELPER_BUFF,100,3);" -data "TargetRadius" "9" -data "AreaRadius" "9" +data "TargetRadius" "12" +data "AreaRadius" "12" data "TargetConditions" "HasStatus('UNDETECTED',context.Target) and not HasStatus('UNDETECTED_FROM',context.Source,context.Target) and Enemy();" data "AoEConditions" "Ally() and AuditorySpell() and VisualSpell();" data "Icon" "Action_Monster_Duergar_MentalArrow" @@ -687,8 +687,8 @@ data "SpellContainerID" "Target_SkillActions" data "AIFlags" "CanNotUse" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" -data "RequirementConditions" "not HasStatus('TUMBLE_THROUGH_SOURCE');" +data "TargetRadius" "2" +data "RequirementConditions" "not HasStatus('TUMBLE_THROUGH_SOURCE') and HasActionResource('Movement',1);" data "SpellRoll" "SkillCheck(Skill.Acrobatics,ReflexDC());" data "SpellSuccess" "ApplyStatus(SELF,TUMBLE_THROUGH_SOURCE,100,1);ApplyStatus(TUMBLE_THROUGH_TARGET,100,1);" data "SpellFail" "ApplyStatus(SELF,TUMBLE_THROUGH_FAILED,100,1);ApplyStatus(SELF,DEBUG_RESET_MOVE,100,-1);" @@ -778,7 +778,7 @@ using "Target_Critspec_Axe" data "Icon" "Action_PushingAttack_Melee" data "DisplayName" "hb8a19a05gf09cg287aga9ebgd89ae6c2f043;1" data "Description" "h98a667e8g7b79g06d2gd7cege017b4df3805;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "InterruptPrototype" "Interrupt_Critspec_Club" new entry "Target_Critspec_Flail" @@ -826,7 +826,7 @@ using "Target_Critspec_Axe" data "Icon" "Action_Monster_Gortash_ReelIn" data "DisplayName" "h984ff71fgb59eg730eg5f73g4a10efb93d0e;1" data "Description" "hea92dc27g1babgd435gb6d6g25bfff4e4073;1" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "InterruptPrototype" "Interrupt_Critspec_Polearm" new entry "Target_Critspec_Spear" @@ -875,6 +875,31 @@ data "TargetEffect" "a5341b2a-c161-4a4a-aa97-ea6a493d1402" data "Sheathing" "Melee" data "HighlightConditions" "HasStatus('CRITSPEC_AXE_TARGET',context.Target)" +new entry "Target_Critspec_Polearm_Spell" +type "SpellData" +data "SpellType" "Target" +using "Target_Critspec_Axe_Spell" +data "SpellProperties" "AOE:Force(2, TargetToEntity, Aggressive, true);AOE:RemoveStatus(CRITSPEC_POLE_TARGET);" +data "TargetCeiling" "" +data "TargetFloor" "" +data "TargetRadius" "" +data "AreaRadius" "2" +data "TargetConditions" "" +data "AoEConditions" "HasStatus('CRITSPEC_POLE_TARGET',context.Target,context.Source);" +data "Icon" "Action_Monster_Gortash_ReelIn" +data "DisplayName" "h36113a82g97dagf170gbf0agb7248a0f8933;1" +data "Description" "h7256a4c2g64ecge9deg96e8gfe989236e13c;1" +data "DescriptionParams" "Distance(2)" +data "TooltipDamageList" "" +data "CastSound" "Action_Cast_PushingAttack" +data "TargetSound" "Action_Impact_PushingAttack" +data "CycleConditions" "" +data "SpellFlags" "IsHarmful;Temporary;IsMelee;CannotTargetCharacter;CannotTargetItems" +data "PrepareEffect" "18188471-a2d8-4ed8-82ee-f4a1917eb6ff" +data "CastEffect" "79e441ed-a174-4526-aab8-3aeb74beda2c" +data "TargetEffect" "da2df3f8-b53c-439d-8ca3-1795b31df0d6" +data "HighlightConditions" "HasStatus('CRITSPEC_POLE_TARGET',context.Target)" + new entry "Target_BARBARIAN" type "SpellData" data "SpellType" "Target" @@ -886,7 +911,7 @@ data "SpellType" "Target" data "SpellProperties" "GROUND:DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(MainHand);CastOffhand[GROUND:DealDamage(OffhandMeleeWeapon, OffhandMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(OffHand)];IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasStatus('SG_Rage');" data "RequirementEvents" "OnStatusApplied;OnStatusRemoved" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" @@ -1128,7 +1153,7 @@ new entry "Target_ShareRage" type "SpellData" data "SpellType" "Target" data "SpellProperties" "ApplyStatus(RAGE,100,10);ApplyStatus(RageTempHp,100,-1)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "HasStatus('SG_Rage');" data "RequirementEvents" "OnStatusApplied;OnStatusRemoved" data "TargetConditions" "Character() and Ally() and not HasStatus('SG_Rage')" @@ -1157,7 +1182,7 @@ type "SpellData" data "SpellType" "Target" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasStatus('SG_Rage');" data "RequirementEvents" "OnStatusApplied;OnStatusRemoved" data "SpellRoll" "not SavingThrow(Ability.Constitution, ClassDC());" @@ -1188,7 +1213,7 @@ data "Sheathing" "Sheathed" new entry "Target_SpiritsWrath" type "SpellData" data "SpellType" "Target" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "RageConcentrateSpell():;" data "RequirementEvents" "OnStatusApplied;OnStatusRemoved" data "SpellRoll" "Attack2e(AttackType.MeleeWeaponAttack);" @@ -1269,7 +1294,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Fire_Container" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Fire',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Fire,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier+StrengthModifier,Fire,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Fire',context.Source)):ApplyStatus(PersistentFire_1d6,100,1);" @@ -1298,7 +1323,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Fire_Fire" data "SpellContainerID" "" data "ContainerSpells" "Target_ElementalBlast_Fire_Fire;Target_ElementalBlast_Fire_Fire_2Action;Projectile_ElementalBlast_Fire_Fire;Projectile_ElementalBlast_Fire_Fire_2Action;Target_ElementalBlast_Fire_Cold;Target_ElementalBlast_Fire_Cold_2Action;Projectile_ElementalBlast_Fire_Cold;Projectile_ElementalBlast_Fire_Cold_2Action;" -data "TargetRadius" "18" +data "TargetRadius" "24" data "DisplayName" "hb227e79bg2ce3g5f30gfc92gd189efbf8c36;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast),Fire);" data "SpellFlags" "IsMelee;IsHarmful;IsAttack;IsLinkedSpellContainer" @@ -1318,7 +1343,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Water_Container" data "SpellProperties" "GROUND:SurfaceChange(Douse);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Water',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Bludgeoning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Bludgeoning,Magical);" @@ -1353,7 +1378,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Water_Bludgeoning" data "SpellContainerID" "" data "ContainerSpells" "Target_ElementalBlast_Water_Bludgeoning;Target_ElementalBlast_Water_Bludgeoning_2Action;Projectile_ElementalBlast_Water_Bludgeoning;Projectile_ElementalBlast_Water_Bludgeoning_2Action;Target_ElementalBlast_Water_Cold;Target_ElementalBlast_Water_Cold_2Action;Projectile_ElementalBlast_Water_Cold;Projectile_ElementalBlast_Water_Cold_2Action;Target_ElementalBlast_Water_Acid;Target_ElementalBlast_Water_Acid_2Action;Projectile_ElementalBlast_Water_Acid;Projectile_ElementalBlast_Water_Acid_2Action;" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "h5fd00dd6gc180g2747gfb31g214c71f7fd96;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D8AoeCantrip),Bludgeoning);" data "SpellFlags" "IsMelee;IsHarmful;IsAttack;IsLinkedSpellContainer" @@ -1372,10 +1397,10 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Air_Container" data "SpellProperties" "GROUND:SurfaceChange(Electrify);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Air',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" -data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TargetConditions" "not Self() and not Dead() and RageConcentrateSpell();" data "Icon" "Spell_Transmutation_ElementalWeapon_Lightning" data "DisplayName" "h774760c1g8c81g1333g71b8g4301ea7afbd9;1" @@ -1407,7 +1432,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Air_Electric" data "SpellContainerID" "" data "ContainerSpells" "Target_ElementalBlast_Air_Electric;Target_ElementalBlast_Air_Electric_2Action;Projectile_ElementalBlast_Air_Electric;Projectile_ElementalBlast_Air_Electric_2Action;Target_ElementalBlast_Air_Slashing;Target_ElementalBlast_Air_Slashing_2Action;Projectile_ElementalBlast_Air_Slashing;Projectile_ElementalBlast_Air_Slashing_2Action;Target_ElementalBlast_Air_Cold;Target_ElementalBlast_Air_Cold_2Action;Projectile_ElementalBlast_Air_Cold;Projectile_ElementalBlast_Air_Cold_2Action;" -data "TargetRadius" "18" +data "TargetRadius" "24" data "DisplayName" "h705b462fg092eg14f5g840ag9443c9612317;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast),Lightning);" data "SpellFlags" "IsMelee;IsHarmful;IsAttack;IsLinkedSpellContainer" @@ -1425,7 +1450,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Earth_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Earth',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Bludgeoning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Earth',context.Source)):ApplyStatus(PRONE_PF2,100,-1);" @@ -1454,7 +1479,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Earth_Bludgeoning" data "SpellContainerID" "" data "ContainerSpells" "Target_ElementalBlast_Earth_Bludgeoning;Target_ElementalBlast_Earth_Bludgeoning_2Action;Projectile_ElementalBlast_Earth_Bludgeoning;Projectile_ElementalBlast_Earth_Bludgeoning_2Action;Target_ElementalBlast_Earth_Piercing;Target_ElementalBlast_Earth_Piercing_2Action;Projectile_ElementalBlast_Earth_Piercing;Projectile_ElementalBlast_Earth_Piercing_2Action;Target_ElementalBlast_Earth_Poison;Target_ElementalBlast_Earth_Poison_2Action;Projectile_ElementalBlast_Earth_Poison;Projectile_ElementalBlast_Earth_Poison_2Action;" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "h5d3a8e38g5308ga273gb045gb3a7397bcc69;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D8AoeCantrip),Bludgeoning);" data "SpellFlags" "IsMelee;IsHarmful;IsAttack;IsLinkedSpellContainer" @@ -1472,7 +1497,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Wood_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Wood',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Bludgeoning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Wood',context.Source)):ApplyStatus(ENSNARED,100,1);" @@ -1506,7 +1531,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Wood_Bludgeoning" data "SpellContainerID" "" data "ContainerSpells" "Target_ElementalBlast_Wood_Bludgeoning;Target_ElementalBlast_Wood_Bludgeoning_2Action;Projectile_ElementalBlast_Wood_Bludgeoning;Projectile_ElementalBlast_Wood_Bludgeoning_2Action;Target_ElementalBlast_Wood_Vitality;Target_ElementalBlast_Wood_Vitality_2Action;Projectile_ElementalBlast_Wood_Vitality;Projectile_ElementalBlast_Wood_Vitality_2Action;Target_ElementalBlast_Wood_Poison;Target_ElementalBlast_Wood_Poison_2Action;Projectile_ElementalBlast_Wood_Poison;Projectile_ElementalBlast_Wood_Poison_2Action;" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "ha6d2e4ccg32beg9e90g1f5dg9f026abd97c4;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D8AoeCantrip),Bludgeoning);" data "SpellFlags" "IsMelee;IsHarmful;IsAttack;IsLinkedSpellContainer" @@ -1524,7 +1549,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Metal_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Metal',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Piercing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Piercing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Metal',context.Source)):ApplyStatus(PersistentAcid_1d6,100,1);" @@ -1553,7 +1578,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Metal_Piercing" data "SpellContainerID" "" data "ContainerSpells" "Target_ElementalBlast_Metal_Piercing;Target_ElementalBlast_Metal_Piercing_2Action;Projectile_ElementalBlast_Metal_Piercing;Projectile_ElementalBlast_Metal_Piercing_2Action;Target_ElementalBlast_Metal_Slashing;Target_ElementalBlast_Metal_Slashing_2Action;Projectile_ElementalBlast_Metal_Slashing;Projectile_ElementalBlast_Metal_Slashing_2Action;Target_ElementalBlast_Metal_Lightning;Target_ElementalBlast_Metal_Lightning_2Action;Projectile_ElementalBlast_Metal_Lightning;Projectile_ElementalBlast_Metal_Lightning_2Action;" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "h37550b8dg2401gea05gc53eg3ff82195c4f5;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D8AoeCantrip),Piercing);" data "SpellFlags" "IsMelee;IsHarmful;IsAttack;IsLinkedSpellContainer" @@ -1576,7 +1601,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(HEROISM, 100, 10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_Heroism" @@ -1607,7 +1632,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Heroism" data "SpellProperties" "ApplyStatus(HymnStatus, 100, 4)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "h3e45296ega9e2ge283g5998g993eed7b0bab;1" data "Description" "h177e55cdg9493g65d4g5f81g096dfdbcd6d4;1" data "DescriptionParams" "GainTemporaryHitPoints(2)" @@ -1625,7 +1650,7 @@ data "SpellType" "Target" using "Target_ShapeTheFlowingRiver_IceBlock" data "SpellSchool" "Illusion" data "SpellProperties" "GROUND:Summon(408559c5-ac6c-4fab-b629-7fd6e52e108a, 1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "AreaRadius" "1" data "AmountOfTargets" "3" data "DisplayName" "h076f60d8gc50fgd2bage0e3g69dd45b39c2b;1" @@ -1643,7 +1668,7 @@ type "SpellData" data "SpellType" "Target" using "Target_ForcedManeuver" data "SpellProperties" "ApplyStatus(STRIDE,100,1);RemoveStatus(DEBUG_RESET_MOVE);UseActionResource(ReactionActionPoint,1,0,false);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Ally() and not Self() and HasStatus('CourageousAnthem',context.Target,context.Source) and HasActionResource('ReactionActionPoint', 1, 0, false)" data "DisplayName" "hdd2b85a1g2087g3029ga53dgaae61788efe7;1" data "Description" "h57f408c2g7b47g889eg5243g2faf4eb8a8bd;1" @@ -1666,7 +1691,7 @@ type "SpellData" data "SpellType" "Target" using "Target_CommandersStrike" data "SpellProperties" "ApplyStatus(COURAGEOUS_ASSAULT,100,1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Ally() and not Self() and HasStatus('CourageousAnthem',context.Target,context.Source) " data "DisplayName" "h4a4b37f5gd315g2efcgba47g17c901b9fb89;1" data "Description" "h634644abgf377g574agbcf5g1af2e7136dc2;1" @@ -2140,7 +2165,7 @@ type "SpellData" data "SpellType" "Target" using "Target_DefensiveAdvance" data "SpellProperties" "ApplyStatus(SELF,SUDDENCHARGE_CAST_FX);IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);RemoveStatus(SELF,DefensiveStrike);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(AnimalSecondaryFrog)+StrengthModifier, Bludgeoning, Magical);" data "TargetConditions" "not Self() and not Dead()" @@ -2246,7 +2271,7 @@ data "ContainerSpells" "Target_OneInchPunch2Action;Target_OneInchPunch3Action;" data "SpellProperties" "GROUND:DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(MainHand);CastOffhand[GROUND:DealDamage(OffhandMeleeWeapon, OffhandMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(OffHand)];IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack)" data "TargetConditions" "not Self() and not Dead()" data "Icon" "Action_Monk_OpenHandTechnique_Knock" @@ -2270,7 +2295,7 @@ data "SpellContainerID" "Target_OneInchPunch" data "SpellProperties" "GROUND:DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(MainHand);CastOffhand[GROUND:DealDamage(OffhandMeleeWeapon, OffhandMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(OffHand)];IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack)" data "SpellSuccess" "IF(HasPassive('DragonStance',context.Source)):DealDamage(LevelMapValue(AnimalInstinct)+1d10+StrengthModifier, Bludgeoning, Magical) or IF(HasPassive('WolfStance',context.Source)):DealDamage(LevelMapValue(D8Unarmed)+1d8+StrengthModifier, Piercing, Magical) or IF(HasPassive('TigerStance',context.Source)):DealDamage(LevelMapValue(D8Unarmed)+1d8+StrengthModifier, Slashing, Magical) or IF(HasPassive('MountainStance',context.Source)):DealDamage(LevelMapValue(D8Unarmed)+1d8+StrengthModifier, Bludgeoning, Magical) or (IF(not HasPassive('DragonStance',context.Source) and not HasPassive('WolfStance',context.Source) and not HasPassive('TigerStance',context.Source) and not HasPassive('MountainStance',context.Source)): DealDamage(LevelMapValue(MartialArts)+1d6+StrengthModifier, Bludgeoning, Magical);" data "TargetConditions" "not Self() and not Dead()" @@ -2362,11 +2387,11 @@ type "SpellData" data "SpellType" "Target" using "Target_FlurryOfBlows" data "ContainerSpells" "" -data "SpellSuccess" "DealDamage(UnarmedDamage , Bludgeoning, Magical);Cast2[DealDamage(UnarmedDamage , Bludgeoning, Magical)];IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(5);" +data "SpellSuccess" "DealDamage(UnarmedDamage , Bludgeoning, Magical);Cast2[DealDamage(UnarmedDamage , Bludgeoning, Magical)];IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(4);" data "Icon" "Action_Monk_OpenHandTechnique_Push" data "DisplayName" "h2f9a8273g6354ge86fg1181g684e3da636db;1" data "Description" "h0a21b444gd17cge0d3g0b52g3c1232131413;1" -data "DescriptionParams" "Distance(5)" +data "DescriptionParams" "Distance(4)" data "TargetSound" "Spell_Impact_Monk_OpenHandTech_L1to3" data "SpellAnimation" "e1a544d9-209c-4928-aaa8-34158e755235,,;c06d3974-75cc-47db-94fc-58ffee6f6d9c,,;5fac68a4-bf82-471c-a3f1-f170652e5305,,;0f459162-778f-4bc4-97d0-f54130ec73be,,;4d79a581-a66e-49d3-a6bf-b7f66085cae4,,;37602812-a7a8-45a8-8cd3-2efa6f81f60d,,;0b07883a-08b8-43b6-ac18-84dc9e84ff50,,;,,;,," data "SpellFlags" "IsMelee;IsHarmful;DisableBlood;AddFallDamageOnLand" @@ -2437,7 +2462,7 @@ new entry "Target_WindCrash" type "SpellData" data "SpellType" "Target" using "Target_CraneWing" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "HasStatus('WildWindsStanceStatus');" data "SpellRoll" "Attack2e(AttackType.RangedUnarmedAttack)" data "Icon" "Action_Monk_FangsOfTheFireSnake" @@ -2466,7 +2491,7 @@ type "SpellData" data "SpellType" "Target" using "Target_OpenHandTechnique_Push" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" -data "SpellSuccess" "DealDamage(UnarmedDamage , Bludgeoning, Magical);IF(not SavingThrow(Ability.Constitution, ClassDC())):Force(5);" +data "SpellSuccess" "DealDamage(UnarmedDamage , Bludgeoning, Magical);IF(not SavingThrow(Ability.Constitution, ClassDC())):Force(4);" data "DisplayName" "hba33a07dg265dgc901g5553gc76f67de410a;1" data "Description" "hccacaaddg9edbg72a1g4a15g779f5ff5373d;1" data "TooltipDamageList" "DealDamage(UnarmedDamage , Bludgeoning)" @@ -2478,7 +2503,7 @@ data "SpellType" "Target" data "SpellProperties" "GROUND:DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(MainHand);CastOffhand[GROUND:DealDamage(OffhandMeleeWeapon, OffhandMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(OffHand)];IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" data "SpellSuccess" "DealDamage(UnarmedDamage , Bludgeoning, Magical);ApplyStatus(DisruptedQi,100,-1);" data "TargetConditions" "not Self() and not Dead()" @@ -2573,7 +2598,7 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Transmutation" data "ContainerSpells" "Target_GougingClaw_Piercing;Target_GougingClaw_Slashing" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D6Cantrip),Piercing,Magical);IF(not IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(GougingClawBleed_Rank1,100,-1);IF(IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(GougingClawBleed_Rank1_crit,100,-1);IF(not IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(GougingClawBleed_Rank2,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(GougingClawBleed_Rank2_crit,100,-1);IF(not IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(GougingClawBleed_Rank3,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(GougingClawBleed_Rank3_crit,100,-1);IF(not IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(GougingClawBleed_Rank4,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(GougingClawBleed_Rank4_crit,100,-1);IF(not IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(GougingClawBleed_Rank5,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(GougingClawBleed_Rank5_crit,100,-1);IF(not IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(GougingClawBleed_Rank6,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(GougingClawBleed_Rank6_crit,100,-1);" @@ -2630,7 +2655,7 @@ data "Level" "0" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_IgnitionMelee;Projectile_Ignition" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D6Cantrip),Fire,Magical);IF(IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(IgnitionPersistent_Rank1,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(IgnitionPersistent_Rank2,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(IgnitionPersistent_Rank3,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(IgnitionPersistent_Rank4,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(IgnitionPersistent_Rank5,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(IgnitionPersistent_Rank6,100,-1);" @@ -2660,7 +2685,7 @@ data "Level" "0" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_IgnitionContainer" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D6Cantrip),Fire,Magical);IF(IsCritical() and not CharacterLevelGreaterThan(2)):ApplyStatus(IgnitionPersistent_Rank1,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(IgnitionPersistent_Rank2,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(IgnitionPersistent_Rank3,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(IgnitionPersistent_Rank4,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(IgnitionPersistent_Rank5,100,-1);IF(IsCritical() and CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(IgnitionPersistent_Rank6,100,-1);" @@ -2694,8 +2719,8 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Evocation" data "SpellContainerID" "Projectile_EldritchBlast" -data "SpellProperties" "GROUND:SurfaceClearLayer(Cloud); IF(not Character()):Force(5);" -data "TargetRadius" "9" +data "SpellProperties" "GROUND:SurfaceClearLayer(Cloud); IF(not Character()):Force(6);" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack)" data "SpellSuccess" "DealDamage(LevelMapValue(D4AoeCantrip),Slashing,Magical);IF(IsCritical()):ApplyStatus(BLEEDING,100,10);" @@ -2743,7 +2768,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Necromancy" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D4AoeCantrip), Necrotic,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D4AoeCantrip))*2, Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -2776,7 +2801,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Conjuration" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack)" data "SpellSuccess" "ApplyStatus(TANGLE_VINE,100,1);IF(IsCritical()):ApplyStatus(ENSNARED,100,1);" @@ -2785,7 +2810,7 @@ data "TargetConditions" "not Self() and (Item() or Character() or Dead()) and Co data "Icon" "Spell_Transmutation_ThornWhip" data "DisplayName" "h2ff0127dgfde1g08e1gc4afgb1b8453edeec;1" data "Description" "h2afcc8eaga39bg02feg3c7dgaf980f80c0ae;2" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "TooltipAttackSave" "MeleeSpellAttack" data "TooltipStatusApply" "ApplyStatus(TANGLE_VINE,100,1);ApplyStatus(ENSNARED,100,1)" data "CastSound" "Spell_Cast_Damage_ThornWhip_L0" @@ -2825,9 +2850,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(5,10,Mud)" -data "TargetRadius" "18" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:CreateSurface(6,10,Mud)" +data "TargetRadius" "24" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_ConjureMinorElementals_MudMephit" @@ -2914,7 +2939,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Electrify)" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC())" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(1d12,Lightning,Magical);IF(not SaveCrit()):DealDamage(1d4,Thunder,Magical);IF(SaveCrit()):DealDamage((1d12)*2,Lightning,Magical);IF(SaveCrit()):DealDamage((1d4)*2,Thunder,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -3015,7 +3040,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" data "ContainerSpells" "Target_HealingFont1Action;Target_HealingFont2Action;Shout_HealingFont_ThreeAction" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Icon" "GenericIcon_Intent_Healing" data "DisplayName" "h4b7a2dd4gdf3ag172bgc3f6g2c84ade90fae;1" data "Description" "h8ff2ee64g6a54g64e9g3cddg0b10d9c9e096;1" @@ -3059,7 +3084,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HealingFont" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(LevelMapValue(H1D8));IF(HealLive(10)):RegainHitPoints(LevelMapValue(H1D10));IF(AngelicHalo()):RegainHitPoints(2*LevelMapValue(H1Plus1));" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "HealSavingThrow()" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(LevelMapValue(H1D8),Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(LevelMapValue(H1D10),Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((LevelMapValue(H1D8))*2,Radiant,Magical);IF(HealVoid(10) and SaveCrit()):DealDamage((LevelMapValue(H1D10))*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage(LevelMapValue(H1D8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage(LevelMapValue(H1D10)/2,Radiant,Magical);" @@ -3109,7 +3134,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HealBase1" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(1d8+8);IF(HealLive(10)):RegainHitPoints(1d10+8);IF(AngelicHalo()):RegainHitPoints(2);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HealSavingThrow()" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(1d8,Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(1d10,Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((1d8)*2,Radiant,Magical);IF(HealVoid(10)and SaveCrit()):DealDamage((1d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((1d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((1d10)/2,Radiant,Magical);" @@ -3157,7 +3182,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HealBase1" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(2d8+16);IF(HealLive(10)):RegainHitPoints(2d10+16);IF(AngelicHalo()):RegainHitPoints(4);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HealSavingThrow()" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(2d8,Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(2d10,Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((2d8)*2,Radiant,Magical);IF(HealVoid(10)and SaveCrit()):DealDamage((2d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((2d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((2d10)/2,Radiant,Magical);" @@ -3205,7 +3230,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HealBase1" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(3d8+24);IF(HealLive(10)):RegainHitPoints(3d10+24);IF(AngelicHalo()):RegainHitPoints(6);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HealSavingThrow()" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(3d8,Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(3d10,Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((3d8)*2,Radiant,Magical);IF(HealVoid(10)and SaveCrit()):DealDamage((3d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((3d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((3d10)/2,Radiant,Magical);" @@ -3251,7 +3276,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HealTwoAction_Rank_3" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(4d8+32);IF(HealLive(10)):RegainHitPoints(4d10+32);IF(AngelicHalo()):RegainHitPoints(8);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(4d8,Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(4d10,Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((4d8)*2,Radiant,Magical);IF(HealVoid(10)and SaveCrit()):DealDamage((4d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((4d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((4d10)/2,Radiant,Magical);" data "DescriptionParams" "4d8;32" @@ -3276,7 +3301,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HealTwoAction_Rank_3" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(5d8+40);IF(HealLive(10)):RegainHitPoints(5d10+40);IF(AngelicHalo()):RegainHitPoints(10);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(5d8,Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(5d10,Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((5d8)*2,Radiant,Magical);IF(HealVoid(10)and SaveCrit()):DealDamage((5d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((5d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((5d10)/2,Radiant,Magical);" data "DescriptionParams" "5d8;40" @@ -3301,7 +3326,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HealTwoAction_Rank_3" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(6d8+48);IF(HealLive(10)):RegainHitPoints(6d10+48);IF(AngelicHalo()):RegainHitPoints(12);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "IF(HealVoid(8) and not SaveCrit()):DealDamage(6d8,Radiant,Magical);IF(HealVoid(10) and not SaveCrit()):DealDamage(6d10,Radiant,Magical);IF(HealVoid(8) and SaveCrit()):DealDamage((6d8)*2,Radiant,Magical);IF(HealVoid(10)and SaveCrit()):DealDamage((6d10)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HealVoid(8) and not SaveCritMiss('Fort')):DealDamage((6d8)/2,Radiant,Magical);IF(HealVoid(10) and not SaveCritMiss('Fort')):DealDamage((6d10)/2,Radiant,Magical);" data "DescriptionParams" "6d8;48" @@ -3315,7 +3340,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" data "ContainerSpells" "Target_HarmingFont1Action;Target_HarmingFont2Action;Shout_HarmingFont_ThreeAction" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "HarmSavingThrow()" data "Icon" "Action_Monster_Raphael_CorruptedHealing" data "DisplayName" "h4cdeb844g4d2dg9af3ge9e4g25e842d9bd13;1" @@ -3360,7 +3385,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HarmingFont" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(LevelMapValue(H1D8),Guaranteed);IF(HarmVoid(10)):RegainHitPoints(LevelMapValue(H1D10),Guaranteed);IF(SapLife()):RegainHitPoints(SELF,LevelMapValue(H1Plus1),Guaranteed);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8)):DealDamage(LevelMapValue(H1D8),Necrotic,Magical);IF(HarmLive(10)):DealDamage(LevelMapValue(H1D10),Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage(LevelMapValue(H1D8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage(LevelMapValue(H1D10)/2,Necrotic,Magical);" @@ -3412,7 +3437,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HarmBase1" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(1d8+8,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(1d10+8,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,1);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(1d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(1d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((1d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((1d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((1d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((1d10)/2,Necrotic,Magical);" @@ -3462,7 +3487,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HarmBase1" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(2d8+16,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(2d10+16,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,2);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(2d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(2d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((2d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((2d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((2d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((2d10)/2,Necrotic,Magical);" @@ -3513,7 +3538,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_HarmBase1" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(3d8+24,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(3d10+24,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,3);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(3d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(3d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((3d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((3d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((3d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((3d10)/2,Necrotic,Magical);" @@ -3562,7 +3587,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Harm_Two_Action_Rank_3" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(4d8+32,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(4d10+32,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,4);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(4d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(4d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((4d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((4d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((4d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((4d10)/2,Necrotic,Magical);" data "DescriptionParams" "4d8" @@ -3586,7 +3611,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Harm_Two_Action_Rank_3" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(5d8+40,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(5d10+40,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,5);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(5d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(5d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((5d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((5d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((5d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((5d10)/2,Necrotic,Magical);" data "DescriptionParams" "5d8" @@ -3610,7 +3635,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Harm_Two_Action_Rank_3" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(6d8+48,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(6d10+48,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,6);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(6d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(6d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((6d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((6d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((6d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((6d10)/2,Necrotic,Magical);" data "DescriptionParams" "6d8" @@ -3622,8 +3647,8 @@ new entry "Target_BardicInspiration" type "SpellData" data "SpellType" "Target" data "SpellProperties" "ApplyStatus(CourageousAnthem,100,1)" -data "TargetRadius" "36" -data "AreaRadius" "36" +data "TargetRadius" "48" +data "AreaRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and not Enemy() and EmotionSpell() and MentalSpell() and ConcentrateSpell();" data "AmountOfTargets" "10" @@ -3660,7 +3685,7 @@ data "Level" "1" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(BLESS, 100, 10)" data "TargetRadius" "MeleeMainWeaponRange" -data "AreaRadius" "9" +data "AreaRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and not Enemy() and MentalSpell() and ConcentrateSpell();" data "AmountOfTargets" "10" @@ -3694,7 +3719,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Bless" data "TargetRadius" "MeleeMainWeaponRange" -data "AreaRadius" "9" +data "AreaRadius" "12" data "TargetConditions" "not Item() and not Dead() and not Enemy() and MentalSpell() and ConcentrateSpell();" data "AmountOfTargets" "" data "MaximumTargets" "3" @@ -3715,7 +3740,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Bless_2" data "TargetRadius" "MeleeMainWeaponRange" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "4" data "RootSpellID" "" @@ -3736,7 +3761,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Bless_3" data "TargetRadius" "MeleeMainWeaponRange" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "5" data "RootSpellID" "" @@ -3747,7 +3772,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Necromancy" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, IncapSpellSlotDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(BLINDNESS,100,10);IF(SaveCrit()):ApplyStatus(BLINDNESS,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -3802,7 +3827,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(CHARMED,100,10);" @@ -3848,7 +3873,7 @@ new entry "Target_CharmPerson_2_AI" type "SpellData" data "SpellType" "Target" using "Target_CharmPerson_2" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AoEConditions" "not Item() and not Self() and Character() and Tagged('HUMANOID') and not Tagged('UNDEAD') and not Ally()" data "AmountOfTargets" "" data "MaximumTargets" "2" @@ -3870,7 +3895,7 @@ new entry "Target_CharmPerson_3_AI" type "SpellData" data "SpellType" "Target" using "Target_CharmPerson_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AoEConditions" "not Item() and not Self() and Character() and Tagged('HUMANOID') and not Tagged('UNDEAD') and not Ally()" data "AmountOfTargets" "" data "MaximumTargets" "3" @@ -3893,7 +3918,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(BARKSKIN,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "TargetConditions" "Character() and ConcentrateSpell(context.Source);" data "Icon" "Spell_Transmutation_Barkskin" @@ -3931,7 +3956,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(FRIGHTENED,100,2);IF(IsCritical()):ApplyStatus(FRIGHTENED,100,3);DealDamage(4d6,Psychic,Magical);" data "SpellFail" "IF(not SaveCritMiss('Fear')):ApplyStatus(FRIGHTENED,100,1);IF(not SaveCritMiss('Fear')):DealDamage((4d6)/2,Psychic,Magical);" @@ -4253,7 +4278,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Necromancy" data "ContainerSpells" "Target_Contagion_BlindingSickness;Target_Contagion_FilthFever;Target_Contagion_FleshRot;Target_Contagion_Mindfire;Target_Contagion_Seizure;Target_Contagion_SlimyDoom" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack)" data "SpellSuccess" "ApplyStatus(CONTAGION_SLIMY_DOOM,100,-1);" data "TargetConditions" "Character() and not Dead() and not Tagged('CONSTRUCT');" @@ -4434,13 +4459,12 @@ data "Level" "2" data "SpellSchool" "Transmutation" data "AIFlags" "CanNotUse" data "SpellProperties" "ApplyStatus(DARKVISION,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Spell_Evocation_Darkvision" data "DisplayName" "h9d3e89e2g8bbdg0729gc331g3a6902b63bb4;1" -data "Description" "he70896eeg98dbgf6e2g0eeeg460d7b5861b1;1" -data "DescriptionParams" "Distance(12)" +data "Description" "he70896eeg98dbgf6e2g0eeeg460d7b5861b1;2" data "TooltipStatusApply" "ApplyStatus(DARKVISION,100,-1)" data "TooltipUpcastDescription" "6ff1780a-855a-414c-a8bf-811251537206" data "PrepareSound" "Spell_Prepare_Utility_Gen_L1to3_01" @@ -4468,7 +4492,7 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(DEATH_WARD,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and Ally()" data "Icon" "Spell_Abjuration_DeathWard" data "DisplayName" "h7e324ba9gdf31gf72fg8834g76a7d5504a68;1" @@ -4513,7 +4537,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "ContainerSpells" "Target_ElementalWeapon_Acid;Target_ElementalWeapon_Cold;Target_ElementalWeapon_Fire;Target_ElementalWeapon_Lightning;Target_ElementalWeapon_Thunder" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "IsWeapon() or (not Enemy() and HasWeaponInMainHand()) and ConcentrateSpell();" data "Icon" "Spell_Transmutation_ElementalWeapon" @@ -4676,7 +4700,7 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(FREEDOM_OF_MOVEMENT,100,-1);RemoveStatus(SG_Stunned);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_FreedomOfMovement" @@ -4725,7 +4749,7 @@ data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_FreezingSphere_Throw;Projectile_FreezingSphere_Hurl" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Icon" "Spell_Evocation_OtilukesFreezingSphere_CreateGlobe" data "DisplayName" "h672348c0g5055gc260g70aag87b10ddf649c;1" data "Description" "h2d86d640g4c9cgdd78g96b2g231de4c0a0ff;1" @@ -4746,7 +4770,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(GASEOUS_FORM,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and Ally() and not Dead()" data "Icon" "Spell_Transmutation_GaseousForm" data "DisplayName" "h4b782432gbdf5gd568g952egac9cdcd3dd67;1" @@ -4787,7 +4811,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Abjuration" data "SpellProperties" "RemoveStatus(SG_Charmed);RemoveStatus(SG_Petrified);RemoveStatus(SG_Cursed);RemoveStatus(SG_Stunned);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead()" data "Icon" "Spell_Abjuration_GreaterRestoration" data "DisplayName" "h072230e1gb5d6gcf92gad2fg5cf1b2d950e6;1" @@ -4830,7 +4854,7 @@ new entry "Target_Heroism_4_AI" type "SpellData" data "SpellType" "Target" using "Target_Heroism_4" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "4" data "RootSpellID" "" @@ -4841,7 +4865,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerRest" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(HYPNOTIC_GAZE,100,2);ApplyStatus(SELF,HYPNOTIC_GAZE_OWNER,100,2);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL_CHARM, 100, 0);" @@ -4871,7 +4895,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(HYPNOTIC_GAZE,100,2);SetStatusDuration(SELF,HYPNOTIC_GAZE_OWNER,2)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "HasStatus('HYPNOTIC_GAZE') and ConcentrateSpell();" data "Icon" "Action_HypnoticGaze_Maintain" @@ -4897,7 +4921,7 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Illusion" data "SpellProperties" "AI_IGNORE:ApplyStatus(GREATER_INVISIBILITY,100,10);AI_ONLY:ApplyStatus(GREATER_INVISIBILITY,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not HasStatus('FAERIE_FIRE') and not IsImmuneToStatus('SG_Invisible')" data "AmountOfTargets" "1" data "Icon" "Spell_Illusion_Invisibility" @@ -4928,7 +4952,7 @@ new entry "Target_Invisibility_4_AI" type "SpellData" data "SpellType" "Target" using "Target_Invisibility_4" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "not Item() and not HasStatus('FAERIE_FIRE') and not IsImmuneToStatus('SG_Invisible')" data "AmountOfTargets" "" data "SpellFlags" "IsSpell;HasSomaticComponent;IsMelee;UnavailableInDialogs;IgnorePreviouslyPickedEntities;Stealth;Invisible" @@ -4942,7 +4966,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellProperties" "AI_IGNORE:ApplyStatus(GREATER_INVISIBILITY,100,10);AI_ONLY:ApplyStatus(GREATER_INVISIBILITY,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not HasStatus('FAERIE_FIRE') and not IsImmuneToStatus('SG_Invisible')" data "Icon" "Spell_Illusion_GreaterInvisibility" data "DisplayName" "hbad4d228gf322g6346g0431g775e8a74fc36;1" @@ -5009,7 +5033,7 @@ new entry "Target_Heroism_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Heroism_2" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -5031,7 +5055,7 @@ new entry "Target_Heroism_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Heroism_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -5043,7 +5067,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Illusion" data "SpellProperties" "AI_IGNORE:ApplyStatus(INVISIBILITY,100,10);AI_ONLY:ApplyStatus(INVISIBILITY,100,2);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not HasStatus('FAERIE_FIRE') and not IsImmuneToStatus('SG_Invisible')" data "Icon" "Spell_Illusion_Invisibility" data "DisplayName" "h15414215g66f5gf231g573eg2fcda6654403;1" @@ -5071,7 +5095,7 @@ new entry "Target_Invisibility_3" type "SpellData" data "SpellType" "Target" using "Target_Invisibility" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "AmountOfTargets" "2" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "SpellFlags" "IsSpell;HasSomaticComponent;IsMelee;UnavailableInDialogs;IgnorePreviouslyPickedEntities;Stealth;Invisible" @@ -5083,7 +5107,7 @@ new entry "Target_Invisibility_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Invisibility_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "not Item() and not HasStatus('FAERIE_FIRE') and not IsImmuneToStatus('SG_Invisible')" data "AmountOfTargets" "" data "MaximumTargets" "1" @@ -5096,7 +5120,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Abjuration" data "SpellProperties" "RemoveStatus(SG_Poisoned);RemoveStatus(SG_Disease);RemoveStatus(SG_Paralyzed);RemoveStatus(SG_Blinded);RemoveStatus(ASTARION_WEAK)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and (HasStatus('SG_Poisoned') or HasStatus('SG_Disease') or HasStatus('SG_Paralyzed') or HasStatus('SG_Blinded') or HasStatus('ASTARION_WEAK'))" data "Icon" "Spell_Abjuration_LesserRestoration" data "DisplayName" "ha7d591eegc021g2cc2g0559g2ce27e784f32;1" @@ -5134,13 +5158,13 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(LONGSTRIDER,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Longstrider" data "DisplayName" "hff357b81ge5cag4d2cg6b29ga139cd07bffb;2" -data "Description" "h20c09337g5715gdf52gf38cg9ac412d2204e;2" -data "DescriptionParams" "Distance(6)" +data "Description" "h20c09337g5715gdf52gf38cg9ac412d2204e;3" +data "DescriptionParams" "Distance(4)" data "TooltipStatusApply" "ApplyStatus(LONGSTRIDER,100,-1)" data "TooltipUpcastDescription" "b14d6c0c-f1bd-4433-a57a-858b4f6669bd" data "PrepareSound" "Spell_Prepare_Buff_Gen_L1to3_01" @@ -5176,7 +5200,7 @@ new entry "Target_Longstrider_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Longstrider_2" -data "AreaRadius" "6" +data "AreaRadius" "8" data "AmountOfTargets" "" data "RitualCosts" "" data "MaximumTargets" "2" @@ -5199,7 +5223,7 @@ new entry "Target_Longstrider_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Longstrider_3" -data "AreaRadius" "6" +data "AreaRadius" "8" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -5211,7 +5235,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MysticArmorStatus_Rank_1,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and not WearingArmor() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_MageArmor" @@ -5241,7 +5265,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MysticArmorStatus_Rank_1,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and not WearingArmor() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_MageArmor" @@ -5273,7 +5297,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MysticArmorStatus_Rank_1,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and not WearingArmor() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_MageArmor" @@ -5305,7 +5329,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "IF(Item()):ApplyStatus(MAGIC_WEAPON,100,10);IF(not Item()):ApplyEquipmentStatus(MainHand,MAGIC_WEAPON,100,10);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Item() or (Ally() and HasWeaponInMainHand()) and ConcentrateSpell();" data "Icon" "Spell_Transmutation_MagicWeapon" @@ -5382,7 +5406,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Abjuration" data "ContainerSpells" "Target_ProtectionFromEnergy_Acid;Target_ProtectionFromEnergy_Cold;Target_ProtectionFromEnergy_Fire;Target_ProtectionFromEnergy_Lightning;Target_ProtectionFromEnergy_Thunder" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy" @@ -5483,7 +5507,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(PROTECTION_FROM_EVIL_AND_GOOD,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEvilAndGood" @@ -5537,7 +5561,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Abjuration" data "SpellProperties" "RemoveStatus(SG_Poisoned); ApplyStatus(PROTECTION_FROM_POISON, 100, -1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromPoison" @@ -5576,7 +5600,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Abjuration" data "SpellProperties" "RemoveStatus(SG_Cursed)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "HasStatus('SG_Cursed') and ConcentrateSpell();" data "Icon" "Spell_Abjuration_RemoveCurse" @@ -5603,7 +5627,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Abjuration" data "SpellProperties" "RemoveStatus(SG_Cursed);RemoveStatus(SG_Poisoned);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell() and (HasStatus('SG_Cursed') or HasStatus('SG_Poisoned');" data "Icon" "Spell_Abjuration_RemoveCurse" @@ -5667,7 +5691,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Necrotic,Magical);RegainHitPoints(SELF,(DamageDone)/2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -5704,7 +5728,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" -data "TargetRadius" "4.5" +data "TargetRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(BANE, 100, 10);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0);" @@ -5738,7 +5762,7 @@ new entry "Target_Bane_AI" type "SpellData" data "SpellType" "Target" using "Target_Bane" -data "AreaRadius" "4" +data "AreaRadius" "6" data "TargetConditions" "not Dead() and not Ally() and not Item() and MentalSpell();" data "AmountOfTargets" "" data "MaximumTargets" "3" @@ -5759,7 +5783,7 @@ new entry "Target_Bane_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Bane_2" -data "AreaRadius" "4" +data "AreaRadius" "6" data "AmountOfTargets" "" data "MaximumTargets" "4" data "RootSpellID" "" @@ -5780,7 +5804,7 @@ new entry "Target_Bane_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Bane_3" -data "AreaRadius" "4" +data "AreaRadius" "6" data "AmountOfTargets" "" data "MaximumTargets" "5" data "RootSpellID" "" @@ -5799,7 +5823,7 @@ new entry "Target_Bane_ThiefOfFiveFates_AI" type "SpellData" data "SpellType" "Target" using "Target_Bane_ThiefOfFiveFates" -data "AreaRadius" "4" +data "AreaRadius" "6" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -5819,7 +5843,7 @@ new entry "Target_Bane_ThiefOfFiveFates_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Bane_ThiefOfFiveFates_2" -data "AreaRadius" "4" +data "AreaRadius" "6" data "AmountOfTargets" "" data "MaximumTargets" "4" data "RootSpellID" "" @@ -5839,7 +5863,7 @@ new entry "Target_Bane_ThiefOfFiveFates_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Bane_ThiefOfFiveFates_3" -data "AreaRadius" "4" +data "AreaRadius" "6" data "AmountOfTargets" "" data "MaximumTargets" "5" data "RootSpellID" "" @@ -5850,7 +5874,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Shove" data "SpellSchool" "Conjuration" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Dexterity, CalculateSpellDC(Ability.Wisdom, GetSummoner(context.Source)))" data "SpellSuccess" "DealDamage(2d6,Fire);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage(2d6/2,Fire);" @@ -5889,7 +5913,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Transmutation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d6,Fire,Magical);IF(SaveCrit()):DealDamage((4d6)*2,Fire,Magical);IF(not SaveCrit()):ApplyStatus(HeatMetal_Rank2,100,-1);IF(SaveCrit()):ApplyStatus(HeatMetal__Double_Rank2,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -5924,7 +5948,7 @@ data "SpellType" "Target" using "Target_HeatMetal" data "ConcentrationSpellID" "" data "SpellProperties" "DealDamage(2d8,Fire)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "HeatMetalReapplyCheck(Ability.Constitution, SourceSpellDC())" data "SpellSuccess" "ApplyStatus(DISARM,100,0);" data "TargetConditions" "Character() and HasHeatMetalActive() and ConcentrateSpell();" @@ -5961,7 +5985,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" data "ContainerSpells" "Target_Hex_Strength;Target_Hex_Dexterity;Target_Hex_Constitution;Target_Hex_Intelligence;Target_Hex_Wisdom;Target_Hex_Charisma" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_Hex" @@ -6085,7 +6109,7 @@ data "SpellSchool" "Divination" data "ConcentrationSpellID" "Target_HuntersMark_Reapply" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(SELF,HUNTERS_MARK_OWNER,100,10);ApplyStatus(HUNTERS_MARK,100,10);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Self() and not (not Player(context.Source) and not Enemy()) and not HasStatus('DOWNED') and ConcentrateSpell();" data "AmountOfTargets" "1" @@ -6132,7 +6156,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:TeleportSource();" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "CanStand('') and not Character() and not Self() and ConcentrateSpell();" data "Icon" "Spell_Conjuration_MistyStep" @@ -6158,7 +6182,7 @@ data "SpellType" "Target" using "Target_MistyStep" data "Level" "" data "SpellSchool" "" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "" data "TargetConditions" "CanStand('') and not Character() and not Self();" data "Icon" "Spell_WildMagic_Teleport_Activate" @@ -6183,7 +6207,7 @@ new entry "Target_DigestCorpse_CorpseFlower" type "SpellData" data "SpellType" "Target" data "SpellProperties" "RegainHitPoints(2d10)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Self()" data "DisplayName" "h3825eac3g24bege5edg7471gcbd1b9d1fe72;1" data "UseCosts" "ActionPoint:1" @@ -6196,7 +6220,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(RALLY,100,5)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Character() and Ally() and not Self() and AuditorySpell();" data "Icon" "Skill_Fighter_Rally" data "DisplayName" "hf88e3651g6b8dg583fgb4a7g372a7185d150;1" @@ -6231,7 +6255,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" data "SpellProperties" "GROUND:Summon(4b2a85ba-2e6e-481e-a469-3a878d17eb1a, -1,Projectile_AiHelper_Summon_Weak,,,CF_ZOMBIE)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "CanStand('4b2a85ba-2e6e-481e-a469-3a878d17eb1a') and ConcentrateSpell();" data "Icon" "GenericIcon_Intent_Summon" @@ -6247,9 +6271,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(4,10,Web,true)" -data "TargetRadius" "18" -data "AreaRadius" "4" +data "SpellProperties" "GROUND:CreateSurface(6,10,Web,true)" +data "TargetRadius" "24" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_Web" @@ -6280,8 +6304,8 @@ data "SpellType" "Target" using "Target_Web" data "Level" "" data "SpellSchool" "" -data "SpellProperties" "GROUND:CreateSurface(3,10,Web)" -data "TargetRadius" "18" +data "SpellProperties" "GROUND:CreateSurface(4,10,Web)" +data "TargetRadius" "24" data "RequirementConditions" "" data "TargetConditions" "Character() and Enemy() and not Dead()" data "Icon" "Action_Spider_Giant_Web" @@ -6303,7 +6327,7 @@ new entry "Target_Web_Spider_WildShape" type "SpellData" data "SpellType" "Target" using "Target_Web_Spider" -data "SpellProperties" "GROUND:CreateSurface(4.5,10,Web)" +data "SpellProperties" "GROUND:CreateSurface(6,10,Web)" data "Requirements" "Combat " data "UseCosts" "ActionPoint:2" data "SpellAnimationIntentType" "Aggressive" @@ -6469,7 +6493,7 @@ data "Level" "1" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(PathfinderSmiteStatus,100,-1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Self() and not (not Player(context.Source) and not Enemy()) and not HasStatus('DOWNED') and not HasStatus('SmitePathfinderStatus') and ConcentrateSpell();" data "Icon" "Spell_Enchantment_CompelledDuel" @@ -6495,7 +6519,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Evocation" data "SpellProperties" "RegainHitPoints(1d10+4);ApplyStatus(SOOTHE, 100, 10)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and EmotionSpell() and MentalSpell() and ConcentrateSpell();" data "Icon" "Spell_Evocation_HealingWord" @@ -6576,7 +6600,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "AI_IGNORE:ApplyStatus(SANCTUARY,100,10);AI_ONLY:ApplyStatus(AI_HELPER_BUFF,100,10)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not HasStatus('SANCTUARY_BLOCK') and not HasStatus('SANCTUARY') and ConcentrateSpell();" data "Icon" "Spell_Abjuration_Sanctuary" @@ -6607,7 +6631,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(SHIELD_OF_FAITH,100,10);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ShieldOfFaith" @@ -6698,7 +6722,7 @@ data "Level" "2" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_SpiritualWeapon_Greataxe;Target_SpiritualWeapon_Greatsword;Target_SpiritualWeapon_Halberd;Target_SpiritualWeapon_Maul;Target_SpiritualWeapon_Spear;Target_SpiritualWeapon_Trident" data "SpellProperties" "GROUND:Summon(63854225-bfb0-4585-a427-ee47fcaabced, 10,,,SpiritualWeaponStack,SPIRITUAL_WEAPON,UNSUMMON_ABLE,SHADOWCURSE_SUMMON_CHECK)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "CanStand('dfa62397-bf6c-4bb5-b561-bfd5b8415bd0') and not Character() and not Self() and ConcentrateSpell();" data "Icon" "Spell_Evocation_SpiritualWeapon" @@ -7038,8 +7062,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:Summon(dcbaa902-e45c-41fa-b238-19541402961e, 10,,,'GraspingVineStack',SHADOWCURSE_SUMMON_CHECK,GRASPINGVINE_SURFACE);GROUND:CreateSurface(3,10,Vines,true)" -data "TargetRadius" "9" +data "SpellProperties" "GROUND:Summon(dcbaa902-e45c-41fa-b238-19541402961e, 10,,,'GraspingVineStack',SHADOWCURSE_SUMMON_CHECK,GRASPINGVINE_SURFACE);GROUND:CreateSurface(4,10,Vines,true)" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "CanStand('dcbaa902-e45c-41fa-b238-19541402961e') and not Character() and not Self() and ConcentrateSpell();" data "Icon" "Spell_Conjuration_GraspingVine" @@ -7191,7 +7215,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(INQUISITORS_MIGHT,100, 2)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "Character() and not Dead() and not Enemy()" data "Icon" "Action_Paladin_InquisitorsMight" data "DisplayName" "h071d28d5g7f31g455eg556ag13702cfaadb1;1" @@ -7291,7 +7315,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Evocation" data "SpellProperties" "RegainHitPoints(2d6)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "HasAuraOfVitality()" data "Icon" "Spell_Evocation_AuraOfVitality_Activate" data "DisplayName" "h9ccfe70cg6c0fg45c8g52a2g73bc4a0dbe2e;1" @@ -7326,13 +7350,13 @@ type "SpellData" data "SpellType" "Target" data "Cooldown" "OncePerTurn" data "SpellProperties" "GROUND:Summon(0e40a847-a275-4eea-95d7-dd6bad6643ca,1,,,,FLUMPH_EXPLODE)" -data "TargetRadius" "9" -data "AreaRadius" "2" +data "TargetRadius" "12" +data "AreaRadius" "3" data "TargetConditions" "CanStand('0e40a847-a275-4eea-95d7-dd6bad6643ca') and not Character() and not Self()" data "Icon" "Action_WildMagic_Barbarian_ExplodingFlumph" data "DisplayName" "hb964e836g4a3bg7fc3gea91ga720ab29ed17;1" data "Description" "he61b06f9gf944ga87dge93cg102c449d5480;1" -data "DescriptionParams" "DealDamage(1d6,Force);Distance(2);" +data "DescriptionParams" "DealDamage(1d6,Force);Distance(3);" data "TooltipDamageList" "DealDamage(1d6,Force)" data "TooltipAttackSave" "Dexterity" data "PrepareSound" "Spell_Prepare_Barbarian_Wildmagic_ExplodingFlumph_L1to3" @@ -7352,7 +7376,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Burrow_GiantBadger" data "SpellProperties" "GROUND:TeleportSource()" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "" data "SpellSuccess" "" data "TargetConditions" "CanStand('1ec072e4-9e76-4a3c-8fe5-7f26bf5ec974')" @@ -7891,7 +7915,7 @@ data "SpellType" "Target" data "Level" "" data "SpellSchool" "" data "Cooldown" "OncePerTurn" -data "SpellProperties" "GROUND:TeleportSource();AI_IGNORE:AOE:Force(3.0,TargetToEntity,Friendly);CreateExplosion(Projectile_AiHelper_Fly_SkeletalDragon)" +data "SpellProperties" "GROUND:TeleportSource();AI_IGNORE:AOE:Force(4.0,TargetToEntity,Friendly);CreateExplosion(Projectile_AiHelper_Fly_SkeletalDragon)" data "TargetRadius" "30" data "AreaRadius" "4" data "TargetConditions" "Player(context.Source) or (Item() and Tagged('AI_USEITEM_A') and DistanceToTargetGreaterThan(8.0))" @@ -7916,7 +7940,7 @@ new entry "Target_Fly_Dragon_Skeletal" type "SpellData" data "SpellType" "Target" using "Target_Fly_Dragon" -data "SpellProperties" "GROUND:TeleportSource();AI_IGNORE:AOE:Force(3.0,TargetToEntity,Friendly);CreateExplosion(Projectile_AiHelper_Fly_SkeletalDragon);TARGET:ApplyStatus(SKELETALDRAGON_CANNOTFLYTOTARGET,100,2);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_SMALL,100,1);" +data "SpellProperties" "GROUND:TeleportSource();AI_IGNORE:AOE:Force(4.0,TargetToEntity,Friendly);CreateExplosion(Projectile_AiHelper_Fly_SkeletalDragon);TARGET:ApplyStatus(SKELETALDRAGON_CANNOTFLYTOTARGET,100,2);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_SMALL,100,1);" data "RequirementConditions" "not HasStatus('DRAGON_SKELETAL_FLIGHTSTATE');" data "TargetConditions" "Player(context.Source) or (Item() and Tagged('DRAGON_FLYPOINT_A') and DistanceToTargetGreaterThan(8.0) and not HasStatus('SKELETALDRAGON_CANNOTFLYTOTARGET'))" data "DisplayName" "h133d2169g1499ga61fg269fg0eba2870c9c0;1" @@ -7928,7 +7952,7 @@ data "SpellFlags" "RangeIgnoreVerticalThreshold;Invisible;IgnoreVisionBlock" new entry "Target_Exhale_Fire" type "SpellData" data "SpellType" "Target" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Dexterity, 13)" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d6, Fire);IF(SaveCrit()):DealDamage((4d6)*2, Fire);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d6)/2, Fire);" @@ -7966,8 +7990,8 @@ data "SpellSchool" "" data "SpellContainerID" "" data "ContainerSpells" "" data "Cooldown" "OncePerShortRest" -data "SpellProperties" "Force(-9, OriginToEntity, Neutral, false, true)" -data "TargetRadius" "18" +data "SpellProperties" "Force(-12, OriginToEntity, Neutral, false, true)" +data "TargetRadius" "24" data "RequirementConditions" "not Tagged('TADPOLE_POWERS_BLOCKED');" data "SpellRoll" "" data "SpellSuccess" "" @@ -8068,7 +8092,7 @@ data "DeathType" "Physical" data "RequirementConditions" "not HasActionResource('ActionPoint',1,0,false,false,context.Source);" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack)" data "SpellSuccess" "AI_IGNORE:ApplyStatus(SELF,GRAPPLING,100,2);ApplyStatus(GRAPPLED_VINE,100,2);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_LARGE,100,2);" -data "TargetConditions" "Character() and not Self() and DistanceToTargetGreaterThan(1)" +data "TargetConditions" "Character() and not Self() and DistanceToTargetGreaterThan(2)" data "Icon" "GenericIcon_Intent_Control" data "DisplayName" "h1590d121g819bg3ffcg515bg601f28fa8bd8;1" data "Description" "h7d3b786bg74f7gea68g335fgcff3ed4669b0;1" @@ -8119,7 +8143,7 @@ new entry "Target_VoiceOfCommand" type "SpellData" data "SpellType" "Target" data "SpellProperties" "AI_IGNORE:ApplyStatus(VOICE_OF_COMMAND,100,1);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_LARGE,100,10)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "not IsConcentrating();" data "TargetConditions" "Character() and Ally() and not Dead() and not Self() and Tagged('BANITE') and not Tagged('BANITE_BLACKGAUNTLET') and not HasStatus('VOICE_OF_COMMAND') and not Tagged('BANITE_BANEGHOST')" data "Icon" "GenericIcon_Intent_Utility" @@ -8147,8 +8171,8 @@ new entry "Target_SpreadingSpores" type "SpellData" data "SpellType" "Target" data "SpellProperties" "GROUND:Summon(c2900350-e3bc-47ca-b522-9ca9bb3661eb,10,Projectile_AiHelper_Summon_Weak,,SpreadingSporesStack,SPREADING_SPORES)" -data "TargetRadius" "9" -data "AreaRadius" "3" +data "TargetRadius" "12" +data "AreaRadius" "4" data "Icon" "Action_SpreadingSpores" data "DisplayName" "h110e643cg5d41g2d4agcb5cg1b942aa5499d;1" data "Description" "ha910d374ga59agfbbfge8cag27a60cca925a;1" @@ -8235,7 +8259,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" data "SpellProperties" "TARGET:RegainHitPoints(LevelMapValue(LayOnHandsHealing));IF(not Self()):ApplyStatus(DEVOTION_AC_BONUS,100,1);IF(HasPassive('AcceleratingTouch',context.Source)):ApplyStatus(LONGSTRIDER,100,1);IF(HasPassive('ResilientTouch',context.Source)):ApplyStatus(StatusBonus1Saves,100,1);IF(HasPassive('AmplifyingTouch',context.Source)):ApplyStatus(StatusBonus1Attack,100,1);IF(HasPassive('AmplifyingTouch',context.Source)):ApplyStatus(SpiritDamageBonus,100,1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT')" data "Icon" "Action_Paladin_LayOnHands_SmallHeal" data "DisplayName" "hf779c9bbgd015gc2c0g6fd2g0cf6094b8a27;1" @@ -8271,7 +8295,7 @@ new entry "Target_TouchOfTheVoid" type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(H1D6),Necrotic);IF(SaveCrit()):DealDamage((LevelMapValue(H1D6))*2,Necrotic);ApplyStatus(DEVOTION_AC_PENALTY,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage(LevelMapValue(H1D6)/2,Necrotic);" @@ -8345,7 +8369,7 @@ type "SpellData" data "SpellType" "Target" data "ContainerSpells" "Target_RangersCompanion_Bear;Target_RangersCompanion_Boar;Target_RangersCompanion_GiantSpider;Target_RangersCompanion_Raven;Target_RangersCompanion_Wolf" data "Cooldown" "OncePerShortRest" -data "TargetRadius" "18" +data "TargetRadius" "24" data "Icon" "Skill_Ranger_RangersCompanion" data "DisplayName" "he979b507gf051g1810gaea0g288f6cdd572f;1" data "Description" "h48081b36gfb7fg408cg27abgdfd17ee6c55c;1" @@ -8423,7 +8447,7 @@ type "SpellData" data "SpellType" "Target" data "ContainerSpells" "Target_PathfinderBear;Target_PathfinderBoar;Target_PathfinderGiantSpider;Target_PathfinderGiantRaven;Target_PathfinderWolf" data "Cooldown" "OncePerRest" -data "TargetRadius" "18" +data "TargetRadius" "24" data "Requirements" "!Combat" data "Icon" "Skill_Ranger_RangersCompanion" data "DisplayName" "h676500d9g1705g31c8ga6acg95bcaf4ee038;1" @@ -8501,7 +8525,7 @@ type "SpellData" data "SpellType" "Target" data "Cooldown" "OncePerRest" data "SpellProperties" "ApplyStatus(PathfinderCompanionScaler,100,LevelMapValue(CharacterLevel))" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Tagged('BEAST') and HasPassive('HuntersMark_RangerCompanion')" data "Icon" "Spell_Transmutation_EnhanceAbility_BullsStrenght" data "DisplayName" "h2d7e05bdg203fgd535g6038gf8ef13d47df8;1" @@ -8523,7 +8547,7 @@ data "SpellType" "Target" using "Target_PathfinderCompanionBuff" data "Cooldown" "OncePerRest" data "SpellProperties" "ApplyStatus(PathfinderMatureCompanionStatus,100,-1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Tagged('BEAST',context.Target) and Ally() and HasPassive('Minion',context.Target) and SummonOwner()" data "DisplayName" "h001c21d0gec34g25a5g65f5g740fcb78061e;1" data "Description" "hf48aa715g2e40gb0d9g40c4gb4c61b1f1e2c;1" @@ -8533,7 +8557,7 @@ type "SpellData" data "SpellType" "Target" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(PathfinderSmiteStatus,100,-1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Self() and not (not Player(context.Source) and not Enemy()) and not HasStatus('DOWNED') and not HasStatus('SmitePathfinderStatus') and ConcentrateSpell();" data "Icon" "Spell_Evocation_SearingSmite" @@ -8556,7 +8580,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(SpiritShields,100,10);" -data "TargetRadius" "4" +data "TargetRadius" "6" data "TargetConditions" "Character() and not Self() " data "Icon" "PassiveFeature_ShieldMaster_Block" data "DisplayName" "hbdb911c4g93dagb479g0625gfccc90560437;1" @@ -8585,7 +8609,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HealingFont1Action" data "SpellProperties" "IF(HealLive(8)):RegainHitPoints(LevelMapValue(H1D8) + LevelMapValue(HealTwoAction));IF(HealLive(10)):RegainHitPoints(LevelMapValue(H1D10) + LevelMapValue(HealTwoAction));IF(AngelicHalo()):RegainHitPoints(2*LevelMapValue(H1Plus1));" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "h1913a139gc56egc87bg48bcg5b7a17dd6539;1" data "Description" "h8e865daegec44g688bgf8edg5db079cdf125;1" data "DescriptionParams" "LevelMapValue(HealTwoAction)+LevelMapValue(H1D8)" @@ -8599,7 +8623,7 @@ new entry "Target_HealingFont3Action" type "SpellData" data "SpellType" "Target" using "Target_HealingFont1Action" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "10" data "DisplayName" "he4254dccgab48g33a8g573dg94494ef21a09;1" data "Description" "hf8642dd6gacc1gd8a0gdf51g7e04b52184ae;1" @@ -8613,7 +8637,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HarmingFont1Action" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(LevelMapValue(H1D8) + LevelMapValue(HealTwoAction),Guaranteed);IF(HarmVoid(10)):RegainHitPoints(LevelMapValue(H1D10) + LevelMapValue(HealTwoAction),Guaranteed);IF(SapLife()):RegainHitPoints(SELF,LevelMapValue(H1Plus1),Guaranteed);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "hbcb2310ag331dg6784gb313g72175bc5bd7c;1" data "Description" "h5cd5c892g9de7gdaa3g5a1eg747ec0400337;1" data "DescriptionParams" "LevelMapValue(H1D8)" @@ -8626,7 +8650,7 @@ new entry "Target_HarmingFont3Action" type "SpellData" data "SpellType" "Target" using "Target_HarmingFont1Action" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "10" data "DisplayName" "h2ed5de55g33ccg7c4dg0a9eg4bdec181a2d7;1" data "Description" "he770e370g357fge19cg8d00g343d6a6c4e13;1" @@ -8952,7 +8976,7 @@ new entry "Target_RestorativeStrikeHeal1" type "SpellData" data "SpellType" "Target" data "SpellProperties" "IF(not HasPassive('HealingHands',context.Source)):RegainHitPoints(1d8,Guaranteed);IF(HasPassive('HealingHands',context.Source)):RegainHitPoints(1d10,Guaranteed);RemoveStatus(SELF,RestorativeStrikeHit1);" -data "TargetRadius" "3" +data "TargetRadius" "MeleeMainWeaponRange" data "TargetConditions" "Character() and not Dead() and not Enemy() and not Tagged('CONSTRUCT');" data "Icon" "PassiveFeature_PotentSpellcasting" data "DisplayName" "h115f7951g4e83g816ag4155g2ab6e291e8c4;1" @@ -9022,7 +9046,7 @@ data "SpellSchool" "Evocation" data "TargetRadius" "160" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" -data "SpellSuccess" "Force(4.5);" +data "SpellSuccess" "Force(6);" data "TargetConditions" "not Self()" data "Icon" "Spell_Evocation_GustOfWind" data "DisplayName" "h4ceca423g432cge091g7c55gbeebabd9f7e6;1" @@ -9047,9 +9071,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" -data "SpellProperties" "GROUND:CreateSurface(5,10,DarknessCloud,true)" -data "TargetRadius" "18" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:CreateSurface(6,10,DarknessCloud,true)" +data "TargetRadius" "24" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Evocation_Darkness" @@ -9075,7 +9099,7 @@ new entry "Target_Darkness_override" type "SpellData" data "SpellType" "Target" using "Target_Darkness" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "DisplayName" "hcca5c9f1ga8a4gb653gee0eg95eabdecbd7b;1" @@ -9095,7 +9119,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(SICKENED_OVERSTUFF,100,10);" @@ -9162,7 +9186,7 @@ type "SpellData" data "SpellType" "Target" using "Target_ChillTouch" data "Level" "1" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellSuccess" "DealDamage(LevelMapValue(d6Rank), Necrotic,Magical);ApplyStatus(CHILL_TOUCH,100,1);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((LevelMapValue(d6Rank))/2,Necrotic,Magical);" data "Icon" "PassiveFeature_TouchOfDeath" @@ -9188,7 +9212,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(SanctifiedWeapon,100,1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead()" data "Icon" "Character() and not Dead()" data "DisplayName" "h846dfa5ag6447gf0acg7b07gd4623c03bcc3;1" @@ -9229,7 +9253,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FreedomOfMovement" data "SpellProperties" "ApplyStatus(FREEDOM_OF_MOVEMENT,100,1);RemoveStatus(SG_Stunned);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Description" "h0073732dgbaa6gfe18gb3ccg937c29f3e671;1" data "TooltipStatusApply" "ApplyStatus(FREEDOM_OF_MOVEMENT,100,1)" data "UseCosts" "ActionPoint:1;KiPoint:1" @@ -9310,7 +9334,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Enchantment" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AreaRadius" "0" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" @@ -9342,7 +9366,7 @@ new entry "Target_SharedNightmare" type "SpellData" data "SpellType" "Target" using "Target_Confusion" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "0" data "SpellSuccess" "AI_IGNORE:ApplyStatus(CONFUSION,100,1);" data "SpellFail" "AI_IGNORE:ApplyStatus(SELF,CONFUSION,100,1);" @@ -9357,12 +9381,12 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(MOON_NEW,100,1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character()" data "Icon" "Action_SelunesDream" data "DisplayName" "h7dbeb3d7g0217g2f65ga43egb6e7a635025d;1" data "Description" "h05a6e650gfaa1gc6ecg7b7bg6b3e215c8189;3" -data "DescriptionParams" "Distance(6)" +data "DescriptionParams" "Distance(8)" data "TooltipStatusApply" "ApplyStatus(MOON_NEW,100,1);ApplyStatus(MOON_WAX,100,1);ApplyStatus(MOON_FULL,100,1);ApplyStatus(MOON_WANE,100,1)" data "CastSound" "Spell_Cast_Buff_BlessingOfTheTrickster_L1to3" data "TargetSound" "Spell_Impact_Buff_BlessingOfTheTrickster_L1to3" @@ -9384,7 +9408,7 @@ data "SpellType" "Target" using "Target_InvokeDuplicity" data "Level" "4" data "SpellSchool" "Illusion" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "CanStand('c05c1aa3-da26-4d73-acbd-adc66f7df6af') and not Character() and not Self() and ConcentrateSpell();" data "DisplayName" "h338ad1degcd59g7247g9a7cgc990017f03c6;1" @@ -9411,7 +9435,7 @@ type "SpellData" data "SpellType" "Target" using "Target_LifeBoost" data "SpellProperties" "ApplyStatus(LifeBoostStatus, 100, 10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Enemy() and Tagged('UNDEAD') and ConcentrateSpell();" data "DisplayName" "h59e1a0bbga217gbf86g99b2g85949f6e261c;1" data "Description" "hdba5eb4cgac0cg6362ga584g6501df56c5df;1" @@ -9458,7 +9482,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "0" data "SpellProperties" "ApplyStatus(SELF,HuntPreyPrecisionOwner,100,-1);ApplyStatus(HuntersMarkPrecisionStatus,100,-1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Self() and not (not Player(context.Source) and not Enemy()) and not HasStatus('DOWNED') and ConcentrateSpell();" data "Icon" "Spell_Divination_HuntersMark" @@ -9486,7 +9510,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "0" data "SpellProperties" "IF(not HuntedPrey()):ApplyStatus(HUNT_PREY,100,-1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Self() and not Ally() and ConcentrateSpell();" data "Icon" "Spell_Divination_HuntersMark" @@ -9535,7 +9559,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HealCompanion_1Action" data "SpellProperties" "RegainHitPoints(LevelMapValue(H1D10)+LevelMapValue(HealTwoAction))" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TooltipDamageList" "RegainHitPoints(LevelMapValue(H1D10)+LevelMapValue(HealTwoAction))" data "UseCosts" "ActionPoint:2;KiPoint:1" data "SpellFlags" "IsSpell;HasSomaticComponent;HasVerbalComponent" @@ -9567,7 +9591,7 @@ using "Target_Barkskin" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MAGICHIDE,100,10)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "Tagged('BEAST',context.Target) and Ally() and YourAnimalCompanion() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Barkskin" data "DisplayName" "h9d34731bg12c9g38f8g2bf6g859191f8de6a;1" @@ -9586,7 +9610,7 @@ data "Level" "2" data "SpellSchool" "Transmutation" data "SpellContainerID" "Target_EnlargeReduce" data "SpellProperties" "ApplyStatus(ENLARGE,100,50);ApplyStatus(CLUMSY,100,50)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Enlarge" @@ -9658,7 +9682,7 @@ new entry "Target_WardensBoon" type "SpellData" data "SpellType" "Target" data "SpellProperties" "ApplyStatus(WARDENS_BOON,100,1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "Ally() and not Self() and not HasStatus('WARDENS_BOON',context.Target,context.Source)" data "Icon" "Action_CommandersStrike" data "DisplayName" "h9dc373e3ga39fg5201g4b95gf8a53b0d92a3;1" @@ -9680,7 +9704,7 @@ new entry "Target_CompanionsCry" type "SpellData" data "SpellType" "Target" data "SpellProperties" "ApplyStatus(COMPANIONS_CRY,100,1)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "Requirements" "TurnBased" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Tagged('BEAST',context.Target) and Ally() and YourAnimalCompanion() and AuditorySpell() and ConcentrateSpell();" @@ -9715,12 +9739,12 @@ data "TargetRadius" "MeleeMainWeaponRange" data "RequirementConditions" "WieldingSneakAttackWeapon(context.Source,false) and HasPassive('SneakAttackPassive');" data "SpellRoll" "Attack2e(AttackType.MeleeWeaponAttack);" data "SpellSuccess" "DealDamage(max(1,MainMeleeWeapon), MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);CastOffhand[DealDamage(max(0,OffhandMeleeWeapon), OffhandMeleeWeaponDamageType);ExecuteWeaponFunctors(OffHand)];" -data "TargetConditions" "Character() and (OffGuard() or HasAllyWithinRange('SG_Incapacitated',1.5) or HasAnyStatus({'FEINT_ROUND','FEINT_ONCE'},{},{},context.Target,context.Source)) and CanPrecisionDamage();" +data "TargetConditions" "Character() and (OffGuard() or HasAllyWithinRange('SG_Incapacitated',2) or HasAnyStatus({'FEINT_ROUND','FEINT_ONCE'},{},{},context.Target,context.Source)) and CanPrecisionDamage();" data "Icon" "Action_SneakAttack_Melee" data "DisplayName" "hd6ae803bg7f6bgb9abgf030g423d31d5016a;1" data "Description" "h61d97d66g340dgb540g47f3g525a33fa84c4;1" data "ExtraDescription" "h554d16bdg0277g4804g4ff3gf572e675d0e1;1" -data "ExtraDescriptionParams" "Distance(1.5)" +data "ExtraDescriptionParams" "Distance(2)" data "TooltipDamageList" "DealDamage(MainMeleeWeapon + LevelMapValue(SneakAttack), MainMeleeWeaponDamageType)" data "CastSound" "Action_Cast_SneakAttack" data "TargetSound" "Action_Impact_SneakAttack" @@ -9821,7 +9845,7 @@ data "SpellSchool" "Evocation" data "SpellProperties" "ApplyStatus(SELF,MAP_PENALTY_3RD,100,2);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(D8Cantrip),Slashing);DealDamage(LevelMapValue(D4Bonus),Force);" data "TargetConditions" "not Self() and (Creature() or Item() and not Dead();" @@ -9885,7 +9909,7 @@ data "Level" "1" data "SpellSchool" "Enchantment" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(SICKENED,100,10);" @@ -9942,7 +9966,7 @@ data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(DIABOLIC_EDICT_BUFF,100,1)" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and ConcentrateSpell();" data "Icon" "Action_Monster_ReaperOBhaal_MurderPrayer" @@ -9969,7 +9993,7 @@ data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(MainHand);CastOffhand[GROUND:DealDamage(OffhandMeleeWeapon, OffhandMeleeWeaponDamageType);GROUND:ExecuteWeaponFunctors(OffHand)];IF(not Player(context.Source)):ApplyStatus(SELF,AI_HELPER_EXTRAATTACK,100,1);" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(D8Cantrip),Slashing);" data "TargetConditions" "not Dead() and not Self();" @@ -10083,7 +10107,7 @@ data "SpellSchool" "Divination" data "SpellProperties" "ApplyStatus(ANCESTRAL_MEMORIES_DEBUFF_1,100,1)" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "TargetConditions" "Enemy() and ConcentrateSpell(context.Source);" data "Icon" "Spell_Divination_TrueStrike" @@ -10114,7 +10138,7 @@ data "Level" "1" data "SpellSchool" "Necromancy" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "SpellAutoResolveOnAlly(Ability.Constitution, SourceSpellDC(), true)" data "SpellSuccess" "ApplyStatus(UndeathsBlessing,100,10);" data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(UndeathsBlessingSuccess,100,10);" @@ -10199,7 +10223,7 @@ data "SpellType" "Target" data "SpellSchool" "Transmutation" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "HasStatus('BloodMagicSelf');" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" data "SpellSuccess" "ApplyStatus(BLEEDING,100,LevelMapValue(H1Plus1));" @@ -10233,7 +10257,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "RegainHitPoints(LevelMapValue(H1D8));RemoveStatus(BLEEDING);RemoveStatus(BURNING)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and ConcentrateSpell();" data "Icon" "Action_Mag_HealingIncenseAura" @@ -10277,7 +10301,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(WarningStripesStatus, 100, 10)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() or (Tagged('BEAST',context.Target) and Ally() and HasPassive('Minion',context.Target) and SummonOwner()) and ConcentrateSpell();" data "Icon" "Action_HaloOfSpores" @@ -10299,7 +10323,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:CreateSurface(8,10,Vines,true)" -data "TargetRadius" "36" +data "TargetRadius" "48" data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "not Grounded() and ConcentrateSpell();" @@ -10339,8 +10363,8 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);TARGET:IF(Item()):ApplyStatus(BURNING,100,10);" -data "TargetRadius" "9" -data "AreaRadius" "3" +data "TargetRadius" "12" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "not Grounded() and ConcentrateSpell();" data "Icon" "Spell_Evocation_BurningHands" @@ -10375,7 +10399,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(OFF_BALANCED,100,1);IF(SaveCrit()):ApplyStatus(WEB,100,1);IF(SaveCrit()):DealDamage((LevelMapValue(2d6H2d6))*2,Bludgeoning,Magical);IF(not SaveCrit()):DealDamage(LevelMapValue(2d6H2d6),Bludgeoning,Magical);" @@ -10412,7 +10436,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:ApplyStatus(SELF,CALL_LIGHTNING_TECHNICAL,100,10);GROUND:SurfaceChange(Electrify)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "AreaRadius" "2" data "RequirementConditions" "not (not Player(context.Source) and HasStatus('CALL_LIGHTNING_TECHNICAL')) and ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" @@ -10452,7 +10476,7 @@ data "SpellType" "Target" using "Target_CallLightning" data "Level" "1" data "SpellProperties" "GROUND:SurfaceChange(Electrify)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "0" data "RequirementConditions" "not HasStatus('RAGE_MUTE') and ConcentrateSpell();" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(1d12H1d12),Lightning,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(1d12H1d12))*2,Lightning,Magical);ApplyStatus(CLUMSY2,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -10472,8 +10496,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "ContainerSpells" "Target_SwampOfSloth_Action1;Target_SwampOfSloth_Action2;Target_SwampOfSloth_Action3;Target_SwampOfSloth_Action1_Rank5;Target_SwampOfSloth_Action2_Rank5;Target_SwampOfSloth_Action3_Rank5;" -data "SpellProperties" "GROUND:CreateSurface(1.5,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_1Action);" -data "TargetRadius" "36" +data "SpellProperties" "GROUND:CreateSurface(2,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_1Action);" +data "TargetRadius" "48" data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "OlfactorySpell() and ConcentrateSpell();" @@ -10499,8 +10523,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "SpellContainerID" "Target_SwampOfSloth_Container" -data "SpellProperties" "GROUND:CreateSurface(1.5,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_1Action);" -data "TargetRadius" "36" +data "SpellProperties" "GROUND:CreateSurface(2,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_1Action);" +data "TargetRadius" "48" data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "OlfactorySpell() and ConcentrateSpell();" @@ -10525,8 +10549,8 @@ type "SpellData" data "SpellType" "Target" using "Target_SwampOfSloth_Action1" data "Level" "3" -data "SpellProperties" "GROUND:CreateSurface(3,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_2Action);" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:CreateSurface(4,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_2Action);" +data "AreaRadius" "4" data "DisplayName" "hb8d781c2g3295g0c8agbf0bg1bdc077369cc;1" data "Description" "h21ef2340g17e9gb28fg2debgb7d96412eacd;1" data "UseCosts" "ActionPoint:2;KiPoint:1;SorceryPoint:1" @@ -10536,8 +10560,8 @@ type "SpellData" data "SpellType" "Target" using "Target_SwampOfSloth_Action1" data "Level" "3" -data "SpellProperties" "GROUND:CreateSurface(4.5,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_3Action);" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:CreateSurface(6,10,Mud);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SwampOfSlothAura_3Action);" +data "AreaRadius" "6" data "DisplayName" "hab7d2670g40cbg120cg24e6gebbc4ca00048;1" data "Description" "h2759c366g7a4dg6fb2g3030gfa9aeab68f11;1" data "UseCosts" "ActionPoint:3;KiPoint:1;SorceryPoint:1" @@ -10546,21 +10570,21 @@ new entry "Target_SwampOfSloth_Action1_Rank5" type "SpellData" data "SpellType" "Target" using "Target_SwampOfSloth_Action1" -data "AreaRadius" "3" +data "AreaRadius" "4" data "RequirementConditions" "CharacterLevelGreaterThan(8) and ConcentrateSpell();" new entry "Target_SwampOfSloth_Action2_Rank5" type "SpellData" data "SpellType" "Target" using "Target_SwampOfSloth_Action2" -data "AreaRadius" "5" +data "AreaRadius" "6" data "RequirementConditions" "CharacterLevelGreaterThan(8) and ConcentrateSpell();" new entry "Target_SwampOfSloth_Action3_Rank5" type "SpellData" data "SpellType" "Target" using "Target_SwampOfSloth_Action3" -data "AreaRadius" "6" +data "AreaRadius" "8" data "RequirementConditions" "CharacterLevelGreaterThan(8) and ConcentrateSpell();" new entry "Target_DrainLife" @@ -10569,7 +10593,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" data "SpellProperties" "ApplyStatus(SELF,DrainLifeTemp,100,10);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D4Bonus),Necrotic,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D4Bonus))*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage(LevelMapValue(D4Bonus)/2,Necrotic,Magical);" @@ -10631,13 +10655,13 @@ data "SpellType" "Target" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerTurn" data "SpellProperties" "SetStatusDuration(OFF_BALANCED,1,Add);SetStatusDuration(FEINT_ROUND,1,Add);SetStatusDuration(DAZZLED_APPLY,1,Add);SetStatusDuration(Grappled,1,Add);SetStatusDuration(POISONED,1,Add);SetStatusDuration(BLINDED,1,Add);SetStatusDuration(CLUMSY,1,Add);SetStatusDuration(CLUMSY2,1,Add);SetStatusDuration(CLUMSY2,1,Add);SetStatusDuration(STUNNED1,1,Add);SetStatusDuration(STUNNED2,1,Add);SetStatusDuration(STUPEFIED_1,1,Add);SetStatusDuration(STUPEFIED_2,1,Add);SetStatusDuration(STUPEFIED_3,1,Add);SetStatusDuration(STUPEFIED_4,1,Add);SetStatusDuration(ENFEEBLED,1,Add);SetStatusDuration(ENFEEBLED_2,1,Add);SetStatusDuration(ENFEEBLED_3,1,Add);" -data "TargetRadius" "36" +data "TargetRadius" "48" data "TargetConditions" "Character() and not Dead() and HasStatus('FAMILIAR_AURA_STATUS') and OngoingMisery()" data "AmountOfTargets" "1" data "Icon" "Spell_Enchantment_Hex" data "DisplayName" "hacc81cd0gac8eg698dgc07dgaff7cf038ef2;1" data "Description" "h8facfd7dg954bg8055g5fa6g94d26b4c6e0f;1" -data "DescriptionParams" "Distance(4.5)" +data "DescriptionParams" "Distance(6)" data "CastSound" "Spell_Cast_Debuff_Hex_L1to3" data "TargetSound" "Spell_Impact_Debuff_Hex_L1to3" data "VocalComponentSound" "Vocal_Component_Curse" @@ -10728,7 +10752,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerTurn" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(SICKENED,100,10);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" @@ -10757,12 +10781,12 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Evocation" data "Cooldown" "OncePerTurn" -data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);RemoveStatus(BURNING);GROUND:CreateSurface(1.5,1,WaterFrozen)" +data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);RemoveStatus(BURNING);GROUND:CreateSurface(2,1,WaterFrozen)" data "TargetConditions" "Ally() and HasPassive('IsFamiliar',context.Target) and SummonOwner()" data "Icon" "Action_Monster_ElementalWater_WintersBreath" data "DisplayName" "hb6857b3cg5134g8939gf437g0e97d5e8dfb1;1" data "Description" "h541031afge8ffga4b8g5e20g36b7d5c604b8;1" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "CastSound" "Spell_Cast_Control_SleetStorm_L1to3" data "TargetSound" "CrSpell_Impact_ElementalWater_WintersBreath" data "CastTextEvent" "Cast" @@ -10836,7 +10860,7 @@ data "SpellType" "Target" using "Target_AnimalFriendship" data "Level" "0" data "Cooldown" "OncePerTurn" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC(),AdvantageOnCharmed());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(SICKENED,100,1);IF(SaveCrit()):ApplyStatus(SICKENED_2,100,1);" data "SpellFail" "IF(not SaveCritMiss('Fear')):ApplyStatus(FRIGHTENED,100,1);" @@ -10854,7 +10878,7 @@ data "Level" "0" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(DISCERN_SECRETS,100,2)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "Character() and Ally()" data "Icon" "Action_KnowledgeOfTheAges" data "DisplayName" "hde99a280g4b27g65e7g91f7ga1413066dd6f;1" @@ -10899,7 +10923,7 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(STOKE_HEART,100,2);ApplyStatus(SELF,WITCH_HEX,100,1);" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "CanSustainTarget('STOKE_HEART') and ConcentrateSpell();" data "Icon" "Spell_Evocation_CrusadersMantle" @@ -10940,7 +10964,7 @@ type "SpellData" data "SpellType" "Target" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementEvents" "OnTurn" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(MartialArts)+StrengthModifier, Slashing);" @@ -10970,7 +10994,7 @@ type "SpellData" data "SpellType" "Target" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementEvents" "OnTurn" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(D8Unarmed)+StrengthModifier, Piercing);" @@ -11000,7 +11024,7 @@ type "SpellData" data "SpellType" "Target" data "TargetCeiling" "0" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementEvents" "OnTurn" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(AnimalSecondaryFrog)+StrengthModifier, Bludgeoning);" @@ -11032,7 +11056,7 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerTurn" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(StatusPenalty1Attack,100,1);ApplyStatus(StatusPenalty1WillSaves,100,1);" data "SpellFail" "IF(not SaveCritMiss('Will')):ApplyStatus(StatusPenalty1Attack,100,1);IF(not SaveCritMiss('Will')):ApplyStatus(StatusPenalty1WillSaves,100,1);" @@ -11062,7 +11086,7 @@ data "SpellType" "Target" using "Target_ShieldOfFaith" data "Cooldown" "OncePerTurn" data "SpellProperties" "ApplyStatus(SELF,BLOOD_WARD_OWNER,100,2);IF(not CharacterLevelGreaterThan(9)):ApplyStatus(BLOOD_WARD,100,2);IF(CharacterLevelGreaterThan(9)):ApplyStatus(BLOOD_WARD_5,100,2)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "h9151eab9g250bg5b57g6eedg257c9fbd5ddc;1" data "Description" "hfc5c4da1gcfeeg9309g479cga8d9686cca7f;1" data "TooltipStatusApply" "ApplyStatus(BLOOD_WARD,100,2)" @@ -11087,7 +11111,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MysticArmorStatus_Rank_1,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and not WearingArmor() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_MageArmor" @@ -11118,7 +11142,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MysticArmorStatus_Rank_1,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and not WearingArmor() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_MageArmor" @@ -11150,7 +11174,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(MysticArmorStatus_Rank_4,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and not WearingArmor() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_MageArmor" @@ -11181,7 +11205,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Illusion" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(PhantomPainStatus_1,100,10);DealDamage(2d4,Psychic,Magical,NonLethal);IF(not SaveCrit()):ApplyStatus(SICKENED,100,-1);IF(SaveCrit()):ApplyStatus(SICKENED2,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -11274,7 +11298,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(SELF,NeedleVengeance_Owner,100,2);ApplyStatus(SELF,NeedleVengeance_Move,100,1);ApplyStatus(NeedleVengeance_Enemy,100,2); IF(not CharacterLevelGreaterThan(3)):ApplyStatus(SELF,NeedleVengeance_Ally_1,100,2);IF(CharacterLevelGreaterThan(3) and not CharacterLevelGreaterThan(5)):ApplyStatus(SELF,NeedleVengeance_Ally_2,100,2);IF(CharacterLevelGreaterThan(5) and not CharacterLevelGreaterThan(7)):ApplyStatus(SELF,NeedleVengeance_Ally_3,100,2);IF(CharacterLevelGreaterThan(7) and not CharacterLevelGreaterThan(9)):ApplyStatus(SELF,NeedleVengeance_Ally_4,100,2);IF(CharacterLevelGreaterThan(9) and not CharacterLevelGreaterThan(11)):ApplyStatus(SELF,NeedleVengeance_Ally_5,100,2);IF(CharacterLevelGreaterThan(11)):ApplyStatus(SELF,NeedleVengeance_Ally_6,100,2)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "Character() and not Self()" data "Icon" "Action_Monster_Duergar_MindSpike" data "DisplayName" "h0299e18dge5d3g4b28g0017g6afb285efb2e;1" @@ -11301,7 +11325,7 @@ new entry "Target_NeedleOfVengeance_Move" type "SpellData" data "SpellType" "Target" data "SpellProperties" "IF(not CharacterLevelGreaterThan(3)):ApplyStatus(NeedleVengeance_Ally_1,100,2);IF(CharacterLevelGreaterThan(3) and not CharacterLevelGreaterThan(5)):ApplyStatus(NeedleVengeance_Ally_2,100,2);IF(CharacterLevelGreaterThan(5) and not CharacterLevelGreaterThan(7)):ApplyStatus(NeedleVengeance_Ally_3,100,2);IF(CharacterLevelGreaterThan(7) and not CharacterLevelGreaterThan(9)):ApplyStatus(NeedleVengeance_Ally_4,100,2);IF(CharacterLevelGreaterThan(9) and not CharacterLevelGreaterThan(11)):ApplyStatus(NeedleVengeance_Ally_5,100,2);IF(CharacterLevelGreaterThan(11)):ApplyStatus(NeedleVengeance_Ally_6,100,2)" -data "TargetRadius" "36" +data "TargetRadius" "48" data "TargetConditions" "Ally() or Self()" data "Icon" "PassiveFeature_Generic_Info" data "DisplayName" "h8fd80848g1334g53d0g8c35gd697c20e4dd4;1" @@ -11357,7 +11381,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(MaliciousShadowDamage), Bludgeoning,Magical);" @@ -11391,7 +11415,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" data "SpellProperties" "ApplyStatus(MaliciousShadowTarget,100,10);ApplyStatus(SELF,MaliciousShadowStatus,100,10);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(MaliciousShadowDamage), Bludgeoning,Magical);" @@ -11458,7 +11482,7 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Evocation" data "Cooldown" "OncePerShortRest" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(FamiliarWitchDamage),Slashing,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(FamiliarWitchDamage))*2,Slashing,Magical);ApplyStatus(ENSNARED,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage(LevelMapValue(FamiliarWitchDamage)/2,Slashing,Magical);" @@ -11487,7 +11511,7 @@ data "Level" "4" data "SpellSchool" "Evocation" data "Cooldown" "OncePerShortRest" data "SpellProperties" "ApplyStatus(SELF,SpiritFamiliarStatus,100,1)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(FamiliarWitchDamage),Radiant,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(FamiliarWitchDamage))*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage(LevelMapValue(FamiliarWitchDamage)/2,Radiant,Magical);" @@ -11516,7 +11540,7 @@ using "Target_Heal" data "Level" "4" data "Cooldown" "OncePerTurn" data "SpellProperties" "RegainHitPoints(LevelMapValue(FamiliarWitchDamage)/2);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "DisplayName" "hc4a6c8fcgee1cg0771g6092g693b11a61a3a;1" data "Description" "h25c5d630gd481gdb94g9b6fge4704fc2eff4;1" data "TooltipDamageList" "RegainHitPoints(LevelMapValue(FamiliarWitchDamage)/2);" @@ -11697,7 +11721,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,3);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);IF(SaveCrit()):ApplyStatus(COMMAND_FLEE, 100, 1);" @@ -11771,9 +11795,9 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_GravitationalPull_Action1;Target_GravitationalPull_Action2;Target_GravitationalPull_Action3" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" -data "SpellSuccess" "Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(PRONE_PF2,100,-1);IF(SaveCrit()):ApplyStatus(OFFBALANCE,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellSuccess" "Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(PRONE_PF2,100,-1);IF(SaveCrit()):ApplyStatus(OFFBALANCE,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "TargetConditions" "Character() and not Self()" data "Icon" "Spell_OttosIrresistibleDance" data "DisplayName" "hc8cc2c3bg8dedg1954gc0adgccba0b1f7637;1" @@ -11812,7 +11836,7 @@ data "SpellType" "Target" using "Target_GravitationalPull_Base" data "SpellContainerID" "Target_GravitationalPull_Base" data "ContainerSpells" ";" -data "SpellSuccess" "Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(PRONE_PF2,100,-1);IF(SaveCrit()):ApplyStatus(OFFBALANCE,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellSuccess" "Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(PRONE_PF2,100,-1);IF(SaveCrit()):ApplyStatus(OFFBALANCE,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "DisplayName" "h2ca04870g19f0g92ccgd7feg5d6906e1ddde;1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:1" @@ -11832,8 +11856,8 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "AI_IGNORE:GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AnimatedAssault_Status_Aura);GROUND:ApplyStatus(SELF,AnimatedAssault_Owner,100,2)" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d10,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((2d10)*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -11870,8 +11894,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Conjuration" data "SpellProperties" "AI_IGNORE:GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AnimatedAssault_Status_Aura);GROUND:ApplyStatus(SELF,AnimatedAssault_Owner,100,2)" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d10,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((2d10)*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -11963,7 +11987,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(8e0aeac1-533b-4254-8a37-2357b430cf5f, 100)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "AmountOfTargets" "1" @@ -12042,7 +12066,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Sleep" data "SpellProperties" ";" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" @@ -12165,7 +12189,7 @@ data "SpellType" "Target" using "Target_Entangle" data "ContainerSpells" "Target_Cacti_Rank1;Target_Flowers_Rank1;Target_Fruits_Rank1;Target_Roots_Rank1" data "SpellProperties" ";" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "DisplayName" "hdcf6846dg37adg6667g1f46g308b287716d0;1" @@ -12488,7 +12512,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_ConcordantChoir_1Action_1;Target_ConcordantChoir_2Action_1;Shout_ConcordantChoir_3Action_1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(1d4,Thunder,Magical);IF(SaveCrit()):DealDamage((1d4)*2,Thunder,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -12512,7 +12536,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ConcordantChoir_Base" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(1d4,Thunder,Magical);IF(SaveCrit()):DealDamage((1d4)*2,Thunder,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -12604,8 +12628,8 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ConcordantChoir_Base" -data "TargetRadius" "9" -data "AreaRadius" "3" +data "TargetRadius" "12" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d4,Thunder,Magical);IF(SaveCrit()):DealDamage((2d4)*2,Thunder,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -12698,7 +12722,7 @@ data "Level" "1" data "SpellSchool" "Enchantment" data "SpellContainerID" "Target_Command_Container" data "ContainerSpells" "" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(COMMAND_HALT, 100, 1)" @@ -12837,7 +12861,7 @@ new entry "Target_Command_Approach_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Approach_2" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:2" data "MaximumTargets" "2" @@ -12861,7 +12885,7 @@ new entry "Target_Command_Drop_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Drop_2" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -12884,7 +12908,7 @@ new entry "Target_Command_Flee_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Flee_2" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -12907,7 +12931,7 @@ new entry "Target_Command_Grovel_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Grovel_2" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -12931,7 +12955,7 @@ new entry "Target_Command_Halt_2_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Halt_2" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -12962,7 +12986,7 @@ new entry "Target_Command_Approach_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Approach_3" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -12984,7 +13008,7 @@ new entry "Target_Command_Drop_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Drop_3" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -13006,7 +13030,7 @@ new entry "Target_Command_Flee_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Flee_3" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -13029,7 +13053,7 @@ new entry "Target_Command_Halt_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Halt_3" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "3" data "RootSpellID" "" @@ -13051,7 +13075,7 @@ new entry "Target_Command_Grovel_3_AI" type "SpellData" data "SpellType" "Target" using "Target_Command_Grovel_3" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "CastTextEvent" "Cast" data "MaximumTargets" "3" @@ -13063,7 +13087,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" @@ -13157,7 +13181,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "GROUND:SurfaceChange(DestroyWater);GROUND:SurfaceChange(Melt);RemoveStatus(WET)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" @@ -13196,7 +13220,7 @@ new entry "Target_Dehydrate_Rank3" type "SpellData" data "SpellType" "Target" using "Target_Dehydrate_Rank1" -data "AreaRadius" "3" +data "AreaRadius" "4" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(DehydrateDamage_Rank3,100,-1);ApplyStatus(DehydrateEnfeebled,100,10);IF(SaveCrit()):ApplyStatus(DehydrateDamage_Rank3_Double,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(DehydrateDamage_Rank3_Half,100,-1);IF(not SaveCritMiss('Fort')):ApplyStatus(DehydrateEnfeebled,100,10);" data "TooltipDamageList" "DealDamage(4d6,Fire)" @@ -13209,7 +13233,7 @@ new entry "Target_Dehydrate_Rank5" type "SpellData" data "SpellType" "Target" using "Target_Dehydrate_Rank1" -data "AreaRadius" "5" +data "AreaRadius" "6" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(DehydrateDamage_Rank5,100,-1);ApplyStatus(DehydrateEnfeebled,100,10);IF(SaveCrit()):ApplyStatus(DehydrateDamage_Rank5_Double,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(DehydrateDamage_Rank5_Half,100,-1);IF(not SaveCritMiss('Fort')):ApplyStatus(DehydrateEnfeebled,100,10);" data "TooltipDamageList" "DealDamage(7d6,Fire)" @@ -13224,7 +13248,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(Jump_Rank3Unlock_Status,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Icon" "Spell_Transmutation_LongJump" data "DisplayName" "hfaad0fceg62a9g1423gfbb7gb44fb3087e0c;1" data "Description" "he36fea0bg28d9gcb54gdaa8g7f4ff558113f;1" @@ -13250,7 +13274,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(ENFEEBLED_2,100,10);IF(SaveCrit()):ApplyStatus(ENFEEBLED_3,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -13321,9 +13345,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(4,10,Grease)" -data "TargetRadius" "9" -data "AreaRadius" "4" +data "SpellProperties" "GROUND:CreateSurface(6,10,Grease)" +data "TargetRadius" "12" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_Grease" @@ -13356,7 +13380,7 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Electrify)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "DealDamage(LevelMapValue(D8Cantrip),Lightning,Magical)" @@ -13389,7 +13413,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(StatusBonus1Saves,100,10);ApplyStatus(StatusBonus1AC,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEvilAndGood" @@ -13420,7 +13444,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(Protection_Rank3,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEvilAndGood" @@ -13450,7 +13474,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" data "ContainerSpells" "Target_AcidGrip_Rank2_Push;Target_AcidGrip_Rank2_Pull;Target_AcidGrip_Rank2_NoMove" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -13486,8 +13510,8 @@ data "SpellType" "Target" using "Target_AcidGrip_Rank2" data "SpellContainerID" "Target_AcidGrip_Rank2" data "ContainerSpells" ";" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(2, OriginToEntity, Neutral, false, true);" data "Icon" "Spell_Evocation_ChromaticOrb_Acid" data "DisplayName" "hf16bf50agb225g0a13g9aedgaec065322d9c;1" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;IsSpell;HasHighGroundRangeExtension;IsHarmful" @@ -13498,8 +13522,8 @@ data "SpellType" "Target" using "Target_AcidGrip_Rank2" data "SpellContainerID" "Target_AcidGrip_Rank2" data "ContainerSpells" ";" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Acid,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank2,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "Icon" "Spell_Evocation_ChromaticOrb_Acid" data "DisplayName" "hafa25735g2535g9a11g853dg451192bff582;1" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;IsSpell;HasHighGroundRangeExtension;IsHarmful" @@ -13533,8 +13557,8 @@ data "SpellType" "Target" using "Target_AcidGrip_Rank4" data "SpellContainerID" "Target_AcidGrip_Rank4" data "ContainerSpells" ";" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d8,Acid,Magical);IF(SaveCrit()):DealDamage((4d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d8,Acid,Magical);IF(SaveCrit()):DealDamage((4d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(2, OriginToEntity, Neutral, false, true);" data "DisplayName" "h12c34968g0d73ga508g6a0fg5598459755fd;1" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;IsSpell;HasHighGroundRangeExtension;IsHarmful" @@ -13544,8 +13568,8 @@ data "SpellType" "Target" using "Target_AcidGrip_Rank4" data "SpellContainerID" "Target_AcidGrip_Rank4" data "ContainerSpells" ";" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d8,Acid,Magical);IF(SaveCrit()):DealDamage((4d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d8,Acid,Magical);IF(SaveCrit()):DealDamage((4d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank4,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((4d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "DisplayName" "h14ae12ebg8cf7gfdbag9438ga88d0ebc41c0;1" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;IsSpell;HasHighGroundRangeExtension;IsHarmful" @@ -13578,8 +13602,8 @@ data "SpellType" "Target" using "Target_AcidGrip_Rank6" data "SpellContainerID" "Target_AcidGrip_Rank6" data "ContainerSpells" ";" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank6,100,-1);IF(not SaveCrit()):Force(3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank6,100,-1);IF(not SaveCrit()):Force(4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(2, OriginToEntity, Neutral, false, true);" data "DisplayName" "h4dec05c8g1abagf2f9g2e7fg4c90fbe48548;1" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;IsSpell;HasHighGroundRangeExtension;IsHarmful" @@ -13589,8 +13613,8 @@ data "SpellType" "Target" using "Target_AcidGrip_Rank6" data "SpellContainerID" "Target_AcidGrip_Rank6" data "ContainerSpells" ";" -data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank6,100,-1);IF(not SaveCrit()):Force(-3, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-1.5, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);ApplyStatus(AcidGrip_Rank6,100,-1);IF(not SaveCrit()):Force(-4, OriginToEntity, Neutral, false, true);IF(SaveCrit()):Force(-8, OriginToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((6d8)/2,Acid,Magical);IF(not SaveCritMiss('Reflex')):Force(-2, OriginToEntity, Neutral, false, true);" data "DisplayName" "hc41188b9g905cgf1eegc819g334783060c16;1" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;IsSpell;HasHighGroundRangeExtension;IsHarmful" @@ -13608,7 +13632,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(BlisteringInvectiveBurning_Rank2,100,-1);IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,1);IF(SaveCrit()):ApplyStatus(BlisteringInvectiveBurning_Rank2_Double,100,-1);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -13674,7 +13698,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Illusion" data "SpellProperties" "ApplyStatus(BLUR,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "VisualSpell() and ConcentrateSpell();" data "Icon" "Spell_Illusion_Blur" @@ -13704,8 +13728,8 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,MistAura);" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_FogCloud" @@ -13735,9 +13759,9 @@ type "SpellData" data "SpellType" "Target" using "Target_FogCloud" data "Level" "2" -data "SpellProperties" "GROUND:CreateSurface(5,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank2)" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:CreateSurface(6,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank2)" +data "TargetRadius" "48" +data "AreaRadius" "6" data "DisplayName" "hb7c2763eg6370g356cgc4d1g55da6afe8ef7;1" data "Description" "h9c1dd2b6g7563g9ccfg63c9g92cb0cd82421;1" data "TooltipOnSave" "961753f4-c345-4bc4-b408-1d5b87a5ab0c" @@ -13755,7 +13779,7 @@ new entry "Target_AshCloud_Rank3" type "SpellData" data "SpellType" "Target" using "Target_AshCloud_Rank2" -data "SpellProperties" "GROUND:CreateSurface(5,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank3)" +data "SpellProperties" "GROUND:CreateSurface(6,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank3)" data "UseCosts" "ActionPoint:3;SpellSlotsGroup:1:1:3" data "RootSpellID" "Target_AshCloud_Rank2" data "PowerLevel" "3" @@ -13764,7 +13788,7 @@ new entry "Target_AshCloud_Rank4" type "SpellData" data "SpellType" "Target" using "Target_AshCloud_Rank2" -data "SpellProperties" "GROUND:CreateSurface(5,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank4)" +data "SpellProperties" "GROUND:CreateSurface(6,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank4)" data "UseCosts" "ActionPoint:3;SpellSlotsGroup:1:1:4" data "RootSpellID" "Target_AshCloud_Rank2" data "PowerLevel" "4" @@ -13773,7 +13797,7 @@ new entry "Target_AshCloud_Rank5" type "SpellData" data "SpellType" "Target" using "Target_AshCloud_Rank2" -data "SpellProperties" "GROUND:CreateSurface(5,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank5)" +data "SpellProperties" "GROUND:CreateSurface(6,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank5)" data "UseCosts" "ActionPoint:3;SpellSlotsGroup:1:1:5" data "RootSpellID" "Target_AshCloud_Rank2" data "PowerLevel" "5" @@ -13782,7 +13806,7 @@ new entry "Target_AshCloud_Rank6" type "SpellData" data "SpellType" "Target" using "Target_AshCloud_Rank2" -data "SpellProperties" "GROUND:CreateSurface(5,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank6)" +data "SpellProperties" "GROUND:CreateSurface(6,1,Fire);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank6)" data "UseCosts" "ActionPoint:3;SpellSlotsGroup:1:1:6" data "RootSpellID" "Target_AshCloud_Rank2" data "PowerLevel" "6" @@ -13794,13 +13818,12 @@ data "Level" "2" data "SpellSchool" "Transmutation" data "AIFlags" "CanNotUse" data "SpellProperties" "ApplyStatus(DARKVISION,100,-1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Self() and ConcentrateSpell();" data "Icon" "Spell_Evocation_Darkvision" data "DisplayName" "hdc0f63dfga0b6gaeb7gdff4g859c3a6ba47a;1" -data "Description" "haa2e8680gb61dg2c44g71d3gc9bbb179ecd2;1" -data "DescriptionParams" "Distance(12)" +data "Description" "haa2e8680gb61dg2c44g71d3gc9bbb179ecd2;2" data "TooltipStatusApply" "ApplyStatus(DARKVISION,100,-1)" data "TooltipUpcastDescription" "6ff1780a-855a-414c-a8bf-811251537206" data "PrepareSound" "Spell_Prepare_Utility_Gen_L1to3_01" @@ -13836,7 +13859,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(ENLARGE,100,50);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Enlarge" @@ -13908,8 +13931,8 @@ type "SpellData" data "SpellType" "Target" using "Target_Entangle" data "Level" "2" -data "SpellProperties" "GROUND:CreateSurface(5,10,Vines,true)" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:CreateSurface(6,10,Vines,true)" +data "AreaRadius" "6" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(TANGLE_VINE,100,1);IF(SaveCrit()):ApplyStatus(ENSNARED,100,1);" data "DisplayName" "h4de6d12ege3abg5e8egb1d3g9187ba37f111;1" @@ -13922,7 +13945,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,MistAura);" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_FogCloud" @@ -13952,8 +13975,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Necromancy" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d10,Necrotic,Magical);IF(SaveCrit()):DealDamage((2d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -14035,7 +14058,7 @@ data "SpellType" "Target" using "Target_WardingBond" data "SpellSchool" "Necromancy" data "SpellProperties" "ApplyStatus(SELF, WARDING_BOND_CASTER, 100, 100);ApplyStatus(WARDING_BOND, 100, 100)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and not Self() and not Dead() and ConcentrateSpell();" data "DisplayName" "he1a8fd86g3bfbgdecfg4e6aga6737afef76a;1" @@ -14049,8 +14072,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(FAERIE_FIRE, 100, 10);IF(SaveCrit()):ApplyStatus(FAERIE_FIRE, 100, 100);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -14118,7 +14141,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Abjuration" data "ContainerSpells" "Target_ResistEnergy_Acid_Rank2;Target_ResistEnergy_Cold_Rank2;Target_ResistEnergy_Lightning_Rank2;Target_ResistEnergy_Fire_Rank2;Target_ResistEnergy_Thunder_Rank2" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy" @@ -14148,7 +14171,7 @@ data "Level" "2" data "SpellSchool" "Abjuration" data "SpellContainerID" "Target_ResistEnergyPF2_Container_Rank2" data "SpellProperties" "ApplyStatus(ResistEnergyStatus_Acid_Rank2,100,-1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy_Acid" @@ -14179,7 +14202,7 @@ data "Level" "2" data "SpellSchool" "Abjuration" data "SpellContainerID" "Target_ResistEnergyPF2_Container_Rank2" data "SpellProperties" "ApplyStatus(ResistEnergyStatus_Cold_Rank2,100,-1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy_Cold" @@ -14210,7 +14233,7 @@ data "Level" "2" data "SpellSchool" "Abjuration" data "SpellContainerID" "Target_ResistEnergyPF2_Container_Rank2" data "SpellProperties" "ApplyStatus(ResistEnergyStatus_Lightning_Rank2,100,-1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy_Lightning" @@ -14241,7 +14264,7 @@ data "Level" "2" data "SpellSchool" "Abjuration" data "SpellContainerID" "Target_ResistEnergyPF2_Container_Rank2" data "SpellProperties" "ApplyStatus(ResistEnergyStatus_Fire_Rank2,100,-1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy_Fire" @@ -14272,7 +14295,7 @@ data "Level" "2" data "SpellSchool" "Abjuration" data "SpellContainerID" "Target_ResistEnergyPF2_Container_Rank2" data "SpellProperties" "ApplyStatus(ResistEnergyStatus_Thunder_Rank2,100,-1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_ProtectionFromEnergy_Thunder" @@ -14356,8 +14379,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" -data "TargetRadius" "9" -data "AreaRadius" "3" +data "TargetRadius" "12" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC(),false,IsInorganic());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d10,Thunder,Magical);IF(SaveCrit()):DealDamage((2d10)*2,Thunder,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -14438,7 +14461,7 @@ data "SpellType" "Target" using "Target_ConjureElemental_Container" data "Level" "1" data "ContainerSpells" "Target_SummonAnimal_Rat_1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_HoundOfIllOmen" @@ -14483,7 +14506,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Enchantment" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,3);IF(not SaveCrit()):DealDamage(4d6,Psychic,Magical);IF(SaveCrit()):DealDamage((4d6)*2,Psychic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fear')):ApplyStatus(FRIGHTENED,100,1);IF(not SaveCritMiss('Fear')):DealDamage((4d6)/2,Psychic,Magical);" @@ -14551,7 +14574,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Blindness" data "Level" "3" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellSuccess" "ApplyStatus(BLINDNESS,100,10);IF(SaveCrit()):ApplyStatus(BLINDNESS,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0);IF(not SaveCritMiss('Fort')):ApplyStatus(OFF_BALANCED,100,1);" data "Description" "h7507d3abgca38g1ca5gdc13gd1b47fbaf18b;1" @@ -14563,9 +14586,9 @@ type "SpellData" data "SpellType" "Target" using "Target_Entangle" data "Level" "3" -data "SpellProperties" "GROUND:CreateSurface(6,10,Mud);" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,10,Mud);" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Piercing,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Piercing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -14665,7 +14688,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Enfeeble_PF2" data "Level" "3" -data "TargetRadius" "36" +data "TargetRadius" "48" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(ENFEEBLED_1,100,10);IF(not SaveCrit()):ApplyStatus(StatusPenalty1Saves,100,10);IF(SaveCrit()):ApplyStatus(ENFEEBLED_2,100,10);IF(SaveCrit()):ApplyStatus(StatusPenalty1Saves,100,-1);" data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(ENFEEBLED_1,100,1);IF(not SaveCritMiss('Fort')):ApplyStatus(StatusPenalty1Saves,100,1);" data "TargetConditions" "Character() and not Dead();" @@ -14689,7 +14712,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(EarthbindStatus,100,1);IF(SaveCrit()):ApplyStatus(EarthbindStatus,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -14721,12 +14744,12 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" -data "TargetRadius" "36" -data "AreaRadius" "9" +data "TargetRadius" "48" +data "AreaRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" -data "SpellSuccess" "IF(not SaveCrit()):Force(-5, TargetToEntity, Neutral, false, true);IF(SaveCrit()):Force(-4, TargetToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" -data "SpellFail" "Force(-1.5, TargetToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not SaveCrit()):Force(-12, TargetToEntity, Neutral, false, true);IF(SaveCrit()):Force(-6, TargetToEntity, Neutral, false, true);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" +data "SpellFail" "Force(-2, TargetToEntity, Neutral, false, true);" data "TargetConditions" "ConcentrateSpell();" data "Icon" "PassiveFeature_Generic_Explosion" data "DisplayName" "h8e82a407g14cag43a8ga675g2e77117ac85f;1" @@ -14755,7 +14778,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(HASTE,100,10)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and not Dead() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Haste" @@ -14824,7 +14847,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Transmutation" data "SpellProperties" "IF(not Self()):ApplyStatus(LOOSE_TIMES_ARROW,100,1);IF(Self()):ApplyStatus(LOOSE_TIMES_ARROW,100,2);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and ConcentrateSpell();" data "AmountOfTargets" "6" @@ -14890,7 +14913,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(StatusBonus1Attack,100,100);ApplyStatus(StatusBonus1Saves,100,100);ApplyStatus(StatusBonus1Skills,100,100);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_Heroism" @@ -14931,8 +14954,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,3,,,,HypnotizeAura);" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "Icon" "Spell_Illusion_HypnoticPattern" data "DisplayName" "h382c16adga4a9gb5cag1f6fgff2f434dc0b5;1" data "Description" "h90be83bbg9ff1g79cfg142fgcffe2ba2691c;1" @@ -14986,8 +15009,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Conjuration" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d6,Poison,Magical);IF(SaveCrit()):DealDamage((4d6)*2,Poison,Magical);IF(Tagged('PLANT')):ApplyStatus(SICKENED,100,2);IF(Tagged('PLANT')):ApplyStatus(NoxiousMetalsPersistent_Rank3,100,2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15049,7 +15072,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(PARALYZED,100,1);" @@ -15107,9 +15130,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" -data "SpellProperties" "GROUND:ApplyStatus(SELF,RouseSkeletonsStatus_Rank3,100,2);GROUND:CreateSurface(3,1,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,3,,,,RouseSkeletonsAura);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:ApplyStatus(SELF,RouseSkeletonsStatus_Rank3,100,2);GROUND:CreateSurface(4,1,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,3,,,,RouseSkeletonsAura);" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d6,Slashing,Magical);IF(SaveCrit()):DealDamage((2d6)*2,Slashing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15144,7 +15167,7 @@ new entry "Target_RouseSkeletons_Rank5" type "SpellData" data "SpellType" "Target" using "Target_RouseSkeletons_Rank3" -data "SpellProperties" "GROUND:ApplyStatus(SELF,RouseSkeletonsStatus_Rank5,100,2);GROUND:CreateSurface(3,1,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,3,,,RouseSkeletonsAura);" +data "SpellProperties" "GROUND:ApplyStatus(SELF,RouseSkeletonsStatus_Rank5,100,2);GROUND:CreateSurface(4,1,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,3,,,RouseSkeletonsAura);" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d6,Slashing,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Slashing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((3d6)/2,Slashing,Magical);" data "TooltipDamageList" "DealDamage(3d6,Slashing)" @@ -15174,7 +15197,7 @@ new entry "Target_RouseSkeletons_Rank5_Recast" type "SpellData" data "SpellType" "Target" using "Target_RouseSkeletons_Rank3_Recast" -data "SpellProperties" "GROUND:ApplyStatus(SELF,RouseSkeletonsStatus_Rank5,100,2);GROUND:CreateSurface(3,1,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,1,,,RouseSkeletons,RouseSkeletonsAura);" +data "SpellProperties" "GROUND:ApplyStatus(SELF,RouseSkeletonsStatus_Rank5,100,2);GROUND:CreateSurface(4,1,Mud);GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,1,,,RouseSkeletons,RouseSkeletonsAura);" data "RequirementConditions" "HasStatus('RouseSkeletonsStatus_Rank5') and OwnerCanSustain('RouseSkeletonsStatus_Rank5') and ConcentrateSpell();" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d6,Slashing,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Slashing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((3d6)/2,Slashing,Magical);" @@ -15187,7 +15210,7 @@ using "Target_Stoneskin" data "Level" "4" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(STONESKIN,100,20);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_Stoneskin" @@ -15218,7 +15241,7 @@ using "Target_MountainResilience_Rank4" data "Level" "3" data "SpellSchool" "Abjuration" data "SpellProperties" "ApplyStatus(SANDFORM,100,10);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Barkskin" @@ -15258,7 +15281,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Invisibility" data "Level" "3" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not HasStatus('FAERIE_FIRE') and not IsImmuneToStatus('SG_Invisible') and ConcentrateSpell();" data "AmountOfTargets" "6" @@ -15285,7 +15308,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(STUNNED1,100,10);IF(SaveCrit()):ApplyStatus(STUNNED2,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15319,7 +15342,7 @@ new entry "Target_Slow_Rank3" type "SpellData" data "SpellType" "Target" using "Target_Slow" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(STUNNED1,100,10);IF(SaveCrit()):ApplyStatus(STUNNED2,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(STUNNED1,100,1);" @@ -15362,9 +15385,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(6,10,StinkingCloud,true)" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,10,StinkingCloud,true)" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(SICKENED,100,1);ApplyStatus(STUNNED1,100,1);" @@ -15430,7 +15453,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Necrotic,Magical);RegainHitPoints(SELF,(DamageDone)/2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15503,7 +15526,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "AI_IGNORE:ApplyStatus(CONFUSION,100,10);" @@ -15535,9 +15558,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(3,10,SpikeGrowth,true);" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:CreateSurface(4,10,SpikeGrowth,true);" +data "TargetRadius" "48" +data "AreaRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Piercing,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Piercing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex'))::DealDamage((6d6)/2,Piercing,Magical);" @@ -15586,8 +15609,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Evocation" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d10,Radiant,Magical);IF(SaveCrit()):DealDamage((4d10)*2,Radiant,Magical);ApplyStatus(SICKENED,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15644,7 +15667,7 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(FLY,100,50);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and not Dead() and not Tagged('INNATE_FLYER') and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Fly" @@ -15673,7 +15696,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Enchantment" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Bludgeoning,Magical);ApplyStatus(GRABBED_MAGIC,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15724,8 +15747,8 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SleetStorm,SLEET_STORM);GROUND:ApplyStatus(SELF,IceStorm_Owner,100,2);RemoveStatus(BURNING);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Bludgeoning,Magical);IF(not SaveCrit()):DealDamage(2d8,Cold,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15820,7 +15843,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Evocation" -data "TargetRadius" "45" +data "TargetRadius" "40" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Thunder,Magical);IF(SaveCrit()):DealDamage((8d6)*2,Thunder,Magical);IF(not SaveCrit()):ApplyStatus(SICKENED,100,-1);IF(SaveCrit()):ApplyStatus(SICKENED_2,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15879,8 +15902,8 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Necromancy" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,10,,,,PoltergeistAura);GROUND:ApplyStatus(SELF,PoltergeistRecast_Rank4,100,2);GROUND:ApplyStatus(SELF,PoltergeistCast,100,1);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Gale_ShadowSummon" @@ -15919,8 +15942,8 @@ data "SpellType" "Target" data "SpellSchool" "Conjuration" data "ContainerSpells" "Target_PerniciousPoltergeist_Rank4_Recast_Negative;Shout_Poltergeist_Sustain_Force;Shout_Poltergeist_Sustain_Fear;" data "Cooldown" "OncePerTurn" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "HasStatus('PoltergeistCast') or (HasStatus('PoltergeistRecast_Rank4') and OwnerCanSustain('PoltergeistRecast_Rank4')) and ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Gale_ShadowSummon" @@ -15937,7 +15960,7 @@ new entry "Target_PerniciousPoltergeist_Rank4_Recast_Negative" type "SpellData" data "SpellType" "Target" data "SpellContainerID" "Target_PerniciousPoltergeist_Rank4_Recast" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d10,Necrotic,Magical);IF(SaveCrit()):DealDamage((4d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -15970,8 +15993,8 @@ data "SpellType" "Target" using "Target_PerniciousPoltergeist_Rank4_Recast" data "ContainerSpells" "Target_PerniciousPoltergeist_Rank6_Recast_Negative;Shout_Poltergeist_Sustain_Force_6;Shout_Poltergeist_Sustain_Fear_6;" data "Cooldown" "OncePerTurn" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "HasStatus('PoltergeistCast') or (HasStatus('PoltergeistRecast_Rank6') and OwnerCanSustain('PoltergeistRecast_Rank6')) and ConcentrateSpell();" data "Icon" "Spell_Illusion_Fear" data "Description" "h60ae4ed5g0af1g5674gf841g455c04d9898b;1" @@ -16003,8 +16026,8 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "AI_IGNORE:GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AnimatedAssault_Status_Aura);GROUND:ApplyStatus(SELF,AnimatedAssault_Owner,100,2)" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d10,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((2d10)*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -16042,7 +16065,7 @@ data "SpellType" "Target" using "Target_CloudOfDaggers" data "Level" "4" data "SpellProperties" "AI_IGNORE:GROUND:Summon(b80e9a49-3de8-4fc9-8fe2-1012a4f3fd85, 10,,,,PetalStorm_Aura_Rank4);AI_ONLY:DealDamage(2d10,Slashing);" -data "AreaRadius" "4" +data "AreaRadius" "6" data "DisplayName" "hc73ff27eg7ddeg8488gd7adg3aa9621e45d9;1" data "Description" "h5de0229fg0df0g974egf7ccg54f0af703783;1" data "TooltipDamageList" "DealDamage(2d10,Slashing)" @@ -16077,7 +16100,7 @@ data "SpellType" "Target" using "Target_AshCloud_Rank2" data "Level" "4" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,RustCloudAura_Rank4);" -data "AreaRadius" "6" +data "AreaRadius" "8" data "DisplayName" "h9b69d771gbe36gae11g4c43g911c6d0914f7;1" data "Description" "hfcd43726ge1f6g69b3g3a26ga500ae5abbaf;2" data "DescriptionParams" "DealDamage(5d10,Slashing);DealDamage(1d4,Slashing)" @@ -16110,8 +16133,8 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Necromancy" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,SanguineMist,SanguineMistAura_4);GROUND:ApplyStatus(SELF,SanguineMistRecast_Rank4,100,2);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -16147,8 +16170,8 @@ type "SpellData" data "SpellType" "Target" using "Target_SanguineMist_Rank4" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,SanguineMist,SanguineMistAura_5);GROUND:ApplyStatus(SELF,SanguineMistRecast_Rank5,100,2);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((8d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((8d6)/2,Necrotic,Magical);" data "TooltipDamageList" "DealDamage(8d6,Necrotic)" @@ -16161,8 +16184,8 @@ type "SpellData" data "SpellType" "Target" using "Target_SanguineMist_Rank4" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,SanguineMist,SanguineMistAura_6);GROUND:ApplyStatus(SELF,SanguineMistRecast_Rank6,100,2);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(10d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((10d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((10d6)/2,Necrotic,Magical);" data "TooltipDamageList" "DealDamage(10d6,Necrotic)" @@ -16186,9 +16209,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,MistAura);GROUND:CreateSurface(6,10,Mud);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,MistAura);GROUND:CreateSurface(8,10,Mud);" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_FogCloud" @@ -16215,9 +16238,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(6,1000,SpikeGrowth,true);" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,1000,SpikeGrowth,true);" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Transmutation_SpikeGrowth" @@ -16244,7 +16267,7 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Necromancy" data "SpellProperties" "GROUND:Summon(322b547f-e8e1-48e5-90cd-eda40fc63456, 1,,,,,);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d4,Piercing,Magical);IF(not SaveCrit()):DealDamage(4d4,Necrotic,Magical);IF(SaveCrit()):DealDamage((4d4)*2,Piercing,Magical);IF(SaveCrit()):DealDamage((4d4)*2,Necrotic,Magical);RegainHitPoints(SELF,4d4);ApplyStatus(VampiricMaiden,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -16320,7 +16343,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Illusion" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Psychic,Magical);ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):DealDamage((8d6)*2,Psychic,Magical);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,4);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -16378,8 +16401,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Necromancy" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(VoidWhispers_Rank4,100,-1);" @@ -16458,8 +16481,8 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SleetStorm,SLEET_STORM);GROUND:ApplyStatus(SELF,IceStorm_Owner,100,2);RemoveStatus(BURNING);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d8,Bludgeoning,Magical);IF(not SaveCrit()):DealDamage(2d8,Cold,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((2d8)*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -16493,9 +16516,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(6,1000,SpikeGrowth,true);" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,1000,SpikeGrowth,true);" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Transmutation_SpikeGrowth" @@ -16529,7 +16552,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC(),false,IsInorganic());" data "SpellSuccess" "IF(not HasStatus('DEBRIS_THRESHOLD_GREATER') and not HasStatus('DEBRIS_THRESHOLD') and not HasStatus('DEBRIS_THRESHOLD_LESSER')):DealDamage(2d10,Force,Magical);IF(HasStatus('DEBRIS_THRESHOLD_GREATER')):DealDamage(2d10+50,Force);IF(HasStatus('DEBRIS_THRESHOLD')):DealDamage(2d10+22,Force);IF(HasStatus('DEBRIS_THRESHOLD_LESSER')):DealDamage(2d10+11,Force);" @@ -16608,9 +16631,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" -data "SpellProperties" "GROUND:CreateSurface(6,10,Overgrowth)" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,10,Overgrowth)" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Transmutation_PlantGrowth" @@ -16637,8 +16660,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Illusion" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,3,,,,HypnotizeAura);" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "Icon" "Spell_Illusion_HypnoticPattern" data "DisplayName" "hf0042d15g71dfgb8fdg8607gba31a4751c8e;1" data "Description" "hcb6cd310g0dc5g8a71gee87g3aa3f4aa631f;1" @@ -16701,8 +16724,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(FAERIE_FIRE, 100, 10);" @@ -16790,8 +16813,8 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "AI_IGNORE:GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AnimatedAssault_Status_Aura);GROUND:ApplyStatus(SELF,AnimatedAssault_Owner,100,2)" -data "TargetRadius" "36" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d10,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((2d10)*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -16849,8 +16872,8 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(CALM_EMOTIONS, 100, 10);IF(not HasPassive('MindlessRage')):RemoveStatus(SG_Rage)" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "(not Item() or Tagged('CANBECALMED')) and not Dead() and EmotionSpell() and MentalSpell() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_CalmEmotions" @@ -16888,7 +16911,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt)" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" data "SpellSuccess" "IF(Tagged('FIEND')):DealDamage(2d6,Radiant,Magical);DealDamage(2d6,Fire,Magical);" @@ -16961,8 +16984,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Abjuration" data "ContainerSpells" "Target_GlyphOfWarding_Acid;Target_GlyphOfWarding_Cold;Target_GlyphOfWarding_Fire;Target_GlyphOfWarding_Lightning;Target_GlyphOfWarding_Thunder;Target_GlyphOfWarding_Detonation;Target_GlyphOfWarding_Sleep" -data "TargetRadius" "9" -data "AreaRadius" "4" +data "TargetRadius" "12" +data "AreaRadius" "6" data "Icon" "Spell_Abjuration_GlyphOfWarding_ExplosiveRunes" data "DisplayName" "h9afdc5f4gc191gefafg3a70gf5f22d3380ed;1" data "Description" "hb891b435g5fbfgdd7fg31fag3fe482edadd7;1" @@ -17318,7 +17341,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" data "ContainerSpells" "Target_AnimateDead_Skeleton;Target_AnimateDead_Zombie" -data "TargetRadius" "3" +data "TargetRadius" "4" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "TargetConditions" "ConcentrateSpell(context.Source);" data "Icon" "Spell_Necromancy_AnimateDead" @@ -17375,7 +17398,7 @@ data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:Summon(4c29f8ec-1806-40f4-925a-5ed58bfc1848,10,,,,FLAME_VORTEX_AURA);GROUND:ApplyStatus(SELF, FLAME_VORTEX_SUSTAIN, 100, 10);GROUND:ApplyStatus(SELF, FLAME_VORTEX_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLAME_VORTEX_DAMAGE,100,1);" -data "TargetRadius" "36" +data "TargetRadius" "48" data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" @@ -17383,7 +17406,7 @@ data "AoEConditions" "Character();" data "Icon" "Spell_Evocation_FlameStrike" data "DisplayName" "hb70949feg2d59g7310g8d22gdf4fa12633bd;1" data "Description" "h0f8c94b2geea3g9e8eg4be2g24f3628c806d;3" -data "DescriptionParams" "DealDamage(3d6,Fire);DealDamage(3d4,Bludgeoning);Distance(7)" +data "DescriptionParams" "DealDamage(3d6,Fire);DealDamage(3d4,Bludgeoning);Distance(8)" data "TooltipDamageList" "DealDamage(3d6,Fire);DealDamage(3d4,Bludgeoning)" data "TooltipAttackSave" "Dexterity" data "TooltipOnSave" "f762efbb-f8f1-493e-b248-2de1567b4bd2" @@ -17407,14 +17430,14 @@ using "Target_FlameVortex" data "Level" "2" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(d0790c39-0dbc-4c92-b0c7-5719db4dad0d,10,,,,FLOATING_FLAME_AURA);GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAIN, 100, 10);GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_DAMAGE,100,1);" -data "TargetRadius" "9" -data "AreaRadius" "1" +data "TargetRadius" "12" +data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_FlamingSphere" data "DisplayName" "hdb8d566dg6f2ag25eagcebcg4ed735438dea;2" data "Description" "h1ce1a84fgc101g9c82gb00ag975e0ec3dc33;2" -data "DescriptionParams" "DealDamage(3d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(3d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(3d6,Fire)" data "TooltipAttackSave" "Dexterity" data "TooltipOnSave" "f762efbb-f8f1-493e-b248-2de1567b4bd2" @@ -17432,7 +17455,6 @@ data "SpellFlags" "IsSpell;HasVerbalComponent;HasSomaticComponent;HasHighGroundR data "MemoryCost" "1" data "PrepareEffect" "7b0dc211-4ba6-42fe-ab83-e0c9694193e4" data "CastEffect" "42737352-fb2a-4afa-b0ff-9ea82aa11695" -data "PositionEffect" "300a9a5a-26af-48b7-9a6d-3b9d0c27352f" data "DamageType" "Fire" new entry "Target_FlamingSphere_3" @@ -17440,7 +17462,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere" data "SpellProperties" "GROUND:Summon(d0790c39-0dbc-4c92-b0c7-5719db4dad0d,10,,,,FLOATING_FLAME_3_AURA);GROUND:ApplyStatus(SELF, FLOATING_FLAME_3_SUSTAIN, 100, 10);GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_3_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(4d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(4d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(4d6,Fire)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "RootSpellID" "Target_FlamingSphere" @@ -17451,7 +17473,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere" data "SpellProperties" "GROUND:Summon(d0790c39-0dbc-4c92-b0c7-5719db4dad0d,10,,,,FLOATING_FLAME_4_AURA);GROUND:ApplyStatus(SELF, FLOATING_FLAME_4_SUSTAIN, 100, 10);GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_4_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(5d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(5d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(5d6,Fire)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4" data "RootSpellID" "Target_FlamingSphere" @@ -17462,7 +17484,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere" data "SpellProperties" "GROUND:Summon(d0790c39-0dbc-4c92-b0c7-5719db4dad0d,10,,,,FLOATING_FLAME_5_AURA);GROUND:ApplyStatus(SELF, FLOATING_FLAME_5_SUSTAIN, 100, 10);GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_5_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(6d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(6d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(6d6,Fire)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" data "RootSpellID" "Target_FlamingSphere" @@ -17473,7 +17495,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere" data "SpellProperties" "GROUND:Summon(d0790c39-0dbc-4c92-b0c7-5719db4dad0d,10,,,,FLOATING_FLAME_6_AURA);GROUND:ApplyStatus(SELF, FLOATING_FLAME_6_SUSTAIN, 100, 10);GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_6_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(7d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(7d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(7d6,Fire)" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" data "RootSpellID" "Target_FlamingSphere" @@ -17502,11 +17524,11 @@ data "SpellType" "Target" using "Target_FlameVortex_Sustain" data "Level" "2" data "SpellProperties" "GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_DAMAGE,100,1);" -data "AreaRadius" "1" +data "AreaRadius" "2" data "Icon" "Spell_Conjuration_FlamingSphere" data "DisplayName" "hf73880a9g1d9cg79e9g3109g3045eead566e;1" data "Description" "h24383c6eg67a3g69a2g5726g92acce882b8d;1" -data "DescriptionParams" "DealDamage(3d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(3d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(3d6,Fire)" data "PrepareSound" "" data "PrepareLoopSound" "" @@ -17520,7 +17542,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere_Sustain" data "SpellProperties" "GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_3_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(4d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(4d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(4d6,Fire)" new entry "Target_FlamingSphere_4_Sustain" @@ -17528,7 +17550,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere_3_Sustain" data "SpellProperties" "GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_4_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(5d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(5d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(5d6,Fire)" new entry "Target_FlamingSphere_5_Sustain" @@ -17536,7 +17558,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere_3_Sustain" data "SpellProperties" "GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_5_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(6d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(6d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(6d6,Fire)" new entry "Target_FlamingSphere_6_Sustain" @@ -17544,7 +17566,7 @@ type "SpellData" data "SpellType" "Target" using "Target_FlamingSphere_3_Sustain" data "SpellProperties" "GROUND:ApplyStatus(SELF, FLOATING_FLAME_SUSTAINED, 100, 1);AI_ONLY:AOE:ApplyStatus(FLOATING_FLAME_6_DAMAGE,100,1);" -data "DescriptionParams" "DealDamage(7d6, Fire);Distance(3.5)" +data "DescriptionParams" "DealDamage(7d6, Fire);Distance(4)" data "TooltipDamageList" "DealDamage(7d6,Fire)" new entry "Target_CureWounds" @@ -17553,7 +17575,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" data "ContainerSpells" "Target_HealOneAction_Rank_1;Target_HealTwoAction_Rank_1;Shout_HealThreeAction_Rank_1" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Icon" "Spell_Evocation_CureWounds" data "DisplayName" "h28186622g01e6ge805gab87g209cffe54650;1" data "Description" "h404ee8f4g9b23g71fdg6c43g269d6480164a;1" @@ -17606,7 +17628,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Transmutation" data "ContainerSpells" "Target_EnhanceAbility_BearsEndurance;Target_EnhanceAbility_BullsStrength;Target_EnhanceAbility_CatsGrace;Target_EnhanceAbility_EaglesSplendor;Target_EnhanceAbility_FoxsCunning;Target_EnhanceAbility_OwlsWisdom" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "(Character() and Ally()) or Self() and ConcentrateSpell();" data "Icon" "Spell_Transmutation_EnhanceAbility" @@ -17838,7 +17860,7 @@ new entry "Target_EnhanceAbility_CatsGrace_3_AI" type "SpellData" data "SpellType" "Target" using "Target_EnhanceAbility_CatsGrace_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -17848,7 +17870,7 @@ new entry "Target_EnhanceAbility_BullsStrength_3_AI" type "SpellData" data "SpellType" "Target" using "Target_EnhanceAbility_BullsStrength_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -17858,7 +17880,7 @@ new entry "Target_EnhanceAbility_BearsEndurance_3_AI" type "SpellData" data "SpellType" "Target" using "Target_EnhanceAbility_BearsEndurance_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -17868,7 +17890,7 @@ new entry "Target_EnhanceAbility_EaglesSplendor_3_AI" type "SpellData" data "SpellType" "Target" using "Target_EnhanceAbility_EaglesSplendor_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -17878,7 +17900,7 @@ new entry "Target_EnhanceAbility_FoxsCunning_3_AI" type "SpellData" data "SpellType" "Target" using "Target_EnhanceAbility_FoxsCunning_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -17888,7 +17910,7 @@ new entry "Target_EnhanceAbility_OwlsWisdom_3_AI" type "SpellData" data "SpellType" "Target" using "Target_EnhanceAbility_OwlsWisdom_3" -data "AreaRadius" "3" +data "AreaRadius" "4" data "AmountOfTargets" "" data "MaximumTargets" "2" data "RootSpellID" "" @@ -17900,7 +17922,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Necromancy" data "SpellProperties" "ApplyStatus(FEIGN_DEATH,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and Ally()" data "Icon" "Spell_Necromancy_FeignDeath" data "DisplayName" "h82e05e00gf1ccgaef9ge16dgdd6189722589;1" @@ -17955,7 +17977,7 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(FLY,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and Ally() and not Dead() and not Tagged('INNATE_FLYER') and ConcentrateSpell();" data "Icon" "Spell_Transmutation_Fly" @@ -18036,7 +18058,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(1d8+8,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(1d10+8,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,1,Guaranteed);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(1d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(1d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((1d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((1d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((1d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((1d10)/2,Necrotic,Magical);" @@ -18072,7 +18094,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(2d8+16,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(2d10+16,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,2,Guaranteed);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(2d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(2d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((2d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((2d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((2d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((2d10)/2,Necrotic,Magical);" @@ -18110,7 +18132,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Necromancy" data "SpellProperties" "IF(HarmVoid(8)):RegainHitPoints(3d8+24,Guaranteed);IF(HarmVoid(10)):RegainHitPoints(3d10+24,Guaranteed);IF(SapLife()):RegainHitPoints(SELF,3,Guaranteed);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "HarmSavingThrow()" data "SpellSuccess" "IF(HarmLive(8) and not SaveCrit()):DealDamage(3d8,Necrotic,Magical);IF(HarmLive(10) and not SaveCrit()):DealDamage(3d10,Necrotic,Magical);IF(HarmLive(8) and SaveCrit()):DealDamage((3d8)*2,Necrotic,Magical);IF(HarmLive(10) and SaveCrit()):DealDamage((3d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(HarmLive(8) and not SaveCritMiss('Fort')):DealDamage((3d8)/2,Necrotic,Magical);IF(HarmLive(10) and not SaveCritMiss('Fort')):DealDamage((3d10)/2,Necrotic,Magical);" @@ -18148,7 +18170,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(Jump_Rank3Unlock_Status,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Icon" "Spell_Transmutation_LongJump" data "DisplayName" "haa051dbfgbc64g47c0g560fg4a934d8909a5;1" data "Description" "h25063cf5ge696g1356gf389gf8aa08995a3a;1" @@ -18178,7 +18200,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(Jump_Rank3Unlock_Status,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Icon" "Spell_Transmutation_LongJump" data "DisplayName" "hfddcff36gbbbfg2f30g86c8gb594f080b1a6;1" data "Description" "h4deca0b7g3723gfd89ga240gfea86d493679;1" @@ -18208,7 +18230,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(Jump_Rank3Unlock_Status,100,10)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Icon" "Spell_Transmutation_LongJump" data "DisplayName" "hec8de429g6a17g3c38gf837g55aa0b27d6da;1" data "Description" "h4216c8c8g54dfgb53bgda6cg4e29e66bab80;1" @@ -18237,7 +18259,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" data "SpellProperties" "TARGET:RegainHitPoints(LevelMapValue(LayOnHandsHealing));IF(not Self()):ApplyStatus(DEVOTION_AC_BONUS,100,1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT')" data "Icon" "Action_Paladin_LayOnHands_SmallHeal" data "DisplayName" "h67752676g00fcgc1b6g752dg832abd875a4b;1" @@ -18263,7 +18285,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" data "SpellProperties" "TARGET:RegainHitPoints(LevelMapValue(LayOnHandsHealing));IF(not Self()):ApplyStatus(DEVOTION_AC_BONUS,100,1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT')" data "Icon" "Action_Paladin_LayOnHands_SmallHeal" data "DisplayName" "h6d6b74f7ge16dga9cbg057fgbc64ae59c9ef;1" @@ -18289,7 +18311,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" data "SpellProperties" "TARGET:RegainHitPoints(LevelMapValue(LayOnHandsHealing));IF(not Self()):ApplyStatus(DEVOTION_AC_BONUS,100,1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT')" data "Icon" "Action_Paladin_LayOnHands_SmallHeal" data "DisplayName" "h67b1a8e2g8569g3b2fg4df4g151bdd54fd72;1" @@ -18315,7 +18337,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Necromancy" data "SpellProperties" "TARGET:RegainHitPoints(LevelMapValue(LayOnHandsHealing));IF(not Self()):ApplyStatus(DEVOTION_AC_BONUS,100,1)" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "Character() and not Dead() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT')" data "Icon" "Action_Paladin_LayOnHands_SmallHeal" data "DisplayName" "h2d190a1cg1465g386dg2578g57801c1ff414;1" @@ -18341,7 +18363,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,3);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18376,7 +18398,7 @@ type "SpellData" data "SpellType" "Target" using "Target_DissonantWhispers" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,3);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fear')):ApplyStatus(FRIGHTENED,100,1);" @@ -18407,7 +18429,7 @@ type "SpellData" data "SpellType" "Target" using "Target_DissonantWhispers" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,3);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fear')):ApplyStatus(FRIGHTENED,100,1);" @@ -18448,7 +18470,7 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Enchantment" data "SpellProperties" "ApplyStatus(FRIENDS,100,10)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and not Self() and EmotionSpell() and MentalSpell() and ConcentrateSpell();" data "Icon" "Spell_Enchantment_Friends" @@ -18496,8 +18518,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,AcidStormAcidStormAura);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "TargetConditions" "ConcentrateSpell(context.Source);" data "Icon" "Spell_Conjuration_StinkingCloud" @@ -18524,7 +18546,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Abjuration" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(BANISHED,100,10);ApplyStatus(SELF,BANISHMENT_OWNER,100,10);" @@ -18549,7 +18571,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Abjuration" data "SpellContainerID" "Target_Banishment_Rank5_Container" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(BANISHED,100,10);ApplyStatus(SELF,BANISHMENT_OWNER,100,10);" @@ -18625,7 +18647,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(SELF,BlisterRecast_Rank5,100,10);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(BlisterStatus_Rank5,100,2);IF(SaveCrit()):ApplyStatus(BlisterStatus_Rank5,100,4);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18657,7 +18679,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Blister_Rank5" data "SpellProperties" "ApplyStatus(SELF,BlisterRecast_Rank6,100,10);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(BlisterStatus_Rank6,100,2);" data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(BlisterStatus_Rank6,100,1);" @@ -18673,8 +18695,8 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellProperties" "SetStatusDuration(BlisterStatus_Rank5,-1,Add);" -data "TargetRadius" "18" -data "AreaRadius" "5" +data "TargetRadius" "24" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(7d6,Acid,Magical);IF(SaveCrit()):DealDamage((7d6)*2,Acid,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18703,7 +18725,7 @@ type "SpellData" data "SpellType" "Target" using "Target_BlisterRecast_Rank5" data "SpellProperties" "SetStatusDuration(BlisterStatus_Rank6,-1,Add);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Acid,Magical);IF(SaveCrit()):DealDamage((8d6)*2,Acid,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((8d6)/2,Acid,Magical);" data "TargetConditions" "Character() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and HasStatus('BlisterStatus_Rank6') and ConcentrateSpell();" @@ -18714,9 +18736,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Transmutation" -data "SpellProperties" "GROUND:CreateSurface(3,10,Overgrowth);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,,CorrosiveMuckAura);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:CreateSurface(4,10,Overgrowth);GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,,CorrosiveMuckAura);" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "AmountOfTargets" "2" @@ -18746,8 +18768,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Ignite);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Fire,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Fire,Magical);IF(not SaveCrit()):ApplyStatus(BlisteringInvectiveBurning_Rank2,100,-1);IF(SaveCrit()):ApplyStatus(BlisteringInvectiveBurning_Rank2_Double,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18804,8 +18826,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 1,,,,GEYSER_AURA);" -data "TargetRadius" "100" -data "AreaRadius" "3" +data "TargetRadius" "200" +data "AreaRadius" "4" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d6,Bludgeoning,Magical);IF(not SaveCrit()):DealDamage(4d6,Fire,Magical);IF(not SaveCrit()):DealDamage(10,Force,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((4d6)*2,Fire,Magical);IF(SaveCrit()):DealDamage(20,Force,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((3d6)/2,Bludgeoning,Magical);IF(not SaveCritMiss('Reflex')):DealDamage((4d6)/2,Fire,Magical);" @@ -18842,7 +18864,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Transmutation" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(10d6,Piercing,Magical);IF(not SaveCrit()):DealDamage((10d6)*2,Piercing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18881,7 +18903,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Zone_HowlingBlizzard_Container" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);RemoveStatus(BURNING)" data "TargetRadius" "100" -data "AreaRadius" "9" +data "AreaRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(10d6,Cold,Magical);IF(SaveCrit()):DealDamage((10d6)*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18916,7 +18938,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Transmutation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Piercing,Magical);IF(SaveCrit()):DealDamage((8d6)*2,Piercing,Magical);ApplyStatus(ENSNARED,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18953,8 +18975,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Necromancy" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,1,,,,,);ApplyStatus(SELF,InvokeRecast,100,10);" -data "TargetRadius" "120" -data "AreaRadius" "3" +data "TargetRadius" "48" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d4,Psychic,Magical);IF(not SaveCrit()):DealDamage(2d4,Necrotic,Magical);IF(SaveCrit()):DealDamage((2d4)*2,Psychic,Magical);IF(SaveCrit()):DealDamage((2d4)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -18985,7 +19007,7 @@ data "SpellType" "Target" using "Target_InvokeSpirits_Rank5" data "Cooldown" "OncePerTurn" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b,1,,,,,);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "UseCosts" "ActionPoint:1" new entry "Target_LightningStorm_Rank5" @@ -19019,8 +19041,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Transmutation" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,10,,,,QUICKEN_TIME);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Abjuration_MagicCircle" @@ -19048,7 +19070,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Necromancy" data "ContainerSpells" "Target_RipTheSpirit_Rank5_1Action;Target_RipTheSpirit_Rank5_2Action;Shout_RipTheSpirit_Rank5_3Actions" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "DealDamage(5d6,Necrotic,Magical);" @@ -19076,7 +19098,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_RipTheSpirit_Container" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(5d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((5d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19104,7 +19126,7 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Necromancy" data "SpellContainerID" "Target_RipTheSpirit_Container" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(10d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((10d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19154,8 +19176,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "ContainerSpells" "Target_ShadowBlast_Acid_Burst_Rank5;Target_ShadowBlast_Bludgeoning_Burst_Rank5;Target_ShadowBlast_Cold_Burst_Rank5;Target_ShadowBlast_Electricity_Burst_Rank5;Target_ShadowBlast_Fire_Burst_Rank5;Target_ShadowBlast_Force_Burst_Rank5;Target_ShadowBlast_Piercing_Burst_Rank5;Target_ShadowBlast_Slashing_Burst_Rank5;Target_ShadowBlast_Sonic_Burst_Rank5;Target_ShadowBlast_Spirit_Burst_Rank5;Zone_ShadowBlast_Acid_Rank5_Cone;Zone_ShadowBlast_Bludgeoning_Rank5_Cone;Zone_ShadowBlast_Cold_Rank5_Cone;Zone_ShadowBlast_Electricity_Rank5_Cone;Zone_ShadowBlast_Fire_Rank5_Cone;Zone_ShadowBlast_Force_Rank5_Cone;Zone_ShadowBlast_Piercing_Rank5_Cone;Zone_ShadowBlast_Slashing_Rank5_Cone;Zone_ShadowBlast_Sonic_Rank5_Cone;Zone_ShadowBlast_Spirit_Rank5_Cone;Zone_ShadowBlast_Acid_Rank5_Line;Zone_ShadowBlast_Bludgeoning_Rank5_Line;Zone_ShadowBlast_Cold_Rank5_Line;Zone_ShadowBlast_Electricity_Rank5_Line;Zone_ShadowBlast_Fire_Rank5_Line;Zone_ShadowBlast_Force_Rank5_Line;Zone_ShadowBlast_Piercing_Rank5_Line;Zone_ShadowBlast_Slashing_Rank5_Line;Zone_ShadowBlast_Sonic_Rank5_Line;Zone_ShadowBlast_Spirit_Rank5_Line" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "DealDamage(6d8,Force,Magical);" @@ -19178,8 +19200,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Acid,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Acid,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19203,8 +19225,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Bludgeoning,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19228,8 +19250,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Cold,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19253,8 +19275,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Lightning,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Lightning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19278,8 +19300,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Fire,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Fire,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19303,8 +19325,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Force,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Force,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19328,8 +19350,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Piercing,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Piercing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19353,8 +19375,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Slashing,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Slashing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19378,8 +19400,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Thunder,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Thunder,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19403,8 +19425,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Illusion" data "SpellContainerID" "Target_ShadowBlast_Container" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d8,Radiant,Magical);IF(SaveCrit()):DealDamage((6d8)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19528,8 +19550,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,10,,,,SlitherAura);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d6,Piercing,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Piercing,Magical);ApplyStatus(PersistentPoisonDamage_1d6,100,-1);ApplyStatus(ENSNARED,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19552,7 +19574,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(CLUMSY2,100,10);ApplyStatus(DAZZLED_APPLY,100,10);ApplyStatus(TANGLE_VINE,100,10);ApplyStatus(SYNESTHESIA,100,10);IF(SaveCrit()):ApplyStatus(STUNNED2,100,1);" @@ -19576,8 +19598,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,10,,,,ToxicCloudAura_Rank5);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Action_WildMagic_GasCloud" @@ -19616,8 +19638,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Conjuration" -data "TargetRadius" "36" -data "AreaRadius" "9" +data "TargetRadius" "48" +data "AreaRadius" "12" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d10,Piercing,Magical);IF(SaveCrit()):DealDamage((8d10)*2,Piercing,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19642,8 +19664,8 @@ data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(045576d9-1095-4b16-bd6e-5dc31316df65,10,,,,FieldOfLifeAura);" -data "TargetRadius" "9" -data "AreaRadius" "6" +data "TargetRadius" "12" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Abjuration_MagicCircle" @@ -19660,9 +19682,9 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:CreateSurface(6,10,SpikeGrowth,true);" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "SpellProperties" "GROUND:CreateSurface(8,10,SpikeGrowth,true);" +data "TargetRadius" "24" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Transmutation_SpikeGrowth" @@ -19688,7 +19710,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Abjuration" data "SpellProperties" "GROUND:Summon(a4180db9-9541-4f84-ac7a-23cb8e3b3f31,1,,,,SpellProtectionAura);IF(not Enemy()):ApplyStatus(StatusBonus1Saves,100,1);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "TargetConditions" "not Enemy();" data "Icon" "Spell_Abjuration_GlyphOfWarding_ExplosiveRunes_Acid" @@ -19726,8 +19748,8 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" data "ContainerSpells" "Target_Earthworks_1Action;Target_Earthworks_2Action;Target_Earthworks_3Action;" -data "SpellProperties" "GROUND:CreateSurface(6,10,Mud);" -data "TargetRadius" "18" +data "SpellProperties" "GROUND:CreateSurface(8,10,Mud);" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_ConjureMinorElementals_MudMephit" @@ -19751,9 +19773,9 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" data "SpellContainerID" "Target_Earthworks_Container" -data "SpellProperties" "GROUND:CreateSurface(1.5,10,Mud);" -data "TargetRadius" "18" -data "AreaRadius" "1" +data "SpellProperties" "GROUND:CreateSurface(2,10,Mud);" +data "TargetRadius" "24" +data "AreaRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_ConjureMinorElementals_MudMephit" @@ -19775,8 +19797,8 @@ new entry "Target_Earthworks_2Action" type "SpellData" data "SpellType" "Target" using "Target_Earthworks_1Action" -data "SpellProperties" "GROUND:CreateSurface(3,10,Mud);" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:CreateSurface(4,10,Mud);" +data "AreaRadius" "4" data "DisplayName" "ha297745ag50c4g5bbbg7e6ega698bc6e906c;1" data "UseCosts" "ActionPoint:2;KiPoint:1" @@ -19784,8 +19806,8 @@ new entry "Target_Earthworks_3Action" type "SpellData" data "SpellType" "Target" using "Target_Earthworks_1Action" -data "SpellProperties" "GROUND:CreateSurface(4.5,10,Mud);" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:CreateSurface(6,10,Mud);" +data "AreaRadius" "6" data "DisplayName" "h5a2aa38fgbb76g6b91g1853g7326feeb96ea;1" data "UseCosts" "ActionPoint:3;KiPoint:1" @@ -19794,7 +19816,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC(),AdvantageOnCharmPerson());" data "SpellSuccess" "ApplyStatus(CHARMED,100,1);" @@ -19824,7 +19846,7 @@ data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Conjuration" data "SpellProperties" "ApplyStatus(StatusBonus1Attack,100,10);ApplyStatus(StatusBonus1Saves,100,10);ApplyStatus(StatusBonus1Skills,100,10);ApplyStatus(StatusBonus1AC,100,10);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "IsSummon() and ConcentrateSpell();" data "Icon" "Spell_Abjuration_Banishment" @@ -19851,7 +19873,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Transmutation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(SICKENED,100,-1);IF(SaveCrit()):ApplyStatus(SICKENED2,100,-1);IF(SaveCrit()):ApplyStatus(STUNNED1,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19881,7 +19903,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Necromancy" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(12d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((12d6)*2,Necrotic,Magical);ApplyStatus(CLUMSY,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19915,7 +19937,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(STUPEFIED_4,100,-1);" @@ -19948,7 +19970,7 @@ data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Enchantment" data "TargetRadius" "100" -data "AreaRadius" "9" +data "AreaRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(11d6,Psychic,Magical);IF(not SaveCrit()):ApplyStatus(STUNNED1,100,1);IF(SaveCrit()):DealDamage((11d6)*2,Psychic,Magical);IF(SaveCrit()):ApplyStatus(STUNNED2,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -19982,7 +20004,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Evocation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(16d6,Radiant,Magical);IF(SaveCrit()):DealDamage((16d6)*2,Radiant,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -20020,7 +20042,7 @@ new entry "Target_EternalTorch" type "SpellData" data "SpellType" "Target" using "Target_Light" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "CanCastImpulse('Fire',true) and RageConcentrateSpell();" data "SpellSuccess" "AI_IGNORE:IF(Item()):ApplyStatus(PRODUCE_FLAME,100,20);IF(not Item()):ApplyEquipmentStatus(MainHand,PRODUCE_FLAME,100,-1);AI_ONLY:CAST:ApplyStatus(SELF, AI_STATUS_FAKE,100,10);" data "TargetConditions" "Item() or HasWeaponInMainHand() and RageConcentrateSpell();" @@ -20036,7 +20058,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellProperties" "IF(not CharacterLevelGreaterThan(2)):ApplyStatus(FreshProduceStatus_1,100,1);IF(CharacterLevelGreaterThan(2) and not CharacterLevelGreaterThan(4)):ApplyStatus(FreshProduceStatus_2,100,1);IF(CharacterLevelGreaterThan(4) and not CharacterLevelGreaterThan(6)):ApplyStatus(FreshProduceStatus_3,100,1);IF(CharacterLevelGreaterThan(6) and not CharacterLevelGreaterThan(8)):ApplyStatus(FreshProduceStatus_4,100,1);IF(CharacterLevelGreaterThan(8) and not CharacterLevelGreaterThan(10)):ApplyStatus(FreshProduceStatus_5,100,1);IF(CharacterLevelGreaterThan(10) and not CharacterLevelGreaterThan(12)):ApplyStatus(FreshProduceStatus_6,100,1);" -data "TargetRadius" "3" +data "TargetRadius" "4" data "RequirementConditions" "CanCastImpulse('Wood',true) and RageConcentrateSpell();" data "TargetConditions" "Character() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and not HasStatus('FreshProduceImmune') and RageConcentrateSpell();" data "Icon" "Spell_Transmutation_Goodberry" @@ -20061,8 +20083,8 @@ new entry "Target_OceansBalm" type "SpellData" data "SpellType" "Target" data "SpellSchool" "Evocation" -data "SpellProperties" "RegainHitPoints(LevelMapValue(D8Cantrip));ApplyStatus(OceansBalmImmune,100,100);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" -data "TargetRadius" "1.5" +data "SpellProperties" "RegainHitPoints(LevelMapValue(D8Cantrip));ApplyStatus(OceansBalmImmune,100,100);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Water',true) and RageConcentrateSpell();" data "TargetConditions" "Character() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and not HasStatus('OceansBalmImmune') and RageConcentrateSpell();" data "Icon" "Spell_Evocation_CureWounds" @@ -20089,7 +20111,7 @@ new entry "Target_ScorchingColumn" type "SpellData" data "SpellType" "Target" using "Target_FlameStrike" -data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);GROUND:CreateSurface(3,10,Fire);GROUND:IF(CharacterLevelGreaterThan(6)):Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank2);" +data "SpellProperties" "GROUND:SurfaceChange(Ignite);GROUND:SurfaceChange(Melt);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);GROUND:CreateSurface(4,10,Fire);GROUND:IF(CharacterLevelGreaterThan(6)):Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,,AshCloudAura_Rank2);" data "RequirementConditions" "CanCastImpulse('Fire') and RageConcentrateSpell();" data "SpellSuccess" "IF(not HasPassive('FireJunction',context.Source) and not SaveCrit()):DealDamage(LevelMapValue(ScorchingColumnDamage),Fire,Magical);IF(not HasPassive('FireJunction',context.Source) and SaveCrit()):DealDamage((LevelMapValue(ScorchingColumnDamage))*2,Fire,Magical);IF(HasPassive('FireJunction',context.Source) and not SaveCrit()):DealDamage(LevelMapValue(ScorchingColumnDamageJunction),Fire,Magical);IF(HasPassive('FireJunction',context.Source) and SaveCrit()):DealDamage((LevelMapValue(ScorchingColumnDamageJunction))*2,Fire,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not HasPassive('FireJunction',context.Source) and not SaveCritMiss('Reflex')):DealDamage(LevelMapValue(ScorchingColumnDamage)/2,Fire,Magical);IF(HasPassive('FireJunction',context.Source) and not SaveCritMiss('Reflex')):DealDamage(LevelMapValue(ScorchingColumnDamageJunction)/2,Fire,Magical);" @@ -20124,9 +20146,9 @@ new entry "Target_Tremor" type "SpellData" data "SpellType" "Target" data "SpellSchool" "Evocation" -data "SpellProperties" "GROUND:CreateSurface(3,1,Mud);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" -data "TargetRadius" "9" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:CreateSurface(4,1,Mud);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" +data "TargetRadius" "12" +data "AreaRadius" "4" data "RequirementConditions" "CanCastImpulse('Earth') and RageConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D8Cantrip),Bludgeoning,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D8Cantrip))*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -20155,9 +20177,9 @@ new entry "Target_WintersClutch" type "SpellData" data "SpellType" "Target" data "SpellSchool" "Evocation" -data "SpellProperties" "GROUND:CreateSurface(3,10,Ice);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:CreateSurface(4,10,Ice);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "CanCastImpulse('Water') and RageConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(D4AoeCantrip),Cold,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(D4AoeCantrip))*2,Cold,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -20187,7 +20209,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellProperties" "ApplyStatus(STRIDE,100,1);IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(SELF,DISENGAGE_USESTEP,100,1);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "CanCastImpulse('Air',true) and RageConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and RageConcentrateSpell();" data "AmountOfTargets" "4" @@ -20216,7 +20238,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellProperties" "IF(not CharacterLevelGreaterThan(2)):ApplyStatus(EndureTempHP_Rank1, 100, 1);IF(not CharacterLevelGreaterThan(4) and CharacterLevelGreaterThan(2)):ApplyStatus(EndureTempHP_Rank2, 100, 1);IF(not CharacterLevelGreaterThan(6) and CharacterLevelGreaterThan(4)):ApplyStatus(EndureTempHP_Rank3, 100, 1);IF(not CharacterLevelGreaterThan(8) and CharacterLevelGreaterThan(6)):ApplyStatus(EndureTempHP_Rank4, 100, 1);IF(not CharacterLevelGreaterThan(10) and CharacterLevelGreaterThan(8)):ApplyStatus(EndureTempHP_Rank5, 100, 1);IF(CharacterLevelGreaterThan(10)):ApplyStatus(EndureTempHP_Rank6, 100, 1);GROUND:Summon(0e3d6ba8-f343-4503-9103-80c7e13bdbc2,10);GROUND:IF(HasStatus('WOOD_JUNCTION',context.Source)):ApplyStatus(SELF,WoodTempJunction);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "2" data "RequirementConditions" "CanCastImpulse('Wood',true) and RageConcentrateSpell();" data "TargetConditions" "not Enemy() and RageConcentrateSpell();" @@ -20263,7 +20285,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Air_Electric" data "SpellProperties" "GROUND:SurfaceChange(Electrify);GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);" data "RequirementConditions" "CanCastImpulse('Air',false,false) and RageConcentrateSpell();" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Lightning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Lightning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "Icon" "Spell_Transmutation_ElementalWeapon_Lightning" data "DisplayName" "hb49dba18gbe43g69d5gb61ag8c702b5250f6;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Lightning);" @@ -20275,10 +20297,10 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Air_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Air',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" -data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TargetConditions" "not Self() and not Dead() and RageConcentrateSpell();" data "Icon" "Spell_Evocation_SpiritualWeapon_Greatsword" data "DisplayName" "h74a41376gaffdgcc64g5e91g8ddd99ab5a6b;1" @@ -20304,7 +20326,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Air_Slashing" data "SpellProperties" "GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);" data "RequirementConditions" "CanCastImpulse('Air',false,false) and RageConcentrateSpell();" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Slashing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Slashing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "Icon" "Spell_Evocation_SpiritualWeapon_Greatsword" data "DisplayName" "h09bbb623ge9bag6a37gf7ffg02a10833c921;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Slashing);" @@ -20333,10 +20355,10 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Air_Container" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Air',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "TargetConditions" "not Self() and not Dead() and RageConcentrateSpell();" data "Icon" "Spell_Transmutation_ElementalWeapon_Cold" data "DisplayName" "h0f461490g25a6g9eebgef99g666a5c5a92ab;1" @@ -20367,7 +20389,7 @@ data "SpellType" "Target" using "Target_ElementalBlast_Air_Cold" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);GROUND:IF(HasStatus('AIR_JUNCTION',context.Source)):ApplyStatus(DISENGAGE_USESTEP,100,1);" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Air',false,false) and RageConcentrateSpell();" -data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Air',context.Source)):Force(4, OriginToEntity, Neutral, false, true);" data "Icon" "Spell_Transmutation_ElementalWeapon_Cold" data "DisplayName" "hb5c1ee55g0514g966egc74cg628cb00d2068;1" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Blast)+ConstitutionModifier+StrengthModifier,Cold);" @@ -20391,7 +20413,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Earth_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Earth',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Piercing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Piercing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Earth',context.Source)):ApplyStatus(PRONE_PF2,100,-1);" @@ -20443,7 +20465,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Earth_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Earth',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Poison,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Poison,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Earth',context.Source)):ApplyStatus(PRONE_PF2,100,-1);" @@ -20507,7 +20529,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Fire_Container" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Fire',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D6Blast)+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Fire',context.Source)):ApplyStatus(PersistentFire_1d6,100,1);" @@ -20559,7 +20581,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Metal_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Metal',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Slashing,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Slashing,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Metal',context.Source)):ApplyStatus(PersistentAcid_1d6,100,1);" @@ -20617,7 +20639,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Metal_Container" data "SpellProperties" "GROUND:SurfaceChange(Electrify);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Metal',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Lightning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Lightning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Metal',context.Source)):ApplyStatus(PersistentAcid_1d6,100,1);" @@ -20696,7 +20718,7 @@ new entry "Target_ElementalBlast_Water_Bludgeoning_2Action" type "SpellData" data "SpellType" "Target" using "Target_ElementalBlast_Water_Bludgeoning" -data "SpellProperties" "GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellProperties" "GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" data "RequirementConditions" "CanCastImpulse('Water',false,false) and RageConcentrateSpell();" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+StrengthModifier,Bludgeoning,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Bludgeoning,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Bludgeoning,Magical);" data "Icon" "Action_Monk_WaterWhip" @@ -20710,7 +20732,7 @@ data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Water_Container" data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Water',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Cold,Magical);" @@ -20743,7 +20765,7 @@ new entry "Target_ElementalBlast_Water_Cold_2Action" type "SpellData" data "SpellType" "Target" using "Target_ElementalBlast_Water_Cold" -data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellProperties" "GROUND:SurfaceChange(Freeze);GROUND:SurfaceChange(Douse);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" data "RequirementConditions" "CanCastImpulse('Water',false,false) and RageConcentrateSpell();" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+StrengthModifier,Cold,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Cold,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Cold,Magical);" data "Icon" "Spell_Transmutation_ElementalWeapon_Cold" @@ -20773,7 +20795,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Water_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Water',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Acid,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Acid,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Acid,Magical);" @@ -20806,7 +20828,7 @@ new entry "Target_ElementalBlast_Water_Acid_2Action" type "SpellData" data "SpellType" "Target" using "Target_ElementalBlast_Water_Acid" -data "SpellProperties" "IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellProperties" "IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Water',false,false) and RageConcentrateSpell();" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+StrengthModifier,Acid,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+ConstitutionModifier+ConstitutionModifier+StrengthModifier+StrengthModifier,Acid,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Water',context.Source)):DealDamage(LevelMapValue(WaterSplashJunction),Acid,Magical);" data "Icon" "Spell_Transmutation_ElementalWeapon_Acid" @@ -20831,7 +20853,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Wood_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "HasPassive('VersatileBlasts') and CanCastImpulse('Wood',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Radiant,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Radiant,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Wood',context.Source)):ApplyStatus(ENSNARED,100,1);" @@ -20884,7 +20906,7 @@ data "SpellType" "Target" data "SpellSchool" "Evocation" data "SpellContainerID" "Target_ElementalBlast_Wood_Container" data "TargetFloor" ".25" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "CanCastImpulse('Wood',false,true) and RageConcentrateSpell();" data "SpellRoll" "Attack2e(AttackType.MeleeSpellAttack);" data "SpellSuccess" "IF(not IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier,Poison,Magical);IF(IsCritical()):DealDamage(LevelMapValue(D8AoeCantrip)+StrengthModifier+StrengthModifier,Poison,Magical);IF(IsCritical() and HasPassive('CriticalBlast_Wood',context.Source)):ApplyStatus(ENSNARED,100,1);" @@ -20928,9 +20950,9 @@ new entry "Target_RainOfRust" type "SpellData" data "SpellType" "Target" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SleetStorm,RustAura);ApplyStatus(WET,100, 3);GROUND:CreateSurface(3,0, Water);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "SpellProperties" "GROUND:Summon(802b8b51-1bcf-469d-8663-2f1dc9698982, 10,,,SleetStorm,RustAura);ApplyStatus(WET,100, 3);GROUND:CreateSurface(4,0, Water);GROUND:IF(HasStatus('METAL_JUNCTION',context.Source)):ApplyStatus(SELF,MetalJunctionStatus);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "CanCastHybridImpulse('Metal','Water') and RageConcentrateSpell();" data "TargetConditions" "RageConcentrateSpell();" data "Icon" "Spell_Conjuration_SleetStorm" @@ -20958,7 +20980,7 @@ type "SpellData" data "SpellType" "Target" data "SpellSchool" "Transmutation" data "ContainerSpells" "Target_DashOfHerbs_Malady;Target_DashOfHerbs_Injury;" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "CanCastImpulse('Wood',true) and RageConcentrateSpell();" data "TargetConditions" "Character() or Self() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and RageConcentrateSpell();" data "Icon" "GenericIcon_Intent_Healing" @@ -20984,7 +21006,7 @@ data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellContainerID" "Target_DashOfHerbs_Container" data "SpellProperties" "RegainHitPoints(LevelMapValue(DashOfHerbsDice) + 4);RemoveStatus(SG_Poisoned);RemoveStatus(SG_Disease);RemoveStatus(SG_Paralyzed);RemoveStatus(SG_Blinded);RemoveStatus(ASTARION_WEAK);ApplyStatus(HerbsImmune,100,100);GROUND:IF(HasStatus('WOOD_JUNCTION',context.Source)):ApplyStatus(SELF,WoodTempJunction);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "CanCastImpulse('Wood',true) and RageConcentrateSpell();" data "TargetConditions" "Character() or Self() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and RageConcentrateSpell();" data "Icon" "GenericIcon_Intent_Healing" @@ -21009,7 +21031,7 @@ data "SpellType" "Target" data "SpellSchool" "Transmutation" data "SpellContainerID" "Target_DashOfHerbs_Container" data "SpellProperties" "RegainHitPoints(LevelMapValue(DashOfHerbsDiceInjury) + 4);ApplyStatus(HerbsImmune,100,100);GROUND:IF(HasStatus('WOOD_JUNCTION',context.Source)):ApplyStatus(SELF,WoodTempJunction);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "CanCastImpulse('Wood',true) and RageConcentrateSpell();" data "TargetConditions" "Character() or Self() and not Tagged('UNDEAD') and not Tagged('CONSTRUCT') and RageConcentrateSpell();" data "Icon" "GenericIcon_Intent_Healing" @@ -21032,9 +21054,9 @@ new entry "Target_DrivingRain" type "SpellData" data "SpellType" "Target" data "SpellSchool" "Conjuration" -data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 1,,,,DRIVING_RAIN_AURA);ApplyStatus(WET,100, 5);GROUND:CreateSurface(5,0, Water);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-3, OriginToEntity, Neutral, false, true);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 1,,,,DRIVING_RAIN_AURA);ApplyStatus(WET,100, 5);GROUND:CreateSurface(6,0, Water);GROUND:ApplyStatus(SELF,KineticistOverflow,100,0);IF(HasStatus('WATER_JUNCTION',context.Source)):Force(-4, OriginToEntity, Neutral, false, true);RemoveStatus(SELF,ChannelElementsStatusAir);RemoveStatus(SELF,ChannelElementsStatusEarth);RemoveStatus(SELF,ChannelElementsStatusFire);RemoveStatus(SELF,ChannelElementsStatusWater);RemoveStatus(SELF,ChannelElementsStatusMetal);RemoveStatus(SELF,ChannelElementsStatusWood);RemoveStatus(SELF,ChannelingStatus);RemoveStatus(SELF,ThermalNimbusAura_Fire);RemoveStatus(SELF,ThermalNimbusAura_Cold);RemoveStatus(SELF,RavelOfThorns_Aura);RemoveStatus(SELF,RavelOfThorns_DamageAura);" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "CanCastImpulse('Wood') and RageConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(LevelMapValue(DrivingRainDamage),Bludgeoning,Magical);IF(SaveCrit()):DealDamage((LevelMapValue(DrivingRainDamage))*2,Bludgeoning,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -21072,7 +21094,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Abjuration" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell(context.Source);" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(BANISHED,100,10);ApplyStatus(SELF,BANISHMENT_OWNER,100,10);" @@ -21164,8 +21186,8 @@ data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,10,,,,ToxicCloudAura_Rank5);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "ConcentrateSpell();" data "Icon" "Spell_Conjuration_Cloudkill" @@ -21196,7 +21218,7 @@ using "Target_Cloudkill" data "ConcentrationSpellID" "" data "Cooldown" "OncePerTurn" data "SpellProperties" "GROUND:ApplyStatus(SELF,CLOUDKILL_CASTER_RECAST,100,10);ApplyStatus(CLOUDKILL,100,1);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Description" "hbd95176cg144cg2350g37bdgcadfe4fe9892;1" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "UseCosts" "ActionPoint:1" @@ -21229,7 +21251,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(DOMINATE_PERSON,100,10);" @@ -21269,7 +21291,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(DOMINATE_PERSON,100,10);" @@ -21298,8 +21320,8 @@ data "TargetEffect" "fdf323a9-8912-4dcd-b55e-e268f7f45170" new entry "Target_InterdisciplinaryIncantation" type "SpellData" data "SpellType" "Target" -data "TargetRadius" "18" -data "AreaRadius" "9" +data "TargetRadius" "24" +data "AreaRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "TriggerRandomCast(20,,WildMagic);" @@ -21357,7 +21379,7 @@ data "SpellType" "Target" data "Level" "0" data "SpellSchool" "Divination" data "SpellProperties" "ApplyStatus(GUIDANCE, 100, 10);ApplyStatus(GuidanceImmune,100,100);" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "Character() and not Enemy() and not HasStatus('GuidanceImmune',context.Target) and ConcentrateSpell();" data "Icon" "Spell_Divination_Guidance" @@ -21415,7 +21437,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Multiattack" data "SpellProperties" "AI_IGNORE:ApplyStatus(SELF,CLOAKER_ARCHETYPE_HELPER,100,1)" -data "TargetRadius" "2.0" +data "TargetRadius" "2" data "SpellSuccess" "DealDamage(3d6+UnarmedMeleeAbilityModifier,Piercing);ApplyStatus(GAPING_WOUND,100,5);Cast2[DealDamage(3d8+UnarmedMeleeAbilityModifier,Slashing);ApplyStatus(BLEEDING,100,5)]" data "TargetConditions" "not Self() and not Dead() and HasStatus('FRIGHTENED',context.Target) " data "Description" "ha2789d2bgc72eg99b2g3827g77bbdb535e4c;1" @@ -21734,8 +21756,8 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Illusion" data "SpellProperties" "GROUND:Summon(edca6656-dc8c-410b-9f16-fcc02d5ed803, 100,Projectile_AiHelper_Silence,,,SILENCED_AURA)" -data "TargetRadius" "18" -data "AreaRadius" "6" +data "TargetRadius" "24" +data "AreaRadius" "8" data "Icon" "Spell_Illusion_Silence" data "DisplayName" "h1ca878efgb802g48efgbc5age4f3a7afd806;1" data "Description" "h84a0cdf0gd6acg34fbg94f2g18be7fc0c049;1" @@ -21899,7 +21921,7 @@ new entry "Target_OpenWounds_Redcap" type "SpellData" data "SpellType" "Target" using "Target_UnarmedAttack" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(2d6,Piercing);ApplyStatus(BLEEDING,100,2);IF(SaveCrit()):DealDamage((2d6)*2,Piercing);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Reflex')):DealDamage((2d6)/2,Piercing);" @@ -21927,7 +21949,7 @@ using "Target_MainHandAttack" data "Cooldown" "OncePerTurn" data "SpellProperties" "" data "TargetFloor" "" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "not HasStatus('SLOW',context.Source);" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC(), AdvantageOnParalyzed());" data "SpellSuccess" "ApplyStatus(PARALYZED_SPECTATOR,100,1);" @@ -22069,7 +22091,7 @@ new entry "Target_Blindness_5_AI" type "SpellData" data "SpellType" "Target" using "Target_Blindness_5" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" data "MaximumTargets" "1" @@ -22090,7 +22112,7 @@ new entry "Target_Blindness_6_AI" type "SpellData" data "SpellType" "Target" using "Target_Blindness_6" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" data "MaximumTargets" "1" @@ -22188,7 +22210,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(STUPEFIED_2,100,10);IF(SaveCrit()):ApplyStatus(STUPEFIED_3,100,10);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -22291,7 +22313,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(PARALYZED,100,1);IF(SaveCrit()):ApplyStatus(PARALYZED,100,2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -22300,7 +22322,7 @@ data "TargetConditions" "Character() and not Dead() and MentalSpell() and Concen data "Icon" "Spell_Enchantment_HoldMonster" data "DisplayName" "h119345ddg21c0ge070g62bag16272ab56298;1" data "Description" "h3feb426dg204bg2ac0g40e4g1e4404e641e2;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "TooltipAttackSave" "Wisdom" data "TooltipStatusApply" "ApplyStatus(PARALYZED,100,1);" data "TooltipPermanentWarnings" "22ced04e-39ec-4faf-b358-708cb8f53ce4" @@ -22345,7 +22367,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(PARALYZED,100,1);IF(SaveCrit()):ApplyStatus(PARALYZED,100,2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -22354,7 +22376,7 @@ data "TargetConditions" "Character() and not Dead() and MentalSpell() and Concen data "Icon" "Spell_Enchantment_HoldPerson" data "DisplayName" "hda8b28f5g3fbbgfd38gd9c3g67029dcfdc97;1" data "Description" "h47b334edg1b50g8b90g909eg7c3f5dfcdcf3;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "TooltipAttackSave" "Wisdom" data "TooltipStatusApply" "ApplyStatus(PARALYZED,100,1);" data "TooltipUpcastDescription" "6ff1780a-855a-414c-a8bf-811251537206" @@ -22458,7 +22480,7 @@ new entry "Target_HoldPerson_3" type "SpellData" data "SpellType" "Target" using "Target_HoldPerson" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "1" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "RootSpellID" "Target_HoldPerson" @@ -22506,7 +22528,7 @@ data "SpellType" "Target" using "Target_HoldPerson" data "Level" "" data "SpellSchool" "" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(PARALYZED,100,1);IF(SaveCrit()):ApplyStatus(PARALYZED,100,2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "TargetConditions" "Character() and not Dead() and ConcentrateSpell();" @@ -22534,7 +22556,7 @@ new entry "Target_HoldPerson_3_AI" type "SpellData" data "SpellType" "Target" using "Target_HoldPerson_3" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "" data "RootSpellID" "" data "PowerLevel" "" @@ -22544,7 +22566,7 @@ new entry "Target_GOB_DrowCommander_HoldPerson" type "SpellData" data "SpellType" "Target" using "Target_HoldPerson" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "Character() and not Dead() and MentalSpell() and ConcentrateSpell();" new entry "Target_GOB_Priestess_HoldPerson" @@ -22552,7 +22574,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HoldPerson" data "Cooldown" "None" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TargetConditions" "Character() and not Dead() and MentalSpell() and ConcentrateSpell();" data "SpellFlags" "IsSpell;HasVerbalComponent;HasSomaticComponent;HasHighGroundRangeExtension;RangeIgnoreVerticalThreshold" data "MemoryCost" "0" @@ -22562,7 +22584,7 @@ type "SpellData" data "SpellType" "Target" using "Target_HoldPerson" data "Level" "0" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "not Tagged('ACT3_LOW_HAG') and ConcentrateSpell();" data "TargetConditions" "Character() and not Dead() and MentalSpell() and ConcentrateSpell();" data "VocalComponentSound" "Vocal_Component_UniqueNPC_Gen_Hag" @@ -22584,7 +22606,7 @@ data "Level" "3" data "SpellSchool" "Necromancy" data "SpellContainerID" "" data "SpellProperties" "Resurrect(100, 50);RegainHitPoints(1,Undead)" -data "TargetRadius" "3" +data "TargetRadius" "4" data "TargetConditions" "CanStand('c2a2c269-ede8-4887-99f1-e0c044cc0c75') and Tagged('UNDEAD')" data "AmountOfTargets" "1" data "Icon" "Spell_Necromancy_AnimateDead_Zombie" @@ -22622,8 +22644,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Conjuration" data "SpellProperties" "GROUND:Summon(e848dcdf-fb01-4fb9-ba05-4d71099aa4c7,10,,,,SlitherAura);" -data "TargetRadius" "36" -data "AreaRadius" "6" +data "TargetRadius" "48" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(3d6,Piercing,Magical);IF(SaveCrit()):DealDamage((3d6)*2,Piercing,Magical);ApplyStatus(PersistentPoisonDamage_1d6,100,-1);ApplyStatus(ENSNARED,100,1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -22689,8 +22711,8 @@ data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Necromancy" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,SanguineMist,SanguineMistAura_4);GROUND:ApplyStatus(SELF,SanguineMistRecast_Rank4,100,2);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -22727,8 +22749,8 @@ data "SpellType" "Target" using "Target_GuardianOfFaith" data "Level" "5" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,SanguineMist,SanguineMistAura_5);GROUND:ApplyStatus(SELF,SanguineMistRecast_Rank5,100,2);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Necrotic,Magical);IF(SaveCrit()):DealDamage((8d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((8d6)/2,Necrotic,Magical);" data "TooltipDamageList" "DealDamage(8d6,Necrotic)" @@ -22742,8 +22764,8 @@ data "SpellType" "Target" using "Target_GuardianOfFaith" data "Level" "6" data "SpellProperties" "GROUND:Summon(0ba4af65-19d0-4a31-9a42-2c365462841b, 10,,,SanguineMist,SanguineMistAura_6);GROUND:ApplyStatus(SELF,SanguineMistRecast_Rank6,100,2);" -data "TargetRadius" "18" -data "AreaRadius" "3" +data "TargetRadius" "24" +data "AreaRadius" "4" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(10d6,Necrotic,Magical);IF(not SaveCrit()):DealDamage((10d6)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" data "SpellFail" "IF(not SaveCritMiss('Fort')):DealDamage((10d6)/2,Necrotic,Magical);" data "TooltipDamageList" "DealDamage(10d6,Necrotic)" @@ -22803,9 +22825,9 @@ new entry "Target_Entangle_WoodWoad" type "SpellData" data "SpellType" "Target" using "Target_Entangle" -data "SpellProperties" "GROUND:CreateSurface(3,10,Vines,true);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_LARGE,100,1)" +data "SpellProperties" "GROUND:CreateSurface(4,10,Vines,true);AI_ONLY:ApplyStatus(SELF,AI_HELPER_BUFF_LARGE,100,1)" data "TargetRadius" "6" -data "AreaRadius" "3" +data "AreaRadius" "4" data "TargetConditions" "Enemy() and not IsDowned() and not Dead() and ConcentrateSpell();" data "CastSound" "CrSpell_Cast_Entangle" data "TargetSound" "CrSpell_Impact_Entangle" @@ -22909,8 +22931,8 @@ data "SpellType" "Target" data "Level" "3" data "SpellSchool" "Evocation" data "SpellProperties" "GROUND:SurfaceChange(Ignite);" -data "TargetRadius" "50" -data "AreaRadius" "6" +data "TargetRadius" "200" +data "AreaRadius" "8" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Dexterity, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(6d6,Fire,Magical);IF(SaveCrit()):DealDamage((6d6)*2,Fire,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -22964,10 +22986,10 @@ data "SpellType" "Target" using "Target_DancingLights" data "Cooldown" "OncePerRestPerItem" data "SpellProperties" "GROUND:Summon(2064328c-a090-454f-b3b8-b488bbe64567, 10,,,,DANCING_LIGHTS)" -data "AreaRadius" "9" +data "AreaRadius" "12" data "DisplayName" "h32f6c8bfge3e3g89acg5455ge401443cd000;1" data "Description" "h7ca30415g95a9g9a0ag5916ge0bc0e33551d;1" -data "DescriptionParams" "Distance(9);" +data "DescriptionParams" "Distance(12);" data "UseCosts" "ActionPoint:2" data "VerbalIntent" "Buff" data "SpellFlags" "HasVerbalComponent;HasSomaticComponent;HasHighGroundRangeExtension;CannotTargetItems" @@ -22977,7 +22999,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):ApplyStatus(BlisteringInvectiveBurning_Rank2,100,-1);IF(not SaveCrit()):ApplyStatus(FRIGHTENED,100,1);IF(SaveCrit()):ApplyStatus(BlisteringInvectiveBurning_Rank2_Double,100,-1);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -23059,7 +23081,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "6" data "SpellSchool" "Enchantment" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, IncapSpellSlotDC());" data "SpellSuccess" "ApplyStatus(STUPEFIED_4,100,-1);" @@ -23090,7 +23112,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "1" data "SpellSchool" "Illusion" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(PhantomPainStatus_1,100,10);DealDamage(2d4,Psychic,Magical,NonLethal);IF(not SaveCrit()):ApplyStatus(SICKENED,100,-1);IF(SaveCrit()):ApplyStatus(SICKENED2,100,-1);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -23300,8 +23322,8 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Necromancy" -data "TargetRadius" "36" -data "AreaRadius" "5" +data "TargetRadius" "48" +data "AreaRadius" "6" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Constitution, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(4d10,Necrotic,Magical);IF(SaveCrit()):DealDamage((4d10)*2,Necrotic,Magical);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -23572,7 +23594,7 @@ data "TargetFloor" ".25" data "TargetRadius" "MeleeMainWeaponRange" data "RequirementConditions" "Press() and CanUseWeaponActions();" data "SpellRoll" "Attack2e(AttackType.MeleeWeaponAttack);" -data "SpellSuccess" "DealDamage(MainMeleeWeapon);ApplyStatus(OFF_BALANCED,100,1);ExecuteWeaponFunctors(MainHand);TARGET:IF(not Grounded() and TargetSizeEqualOrSmaller(Size.Large)):Force(-3, OriginToEntity, Neutral, false, true);" +data "SpellSuccess" "DealDamage(MainMeleeWeapon);ApplyStatus(OFF_BALANCED,100,1);ExecuteWeaponFunctors(MainHand);TARGET:IF(not Grounded() and TargetSizeEqualOrSmaller(Size.Large)):Force(-4, OriginToEntity, Neutral, false, true);" data "SpellFail" "ApplyStatus(OFF_BALANCED, 100, 1)" data "TargetConditions" "(Character() or Item()) and not Self() and not Dead();" data "Icon" "Action_PommelStrike" @@ -23743,7 +23765,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Evocation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "SpellAutoResolveOnAlly(Ability.Dexterity, SourceSpellDC(),true)" data "SpellSuccess" "ApplyStatus(RESILIENT_SPHERE,100,1);" @@ -23885,7 +23907,7 @@ new entry "Target_Slow_AI" type "SpellData" data "SpellType" "Target" using "Target_Slow" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "" data "CombatAIOverrideSpell" "" @@ -23894,7 +23916,7 @@ type "SpellData" data "SpellType" "Target" using "Target_Slow" data "Level" "4" -data "TargetRadius" "9" +data "TargetRadius" "12" data "TooltipUpcastDescription" "04cc3403-f67a-4747-b49e-a1802cc7a6ad" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" @@ -23909,7 +23931,7 @@ new entry "Target_Slow_4_AI" type "SpellData" data "SpellType" "Target" using "Target_Slow_4" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AmountOfTargets" "" data "RootSpellID" "" data "CombatAIOverrideSpell" "" @@ -23949,7 +23971,7 @@ new entry "Target_Slow_6_AI" type "SpellData" data "SpellType" "Target" using "Target_Slow_6" -data "AreaRadius" "9" +data "AreaRadius" "12" data "AmountOfTargets" "" data "MaximumTargets" "10" data "RootSpellID" "" @@ -23961,7 +23983,7 @@ data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Illusion" data "SpellProperties" "ApplyStatus(SILENCED,100,10);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "TargetConditions" "not Enemy();" data "Icon" "Spell_Illusion_Silence" data "DisplayName" "haaa1115dgcc25g9d51g7a97g97459003e531;1" @@ -24028,7 +24050,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "2" data "SpellSchool" "Illusion" -data "TargetRadius" "18" +data "TargetRadius" "24" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(PHANTASMAL_FORCE,100,10)" @@ -24071,7 +24093,7 @@ type "SpellData" data "SpellType" "Target" using "Target_TADPOLE" data "Cooldown" "OncePerShortRest" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(TAD_ABSORB_INTELLECT_1,100,1);ApplyStatus(TAD_ABSORB_INTELLECT_TECHNICAL,100,-1)" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" @@ -24118,9 +24140,9 @@ type "SpellData" data "SpellType" "Target" using "Target_TADPOLE" data "Cooldown" "OncePerShortRest" -data "SpellProperties" "Force(-6, TargetToEntity, Neutral, false, true);GROUND:ApplyStatus(SELF,TAD_BLACK_HOLE_AURA,100,5)" -data "TargetRadius" "18" -data "AreaRadius" "9" +data "SpellProperties" "Force(-8, TargetToEntity, Neutral, false, true);GROUND:ApplyStatus(SELF,TAD_BLACK_HOLE_AURA,100,5)" +data "TargetRadius" "24" +data "AreaRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC())" data "SpellSuccess" "ApplyStatus(TAD_BLACK_HOLE_SLOW,100,1)" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" @@ -24147,7 +24169,7 @@ type "SpellData" data "SpellType" "Target" using "Target_TAD_BlackHole" data "Cooldown" "" -data "SpellProperties" "Force(-6, TargetToEntity, Neutral, false, true)" +data "SpellProperties" "Force(-8, TargetToEntity, Neutral, false, true)" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC())" data "ExtraDescription" "" data "SpellFlags" "IsHarmful;DisableBlood;Temporary" @@ -24157,7 +24179,7 @@ type "SpellData" data "SpellType" "Target" using "Target_TAD_BlackHole" data "Cooldown" "" -data "SpellProperties" "Force(-6,TargetToEntity,false,true);GROUND:ApplyStatus(SELF,MF_BLACK_HOLE_AURA,100,5);DealDamage(3d10+4, Force,Magical)" +data "SpellProperties" "Force(-8,TargetToEntity,false,true);GROUND:ApplyStatus(SELF,MF_BLACK_HOLE_AURA,100,5);DealDamage(3d10+4, Force,Magical)" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(MF_BLACK_HOLE_SLOW,100,1)" data "DisplayName" "h3c3f6951gd175g14fbg6433g4652cf0c5012;1" @@ -24170,7 +24192,7 @@ new entry "Target_TAD_Charm" type "SpellData" data "SpellType" "Target" using "Target_TADPOLE" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC(),AdvantageOnCharmPerson())" data "SpellSuccess" "ApplyStatus(CHARMED,100,1)" data "TargetConditions" "Character() and MentalSpell();" @@ -24189,7 +24211,7 @@ type "SpellData" data "SpellType" "Target" using "Target_DominatePerson" data "Level" "4" -data "TargetRadius" "18" +data "TargetRadius" "24" data "TargetConditions" "not Ally() and not Dead() and Tagged('HUMANOID') and not Tagged('ILLITHID') and not HasStatus('POTION_BRINE') and not Tagged('ORPHEUS') " data "Icon" "Spell_Enchantment_DominatePerson" data "DisplayName" "h79762309gd60cgb5e4g2a77g407125cd8875;1" @@ -24291,7 +24313,7 @@ data "PowerLevel" "6" new entry "Target_DevourIntellect" type "SpellData" data "SpellType" "Target" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "not SavingThrow(Ability.Wisdom,12);" data "SpellSuccess" "IF(not IntelligenceGreaterThan(3)):DealDamage(2d10,Psychic,Magical);IF(not IntelligenceGreaterThan(3)):ApplyStatus(DEVOUR_INTELLECT_VFX,100,0);IF(not IntelligenceGreaterThan(3)):ApplyStatus(STUNNED,100,1);IF(IntelligenceGreaterThan(3)):ApplyStatus(DEVOURED_INT,100,3)" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" @@ -24347,7 +24369,7 @@ new entry "Target_MAG_Legendary_ImmolatingGaze" type "SpellData" data "SpellType" "Target" data "Cooldown" "OncePerRestPerItem" -data "TargetRadius" "9" +data "TargetRadius" "12" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(FRIGHTENED,100, 1);IF(not HasStatus('BURNING')):DealDamage(2d8, Fire);IF(HasStatus('BURNING')):DealDamage(2d8, Fire,Magical);" data "SpellFail" "IF(not HasStatus('BURNING')):DealDamage((2d8)/2, Fire);IF(HasStatus('BURNING')):DealDamage((4d8)/2, Fire,Magical)" @@ -24398,7 +24420,7 @@ type "SpellData" data "SpellType" "Target" data "ConcentrationSpellID" "Target_TAD_Imperil_Recast" data "Cooldown" "OncePerShortRest" -data "TargetRadius" "9" +data "TargetRadius" "12" data "RequirementConditions" "not Tagged('TADPOLE_POWERS_BLOCKED')" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "ApplyStatus(TAD_IMPERIL,100,5)" @@ -24468,7 +24490,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "5" data "SpellSchool" "Abjuration" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "Kill()" @@ -24545,7 +24567,7 @@ data "Level" "5" data "SpellSchool" "Enchantment" data "Cooldown" "OncePerTurn" data "SpellProperties" "AI_ONLY:ApplyStatus(DOMINATE_PERSON,100,10);" -data "TargetRadius" "18" +data "TargetRadius" "24" data "SpellRoll" "not SavingThrow(Ability.Wisdom, 15);" data "SpellSuccess" "AI_IGNORE:ApplyStatus(LOW_GHOST_POSSESSED, 100, 10);AI_IGNORE:ApplyStatus(SELF,LOW_GHOST_DISAPPEAR, 100, 10)" data "TargetConditions" "Character() and Enemy() and not Dead() and not HasStatus('FRIGHTENED') and not HasStatus('CONFUSION') and not Tagged('OSKARSBELOVED_IMMUNITY') and not HasStatus('LOW_OSKARSBELOVED_UNNERVED')" @@ -24692,11 +24714,11 @@ data "SpellType" "Target" using "Target_MainHandAttack" data "Cooldown" "OncePerTurn" data "DeathType" "Physical" -data "SpellSuccess" "DealDamage(MainMeleeWeapon+StrengthModifier, MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);DealDamage(1d6, Force);IF(not SavingThrow(Ability.Constitution, SourceSpellDC())):Force(5);" +data "SpellSuccess" "DealDamage(MainMeleeWeapon+StrengthModifier, MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);DealDamage(1d6, Force);IF(not SavingThrow(Ability.Constitution, SourceSpellDC())):Force(8);" data "Icon" "Action_AbsolutePower" data "DisplayName" "h8160bdb0g5d45g7897g0bf3g7c4cc44acd8d;1" data "Description" "h872468c3g2c1fgbb4fg2cf4gff23383ab0cc;1" -data "DescriptionParams" "Distance(5)" +data "DescriptionParams" "Distance(6)" data "TooltipDamageList" "DealDamage(MainMeleeWeapon+StrengthModifier, MainMeleeWeaponDamageType); DealDamage(1d6, Force)" data "CastSound" "CrSpell_Cast_BlindFury" data "TargetSound" "CrSpell_Impact_BlindFury" @@ -24719,7 +24741,7 @@ new entry "Target_Slam_AdamantineGolem" type "SpellData" data "SpellType" "Target" using "Target_UnarmedAttack" -data "TargetRadius" "3.0" +data "TargetRadius" "4" data "AreaRadius" "1" data "SpellSuccess" "DealDamage(4d8+UnarmedMeleeAbilityModifier, Bludgeoning);IF(not SavingThrow(Ability.Constitution, SourceSpellDC())):ApplyStatus(PRONE_PF2,100,-1);" data "TargetConditions" "Character() and not (HasStatus('UND_ADMANTINEGOLEM_TAUNT_HELPER',context.Source) and not HasStatus('UND_ADMANTINEGOLEM_TAUNT',context.Target))" @@ -24746,10 +24768,10 @@ new entry "Target_Multiattack_Owlbear" type "SpellData" data "SpellType" "Target" using "Target_Multiattack" -data "TargetRadius" "2.5" -data "SpellSuccess" "DealDamage(2d8+UnarmedMeleeAbilityModifier,Slashing);Cast2[DealDamage(1d10+UnarmedMeleeAbilityModifier,Piercing);IF(not SavingThrow(Ability.Constitution, SourceSpellDC())):ApplyStatus(PRONE_PF2,100,-1);IF(TargetSizeEqualOrSmaller(Size.Medium)):Force(1.5)];" +data "TargetRadius" "3" +data "SpellSuccess" "DealDamage(2d8+UnarmedMeleeAbilityModifier,Slashing);Cast2[DealDamage(1d10+UnarmedMeleeAbilityModifier,Piercing);IF(not SavingThrow(Ability.Constitution, SourceSpellDC())):ApplyStatus(PRONE_PF2,100,-1);IF(TargetSizeEqualOrSmaller(Size.Medium)):Force(2)];" data "Description" "h51d733cbgdb1agcd5ege96bg443ede8aaa8b;1" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "TooltipDamageList" "DealDamage(2d8+UnarmedMeleeAbilityModifier,Slashing); DealDamage(1d10+UnarmedMeleeAbilityModifier,Piercing)" data "TooltipPermanentWarnings" "35d354f2-d8ac-4758-af8c-30fd59fd261f" data "SpellAnimation" "6d444cbe-28c7-4f69-9409-9b4871851d9b,,;ebd0529b-057e-491f-b124-acfed054728b,,;eeca2c0a-5f81-411e-aad8-b72362322900,,;2b6afcc6-c9c1-4dc1-9904-88bebecb892f,,;,,;e6d40932-427f-4699-a0de-66f124d905b1,,;0b07883a-08b8-43b6-ac18-84dc9e84ff50,,;,,;,," @@ -24762,7 +24784,7 @@ type "SpellData" data "SpellType" "Target" using "Target_PushingAttack" data "Cooldown" "OncePerCombat" -data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(5);DealDamage(MainMeleeWeapon + LevelMapValue(SuperiorityDie), MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);" +data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(4);DealDamage(MainMeleeWeapon + LevelMapValue(SuperiorityDie), MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);" data "TooltipAttackSave" "Constitution" data "HitCosts" "" data "SpellAnimationIntentType" "Aggressive" @@ -24860,10 +24882,10 @@ new entry "Target_BoomingBladeEx" type "SpellData" data "SpellType" "Target" using "Target_BoomingBlade" -data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(4.5);ApplyStatus(BOOMING_BLADE,100,1);DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);" +data "SpellSuccess" "IF(not SavingThrow(Ability.Constitution, ManeuverSaveDC())):Force(6);ApplyStatus(BOOMING_BLADE,100,1);DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);ExecuteWeaponFunctors(MainHand);" data "DisplayName" "h06564ab4gdb2dgeebcgdbe6g586ffe87b878;1" data "Description" "h60219fa0g32b8gbb9bga17dg33516636b834;1" -data "DescriptionParams" "Distance(4.5);DealDamage(1d8, Thunder)" +data "DescriptionParams" "Distance(6);DealDamage(1d8, Thunder)" data "ExtraDescription" "" data "TooltipAttackSave" "MeleeWeaponAttack;Strength" data "TargetSound" "Spell_Impact_Sorcerer_BoomingBlade" @@ -24980,16 +25002,16 @@ data "Level" "0" data "SpellSchool" "Evocation" data "Cooldown" "OncePerShortRestPerItem" data "SpellProperties" "SetStatusDuration(SELF,MAG_CHARGED_LIGHTNING,-3,Add)" -data "TargetRadius" "4.5" +data "TargetRadius" "4" data "RequirementConditions" "HasStatus('MAG_CHARGED_LIGHTNING')" data "SpellRoll" "not SavingThrow(Ability.Constitution, 13)" -data "SpellSuccess" "TARGET:IF(TargetSizeEqualOrSmaller(Size.Large)):Force(-2); DealDamage(1d8,Lightning,Magical);" +data "SpellSuccess" "TARGET:IF(TargetSizeEqualOrSmaller(Size.Large)):Force(-3); DealDamage(1d8,Lightning,Magical);" data "SpellFail" "ApplyStatus(SAVED_AGAINST_HOSTILE_SPELL, 100, 0)" data "TargetConditions" "not Self() and not Grounded() and (Item() or Character() or Dead())" data "Icon" "GenericIcon_DamageType_Lightning" data "DisplayName" "h85c05e74g70f5gfc5eg8ffcga6e4d3b4e131;1" data "Description" "hb9862fabgc985g2372gb839g3a8f000d77e5;1" -data "DescriptionParams" "DealDamage(1d8,Lightning);Distance(3)" +data "DescriptionParams" "DealDamage(1d8,Lightning);Distance(4)" data "TooltipDamageList" "DealDamage(1d8,Lightning);" data "TooltipAttackSave" "Constitution" data "TooltipPermanentWarnings" "c211ed6a-1f57-4488-be1c-6bd44be5a1c6" @@ -25010,7 +25032,7 @@ type "SpellData" data "SpellType" "Target" data "Level" "4" data "SpellSchool" "Illusion" -data "TargetRadius" "36" +data "TargetRadius" "48" data "RequirementConditions" "ConcentrateSpell();" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "SpellSuccess" "IF(not SaveCrit()):DealDamage(8d6,Psychic,Magical);ApplyStatus(FRIGHTENED,100,2);IF(SaveCrit()):DealDamage((8d6)*2,Psychic,Magical);IF(SaveCrit()):ApplyStatus(FRIGHTENED,100,4);IF(SaveCrit()):ApplyStatus(CriticalFailureDisplay,100,0);" @@ -25077,7 +25099,7 @@ data "Level" "3" data "SpellSchool" "Necromancy" data "AIFlags" "CanNotUse" data "SpellProperties" "TARGET:ApplyStatus(SELF,SPEAK_WITH_DEAD_RECAST,100,-1);TARGET:ApplyStatus(SPEAK_WITH_DEAD,100,0)" -data "TargetRadius" "9" +data "TargetRadius" "12" data "Requirements" "!Combat" data "RequirementConditions" "ConcentrateSpell();" data "TargetConditions" "not Tagged('CORPSE_SPOKEN') and not Tagged('BLOCK_SPEAK_WITH_DEAD') and ((FreshCorpse() and not Tagged('BEAST') and not Tagged('UNDEAD') and not Player()) or Tagged('ALLOW_SPEAK_WITH_DEAD')) and not HasStatus('SILENCED') and ConcentrateSpell();" @@ -25151,7 +25173,7 @@ type "SpellData" data "SpellType" "Target" using "Target_CureWounds" data "SpellProperties" "ApplyStatus(HAG_MASKOFSERVITUDE,100,2)" -data "TargetRadius" "18" +data "TargetRadius" "24" data "DisplayName" "hb9a8b1c3g6002g7a2cge2f8g28e028742cf3;1" data "Description" "h18d6d55eg482cgdb95g4b18g1e4cf61ed296;1" data "DescriptionParams" "RegainHitPoints(2d4+SpellCastingAbilityModifier)" @@ -25254,7 +25276,7 @@ type "SpellData" data "SpellType" "Target" using "Target_ConcussiveSmash" data "RequirementConditions" "CanUseWeaponActions();" -data "SpellSuccess" "DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);DealDamage(ProficiencyBonus, Acid);CreateSurface(1.5, 3, Acid) ;ExecuteWeaponFunctors(MainHand);" +data "SpellSuccess" "DealDamage(MainMeleeWeapon, MainMeleeWeaponDamageType);DealDamage(ProficiencyBonus, Acid);CreateSurface(2, 3, Acid) ;ExecuteWeaponFunctors(MainHand);" data "Icon" "Action_Mag_CorrosiveStrike" data "DisplayName" "h84b8e518g61c1g270cgd062g53ca82fbb11b;1" data "Description" "h1b4b0448g9467gb4afg1a72g119103349239;1" @@ -25288,7 +25310,7 @@ data "TargetConditions" "Ally() and not HasStatus('GLO_BLACKPOWDERKEG') and not data "Icon" "Action_SoulBranding" data "DisplayName" "h71b64f44g60abg5d81g1f90g708dc9be5eb5;1" data "Description" "h91f7cc79g0b5eg30c3g9cecg171b8627d5fb;1" -data "DescriptionParams" "Distance(1.5);DealDamage(2d4+1,Fire)" +data "DescriptionParams" "Distance(2);DealDamage(2d4+1,Fire)" data "ExtraDescription" "hf7b1fdf1g776dg625cgdeecgb59b8a3ee7a2;1" data "TooltipDamageList" "" data "TooltipAttackSave" "" @@ -25310,7 +25332,7 @@ type "SpellData" data "SpellType" "Target" data "Cooldown" "OncePerRest" data "SpellProperties" "IF(not IsSkillExpert('Investigation', 'Intelligence')):ApplyStatus(ROOTMAGIC_1,100,-1);IF(IsSkillExpert('Investigation', 'Intelligence')):ApplyStatus(ROOTMAGIC_2,100,-1);" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "Requirements" "!Combat" data "TargetConditions" "Character() and not Dead() and not Self() and Ally();" data "Icon" "Spell_Conjuration_GraspingVine" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Teleportation.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Teleportation.txt index 86fc3559..8ac81b2d 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Teleportation.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Teleportation.txt @@ -3,7 +3,7 @@ type "SpellData" data "SpellType" "Teleportation" data "Level" "4" data "SpellSchool" "Conjuration" -data "TargetRadius" "2" +data "TargetRadius" "0" data "AreaRadius" "50" data "LineOfSightFlags" "AddSourceHeight" data "SpellProperties" "GROUND:TeleportSource()" @@ -28,33 +28,84 @@ data "CastEffect" "4d65f0dd-ff5e-4253-8aa1-f0e12e539a40" data "DisappearEffect" "b214ce9c-33c2-4dfc-bfc2-3af8e4124714" data "RequirementConditions" "ConcentrateSpell();" -new entry "Teleportation_ShrinkTheSpan" +new entry "Teleportation_ShrinkTheSpan_6" type "SpellData" data "SpellType" "Teleportation" -data "TargetRadius" "2" -data "AreaRadius" "50" +data "SpellContainerID" "ShrinkTheSpan_Container" +data "TargetRadius" "0" +data "AreaRadius" "6" data "LineOfSightFlags" "AddSourceHeight" data "SpellProperties" "GROUND:TeleportSource()" data "TargetConditions" "CanStand('') and not Character()" data "OriginTargetConditions" "Self()" data "TeleportSelf" "Yes" data "TeleportSurface" "No" -data "Icon" "Spell_Conjuration_DimensionDoor" -data "DisplayName" "hf75269e1gd117g0acfgbd5agcea93e1fabcc;1" -data "Description" "h8086d514g623eg1d75g45fdga91838e8db68;1" +data "Icon" "Action_BenignTransposition" +data "DisplayName" "hfb8fa7edgc4b4g2437gb6bfge461ab1a4cba;1" +data "Description" "h310d18ceg4a48g4899gb4c5g0385c6c98f3d;1" +data "DescriptionParams" "Distance(6)" data "CastSound" "Spell_Cast_Utility_DimensionDoor_L4to5" data "TargetSound" "Spell_Impact_Utility_DimensionDoor_L4to5" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "UseCosts" "ActionPoint:1;KiPoint:1" data "SpellAnimation" "dd86aa43-8189-4d9f-9a5c-454b5fe4a197,,;,,;7abe77ed-9c77-4eac-872c-5b8caed070b6,,;cb171bda-f065-4520-b470-e447f678ba1f,,;cc5b0caf-3ed1-4711-a50d-11dc3f1fdc6a,,;,,;1715b877-4512-472e-9bd0-fd568a112e90,,;,,;,," -data "SpellFlags" "HasHighGroundRangeExtension;RangeIgnoreVerticalThreshold;CannotTargetItems;IsSpell;HasSomaticComponent" +data "SpellFlags" "RangeIgnoreVerticalThreshold;CannotTargetItems;IsSpell;HasSomaticComponent" data "HitAnimationType" "None" data "VerbalIntent" "Utility" data "PrepareEffect" "7121a488-7c9a-4ba1-a585-f79aaa77e97c" data "CastEffect" "4d65f0dd-ff5e-4253-8aa1-f0e12e539a40" data "DisappearEffect" "b214ce9c-33c2-4dfc-bfc2-3af8e4124714" +new entry "Teleportation_ShrinkTheSpan_8" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "8" +data "DescriptionParams" "Distance(8)" + +new entry "Teleportation_ShrinkTheSpan_10" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "10" +data "DescriptionParams" "Distance(10)" + +new entry "Teleportation_ShrinkTheSpan_12" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "12" +data "DescriptionParams" "Distance(12)" + +new entry "Teleportation_ShrinkTheSpan_14" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "14" +data "DescriptionParams" "Distance(14)" + +new entry "Teleportation_ShrinkTheSpan_16" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "16" +data "DescriptionParams" "Distance(16)" + +new entry "Teleportation_ShrinkTheSpan_18" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "18" +data "DescriptionParams" "Distance(18)" + +new entry "Teleportation_ShrinkTheSpan_20" +type "SpellData" +data "SpellType" "Teleportation" +using "Teleportation_ShrinkTheSpan_6" +data "AreaRadius" "20" +data "DescriptionParams" "Distance(20)" + new entry "Teleportation_Critspec_Polearm" type "SpellData" data "SpellType" "Teleportation" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Throw.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Throw.txt index 7000f584..61a199e3 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Throw.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Throw.txt @@ -13,14 +13,14 @@ new entry "Throw_Critspec_Polearm" type "SpellData" data "SpellType" "Throw" data "TargetFloor" "-1" -data "TargetRadius" "4.5" -data "AreaRadius" "3" +data "TargetRadius" "6" +data "AreaRadius" "4" data "ThrowOrigin" "Target" data "TargetConditions" "not Self()" data "Trajectories" "rules:861d0046-1858-401e-b97b-28f7b3e3e89a,d5e54f29-f80f-4105-96b2-23b5af9321c7,bac38aab-dfa7-4a5a-9c2a-552b0b626ee3" data "Icon" "Action_Monster_Gortash_ReelIn" data "DisplayName" "h66a6b4c7ge757gf17cg6fdfgd86a1edf0d46;1" -data "DescriptionParams" "Distance(4.5)" +data "DescriptionParams" "Distance(6)" data "PreviewCursor" "Melee_Ground" data "CastTextEvent" "Cast" data "UseCosts" "ActionPoint:0" @@ -58,7 +58,7 @@ new entry "Throw_ImprovisedWeapon" type "SpellData" data "SpellType" "Throw" using "Throw_Throw" -data "TargetRadius" "1.5" +data "TargetRadius" "2" data "SpellRoll" "Attack2e(AttackType.MeleeUnarmedAttack);" data "SpellSuccess" "TARGET:IF(IsLightThrownObject(context.HitDescription.ThrownObject, false)):DealDamage(1d4,Bludgeoning);TARGET:IF(IsMediumThrownObject(context.HitDescription.ThrownObject, false)):DealDamage(2d4,Bludgeoning);TARGET:IF(IsHeavyThrownObject(context.HitDescription.ThrownObject, false)):DealDamage(2d4,Bludgeoning);TARGET:IF(HasWeaponProperty(WeaponProperties.Thrown,context.HitDescription.ThrownObject)):DealDamage(ThrownWeapon, ThrownWeaponDamageType);TARGET:IF(HasWeightGreaterThan(context.Target.Weight/2, context.HitDescription.ThrownObject)):Force(2);TARGET:IF(HasWeightGreaterThan(context.Target.Weight, context.HitDescription.ThrownObject)):ApplyStatus(PRONE,100,1)" data "ThrowableTargetConditions" "IsImprovisedWeapon() and CanImprovisedWeaponWeight() and not Grounded() and not IsItemDisabled() and not HasAttribute('InventoryBound') and (IsMovable() or Character() or Dead()) and CanMove(context.Target, context.Source, false) and not Tagged('CANT_SHOVE_THROW')" @@ -114,7 +114,7 @@ data "SpellType" "Throw" using "Throw_Telekinesis" data "Level" "0" data "SpellSchool" "Evocation" -data "TargetRadius" "9" +data "TargetRadius" "12" data "AreaRadius" "9" data "SpellProperties" "GROUND:DealDamage(LevelMapValue(D6Cantrip),Bludgeoning)" data "SpellRoll" "Attack2e(AttackType.RangedSpellAttack);" @@ -125,7 +125,7 @@ data "ThrowableTargetConditions" "not Grounded() and not IsItemDisabled() and no data "Icon" "Spell_Transmutation_Levitate" data "DisplayName" "h5c8acea4g3472g5267g1c78g73787f3f7f0f;1" data "Description" "ha9743f03g415cg49a2g4e07g428521662fd3;1" -data "DescriptionParams" "Distance(9)" +data "DescriptionParams" "Distance(12)" data "TooltipDamageList" "DealDamage(LevelMapValue(D6Cantrip),Bludgeoning,Magical)" data "TooltipAttackSave" "RangedAttack" data "TooltipStatusApply" ";" @@ -141,8 +141,8 @@ new entry "Throw_FlingingUpdraft" type "SpellData" data "SpellType" "Throw" data "TargetFloor" "-1" -data "TargetRadius" "18" -data "AreaRadius" "9" +data "TargetRadius" "24" +data "AreaRadius" "12" data "SpellRoll" "SpellAutoResolveOnAlly(Ability.Dexterity, SourceSpellDC(),true);" data "SpellSuccess" "IF(not Ally()):DealDamage(15,Bludgeoning,Magical);" data "TargetConditions" "not Self() and RageConcentrateSpell();" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Wall.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Wall.txt index c908c113..7d57f7b1 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Wall.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Wall.txt @@ -29,8 +29,8 @@ type "SpellData" data "SpellType" "Wall" data "Level" "5" data "SpellSchool" "Evocation" -data "TargetRadius" "36" -data "MaxDistance" "36" +data "TargetRadius" "48" +data "MaxDistance" "48" data "Lifetime" "10" data "SurfaceType" "WaterFrozen" data "SurfaceRadius" "2" @@ -63,8 +63,8 @@ type "SpellData" data "SpellType" "Wall" data "Level" "6" data "SpellSchool" "Evocation" -data "TargetRadius" "36" -data "MaxDistance" "36" +data "TargetRadius" "48" +data "MaxDistance" "48" data "Lifetime" "10" data "SurfaceType" "WaterFrozen" data "SurfaceRadius" "2" @@ -103,8 +103,8 @@ type "SpellData" data "SpellType" "Wall" data "Level" "4" data "SpellSchool" "Evocation" -data "TargetRadius" "18" -data "MaxDistance" "9" +data "TargetRadius" "48" +data "MaxDistance" "48" data "Lifetime" "10" data "SurfaceType" "Fire" data "SurfaceRadius" "2" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Zone.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Zone.txt index ff806641..46f56d8f 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Zone.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Spell_Zone.txt @@ -66,7 +66,7 @@ data "CastSound" "CrSpell_Cast_RedDragon_FrightfulPresence" data "TargetSound" "CrSpell_Impact_RedDragon_FrightfulPresence" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "4" +data "Range" "6" data "Angle" "360" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:1" @@ -108,7 +108,7 @@ data "CastSound" "Action_Impact_Monk_ResonationPunch" data "TargetSound" "Action_Cast_Monk_ResonationBlast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "4" +data "Range" "6" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:1;KiPoint:1" @@ -131,7 +131,7 @@ data "DisplayName" "h0d29a52dg7a34g1454ge607g88f86c967a34;1" data "Description" "h7210e1f9gcbd2g9889g07e7g35a5f8925f29;1" data "DescriptionParams" "LevelMapValue(QiBlast2Action)" data "TooltipDamageList" "LevelMapValue(QiBlast2Action)" -data "Range" "9" +data "Range" "12" data "UseCosts" "ActionPoint:2;KiPoint:1" new entry "Zone_QiBlast3Action" @@ -144,7 +144,7 @@ data "DisplayName" "h27b590f9g0061g8a80gc825g07b41011e7de;1" data "Description" "hbac1ea12g94fdg0fdbg5590g7b73f3f29b88;1" data "DescriptionParams" "LevelMapValue(QiBlast3Action)" data "TooltipDamageList" "LevelMapValue(QiBlast3Action)" -data "Range" "18" +data "Range" "24" data "UseCosts" "ActionPoint:3;KiPoint:1" new entry "Zone_BreathWeapon_Acid" @@ -170,7 +170,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Acid" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Acid" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "5" +data "Range" "6" data "Base" "2" data "UseCosts" "ActionPoint:2;" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -223,7 +223,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2" @@ -306,7 +306,7 @@ data "DisplayName" "h6aca698agf0efg7e3egd4f7gf855857f874a;1" data "Description" "hf6a15742g4fbbg5aaege319gdd12d3ab765c;1" data "TooltipDamageList" "DealDamage(LevelMapValue(CharacterLevel),Fire)" data "TooltipAttackSave" "Constitution" -data "Range" "7" +data "Range" "8" data "Angle" "360" data "UseCosts" "ActionPoint:0" data "RequirementConditions" "HasStatus('RAGE_DRAGON_FIRE');" @@ -324,7 +324,7 @@ data "DisplayName" "h87da19bbg7b0fg02e4g92a7ge32b4494f798;1" data "Description" "h36aea3a8g86bcg7293g779aga71f59fd2d8a;1" data "TooltipDamageList" "DealDamage(LevelMapValue(CharacterLevel),Bludgeoning)" data "TooltipAttackSave" "Constitution" -data "Range" "7" +data "Range" "8" data "Angle" "360" data "UseCosts" "ActionPoint:0" data "RequirementConditions" "HasStatus('RAGE_DRAGON');" @@ -342,7 +342,7 @@ data "DisplayName" "h736c6aa4g4329g845fge981g34bdd5922208;1" data "Description" "h0e47e4a7gcc3fg48b8gac62g35b7a54e03aa;1" data "TooltipDamageList" "DealDamage(LevelMapValue(CharacterLevel),Poison)" data "TooltipAttackSave" "Constitution" -data "Range" "7" +data "Range" "8" data "Angle" "360" data "UseCosts" "ActionPoint:0" data "RequirementConditions" "HasStatus('RAGE_DRAGON_POISON');" @@ -360,7 +360,7 @@ data "DisplayName" "h968d2bccga725gbd98g4fbfg514dd46f88fe;1" data "Description" "h3912cacbgfaa2gde11gd7bag824aad24890b;1" data "TooltipDamageList" "DealDamage(LevelMapValue(CharacterLevel),Force)" data "TooltipAttackSave" "Constitution" -data "Range" "7" +data "Range" "8" data "Angle" "360" data "UseCosts" "ActionPoint:0" data "RequirementConditions" "HasStatus('RAGE_DRAGON_FORCE');" @@ -378,7 +378,7 @@ data "DisplayName" "hbeca3bffgadbeg755cg3404g9b32c6fbdfc2;1" data "Description" "h817ad62bgb0cbg173cg682egb9d88b87accf;1" data "TooltipDamageList" "DealDamage(LevelMapValue(CharacterLevel),Psychic)" data "TooltipAttackSave" "Constitution" -data "Range" "7" +data "Range" "8" data "Angle" "360" data "UseCosts" "ActionPoint:0" data "RequirementConditions" "HasStatus('RAGE_DRAGON_PSYCHIC');" @@ -537,7 +537,7 @@ data "VocalComponentSound" "Vocal_Component_Scare" data "CastTextEvent" "Cast" data "Shape" "Cone" data "FrontOffset" "-2" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" @@ -568,7 +568,7 @@ data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(ENSNARED,100,1);" data "TargetConditions" "not Dead() and not (HasPassive('SculptSpells', context.Source) and Ally()) and not Tagged('INVISIBLE_HELPER') and ConcentrateSpell();" data "Description" "hf3fcc4fage68bg8d02g824bga43d06ff4794;1" data "TooltipAttackSave" "Constitution" -data "Range" "18" +data "Range" "24" data "Base" "2" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:2" data "RequirementConditions" "ConcentrateSpell();" @@ -583,7 +583,7 @@ data "SpellFail" "IF(not SaveCritMiss('Fort')):ApplyStatus(ENSNARED,100,1);" data "TargetConditions" "not Dead() and not (HasPassive('SculptSpells', context.Source) and Ally()) and not Tagged('INVISIBLE_HELPER') and ConcentrateSpell();" data "Description" "ha766f1fag219bge53ag0d01g12fe2458d8ac;1" data "TooltipAttackSave" "Constitution" -data "Range" "18" +data "Range" "24" data "Base" "2" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "RootSpellID" "Zone_GustOfWind" @@ -784,7 +784,7 @@ data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" data "FrontOffset" "-2" -data "Range" "18" +data "Range" "24" data "Angle" "60" data "UseCosts" "ActionPoint:3;SpellSlotsGroup:1:1:1" data "SpellAnimation" "554a18f7-952e-494a-b301-7702a85d4bc9,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;22dfbbf4-f417-4c84-b39e-2039315961e6,,;,,;5bfbe9f9-4fc3-4f26-b112-43d404db6a89,,;,,;,," @@ -1068,7 +1068,7 @@ data "TargetSound" "Spell_Impact_Damage_Radiant_Sunbeam_L6to8" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;KiPoint:1" @@ -1103,7 +1103,7 @@ data "CastSound" "Spell_Cast_Damage_Thunder_Thunderwave_L1to3_01" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "5" +data "Range" "6" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;KiPoint:1" @@ -1181,7 +1181,7 @@ data "TargetConditions" "not Dead() and not (HasPassive('SculptSpells', context. data "Description" "h8724ea10g1065g4fa7gfc8egdd0000de0596;1" data "TooltipAttackSave" "Constitution" data "TooltipStatusApply" "ApplyStatus(PRONE_PF2,100,-1);ApplyStatus(OFFBALANCE,100,1);ApplyStatus(ENSNARED,100,1)" -data "Range" "18" +data "Range" "24" data "Base" "2" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:1" data "RequirementConditions" "ConcentrateSpell();" @@ -1220,7 +1220,7 @@ data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Square" data "FrontOffset" "-2" -data "Range" "30" +data "Range" "48" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3;" @@ -1257,7 +1257,7 @@ data "PrepareSound" "Spell_Prepare_Damage_Necrotic_Gen_L1to3" data "PrepareLoopSound" "Spell_Prepare_Damage_Necrotic_Gen_L1to3_Loop" data "CastSound" "Spell_Cast_Damage_Necrotic_ArmsOfHadar_L1to3" data "TargetSound" "Spell_Impact_Barbarian_WildMagic_ShadowyTendrils" -data "Range" "9" +data "Range" "12" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:1" data "HitAnimationType" "MagicalDamage_External" data "RequirementConditions" "ConcentrateSpell();" @@ -1352,7 +1352,7 @@ data "CastSound" "Spell_Cast_Damage_Ice_ConeOfCold_L4to5" data "TargetSound" "Spell_Impact_Damage_Ice_ConeOfCold_L4to5" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -1378,7 +1378,7 @@ data "DisplayName" "he949d341g8082g5e36g6ad4g87f85164b63d;1" data "Description" "h9756b5d4ga0e7g5591g5e49ge671e36b9025;1" data "TooltipDamageList" "DealDamage(2d4,Cold,Magical);" data "TooltipAttackSave" "Dexterity" -data "Range" "4" +data "Range" "6" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:1" data "RequirementConditions" "ConcentrateSpell();" @@ -1464,7 +1464,7 @@ data "TargetSound" "CrSpell_Impact_ElementalEarth_SeismicStrike" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "5" +data "Range" "6" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:1" @@ -1484,7 +1484,7 @@ new entry "Zone_Shockwave_Rank2" type "SpellData" data "SpellType" "Zone" using "Zone_Shockwave_Rank1" -data "Range" "7" +data "Range" "8" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:2" data "RootSpellID" "Zone_Shockwave_Rank1" data "PowerLevel" "2" @@ -1493,7 +1493,7 @@ new entry "Zone_Shockwave_Rank3" type "SpellData" data "SpellType" "Zone" using "Zone_Shockwave_Rank1" -data "Range" "9" +data "Range" "10" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3" data "RootSpellID" "Zone_Shockwave_Rank1" data "PowerLevel" "3" @@ -1502,7 +1502,7 @@ new entry "Zone_Shockwave_Rank4" type "SpellData" data "SpellType" "Zone" using "Zone_Shockwave_Rank1" -data "Range" "11" +data "Range" "12" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4" data "RootSpellID" "Zone_Shockwave_Rank1" data "PowerLevel" "4" @@ -1511,7 +1511,7 @@ new entry "Zone_Shockwave_Rank5" type "SpellData" data "SpellType" "Zone" using "Zone_Shockwave_Rank1" -data "Range" "13" +data "Range" "14" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5" data "RootSpellID" "Zone_Shockwave_Rank1" data "PowerLevel" "5" @@ -1520,7 +1520,7 @@ new entry "Zone_Shockwave_Rank6" type "SpellData" data "SpellType" "Zone" using "Zone_Shockwave_Rank1" -data "Range" "15" +data "Range" "16" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6" data "RootSpellID" "Zone_Shockwave_Rank1" data "PowerLevel" "6" @@ -1552,7 +1552,7 @@ data "TargetSound" "Action_Impact_Druid_SpreadingSpores" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "4" +data "Range" "6" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:2" @@ -1607,7 +1607,7 @@ data "CastSound" "Spell_Cast_Utility_CreateWater_L1to3" data "TargetSound" "Spell_Impact_Utility_CreateWater_L1to3" data "VocalComponentSound" "Vocal_Component_CreateWater" data "PreviewCursor" "Cast" -data "Range" "9" +data "Range" "12" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;7abe77ed-9c77-4eac-872c-5b8caed070b6,,;cb171bda-f065-4520-b470-e447f678ba1f,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," data "PowerLevel" "3" @@ -1658,7 +1658,7 @@ data "DisplayName" "h02c535eagdd56g0b66gafdbgb1b70f239aef;1" data "Description" "h22d54faagf660g47a7g6757g4dcc5d24fdd5;1" data "TooltipDamageList" "DealDamage(4d12,Lightning)" data "TooltipUpcastDescriptionParams" "DealDamage(1d12,Lightning)" -data "Range" "36" +data "Range" "48" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:3;" data "PowerLevel" "3" @@ -1730,7 +1730,7 @@ data "VocalComponentSound" "Vocal_Component_CreateWater" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "18" +data "Range" "24" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4;" @@ -1794,7 +1794,7 @@ data "VocalComponentSound" "Vocal_Component_DamageNecroticVamparic" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "9" +data "Range" "12" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:4;" @@ -1884,7 +1884,7 @@ data "TooltipDamageList" "DealDamage(LevelMapValue(BreathWeapon),Lightning)" data "PrepareSound" "Spell_Prepare_Damage_BreathWeapon_Lightning" data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Lightning" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Lightning" -data "Range" "9" +data "Range" "12" data "PrepareEffect" "f3b75f38-8529-4da8-a3be-935d75ba3525" data "CastEffect" "72ee0212-de05-4231-8036-602859ac5f2b" data "TargetEffect" "15947330-096e-488e-bec2-1086195d0498" @@ -1936,7 +1936,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;KiPoint:1;" @@ -1972,7 +1972,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;KiPoint:1" @@ -2008,7 +2008,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;KiPoint:1" @@ -2045,7 +2045,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;KiPoint:1" @@ -2085,7 +2085,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "36" +data "Range" "48" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" @@ -2126,7 +2126,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "36" +data "Range" "48" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6;" @@ -2160,7 +2160,7 @@ data "TooltipOnSave" "961753f4-c345-4bc4-b408-1d5b87a5ab0c" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2194,7 +2194,7 @@ data "TooltipOnSave" "961753f4-c345-4bc4-b408-1d5b87a5ab0c" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2228,7 +2228,7 @@ data "TooltipOnSave" "961753f4-c345-4bc4-b408-1d5b87a5ab0c" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2264,7 +2264,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Fire" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Fire" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2297,7 +2297,7 @@ data "TooltipOnSave" "961753f4-c345-4bc4-b408-1d5b87a5ab0c" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2333,7 +2333,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_BreathWeapon_Cold" data "CastSound" "Spell_Cast_Damage_BreathWeapon_Cold" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2366,7 +2366,7 @@ data "TooltipOnSave" "961753f4-c345-4bc4-b408-1d5b87a5ab0c" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "18" +data "Range" "24" data "Base" "0" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -2488,7 +2488,7 @@ data "Description" "ha7dc149dga8efg8959g907bg7e676dd20588;1" data "TooltipDamageList" "DealDamage(10d6,Cold)" data "TooltipAttackSave" "Dexterity" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" -data "Range" "18" +data "Range" "24" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "PowerLevel" "5" data "RequirementConditions" "ConcentrateSpell();" @@ -2527,7 +2527,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2558,7 +2558,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2589,7 +2589,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2620,7 +2620,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2651,7 +2651,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2682,7 +2682,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2713,7 +2713,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2744,7 +2744,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2775,7 +2775,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2806,7 +2806,7 @@ data "TooltipAttackSave" "Wisdom" data "TooltipUpcastDescription" "66388a6f-44dd-4c9f-a9e7-910c50e70755" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:5;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -2829,7 +2829,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "heb7c6734g1ff5gd471g737dge2da6ab897a9;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2848,7 +2848,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "he59c8b54gda37gd9b4g94ecg605be2794819;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2867,7 +2867,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "h717e5873ga559gb8d6g490agcbfa34274f3e;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2886,7 +2886,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "h0256e4b3g70cbg6e45g4550gc7106f855ec0;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2905,7 +2905,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "h886bb54cg3dc5ge96fg270dg96226200ada0;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2924,7 +2924,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "heb324fc8ge1b3gd154gc2fdga1b7ecef6c60;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2943,7 +2943,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "h004b6e34g4536gdf64g545bg18647aec3ef0;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2962,7 +2962,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "hed580645g96f2g03a6g323fgb1e7d9c0748f;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -2981,7 +2981,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "h1b3efcdcg7f0fgdcc6g27cbg57d3dc72e7f0;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -3000,7 +3000,7 @@ data "SurfaceGrowInterval" "10" data "SpellRoll" "not SavingThrow(Ability.Wisdom, SourceSpellDC());" data "DisplayName" "h38ce4c70g624bge690g9029g25b5a16b8292;1" data "Shape" "Square" -data "Range" "15" +data "Range" "20" data "Base" "2" data "Angle" "0" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -3245,7 +3245,7 @@ data "TooltipDamageList" "DealDamage(5d8,Psychic);DealDamage(5d6,Bludgeoning)" data "TooltipAttackSave" "Constitution" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "5" +data "Range" "6" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6;" data "SpellAnimation" "ce0aa392-7d13-45a2-8a59-e6786830265d,,;,,;bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11,bd10df60-20c2-4711-a1b0-cef708fa0f11;af7ebc22-2ad5-4a39-ad4f-4e93e45f88c1,,;4354d3c1-ffc2-4da2-9840-d8c5f0932cbf,,;,,;c6951776-8830-4d97-9286-35899fe08d0b,,;,,;,," @@ -3275,7 +3275,7 @@ data "TooltipDamageList" "DealDamage(12d6,Necrotic)" data "TooltipAttackSave" "Constitution" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;5e7e63e1-0e69-46e7-ade7-fe3dadcc9184,,;e9ad50df-e7f1-43a0-b782-4c08f92b0f5a,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -3317,7 +3317,7 @@ data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Square" data "FrontOffset" "1" -data "Range" "18" +data "Range" "24" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;" @@ -3380,7 +3380,7 @@ data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Square" data "FrontOffset" "1" -data "Range" "9" +data "Range" "12" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;" @@ -3422,7 +3422,7 @@ data "TargetSound" "Action_Impact_Druid_SpreadingSpores" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Base" "2" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -3463,7 +3463,7 @@ data "TargetSound" "Spell_Impact_Damage_LightningBolt_L5" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "5" +data "Range" "6" data "Base" "2" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" @@ -3485,7 +3485,7 @@ data "SpellSchool" "Evocation" data "DisplayName" "h81552848gb2cfg3ec9g923bga4d72e652abf;1" data "Shape" "Square" data "FrontOffset" "1" -data "Range" "9" +data "Range" "12" data "Angle" "0" data "CastEffect" "a6aab94c-e0b5-4cbe-81cb-53ff6b1a662a" data "HitEffect" "f2ca2970-0882-412b-9c84-033ac7160ed7" @@ -3517,7 +3517,7 @@ data "VocalComponentSound" "Vocal_Component_CreateWater" data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "UseCosts" "ActionPoint:2;" data "SpellAnimation" "3ff87abf-1ea1-4c32-aadf-c822d74c7dc0,,;,,;7abe77ed-9c77-4eac-872c-5b8caed070b6,,;cb171bda-f065-4520-b470-e447f678ba1f,,;d8925ce4-d6d9-400c-92f5-ad772ef7f178,,;,,;eadedcce-d01b-4fbb-a1ae-d218f13aa5d6,,;,,;,," @@ -3556,7 +3556,7 @@ data "TargetSound" "Spell_Impact_Damage_Fire_BurningHands_L1to3" data "CastTextEvent" "Cast" data "Shape" "Cone" data "FrontOffset" "-2" -data "Range" "9" +data "Range" "12" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;" @@ -3594,7 +3594,7 @@ data "PrepareLoopSound" "Spell_Loop_Damage_Thunder_Gen_L1to3" data "CastSound" "Spell_Cast_Damage_Thunder_Thunderwave_L1to3_01" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "9" +data "Range" "12" data "Base" "3" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;" @@ -3635,7 +3635,7 @@ data "CastSound" "Spell_Cast_Damage_Radiant_Sunbeam_L6to8" data "TargetSound" "Spell_Impact_Damage_Radiant_Sunbeam_L6to8" data "CastTextEvent" "Cast" data "Shape" "Square" -data "Range" "18" +data "Range" "24" data "Base" "2" data "CycleConditions" "Enemy() and not Dead()" data "UseCosts" "ActionPoint:2;SpellSlotsGroup:1:1:6;" @@ -3881,7 +3881,7 @@ data "TooltipDamageList" "DealDamage(2d8,Force)" data "TooltipAttackSave" "Strength" data "Shape" "Cone" data "FrontOffset" "-2" -data "Range" "5" +data "Range" "6" data "Angle" "60" data "UseCosts" "ActionPoint:2;" data "SpellFlags" "AddFallDamageOnLand;IsHarmful;IsSpell;ImmediateCast" @@ -3977,7 +3977,7 @@ data "DescriptionParams" "Distance(3)" data "TooltipDamageList" "DealDamage(2d12+UnarmedMeleeAbilityModifier,Slashing);DealDamage(3d6,Necrotic)" data "CastSound" "Vocal_Component_Stop" data "FrontOffset" "-2" -data "Range" "5" +data "Range" "6" data "Angle" "120" data "SpellAnimation" "8b8bb757-21ce-4e02-a2f3-97d55cf2f90b,,;6606c30b-be1c-4f17-ae6b-1a591c80b18c,,;f4ac302b-1569-404f-bd52-1fe443e265df,,;e8a5c57f-855b-4227-acaa-11e8ce8d7d64,,;7bb52cd4-0b1c-4926-9165-fa92b75876a3,,;2b81c18b-9698-4262-a623-932c2bb1296d,,;0b07883a-08b8-43b6-ac18-84dc9e84ff50,,;,,;,," data "WeaponTypes" "Melee" @@ -4054,7 +4054,7 @@ data "PreviewCursor" "Cast" data "CastTextEvent" "Cast" data "Shape" "Cone" data "FrontOffset" "-2" -data "Range" "3" +data "Range" "6" data "Base" "2" data "Angle" "60" data "CycleConditions" "Enemy() and not Dead()" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Status_BOOST.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Status_BOOST.txt index 52abb8d9..595c604f 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Status_BOOST.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Status_BOOST.txt @@ -1442,19 +1442,19 @@ data "StatusType" "BOOST" using "StatusBonus1Attack" data "DisplayName" "hfd6e2530gef90g94f0g89cfgd42dabb606ee;1" data "Description" "hea0e0befg7b50g80ccgf10dgcd17e171f817;3" -data "DescriptionParams" "Distance(1.5)" +data "DescriptionParams" "Distance(2)" data "Icon" "statIcons_Momentum" data "StackId" "STATUS_BONUS_SPEED" -data "Boosts" "ActionResource(Movement, 1.5, 0);" +data "Boosts" "ActionResource(Movement, 2, 0);" data "RemoveConditions" "not Tagged('STAT_BON_SPEED_05')" new entry "StatusBonusSpeed10" type "StatusData" data "StatusType" "BOOST" using "StatusBonusSpeed05" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "StackPriority" "2" -data "Boosts" "ActionResource(Movement, 3, 0);" +data "Boosts" "ActionResource(Movement, 4, 0);" data "RemoveConditions" "not Tagged('STAT_BON_SPEED_10')" data "OnRemoveFunctors" "IF(Tagged('STAT_BON_SPEED_05')):ApplyStatus(StatusBonusSpeed05,100,-1)" @@ -1462,9 +1462,9 @@ new entry "StatusBonusSpeed15" type "StatusData" data "StatusType" "BOOST" using "StatusBonusSpeed10" -data "DescriptionParams" "Distance(4.5)" +data "DescriptionParams" "Distance(6)" data "StackPriority" "3" -data "Boosts" "ActionResource(Movement, 4.5, 0);" +data "Boosts" "ActionResource(Movement, 6, 0);" data "RemoveConditions" "not Tagged('STAT_BON_SPEED_15')" data "OnRemoveFunctors" "IF(Tagged('STAT_BON_SPEED_05') and not Tagged('STAT_BON_SPEED_10')):ApplyStatus(StatusBonusSpeed05,100,-1);IF(Tagged('STAT_BON_SPEED_10')):ApplyStatus(StatusBonusSpeed10,100,-1);" @@ -1472,9 +1472,9 @@ new entry "StatusBonusSpeed20" type "StatusData" data "StatusType" "BOOST" using "StatusBonusSpeed15" -data "DescriptionParams" "Distance(6)" +data "DescriptionParams" "Distance(8)" data "StackPriority" "4" -data "Boosts" "ActionResource(Movement, 6, 0);" +data "Boosts" "ActionResource(Movement, 8, 0);" data "RemoveConditions" "not Tagged('STAT_BON_SPEED_20')" data "OnRemoveFunctors" "IF(Tagged('STAT_BON_SPEED_05') and not Tagged('STAT_BON_SPEED_10') and not Tagged('STAT_BON_SPEED_15')):ApplyStatus(StatusBonusSpeed05,100,-1);IF(Tagged('STAT_BON_SPEED_10') and not Tagged('STAT_BON_SPEED_15')):ApplyStatus(StatusBonusSpeed10,100,-1);IF(Tagged('STAT_BON_SPEED_15')):ApplyStatus(StatusBonusSpeed15,100,-1);" @@ -1485,16 +1485,16 @@ using "StatusBonusSpeed05" data "DisplayName" "h4439e6bcgf972gf3c9g2388gfa4df58a8614;1" data "Description" "hdc7c1a4dg11c8gd1c3g7d82g02a16885c38c;3" data "StackId" "STATUS_PENALTY_SPEED" -data "Boosts" "ActionResource(Movement, -1.5, 0);" +data "Boosts" "ActionResource(Movement, -2, 0);" data "RemoveConditions" "not Tagged('STAT_PEN_SPEED_05')" new entry "StatusPenaltySpeed10" type "StatusData" data "StatusType" "BOOST" using "StatusPenaltySpeed05" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "StackPriority" "2" -data "Boosts" "ActionResource(Movement, -3, 0);" +data "Boosts" "ActionResource(Movement, -4, 0);" data "RemoveConditions" "not Tagged('STAT_PEN_SPEED_10')" data "OnRemoveFunctors" "IF(Tagged('STAT_PEN_SPEED_05')):ApplyStatus(StatusPenaltySpeed05,100,-1)" @@ -1504,10 +1504,10 @@ data "StatusType" "BOOST" using "StatusPenaltySpeed05" data "DisplayName" "h90699ecbg557cgbae8ge9acg1aae4f2c1da0;1" data "Description" "h5dd98765gab73gb8ddga44cgce2be1b186ef;2" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "StackId" "CIRCUMSTANCE_PENALTY_SPEED" data "StackPriority" "2" -data "Boosts" "ActionResource(Movement, -3, 0);" +data "Boosts" "ActionResource(Movement, -4, 0);" data "RemoveConditions" "not Tagged('CIRC_PEN_SPEED_10')" new entry "ItemBonus1AC" @@ -1811,10 +1811,16 @@ data "Icon" "Action_Dash_Bonus" data "StackId" "MOVE_READY" data "StackType" "Ignore" data "Boosts" "UnlockSpellVariant(StrideCostSpellCheck(), ModifyTooltipDescription(), ModifyUseCosts(Add,ActionPoint,1,0))" +data "RemoveConditions" "not (HasActionResource('Movement',90,0,true,true) and HasStatus('HAS_NOT_MOVED'))" data "RemoveEvents" "OnMove" data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog" -data "OnApplyFunctors" "IF( AutoStride() ):RestoreResource(Movement,100%,0,true); IF( not AutoStride() ):UseActionResource(Movement,100%,0,true); IF( not AutoStride() ):RemoveStatus(DEBUG_RESET_MOVE)" -data "OnRemoveFunctors" "AI_IGNORE:IF( RemoveCause(StatusRemoveCause.Condition) and TurnBased() ):ApplyStatus(DEBUG_CAST_STRIDE,100,1);" +data "OnApplyFunctors" "IF(HasActionResource('ActionPoint',100,0,true,true)):ApplyStatus(HAS_NOT_MOVED,100,-1);IF(AutoStride()):RestoreResource(Movement,100%,0);IF(not AutoStride()):UseActionResource(Movement,100%,0,true);IF(not AutoStride() and HasStatus('HAS_NOT_MOVED')):RestoreResource(Movement,10%,0);IF(not AutoStride()):RemoveStatus(DEBUG_RESET_MOVE)" +data "OnRemoveFunctors" "AI_IGNORE:IF(RemoveCause(StatusRemoveCause.Condition) and TurnBased()):ApplyStatus(DEBUG_CAST_STRIDE,100,1);RemoveStatus(HAS_NOT_MOVED);" + +new entry "HAS_NOT_MOVED" +type "StatusData" +data "StatusType" "BOOST" +data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator" new entry "DEBUG_CAST_STRIDE" type "StatusData" @@ -1848,7 +1854,7 @@ data "StatusType" "BOOST" using "DISENGAGE" data "SoundVocalStart" "NONE" data "RemoveConditions" "(StatusId('SG_DifficultTerrain') and not HasPassive('FeatherStep')) or not IsStatusEvent(StatusEvent.OnStatusApplied)" -data "OnApplyFunctors" "UseActionResource(Movement,100%,0,true);AI_IGNORE:RestoreResource(Movement,3,0);IF(not Tagged('DOUBLE_STEP')):UseActionResource(Movement,1.5,0,true)" +data "OnApplyFunctors" "UseActionResource(Movement,100%,0,true);AI_IGNORE:RestoreResource(Movement,4,0);IF(not Tagged('DOUBLE_STEP')):UseActionResource(Movement,2,0,true)" new entry "INTERRUPT_FREE_MOVEMENT" type "StatusData" @@ -1885,6 +1891,14 @@ data "StatusType" "BOOST" using "ENSNARED" data "RemoveEvents" "OnTurn;OnAttack;OnSpellCast;OnMove;OnCombatEnded" +new entry "MANUAL_STRIDE" +type "StatusData" +data "StatusType" "BOOST" +data "DisplayName" "he42cee01g642egd323gc84dg279c4420de44;1" +data "Icon" "Action_Fighter_EvasiveFootwork" +data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator" +data "OnApplyFunctors" "IF(HasStatus('HAS_NOT_MOVED')):UseActionResource(Movement,90%,0,true);IF(not HasStatus('HAS_NOT_MOVED') and HasStatus('DEBUG_RESET_MOVE')):UseActionResource(Movement,100%,0,true);RemoveStatus(DEBUG_RESET_MOVE)" + new entry "STEALTH_AND_CONCEALMENT" type "StatusData" data "StatusType" "BOOST" @@ -2335,7 +2349,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h95d70712g5e0fg677dg3143ge087fca6dfec;1" data "Description" "hcdfb0b1eg4e17g394fg05f6gfbc3961a17bb;4" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "Status_Blinded" data "StillAnimationType" "Blinded" data "StillAnimationPriority" "Blinded" @@ -2345,7 +2359,7 @@ data "SoundStop" "Spell_Status_Blinded_MO_Stop" data "StackId" "BLINDED" data "StackPriority" "1" data "StackType" "Ignore" -data "Boosts" "SightRangeMaximum(3);ActionResourceConsumeMultiplier(Movement, 2,0);Tag(STAT_PEN_3PERC);Tag(OFF_GUARD);" +data "Boosts" "SightRangeMaximum(4);ActionResourceConsumeMultiplier(Movement, 2,0);Tag(STAT_PEN_3PERC);Tag(OFF_GUARD);" data "StatusPropertyFlags" "InitiateCombat;Blind" data "OnApplyFunctors" "RemoveStatus(DAZZLED);RemoveStatus(DAZZLED_APPLY);" data "OnRemoveFunctors" "IF(Tagged('DAZZLED')):ApplyStatus(DAZZLED, 100, -1)" @@ -3010,7 +3024,7 @@ new entry "CRITSPEC_POLE_UNLOCK" type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h68cc210ag3193ga2eeg1bfagf86aa6fe4a42;1" -data "Boosts" "UnlockSpell(Teleportation_Critspec_Polearm)" +data "Boosts" "UnlockSpell(Target_Critspec_Polearm_Spell);" data "RemoveEvents" "OnMove;OnSpellCast" data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator;BringIntoCombat" data "StatusEffect" "04e49f47-cceb-4026-a2b2-a14c03f321ef" @@ -3212,7 +3226,7 @@ using "RAGE" data "DisplayName" "h8eef8440gf41cgbdf0gd1fagca870d8a3c64;1" data "Description" "hbc5d04b3gf8f1ge02dg160cgb8e8e49a84fe;1" data "DescriptionParams" "DealDamage(LevelMapValue(ElementalRage),Fire)" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Self()):ApplyStatus(CONCEALED_BLOCK_ELEMENTAL_RAGE,100,0)" data "AuraFlags" "IgnoreItems" data "Boosts" "Tag(VFX_RAGE);Attribute(ForceMainhandAlternativeEquipBones);IF(SpellId('Target_FuriousFinish')):CharacterWeaponDamage(RAGE_FIRE.Duration);" @@ -3301,8 +3315,7 @@ new entry "DARKVISION" type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h35f70df2g50a7g970fg20c2g06bd15966995;1" -data "Description" "h83f2aab6gef66g3ea8gb08fgd9ed10c0e3c1;1" -data "DescriptionParams" "Distance(999)" +data "Description" "h83f2aab6gef66g3ea8gb08fgd9ed10c0e3c1;2" data "Icon" "Spell_Evocation_Darkvision" data "StackId" "DARKVISION" data "Boosts" "DarkvisionRangeMin(999);ActiveCharacterLight(051648e6-f05a-e41f-e398-ffd5cd148989);" @@ -3531,7 +3544,7 @@ type "StatusData" data "StatusType" "BOOST" using "CourageousAnthem" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(CourageousAnthem)" data "AuraFlags" "IgnoreItems" @@ -3546,7 +3559,7 @@ type "StatusData" data "StatusType" "BOOST" using "CourageForte2" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(CourageForte2)" data "AuraFlags" "IgnoreItems" @@ -3560,7 +3573,7 @@ type "StatusData" data "StatusType" "BOOST" using "CourageForte3" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(CourageForte3)" data "AuraFlags" "IgnoreItems" @@ -3604,7 +3617,7 @@ type "StatusData" data "StatusType" "BOOST" using "SongOfStrengthStatus" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(SongOfStrengthStatus)" data "AuraFlags" "IgnoreItems" @@ -3620,7 +3633,7 @@ type "StatusData" data "StatusType" "BOOST" using "StrengthForte2" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(StrengthForte2)" data "AuraFlags" "IgnoreItems" @@ -3635,7 +3648,7 @@ type "StatusData" data "StatusType" "BOOST" using "StrengthForte3" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(StrengthForte3)" data "AuraFlags" "IgnoreItems" @@ -3678,7 +3691,7 @@ type "StatusData" data "StatusType" "BOOST" using "RallyingAnthemStatus" data "StackPriority" "3" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(RallyingAnthemStatus)" data "AuraFlags" "IgnoreItems" @@ -3692,7 +3705,7 @@ new entry "RallyingForteAura2" type "StatusData" data "StatusType" "BOOST" using "RallyingForte2" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(RallyingForte2)" data "AuraFlags" "IgnoreItems" @@ -3705,7 +3718,7 @@ new entry "RallyingForteAura3" type "StatusData" data "StatusType" "BOOST" using "RallyingForte3" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(RallyingForte3)" data "AuraFlags" "IgnoreItems" @@ -3737,7 +3750,7 @@ data "Icon" "Action_Monster_GiantEagle_Fly" data "StackId" "SONGBIRDS_CALL" data "StackPriority" "1" data "StackType" "Overwrite" -data "AuraRadius" "5" +data "AuraRadius" "6" data "AuraStatuses" "IF(not Self()):ApplyStatus(SONGBIRDS_CALL_DAMAGE,100,0);IF(not Self()):ApplyStatus(CONCEALED_BLOCK_SONGBIRDS_CALL,100,0);IF(not Self()):ApplyStatus(DAZZLED_BLOCK_SONGBIRDS_CALL,100,0);IF(not Self()):ApplyStatus(SONGBIRDS_CALL_AURA,100,0);" data "AuraFlags" "IgnoreItems;DangerousForPathfinding" data "TickType" "EndTurn" @@ -3762,7 +3775,7 @@ data "DisplayName" "h4ba57a7dgd9c3ge6f2g5c59gcf3a1b232f0c;1" data "StackId" "SONGBIRDS_CALL_AURA" data "StackPriority" "1" data "StackType" "Ignore" -data "AuraRadius" "10" +data "AuraRadius" "16" data "AuraStatuses" "IF(not Self() and (HasStatus('SONGBIRDS_CALL_AURA', context.Target) or HasStatus('SONGBIRDS_CALL', context.Target))):ApplyStatus(CONCEALED_BLOCK_SONGBIRDS_CALL, 100, 0); IF(not Self() and (HasStatus('SONGBIRDS_CALL_AURA', context.Target) or HasStatus('SONGBIRDS_CALL', context.Target))):ApplyStatus(DAZZLED_BLOCK, 100, 0)" data "AuraFlags" "IgnoreItems" data "Boosts" "Tag(DAZZLED);" @@ -3813,8 +3826,8 @@ data "Icon" "Action_Monster_Banite_AuraOfTerror" data "StackId" "AURA_OF_TERROR" data "StackType" "Ignore" data "AuraRadius" "2" -data "AuraStatuses" "IF(Enemy()):ApplyStatus(FRIGHT_PERPETUAL);" -data "AuraFlags" "DangerousOnlyToEnemies;IgnoreItems;DangerousForPathfinding" +data "AuraStatuses" "IF(Enemy()):ApplyStatus(FEAR_LOCK,100,0)" +data "AuraFlags" "DangerousOnlyToEnemies;IgnoreItems" data "TickType" "EndTurn" data "StatusEffect" "92797a80-0c35-4735-a573-d145dd50da02" @@ -3823,11 +3836,10 @@ type "StatusData" data "StatusType" "BOOST" using "DRAGON_ROAR_AURA" data "Icon" "Action_MagicItem_HowlOfTheDead" +data "StackId" "DIRGE_OF_DOOM" data "StackType" "Overwrite" -data "AuraRadius" "9" -data "AuraStatuses" "IF(Enemy()):ApplyStatus(FRIGHTENED)" +data "AuraRadius" "12" data "TickType" "StartTurn" -data "Boosts" "RollBonus(MeleeWeaponDamage,999);" data "StatusEffect" "f662eea9-51d6-41c6-8d23-3059b720cd9b" new entry "SpiralRecast" @@ -3843,7 +3855,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "hf30a1c41g35a0g450fg63beg82e5ff79e183;1" data "Description" "ha26c3ea7g4627g4339g4520gee5409dab49f;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "Spell_Transmutation_Longstrider" data "SoundLoop" "Spell_Status_Longstrider_MO" data "SoundStop" "Spell_Status_Longstrider_MO_Stop" @@ -3857,6 +3869,7 @@ type "StatusData" data "StatusType" "BOOST" using "LONGSTRIDER" data "DisplayName" "h871785deg922agc1ecg7d5bgb85e31aeca6e;1" +data "DescriptionParams" "Distance(4)" data "StackId" "TRIPLE_TIME" data "Boosts" "Tag(STAT_BON_SPEED_10);" data "StatusPropertyFlags" "TickingWithSource" @@ -3865,8 +3878,9 @@ new entry "TRIPLE_TIME_LINGERING" type "StatusData" data "StatusType" "BOOST" using "TRIPLE_TIME" +data "Description" "h2d2a147bgc120g6cd9g382fg8c0605289afa;1" data "StackPriority" "4" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF( not Enemy() ):ApplyStatus(TRIPLE_TIME)" data "AuraFlags" "IgnoreItems" data "TickType" "StartTurn" @@ -3899,7 +3913,7 @@ data "DisplayName" "h7ad436ecg86ccge122g3c1eg2212fea0e050;1" data "StackId" "COUNTER_PERFORMANCE_SOURCE" data "StackPriority" "1" data "StackType" "Ignore" -data "AuraRadius" "18" +data "AuraRadius" "24" data "AuraStatuses" "IF(Ally()):ApplyStatus(COUNTER_PERFORMANCE_ALLY,100,0)" data "AuraFlags" "IgnoreItems" data "TickType" "StartTurn" @@ -3963,7 +3977,7 @@ data "StackId" "COUNTER_PERFORMANCE_USED" data "StackPriority" "1" data "StackType" "Ignore" data "TickType" "EndTurn" -data "TickFunctors" "ApplyStatus(COUNTER_PERFORMANCE_SOURCE,100,-1);ApplyStatus(COUNTER_PERFORMANCE_ROLL,100,1d20);ApplyStatus(COUNTER_PERFORMANCE_ALLY,100,-1);" +data "TickFunctors" "IF(HasActionResource('KiPoint', 1, 0, false, false, context.Source)):ApplyStatus(COUNTER_PERFORMANCE_SOURCE,100,-1);IF(HasActionResource('KiPoint', 1, 0, false, false, context.Source)):ApplyStatus(COUNTER_PERFORMANCE_ROLL,100,1d20);IF(HasActionResource('KiPoint', 1, 0, false, false, context.Source)):ApplyStatus(COUNTER_PERFORMANCE_ALLY,100,-1);" data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator" new entry "COUNTER_PERFORMANCE_VISUALS" @@ -3991,13 +4005,13 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h55344d0dg2bf4g34bcg4fa6g08a3a0d951fd;1" data "Description" "hc4192741g0fe0gf53cg4ea5g775757f2d1f5;1" -data "DescriptionParams" "Distance(4.5)" +data "DescriptionParams" "Distance(6)" data "Icon" "Action_Paladin_AuraOfProtection" data "FormatColor" "Gold" data "StackId" "CHAMPION_AURA" data "StackType" "Ignore" -data "AuraRadius" "9" -data "AuraStatuses" "IF( DistanceToTargetLessThan(4.5) or HasStatus('EXPAND_AURA',context.Source) ):ApplyStatus(CHAMPION_AURA_STATUS); IF( HasPassive('AuraOfCouragePathfinder',context.Source) and Ally() and DistanceToTargetLessThan(4.5) or HasStatus('EXPAND_AURA',context.Source) ):ApplyStatus(AURA_OF_COURAGE_BUFF)" +data "AuraRadius" "12" +data "AuraStatuses" "IF( DistanceToTargetLessThan(6) or HasStatus('EXPAND_AURA',context.Source) ):ApplyStatus(CHAMPION_AURA_STATUS); IF( HasPassive('AuraOfCouragePathfinder',context.Source) and Ally() and DistanceToTargetLessThan(6) or HasStatus('EXPAND_AURA',context.Source) ):ApplyStatus(AURA_OF_COURAGE_BUFF)" data "AuraFlags" "IgnoreItems;ShouldCheckLOS;AIIgnoreOnSelf" data "TickType" "StartRound" data "RemoveConditions" "HasStatus('SG_Unconscious') or not Combat()" @@ -4045,7 +4059,7 @@ data "StatusType" "BOOST" using "RAISE_SHIELD" data "SoundLoop" "Spell_Status_SpiritGuardian_ST" data "SoundStop" "Spell_Status_SpiritGuardian_ST_Stop" -data "AuraRadius" "9" +data "AuraRadius" "12" data "AuraStatuses" "IF( Character() and Ally() and HasStatus('CHAMPION_AURA_STATUS',context.Target,context.Source)):ApplyStatus(SpiritShields)" data "AuraFlags" "IgnoreItems;DangerousOnlyToEnemies;DangerousForPathfinding;ShouldCheckLOS" data "StatusGroups" "SG_RemoveOnRespec" @@ -4103,7 +4117,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h21a18bb6g962ag1132gfd7cg8bcc65f7183c;1" data "Description" "hda0e2a5egea1eg4119g720ag3b595283a2b8;1" -data "DescriptionParams" "Distance(9)" +data "DescriptionParams" "Distance(12)" data "Icon" "Action_Paladin_AuraOfDevotion" data "SoundLoop" "Spell_Status_AuraOfLeadership_MO" data "SoundStop" "Spell_Status_AuraOfLeadership_MO_Stop" @@ -4356,14 +4370,6 @@ data "RemoveConditions" "HasStatus('SG_Frightened',context.Target)" data "RemoveEvents" "OnDamage" data "TooltipDamage" "DamageBonus(4)" -new entry "FRIGHT_PERPETUAL" -type "StatusData" -data "StatusType" "BOOST" -data "DisplayName" "h904d0ce2g251fg6ec8ga9fcg62a466c04f9c;1" -data "StackType" "Ignore" -data "Passives" "DragonRoar_Fright" -data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator" - new entry "InnerUpheavalStatus" type "StatusData" data "StatusType" "BOOST" @@ -4386,12 +4392,13 @@ new entry "CraneStanceStatus" type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h78df480fg0fb0g5077g5a31g9403b257b11c;1" -data "Description" "h3097e1adg0bfcg907fg9b8ag95459a8ef415;1" +data "Description" "h3097e1adg0bfcg907fg9b8ag95459a8ef415;2" +data "DescriptionParams" "Distance(2)" data "Icon" "Spell_Conjuration_FindFamiliar_Raven" data "StackId" "STANCE" data "StackPriority" "0" data "StackType" "Overwrite" -data "Boosts" "AttackSpellOverride(Target_CraneWing, Target_MainHandAttack);AttackSpellOverride(Target_CraneWing, Target_UnarmedAttack);Tag(CIRC_BON_1AC);JumpMaxDistanceBonus(1.5)" +data "Boosts" "AttackSpellOverride(Target_CraneWing, Target_MainHandAttack);AttackSpellOverride(Target_CraneWing, Target_UnarmedAttack);Tag(CIRC_BON_1AC);JumpMaxDistanceBonus(2);" data "Passives" "Block_NonUnarmedStrike" data "RemoveConditions" "WearingArmor(context.Source) or not Combat()" data "RemoveEvents" "OnCombatEnded;OnEquip" @@ -4439,7 +4446,7 @@ type "StatusData" data "StatusType" "BOOST" using "CraneStanceStatus" data "DisplayName" "ha92ca62ag146dge407gce1ega62fa237901f;1" -data "Description" "h65894b23g0c8dg087eg50e2g72c6175fe2ca;1" +data "Description" "h65894b23g0c8dg087eg50e2g72c6175fe2ca;2" data "Icon" "Action_Monster_Duergar_MentalArrow" data "Boosts" "" data "Passives" "" @@ -4514,7 +4521,8 @@ type "StatusData" data "StatusType" "BOOST" using "CraneStanceStatus" data "DisplayName" "h68b2b67dg73b4g009bg3884gd68de5de5c82;1" -data "Description" "ha52104adgeefbg639ageeb9g7052e6a66243;1" +data "Description" "ha52104adgeefbg639ageeb9g7052e6a66243;2" +data "DescriptionParams" "Distance(12)" data "Icon" "Action_Monk_FangsOfTheFireSnake" data "Boosts" "AttackSpellOverride(Target_WindCrash, Target_MainHandAttack);AttackSpellOverride(Target_WindCrash, Target_UnarmedAttack);" data "RemoveConditions" "not Combat()" @@ -4653,7 +4661,7 @@ type "StatusData" data "StatusType" "BOOST" using "LONGSTRIDER" data "DisplayName" "h7dee90aegcf6bg5d6bg3021gcda719e4ffa9;1" -data "DescriptionParams" "Distance(6)" +data "DescriptionParams" "Distance(8)" data "StackId" "SHIFTERS_SPEED" data "Boosts" "Tag(STAT_BON_SPEED_20);" @@ -4729,7 +4737,7 @@ data "Icon" "Spell_Enchantment_Bless" data "StackId" "BLESS_AURA" data "StackPriority" "0" data "StackType" "Overwrite" -data "AuraRadius" "4" +data "AuraRadius" "6" data "AuraStatuses" "Target:IF(Character() and MentalSpell() and Ally() and not (Dead() or HasStatus('KNOCKED_OUT'))):ApplyStatus(BLESS,100,-1)" data "TickType" "StartTurn" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain);" @@ -4740,63 +4748,63 @@ new entry "BLESS_AURA_2" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA" -data "AuraRadius" "7" +data "AuraRadius" "10" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_2);" new entry "BLESS_AURA_3" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "10" +data "AuraRadius" "14" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_3);" new entry "BLESS_AURA_4" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "13" +data "AuraRadius" "18" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_4);" new entry "BLESS_AURA_5" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "16" +data "AuraRadius" "22" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_5);" new entry "BLESS_AURA_6" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "19" +data "AuraRadius" "26" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_6);" new entry "BLESS_AURA_7" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "22" +data "AuraRadius" "30" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_7);" new entry "BLESS_AURA_8" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "25" +data "AuraRadius" "34" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_8);" new entry "BLESS_AURA_9" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "28" +data "AuraRadius" "38" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_9);" new entry "BLESS_AURA_10" type "StatusData" data "StatusType" "BOOST" using "BLESS_AURA_2" -data "AuraRadius" "31" +data "AuraRadius" "42" data "Boosts" "Tag(STAT_BON_1ATTACK);UnlockSpell(Shout_Bless_Sustain_10);" new entry "ProtectiveWardStatus" @@ -4835,35 +4843,35 @@ new entry "ProtectiveWards_AURA_2" type "StatusData" data "StatusType" "BOOST" using "ProtectiveWards_AURA" -data "AuraRadius" "3" +data "AuraRadius" "4" data "Boosts" "UnlockSpell(Shout_ProtectiveWardsSustain_2);Tag(STAT_BON_1AC);" new entry "ProtectiveWards_AURA_3" type "StatusData" data "StatusType" "BOOST" using "ProtectiveWards_AURA" -data "AuraRadius" "5" +data "AuraRadius" "6" data "Boosts" "UnlockSpell(Shout_ProtectiveWardsSustain_3);Tag(STAT_BON_1AC);" new entry "ProtectiveWards_AURA_4" type "StatusData" data "StatusType" "BOOST" using "ProtectiveWards_AURA" -data "AuraRadius" "6" +data "AuraRadius" "8" data "Boosts" "UnlockSpell(Shout_ProtectiveWardsSustain_4);Tag(STAT_BON_1AC);" new entry "ProtectiveWards_AURA_5" type "StatusData" data "StatusType" "BOOST" using "ProtectiveWards_AURA" -data "AuraRadius" "7" +data "AuraRadius" "10" data "Boosts" "UnlockSpell(Shout_ProtectiveWardsSustain_5);Tag(STAT_BON_1AC);" new entry "ProtectiveWards_AURA_6" type "StatusData" data "StatusType" "BOOST" using "ProtectiveWards_AURA" -data "AuraRadius" "9" +data "AuraRadius" "12" data "Boosts" "UnlockSpell(Shout_ProtectiveWardsSustain_6);Tag(STAT_BON_1AC);" new entry "BENEDICTION" @@ -4892,7 +4900,7 @@ data "Icon" "PassiveAction_WardingFlare" data "StackId" "BENEDICTION_AURA" data "StackPriority" "0" data "StackType" "Overwrite" -data "AuraRadius" "4" +data "AuraRadius" "6" data "AuraStatuses" "Target:IF(Character() and MentalSpell() and not Enemy() and not (Dead() or HasStatus('KNOCKED_OUT'))):ApplyStatus(BENEDICTION,100,-1)" data "TickType" "StartTurn" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_1);Tag(STAT_BON_1AC);" @@ -4904,63 +4912,63 @@ type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA" data "DisplayName" "h8130b0c4g1cccg6fdbg5765gc074debda765;1" -data "AuraRadius" "7" +data "AuraRadius" "10" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_2);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_3" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "10" +data "AuraRadius" "14" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_3);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_4" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "13" +data "AuraRadius" "18" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_4);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_5" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "16" +data "AuraRadius" "22" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_5);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_6" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "19" +data "AuraRadius" "26" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_6);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_7" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "22" +data "AuraRadius" "30" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_7);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_8" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "25" +data "AuraRadius" "34" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_8);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_9" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "28" +data "AuraRadius" "38" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_9);Tag(STAT_BON_1AC);" new entry "BENEDICTION_AURA_10" type "StatusData" data "StatusType" "BOOST" using "BENEDICTION_AURA_2" -data "AuraRadius" "31" +data "AuraRadius" "42" data "Boosts" "UnlockSpell(Shout_Benediction_Sustain_10);Tag(STAT_BON_1AC);" new entry "BENEDICTION_SUSTAIN_BLOCKED" @@ -5039,7 +5047,7 @@ data "SoundStop" "Misc_Status_Poison_MO_Stop" data "StackId" "ToxicCloudAura" data "StackPriority" "1" data "StackType" "Overwrite" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(ToxicCloudStatus_Rank5);" data "TickType" "StartRound" data "StatusPropertyFlags" "InitiateCombat;BringIntoCombat" @@ -5091,7 +5099,7 @@ data "Description" "hd2c43654g0a33g5191g24dag6b6d046e7276;1" data "Icon" "Spell_Divination_Guidance" data "FormatColor" "Yellow" data "StackId" "FieldOfLifeAura" -data "AuraRadius" "6" +data "AuraRadius" "8" data "TickType" "StartTurn" data "TooltipDamage" "RegainHitPoints(1d8)" data "TickFunctors" "IF(not Tagged('UNDEAD')):RegainHitPoints(1d8);IF(Tagged('UNDEAD')):DealDamage(1d8,Radiant,Magical);" @@ -5171,7 +5179,7 @@ data "Icon" "Spell_Enchantment_Bane" data "StackId" "BANE_AURA" data "StackPriority" "0" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "TARGET:IF(Character() and MentalSpell() and Enemy() and not (Dead() or HasStatus('KNOCKED_OUT'))):ApplyStatus(BANE_TECHNICAL,100,-1)" data "TickType" "StartTurn" data "Boosts" "UnlockSpell(Shout_Bane_Sustain);" @@ -5182,63 +5190,63 @@ new entry "BANE_AURA_2" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "6" +data "AuraRadius" "8" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_2);" new entry "BANE_AURA_3" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "9" +data "AuraRadius" "12" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_3);" new entry "BANE_AURA_4" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "12" +data "AuraRadius" "16" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_4);" new entry "BANE_AURA_5" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "15" +data "AuraRadius" "20" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_5);" new entry "BANE_AURA_6" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "18" +data "AuraRadius" "24" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_6);" new entry "BANE_AURA_7" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "21" +data "AuraRadius" "28" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_7);" new entry "BANE_AURA_8" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "24" +data "AuraRadius" "32" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_8);" new entry "BANE_AURA_9" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "27" +data "AuraRadius" "36" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_9);" new entry "BANE_AURA_10" type "StatusData" data "StatusType" "BOOST" using "BANE_AURA" -data "AuraRadius" "30" +data "AuraRadius" "40" data "Boosts" "UnlockSpell(Shout_Bane_Sustain_10);" new entry "WEB_WALKER" @@ -5558,12 +5566,12 @@ type "StatusData" data "StatusType" "BOOST" using "LIGHT" data "DisplayName" "h026694a0gc230g0624gfe62gd627fc50fe3f;1" -data "DescriptionParams" "Distance(6)" +data "DescriptionParams" "Distance(8)" data "Icon" "PassiveFeature_Generic_Darkness" data "StackId" "MOON_TOUCH" data "StackType" "Overwrite" data "TickType" "EndTurn" -data "Boosts" "GameplayLight(3,false,0.1)" +data "Boosts" "GameplayLight(8,false,0.1);" data "RemoveEvents" "OnCombatEnded" data "TickFunctors" "ApplyStatus(MOON_WAX)" data "StatusPropertyFlags" "DisableCombatlog" @@ -5576,7 +5584,7 @@ data "StatusType" "BOOST" using "MOON_NEW" data "DisplayName" "hbf0b862fg6893g1b52g335dg34df368d1304;1" data "Icon" "PassiveAction_WardingFlare" -data "Boosts" "GameplayLight(3,false,0.1); Tag(STAT_BON_1ATTACK);Tag(STAT_BON_3DAMAGE)" +data "Boosts" "GameplayLight(8,false,0.1);Tag(STAT_BON_1ATTACK);Tag(STAT_BON_3DAMAGE);" data "TickFunctors" "ApplyStatus(MOON_FULL)" data "StatusEffect" "326dcd92-d609-4a82-93cb-4023f914fecd" @@ -5586,7 +5594,7 @@ data "StatusType" "BOOST" using "MOON_NEW" data "DisplayName" "hce9d71f2g0fb5g9f5fgdae0g31d6795eba19;1" data "Icon" "PassiveFeature_Generic_Light" -data "Boosts" "GameplayLight(3,false,0.1); Tag(STAT_BON_1ATTACK);Tag(STAT_BON_1AC);Tag(STAT_BON_1SAVES);DamageBonus(4)" +data "Boosts" "GameplayLight(8,false,0.1);Tag(STAT_BON_1ATTACK);Tag(STAT_BON_1AC);Tag(STAT_BON_1SAVES);DamageBonus(4);" data "TickFunctors" "ApplyStatus(MOON_WANE)" data "StatusEffect" "efc1e71f-bf3c-4053-99ef-dc9475cdcfb8" @@ -5596,7 +5604,7 @@ data "StatusType" "BOOST" using "MOON_NEW" data "DisplayName" "h1dd83accg425cg116dgde99g1433220a00dc;1" data "Icon" "PassiveFeature_WardingFlare" -data "Boosts" "GameplayLight(3,false,0.1); Tag(STAT_BON_1AC);Tag(STAT_BON_1SAVES)" +data "Boosts" "GameplayLight(8,false,0.1);Tag(STAT_BON_1AC);Tag(STAT_BON_1SAVES);" data "TickFunctors" "ApplyStatus(MOON_NEW)" data "StatusEffect" "0b3c44c7-36e1-4d26-849b-e42ec3ea22cf" @@ -5621,8 +5629,8 @@ data "SoundStart" "Spell_Status_GlobeOfInvulnerability_Start" data "SoundLoop" "Spell_Status_GlobeOfInvulnerability_MO" data "SoundStop" "Spell_Status_GlobeOfInvulnerability_End" data "StackPriority" "2" -data "AuraRadius" "5" -data "AuraStatuses" "IF(DistanceToTargetLessThan(4.5) and Ally()):ApplyStatus(PROTECTOR_SPHERE)" +data "AuraRadius" "6" +data "AuraStatuses" "IF(Ally()):ApplyStatus(PROTECTOR_SPHERE)" data "StatusEffect" "9fa7b901-439a-4425-ae92-b027775cf5af" new entry "PROTECTOR_SPHERE_DR" @@ -5753,7 +5761,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h1525ac43gee42gb230g8218g1225dab0c075;1" data "Description" "h35bc0aa6gc896g7a30g6facg30dfd28d25bb;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "PassiveFeature_Sentinel_ZeroSpeed" data "StillAnimationType" "Weakened" data "StillAnimationPriority" "Weakened" @@ -5799,7 +5807,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h351cc5fbg1f53gba48gfbc4g06a1e9d7327f;1" data "Description" "hbce0e7edg456egf243g43d2g7ff7eebd23ed;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "Spell_Transmutation_ThornWhip" data "StillAnimationType" "Snared" data "StillAnimationPriority" "Snared" @@ -6023,7 +6031,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h0116d40bg43c7gf8cfg4933g0db53235736c;1" data "Description" "hb08fbac1g97a7ga24bg99f3gf53c52b631bb;1" -data "DescriptionParams" "Distance(18)" +data "DescriptionParams" "Distance(24)" data "Icon" "Spell_Divination_TrueStrike" data "StackType" "Overwrite" data "TickType" "EndTurn" @@ -6549,8 +6557,8 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h87e2bea9gcc98gd47ag3a1dg8a1ddb4f3a3d;1" data "SoundVocalStart" "ALERT" -data "AuraRadius" "5" -data "AuraStatuses" "IF( DistanceToTargetLessThan(4.5) ):ApplyStatus(FAMILIAR_AURA_STATUS)" +data "AuraRadius" "6" +data "AuraStatuses" "ApplyStatus(FAMILIAR_AURA_STATUS)" data "AuraFlags" "IgnoreItems;ShouldCheckLOS;AIIgnoreOnSelf" data "TickType" "EndTurn" data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator;TickingWithSource" @@ -6603,7 +6611,7 @@ data "DisplayName" "hf0779113gb172g11dag713ag01ce09d0563c;1" data "Icon" "PassiveFeature_Banite_TacticalDiscipline" data "FormatColor" "Gold" data "AuraRadius" "2" -data "AuraStatuses" "IF( DistanceToTargetLessThan(1.5) and Enemy() ):ApplyStatus(OFF_BALANCED)" +data "AuraStatuses" "IF(Enemy()):ApplyStatus(OFF_BALANCED)" data "AuraFlags" "IgnoreItems;ShouldCheckLOS;AIIgnoreOnSelf;DangerousForPathfinding;DangerousOnlyToEnemies" data "TickType" "StartTurn" data "StatusPropertyFlags" "TickingWithSource" @@ -7051,7 +7059,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h98f45644gf7a9gebe5g5d61gf3491739c252;1" data "Description" "h181cf5f7gca83g0909g62a6g2188a0d76f56;1" -data "DescriptionParams" "Distance(3)" +data "DescriptionParams" "Distance(4)" data "Icon" "Action_Cleric_InvokeDuplicity" data "StackId" "INVOKE_DUPLICITY" data "Boosts" ";" @@ -7238,7 +7246,7 @@ data "SoundLoop" "Spell_Status_CloudOfDaggers_ST" data "SoundStop" "Spell_Status_CloudOfDaggers_ST_Stop" data "StackId" "PetalStorm_Aura_Stack" data "StackPriority" "4" -data "AuraRadius" "4" +data "AuraRadius" "6" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(PetalStorm_Damage_Rank4);" data "TickType" "StartTurn" data "StatusPropertyFlags" "InitiateCombat;BringIntoCombat" @@ -7255,7 +7263,7 @@ data "Description" "h8fa2078eg1a78gead0g7a05g065931851cc9;3" data "DescriptionParams" "DealDamage(5d10,Slashing);DealDamage(1d4,Slashing)" data "Icon" "Spell_Conjuration_FogCloud" data "StackId" "RustCloud_Aura_Stack" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(RustCloudDamage_Rank4,100,0);" data "AuraFlags" "IgnoreItems;DangerousForPathfinding" data "StatusEffect" "c144df98-a4f9-4e86-8b91-57ee5359a61f" @@ -7342,7 +7350,7 @@ using "CLOUD_OF_DAGGERS_AURA" data "DisplayName" "h9d9376c1gb0d2g485ag5a73gb80f191922c9;1" data "Description" "h81bf67b6gd63bgafb8gadd9gbad1c74fb54e;1" data "DescriptionParams" "DealDamage(1d10,Bludgeoning)" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(AnimatedAssault_Status);IF(IsCurrentTurnInCombat(GetOwner(context.Source)) or not Combat()):ApplyStatus(ANIMATED_ASSAULT)" data "TickType" "EndRound" data "TickFunctors" "IF(not HasStatus('AnimatedAssault_Owner',GetOwner())):RemoveStatus(AnimatedAssault_Status_Aura)" @@ -7741,7 +7749,7 @@ data "DisplayName" "h698a03e1g4a9fgfd47gf071g91a1ebca3a70;1" data "Description" "h9311f837g1461gad7bg4c3cgdfcd9986c3f7;1" data "Icon" "Spell_Abjuration_ProtectionFromEvilAndGood" data "FormatColor" "White" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Enemy()):ApplyStatus(StatusBonus1Saves,100,1);IF(not Enemy()):ApplyStatus(StatusBonus1AC,100,1)" data "TickType" "EndTurn" @@ -7954,7 +7962,7 @@ data "Description" "h68aa0cdfgf5ccgc2f5g33e8gbaf882cc14e1;1" data "Icon" "Status_Charmed" data "StackId" "HypnotizeAura" data "StackPriority" "1" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') and VisualSpell()):ApplyStatus(HyponotizeStatus,100,0)" data "AuraFlags" "IgnoreItems" data "StatusPropertyFlags" "InitiateCombat;BringIntoCombat" @@ -7970,6 +7978,7 @@ data "AuraRadius" "" data "AuraStatuses" "" data "Boosts" "Tag(DAZZLED);" data "OnRemoveFunctors" "" +data "StatusEffect" "" new entry "AshCloudAura_Rank2" type "StatusData" @@ -7981,7 +7990,7 @@ data "DescriptionParams" "DealDamage(1d4,Fire)" data "FormatColor" "Fire" data "StackId" "AshCloud" data "StackPriority" "2" -data "AuraRadius" "5" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(AshCloudAura_Status_Rank2);" data "TickFunctors" ";" data "StatusPropertyFlags" "InitiateCombat;BringIntoCombat;DisableOverhead;DisableCombatlog;DisablePortraitIndicator" @@ -8509,11 +8518,12 @@ data "StatusType" "BOOST" using "AshCloudAura_Rank2" data "DisplayName" "h14936cc7g6025gc915g8d2bg3204caf12edd;1" data "FormatColor" "White" +data "AuraRadius" "4" data "AuraStatuses" ";" data "TickType" "EndRound" data "StatusPropertyFlags" "InitiateCombat;BringIntoCombat" -data "OnApplyFunctors" "CreateSurface(3,1,Mud)" -data "OnRemoveFunctors" "ApplyStatus(AURA_CLEANUP);CreateSurface(3,0,Blood)" +data "OnApplyFunctors" "CreateSurface(4,1,Mud)" +data "OnRemoveFunctors" "ApplyStatus(AURA_CLEANUP);CreateSurface(4,0,Blood)" data "IsUnique" "1" data "StatusEffect" "43b24ea4-b4a0-4745-ae2e-002c246383e8" @@ -8546,12 +8556,12 @@ data "DisplayName" "h05f39126gbfb3g336aga215g9210981a023d;1" data "Icon" "Spell_Necromancy_Contagion_FilthFever" data "FormatColor" "Red" data "StackId" "SanguineMist" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(SanguineMistStatus_4);IF(IsCurrentTurnInCombat(GetOwner(context.Source)) or not Combat()):ApplyStatus(SANGUINE_MIST_TECHNICAL)" data "RemoveConditions" "not HasStatus('SanguineMistRecast_Rank4',GetOwner())" data "RemoveEvents" "OnTurn" -data "TickFunctors" "CreateSurface(3,0,Blood,true)" -data "OnApplyFunctors" "CreateSurface(3,0,Blood,true)" +data "TickFunctors" "CreateSurface(4,0,Blood,true)" +data "OnApplyFunctors" "CreateSurface(4,0,Blood,true)" data "OnRemoveFunctors" "ApplyStatus(AURA_CLEANUP)" data "IsUnique" "1" data "StatusEffect" "92797a80-0c35-4735-a573-d145dd50da02" @@ -8596,7 +8606,7 @@ data "Icon" "Spell_Conjuration_StinkingCloud" data "StillAnimationType" "Suffocating" data "StillAnimationPriority" "Suffocating" data "StackId" "STINKING_CLOUD" -data "AuraRadius" "6" +data "AuraRadius" "8" data "TickType" "EndRound" data "StatusPropertyFlags" "BringIntoCombat;InitiateCombat" data "StatusGroups" "SG_Poisoned" @@ -8611,14 +8621,14 @@ data "Icon" "Spell_Conjuration_SleetStorm" data "SoundLoop" "Spell_Position_Control_SleetStorm_L1to3" data "SoundStop" "Spell_Position_Control_SleetStorm_L1to3_Stop" data "StackId" "SLEET_STORM_AURA" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(IceStormStatus_4);" data "TickType" "EndTurn" data "RemoveConditions" "not HasStatus('IceStorm_Owner',GetOwner())" data "RemoveEvents" "OnTurn" -data "TickFunctors" "CreateSurface(6,1,WaterFrozen)" +data "TickFunctors" "CreateSurface(8,1,WaterFrozen)" data "StatusPropertyFlags" "TickingWithSource" -data "OnApplyFunctors" "CreateSurface(6,2,WaterFrozen)" +data "OnApplyFunctors" "CreateSurface(8,2,WaterFrozen)" data "OnRemoveFunctors" "ApplyStatus(AURA_CLEANUP)" new entry "SLEET_STORM_6" @@ -8634,7 +8644,7 @@ data "DisplayName" "hf3e13aedg6862g85f1gddbcg15e82a7dd137;1" data "Description" "h1bebc066g9639gdf1fg7269ga7345effcea9;1" data "Icon" "Spell_Conjuration_StinkingCloud" data "StackId" "AcidStorm_Aura" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(AcidStormDamage,100,1);" data "TickType" "StartTurn" data "StatusPropertyFlags" "TickingWithSource" @@ -8665,7 +8675,7 @@ data "DisplayName" "h724c48fbgd548g32b7g3b7bg4323f2d14672;1" data "Description" "hcd5537d9gcbf9g514cg6869g8616a175917c;1" data "StackId" "CorrosiveMuck_Aura" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(CorrosiveMuckDamage,100,0);" new entry "CorrosiveMuckDamage" @@ -8702,7 +8712,7 @@ data "DisplayName" "h4e0ffecegcd85ga6fbgb7e2gb054a8b71b67;1" data "Description" "hf6ead1a8gc797g223bga445gfab967c5dee7;1" data "Icon" "Spell_Conjuration_StinkingCloud" data "StackId" "SwampOfSlothAura" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(SwampOfSlothDamage,100,1);" data "TickType" "EndTurn" data "StatusPropertyFlags" "TickingWithSource" @@ -8715,7 +8725,7 @@ data "DisplayName" "hb1e2220bg780fgffd0g7c95g07ba4cebabe9;1" data "Description" "h48b34990g4604g6afeg68dfg94a98c2e5392;1" data "Icon" "Spell_Conjuration_StinkingCloud" data "StackId" "SwampOfSlothAura" -data "AuraRadius" "5" +data "AuraRadius" "6" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(SwampOfSlothDamage,100,1);" data "TickType" "EndTurn" data "StatusPropertyFlags" "TickingWithSource" @@ -8725,21 +8735,21 @@ new entry "SwampOfSlothAura_1Action_Rank5" type "StatusData" data "StatusType" "BOOST" using "SwampOfSlothAura_1Action" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(SwampOfSlothDamage_Rank5,100,1);" new entry "SwampOfSlothAura_2Action_Rank5" type "StatusData" data "StatusType" "BOOST" using "SwampOfSlothAura_2Action" -data "AuraRadius" "5" +data "AuraRadius" "6" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(SwampOfSlothDamage_Rank5,100,1);" new entry "SwampOfSlothAura_3Action_Rank5" type "StatusData" data "StatusType" "BOOST" using "SwampOfSlothAura_3Action" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(SwampOfSlothDamage_Rank5,100,1);" new entry "SwampOfSlothDamage" @@ -8847,7 +8857,7 @@ new entry "SanguineMistAura_5" type "StatusData" data "StatusType" "BOOST" using "SanguineMistAura_4" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(SanguineMistStatus_5);IF(IsCurrentTurnInCombat(GetOwner(context.Source)) or not Combat()):ApplyStatus(SANGUINE_MIST_TECHNICAL)" data "RemoveConditions" "not HasStatus('SanguineMistRecast_Rank5',GetOwner())" data "TickFunctors" "CreateSurface(4,0,Blood,true)" @@ -8858,11 +8868,11 @@ new entry "SanguineMistAura_6" type "StatusData" data "StatusType" "BOOST" using "SanguineMistAura_4" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(SanguineMistStatus_6);IF(IsCurrentTurnInCombat(GetOwner(context.Source)) or not Combat()):ApplyStatus(SANGUINE_MIST_TECHNICAL)" data "RemoveConditions" "not HasStatus('SanguineMistRecast_Rank6',GetOwner())" -data "TickFunctors" "CreateSurface(5,0,Blood,true)" -data "OnApplyFunctors" "CreateSurface(5,0,Blood,true)" +data "TickFunctors" "CreateSurface(4,0,Blood,true)" +data "OnApplyFunctors" "CreateSurface(4,0,Blood,true)" data "StatusEffect" "92797a80-0c35-4735-a573-d145dd50da02" new entry "SanguineMistStatus_4" @@ -9000,8 +9010,9 @@ data "StatusType" "BOOST" using "MistAura" data "Icon" "Action_Legendary_DiamondScalesBurst" data "StackId" "GEYSER_AURA" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(GEYSER_STATUS,100,0)" +data "StatusEffect" "e749054e-38db-43fb-ab99-216f3287fae2" new entry "GEYSER_STATUS" type "StatusData" @@ -9512,7 +9523,7 @@ new entry "WEB_BUFF_SPIDER_ACTIVE" type "StatusData" data "StatusType" "BOOST" using "WEB_BUFF_SPIDER_ACTIVE" -data "Boosts" "ActionResource(Movement,4.5,0)" +data "Boosts" "Tag(STAT_BON_SPEED_15);" new entry "TAD_PERILOUS_STAKES" type "StatusData" @@ -10031,7 +10042,7 @@ data "StatusType" "BOOST" data "DisplayName" "h2e7feac2gd417gafb7g2717g0bca0a7d3f83;1" data "Description" "hb660df9agd43eg3670gb7e5g8ff9b0e88bff;1" data "Icon" "Spell_Abjuration_Resistance" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(HASTE,100,1);IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(QUICKEN_TIME_AURA,100,0);" data "AuraFlags" "IgnoreItems" @@ -10044,7 +10055,7 @@ data "Icon" "Spell_Abjuration_Resistance" data "StackId" "QUICKEN_TIME_AURA" data "StackPriority" "1" data "StackType" "Overwrite" -data "AuraRadius" "12" +data "AuraRadius" "16" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') and HasStatus('QUICKEN_TIME_AURA', context.Target)):ApplyStatus(CONCEALED_BLOCK_QUICKEN_TIME,100,0);IF(not Tagged('INVISIBLE_HELPER') and HasStatus('QUICKEN_TIME_AURA', context.Target)):ApplyStatus(DAZZLED_BLOCK_QUICKEN_TIME,100,0);" data "AuraFlags" "IgnoreItems" data "Boosts" "Tag(DAZZLED);" @@ -10058,7 +10069,7 @@ data "DisplayName" "h6f53063cg1800g5d4fg80d2g84677f35e245;1" data "Description" "ha3abb6b3g6efagfc02g00a7g2f65c9e770f5;1" data "Icon" "Spell_Conjuration_StinkingCloud" data "StackId" "SlitherAura" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(SlitherAuraDamage,100,1);" new entry "WALLOFICE" @@ -10548,7 +10559,7 @@ data "DisplayName" "hf1f6e56cg6e63g7a08g1b47g35b709d0b978;1" data "Description" "h0a252deeg2d37g48f4gdb94gb431432d7354;1" data "StackId" "STANCE" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(CircumstanceBonus1AC,100,1);" data "TickType" "StartTurn" data "RemoveConditions" "StatusId('ChannelingStatus')" @@ -10578,7 +10589,7 @@ data "Icon" "GenericIcon_DamageType_Fire" data "FormatColor" "Fire" data "StackId" "STANCE" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') and not Enemy()):ApplyStatus(ThermalNimbusAura_Fire_Resistance,100,-1);" data "TickType" "EndRound" data "OnRemoveFunctors" "ApplyStatus(AURA_CLEANUP)" @@ -10593,7 +10604,7 @@ data "Icon" "Status_Burning" data "FormatColor" "Fire" data "StackId" "ThermalNimbusAura" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(Enemy()):ApplyStatus(ThermalNimbusAura_Fire_Damage,100,-1);" data "TickType" "StartTurn" data "RemoveConditions" "not HasStatus('ThermalNimbusAura_Fire')" @@ -10633,7 +10644,7 @@ data "Icon" "GenericIcon_DamageType_Cold" data "FormatColor" "Water" data "StackId" "STANCE" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Enemy()):ApplyStatus(ThermalNimbusAura_Cold_Resistance,100,-1);" data "TickType" "EndRound" data "OnRemoveFunctors" "ApplyStatus(AURA_CLEANUP)" @@ -10657,7 +10668,7 @@ data "Icon" "Status_Burning" data "FormatColor" "Water" data "StackId" "ThermalNimbusDamage" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "TickFunctors" "DealDamage(LevelMapValue(CharacterLevel),Cold,Magical)" data "StatusEffect" "3c134510-649a-4aa7-a4bf-2dd243cc173b" @@ -10676,7 +10687,7 @@ data "Description" "hbdca3835g27d8gfe6agc11cg36349ade7506;1" data "Icon" "Spell_Transmutation_SpikeGrowth" data "StackId" "STANCE" data "StackType" "Overwrite" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not (HasPassive('SafeElements', context.Source) and not Enemy() and not HasStatus('RavelImmune',context.Target)) or (Enemy() and not HasStatus('RavelImmune',context.Target)) and not Self()):ApplyStatus(RavelOfThorns_Effects,100,-1);" data "RemoveConditions" "StatusId('ChannelingStatus')" data "RemoveEvents" "OnStatusRemoved" @@ -10721,7 +10732,7 @@ data "DisplayName" "h47472932g6d31g15c6g04f2g888db19512d0;1" data "Description" "h9cf39245g39e5gf67fg68aag9bf8fbeb9efa;1" data "FormatColor" "PoisonGreen" data "StackId" "RainOfRust" -data "AuraRadius" "3" +data "AuraRadius" "4" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(RustDamage,100,1);" data "TickType" "EndRound" data "StatusPropertyFlags" "InitiateCombat;BringIntoCombat" @@ -10812,7 +10823,7 @@ data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndi new entry "DRIVING_RAIN_AURA" type "StatusData" data "StatusType" "BOOST" -data "AuraRadius" "5" +data "AuraRadius" "6" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER')):ApplyStatus(DRIVING_RAIN_STATUS, 100, 0)" data "AuraFlags" "IgnoreItems" data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator" @@ -10918,13 +10929,22 @@ new entry "BLINK" type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h650018b1gad69g3135g6963g98cf7efe3fb2;1" -data "Description" "h35baa752gd901g26a9geadcg05608ed3930c;1" -data "DescriptionParams" "Distance(6)" +data "Description" "h35baa752gd901g26a9geadcg05608ed3930c;3" +data "DescriptionParams" "Distance(4);5" data "Icon" "Spell_Transmutation_Blink" data "HitAnimationType" "MagicalNonDamage" data "StackId" "BLINK" +data "Boosts" "UnlockSpell(Shout_Blink_Sustain);" data "Passives" "GhostResist_5" data "StatusGroups" "SG_RemoveOnRespec" +data "StatusEffect" "e3cc6ce6-133d-4d76-84c4-e656cd61ec69" + +new entry "BLINK_6" +type "StatusData" +data "StatusType" "BOOST" +using "BLINK" +data "DescriptionParams" "Distance(4);8" +data "Passives" "GhostResist_8;" new entry "DEADLYD6" type "StatusData" @@ -10989,14 +11009,14 @@ new entry "WALLOFFIRE" type "StatusData" data "StatusType" "BOOST" data "DisplayName" "he2538cb6g2d4fg902fg2043gebbbac2028d1;1" -data "Description" "h6626e66eg8674g15a6g5ef5g97dadfbf4a65;1" -data "DescriptionParams" "Distance(3);DealDamage(4d6,Fire)" +data "Description" "h6626e66eg8674g15a6g5ef5g97dadfbf4a65;2" +data "DescriptionParams" "DealDamage(4d6,Fire)" data "Icon" "Spell_Evocation_WallOfFire" data "SoundLoop" "Spell_Impact_Damage_WallOfFire_L4to5_Loop" data "SoundStop" "Spell_End_Loop_Damage_WallOfFire_L4to5" data "StackId" "WALLOFFIRE" data "StackPriority" "1" -data "AuraRadius" "2" +data "AuraRadius" "1" data "AuraStatuses" "IF(not Dead() and not (HasPassive('SculptSpells', context.Source) and Ally())):ApplyStatus(WALLOFFIRE_AURA,100,1)" data "TooltipSave" "Dexterity" data "TooltipDamage" "DealDamage(4d6,Fire)" @@ -11007,7 +11027,7 @@ new entry "WALLOFFIRE_5" type "StatusData" data "StatusType" "BOOST" using "WALLOFFIRE" -data "DescriptionParams" "Distance(3);DealDamage(5d6,Fire)" +data "DescriptionParams" "DealDamage(5d6,Fire)" data "StackId" "WALLOFFIRE_5" data "AuraStatuses" "IF(not Dead() and not (HasPassive('SculptSpells', context.Source) and Ally())):ApplyStatus(WALLOFFIRE_AURA_5,100,1)" data "TooltipDamage" "DealDamage(5d6,Fire)" @@ -11016,7 +11036,7 @@ new entry "WALLOFFIRE_6" type "StatusData" data "StatusType" "BOOST" using "WALLOFFIRE" -data "DescriptionParams" "Distance(3);DealDamage(6d6,Fire)" +data "DescriptionParams" "DealDamage(6d6,Fire)" data "StackId" "WALLOFFIRE_6" data "AuraStatuses" "IF(not Dead() and not (HasPassive('SculptSpells', context.Source) and Ally())):ApplyStatus(WALLOFFIRE_AURA_6,100,1)" data "TooltipDamage" "DealDamage(6d6,Fire)" @@ -11025,8 +11045,8 @@ new entry "WALLOFFIRE_AURA" type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h41b53088g5a71ga3c0g307dg63868860e149;1" -data "Description" "h453c7421g7c08g7cb9g183eg0e64ea6983f2;1" -data "DescriptionParams" "Distance(3);DealDamage(4d6,Fire)" +data "Description" "h453c7421g7c08g7cb9g183eg0e64ea6983f2;2" +data "DescriptionParams" "DealDamage(4d6,Fire)" data "Icon" "GenericIcon_DamageType_Fire" data "StackId" "WALLOFFIRE" data "StackPriority" "0" @@ -11044,7 +11064,7 @@ new entry "WALLOFFIRE_AURA_5" type "StatusData" data "StatusType" "BOOST" using "WALLOFFIRE_AURA" -data "DescriptionParams" "Distance(3);DealDamage(5d6,Fire)" +data "DescriptionParams" "DealDamage(5d6,Fire)" data "StackId" "WALLOFFIRE_5" data "TooltipDamage" "DealDamage(5d6,Fire)" data "OnApplySuccess" "IF(not HasStatus('WALLOFFIRE_DAMAGE_RECEIVED_5')):DealDamage(5d6,Fire,Magical);IF(not HasStatus('WALLOFFIRE_DAMAGE_RECEIVED_5')):ApplyStatus(WALLOFFIRE_DAMAGE_RECEIVED_5,100,1)" @@ -11056,7 +11076,7 @@ new entry "WALLOFFIRE_AURA_6" type "StatusData" data "StatusType" "BOOST" using "WALLOFFIRE_AURA" -data "DescriptionParams" "Distance(3);DealDamage(6d6,Fire)" +data "DescriptionParams" "DealDamage(6d6,Fire)" data "StackId" "WALLOFFIRE_6" data "TooltipDamage" "DealDamage(6d6,Fire)" data "OnApplySuccess" "IF(not HasStatus('WALLOFFIRE_DAMAGE_RECEIVED_6')):DealDamage(6d6,Fire,Magical);IF(not HasStatus('WALLOFFIRE_DAMAGE_RECEIVED_6')):ApplyStatus(WALLOFFIRE_DAMAGE_RECEIVED_6,100,1)" @@ -11099,7 +11119,7 @@ using "DIFFICULTY" data "DisplayName" "h3d9e50e0ga7c9g0a85g2a43gd6c6ae17d2da;1" data "Description" "h5ef99554gfd45g1738g6f5eg059b523f078c;1" data "Icon" "GenericIcon_Intent_Control" -data "Boosts" "IF(DistanceToTargetGreaterThan(3)):AC(2);" +data "Boosts" "IF(DistanceToTargetGreaterThan(4)):AC(2);" data "Passives" "Doppelganger_ReadThoughts" new entry "ETTERCAP_HARDCORE" @@ -11261,7 +11281,7 @@ data "Description" "h482a025cge429g2919gddf2g105ca467cfc3;1" data "Icon" "Spell_Illusion_Silence" data "SoundStart" "Misc_Status_Silence_Gameobject_Mute" data "SoundStop" "Misc_Status_Silence_Gameobject_Unmute" -data "AuraRadius" "6" +data "AuraRadius" "8" data "AuraStatuses" "ApplyStatus(SILENCED)" data "ApplyEffect" "004bb348-d674-416c-a67e-366fd63e1ff1" data "StatusEffect" "bb24db0e-f040-4e1d-8c04-aa8046018b69" @@ -11270,7 +11290,7 @@ new entry "SILENCED_AURA_PF2" type "StatusData" data "StatusType" "BOOST" using "SILENCED_AURA" -data "AuraRadius" "3" +data "AuraRadius" "4" new entry "Infusion_Agile" type "StatusData" @@ -11751,10 +11771,11 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "hf5d455bagb10fgd45bg91b2gea52ee375cf3;1" data "Description" "h6b6ddbbbg39eega009gb20cg07c2b2c22498;1" -data "DescriptionParams" "Distance(5)" +data "DescriptionParams" "Distance(4)" data "Icon" "statIcons_CurseOfRegret" -data "AuraRadius" "5" +data "AuraRadius" "4" data "AuraStatuses" "IF(Enemy()):ApplyStatus(FEAR_LOCK,100,0)" +data "AuraFlags" "IgnoreItems;DangerousOnlyToEnemies" data "StatusPropertyFlags" "DisableCombatlog;DisableOverhead" new entry "SKILL_CHECK_DC" @@ -12097,9 +12118,10 @@ data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(FLAME_VORTE data "AuraFlags" "DangerousForPathfinding" data "RemoveConditions" "HasStatus('FLAME_VORTEX_CLEANUP',context.Source)" data "RemoveEvents" "OnSourceStatusApplied" -data "TickFunctors" "CreateSurface(7.0,1,BloodCloud)" +data "TickFunctors" "CreateSurface(8,1,BloodCloud)" data "StatusPropertyFlags" "BringIntoCombat;DisableOverhead;DisableCombatlog;DisablePortraitIndicator;TickingWithSource" -data "OnApplyFunctors" "CreateSurface(7.0,1,BloodCloud);" +data "OnApplyFunctors" "CreateSurface(8,1,BloodCloud);" +data "ApplyEffect" "5470483e-f1cf-413b-9a41-93f16b58a30b" data "StatusEffect" "a4aefae4-51ce-4e67-afa1-c329e6357f31" new entry "FLAME_VORTEX_DAMAGE_APPLY" @@ -12157,7 +12179,7 @@ type "StatusData" data "StatusType" "BOOST" data "DisplayName" "h85c39839g7751g946egd425g309502a26b4a;1" data "StatusPropertyFlags" "DisableOverhead;DisableCombatlog;DisablePortraitIndicator" -data "OnApplyFunctors" "CreateSurface(7.0,1,BloodCloud);" +data "OnApplyFunctors" "CreateSurface(8,1,BloodCloud);" new entry "FLAME_VORTEX_CLEANUP" type "StatusData" @@ -12171,11 +12193,11 @@ data "StatusType" "BOOST" using "FLAME_VORTEX_AURA" data "DisplayName" "hfa83f91ega8d2g5ae2geb29g1a1491e0e69c;1" data "StackId" "FLOATING_FLAME_AURA" -data "AuraRadius" "1" +data "AuraRadius" "2" data "AuraStatuses" "IF(not Tagged('INVISIBLE_HELPER') ):ApplyStatus(FLOATING_FLAME_DAMAGE_APPLY,100,0);" data "RemoveConditions" "HasStatus('FLOATING_FLAME_CLEANUP',context.Source)" -data "TickFunctors" "CreateSurface(3.5,1,BloodCloud)" -data "OnApplyFunctors" "CreateSurface(3.5,1,BloodCloud);" +data "TickFunctors" "CreateSurface(4,1,BloodCloud)" +data "OnApplyFunctors" "CreateSurface(4,1,BloodCloud);" data "StatusEffect" "088ec2fe-91c6-41af-9836-1934985a7f08" new entry "FLOATING_FLAME_3_AURA" @@ -12308,7 +12330,7 @@ new entry "FLOATING_FLAME_MOVE_COMPLETE" type "StatusData" data "StatusType" "BOOST" using "FLAME_VORTEX_MOVE_COMPLETE" -data "OnApplyFunctors" "CreateSurface(3.5,1,BloodCloud);" +data "OnApplyFunctors" "CreateSurface(4,1,BloodCloud);" new entry "FLOATING_FLAME_CLEANUP" type "StatusData" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Weapon.txt b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Weapon.txt index 54490715..19def9c3 100644 --- a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Weapon.txt +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/Stats/Generated/Data/Weapon.txt @@ -1,3 +1,21 @@ +new entry "_BaseWeapon" +type "Weapon" +data "Level" "1" +data "UseCosts" "ActionPoint:1" +data "Damage Type" "Bludgeoning" +data "Damage" "1d4" +data "WeaponRange" "200" +data "ValueLevel" "1" +data "ValueUUID" "3ae7de83-816a-43e3-a0e1-4d5b78664fc6" +data "ValueScale" "1" +data "ValueRounding" "1" +data "Weight" "1" +data "Slot" "Melee Main Weapon" +data "PersonalStatusImmunities" "SILENCED;SG_Condition;BLEEDING;BURNING" +data "InventoryTab" "Equipment" +data "ItemColor" "DefaultGray" +data "Weapon Group" "SimpleMeleeWeapon" + new entry "WPN_Battleaxe" type "Weapon" using "_BaseWeapon" @@ -61,8 +79,8 @@ using "_BaseWeapon" data "RootTemplate" "fb08eef6-f6a0-454e-ab14-c1470f3ba18d" data "Damage Type" "Piercing" data "Damage" "1d4" -data "Damage Range" "2400" -data "WeaponRange" "1200" +data "Damage Range" "1600" +data "WeaponRange" "800" data "ValueScale" "0.2" data "Weight" "0.225" data "Slot" "Ranged Main Weapon" @@ -90,7 +108,7 @@ using "_BaseWeapon" data "RootTemplate" "99f3b2d9-e03d-4cd5-9a67-5435a95682da" data "Damage Type" "Slashing" data "Damage" "1d8" -data "WeaponRange" "250" +data "WeaponRange" "300" data "ValueLevel" "4" data "Weight" "2.7" data "Boosts" "UnlockSpell(Target_Critspec_Polearm)" @@ -149,7 +167,7 @@ using "_BaseWeapon" data "RootTemplate" "f928a70d-5b23-4605-9cae-5342f9ed206e" data "Damage Type" "Slashing" data "Damage" "1d10" -data "WeaponRange" "250" +data "WeaponRange" "300" data "ValueLevel" "4" data "Weight" "2.7" data "Boosts" "UnlockSpell(Target_Critspec_Polearm)" @@ -177,8 +195,8 @@ data "RootTemplate" "a5d843ab-c3af-4e60-a925-bb2e15828938" data "UseCosts" "ActionPoint:2" data "Damage Type" "Piercing" data "Damage" "1d6" -data "Damage Range" "7200" -data "WeaponRange" "3600" +data "Damage Range" "4800" +data "WeaponRange" "2400" data "ValueLevel" "3" data "Weight" "0.9" data "Slot" "Ranged Main Weapon" @@ -196,8 +214,8 @@ data "RootTemplate" "04622e3d-5b3f-4f2c-a0db-513a717d911f" data "UseCosts" "ActionPoint:2" data "Damage Type" "Piercing" data "Damage" "1d10" -data "Damage Range" "14400" -data "WeaponRange" "7200" +data "Damage Range" "9600" +data "WeaponRange" "4800" data "ValueLevel" "4" data "Weight" "8.1" data "Slot" "Ranged Main Weapon" @@ -232,8 +250,8 @@ using "_BaseWeapon" data "RootTemplate" "43b7fbf5-7f6e-4e9e-bce7-c679eea44593" data "Damage Type" "Piercing" data "Damage" "1d8" -data "Damage Range" "14400" -data "WeaponRange" "7200" +data "Damage Range" "9600" +data "WeaponRange" "4800" data "Weight" "2.25" data "Slot" "Ranged Main Weapon" data "Projectile" "ff93ba9c-124c-454e-ac8c-436c136bcef2" @@ -261,15 +279,15 @@ using "_BaseWeapon" data "RootTemplate" "86e3d864-309c-4c17-ba38-877ce487d481" data "Damage Type" "Piercing" data "Damage" "1d8" -data "Damage Range" "12000" -data "WeaponRange" "6000" +data "Damage Range" "8000" +data "WeaponRange" "4000" data "ValueLevel" "3" data "Weight" "1.1" data "Slot" "Ranged Main Weapon" data "Projectile" "ff93ba9c-124c-454e-ac8c-436c136bcef2" data "DefaultBoosts" "BlockAbilityModifierDamageBonus()" data "Boosts" "UnlockSpell(Target_Critspec_Bow)" -data "PassivesOnEquip" "DeadlyD10" +data "PassivesOnEquip" "DeadlyD10;Volley30;" data "Weapon Group" "MartialRangedWeapon" data "Weapon Properties" "Ammunition;Heavy;Twohanded;Dippable" data "Proficiency Group" "Longbows;MartialWeapons" @@ -336,7 +354,7 @@ using "_BaseWeapon" data "RootTemplate" "baa5b139-42ad-40fd-b6c3-6b52b092c48e" data "Damage Type" "Piercing" data "Damage" "1d10" -data "WeaponRange" "250" +data "WeaponRange" "300" data "ValueScale" "0.3" data "Weight" "8.1" data "Boosts" "UnlockSpell(Target_Critspec_Spear)" @@ -403,8 +421,8 @@ using "_BaseWeapon" data "RootTemplate" "c5403c1d-f372-43e1-927a-9189e9e3545d" data "Damage Type" "Piercing" data "Damage" "1d6" -data "Damage Range" "7200" -data "WeaponRange" "3600" +data "Damage Range" "4800" +data "WeaponRange" "2400" data "ValueScale" "0.5" data "Weight" "0.9" data "Slot" "Ranged Main Weapon" @@ -451,8 +469,8 @@ using "_BaseWeapon" data "RootTemplate" "d31af642-ae35-4f22-b7a6-100f3048be33" data "Damage Type" "Bludgeoning" data "Damage" "1d6" -data "Damage Range" "6000" -data "WeaponRange" "3000" +data "Damage Range" "4000" +data "WeaponRange" "2000" data "ValueScale" "0.5" data "Weight" "0.1" data "Slot" "Ranged Main Weapon" @@ -1152,7 +1170,7 @@ data "ItemGroup" "Dummy" data "Level" "1" data "Damage Type" "Bludgeoning" data "Damage" "1d4" -data "WeaponRange" "150" +data "WeaponRange" "200" data "ValueUUID" "91696f37-5a03-4f10-b636-2e5e2096a594" data "Slot" "Melee Main Weapon" data "InventoryTab" "Hidden" @@ -2452,7 +2470,7 @@ using "WPN_Mace" data "RootTemplate" "96df6fd6-a688-47ab-b448-0b6d27d1cf1d" data "UseConditions" "HasPassive('GiantInstinct'.context.Source) or Tagged('BREWER_CREATURE', context.Source);" data "Damage" "1d8" -data "WeaponRange" "220" +data "WeaponRange" "270" data "DefaultBoosts" "WeaponAttackRollBonus(1);WeaponProperty(Magical);" data "Boosts" "" data "BoostsOnEquipMainHand" "" diff --git a/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/TooltipExtras/TooltipUpcastDescriptions.lsx b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/TooltipExtras/TooltipUpcastDescriptions.lsx new file mode 100644 index 00000000..a78ee8a0 --- /dev/null +++ b/Public/Pathfinder2ndEdition_dda83752-5c01-30f9-6a09-824c7e182090/TooltipExtras/TooltipUpcastDescriptions.lsx @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + +