diff --git a/.editorconfig b/.editorconfig new file mode 100644 index 00000000..8f0de65c --- /dev/null +++ b/.editorconfig @@ -0,0 +1,18 @@ +root = true + +[*] +charset = utf-8 +end_of_line = lf +indent_size = 4 +indent_style = space +insert_final_newline = true +trim_trailing_whitespace = true + +[*.md] +trim_trailing_whitespace = false + +[*.{yml,yaml}] +indent_size = 2 + +[docker-compose.yml] +indent_size = 4 diff --git a/.env.example b/.env.example new file mode 100644 index 00000000..cfcd04c9 --- /dev/null +++ b/.env.example @@ -0,0 +1,75 @@ +APP_NAME="Article Crud" +APP_ENV=local +APP_KEY=base64:UfXqKchu5dj4hrHMQX7NA554kgxYYoZQ+mFbL2pKXtM= +APP_DEBUG=true +APP_URL=http://localhost + +LOG_CHANNEL=stack +LOG_DEPRECATIONS_CHANNEL=null +LOG_LEVEL=debug + +DB_CONNECTION=mysql +DB_HOST=127.0.0.1 +DB_PORT=3306 +DB_DATABASE=article_crud +DB_USERNAME=root +DB_PASSWORD=your_password_here + +BROADCAST_DRIVER=log +CACHE_DRIVER=file +FILESYSTEM_DISK=local +QUEUE_CONNECTION=sync +SESSION_DRIVER=file +SESSION_LIFETIME=120 + +MEMCACHED_HOST=127.0.0.1 + +REDIS_HOST=127.0.0.1 +REDIS_PASSWORD=null +REDIS_PORT=6379 + +MAIL_MAILER=smtp +MAIL_HOST=mailpit +MAIL_PORT=1025 +MAIL_USERNAME=null +MAIL_PASSWORD=null +MAIL_ENCRYPTION=null +MAIL_FROM_ADDRESS="hello@example.com" +MAIL_FROM_NAME="${APP_NAME}" + +AWS_ACCESS_KEY_ID= +AWS_SECRET_ACCESS_KEY= +AWS_DEFAULT_REGION=us-east-1 +AWS_BUCKET= +AWS_USE_PATH_STYLE_ENDPOINT=false + +PUSHER_APP_ID= +PUSHER_APP_KEY= +PUSHER_APP_SECRET= +PUSHER_HOST= +PUSHER_PORT=443 +PUSHER_SCHEME=https +PUSHER_APP_CLUSTER=mt1 + +VITE_APP_NAME="${APP_NAME}" +VITE_PUSHER_APP_KEY="${PUSHER_APP_KEY}" +VITE_PUSHER_HOST="${PUSHER_HOST}" +VITE_PUSHER_PORT="${PUSHER_PORT}" +VITE_PUSHER_SCHEME="${PUSHER_SCHEME}" +VITE_PUSHER_APP_CLUSTER="${PUSHER_APP_CLUSTER}" + +DEBUGBAR_ENABLED=true + +DEFAULT_USER_NAME="Blogger" +DEFAULT_USER_EMAIL="blogger@blogger.website" +DEFAULT_USER_PASSWORD="123456789" +CATEGORIES_TO_SEED=12 +TAGS_TO_SEED=18 +ARTICLES_TO_SEED=40 +MIN_TAGS_PER_ARTICLE_TO_SEED=0 +MAX_TAGS_PER_ARTICLE_TO_SEED=7 +PERCENTAGE_OF_ARTICLES_WITH_IMAGES=40 +CATEGORIES_PER_PAGE=10 +TAGS_PER_PAGE=7 +ARTICLES_PER_PAGE=8 +MAX_CHARS_ARTICLE_TEXT=300 diff --git a/.gitattributes b/.gitattributes new file mode 100644 index 00000000..fcb21d39 --- /dev/null +++ b/.gitattributes @@ -0,0 +1,11 @@ +* text=auto eol=lf + +*.blade.php diff=html +*.css diff=css +*.html diff=html +*.md diff=markdown +*.php diff=php + +/.github export-ignore +CHANGELOG.md export-ignore +.styleci.yml export-ignore diff --git a/.gitignore b/.gitignore new file mode 100644 index 00000000..463cfb0a --- /dev/null +++ b/.gitignore @@ -0,0 +1,24 @@ +/.phpunit.cache +/node_modules +/public/hot +/public/storage +/storage/*.key +/vendor +.env +.env.backup +.env.production +.phpunit.result.cache +Homestead.json +Homestead.yaml +auth.json +npm-debug.log +yarn-error.log +/.fleet +/.idea +/.vscode +/gitignore +app/Http/Requests/Admin/*.txt +/resources/views/admin/articles/*.txt +/routes/web_dev.php +/tests0 +leiame.txt diff --git a/README.md b/README.md index e24f3eaa..5bce223e 100644 --- a/README.md +++ b/README.md @@ -1,87 +1,32 @@ -# Laravel Roadmap: Beginner Level Challenge +# Blogger's Home Page -This is a task for the [Beginner Level of the Laravel Roadmap](https://github.com/LaravelDaily/Laravel-Roadmap-Learning-Path#beginner-level), with the goal to implement as many of its topics as possible. +![Laravel](https://img.shields.io/badge/laravel-%23FF2D20.svg?style=for-the-badge&logo=laravel&logoColor=white) +![PHP](https://img.shields.io/badge/php-%23777BB4.svg?style=for-the-badge&logo=php&logoColor=white) +![MySQL](https://img.shields.io/badge/mysql-%2300f.svg?style=for-the-badge&logo=mysql&logoColor=white) +![TailwindCSS](https://img.shields.io/badge/tailwindcss-%2338B2AC.svg?style=for-the-badge&logo=tailwind-css&logoColor=white) +![HTML5](https://img.shields.io/badge/html5-%23E34F26.svg?style=for-the-badge&logo=html5&logoColor=white) +![DigitalOcean](https://img.shields.io/badge/DigitalOcean-%230167ff.svg?style=for-the-badge&logo=digitalOcean&logoColor=white) -This repository is intentionally empty, with only a Readme file. Your task if to submit a Pull Request with your version of implementing the task, and your PR may be reviewed by someone on our team, or other volunteers. +This is a blogger web app for only one registered user who is both the blogger and admin. Public users can read the articles posted, and select which article he/she wishes to read by navigating on the main page. The admin and blogger can manage categories, tags as well as the articles themselves. -## The Task: Simple Personal Blog +This project is an answer to the **[Laravel Roadmap: Beginner Level Challenge](https://github.com/LaravelDaily/Laravel-Roadmap-Beginner-Challenge)**. -You need to create a personal blog with just three pages: +This project has been taken offline on Oct. 17th, 2023. The server is minimal: 10GB SSD, 0.5GB RAM. Yet the queries are performant. Images below: -- Homepage: List of articles -- Article page -- Some static text page like "About me" +![main page](/gitimages/image01.png) +![article editing page](/gitimages/image02.png) -Also, there should be a Login mechanism (but no Register) for the author to write articles: +## Instalation -- Manage (meaning, create/update/delete) categories -- Manage tags -- Manage articles -- For Auth Starter Kit, use [Laravel Breeze](https://github.com/laravel/breeze) (Tailwind) or [Laravel UI](https://github.com/laravel/ui) (Bootstrap) - that starter kit will have some design, which is enough: the design is irrelevant for accomplishing the task +### Forge Install +Deploy the server and the code. Run the command `php artisan db:seed`. Schedule the unused image cleansing job with this command (or similar): `php /home/forge/default/artisan app:purge-garbage-images` to run every minute or whenever. -**DB Structure:** +### Local Install -- Article has title (required), full text (required) and image to upload (optional) -- Article may have only one category, but may have multiple tags +Create a new MySQL schema. Name it according to your .env file. Run the command `php artisan migrate --seed`. Optional: Schedule the unused image cleansing command with `php artisan app:purge-garbage-files` to run every minute or whenever. Run this app as usual. +*It is crucial to run at least the UserSeeder, to seed the database with the only user.* That user is described in the `.env` / `.env.example` file. ------ - -## Features to implement - -Here's the [list of Roadmap features](https://github.com/LaravelDaily/Laravel-Roadmap-Learning-Path#beginner-level) you need to try to implement in your code: - -**Routing and Controllers: Basics** - -- Callback Functions and Route::view() -- Routing to a Single Controller Method -- Route Parameters -- Route Naming -- Route Groups - - -**Blade Basics** - -- Displaying Variables in Blade -- Blade If-Else and Loop Structures -- Blade Loops -- Layout: @include, @extends, @section, @yield -- Blade Components - - -**Auth Basics** - -- Default Auth Model and Access its Fields from Anywhere -- Check Auth in Controller / Blade -- Auth Middleware - - -**Database Basics** - -- Database Migrations -- Basic Eloquent Model and MVC: Controller -> Model -> View -- Eloquent Relationships: belongsTo / hasMany / belongsToMany -- Eager Loading and N+1 Query Problem - - -**Full Simple CRUD** - -- Route Resource and Resourceful Controllers -- Forms, Validation and Form Requests -- File Uploads and Storage Folder Basics -- Table Pagination - - ------ - -## Example Solutions - -If you need help, or you want to compare your version with our simple version, here are two public repositories with the solution: - -- [Laravel Roadmap Beginner: Breeze](https://github.com/LaravelDaily/Laravel-Roadmap-Beginner-Roadmap-Breeze) -- [Laravel Roadmap Beginner: UI](https://github.com/LaravelDaily/Laravel-Roadmap-Beginner-Blog-UI) - - -**Notice**: please look at those repositories only AFTER you've accomplished the task yourself, or if you're confident about your Laravel beginner skills and you think you don't need to practice this task. +*It is not necessary to run the command* `php artisan storage:link`*.* diff --git a/app/Console/Commands/GenerateGarbageFiles.php b/app/Console/Commands/GenerateGarbageFiles.php new file mode 100644 index 00000000..4e42fb20 --- /dev/null +++ b/app/Console/Commands/GenerateGarbageFiles.php @@ -0,0 +1,34 @@ +put('garbage' . strval($i) . '.txt', fake()->text(80)); + } + $this->info(strval($n) . ' garbage files successfully generated.'); + } +} \ No newline at end of file diff --git a/app/Console/Commands/PurgeGarbageImages.php b/app/Console/Commands/PurgeGarbageImages.php new file mode 100644 index 00000000..3413cdac --- /dev/null +++ b/app/Console/Commands/PurgeGarbageImages.php @@ -0,0 +1,55 @@ +files()); + $filesystemImages->transform(function (string $item, int $key) { + return FilesystemHelper::DISK_FOR_UPLOADS . '/' . $item; + }); + //var_dump($filesystemImages); + $dbImages = DB::table('articles') + ->select('image') + ->whereNotNull('image') + ->whereRaw("image like '" . FilesystemHelper::DISK_FOR_UPLOADS . "%'") + ->distinct() + ->get() + ->pluck('image'); + //var_dump($dbImages); + $diffImages = $filesystemImages->diff($dbImages); + //var_dump($diffImages); + $diffImages->transform(function (string $item, int $key) { + return substr($item, strlen(FilesystemHelper::DISK_FOR_UPLOADS) + 1); + }); + //var_dump($diffImages); + $diffImages->each(function (string $item, int $key) { + Storage::disk(FilesystemHelper::DISK_FOR_UPLOADS)->delete($item); + }); + $this->info(strval($diffImages->count()) . ' undesirable image(s) removed.'); + } +} \ No newline at end of file diff --git a/app/Console/Kernel.php b/app/Console/Kernel.php new file mode 100644 index 00000000..e6b9960e --- /dev/null +++ b/app/Console/Kernel.php @@ -0,0 +1,27 @@ +command('inspire')->hourly(); + } + + /** + * Register the commands for the application. + */ + protected function commands(): void + { + $this->load(__DIR__.'/Commands'); + + require base_path('routes/console.php'); + } +} diff --git a/app/Exceptions/Handler.php b/app/Exceptions/Handler.php new file mode 100644 index 00000000..56af2640 --- /dev/null +++ b/app/Exceptions/Handler.php @@ -0,0 +1,30 @@ + + */ + protected $dontFlash = [ + 'current_password', + 'password', + 'password_confirmation', + ]; + + /** + * Register the exception handling callbacks for the application. + */ + public function register(): void + { + $this->reportable(function (Throwable $e) { + // + }); + } +} diff --git a/app/Helpers/FilesystemHelper.php b/app/Helpers/FilesystemHelper.php new file mode 100644 index 00000000..b7b192bf --- /dev/null +++ b/app/Helpers/FilesystemHelper.php @@ -0,0 +1,8 @@ +format('Y-m-d-H-i-s-u'); + } +} \ No newline at end of file diff --git a/app/Http/Controllers/Admin/ArticleController.php b/app/Http/Controllers/Admin/ArticleController.php new file mode 100644 index 00000000..7873ffa4 --- /dev/null +++ b/app/Http/Controllers/Admin/ArticleController.php @@ -0,0 +1,97 @@ +get(); + $allTags = Tag::select('id','name')->get(); + return view('admin.articles.create', compact('categories','allTags')); + } + + /** + * Store a newly created resource in storage. + */ + public function store(CreateArticleRequest $request) { + $tags = TagsForArticle::fetchTagsFromRequest(); + if ($request->has('image')) { + $filename = TimestampHelper::getFileTimestamp() . '_' . $request->file('image')->getClientOriginalName(); + $request->file('image')->storeAs('', $filename, FilesystemHelper::DISK_FOR_UPLOADS); + } + DB::beginTransaction(); + $article = Article::create([ + 'user_id' => auth()->id(), + 'category_id' => $request->category_id, + 'title' => $request->title, + 'fulltext' => $request->fulltext, + 'image' => $request->has('image') ? FilesystemHelper::DISK_FOR_UPLOADS . '/' . $filename : null + ]); + $article->tags()->sync($tags); + DB::commit(); + return redirect()->route('home'); + } + + /** + * Show the form for editing the specified resource. + */ + public function edit(Article $article) { + $categories = Category::select('id','name')->get(); + $allTags = Tag::select('id','name')->get(); + $tagIds = $article->tags()->get()->pluck('id')->toArray(); + return view('admin.articles.edit', compact('article', 'categories', 'allTags', 'tagIds')); + } + + /** + * Update the specified resource in storage. + */ + public function update(EditArticleRequest $request, Article $article) { + $tags = TagsForArticle::fetchTagsFromRequest(); + if ($request->image_confirmation && $request->has('image')) { + $filename = TimestampHelper::getFileTimestamp() . '_' . $request->file('image')->getClientOriginalName(); + $request->file('image')->storeAs('', $filename, FilesystemHelper::DISK_FOR_UPLOADS); + } + DB::beginTransaction(); + $fields = [ + 'user_id' => auth()->id(), + 'category_id' => $request->category_id, + 'title' => $request->title, + 'fulltext' => $request->fulltext + ]; + if ($request->image_confirmation) { + $fields['image'] = $request->has('image') ? FilesystemHelper::DISK_FOR_UPLOADS . '/' . $filename : null; + } + $article->update($fields); + $article->tags()->sync($tags); + DB::commit(); + return redirect()->route('home'); + } + + /** + * Remove the specified resource from storage. + */ + public function destroy(Article $article) { + $article->delete(); + return redirect()->route('home'); + } + + /* + Dear Reader: + You might be wondering how the unused images are actually discarded. + So.. for this answer -- + Please check: App\Console\Commands\PurgeGarbageImages.php + */ +} \ No newline at end of file diff --git a/app/Http/Controllers/Admin/CategoryController.php b/app/Http/Controllers/Admin/CategoryController.php new file mode 100644 index 00000000..fef96ed7 --- /dev/null +++ b/app/Http/Controllers/Admin/CategoryController.php @@ -0,0 +1,55 @@ +withCount('articles')->paginate(env('CATEGORIES_PER_PAGE',6)); + return view('admin.categories.index', compact('categories')); + } + + /** + * Show the form for creating a new resource. + */ + public function create() { + return view('admin.categories.create'); + } + + /** + * Store a newly created resource in storage. + */ + public function store(CategoryRequest $request) { + Category::create($request->validated()); + return redirect()->route('admin.categories.index'); + } + + /** + * Show the form for editing the specified resource. + */ + public function edit(Category $category) { + return view('admin.categories.edit', compact('category')); + } + + /** + * Update the specified resource in storage. + */ + public function update(CategoryRequest $request, Category $category) { + $category->update($request->validated()); + return redirect()->route('admin.categories.index'); + } + + /** + * Remove the specified resource from storage. + */ + public function destroy(Category $category) { + $category->delete(); + return redirect()->route('admin.categories.index'); + } +} \ No newline at end of file diff --git a/app/Http/Controllers/Admin/TagController.php b/app/Http/Controllers/Admin/TagController.php new file mode 100644 index 00000000..8f87879a --- /dev/null +++ b/app/Http/Controllers/Admin/TagController.php @@ -0,0 +1,55 @@ +withCount('articles')->paginate(env('TAGS_PER_PAGE',6)); + return view('admin.tags.index', compact('tags')); + } + + /** + * Show the form for creating a new resource. + */ + public function create() { + return view('admin.tags.create'); + } + + /** + * Store a newly created resource in storage. + */ + public function store(TagRequest $request) { + Tag::create($request->validated()); + return redirect()->route('admin.tags.index'); + } + + /** + * Show the form for editing the specified resource. + */ + public function edit(Tag $tag) { + return view('admin.tags.edit', compact('tag')); + } + + /** + * Update the specified resource in storage. + */ + public function update(TagRequest $request, Tag $tag) { + $tag->update($request->validated()); + return redirect()->route('admin.tags.index'); + } + + /** + * Remove the specified resource from storage. + */ + public function destroy(Tag $tag) { + $tag->delete(); + return redirect()->route('admin.tags.index'); + } +} \ No newline at end of file diff --git a/app/Http/Controllers/Auth/AuthenticatedSessionController.php b/app/Http/Controllers/Auth/AuthenticatedSessionController.php new file mode 100644 index 00000000..494a1064 --- /dev/null +++ b/app/Http/Controllers/Auth/AuthenticatedSessionController.php @@ -0,0 +1,48 @@ +authenticate(); + + $request->session()->regenerate(); + + return redirect()->intended(RouteServiceProvider::HOME); + } + + /** + * Destroy an authenticated session. + */ + public function destroy(Request $request): RedirectResponse + { + Auth::guard('web')->logout(); + + $request->session()->invalidate(); + + $request->session()->regenerateToken(); + + return redirect('/'); + } +} diff --git a/app/Http/Controllers/Controller.php b/app/Http/Controllers/Controller.php new file mode 100644 index 00000000..77ec359a --- /dev/null +++ b/app/Http/Controllers/Controller.php @@ -0,0 +1,12 @@ +with('category:id,name','tags:id,name') + ->latest() + ->paginate(env('ARTICLES_PER_PAGE',10)); + return view('index', compact('articles')); + } +} \ No newline at end of file diff --git a/app/Http/Controllers/Main/ShowArticleController.php b/app/Http/Controllers/Main/ShowArticleController.php new file mode 100644 index 00000000..4c9536b6 --- /dev/null +++ b/app/Http/Controllers/Main/ShowArticleController.php @@ -0,0 +1,16 @@ +with('category:id,name','tags:id,name') + ->find($article_id); + if (!isset($article)) abort(404); + return view('show', compact('article')); + } +} \ No newline at end of file diff --git a/app/Http/Kernel.php b/app/Http/Kernel.php new file mode 100644 index 00000000..494c0501 --- /dev/null +++ b/app/Http/Kernel.php @@ -0,0 +1,68 @@ + + */ + protected $middleware = [ + // \App\Http\Middleware\TrustHosts::class, + \App\Http\Middleware\TrustProxies::class, + \Illuminate\Http\Middleware\HandleCors::class, + \App\Http\Middleware\PreventRequestsDuringMaintenance::class, + \Illuminate\Foundation\Http\Middleware\ValidatePostSize::class, + \App\Http\Middleware\TrimStrings::class, + \Illuminate\Foundation\Http\Middleware\ConvertEmptyStringsToNull::class, + ]; + + /** + * The application's route middleware groups. + * + * @var array> + */ + protected $middlewareGroups = [ + 'web' => [ + \App\Http\Middleware\EncryptCookies::class, + \Illuminate\Cookie\Middleware\AddQueuedCookiesToResponse::class, + \Illuminate\Session\Middleware\StartSession::class, + \Illuminate\View\Middleware\ShareErrorsFromSession::class, + \App\Http\Middleware\VerifyCsrfToken::class, + \Illuminate\Routing\Middleware\SubstituteBindings::class, + ], + + 'api' => [ + // \Laravel\Sanctum\Http\Middleware\EnsureFrontendRequestsAreStateful::class, + \Illuminate\Routing\Middleware\ThrottleRequests::class.':api', + \Illuminate\Routing\Middleware\SubstituteBindings::class, + ], + ]; + + /** + * The application's middleware aliases. + * + * Aliases may be used instead of class names to conveniently assign middleware to routes and groups. + * + * @var array + */ + protected $middlewareAliases = [ + 'auth' => \App\Http\Middleware\Authenticate::class, + 'auth.basic' => \Illuminate\Auth\Middleware\AuthenticateWithBasicAuth::class, + 'auth.session' => \Illuminate\Session\Middleware\AuthenticateSession::class, + 'cache.headers' => \Illuminate\Http\Middleware\SetCacheHeaders::class, + 'can' => \Illuminate\Auth\Middleware\Authorize::class, + 'guest' => \App\Http\Middleware\RedirectIfAuthenticated::class, + 'password.confirm' => \Illuminate\Auth\Middleware\RequirePassword::class, + 'precognitive' => \Illuminate\Foundation\Http\Middleware\HandlePrecognitiveRequests::class, + 'signed' => \App\Http\Middleware\ValidateSignature::class, + 'throttle' => \Illuminate\Routing\Middleware\ThrottleRequests::class, + 'verified' => \Illuminate\Auth\Middleware\EnsureEmailIsVerified::class, + ]; +} diff --git a/app/Http/Middleware/Authenticate.php b/app/Http/Middleware/Authenticate.php new file mode 100644 index 00000000..d4ef6447 --- /dev/null +++ b/app/Http/Middleware/Authenticate.php @@ -0,0 +1,17 @@ +expectsJson() ? null : route('login'); + } +} diff --git a/app/Http/Middleware/EncryptCookies.php b/app/Http/Middleware/EncryptCookies.php new file mode 100644 index 00000000..867695bd --- /dev/null +++ b/app/Http/Middleware/EncryptCookies.php @@ -0,0 +1,17 @@ + + */ + protected $except = [ + // + ]; +} diff --git a/app/Http/Middleware/PreventRequestsDuringMaintenance.php b/app/Http/Middleware/PreventRequestsDuringMaintenance.php new file mode 100644 index 00000000..74cbd9a9 --- /dev/null +++ b/app/Http/Middleware/PreventRequestsDuringMaintenance.php @@ -0,0 +1,17 @@ + + */ + protected $except = [ + // + ]; +} diff --git a/app/Http/Middleware/RedirectIfAuthenticated.php b/app/Http/Middleware/RedirectIfAuthenticated.php new file mode 100644 index 00000000..afc78c4e --- /dev/null +++ b/app/Http/Middleware/RedirectIfAuthenticated.php @@ -0,0 +1,30 @@ +check()) { + return redirect(RouteServiceProvider::HOME); + } + } + + return $next($request); + } +} diff --git a/app/Http/Middleware/TrimStrings.php b/app/Http/Middleware/TrimStrings.php new file mode 100644 index 00000000..88cadcaa --- /dev/null +++ b/app/Http/Middleware/TrimStrings.php @@ -0,0 +1,19 @@ + + */ + protected $except = [ + 'current_password', + 'password', + 'password_confirmation', + ]; +} diff --git a/app/Http/Middleware/TrustHosts.php b/app/Http/Middleware/TrustHosts.php new file mode 100644 index 00000000..c9c58bdd --- /dev/null +++ b/app/Http/Middleware/TrustHosts.php @@ -0,0 +1,20 @@ + + */ + public function hosts(): array + { + return [ + $this->allSubdomainsOfApplicationUrl(), + ]; + } +} diff --git a/app/Http/Middleware/TrustProxies.php b/app/Http/Middleware/TrustProxies.php new file mode 100644 index 00000000..3391630e --- /dev/null +++ b/app/Http/Middleware/TrustProxies.php @@ -0,0 +1,28 @@ +|string|null + */ + protected $proxies; + + /** + * The headers that should be used to detect proxies. + * + * @var int + */ + protected $headers = + Request::HEADER_X_FORWARDED_FOR | + Request::HEADER_X_FORWARDED_HOST | + Request::HEADER_X_FORWARDED_PORT | + Request::HEADER_X_FORWARDED_PROTO | + Request::HEADER_X_FORWARDED_AWS_ELB; +} diff --git a/app/Http/Middleware/ValidateSignature.php b/app/Http/Middleware/ValidateSignature.php new file mode 100644 index 00000000..093bf64a --- /dev/null +++ b/app/Http/Middleware/ValidateSignature.php @@ -0,0 +1,22 @@ + + */ + protected $except = [ + // 'fbclid', + // 'utm_campaign', + // 'utm_content', + // 'utm_medium', + // 'utm_source', + // 'utm_term', + ]; +} diff --git a/app/Http/Middleware/VerifyCsrfToken.php b/app/Http/Middleware/VerifyCsrfToken.php new file mode 100644 index 00000000..9e865217 --- /dev/null +++ b/app/Http/Middleware/VerifyCsrfToken.php @@ -0,0 +1,17 @@ + + */ + protected $except = [ + // + ]; +} diff --git a/app/Http/Requests/Admin/CategoryRequest.php b/app/Http/Requests/Admin/CategoryRequest.php new file mode 100644 index 00000000..086d3fe1 --- /dev/null +++ b/app/Http/Requests/Admin/CategoryRequest.php @@ -0,0 +1,27 @@ + 'required' + ]; + } +} \ No newline at end of file diff --git a/app/Http/Requests/Admin/CreateArticleRequest.php b/app/Http/Requests/Admin/CreateArticleRequest.php new file mode 100644 index 00000000..ccff3348 --- /dev/null +++ b/app/Http/Requests/Admin/CreateArticleRequest.php @@ -0,0 +1,40 @@ +|string> + */ + public function rules(): array { + $tagIds = Tag::selectRaw("concat('tag',id) as tag_number")->addSelect('id')->get(); + $tagIdsWithPrefix = $tagIds->pluck('tag_number')->toArray(); + $tagIdsFormatted = $tagIds->pluck('id')->implode(','); + $rules = array_fill_keys($tagIdsWithPrefix, ['nullable','integer','min:1','in:[,' . $tagIdsFormatted . ',]']); + $rules['category_id'] = ['required','integer','min:1','exists:categories,id']; + $rules['title'] = ['required','string']; + $rules['fulltext'] = ['required','string']; + $rules['image'] = ['nullable','image']; + return $rules; + } + /* + This generates an array whose tag-related key/value pairs are: + 'tag#' => ['nullable','integer','min:1','in:[all_tag_ids_list]'] + Where # is the tag id#, and the primary key of the table tags. + # also matches the value of the checkbox field from the blade template. + Each key 'tag#' matches the name field of the checkbox from the blade template. + There will be one such rule for each tag (*not* for each checked tag). + */ +} \ No newline at end of file diff --git a/app/Http/Requests/Admin/EditArticleRequest.php b/app/Http/Requests/Admin/EditArticleRequest.php new file mode 100644 index 00000000..91a1c9ba --- /dev/null +++ b/app/Http/Requests/Admin/EditArticleRequest.php @@ -0,0 +1,25 @@ +|string> + */ + public function rules(): array { + $rules = (new CreateArticleRequest)->rules(); + $rules['image_confirmation'] = ['nullable','boolean']; + return $rules; + } +} \ No newline at end of file diff --git a/app/Http/Requests/Admin/TagRequest.php b/app/Http/Requests/Admin/TagRequest.php new file mode 100644 index 00000000..1439199e --- /dev/null +++ b/app/Http/Requests/Admin/TagRequest.php @@ -0,0 +1,27 @@ + 'required' + ]; + } +} \ No newline at end of file diff --git a/app/Http/Requests/Auth/LoginRequest.php b/app/Http/Requests/Auth/LoginRequest.php new file mode 100644 index 00000000..7a19bc02 --- /dev/null +++ b/app/Http/Requests/Auth/LoginRequest.php @@ -0,0 +1,85 @@ + + */ + public function rules(): array + { + return [ + 'email' => ['required', 'string', 'email'], + 'password' => ['required', 'string'], + ]; + } + + /** + * Attempt to authenticate the request's credentials. + * + * @throws \Illuminate\Validation\ValidationException + */ + public function authenticate(): void + { + $this->ensureIsNotRateLimited(); + + if (! Auth::attempt($this->only('email', 'password'), $this->boolean('remember'))) { + RateLimiter::hit($this->throttleKey()); + + throw ValidationException::withMessages([ + 'email' => trans('auth.failed'), + ]); + } + + RateLimiter::clear($this->throttleKey()); + } + + /** + * Ensure the login request is not rate limited. + * + * @throws \Illuminate\Validation\ValidationException + */ + public function ensureIsNotRateLimited(): void + { + if (! RateLimiter::tooManyAttempts($this->throttleKey(), 5)) { + return; + } + + event(new Lockout($this)); + + $seconds = RateLimiter::availableIn($this->throttleKey()); + + throw ValidationException::withMessages([ + 'email' => trans('auth.throttle', [ + 'seconds' => $seconds, + 'minutes' => ceil($seconds / 60), + ]), + ]); + } + + /** + * Get the rate limiting throttle key for the request. + */ + public function throttleKey(): string + { + return Str::transliterate(Str::lower($this->input('email')).'|'.$this->ip()); + } +} diff --git a/app/Models/Article.php b/app/Models/Article.php new file mode 100644 index 00000000..ba6b54ee --- /dev/null +++ b/app/Models/Article.php @@ -0,0 +1,36 @@ +belongsTo(User::class); } + public function category() { return $this->belongsTo(Category::class); } + public function tags() { return $this->belongsToMany(Tag::class); } + + /* Accessors */ + protected function readWhat(): Attribute { + return Attribute::make( + get: fn () => strlen($this->fulltext) > env('MAX_CHARS_ARTICLE_TEXT',200) + ? 'Read more...' + : 'Read article.' + ); + } + + protected function startFulltext(): Attribute { + return Attribute::make( + get: fn () => strlen($this->fulltext) > env('MAX_CHARS_ARTICLE_TEXT',200) + ? StringTrimmerHelper::rightTrimOnSpace($this->fulltext, env('MAX_CHARS_ARTICLE_TEXT',200)) . '...' + : $this->fulltext + ); + } +} \ No newline at end of file diff --git a/app/Models/Category.php b/app/Models/Category.php new file mode 100644 index 00000000..b2d006c2 --- /dev/null +++ b/app/Models/Category.php @@ -0,0 +1,15 @@ +hasMany(Article::class); } +} \ No newline at end of file diff --git a/app/Models/Tag.php b/app/Models/Tag.php new file mode 100644 index 00000000..ca0a38b2 --- /dev/null +++ b/app/Models/Tag.php @@ -0,0 +1,15 @@ +belongsToMany(Article::class); } +} \ No newline at end of file diff --git a/app/Models/User.php b/app/Models/User.php new file mode 100644 index 00000000..2ac151c2 --- /dev/null +++ b/app/Models/User.php @@ -0,0 +1,47 @@ + + */ + protected $fillable = [ + 'name', + 'email', + 'password', + ]; + + /** + * The attributes that should be hidden for serialization. + * + * @var array + */ + protected $hidden = [ + 'password', + 'remember_token', + ]; + + /** + * The attributes that should be cast. + * + * @var array + */ + protected $casts = [ + 'email_verified_at' => 'datetime', + 'password' => 'hashed', + ]; + + /* Relationships */ + public function articles() { return $this->hasMany(Article::class); } +} \ No newline at end of file diff --git a/app/Providers/AppServiceProvider.php b/app/Providers/AppServiceProvider.php new file mode 100644 index 00000000..452e6b65 --- /dev/null +++ b/app/Providers/AppServiceProvider.php @@ -0,0 +1,24 @@ + + */ + protected $policies = [ + // + ]; + + /** + * Register any authentication / authorization services. + */ + public function boot(): void + { + // + } +} diff --git a/app/Providers/BroadcastServiceProvider.php b/app/Providers/BroadcastServiceProvider.php new file mode 100644 index 00000000..2be04f5d --- /dev/null +++ b/app/Providers/BroadcastServiceProvider.php @@ -0,0 +1,19 @@ +> + */ + protected $listen = [ + Registered::class => [ + SendEmailVerificationNotification::class, + ], + ]; + + /** + * Register any events for your application. + */ + public function boot(): void + { + // + } + + /** + * Determine if events and listeners should be automatically discovered. + */ + public function shouldDiscoverEvents(): bool + { + return false; + } +} diff --git a/app/Providers/RouteServiceProvider.php b/app/Providers/RouteServiceProvider.php new file mode 100644 index 00000000..4d4f7d28 --- /dev/null +++ b/app/Providers/RouteServiceProvider.php @@ -0,0 +1,39 @@ +by($request->user()?->id ?: $request->ip()); + }); + + $this->routes(function () { + Route::middleware('api') + ->prefix('api') + ->group(base_path('routes/api.php')); + + Route::middleware('web') + ->group(base_path('routes/web.php')); + }); + } +} \ No newline at end of file diff --git a/app/Services/RandomImage.php b/app/Services/RandomImage.php new file mode 100644 index 00000000..9a9fc5b0 --- /dev/null +++ b/app/Services/RandomImage.php @@ -0,0 +1,16 @@ +files(); + return FilesystemHelper::LEGACY_DISK . '/' . $ar[array_rand($ar)]; + } else return null; + } +} \ No newline at end of file diff --git a/app/Services/TagsForArticle.php b/app/Services/TagsForArticle.php new file mode 100644 index 00000000..dfca3665 --- /dev/null +++ b/app/Services/TagsForArticle.php @@ -0,0 +1,21 @@ +collect(); + $tagCollection->pull('_token'); + $tagCollection->pull('_method'); + $tagCollection->pull('category_id'); + $tagCollection->pull('title'); + $tagCollection->pull('fulltext'); + $tagCollection->pull('image'); + $tagCollection->pull('image_confirmation'); + return $tagCollection->values()->toArray(); + } +} \ No newline at end of file diff --git a/app/View/Components/AppLayout.php b/app/View/Components/AppLayout.php new file mode 100644 index 00000000..de0d46f5 --- /dev/null +++ b/app/View/Components/AppLayout.php @@ -0,0 +1,17 @@ +make(Illuminate\Contracts\Console\Kernel::class); + +$status = $kernel->handle( + $input = new Symfony\Component\Console\Input\ArgvInput, + new Symfony\Component\Console\Output\ConsoleOutput +); + +/* +|-------------------------------------------------------------------------- +| Shutdown The Application +|-------------------------------------------------------------------------- +| +| Once Artisan has finished running, we will fire off the shutdown events +| so that any final work may be done by the application before we shut +| down the process. This is the last thing to happen to the request. +| +*/ + +$kernel->terminate($input, $status); + +exit($status); diff --git a/bootstrap/app.php b/bootstrap/app.php new file mode 100644 index 00000000..037e17df --- /dev/null +++ b/bootstrap/app.php @@ -0,0 +1,55 @@ +singleton( + Illuminate\Contracts\Http\Kernel::class, + App\Http\Kernel::class +); + +$app->singleton( + Illuminate\Contracts\Console\Kernel::class, + App\Console\Kernel::class +); + +$app->singleton( + Illuminate\Contracts\Debug\ExceptionHandler::class, + App\Exceptions\Handler::class +); + +/* +|-------------------------------------------------------------------------- +| Return The Application +|-------------------------------------------------------------------------- +| +| This script returns the application instance. The instance is given to +| the calling script so we can separate the building of the instances +| from the actual running of the application and sending responses. +| +*/ + +return $app; diff --git a/bootstrap/cache/.gitignore b/bootstrap/cache/.gitignore new file mode 100644 index 00000000..d6b7ef32 --- /dev/null +++ b/bootstrap/cache/.gitignore @@ -0,0 +1,2 @@ +* +!.gitignore diff --git a/composer.json b/composer.json new file mode 100644 index 00000000..ce38f69f --- /dev/null +++ b/composer.json @@ -0,0 +1,68 @@ +{ + "name": "laravel/laravel", + "type": "project", + "description": "The skeleton application for the Laravel framework.", + "keywords": ["laravel", "framework"], + "license": "MIT", + "require": { + "php": "^8.1", + "barryvdh/laravel-debugbar": "^3.9", + "fakerphp/faker": "^1.23", + "guzzlehttp/guzzle": "^7.2", + "laravel/breeze": "^1.24", + "laravel/framework": "^10.10", + "laravel/sanctum": "^3.2", + "laravel/tinker": "^2.8" + }, + "require-dev": { + "laravel/pint": "^1.0", + "laravel/sail": "^1.18", + "mockery/mockery": "^1.4.4", + "nunomaduro/collision": "^7.0", + "phpunit/phpunit": "^10.1", + "spatie/laravel-ignition": "^2.0" + }, + "autoload": { + "psr-4": { + "App\\": "app/", + "Database\\Factories\\": "database/factories/", + "Database\\Seeders\\": "database/seeders/" + } + }, + "autoload-dev": { + "psr-4": { + "Tests\\": "tests/" + } + }, + "scripts": { + "post-autoload-dump": [ + "Illuminate\\Foundation\\ComposerScripts::postAutoloadDump", + "@php artisan package:discover --ansi" + ], + "post-update-cmd": [ + "@php artisan vendor:publish --tag=laravel-assets --ansi --force" + ], + "post-root-package-install": [ + "@php -r \"file_exists('.env') || copy('.env.example', '.env');\"" + ], + "post-create-project-cmd": [ + "@php artisan key:generate --ansi" + ] + }, + "extra": { + "laravel": { + "dont-discover": [] + } + }, + "config": { + "optimize-autoloader": true, + "preferred-install": "dist", + "sort-packages": true, + "allow-plugins": { + "pestphp/pest-plugin": true, + "php-http/discovery": true + } + }, + "minimum-stability": "stable", + "prefer-stable": true +} diff --git a/composer.lock b/composer.lock new file mode 100644 index 00000000..982a8a99 --- /dev/null +++ b/composer.lock @@ -0,0 +1,8288 @@ +{ + "_readme": [ + "This file locks the dependencies of your project to a known state", + "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies", + "This file is @generated automatically" + ], + "content-hash": "6e65ef035ef6580a7853581ad69a8367", + "packages": [ + { + "name": "barryvdh/laravel-debugbar", + "version": "v3.9.2", + "source": { + "type": "git", + "url": "https://github.com/barryvdh/laravel-debugbar.git", + "reference": "bfd0131c146973cab164e50f5cdd8a67cc60cab1" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/barryvdh/laravel-debugbar/zipball/bfd0131c146973cab164e50f5cdd8a67cc60cab1", + "reference": "bfd0131c146973cab164e50f5cdd8a67cc60cab1", + "shasum": "" + }, + "require": { + "illuminate/routing": "^9|^10", + "illuminate/session": "^9|^10", + "illuminate/support": "^9|^10", + "maximebf/debugbar": "^1.18.2", + "php": "^8.0", + "symfony/finder": "^6" + }, + "require-dev": { + "mockery/mockery": "^1.3.3", + "orchestra/testbench-dusk": "^5|^6|^7|^8", + "phpunit/phpunit": "^8.5.30|^9.0", + "squizlabs/php_codesniffer": "^3.5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.8-dev" + }, + "laravel": { + "providers": [ + "Barryvdh\\Debugbar\\ServiceProvider" + ], + "aliases": { + "Debugbar": "Barryvdh\\Debugbar\\Facades\\Debugbar" + } + } + }, + "autoload": { + "files": [ + "src/helpers.php" + ], + "psr-4": { + "Barryvdh\\Debugbar\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Barry vd. Heuvel", + "email": "barryvdh@gmail.com" + } + ], + "description": "PHP Debugbar integration for Laravel", + "keywords": [ + "debug", + "debugbar", + "laravel", + "profiler", + "webprofiler" + ], + "support": { + "issues": "https://github.com/barryvdh/laravel-debugbar/issues", + "source": "https://github.com/barryvdh/laravel-debugbar/tree/v3.9.2" + }, + "funding": [ + { + "url": "https://fruitcake.nl", + "type": "custom" + }, + { + "url": "https://github.com/barryvdh", + "type": "github" + } + ], + "time": "2023-08-25T18:43:57+00:00" + }, + { + "name": "brick/math", + "version": "0.11.0", + "source": { + "type": "git", + "url": "https://github.com/brick/math.git", + "reference": "0ad82ce168c82ba30d1c01ec86116ab52f589478" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/brick/math/zipball/0ad82ce168c82ba30d1c01ec86116ab52f589478", + "reference": "0ad82ce168c82ba30d1c01ec86116ab52f589478", + "shasum": "" + }, + "require": { + "php": "^8.0" + }, + "require-dev": { + "php-coveralls/php-coveralls": "^2.2", + "phpunit/phpunit": "^9.0", + "vimeo/psalm": "5.0.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Brick\\Math\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Arbitrary-precision arithmetic library", + "keywords": [ + "Arbitrary-precision", + "BigInteger", + "BigRational", + "arithmetic", + "bigdecimal", + "bignum", + "brick", + "math" + ], + "support": { + "issues": "https://github.com/brick/math/issues", + "source": "https://github.com/brick/math/tree/0.11.0" + }, + "funding": [ + { + "url": "https://github.com/BenMorel", + "type": "github" + } + ], + "time": "2023-01-15T23:15:59+00:00" + }, + { + "name": "dflydev/dot-access-data", + "version": "v3.0.2", + "source": { + "type": "git", + "url": "https://github.com/dflydev/dflydev-dot-access-data.git", + "reference": "f41715465d65213d644d3141a6a93081be5d3549" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/dflydev/dflydev-dot-access-data/zipball/f41715465d65213d644d3141a6a93081be5d3549", + "reference": "f41715465d65213d644d3141a6a93081be5d3549", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "require-dev": { + "phpstan/phpstan": "^0.12.42", + "phpunit/phpunit": "^7.5 || ^8.5 || ^9.3", + "scrutinizer/ocular": "1.6.0", + "squizlabs/php_codesniffer": "^3.5", + "vimeo/psalm": "^4.0.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Dflydev\\DotAccessData\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Dragonfly Development Inc.", + "email": "info@dflydev.com", + "homepage": "http://dflydev.com" + }, + { + "name": "Beau Simensen", + "email": "beau@dflydev.com", + "homepage": "http://beausimensen.com" + }, + { + "name": "Carlos Frutos", + "email": "carlos@kiwing.it", + "homepage": "https://github.com/cfrutos" + }, + { + "name": "Colin O'Dell", + "email": "colinodell@gmail.com", + "homepage": "https://www.colinodell.com" + } + ], + "description": "Given a deep data structure, access data by dot notation.", + "homepage": "https://github.com/dflydev/dflydev-dot-access-data", + "keywords": [ + "access", + "data", + "dot", + "notation" + ], + "support": { + "issues": "https://github.com/dflydev/dflydev-dot-access-data/issues", + "source": "https://github.com/dflydev/dflydev-dot-access-data/tree/v3.0.2" + }, + "time": "2022-10-27T11:44:00+00:00" + }, + { + "name": "doctrine/inflector", + "version": "2.0.8", + "source": { + "type": "git", + "url": "https://github.com/doctrine/inflector.git", + "reference": "f9301a5b2fb1216b2b08f02ba04dc45423db6bff" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/inflector/zipball/f9301a5b2fb1216b2b08f02ba04dc45423db6bff", + "reference": "f9301a5b2fb1216b2b08f02ba04dc45423db6bff", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "require-dev": { + "doctrine/coding-standard": "^11.0", + "phpstan/phpstan": "^1.8", + "phpstan/phpstan-phpunit": "^1.1", + "phpstan/phpstan-strict-rules": "^1.3", + "phpunit/phpunit": "^8.5 || ^9.5", + "vimeo/psalm": "^4.25 || ^5.4" + }, + "type": "library", + "autoload": { + "psr-4": { + "Doctrine\\Inflector\\": "lib/Doctrine/Inflector" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Guilherme Blanco", + "email": "guilhermeblanco@gmail.com" + }, + { + "name": "Roman Borschel", + "email": "roman@code-factory.org" + }, + { + "name": "Benjamin Eberlei", + "email": "kontakt@beberlei.de" + }, + { + "name": "Jonathan Wage", + "email": "jonwage@gmail.com" + }, + { + "name": "Johannes Schmitt", + "email": "schmittjoh@gmail.com" + } + ], + "description": "PHP Doctrine Inflector is a small library that can perform string manipulations with regard to upper/lowercase and singular/plural forms of words.", + "homepage": "https://www.doctrine-project.org/projects/inflector.html", + "keywords": [ + "inflection", + "inflector", + "lowercase", + "manipulation", + "php", + "plural", + "singular", + "strings", + "uppercase", + "words" + ], + "support": { + "issues": "https://github.com/doctrine/inflector/issues", + "source": "https://github.com/doctrine/inflector/tree/2.0.8" + }, + "funding": [ + { + "url": "https://www.doctrine-project.org/sponsorship.html", + "type": "custom" + }, + { + "url": "https://www.patreon.com/phpdoctrine", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finflector", + "type": "tidelift" + } + ], + "time": "2023-06-16T13:40:37+00:00" + }, + { + "name": "doctrine/lexer", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/doctrine/lexer.git", + "reference": "84a527db05647743d50373e0ec53a152f2cde568" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/lexer/zipball/84a527db05647743d50373e0ec53a152f2cde568", + "reference": "84a527db05647743d50373e0ec53a152f2cde568", + "shasum": "" + }, + "require": { + "php": "^8.1" + }, + "require-dev": { + "doctrine/coding-standard": "^10", + "phpstan/phpstan": "^1.9", + "phpunit/phpunit": "^9.5", + "psalm/plugin-phpunit": "^0.18.3", + "vimeo/psalm": "^5.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Doctrine\\Common\\Lexer\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Guilherme Blanco", + "email": "guilhermeblanco@gmail.com" + }, + { + "name": "Roman Borschel", + "email": "roman@code-factory.org" + }, + { + "name": "Johannes Schmitt", + "email": "schmittjoh@gmail.com" + } + ], + "description": "PHP Doctrine Lexer parser library that can be used in Top-Down, Recursive Descent Parsers.", + "homepage": "https://www.doctrine-project.org/projects/lexer.html", + "keywords": [ + "annotations", + "docblock", + "lexer", + "parser", + "php" + ], + "support": { + "issues": "https://github.com/doctrine/lexer/issues", + "source": "https://github.com/doctrine/lexer/tree/3.0.0" + }, + "funding": [ + { + "url": "https://www.doctrine-project.org/sponsorship.html", + "type": "custom" + }, + { + "url": "https://www.patreon.com/phpdoctrine", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/doctrine%2Flexer", + "type": "tidelift" + } + ], + "time": "2022-12-15T16:57:16+00:00" + }, + { + "name": "dragonmantank/cron-expression", + "version": "v3.3.3", + "source": { + "type": "git", + "url": "https://github.com/dragonmantank/cron-expression.git", + "reference": "adfb1f505deb6384dc8b39804c5065dd3c8c8c0a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/dragonmantank/cron-expression/zipball/adfb1f505deb6384dc8b39804c5065dd3c8c8c0a", + "reference": "adfb1f505deb6384dc8b39804c5065dd3c8c8c0a", + "shasum": "" + }, + "require": { + "php": "^7.2|^8.0", + "webmozart/assert": "^1.0" + }, + "replace": { + "mtdowling/cron-expression": "^1.0" + }, + "require-dev": { + "phpstan/extension-installer": "^1.0", + "phpstan/phpstan": "^1.0", + "phpstan/phpstan-webmozart-assert": "^1.0", + "phpunit/phpunit": "^7.0|^8.0|^9.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Cron\\": "src/Cron/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Chris Tankersley", + "email": "chris@ctankersley.com", + "homepage": "https://github.com/dragonmantank" + } + ], + "description": "CRON for PHP: Calculate the next or previous run date and determine if a CRON expression is due", + "keywords": [ + "cron", + "schedule" + ], + "support": { + "issues": "https://github.com/dragonmantank/cron-expression/issues", + "source": "https://github.com/dragonmantank/cron-expression/tree/v3.3.3" + }, + "funding": [ + { + "url": "https://github.com/dragonmantank", + "type": "github" + } + ], + "time": "2023-08-10T19:36:49+00:00" + }, + { + "name": "egulias/email-validator", + "version": "4.0.1", + "source": { + "type": "git", + "url": "https://github.com/egulias/EmailValidator.git", + "reference": "3a85486b709bc384dae8eb78fb2eec649bdb64ff" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/egulias/EmailValidator/zipball/3a85486b709bc384dae8eb78fb2eec649bdb64ff", + "reference": "3a85486b709bc384dae8eb78fb2eec649bdb64ff", + "shasum": "" + }, + "require": { + "doctrine/lexer": "^2.0 || ^3.0", + "php": ">=8.1", + "symfony/polyfill-intl-idn": "^1.26" + }, + "require-dev": { + "phpunit/phpunit": "^9.5.27", + "vimeo/psalm": "^4.30" + }, + "suggest": { + "ext-intl": "PHP Internationalization Libraries are required to use the SpoofChecking validation" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Egulias\\EmailValidator\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Eduardo Gulias Davis" + } + ], + "description": "A library for validating emails against several RFCs", + "homepage": "https://github.com/egulias/EmailValidator", + "keywords": [ + "email", + "emailvalidation", + "emailvalidator", + "validation", + "validator" + ], + "support": { + "issues": "https://github.com/egulias/EmailValidator/issues", + "source": "https://github.com/egulias/EmailValidator/tree/4.0.1" + }, + "funding": [ + { + "url": "https://github.com/egulias", + "type": "github" + } + ], + "time": "2023-01-14T14:17:03+00:00" + }, + { + "name": "fakerphp/faker", + "version": "v1.23.0", + "source": { + "type": "git", + "url": "https://github.com/FakerPHP/Faker.git", + "reference": "e3daa170d00fde61ea7719ef47bb09bb8f1d9b01" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/FakerPHP/Faker/zipball/e3daa170d00fde61ea7719ef47bb09bb8f1d9b01", + "reference": "e3daa170d00fde61ea7719ef47bb09bb8f1d9b01", + "shasum": "" + }, + "require": { + "php": "^7.4 || ^8.0", + "psr/container": "^1.0 || ^2.0", + "symfony/deprecation-contracts": "^2.2 || ^3.0" + }, + "conflict": { + "fzaninotto/faker": "*" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.4.1", + "doctrine/persistence": "^1.3 || ^2.0", + "ext-intl": "*", + "phpunit/phpunit": "^9.5.26", + "symfony/phpunit-bridge": "^5.4.16" + }, + "suggest": { + "doctrine/orm": "Required to use Faker\\ORM\\Doctrine", + "ext-curl": "Required by Faker\\Provider\\Image to download images.", + "ext-dom": "Required by Faker\\Provider\\HtmlLorem for generating random HTML.", + "ext-iconv": "Required by Faker\\Provider\\ru_RU\\Text::realText() for generating real Russian text.", + "ext-mbstring": "Required for multibyte Unicode string functionality." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "v1.21-dev" + } + }, + "autoload": { + "psr-4": { + "Faker\\": "src/Faker/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "François Zaninotto" + } + ], + "description": "Faker is a PHP library that generates fake data for you.", + "keywords": [ + "data", + "faker", + "fixtures" + ], + "support": { + "issues": "https://github.com/FakerPHP/Faker/issues", + "source": "https://github.com/FakerPHP/Faker/tree/v1.23.0" + }, + "time": "2023-06-12T08:44:38+00:00" + }, + { + "name": "fruitcake/php-cors", + "version": "v1.2.0", + "source": { + "type": "git", + "url": "https://github.com/fruitcake/php-cors.git", + "reference": "58571acbaa5f9f462c9c77e911700ac66f446d4e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/fruitcake/php-cors/zipball/58571acbaa5f9f462c9c77e911700ac66f446d4e", + "reference": "58571acbaa5f9f462c9c77e911700ac66f446d4e", + "shasum": "" + }, + "require": { + "php": "^7.4|^8.0", + "symfony/http-foundation": "^4.4|^5.4|^6" + }, + "require-dev": { + "phpstan/phpstan": "^1.4", + "phpunit/phpunit": "^9", + "squizlabs/php_codesniffer": "^3.5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.1-dev" + } + }, + "autoload": { + "psr-4": { + "Fruitcake\\Cors\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fruitcake", + "homepage": "https://fruitcake.nl" + }, + { + "name": "Barryvdh", + "email": "barryvdh@gmail.com" + } + ], + "description": "Cross-origin resource sharing library for the Symfony HttpFoundation", + "homepage": "https://github.com/fruitcake/php-cors", + "keywords": [ + "cors", + "laravel", + "symfony" + ], + "support": { + "issues": "https://github.com/fruitcake/php-cors/issues", + "source": "https://github.com/fruitcake/php-cors/tree/v1.2.0" + }, + "funding": [ + { + "url": "https://fruitcake.nl", + "type": "custom" + }, + { + "url": "https://github.com/barryvdh", + "type": "github" + } + ], + "time": "2022-02-20T15:07:15+00:00" + }, + { + "name": "graham-campbell/result-type", + "version": "v1.1.1", + "source": { + "type": "git", + "url": "https://github.com/GrahamCampbell/Result-Type.git", + "reference": "672eff8cf1d6fe1ef09ca0f89c4b287d6a3eb831" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/GrahamCampbell/Result-Type/zipball/672eff8cf1d6fe1ef09ca0f89c4b287d6a3eb831", + "reference": "672eff8cf1d6fe1ef09ca0f89c4b287d6a3eb831", + "shasum": "" + }, + "require": { + "php": "^7.2.5 || ^8.0", + "phpoption/phpoption": "^1.9.1" + }, + "require-dev": { + "phpunit/phpunit": "^8.5.32 || ^9.6.3 || ^10.0.12" + }, + "type": "library", + "autoload": { + "psr-4": { + "GrahamCampbell\\ResultType\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + } + ], + "description": "An Implementation Of The Result Type", + "keywords": [ + "Graham Campbell", + "GrahamCampbell", + "Result Type", + "Result-Type", + "result" + ], + "support": { + "issues": "https://github.com/GrahamCampbell/Result-Type/issues", + "source": "https://github.com/GrahamCampbell/Result-Type/tree/v1.1.1" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/graham-campbell/result-type", + "type": "tidelift" + } + ], + "time": "2023-02-25T20:23:15+00:00" + }, + { + "name": "guzzlehttp/guzzle", + "version": "7.8.0", + "source": { + "type": "git", + "url": "https://github.com/guzzle/guzzle.git", + "reference": "1110f66a6530a40fe7aea0378fe608ee2b2248f9" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/guzzle/zipball/1110f66a6530a40fe7aea0378fe608ee2b2248f9", + "reference": "1110f66a6530a40fe7aea0378fe608ee2b2248f9", + "shasum": "" + }, + "require": { + "ext-json": "*", + "guzzlehttp/promises": "^1.5.3 || ^2.0.1", + "guzzlehttp/psr7": "^1.9.1 || ^2.5.1", + "php": "^7.2.5 || ^8.0", + "psr/http-client": "^1.0", + "symfony/deprecation-contracts": "^2.2 || ^3.0" + }, + "provide": { + "psr/http-client-implementation": "1.0" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.8.1", + "ext-curl": "*", + "php-http/client-integration-tests": "dev-master#2c025848417c1135031fdf9c728ee53d0a7ceaee as 3.0.999", + "php-http/message-factory": "^1.1", + "phpunit/phpunit": "^8.5.29 || ^9.5.23", + "psr/log": "^1.1 || ^2.0 || ^3.0" + }, + "suggest": { + "ext-curl": "Required for CURL handler support", + "ext-intl": "Required for Internationalized Domain Name (IDN) support", + "psr/log": "Required for using the Log middleware" + }, + "type": "library", + "extra": { + "bamarni-bin": { + "bin-links": true, + "forward-command": false + } + }, + "autoload": { + "files": [ + "src/functions_include.php" + ], + "psr-4": { + "GuzzleHttp\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + }, + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + }, + { + "name": "Jeremy Lindblom", + "email": "jeremeamia@gmail.com", + "homepage": "https://github.com/jeremeamia" + }, + { + "name": "George Mponos", + "email": "gmponos@gmail.com", + "homepage": "https://github.com/gmponos" + }, + { + "name": "Tobias Nyholm", + "email": "tobias.nyholm@gmail.com", + "homepage": "https://github.com/Nyholm" + }, + { + "name": "Márk Sági-Kazár", + "email": "mark.sagikazar@gmail.com", + "homepage": "https://github.com/sagikazarmark" + }, + { + "name": "Tobias Schultze", + "email": "webmaster@tubo-world.de", + "homepage": "https://github.com/Tobion" + } + ], + "description": "Guzzle is a PHP HTTP client library", + "keywords": [ + "client", + "curl", + "framework", + "http", + "http client", + "psr-18", + "psr-7", + "rest", + "web service" + ], + "support": { + "issues": "https://github.com/guzzle/guzzle/issues", + "source": "https://github.com/guzzle/guzzle/tree/7.8.0" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://github.com/Nyholm", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/guzzle", + "type": "tidelift" + } + ], + "time": "2023-08-27T10:20:53+00:00" + }, + { + "name": "guzzlehttp/promises", + "version": "2.0.1", + "source": { + "type": "git", + "url": "https://github.com/guzzle/promises.git", + "reference": "111166291a0f8130081195ac4556a5587d7f1b5d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/promises/zipball/111166291a0f8130081195ac4556a5587d7f1b5d", + "reference": "111166291a0f8130081195ac4556a5587d7f1b5d", + "shasum": "" + }, + "require": { + "php": "^7.2.5 || ^8.0" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.8.1", + "phpunit/phpunit": "^8.5.29 || ^9.5.23" + }, + "type": "library", + "extra": { + "bamarni-bin": { + "bin-links": true, + "forward-command": false + } + }, + "autoload": { + "psr-4": { + "GuzzleHttp\\Promise\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + }, + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + }, + { + "name": "Tobias Nyholm", + "email": "tobias.nyholm@gmail.com", + "homepage": "https://github.com/Nyholm" + }, + { + "name": "Tobias Schultze", + "email": "webmaster@tubo-world.de", + "homepage": "https://github.com/Tobion" + } + ], + "description": "Guzzle promises library", + "keywords": [ + "promise" + ], + "support": { + "issues": "https://github.com/guzzle/promises/issues", + "source": "https://github.com/guzzle/promises/tree/2.0.1" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://github.com/Nyholm", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/promises", + "type": "tidelift" + } + ], + "time": "2023-08-03T15:11:55+00:00" + }, + { + "name": "guzzlehttp/psr7", + "version": "2.6.1", + "source": { + "type": "git", + "url": "https://github.com/guzzle/psr7.git", + "reference": "be45764272e8873c72dbe3d2edcfdfcc3bc9f727" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/psr7/zipball/be45764272e8873c72dbe3d2edcfdfcc3bc9f727", + "reference": "be45764272e8873c72dbe3d2edcfdfcc3bc9f727", + "shasum": "" + }, + "require": { + "php": "^7.2.5 || ^8.0", + "psr/http-factory": "^1.0", + "psr/http-message": "^1.1 || ^2.0", + "ralouphie/getallheaders": "^3.0" + }, + "provide": { + "psr/http-factory-implementation": "1.0", + "psr/http-message-implementation": "1.0" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.8.1", + "http-interop/http-factory-tests": "^0.9", + "phpunit/phpunit": "^8.5.29 || ^9.5.23" + }, + "suggest": { + "laminas/laminas-httphandlerrunner": "Emit PSR-7 responses" + }, + "type": "library", + "extra": { + "bamarni-bin": { + "bin-links": true, + "forward-command": false + } + }, + "autoload": { + "psr-4": { + "GuzzleHttp\\Psr7\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + }, + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + }, + { + "name": "George Mponos", + "email": "gmponos@gmail.com", + "homepage": "https://github.com/gmponos" + }, + { + "name": "Tobias Nyholm", + "email": "tobias.nyholm@gmail.com", + "homepage": "https://github.com/Nyholm" + }, + { + "name": "Márk Sági-Kazár", + "email": "mark.sagikazar@gmail.com", + "homepage": "https://github.com/sagikazarmark" + }, + { + "name": "Tobias Schultze", + "email": "webmaster@tubo-world.de", + "homepage": "https://github.com/Tobion" + }, + { + "name": "Márk Sági-Kazár", + "email": "mark.sagikazar@gmail.com", + "homepage": "https://sagikazarmark.hu" + } + ], + "description": "PSR-7 message implementation that also provides common utility methods", + "keywords": [ + "http", + "message", + "psr-7", + "request", + "response", + "stream", + "uri", + "url" + ], + "support": { + "issues": "https://github.com/guzzle/psr7/issues", + "source": "https://github.com/guzzle/psr7/tree/2.6.1" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://github.com/Nyholm", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/psr7", + "type": "tidelift" + } + ], + "time": "2023-08-27T10:13:57+00:00" + }, + { + "name": "guzzlehttp/uri-template", + "version": "v1.0.2", + "source": { + "type": "git", + "url": "https://github.com/guzzle/uri-template.git", + "reference": "61bf437fc2197f587f6857d3ff903a24f1731b5d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/guzzle/uri-template/zipball/61bf437fc2197f587f6857d3ff903a24f1731b5d", + "reference": "61bf437fc2197f587f6857d3ff903a24f1731b5d", + "shasum": "" + }, + "require": { + "php": "^7.2.5 || ^8.0", + "symfony/polyfill-php80": "^1.17" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.8.1", + "phpunit/phpunit": "^8.5.19 || ^9.5.8", + "uri-template/tests": "1.0.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "GuzzleHttp\\UriTemplate\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + }, + { + "name": "Michael Dowling", + "email": "mtdowling@gmail.com", + "homepage": "https://github.com/mtdowling" + }, + { + "name": "George Mponos", + "email": "gmponos@gmail.com", + "homepage": "https://github.com/gmponos" + }, + { + "name": "Tobias Nyholm", + "email": "tobias.nyholm@gmail.com", + "homepage": "https://github.com/Nyholm" + } + ], + "description": "A polyfill class for uri_template of PHP", + "keywords": [ + "guzzlehttp", + "uri-template" + ], + "support": { + "issues": "https://github.com/guzzle/uri-template/issues", + "source": "https://github.com/guzzle/uri-template/tree/v1.0.2" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://github.com/Nyholm", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/uri-template", + "type": "tidelift" + } + ], + "time": "2023-08-27T10:19:19+00:00" + }, + { + "name": "laravel/breeze", + "version": "v1.24.0", + "source": { + "type": "git", + "url": "https://github.com/laravel/breeze.git", + "reference": "d3979dc75f78c1c6b0b035f52e3f4ea2dacab615" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/breeze/zipball/d3979dc75f78c1c6b0b035f52e3f4ea2dacab615", + "reference": "d3979dc75f78c1c6b0b035f52e3f4ea2dacab615", + "shasum": "" + }, + "require": { + "illuminate/console": "^10.17", + "illuminate/filesystem": "^10.17", + "illuminate/support": "^10.17", + "illuminate/validation": "^10.17", + "php": "^8.1.0" + }, + "require-dev": { + "orchestra/testbench": "^8.0", + "phpstan/phpstan": "^1.10" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.x-dev" + }, + "laravel": { + "providers": [ + "Laravel\\Breeze\\BreezeServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Laravel\\Breeze\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "Minimal Laravel authentication scaffolding with Blade and Tailwind.", + "keywords": [ + "auth", + "laravel" + ], + "support": { + "issues": "https://github.com/laravel/breeze/issues", + "source": "https://github.com/laravel/breeze" + }, + "time": "2023-09-20T18:37:37+00:00" + }, + { + "name": "laravel/framework", + "version": "v10.25.2", + "source": { + "type": "git", + "url": "https://github.com/laravel/framework.git", + "reference": "6014dd456b414b305fb0b408404efdcec18e64bc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/framework/zipball/6014dd456b414b305fb0b408404efdcec18e64bc", + "reference": "6014dd456b414b305fb0b408404efdcec18e64bc", + "shasum": "" + }, + "require": { + "brick/math": "^0.9.3|^0.10.2|^0.11", + "composer-runtime-api": "^2.2", + "doctrine/inflector": "^2.0.5", + "dragonmantank/cron-expression": "^3.3.2", + "egulias/email-validator": "^3.2.1|^4.0", + "ext-ctype": "*", + "ext-filter": "*", + "ext-hash": "*", + "ext-mbstring": "*", + "ext-openssl": "*", + "ext-session": "*", + "ext-tokenizer": "*", + "fruitcake/php-cors": "^1.2", + "guzzlehttp/uri-template": "^1.0", + "laravel/prompts": "^0.1.9", + "laravel/serializable-closure": "^1.3", + "league/commonmark": "^2.2.1", + "league/flysystem": "^3.8.0", + "monolog/monolog": "^3.0", + "nesbot/carbon": "^2.67", + "nunomaduro/termwind": "^1.13", + "php": "^8.1", + "psr/container": "^1.1.1|^2.0.1", + "psr/log": "^1.0|^2.0|^3.0", + "psr/simple-cache": "^1.0|^2.0|^3.0", + "ramsey/uuid": "^4.7", + "symfony/console": "^6.2", + "symfony/error-handler": "^6.2", + "symfony/finder": "^6.2", + "symfony/http-foundation": "^6.2", + "symfony/http-kernel": "^6.2", + "symfony/mailer": "^6.2", + "symfony/mime": "^6.2", + "symfony/process": "^6.2", + "symfony/routing": "^6.2", + "symfony/uid": "^6.2", + "symfony/var-dumper": "^6.2", + "tijsverkoyen/css-to-inline-styles": "^2.2.5", + "vlucas/phpdotenv": "^5.4.1", + "voku/portable-ascii": "^2.0" + }, + "conflict": { + "tightenco/collect": "<5.5.33" + }, + "provide": { + "psr/container-implementation": "1.1|2.0", + "psr/simple-cache-implementation": "1.0|2.0|3.0" + }, + "replace": { + "illuminate/auth": "self.version", + "illuminate/broadcasting": "self.version", + "illuminate/bus": "self.version", + "illuminate/cache": "self.version", + "illuminate/collections": "self.version", + "illuminate/conditionable": "self.version", + "illuminate/config": "self.version", + "illuminate/console": "self.version", + "illuminate/container": "self.version", + "illuminate/contracts": "self.version", + "illuminate/cookie": "self.version", + "illuminate/database": "self.version", + "illuminate/encryption": "self.version", + "illuminate/events": "self.version", + "illuminate/filesystem": "self.version", + "illuminate/hashing": "self.version", + "illuminate/http": "self.version", + "illuminate/log": "self.version", + "illuminate/macroable": "self.version", + "illuminate/mail": "self.version", + "illuminate/notifications": "self.version", + "illuminate/pagination": "self.version", + "illuminate/pipeline": "self.version", + "illuminate/process": "self.version", + "illuminate/queue": "self.version", + "illuminate/redis": "self.version", + "illuminate/routing": "self.version", + "illuminate/session": "self.version", + "illuminate/support": "self.version", + "illuminate/testing": "self.version", + "illuminate/translation": "self.version", + "illuminate/validation": "self.version", + "illuminate/view": "self.version" + }, + "require-dev": { + "ably/ably-php": "^1.0", + "aws/aws-sdk-php": "^3.235.5", + "doctrine/dbal": "^3.5.1", + "ext-gmp": "*", + "fakerphp/faker": "^1.21", + "guzzlehttp/guzzle": "^7.5", + "league/flysystem-aws-s3-v3": "^3.0", + "league/flysystem-ftp": "^3.0", + "league/flysystem-path-prefixing": "^3.3", + "league/flysystem-read-only": "^3.3", + "league/flysystem-sftp-v3": "^3.0", + "mockery/mockery": "^1.5.1", + "orchestra/testbench-core": "^8.12", + "pda/pheanstalk": "^4.0", + "phpstan/phpstan": "^1.4.7", + "phpunit/phpunit": "^10.0.7", + "predis/predis": "^2.0.2", + "symfony/cache": "^6.2", + "symfony/http-client": "^6.2.4" + }, + "suggest": { + "ably/ably-php": "Required to use the Ably broadcast driver (^1.0).", + "aws/aws-sdk-php": "Required to use the SQS queue driver, DynamoDb failed job storage, and SES mail driver (^3.235.5).", + "brianium/paratest": "Required to run tests in parallel (^6.0).", + "doctrine/dbal": "Required to rename columns and drop SQLite columns (^3.5.1).", + "ext-apcu": "Required to use the APC cache driver.", + "ext-fileinfo": "Required to use the Filesystem class.", + "ext-ftp": "Required to use the Flysystem FTP driver.", + "ext-gd": "Required to use Illuminate\\Http\\Testing\\FileFactory::image().", + "ext-memcached": "Required to use the memcache cache driver.", + "ext-pcntl": "Required to use all features of the queue worker and console signal trapping.", + "ext-pdo": "Required to use all database features.", + "ext-posix": "Required to use all features of the queue worker.", + "ext-redis": "Required to use the Redis cache and queue drivers (^4.0|^5.0).", + "fakerphp/faker": "Required to use the eloquent factory builder (^1.9.1).", + "filp/whoops": "Required for friendly error pages in development (^2.14.3).", + "guzzlehttp/guzzle": "Required to use the HTTP Client and the ping methods on schedules (^7.5).", + "laravel/tinker": "Required to use the tinker console command (^2.0).", + "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (^3.0).", + "league/flysystem-ftp": "Required to use the Flysystem FTP driver (^3.0).", + "league/flysystem-path-prefixing": "Required to use the scoped driver (^3.3).", + "league/flysystem-read-only": "Required to use read-only disks (^3.3)", + "league/flysystem-sftp-v3": "Required to use the Flysystem SFTP driver (^3.0).", + "mockery/mockery": "Required to use mocking (^1.5.1).", + "nyholm/psr7": "Required to use PSR-7 bridging features (^1.2).", + "pda/pheanstalk": "Required to use the beanstalk queue driver (^4.0).", + "phpunit/phpunit": "Required to use assertions and run tests (^9.5.8|^10.0.7).", + "predis/predis": "Required to use the predis connector (^2.0.2).", + "psr/http-message": "Required to allow Storage::put to accept a StreamInterface (^1.0).", + "pusher/pusher-php-server": "Required to use the Pusher broadcast driver (^6.0|^7.0).", + "symfony/cache": "Required to PSR-6 cache bridge (^6.2).", + "symfony/filesystem": "Required to enable support for relative symbolic links (^6.2).", + "symfony/http-client": "Required to enable support for the Symfony API mail transports (^6.2).", + "symfony/mailgun-mailer": "Required to enable support for the Mailgun mail transport (^6.2).", + "symfony/postmark-mailer": "Required to enable support for the Postmark mail transport (^6.2).", + "symfony/psr-http-message-bridge": "Required to use PSR-7 bridging features (^2.0)." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "10.x-dev" + } + }, + "autoload": { + "files": [ + "src/Illuminate/Collections/helpers.php", + "src/Illuminate/Events/functions.php", + "src/Illuminate/Foundation/helpers.php", + "src/Illuminate/Support/helpers.php" + ], + "psr-4": { + "Illuminate\\": "src/Illuminate/", + "Illuminate\\Support\\": [ + "src/Illuminate/Macroable/", + "src/Illuminate/Collections/", + "src/Illuminate/Conditionable/" + ] + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "The Laravel Framework.", + "homepage": "https://laravel.com", + "keywords": [ + "framework", + "laravel" + ], + "support": { + "issues": "https://github.com/laravel/framework/issues", + "source": "https://github.com/laravel/framework" + }, + "time": "2023-09-28T14:08:59+00:00" + }, + { + "name": "laravel/prompts", + "version": "v0.1.10", + "source": { + "type": "git", + "url": "https://github.com/laravel/prompts.git", + "reference": "37ed55f6950d921a87d5beeab16d03f8de26b060" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/prompts/zipball/37ed55f6950d921a87d5beeab16d03f8de26b060", + "reference": "37ed55f6950d921a87d5beeab16d03f8de26b060", + "shasum": "" + }, + "require": { + "ext-mbstring": "*", + "illuminate/collections": "^10.0|^11.0", + "php": "^8.1", + "symfony/console": "^6.2" + }, + "conflict": { + "illuminate/console": ">=10.17.0 <10.25.0", + "laravel/framework": ">=10.17.0 <10.25.0" + }, + "require-dev": { + "mockery/mockery": "^1.5", + "pestphp/pest": "^2.3", + "phpstan/phpstan": "^1.10", + "phpstan/phpstan-mockery": "^1.1" + }, + "suggest": { + "ext-pcntl": "Required for the spinner to be animated." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "0.1.x-dev" + } + }, + "autoload": { + "files": [ + "src/helpers.php" + ], + "psr-4": { + "Laravel\\Prompts\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "support": { + "issues": "https://github.com/laravel/prompts/issues", + "source": "https://github.com/laravel/prompts/tree/v0.1.10" + }, + "time": "2023-09-29T07:26:07+00:00" + }, + { + "name": "laravel/sanctum", + "version": "v3.3.1", + "source": { + "type": "git", + "url": "https://github.com/laravel/sanctum.git", + "reference": "338f633e6487e76b255470d3373fbc29228aa971" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/sanctum/zipball/338f633e6487e76b255470d3373fbc29228aa971", + "reference": "338f633e6487e76b255470d3373fbc29228aa971", + "shasum": "" + }, + "require": { + "ext-json": "*", + "illuminate/console": "^9.21|^10.0", + "illuminate/contracts": "^9.21|^10.0", + "illuminate/database": "^9.21|^10.0", + "illuminate/support": "^9.21|^10.0", + "php": "^8.0.2" + }, + "require-dev": { + "mockery/mockery": "^1.0", + "orchestra/testbench": "^7.28.2|^8.8.3", + "phpstan/phpstan": "^1.10", + "phpunit/phpunit": "^9.6" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.x-dev" + }, + "laravel": { + "providers": [ + "Laravel\\Sanctum\\SanctumServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Laravel\\Sanctum\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "Laravel Sanctum provides a featherweight authentication system for SPAs and simple APIs.", + "keywords": [ + "auth", + "laravel", + "sanctum" + ], + "support": { + "issues": "https://github.com/laravel/sanctum/issues", + "source": "https://github.com/laravel/sanctum" + }, + "time": "2023-09-07T15:46:33+00:00" + }, + { + "name": "laravel/serializable-closure", + "version": "v1.3.1", + "source": { + "type": "git", + "url": "https://github.com/laravel/serializable-closure.git", + "reference": "e5a3057a5591e1cfe8183034b0203921abe2c902" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/e5a3057a5591e1cfe8183034b0203921abe2c902", + "reference": "e5a3057a5591e1cfe8183034b0203921abe2c902", + "shasum": "" + }, + "require": { + "php": "^7.3|^8.0" + }, + "require-dev": { + "nesbot/carbon": "^2.61", + "pestphp/pest": "^1.21.3", + "phpstan/phpstan": "^1.8.2", + "symfony/var-dumper": "^5.4.11" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Laravel\\SerializableClosure\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + }, + { + "name": "Nuno Maduro", + "email": "nuno@laravel.com" + } + ], + "description": "Laravel Serializable Closure provides an easy and secure way to serialize closures in PHP.", + "keywords": [ + "closure", + "laravel", + "serializable" + ], + "support": { + "issues": "https://github.com/laravel/serializable-closure/issues", + "source": "https://github.com/laravel/serializable-closure" + }, + "time": "2023-07-14T13:56:28+00:00" + }, + { + "name": "laravel/tinker", + "version": "v2.8.2", + "source": { + "type": "git", + "url": "https://github.com/laravel/tinker.git", + "reference": "b936d415b252b499e8c3b1f795cd4fc20f57e1f3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/tinker/zipball/b936d415b252b499e8c3b1f795cd4fc20f57e1f3", + "reference": "b936d415b252b499e8c3b1f795cd4fc20f57e1f3", + "shasum": "" + }, + "require": { + "illuminate/console": "^6.0|^7.0|^8.0|^9.0|^10.0", + "illuminate/contracts": "^6.0|^7.0|^8.0|^9.0|^10.0", + "illuminate/support": "^6.0|^7.0|^8.0|^9.0|^10.0", + "php": "^7.2.5|^8.0", + "psy/psysh": "^0.10.4|^0.11.1", + "symfony/var-dumper": "^4.3.4|^5.0|^6.0" + }, + "require-dev": { + "mockery/mockery": "~1.3.3|^1.4.2", + "phpstan/phpstan": "^1.10", + "phpunit/phpunit": "^8.5.8|^9.3.3" + }, + "suggest": { + "illuminate/database": "The Illuminate Database package (^6.0|^7.0|^8.0|^9.0|^10.0)." + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.x-dev" + }, + "laravel": { + "providers": [ + "Laravel\\Tinker\\TinkerServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Laravel\\Tinker\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "Powerful REPL for the Laravel framework.", + "keywords": [ + "REPL", + "Tinker", + "laravel", + "psysh" + ], + "support": { + "issues": "https://github.com/laravel/tinker/issues", + "source": "https://github.com/laravel/tinker/tree/v2.8.2" + }, + "time": "2023-08-15T14:27:00+00:00" + }, + { + "name": "league/commonmark", + "version": "2.4.1", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/commonmark.git", + "reference": "3669d6d5f7a47a93c08ddff335e6d945481a1dd5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/commonmark/zipball/3669d6d5f7a47a93c08ddff335e6d945481a1dd5", + "reference": "3669d6d5f7a47a93c08ddff335e6d945481a1dd5", + "shasum": "" + }, + "require": { + "ext-mbstring": "*", + "league/config": "^1.1.1", + "php": "^7.4 || ^8.0", + "psr/event-dispatcher": "^1.0", + "symfony/deprecation-contracts": "^2.1 || ^3.0", + "symfony/polyfill-php80": "^1.16" + }, + "require-dev": { + "cebe/markdown": "^1.0", + "commonmark/cmark": "0.30.0", + "commonmark/commonmark.js": "0.30.0", + "composer/package-versions-deprecated": "^1.8", + "embed/embed": "^4.4", + "erusev/parsedown": "^1.0", + "ext-json": "*", + "github/gfm": "0.29.0", + "michelf/php-markdown": "^1.4 || ^2.0", + "nyholm/psr7": "^1.5", + "phpstan/phpstan": "^1.8.2", + "phpunit/phpunit": "^9.5.21", + "scrutinizer/ocular": "^1.8.1", + "symfony/finder": "^5.3 | ^6.0", + "symfony/yaml": "^2.3 | ^3.0 | ^4.0 | ^5.0 | ^6.0", + "unleashedtech/php-coding-standard": "^3.1.1", + "vimeo/psalm": "^4.24.0 || ^5.0.0" + }, + "suggest": { + "symfony/yaml": "v2.3+ required if using the Front Matter extension" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "2.5-dev" + } + }, + "autoload": { + "psr-4": { + "League\\CommonMark\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Colin O'Dell", + "email": "colinodell@gmail.com", + "homepage": "https://www.colinodell.com", + "role": "Lead Developer" + } + ], + "description": "Highly-extensible PHP Markdown parser which fully supports the CommonMark spec and GitHub-Flavored Markdown (GFM)", + "homepage": "https://commonmark.thephpleague.com", + "keywords": [ + "commonmark", + "flavored", + "gfm", + "github", + "github-flavored", + "markdown", + "md", + "parser" + ], + "support": { + "docs": "https://commonmark.thephpleague.com/", + "forum": "https://github.com/thephpleague/commonmark/discussions", + "issues": "https://github.com/thephpleague/commonmark/issues", + "rss": "https://github.com/thephpleague/commonmark/releases.atom", + "source": "https://github.com/thephpleague/commonmark" + }, + "funding": [ + { + "url": "https://www.colinodell.com/sponsor", + "type": "custom" + }, + { + "url": "https://www.paypal.me/colinpodell/10.00", + "type": "custom" + }, + { + "url": "https://github.com/colinodell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/league/commonmark", + "type": "tidelift" + } + ], + "time": "2023-08-30T16:55:00+00:00" + }, + { + "name": "league/config", + "version": "v1.2.0", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/config.git", + "reference": "754b3604fb2984c71f4af4a9cbe7b57f346ec1f3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/config/zipball/754b3604fb2984c71f4af4a9cbe7b57f346ec1f3", + "reference": "754b3604fb2984c71f4af4a9cbe7b57f346ec1f3", + "shasum": "" + }, + "require": { + "dflydev/dot-access-data": "^3.0.1", + "nette/schema": "^1.2", + "php": "^7.4 || ^8.0" + }, + "require-dev": { + "phpstan/phpstan": "^1.8.2", + "phpunit/phpunit": "^9.5.5", + "scrutinizer/ocular": "^1.8.1", + "unleashedtech/php-coding-standard": "^3.1", + "vimeo/psalm": "^4.7.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.2-dev" + } + }, + "autoload": { + "psr-4": { + "League\\Config\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Colin O'Dell", + "email": "colinodell@gmail.com", + "homepage": "https://www.colinodell.com", + "role": "Lead Developer" + } + ], + "description": "Define configuration arrays with strict schemas and access values with dot notation", + "homepage": "https://config.thephpleague.com", + "keywords": [ + "array", + "config", + "configuration", + "dot", + "dot-access", + "nested", + "schema" + ], + "support": { + "docs": "https://config.thephpleague.com/", + "issues": "https://github.com/thephpleague/config/issues", + "rss": "https://github.com/thephpleague/config/releases.atom", + "source": "https://github.com/thephpleague/config" + }, + "funding": [ + { + "url": "https://www.colinodell.com/sponsor", + "type": "custom" + }, + { + "url": "https://www.paypal.me/colinpodell/10.00", + "type": "custom" + }, + { + "url": "https://github.com/colinodell", + "type": "github" + } + ], + "time": "2022-12-11T20:36:23+00:00" + }, + { + "name": "league/flysystem", + "version": "3.16.0", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/flysystem.git", + "reference": "4fdf372ca6b63c6e281b1c01a624349ccb757729" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/flysystem/zipball/4fdf372ca6b63c6e281b1c01a624349ccb757729", + "reference": "4fdf372ca6b63c6e281b1c01a624349ccb757729", + "shasum": "" + }, + "require": { + "league/flysystem-local": "^3.0.0", + "league/mime-type-detection": "^1.0.0", + "php": "^8.0.2" + }, + "conflict": { + "async-aws/core": "<1.19.0", + "async-aws/s3": "<1.14.0", + "aws/aws-sdk-php": "3.209.31 || 3.210.0", + "guzzlehttp/guzzle": "<7.0", + "guzzlehttp/ringphp": "<1.1.1", + "phpseclib/phpseclib": "3.0.15", + "symfony/http-client": "<5.2" + }, + "require-dev": { + "async-aws/s3": "^1.5", + "async-aws/simple-s3": "^1.1", + "aws/aws-sdk-php": "^3.220.0", + "composer/semver": "^3.0", + "ext-fileinfo": "*", + "ext-ftp": "*", + "ext-zip": "*", + "friendsofphp/php-cs-fixer": "^3.5", + "google/cloud-storage": "^1.23", + "microsoft/azure-storage-blob": "^1.1", + "phpseclib/phpseclib": "^3.0.14", + "phpstan/phpstan": "^0.12.26", + "phpunit/phpunit": "^9.5.11|^10.0", + "sabre/dav": "^4.3.1" + }, + "type": "library", + "autoload": { + "psr-4": { + "League\\Flysystem\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Frank de Jonge", + "email": "info@frankdejonge.nl" + } + ], + "description": "File storage abstraction for PHP", + "keywords": [ + "WebDAV", + "aws", + "cloud", + "file", + "files", + "filesystem", + "filesystems", + "ftp", + "s3", + "sftp", + "storage" + ], + "support": { + "issues": "https://github.com/thephpleague/flysystem/issues", + "source": "https://github.com/thephpleague/flysystem/tree/3.16.0" + }, + "funding": [ + { + "url": "https://ecologi.com/frankdejonge", + "type": "custom" + }, + { + "url": "https://github.com/frankdejonge", + "type": "github" + } + ], + "time": "2023-09-07T19:22:17+00:00" + }, + { + "name": "league/flysystem-local", + "version": "3.16.0", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/flysystem-local.git", + "reference": "ec7383f25642e6fd4bb0c9554fc2311245391781" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/flysystem-local/zipball/ec7383f25642e6fd4bb0c9554fc2311245391781", + "reference": "ec7383f25642e6fd4bb0c9554fc2311245391781", + "shasum": "" + }, + "require": { + "ext-fileinfo": "*", + "league/flysystem": "^3.0.0", + "league/mime-type-detection": "^1.0.0", + "php": "^8.0.2" + }, + "type": "library", + "autoload": { + "psr-4": { + "League\\Flysystem\\Local\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Frank de Jonge", + "email": "info@frankdejonge.nl" + } + ], + "description": "Local filesystem adapter for Flysystem.", + "keywords": [ + "Flysystem", + "file", + "files", + "filesystem", + "local" + ], + "support": { + "issues": "https://github.com/thephpleague/flysystem-local/issues", + "source": "https://github.com/thephpleague/flysystem-local/tree/3.16.0" + }, + "funding": [ + { + "url": "https://ecologi.com/frankdejonge", + "type": "custom" + }, + { + "url": "https://github.com/frankdejonge", + "type": "github" + } + ], + "time": "2023-08-30T10:23:59+00:00" + }, + { + "name": "league/mime-type-detection", + "version": "1.13.0", + "source": { + "type": "git", + "url": "https://github.com/thephpleague/mime-type-detection.git", + "reference": "a6dfb1194a2946fcdc1f38219445234f65b35c96" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/thephpleague/mime-type-detection/zipball/a6dfb1194a2946fcdc1f38219445234f65b35c96", + "reference": "a6dfb1194a2946fcdc1f38219445234f65b35c96", + "shasum": "" + }, + "require": { + "ext-fileinfo": "*", + "php": "^7.4 || ^8.0" + }, + "require-dev": { + "friendsofphp/php-cs-fixer": "^3.2", + "phpstan/phpstan": "^0.12.68", + "phpunit/phpunit": "^8.5.8 || ^9.3 || ^10.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "League\\MimeTypeDetection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Frank de Jonge", + "email": "info@frankdejonge.nl" + } + ], + "description": "Mime-type detection for Flysystem", + "support": { + "issues": "https://github.com/thephpleague/mime-type-detection/issues", + "source": "https://github.com/thephpleague/mime-type-detection/tree/1.13.0" + }, + "funding": [ + { + "url": "https://github.com/frankdejonge", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/league/flysystem", + "type": "tidelift" + } + ], + "time": "2023-08-05T12:09:49+00:00" + }, + { + "name": "maximebf/debugbar", + "version": "v1.18.2", + "source": { + "type": "git", + "url": "https://github.com/maximebf/php-debugbar.git", + "reference": "17dcf3f6ed112bb85a37cf13538fd8de49f5c274" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/maximebf/php-debugbar/zipball/17dcf3f6ed112bb85a37cf13538fd8de49f5c274", + "reference": "17dcf3f6ed112bb85a37cf13538fd8de49f5c274", + "shasum": "" + }, + "require": { + "php": "^7.1|^8", + "psr/log": "^1|^2|^3", + "symfony/var-dumper": "^4|^5|^6" + }, + "require-dev": { + "phpunit/phpunit": ">=7.5.20 <10.0", + "twig/twig": "^1.38|^2.7|^3.0" + }, + "suggest": { + "kriswallsmith/assetic": "The best way to manage assets", + "monolog/monolog": "Log using Monolog", + "predis/predis": "Redis storage" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.18-dev" + } + }, + "autoload": { + "psr-4": { + "DebugBar\\": "src/DebugBar/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Maxime Bouroumeau-Fuseau", + "email": "maxime.bouroumeau@gmail.com", + "homepage": "http://maximebf.com" + }, + { + "name": "Barry vd. Heuvel", + "email": "barryvdh@gmail.com" + } + ], + "description": "Debug bar in the browser for php application", + "homepage": "https://github.com/maximebf/php-debugbar", + "keywords": [ + "debug", + "debugbar" + ], + "support": { + "issues": "https://github.com/maximebf/php-debugbar/issues", + "source": "https://github.com/maximebf/php-debugbar/tree/v1.18.2" + }, + "time": "2023-02-04T15:27:00+00:00" + }, + { + "name": "monolog/monolog", + "version": "3.4.0", + "source": { + "type": "git", + "url": "https://github.com/Seldaek/monolog.git", + "reference": "e2392369686d420ca32df3803de28b5d6f76867d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/Seldaek/monolog/zipball/e2392369686d420ca32df3803de28b5d6f76867d", + "reference": "e2392369686d420ca32df3803de28b5d6f76867d", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/log": "^2.0 || ^3.0" + }, + "provide": { + "psr/log-implementation": "3.0.0" + }, + "require-dev": { + "aws/aws-sdk-php": "^3.0", + "doctrine/couchdb": "~1.0@dev", + "elasticsearch/elasticsearch": "^7 || ^8", + "ext-json": "*", + "graylog2/gelf-php": "^1.4.2 || ^2.0", + "guzzlehttp/guzzle": "^7.4.5", + "guzzlehttp/psr7": "^2.2", + "mongodb/mongodb": "^1.8", + "php-amqplib/php-amqplib": "~2.4 || ^3", + "phpstan/phpstan": "^1.9", + "phpstan/phpstan-deprecation-rules": "^1.0", + "phpstan/phpstan-strict-rules": "^1.4", + "phpunit/phpunit": "^10.1", + "predis/predis": "^1.1 || ^2", + "ruflin/elastica": "^7", + "symfony/mailer": "^5.4 || ^6", + "symfony/mime": "^5.4 || ^6" + }, + "suggest": { + "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", + "doctrine/couchdb": "Allow sending log messages to a CouchDB server", + "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client", + "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", + "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler", + "ext-mbstring": "Allow to work properly with unicode symbols", + "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)", + "ext-openssl": "Required to send log messages using SSL", + "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)", + "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", + "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)", + "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", + "rollbar/rollbar": "Allow sending log messages to Rollbar", + "ruflin/elastica": "Allow sending log messages to an Elastic Search server" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Monolog\\": "src/Monolog" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jordi Boggiano", + "email": "j.boggiano@seld.be", + "homepage": "https://seld.be" + } + ], + "description": "Sends your logs to files, sockets, inboxes, databases and various web services", + "homepage": "https://github.com/Seldaek/monolog", + "keywords": [ + "log", + "logging", + "psr-3" + ], + "support": { + "issues": "https://github.com/Seldaek/monolog/issues", + "source": "https://github.com/Seldaek/monolog/tree/3.4.0" + }, + "funding": [ + { + "url": "https://github.com/Seldaek", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/monolog/monolog", + "type": "tidelift" + } + ], + "time": "2023-06-21T08:46:11+00:00" + }, + { + "name": "nesbot/carbon", + "version": "2.71.0", + "source": { + "type": "git", + "url": "https://github.com/briannesbitt/Carbon.git", + "reference": "98276233188583f2ff845a0f992a235472d9466a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/98276233188583f2ff845a0f992a235472d9466a", + "reference": "98276233188583f2ff845a0f992a235472d9466a", + "shasum": "" + }, + "require": { + "ext-json": "*", + "php": "^7.1.8 || ^8.0", + "psr/clock": "^1.0", + "symfony/polyfill-mbstring": "^1.0", + "symfony/polyfill-php80": "^1.16", + "symfony/translation": "^3.4 || ^4.0 || ^5.0 || ^6.0" + }, + "provide": { + "psr/clock-implementation": "1.0" + }, + "require-dev": { + "doctrine/dbal": "^2.0 || ^3.1.4", + "doctrine/orm": "^2.7", + "friendsofphp/php-cs-fixer": "^3.0", + "kylekatarnls/multi-tester": "^2.0", + "ondrejmirtes/better-reflection": "*", + "phpmd/phpmd": "^2.9", + "phpstan/extension-installer": "^1.0", + "phpstan/phpstan": "^0.12.99 || ^1.7.14", + "phpunit/php-file-iterator": "^2.0.5 || ^3.0.6", + "phpunit/phpunit": "^7.5.20 || ^8.5.26 || ^9.5.20", + "squizlabs/php_codesniffer": "^3.4" + }, + "bin": [ + "bin/carbon" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-3.x": "3.x-dev", + "dev-master": "2.x-dev" + }, + "laravel": { + "providers": [ + "Carbon\\Laravel\\ServiceProvider" + ] + }, + "phpstan": { + "includes": [ + "extension.neon" + ] + } + }, + "autoload": { + "psr-4": { + "Carbon\\": "src/Carbon/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Brian Nesbitt", + "email": "brian@nesbot.com", + "homepage": "https://markido.com" + }, + { + "name": "kylekatarnls", + "homepage": "https://github.com/kylekatarnls" + } + ], + "description": "An API extension for DateTime that supports 281 different languages.", + "homepage": "https://carbon.nesbot.com", + "keywords": [ + "date", + "datetime", + "time" + ], + "support": { + "docs": "https://carbon.nesbot.com/docs", + "issues": "https://github.com/briannesbitt/Carbon/issues", + "source": "https://github.com/briannesbitt/Carbon" + }, + "funding": [ + { + "url": "https://github.com/sponsors/kylekatarnls", + "type": "github" + }, + { + "url": "https://opencollective.com/Carbon#sponsor", + "type": "opencollective" + }, + { + "url": "https://tidelift.com/subscription/pkg/packagist-nesbot-carbon?utm_source=packagist-nesbot-carbon&utm_medium=referral&utm_campaign=readme", + "type": "tidelift" + } + ], + "time": "2023-09-25T11:31:05+00:00" + }, + { + "name": "nette/schema", + "version": "v1.2.4", + "source": { + "type": "git", + "url": "https://github.com/nette/schema.git", + "reference": "c9ff517a53903b3d4e29ec547fb20feecb05b8ab" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nette/schema/zipball/c9ff517a53903b3d4e29ec547fb20feecb05b8ab", + "reference": "c9ff517a53903b3d4e29ec547fb20feecb05b8ab", + "shasum": "" + }, + "require": { + "nette/utils": "^2.5.7 || ^3.1.5 || ^4.0", + "php": "7.1 - 8.3" + }, + "require-dev": { + "nette/tester": "^2.3 || ^2.4", + "phpstan/phpstan-nette": "^1.0", + "tracy/tracy": "^2.7" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.2-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause", + "GPL-2.0-only", + "GPL-3.0-only" + ], + "authors": [ + { + "name": "David Grudl", + "homepage": "https://davidgrudl.com" + }, + { + "name": "Nette Community", + "homepage": "https://nette.org/contributors" + } + ], + "description": "📐 Nette Schema: validating data structures against a given Schema.", + "homepage": "https://nette.org", + "keywords": [ + "config", + "nette" + ], + "support": { + "issues": "https://github.com/nette/schema/issues", + "source": "https://github.com/nette/schema/tree/v1.2.4" + }, + "time": "2023-08-05T18:56:25+00:00" + }, + { + "name": "nette/utils", + "version": "v4.0.2", + "source": { + "type": "git", + "url": "https://github.com/nette/utils.git", + "reference": "cead6637226456b35e1175cc53797dd585d85545" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nette/utils/zipball/cead6637226456b35e1175cc53797dd585d85545", + "reference": "cead6637226456b35e1175cc53797dd585d85545", + "shasum": "" + }, + "require": { + "php": ">=8.0 <8.4" + }, + "conflict": { + "nette/finder": "<3", + "nette/schema": "<1.2.2" + }, + "require-dev": { + "jetbrains/phpstorm-attributes": "dev-master", + "nette/tester": "^2.5", + "phpstan/phpstan": "^1.0", + "tracy/tracy": "^2.9" + }, + "suggest": { + "ext-gd": "to use Image", + "ext-iconv": "to use Strings::webalize(), toAscii(), chr() and reverse()", + "ext-intl": "to use Strings::webalize(), toAscii(), normalize() and compare()", + "ext-json": "to use Nette\\Utils\\Json", + "ext-mbstring": "to use Strings::lower() etc...", + "ext-tokenizer": "to use Nette\\Utils\\Reflection::getUseStatements()" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause", + "GPL-2.0-only", + "GPL-3.0-only" + ], + "authors": [ + { + "name": "David Grudl", + "homepage": "https://davidgrudl.com" + }, + { + "name": "Nette Community", + "homepage": "https://nette.org/contributors" + } + ], + "description": "🛠 Nette Utils: lightweight utilities for string & array manipulation, image handling, safe JSON encoding/decoding, validation, slug or strong password generating etc.", + "homepage": "https://nette.org", + "keywords": [ + "array", + "core", + "datetime", + "images", + "json", + "nette", + "paginator", + "password", + "slugify", + "string", + "unicode", + "utf-8", + "utility", + "validation" + ], + "support": { + "issues": "https://github.com/nette/utils/issues", + "source": "https://github.com/nette/utils/tree/v4.0.2" + }, + "time": "2023-09-19T11:58:07+00:00" + }, + { + "name": "nikic/php-parser", + "version": "v4.17.1", + "source": { + "type": "git", + "url": "https://github.com/nikic/PHP-Parser.git", + "reference": "a6303e50c90c355c7eeee2c4a8b27fe8dc8fef1d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/a6303e50c90c355c7eeee2c4a8b27fe8dc8fef1d", + "reference": "a6303e50c90c355c7eeee2c4a8b27fe8dc8fef1d", + "shasum": "" + }, + "require": { + "ext-tokenizer": "*", + "php": ">=7.0" + }, + "require-dev": { + "ircmaxell/php-yacc": "^0.0.7", + "phpunit/phpunit": "^6.5 || ^7.0 || ^8.0 || ^9.0" + }, + "bin": [ + "bin/php-parse" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.9-dev" + } + }, + "autoload": { + "psr-4": { + "PhpParser\\": "lib/PhpParser" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Nikita Popov" + } + ], + "description": "A PHP parser written in PHP", + "keywords": [ + "parser", + "php" + ], + "support": { + "issues": "https://github.com/nikic/PHP-Parser/issues", + "source": "https://github.com/nikic/PHP-Parser/tree/v4.17.1" + }, + "time": "2023-08-13T19:53:39+00:00" + }, + { + "name": "nunomaduro/termwind", + "version": "v1.15.1", + "source": { + "type": "git", + "url": "https://github.com/nunomaduro/termwind.git", + "reference": "8ab0b32c8caa4a2e09700ea32925441385e4a5dc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nunomaduro/termwind/zipball/8ab0b32c8caa4a2e09700ea32925441385e4a5dc", + "reference": "8ab0b32c8caa4a2e09700ea32925441385e4a5dc", + "shasum": "" + }, + "require": { + "ext-mbstring": "*", + "php": "^8.0", + "symfony/console": "^5.3.0|^6.0.0" + }, + "require-dev": { + "ergebnis/phpstan-rules": "^1.0.", + "illuminate/console": "^8.0|^9.0", + "illuminate/support": "^8.0|^9.0", + "laravel/pint": "^1.0.0", + "pestphp/pest": "^1.21.0", + "pestphp/pest-plugin-mock": "^1.0", + "phpstan/phpstan": "^1.4.6", + "phpstan/phpstan-strict-rules": "^1.1.0", + "symfony/var-dumper": "^5.2.7|^6.0.0", + "thecodingmachine/phpstan-strict-rules": "^1.0.0" + }, + "type": "library", + "extra": { + "laravel": { + "providers": [ + "Termwind\\Laravel\\TermwindServiceProvider" + ] + } + }, + "autoload": { + "files": [ + "src/Functions.php" + ], + "psr-4": { + "Termwind\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nuno Maduro", + "email": "enunomaduro@gmail.com" + } + ], + "description": "Its like Tailwind CSS, but for the console.", + "keywords": [ + "cli", + "console", + "css", + "package", + "php", + "style" + ], + "support": { + "issues": "https://github.com/nunomaduro/termwind/issues", + "source": "https://github.com/nunomaduro/termwind/tree/v1.15.1" + }, + "funding": [ + { + "url": "https://www.paypal.com/paypalme/enunomaduro", + "type": "custom" + }, + { + "url": "https://github.com/nunomaduro", + "type": "github" + }, + { + "url": "https://github.com/xiCO2k", + "type": "github" + } + ], + "time": "2023-02-08T01:06:31+00:00" + }, + { + "name": "phpoption/phpoption", + "version": "1.9.1", + "source": { + "type": "git", + "url": "https://github.com/schmittjoh/php-option.git", + "reference": "dd3a383e599f49777d8b628dadbb90cae435b87e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/schmittjoh/php-option/zipball/dd3a383e599f49777d8b628dadbb90cae435b87e", + "reference": "dd3a383e599f49777d8b628dadbb90cae435b87e", + "shasum": "" + }, + "require": { + "php": "^7.2.5 || ^8.0" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.8.2", + "phpunit/phpunit": "^8.5.32 || ^9.6.3 || ^10.0.12" + }, + "type": "library", + "extra": { + "bamarni-bin": { + "bin-links": true, + "forward-command": true + }, + "branch-alias": { + "dev-master": "1.9-dev" + } + }, + "autoload": { + "psr-4": { + "PhpOption\\": "src/PhpOption/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "Apache-2.0" + ], + "authors": [ + { + "name": "Johannes M. Schmitt", + "email": "schmittjoh@gmail.com", + "homepage": "https://github.com/schmittjoh" + }, + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + } + ], + "description": "Option Type for PHP", + "keywords": [ + "language", + "option", + "php", + "type" + ], + "support": { + "issues": "https://github.com/schmittjoh/php-option/issues", + "source": "https://github.com/schmittjoh/php-option/tree/1.9.1" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/phpoption/phpoption", + "type": "tidelift" + } + ], + "time": "2023-02-25T19:38:58+00:00" + }, + { + "name": "psr/clock", + "version": "1.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/clock.git", + "reference": "e41a24703d4560fd0acb709162f73b8adfc3aa0d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/clock/zipball/e41a24703d4560fd0acb709162f73b8adfc3aa0d", + "reference": "e41a24703d4560fd0acb709162f73b8adfc3aa0d", + "shasum": "" + }, + "require": { + "php": "^7.0 || ^8.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Psr\\Clock\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for reading the clock.", + "homepage": "https://github.com/php-fig/clock", + "keywords": [ + "clock", + "now", + "psr", + "psr-20", + "time" + ], + "support": { + "issues": "https://github.com/php-fig/clock/issues", + "source": "https://github.com/php-fig/clock/tree/1.0.0" + }, + "time": "2022-11-25T14:36:26+00:00" + }, + { + "name": "psr/container", + "version": "2.0.2", + "source": { + "type": "git", + "url": "https://github.com/php-fig/container.git", + "reference": "c71ecc56dfe541dbd90c5360474fbc405f8d5963" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/container/zipball/c71ecc56dfe541dbd90c5360474fbc405f8d5963", + "reference": "c71ecc56dfe541dbd90c5360474fbc405f8d5963", + "shasum": "" + }, + "require": { + "php": ">=7.4.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Container\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common Container Interface (PHP FIG PSR-11)", + "homepage": "https://github.com/php-fig/container", + "keywords": [ + "PSR-11", + "container", + "container-interface", + "container-interop", + "psr" + ], + "support": { + "issues": "https://github.com/php-fig/container/issues", + "source": "https://github.com/php-fig/container/tree/2.0.2" + }, + "time": "2021-11-05T16:47:00+00:00" + }, + { + "name": "psr/event-dispatcher", + "version": "1.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/event-dispatcher.git", + "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/event-dispatcher/zipball/dbefd12671e8a14ec7f180cab83036ed26714bb0", + "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0", + "shasum": "" + }, + "require": { + "php": ">=7.2.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\EventDispatcher\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Standard interfaces for event handling.", + "keywords": [ + "events", + "psr", + "psr-14" + ], + "support": { + "issues": "https://github.com/php-fig/event-dispatcher/issues", + "source": "https://github.com/php-fig/event-dispatcher/tree/1.0.0" + }, + "time": "2019-01-08T18:20:26+00:00" + }, + { + "name": "psr/http-client", + "version": "1.0.3", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-client.git", + "reference": "bb5906edc1c324c9a05aa0873d40117941e5fa90" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-client/zipball/bb5906edc1c324c9a05aa0873d40117941e5fa90", + "reference": "bb5906edc1c324c9a05aa0873d40117941e5fa90", + "shasum": "" + }, + "require": { + "php": "^7.0 || ^8.0", + "psr/http-message": "^1.0 || ^2.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Client\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP clients", + "homepage": "https://github.com/php-fig/http-client", + "keywords": [ + "http", + "http-client", + "psr", + "psr-18" + ], + "support": { + "source": "https://github.com/php-fig/http-client" + }, + "time": "2023-09-23T14:17:50+00:00" + }, + { + "name": "psr/http-factory", + "version": "1.0.2", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-factory.git", + "reference": "e616d01114759c4c489f93b099585439f795fe35" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-factory/zipball/e616d01114759c4c489f93b099585439f795fe35", + "reference": "e616d01114759c4c489f93b099585439f795fe35", + "shasum": "" + }, + "require": { + "php": ">=7.0.0", + "psr/http-message": "^1.0 || ^2.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Message\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interfaces for PSR-7 HTTP message factories", + "keywords": [ + "factory", + "http", + "message", + "psr", + "psr-17", + "psr-7", + "request", + "response" + ], + "support": { + "source": "https://github.com/php-fig/http-factory/tree/1.0.2" + }, + "time": "2023-04-10T20:10:41+00:00" + }, + { + "name": "psr/http-message", + "version": "2.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-message.git", + "reference": "402d35bcb92c70c026d1a6a9883f06b2ead23d71" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-message/zipball/402d35bcb92c70c026d1a6a9883f06b2ead23d71", + "reference": "402d35bcb92c70c026d1a6a9883f06b2ead23d71", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Message\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP messages", + "homepage": "https://github.com/php-fig/http-message", + "keywords": [ + "http", + "http-message", + "psr", + "psr-7", + "request", + "response" + ], + "support": { + "source": "https://github.com/php-fig/http-message/tree/2.0" + }, + "time": "2023-04-04T09:54:51+00:00" + }, + { + "name": "psr/log", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/log.git", + "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001", + "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001", + "shasum": "" + }, + "require": { + "php": ">=8.0.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Log\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for logging libraries", + "homepage": "https://github.com/php-fig/log", + "keywords": [ + "log", + "psr", + "psr-3" + ], + "support": { + "source": "https://github.com/php-fig/log/tree/3.0.0" + }, + "time": "2021-07-14T16:46:02+00:00" + }, + { + "name": "psr/simple-cache", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/simple-cache.git", + "reference": "764e0b3939f5ca87cb904f570ef9be2d78a07865" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/simple-cache/zipball/764e0b3939f5ca87cb904f570ef9be2d78a07865", + "reference": "764e0b3939f5ca87cb904f570ef9be2d78a07865", + "shasum": "" + }, + "require": { + "php": ">=8.0.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\SimpleCache\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interfaces for simple caching", + "keywords": [ + "cache", + "caching", + "psr", + "psr-16", + "simple-cache" + ], + "support": { + "source": "https://github.com/php-fig/simple-cache/tree/3.0.0" + }, + "time": "2021-10-29T13:26:27+00:00" + }, + { + "name": "psy/psysh", + "version": "v0.11.21", + "source": { + "type": "git", + "url": "https://github.com/bobthecow/psysh.git", + "reference": "bcb22101107f3bf770523b65630c9d547f60c540" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/bobthecow/psysh/zipball/bcb22101107f3bf770523b65630c9d547f60c540", + "reference": "bcb22101107f3bf770523b65630c9d547f60c540", + "shasum": "" + }, + "require": { + "ext-json": "*", + "ext-tokenizer": "*", + "nikic/php-parser": "^4.0 || ^3.1", + "php": "^8.0 || ^7.0.8", + "symfony/console": "^6.0 || ^5.0 || ^4.0 || ^3.4", + "symfony/var-dumper": "^6.0 || ^5.0 || ^4.0 || ^3.4" + }, + "conflict": { + "symfony/console": "4.4.37 || 5.3.14 || 5.3.15 || 5.4.3 || 5.4.4 || 6.0.3 || 6.0.4" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.2" + }, + "suggest": { + "ext-pcntl": "Enabling the PCNTL extension makes PsySH a lot happier :)", + "ext-pdo-sqlite": "The doc command requires SQLite to work.", + "ext-posix": "If you have PCNTL, you'll want the POSIX extension as well.", + "ext-readline": "Enables support for arrow-key history navigation, and showing and manipulating command history." + }, + "bin": [ + "bin/psysh" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "0.11.x-dev" + }, + "bamarni-bin": { + "bin-links": false, + "forward-command": false + } + }, + "autoload": { + "files": [ + "src/functions.php" + ], + "psr-4": { + "Psy\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Justin Hileman", + "email": "justin@justinhileman.info", + "homepage": "http://justinhileman.com" + } + ], + "description": "An interactive shell for modern PHP.", + "homepage": "http://psysh.org", + "keywords": [ + "REPL", + "console", + "interactive", + "shell" + ], + "support": { + "issues": "https://github.com/bobthecow/psysh/issues", + "source": "https://github.com/bobthecow/psysh/tree/v0.11.21" + }, + "time": "2023-09-17T21:15:54+00:00" + }, + { + "name": "ralouphie/getallheaders", + "version": "3.0.3", + "source": { + "type": "git", + "url": "https://github.com/ralouphie/getallheaders.git", + "reference": "120b605dfeb996808c31b6477290a714d356e822" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822", + "reference": "120b605dfeb996808c31b6477290a714d356e822", + "shasum": "" + }, + "require": { + "php": ">=5.6" + }, + "require-dev": { + "php-coveralls/php-coveralls": "^2.1", + "phpunit/phpunit": "^5 || ^6.5" + }, + "type": "library", + "autoload": { + "files": [ + "src/getallheaders.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ralph Khattar", + "email": "ralph.khattar@gmail.com" + } + ], + "description": "A polyfill for getallheaders.", + "support": { + "issues": "https://github.com/ralouphie/getallheaders/issues", + "source": "https://github.com/ralouphie/getallheaders/tree/develop" + }, + "time": "2019-03-08T08:55:37+00:00" + }, + { + "name": "ramsey/collection", + "version": "2.0.0", + "source": { + "type": "git", + "url": "https://github.com/ramsey/collection.git", + "reference": "a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ramsey/collection/zipball/a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5", + "reference": "a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5", + "shasum": "" + }, + "require": { + "php": "^8.1" + }, + "require-dev": { + "captainhook/plugin-composer": "^5.3", + "ergebnis/composer-normalize": "^2.28.3", + "fakerphp/faker": "^1.21", + "hamcrest/hamcrest-php": "^2.0", + "jangregor/phpstan-prophecy": "^1.0", + "mockery/mockery": "^1.5", + "php-parallel-lint/php-console-highlighter": "^1.0", + "php-parallel-lint/php-parallel-lint": "^1.3", + "phpcsstandards/phpcsutils": "^1.0.0-rc1", + "phpspec/prophecy-phpunit": "^2.0", + "phpstan/extension-installer": "^1.2", + "phpstan/phpstan": "^1.9", + "phpstan/phpstan-mockery": "^1.1", + "phpstan/phpstan-phpunit": "^1.3", + "phpunit/phpunit": "^9.5", + "psalm/plugin-mockery": "^1.1", + "psalm/plugin-phpunit": "^0.18.4", + "ramsey/coding-standard": "^2.0.3", + "ramsey/conventional-commits": "^1.3", + "vimeo/psalm": "^5.4" + }, + "type": "library", + "extra": { + "captainhook": { + "force-install": true + }, + "ramsey/conventional-commits": { + "configFile": "conventional-commits.json" + } + }, + "autoload": { + "psr-4": { + "Ramsey\\Collection\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ben Ramsey", + "email": "ben@benramsey.com", + "homepage": "https://benramsey.com" + } + ], + "description": "A PHP library for representing and manipulating collections.", + "keywords": [ + "array", + "collection", + "hash", + "map", + "queue", + "set" + ], + "support": { + "issues": "https://github.com/ramsey/collection/issues", + "source": "https://github.com/ramsey/collection/tree/2.0.0" + }, + "funding": [ + { + "url": "https://github.com/ramsey", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/ramsey/collection", + "type": "tidelift" + } + ], + "time": "2022-12-31T21:50:55+00:00" + }, + { + "name": "ramsey/uuid", + "version": "4.7.4", + "source": { + "type": "git", + "url": "https://github.com/ramsey/uuid.git", + "reference": "60a4c63ab724854332900504274f6150ff26d286" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ramsey/uuid/zipball/60a4c63ab724854332900504274f6150ff26d286", + "reference": "60a4c63ab724854332900504274f6150ff26d286", + "shasum": "" + }, + "require": { + "brick/math": "^0.8.8 || ^0.9 || ^0.10 || ^0.11", + "ext-json": "*", + "php": "^8.0", + "ramsey/collection": "^1.2 || ^2.0" + }, + "replace": { + "rhumsaa/uuid": "self.version" + }, + "require-dev": { + "captainhook/captainhook": "^5.10", + "captainhook/plugin-composer": "^5.3", + "dealerdirect/phpcodesniffer-composer-installer": "^0.7.0", + "doctrine/annotations": "^1.8", + "ergebnis/composer-normalize": "^2.15", + "mockery/mockery": "^1.3", + "paragonie/random-lib": "^2", + "php-mock/php-mock": "^2.2", + "php-mock/php-mock-mockery": "^1.3", + "php-parallel-lint/php-parallel-lint": "^1.1", + "phpbench/phpbench": "^1.0", + "phpstan/extension-installer": "^1.1", + "phpstan/phpstan": "^1.8", + "phpstan/phpstan-mockery": "^1.1", + "phpstan/phpstan-phpunit": "^1.1", + "phpunit/phpunit": "^8.5 || ^9", + "ramsey/composer-repl": "^1.4", + "slevomat/coding-standard": "^8.4", + "squizlabs/php_codesniffer": "^3.5", + "vimeo/psalm": "^4.9" + }, + "suggest": { + "ext-bcmath": "Enables faster math with arbitrary-precision integers using BCMath.", + "ext-gmp": "Enables faster math with arbitrary-precision integers using GMP.", + "ext-uuid": "Enables the use of PeclUuidTimeGenerator and PeclUuidRandomGenerator.", + "paragonie/random-lib": "Provides RandomLib for use with the RandomLibAdapter", + "ramsey/uuid-doctrine": "Allows the use of Ramsey\\Uuid\\Uuid as Doctrine field type." + }, + "type": "library", + "extra": { + "captainhook": { + "force-install": true + } + }, + "autoload": { + "files": [ + "src/functions.php" + ], + "psr-4": { + "Ramsey\\Uuid\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "A PHP library for generating and working with universally unique identifiers (UUIDs).", + "keywords": [ + "guid", + "identifier", + "uuid" + ], + "support": { + "issues": "https://github.com/ramsey/uuid/issues", + "source": "https://github.com/ramsey/uuid/tree/4.7.4" + }, + "funding": [ + { + "url": "https://github.com/ramsey", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/ramsey/uuid", + "type": "tidelift" + } + ], + "time": "2023-04-15T23:01:58+00:00" + }, + { + "name": "symfony/console", + "version": "v6.3.4", + "source": { + "type": "git", + "url": "https://github.com/symfony/console.git", + "reference": "eca495f2ee845130855ddf1cf18460c38966c8b6" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/console/zipball/eca495f2ee845130855ddf1cf18460c38966c8b6", + "reference": "eca495f2ee845130855ddf1cf18460c38966c8b6", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-mbstring": "~1.0", + "symfony/service-contracts": "^2.5|^3", + "symfony/string": "^5.4|^6.0" + }, + "conflict": { + "symfony/dependency-injection": "<5.4", + "symfony/dotenv": "<5.4", + "symfony/event-dispatcher": "<5.4", + "symfony/lock": "<5.4", + "symfony/process": "<5.4" + }, + "provide": { + "psr/log-implementation": "1.0|2.0|3.0" + }, + "require-dev": { + "psr/log": "^1|^2|^3", + "symfony/config": "^5.4|^6.0", + "symfony/dependency-injection": "^5.4|^6.0", + "symfony/event-dispatcher": "^5.4|^6.0", + "symfony/lock": "^5.4|^6.0", + "symfony/process": "^5.4|^6.0", + "symfony/var-dumper": "^5.4|^6.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Console\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Eases the creation of beautiful and testable command line interfaces", + "homepage": "https://symfony.com", + "keywords": [ + "cli", + "command-line", + "console", + "terminal" + ], + "support": { + "source": "https://github.com/symfony/console/tree/v6.3.4" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-08-16T10:10:12+00:00" + }, + { + "name": "symfony/css-selector", + "version": "v6.3.2", + "source": { + "type": "git", + "url": "https://github.com/symfony/css-selector.git", + "reference": "883d961421ab1709877c10ac99451632a3d6fa57" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/css-selector/zipball/883d961421ab1709877c10ac99451632a3d6fa57", + "reference": "883d961421ab1709877c10ac99451632a3d6fa57", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\CssSelector\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Jean-François Simon", + "email": "jeanfrancois.simon@sensiolabs.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Converts CSS selectors to XPath expressions", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/css-selector/tree/v6.3.2" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-07-12T16:00:22+00:00" + }, + { + "name": "symfony/deprecation-contracts", + "version": "v3.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/deprecation-contracts.git", + "reference": "7c3aff79d10325257a001fcf92d991f24fc967cf" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/deprecation-contracts/zipball/7c3aff79d10325257a001fcf92d991f24fc967cf", + "reference": "7c3aff79d10325257a001fcf92d991f24fc967cf", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.4-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "files": [ + "function.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "A generic function and convention to trigger deprecation notices", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/deprecation-contracts/tree/v3.3.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-05-23T14:45:45+00:00" + }, + { + "name": "symfony/error-handler", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/error-handler.git", + "reference": "1f69476b64fb47105c06beef757766c376b548c4" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/error-handler/zipball/1f69476b64fb47105c06beef757766c376b548c4", + "reference": "1f69476b64fb47105c06beef757766c376b548c4", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/log": "^1|^2|^3", + "symfony/var-dumper": "^5.4|^6.0" + }, + "conflict": { + "symfony/deprecation-contracts": "<2.5" + }, + "require-dev": { + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/http-kernel": "^5.4|^6.0", + "symfony/serializer": "^5.4|^6.0" + }, + "bin": [ + "Resources/bin/patch-type-declarations" + ], + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\ErrorHandler\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides tools to manage errors and ease debugging PHP code", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/error-handler/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-12T06:57:20+00:00" + }, + { + "name": "symfony/event-dispatcher", + "version": "v6.3.2", + "source": { + "type": "git", + "url": "https://github.com/symfony/event-dispatcher.git", + "reference": "adb01fe097a4ee930db9258a3cc906b5beb5cf2e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/adb01fe097a4ee930db9258a3cc906b5beb5cf2e", + "reference": "adb01fe097a4ee930db9258a3cc906b5beb5cf2e", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/event-dispatcher-contracts": "^2.5|^3" + }, + "conflict": { + "symfony/dependency-injection": "<5.4", + "symfony/service-contracts": "<2.5" + }, + "provide": { + "psr/event-dispatcher-implementation": "1.0", + "symfony/event-dispatcher-implementation": "2.0|3.0" + }, + "require-dev": { + "psr/log": "^1|^2|^3", + "symfony/config": "^5.4|^6.0", + "symfony/dependency-injection": "^5.4|^6.0", + "symfony/error-handler": "^5.4|^6.0", + "symfony/expression-language": "^5.4|^6.0", + "symfony/http-foundation": "^5.4|^6.0", + "symfony/service-contracts": "^2.5|^3", + "symfony/stopwatch": "^5.4|^6.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\EventDispatcher\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides tools that allow your application components to communicate with each other by dispatching events and listening to them", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/event-dispatcher/tree/v6.3.2" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-07-06T06:56:43+00:00" + }, + { + "name": "symfony/event-dispatcher-contracts", + "version": "v3.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/event-dispatcher-contracts.git", + "reference": "a76aed96a42d2b521153fb382d418e30d18b59df" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/event-dispatcher-contracts/zipball/a76aed96a42d2b521153fb382d418e30d18b59df", + "reference": "a76aed96a42d2b521153fb382d418e30d18b59df", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/event-dispatcher": "^1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.4-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\EventDispatcher\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to dispatching event", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/event-dispatcher-contracts/tree/v3.3.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-05-23T14:45:45+00:00" + }, + { + "name": "symfony/finder", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/finder.git", + "reference": "a1b31d88c0e998168ca7792f222cbecee47428c4" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/finder/zipball/a1b31d88c0e998168ca7792f222cbecee47428c4", + "reference": "a1b31d88c0e998168ca7792f222cbecee47428c4", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "symfony/filesystem": "^6.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Finder\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Finds files and directories via an intuitive fluent interface", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/finder/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-26T12:56:25+00:00" + }, + { + "name": "symfony/http-foundation", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/http-foundation.git", + "reference": "b50f5e281d722cb0f4c296f908bacc3e2b721957" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/http-foundation/zipball/b50f5e281d722cb0f4c296f908bacc3e2b721957", + "reference": "b50f5e281d722cb0f4c296f908bacc3e2b721957", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-mbstring": "~1.1", + "symfony/polyfill-php83": "^1.27" + }, + "conflict": { + "symfony/cache": "<6.2" + }, + "require-dev": { + "doctrine/dbal": "^2.13.1|^3.0", + "predis/predis": "^1.1|^2.0", + "symfony/cache": "^5.4|^6.0", + "symfony/dependency-injection": "^5.4|^6.0", + "symfony/expression-language": "^5.4|^6.0", + "symfony/http-kernel": "^5.4.12|^6.0.12|^6.1.4", + "symfony/mime": "^5.4|^6.0", + "symfony/rate-limiter": "^5.2|^6.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\HttpFoundation\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Defines an object-oriented layer for the HTTP specification", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/http-foundation/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-04T21:33:54+00:00" + }, + { + "name": "symfony/http-kernel", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/http-kernel.git", + "reference": "9f991a964368bee8d883e8d57ced4fe9fff04dfc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/http-kernel/zipball/9f991a964368bee8d883e8d57ced4fe9fff04dfc", + "reference": "9f991a964368bee8d883e8d57ced4fe9fff04dfc", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/log": "^1|^2|^3", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/error-handler": "^6.3", + "symfony/event-dispatcher": "^5.4|^6.0", + "symfony/http-foundation": "^6.3.4", + "symfony/polyfill-ctype": "^1.8" + }, + "conflict": { + "symfony/browser-kit": "<5.4", + "symfony/cache": "<5.4", + "symfony/config": "<6.1", + "symfony/console": "<5.4", + "symfony/dependency-injection": "<6.3.4", + "symfony/doctrine-bridge": "<5.4", + "symfony/form": "<5.4", + "symfony/http-client": "<5.4", + "symfony/http-client-contracts": "<2.5", + "symfony/mailer": "<5.4", + "symfony/messenger": "<5.4", + "symfony/translation": "<5.4", + "symfony/translation-contracts": "<2.5", + "symfony/twig-bridge": "<5.4", + "symfony/validator": "<5.4", + "symfony/var-dumper": "<6.3", + "twig/twig": "<2.13" + }, + "provide": { + "psr/log-implementation": "1.0|2.0|3.0" + }, + "require-dev": { + "psr/cache": "^1.0|^2.0|^3.0", + "symfony/browser-kit": "^5.4|^6.0", + "symfony/clock": "^6.2", + "symfony/config": "^6.1", + "symfony/console": "^5.4|^6.0", + "symfony/css-selector": "^5.4|^6.0", + "symfony/dependency-injection": "^6.3.4", + "symfony/dom-crawler": "^5.4|^6.0", + "symfony/expression-language": "^5.4|^6.0", + "symfony/finder": "^5.4|^6.0", + "symfony/http-client-contracts": "^2.5|^3", + "symfony/process": "^5.4|^6.0", + "symfony/property-access": "^5.4.5|^6.0.5", + "symfony/routing": "^5.4|^6.0", + "symfony/serializer": "^6.3", + "symfony/stopwatch": "^5.4|^6.0", + "symfony/translation": "^5.4|^6.0", + "symfony/translation-contracts": "^2.5|^3", + "symfony/uid": "^5.4|^6.0", + "symfony/validator": "^6.3", + "symfony/var-exporter": "^6.2", + "twig/twig": "^2.13|^3.0.4" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\HttpKernel\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides a structured process for converting a Request into a Response", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/http-kernel/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-30T06:37:04+00:00" + }, + { + "name": "symfony/mailer", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/mailer.git", + "reference": "d89611a7830d51b5e118bca38e390dea92f9ea06" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/mailer/zipball/d89611a7830d51b5e118bca38e390dea92f9ea06", + "reference": "d89611a7830d51b5e118bca38e390dea92f9ea06", + "shasum": "" + }, + "require": { + "egulias/email-validator": "^2.1.10|^3|^4", + "php": ">=8.1", + "psr/event-dispatcher": "^1", + "psr/log": "^1|^2|^3", + "symfony/event-dispatcher": "^5.4|^6.0", + "symfony/mime": "^6.2", + "symfony/service-contracts": "^2.5|^3" + }, + "conflict": { + "symfony/http-client-contracts": "<2.5", + "symfony/http-kernel": "<5.4", + "symfony/messenger": "<6.2", + "symfony/mime": "<6.2", + "symfony/twig-bridge": "<6.2.1" + }, + "require-dev": { + "symfony/console": "^5.4|^6.0", + "symfony/http-client": "^5.4|^6.0", + "symfony/messenger": "^6.2", + "symfony/twig-bridge": "^6.2" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Mailer\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Helps sending emails", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/mailer/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-06T09:47:15+00:00" + }, + { + "name": "symfony/mime", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/mime.git", + "reference": "d5179eedf1cb2946dbd760475ebf05c251ef6a6e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/mime/zipball/d5179eedf1cb2946dbd760475ebf05c251ef6a6e", + "reference": "d5179eedf1cb2946dbd760475ebf05c251ef6a6e", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-intl-idn": "^1.10", + "symfony/polyfill-mbstring": "^1.0" + }, + "conflict": { + "egulias/email-validator": "~3.0.0", + "phpdocumentor/reflection-docblock": "<3.2.2", + "phpdocumentor/type-resolver": "<1.4.0", + "symfony/mailer": "<5.4", + "symfony/serializer": "<6.2.13|>=6.3,<6.3.2" + }, + "require-dev": { + "egulias/email-validator": "^2.1.10|^3.1|^4", + "league/html-to-markdown": "^5.0", + "phpdocumentor/reflection-docblock": "^3.0|^4.0|^5.0", + "symfony/dependency-injection": "^5.4|^6.0", + "symfony/property-access": "^5.4|^6.0", + "symfony/property-info": "^5.4|^6.0", + "symfony/serializer": "~6.2.13|^6.3.2" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Mime\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Allows manipulating MIME messages", + "homepage": "https://symfony.com", + "keywords": [ + "mime", + "mime-type" + ], + "support": { + "source": "https://github.com/symfony/mime/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-29T06:59:36+00:00" + }, + { + "name": "symfony/polyfill-ctype", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-ctype.git", + "reference": "ea208ce43cbb04af6867b4fdddb1bdbf84cc28cb" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/ea208ce43cbb04af6867b4fdddb1bdbf84cc28cb", + "reference": "ea208ce43cbb04af6867b4fdddb1bdbf84cc28cb", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "provide": { + "ext-ctype": "*" + }, + "suggest": { + "ext-ctype": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Ctype\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Gert de Pagter", + "email": "BackEndTea@gmail.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for ctype functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "ctype", + "polyfill", + "portable" + ], + "support": { + "source": "https://github.com/symfony/polyfill-ctype/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:26:14+00:00" + }, + { + "name": "symfony/polyfill-intl-grapheme", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-intl-grapheme.git", + "reference": "875e90aeea2777b6f135677f618529449334a612" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-intl-grapheme/zipball/875e90aeea2777b6f135677f618529449334a612", + "reference": "875e90aeea2777b6f135677f618529449334a612", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-intl": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Intl\\Grapheme\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for intl's grapheme_* functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "grapheme", + "intl", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-intl-grapheme/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:26:14+00:00" + }, + { + "name": "symfony/polyfill-intl-idn", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-intl-idn.git", + "reference": "ecaafce9f77234a6a449d29e49267ba10499116d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-intl-idn/zipball/ecaafce9f77234a6a449d29e49267ba10499116d", + "reference": "ecaafce9f77234a6a449d29e49267ba10499116d", + "shasum": "" + }, + "require": { + "php": ">=7.1", + "symfony/polyfill-intl-normalizer": "^1.10", + "symfony/polyfill-php72": "^1.10" + }, + "suggest": { + "ext-intl": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Intl\\Idn\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Laurent Bassin", + "email": "laurent@bassin.info" + }, + { + "name": "Trevor Rowbotham", + "email": "trevor.rowbotham@pm.me" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for intl's idn_to_ascii and idn_to_utf8 functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "idn", + "intl", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-intl-idn/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:30:37+00:00" + }, + { + "name": "symfony/polyfill-intl-normalizer", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-intl-normalizer.git", + "reference": "8c4ad05dd0120b6a53c1ca374dca2ad0a1c4ed92" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-intl-normalizer/zipball/8c4ad05dd0120b6a53c1ca374dca2ad0a1c4ed92", + "reference": "8c4ad05dd0120b6a53c1ca374dca2ad0a1c4ed92", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "suggest": { + "ext-intl": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Intl\\Normalizer\\": "" + }, + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for intl's Normalizer class and related functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "intl", + "normalizer", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-intl-normalizer/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:26:14+00:00" + }, + { + "name": "symfony/polyfill-mbstring", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-mbstring.git", + "reference": "42292d99c55abe617799667f454222c54c60e229" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/42292d99c55abe617799667f454222c54c60e229", + "reference": "42292d99c55abe617799667f454222c54c60e229", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "provide": { + "ext-mbstring": "*" + }, + "suggest": { + "ext-mbstring": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Mbstring\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for the Mbstring extension", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "mbstring", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-mbstring/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-07-28T09:04:16+00:00" + }, + { + "name": "symfony/polyfill-php72", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php72.git", + "reference": "70f4aebd92afca2f865444d30a4d2151c13c3179" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php72/zipball/70f4aebd92afca2f865444d30a4d2151c13c3179", + "reference": "70f4aebd92afca2f865444d30a4d2151c13c3179", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Php72\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 7.2+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php72/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:26:14+00:00" + }, + { + "name": "symfony/polyfill-php80", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php80.git", + "reference": "6caa57379c4aec19c0a12a38b59b26487dcfe4b5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/6caa57379c4aec19c0a12a38b59b26487dcfe4b5", + "reference": "6caa57379c4aec19c0a12a38b59b26487dcfe4b5", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Php80\\": "" + }, + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ion Bazan", + "email": "ion.bazan@gmail.com" + }, + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 8.0+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php80/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:26:14+00:00" + }, + { + "name": "symfony/polyfill-php83", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php83.git", + "reference": "b0f46ebbeeeda3e9d2faebdfbf4b4eae9b59fa11" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php83/zipball/b0f46ebbeeeda3e9d2faebdfbf4b4eae9b59fa11", + "reference": "b0f46ebbeeeda3e9d2faebdfbf4b4eae9b59fa11", + "shasum": "" + }, + "require": { + "php": ">=7.1", + "symfony/polyfill-php80": "^1.14" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Php83\\": "" + }, + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 8.3+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php83/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-08-16T06:22:46+00:00" + }, + { + "name": "symfony/polyfill-uuid", + "version": "v1.28.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-uuid.git", + "reference": "9c44518a5aff8da565c8a55dbe85d2769e6f630e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-uuid/zipball/9c44518a5aff8da565c8a55dbe85d2769e6f630e", + "reference": "9c44518a5aff8da565c8a55dbe85d2769e6f630e", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "provide": { + "ext-uuid": "*" + }, + "suggest": { + "ext-uuid": "For best performance" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.28-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Uuid\\": "" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Grégoire Pineau", + "email": "lyrixx@lyrixx.info" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill for uuid functions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "uuid" + ], + "support": { + "source": "https://github.com/symfony/polyfill-uuid/tree/v1.28.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-01-26T09:26:14+00:00" + }, + { + "name": "symfony/process", + "version": "v6.3.4", + "source": { + "type": "git", + "url": "https://github.com/symfony/process.git", + "reference": "0b5c29118f2e980d455d2e34a5659f4579847c54" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/process/zipball/0b5c29118f2e980d455d2e34a5659f4579847c54", + "reference": "0b5c29118f2e980d455d2e34a5659f4579847c54", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Process\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Executes commands in sub-processes", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/process/tree/v6.3.4" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-08-07T10:39:22+00:00" + }, + { + "name": "symfony/routing", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/routing.git", + "reference": "82616e59acd3e3d9c916bba798326cb7796d7d31" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/routing/zipball/82616e59acd3e3d9c916bba798326cb7796d7d31", + "reference": "82616e59acd3e3d9c916bba798326cb7796d7d31", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3" + }, + "conflict": { + "doctrine/annotations": "<1.12", + "symfony/config": "<6.2", + "symfony/dependency-injection": "<5.4", + "symfony/yaml": "<5.4" + }, + "require-dev": { + "doctrine/annotations": "^1.12|^2", + "psr/log": "^1|^2|^3", + "symfony/config": "^6.2", + "symfony/dependency-injection": "^5.4|^6.0", + "symfony/expression-language": "^5.4|^6.0", + "symfony/http-foundation": "^5.4|^6.0", + "symfony/yaml": "^5.4|^6.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Routing\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Maps an HTTP request to a set of configuration variables", + "homepage": "https://symfony.com", + "keywords": [ + "router", + "routing", + "uri", + "url" + ], + "support": { + "source": "https://github.com/symfony/routing/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-20T16:05:51+00:00" + }, + { + "name": "symfony/service-contracts", + "version": "v3.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/service-contracts.git", + "reference": "40da9cc13ec349d9e4966ce18b5fbcd724ab10a4" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/service-contracts/zipball/40da9cc13ec349d9e4966ce18b5fbcd724ab10a4", + "reference": "40da9cc13ec349d9e4966ce18b5fbcd724ab10a4", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/container": "^2.0" + }, + "conflict": { + "ext-psr": "<1.1|>=2" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.4-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\Service\\": "" + }, + "exclude-from-classmap": [ + "/Test/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to writing services", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/service-contracts/tree/v3.3.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-05-23T14:45:45+00:00" + }, + { + "name": "symfony/string", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/string.git", + "reference": "13d76d0fb049051ed12a04bef4f9de8715bea339" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/string/zipball/13d76d0fb049051ed12a04bef4f9de8715bea339", + "reference": "13d76d0fb049051ed12a04bef4f9de8715bea339", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/polyfill-ctype": "~1.8", + "symfony/polyfill-intl-grapheme": "~1.0", + "symfony/polyfill-intl-normalizer": "~1.0", + "symfony/polyfill-mbstring": "~1.0" + }, + "conflict": { + "symfony/translation-contracts": "<2.5" + }, + "require-dev": { + "symfony/error-handler": "^5.4|^6.0", + "symfony/http-client": "^5.4|^6.0", + "symfony/intl": "^6.2", + "symfony/translation-contracts": "^2.5|^3.0", + "symfony/var-exporter": "^5.4|^6.0" + }, + "type": "library", + "autoload": { + "files": [ + "Resources/functions.php" + ], + "psr-4": { + "Symfony\\Component\\String\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides an object-oriented API to strings and deals with bytes, UTF-8 code points and grapheme clusters in a unified way", + "homepage": "https://symfony.com", + "keywords": [ + "grapheme", + "i18n", + "string", + "unicode", + "utf-8", + "utf8" + ], + "support": { + "source": "https://github.com/symfony/string/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-18T10:38:32+00:00" + }, + { + "name": "symfony/translation", + "version": "v6.3.3", + "source": { + "type": "git", + "url": "https://github.com/symfony/translation.git", + "reference": "3ed078c54bc98bbe4414e1e9b2d5e85ed5a5c8bd" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/translation/zipball/3ed078c54bc98bbe4414e1e9b2d5e85ed5a5c8bd", + "reference": "3ed078c54bc98bbe4414e1e9b2d5e85ed5a5c8bd", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-mbstring": "~1.0", + "symfony/translation-contracts": "^2.5|^3.0" + }, + "conflict": { + "symfony/config": "<5.4", + "symfony/console": "<5.4", + "symfony/dependency-injection": "<5.4", + "symfony/http-client-contracts": "<2.5", + "symfony/http-kernel": "<5.4", + "symfony/service-contracts": "<2.5", + "symfony/twig-bundle": "<5.4", + "symfony/yaml": "<5.4" + }, + "provide": { + "symfony/translation-implementation": "2.3|3.0" + }, + "require-dev": { + "nikic/php-parser": "^4.13", + "psr/log": "^1|^2|^3", + "symfony/config": "^5.4|^6.0", + "symfony/console": "^5.4|^6.0", + "symfony/dependency-injection": "^5.4|^6.0", + "symfony/finder": "^5.4|^6.0", + "symfony/http-client-contracts": "^2.5|^3.0", + "symfony/http-kernel": "^5.4|^6.0", + "symfony/intl": "^5.4|^6.0", + "symfony/polyfill-intl-icu": "^1.21", + "symfony/routing": "^5.4|^6.0", + "symfony/service-contracts": "^2.5|^3", + "symfony/yaml": "^5.4|^6.0" + }, + "type": "library", + "autoload": { + "files": [ + "Resources/functions.php" + ], + "psr-4": { + "Symfony\\Component\\Translation\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides tools to internationalize your application", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/translation/tree/v6.3.3" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-07-31T07:08:24+00:00" + }, + { + "name": "symfony/translation-contracts", + "version": "v3.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/translation-contracts.git", + "reference": "02c24deb352fb0d79db5486c0c79905a85e37e86" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/translation-contracts/zipball/02c24deb352fb0d79db5486c0c79905a85e37e86", + "reference": "02c24deb352fb0d79db5486c0c79905a85e37e86", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.4-dev" + }, + "thanks": { + "name": "symfony/contracts", + "url": "https://github.com/symfony/contracts" + } + }, + "autoload": { + "psr-4": { + "Symfony\\Contracts\\Translation\\": "" + }, + "exclude-from-classmap": [ + "/Test/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Generic abstractions related to translation", + "homepage": "https://symfony.com", + "keywords": [ + "abstractions", + "contracts", + "decoupling", + "interfaces", + "interoperability", + "standards" + ], + "support": { + "source": "https://github.com/symfony/translation-contracts/tree/v3.3.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-05-30T17:17:10+00:00" + }, + { + "name": "symfony/uid", + "version": "v6.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/uid.git", + "reference": "01b0f20b1351d997711c56f1638f7a8c3061e384" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/uid/zipball/01b0f20b1351d997711c56f1638f7a8c3061e384", + "reference": "01b0f20b1351d997711c56f1638f7a8c3061e384", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/polyfill-uuid": "^1.15" + }, + "require-dev": { + "symfony/console": "^5.4|^6.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Uid\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Grégoire Pineau", + "email": "lyrixx@lyrixx.info" + }, + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides an object-oriented API to generate and represent UIDs", + "homepage": "https://symfony.com", + "keywords": [ + "UID", + "ulid", + "uuid" + ], + "support": { + "source": "https://github.com/symfony/uid/tree/v6.3.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-04-08T07:25:02+00:00" + }, + { + "name": "symfony/var-dumper", + "version": "v6.3.5", + "source": { + "type": "git", + "url": "https://github.com/symfony/var-dumper.git", + "reference": "3d9999376be5fea8de47752837a3e1d1c5f69ef5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/var-dumper/zipball/3d9999376be5fea8de47752837a3e1d1c5f69ef5", + "reference": "3d9999376be5fea8de47752837a3e1d1c5f69ef5", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-mbstring": "~1.0" + }, + "conflict": { + "symfony/console": "<5.4" + }, + "require-dev": { + "ext-iconv": "*", + "symfony/console": "^5.4|^6.0", + "symfony/http-kernel": "^5.4|^6.0", + "symfony/process": "^5.4|^6.0", + "symfony/uid": "^5.4|^6.0", + "twig/twig": "^2.13|^3.0.4" + }, + "bin": [ + "Resources/bin/var-dump-server" + ], + "type": "library", + "autoload": { + "files": [ + "Resources/functions/dump.php" + ], + "psr-4": { + "Symfony\\Component\\VarDumper\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides mechanisms for walking through any arbitrary PHP variable", + "homepage": "https://symfony.com", + "keywords": [ + "debug", + "dump" + ], + "support": { + "source": "https://github.com/symfony/var-dumper/tree/v6.3.5" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-09-12T10:11:35+00:00" + }, + { + "name": "tijsverkoyen/css-to-inline-styles", + "version": "2.2.6", + "source": { + "type": "git", + "url": "https://github.com/tijsverkoyen/CssToInlineStyles.git", + "reference": "c42125b83a4fa63b187fdf29f9c93cb7733da30c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/tijsverkoyen/CssToInlineStyles/zipball/c42125b83a4fa63b187fdf29f9c93cb7733da30c", + "reference": "c42125b83a4fa63b187fdf29f9c93cb7733da30c", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-libxml": "*", + "php": "^5.5 || ^7.0 || ^8.0", + "symfony/css-selector": "^2.7 || ^3.0 || ^4.0 || ^5.0 || ^6.0" + }, + "require-dev": { + "phpunit/phpunit": "^4.8.35 || ^5.7 || ^6.0 || ^7.5 || ^8.5.21 || ^9.5.10" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.2.x-dev" + } + }, + "autoload": { + "psr-4": { + "TijsVerkoyen\\CssToInlineStyles\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Tijs Verkoyen", + "email": "css_to_inline_styles@verkoyen.eu", + "role": "Developer" + } + ], + "description": "CssToInlineStyles is a class that enables you to convert HTML-pages/files into HTML-pages/files with inline styles. This is very useful when you're sending emails.", + "homepage": "https://github.com/tijsverkoyen/CssToInlineStyles", + "support": { + "issues": "https://github.com/tijsverkoyen/CssToInlineStyles/issues", + "source": "https://github.com/tijsverkoyen/CssToInlineStyles/tree/2.2.6" + }, + "time": "2023-01-03T09:29:04+00:00" + }, + { + "name": "vlucas/phpdotenv", + "version": "v5.5.0", + "source": { + "type": "git", + "url": "https://github.com/vlucas/phpdotenv.git", + "reference": "1a7ea2afc49c3ee6d87061f5a233e3a035d0eae7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/1a7ea2afc49c3ee6d87061f5a233e3a035d0eae7", + "reference": "1a7ea2afc49c3ee6d87061f5a233e3a035d0eae7", + "shasum": "" + }, + "require": { + "ext-pcre": "*", + "graham-campbell/result-type": "^1.0.2", + "php": "^7.1.3 || ^8.0", + "phpoption/phpoption": "^1.8", + "symfony/polyfill-ctype": "^1.23", + "symfony/polyfill-mbstring": "^1.23.1", + "symfony/polyfill-php80": "^1.23.1" + }, + "require-dev": { + "bamarni/composer-bin-plugin": "^1.4.1", + "ext-filter": "*", + "phpunit/phpunit": "^7.5.20 || ^8.5.30 || ^9.5.25" + }, + "suggest": { + "ext-filter": "Required to use the boolean validator." + }, + "type": "library", + "extra": { + "bamarni-bin": { + "bin-links": true, + "forward-command": true + }, + "branch-alias": { + "dev-master": "5.5-dev" + } + }, + "autoload": { + "psr-4": { + "Dotenv\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Graham Campbell", + "email": "hello@gjcampbell.co.uk", + "homepage": "https://github.com/GrahamCampbell" + }, + { + "name": "Vance Lucas", + "email": "vance@vancelucas.com", + "homepage": "https://github.com/vlucas" + } + ], + "description": "Loads environment variables from `.env` to `getenv()`, `$_ENV` and `$_SERVER` automagically.", + "keywords": [ + "dotenv", + "env", + "environment" + ], + "support": { + "issues": "https://github.com/vlucas/phpdotenv/issues", + "source": "https://github.com/vlucas/phpdotenv/tree/v5.5.0" + }, + "funding": [ + { + "url": "https://github.com/GrahamCampbell", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/vlucas/phpdotenv", + "type": "tidelift" + } + ], + "time": "2022-10-16T01:01:54+00:00" + }, + { + "name": "voku/portable-ascii", + "version": "2.0.1", + "source": { + "type": "git", + "url": "https://github.com/voku/portable-ascii.git", + "reference": "b56450eed252f6801410d810c8e1727224ae0743" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/voku/portable-ascii/zipball/b56450eed252f6801410d810c8e1727224ae0743", + "reference": "b56450eed252f6801410d810c8e1727224ae0743", + "shasum": "" + }, + "require": { + "php": ">=7.0.0" + }, + "require-dev": { + "phpunit/phpunit": "~6.0 || ~7.0 || ~9.0" + }, + "suggest": { + "ext-intl": "Use Intl for transliterator_transliterate() support" + }, + "type": "library", + "autoload": { + "psr-4": { + "voku\\": "src/voku/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Lars Moelleken", + "homepage": "http://www.moelleken.org/" + } + ], + "description": "Portable ASCII library - performance optimized (ascii) string functions for php.", + "homepage": "https://github.com/voku/portable-ascii", + "keywords": [ + "ascii", + "clean", + "php" + ], + "support": { + "issues": "https://github.com/voku/portable-ascii/issues", + "source": "https://github.com/voku/portable-ascii/tree/2.0.1" + }, + "funding": [ + { + "url": "https://www.paypal.me/moelleken", + "type": "custom" + }, + { + "url": "https://github.com/voku", + "type": "github" + }, + { + "url": "https://opencollective.com/portable-ascii", + "type": "open_collective" + }, + { + "url": "https://www.patreon.com/voku", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/voku/portable-ascii", + "type": "tidelift" + } + ], + "time": "2022-03-08T17:03:00+00:00" + }, + { + "name": "webmozart/assert", + "version": "1.11.0", + "source": { + "type": "git", + "url": "https://github.com/webmozarts/assert.git", + "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/webmozarts/assert/zipball/11cb2199493b2f8a3b53e7f19068fc6aac760991", + "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991", + "shasum": "" + }, + "require": { + "ext-ctype": "*", + "php": "^7.2 || ^8.0" + }, + "conflict": { + "phpstan/phpstan": "<0.12.20", + "vimeo/psalm": "<4.6.1 || 4.6.2" + }, + "require-dev": { + "phpunit/phpunit": "^8.5.13" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.10-dev" + } + }, + "autoload": { + "psr-4": { + "Webmozart\\Assert\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Bernhard Schussek", + "email": "bschussek@gmail.com" + } + ], + "description": "Assertions to validate method input/output with nice error messages.", + "keywords": [ + "assert", + "check", + "validate" + ], + "support": { + "issues": "https://github.com/webmozarts/assert/issues", + "source": "https://github.com/webmozarts/assert/tree/1.11.0" + }, + "time": "2022-06-03T18:03:27+00:00" + } + ], + "packages-dev": [ + { + "name": "filp/whoops", + "version": "2.15.3", + "source": { + "type": "git", + "url": "https://github.com/filp/whoops.git", + "reference": "c83e88a30524f9360b11f585f71e6b17313b7187" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/filp/whoops/zipball/c83e88a30524f9360b11f585f71e6b17313b7187", + "reference": "c83e88a30524f9360b11f585f71e6b17313b7187", + "shasum": "" + }, + "require": { + "php": "^5.5.9 || ^7.0 || ^8.0", + "psr/log": "^1.0.1 || ^2.0 || ^3.0" + }, + "require-dev": { + "mockery/mockery": "^0.9 || ^1.0", + "phpunit/phpunit": "^4.8.36 || ^5.7.27 || ^6.5.14 || ^7.5.20 || ^8.5.8 || ^9.3.3", + "symfony/var-dumper": "^2.6 || ^3.0 || ^4.0 || ^5.0" + }, + "suggest": { + "symfony/var-dumper": "Pretty print complex values better with var-dumper available", + "whoops/soap": "Formats errors as SOAP responses" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.7-dev" + } + }, + "autoload": { + "psr-4": { + "Whoops\\": "src/Whoops/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Filipe Dobreira", + "homepage": "https://github.com/filp", + "role": "Developer" + } + ], + "description": "php error handling for cool kids", + "homepage": "https://filp.github.io/whoops/", + "keywords": [ + "error", + "exception", + "handling", + "library", + "throwable", + "whoops" + ], + "support": { + "issues": "https://github.com/filp/whoops/issues", + "source": "https://github.com/filp/whoops/tree/2.15.3" + }, + "funding": [ + { + "url": "https://github.com/denis-sokolov", + "type": "github" + } + ], + "time": "2023-07-13T12:00:00+00:00" + }, + { + "name": "hamcrest/hamcrest-php", + "version": "v2.0.1", + "source": { + "type": "git", + "url": "https://github.com/hamcrest/hamcrest-php.git", + "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/hamcrest/hamcrest-php/zipball/8c3d0a3f6af734494ad8f6fbbee0ba92422859f3", + "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3", + "shasum": "" + }, + "require": { + "php": "^5.3|^7.0|^8.0" + }, + "replace": { + "cordoval/hamcrest-php": "*", + "davedevelopment/hamcrest-php": "*", + "kodova/hamcrest-php": "*" + }, + "require-dev": { + "phpunit/php-file-iterator": "^1.4 || ^2.0", + "phpunit/phpunit": "^4.8.36 || ^5.7 || ^6.5 || ^7.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.1-dev" + } + }, + "autoload": { + "classmap": [ + "hamcrest" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "description": "This is the PHP port of Hamcrest Matchers", + "keywords": [ + "test" + ], + "support": { + "issues": "https://github.com/hamcrest/hamcrest-php/issues", + "source": "https://github.com/hamcrest/hamcrest-php/tree/v2.0.1" + }, + "time": "2020-07-09T08:09:16+00:00" + }, + { + "name": "laravel/pint", + "version": "v1.13.2", + "source": { + "type": "git", + "url": "https://github.com/laravel/pint.git", + "reference": "bbb13460d7f8c5c0cd9a58109beedd79cd7331ff" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/pint/zipball/bbb13460d7f8c5c0cd9a58109beedd79cd7331ff", + "reference": "bbb13460d7f8c5c0cd9a58109beedd79cd7331ff", + "shasum": "" + }, + "require": { + "ext-json": "*", + "ext-mbstring": "*", + "ext-tokenizer": "*", + "ext-xml": "*", + "php": "^8.1.0" + }, + "require-dev": { + "friendsofphp/php-cs-fixer": "^3.26.1", + "illuminate/view": "^10.23.1", + "laravel-zero/framework": "^10.1.2", + "mockery/mockery": "^1.6.6", + "nunomaduro/larastan": "^2.6.4", + "nunomaduro/termwind": "^1.15.1", + "pestphp/pest": "^2.18.2" + }, + "bin": [ + "builds/pint" + ], + "type": "project", + "autoload": { + "psr-4": { + "App\\": "app/", + "Database\\Seeders\\": "database/seeders/", + "Database\\Factories\\": "database/factories/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nuno Maduro", + "email": "enunomaduro@gmail.com" + } + ], + "description": "An opinionated code formatter for PHP.", + "homepage": "https://laravel.com", + "keywords": [ + "format", + "formatter", + "lint", + "linter", + "php" + ], + "support": { + "issues": "https://github.com/laravel/pint/issues", + "source": "https://github.com/laravel/pint" + }, + "time": "2023-09-19T15:55:02+00:00" + }, + { + "name": "laravel/sail", + "version": "v1.25.0", + "source": { + "type": "git", + "url": "https://github.com/laravel/sail.git", + "reference": "e81a7bd7ac1a745ccb25572830fecf74a89bb48a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/sail/zipball/e81a7bd7ac1a745ccb25572830fecf74a89bb48a", + "reference": "e81a7bd7ac1a745ccb25572830fecf74a89bb48a", + "shasum": "" + }, + "require": { + "illuminate/console": "^8.0|^9.0|^10.0", + "illuminate/contracts": "^8.0|^9.0|^10.0", + "illuminate/support": "^8.0|^9.0|^10.0", + "php": "^8.0", + "symfony/yaml": "^6.0" + }, + "require-dev": { + "orchestra/testbench": "^6.0|^7.0|^8.0", + "phpstan/phpstan": "^1.10" + }, + "bin": [ + "bin/sail" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.x-dev" + }, + "laravel": { + "providers": [ + "Laravel\\Sail\\SailServiceProvider" + ] + } + }, + "autoload": { + "psr-4": { + "Laravel\\Sail\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + } + ], + "description": "Docker files for running a basic Laravel application.", + "keywords": [ + "docker", + "laravel" + ], + "support": { + "issues": "https://github.com/laravel/sail/issues", + "source": "https://github.com/laravel/sail" + }, + "time": "2023-09-11T17:37:09+00:00" + }, + { + "name": "mockery/mockery", + "version": "1.6.6", + "source": { + "type": "git", + "url": "https://github.com/mockery/mockery.git", + "reference": "b8e0bb7d8c604046539c1115994632c74dcb361e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/mockery/mockery/zipball/b8e0bb7d8c604046539c1115994632c74dcb361e", + "reference": "b8e0bb7d8c604046539c1115994632c74dcb361e", + "shasum": "" + }, + "require": { + "hamcrest/hamcrest-php": "^2.0.1", + "lib-pcre": ">=7.0", + "php": ">=7.3" + }, + "conflict": { + "phpunit/phpunit": "<8.0" + }, + "require-dev": { + "phpunit/phpunit": "^8.5 || ^9.6.10", + "psalm/plugin-phpunit": "^0.18.4", + "symplify/easy-coding-standard": "^11.5.0", + "vimeo/psalm": "^4.30" + }, + "type": "library", + "autoload": { + "files": [ + "library/helpers.php", + "library/Mockery.php" + ], + "psr-4": { + "Mockery\\": "library/Mockery" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Pádraic Brady", + "email": "padraic.brady@gmail.com", + "homepage": "https://github.com/padraic", + "role": "Author" + }, + { + "name": "Dave Marshall", + "email": "dave.marshall@atstsolutions.co.uk", + "homepage": "https://davedevelopment.co.uk", + "role": "Developer" + }, + { + "name": "Nathanael Esayeas", + "email": "nathanael.esayeas@protonmail.com", + "homepage": "https://github.com/ghostwriter", + "role": "Lead Developer" + } + ], + "description": "Mockery is a simple yet flexible PHP mock object framework", + "homepage": "https://github.com/mockery/mockery", + "keywords": [ + "BDD", + "TDD", + "library", + "mock", + "mock objects", + "mockery", + "stub", + "test", + "test double", + "testing" + ], + "support": { + "docs": "https://docs.mockery.io/", + "issues": "https://github.com/mockery/mockery/issues", + "rss": "https://github.com/mockery/mockery/releases.atom", + "security": "https://github.com/mockery/mockery/security/advisories", + "source": "https://github.com/mockery/mockery" + }, + "time": "2023-08-09T00:03:52+00:00" + }, + { + "name": "myclabs/deep-copy", + "version": "1.11.1", + "source": { + "type": "git", + "url": "https://github.com/myclabs/DeepCopy.git", + "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/7284c22080590fb39f2ffa3e9057f10a4ddd0e0c", + "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "conflict": { + "doctrine/collections": "<1.6.8", + "doctrine/common": "<2.13.3 || >=3,<3.2.2" + }, + "require-dev": { + "doctrine/collections": "^1.6.8", + "doctrine/common": "^2.13.3 || ^3.2.2", + "phpunit/phpunit": "^7.5.20 || ^8.5.23 || ^9.5.13" + }, + "type": "library", + "autoload": { + "files": [ + "src/DeepCopy/deep_copy.php" + ], + "psr-4": { + "DeepCopy\\": "src/DeepCopy/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Create deep copies (clones) of your objects", + "keywords": [ + "clone", + "copy", + "duplicate", + "object", + "object graph" + ], + "support": { + "issues": "https://github.com/myclabs/DeepCopy/issues", + "source": "https://github.com/myclabs/DeepCopy/tree/1.11.1" + }, + "funding": [ + { + "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy", + "type": "tidelift" + } + ], + "time": "2023-03-08T13:26:56+00:00" + }, + { + "name": "nunomaduro/collision", + "version": "v7.9.0", + "source": { + "type": "git", + "url": "https://github.com/nunomaduro/collision.git", + "reference": "296d0cf9fe462837ac0da8a568b56fc026b132da" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nunomaduro/collision/zipball/296d0cf9fe462837ac0da8a568b56fc026b132da", + "reference": "296d0cf9fe462837ac0da8a568b56fc026b132da", + "shasum": "" + }, + "require": { + "filp/whoops": "^2.15.3", + "nunomaduro/termwind": "^1.15.1", + "php": "^8.1.0", + "symfony/console": "^6.3.4" + }, + "require-dev": { + "brianium/paratest": "^7.2.7", + "laravel/framework": "^10.23.1", + "laravel/pint": "^1.13.1", + "laravel/sail": "^1.25.0", + "laravel/sanctum": "^3.3.1", + "laravel/tinker": "^2.8.2", + "nunomaduro/larastan": "^2.6.4", + "orchestra/testbench-core": "^8.11.0", + "pestphp/pest": "^2.19.1", + "phpunit/phpunit": "^10.3.5", + "sebastian/environment": "^6.0.1", + "spatie/laravel-ignition": "^2.3.0" + }, + "type": "library", + "extra": { + "laravel": { + "providers": [ + "NunoMaduro\\Collision\\Adapters\\Laravel\\CollisionServiceProvider" + ] + } + }, + "autoload": { + "files": [ + "./src/Adapters/Phpunit/Autoload.php" + ], + "psr-4": { + "NunoMaduro\\Collision\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Nuno Maduro", + "email": "enunomaduro@gmail.com" + } + ], + "description": "Cli error handling for console/command-line PHP applications.", + "keywords": [ + "artisan", + "cli", + "command-line", + "console", + "error", + "handling", + "laravel", + "laravel-zero", + "php", + "symfony" + ], + "support": { + "issues": "https://github.com/nunomaduro/collision/issues", + "source": "https://github.com/nunomaduro/collision" + }, + "funding": [ + { + "url": "https://www.paypal.com/paypalme/enunomaduro", + "type": "custom" + }, + { + "url": "https://github.com/nunomaduro", + "type": "github" + }, + { + "url": "https://www.patreon.com/nunomaduro", + "type": "patreon" + } + ], + "time": "2023-09-19T10:45:09+00:00" + }, + { + "name": "phar-io/manifest", + "version": "2.0.3", + "source": { + "type": "git", + "url": "https://github.com/phar-io/manifest.git", + "reference": "97803eca37d319dfa7826cc2437fc020857acb53" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phar-io/manifest/zipball/97803eca37d319dfa7826cc2437fc020857acb53", + "reference": "97803eca37d319dfa7826cc2437fc020857acb53", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-phar": "*", + "ext-xmlwriter": "*", + "phar-io/version": "^3.0.1", + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0.x-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + }, + { + "name": "Sebastian Heuer", + "email": "sebastian@phpeople.de", + "role": "Developer" + }, + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "Developer" + } + ], + "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)", + "support": { + "issues": "https://github.com/phar-io/manifest/issues", + "source": "https://github.com/phar-io/manifest/tree/2.0.3" + }, + "time": "2021-07-20T11:28:43+00:00" + }, + { + "name": "phar-io/version", + "version": "3.2.1", + "source": { + "type": "git", + "url": "https://github.com/phar-io/version.git", + "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phar-io/version/zipball/4f7fd7836c6f332bb2933569e566a0d6c4cbed74", + "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + }, + { + "name": "Sebastian Heuer", + "email": "sebastian@phpeople.de", + "role": "Developer" + }, + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "Developer" + } + ], + "description": "Library for handling version information and constraints", + "support": { + "issues": "https://github.com/phar-io/version/issues", + "source": "https://github.com/phar-io/version/tree/3.2.1" + }, + "time": "2022-02-21T01:04:05+00:00" + }, + { + "name": "phpunit/php-code-coverage", + "version": "10.1.6", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-code-coverage.git", + "reference": "56f33548fe522c8d82da7ff3824b42829d324364" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/56f33548fe522c8d82da7ff3824b42829d324364", + "reference": "56f33548fe522c8d82da7ff3824b42829d324364", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-libxml": "*", + "ext-xmlwriter": "*", + "nikic/php-parser": "^4.15", + "php": ">=8.1", + "phpunit/php-file-iterator": "^4.0", + "phpunit/php-text-template": "^3.0", + "sebastian/code-unit-reverse-lookup": "^3.0", + "sebastian/complexity": "^3.0", + "sebastian/environment": "^6.0", + "sebastian/lines-of-code": "^2.0", + "sebastian/version": "^4.0", + "theseer/tokenizer": "^1.2.0" + }, + "require-dev": { + "phpunit/phpunit": "^10.1" + }, + "suggest": { + "ext-pcov": "PHP extension that provides line coverage", + "ext-xdebug": "PHP extension that provides line coverage as well as branch and path coverage" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "10.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.", + "homepage": "https://github.com/sebastianbergmann/php-code-coverage", + "keywords": [ + "coverage", + "testing", + "xunit" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues", + "security": "https://github.com/sebastianbergmann/php-code-coverage/security/policy", + "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/10.1.6" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-09-19T04:59:03+00:00" + }, + { + "name": "phpunit/php-file-iterator", + "version": "4.1.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-file-iterator.git", + "reference": "a95037b6d9e608ba092da1b23931e537cadc3c3c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/a95037b6d9e608ba092da1b23931e537cadc3c3c", + "reference": "a95037b6d9e608ba092da1b23931e537cadc3c3c", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "FilterIterator implementation that filters files based on a list of suffixes.", + "homepage": "https://github.com/sebastianbergmann/php-file-iterator/", + "keywords": [ + "filesystem", + "iterator" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues", + "security": "https://github.com/sebastianbergmann/php-file-iterator/security/policy", + "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/4.1.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-08-31T06:24:48+00:00" + }, + { + "name": "phpunit/php-invoker", + "version": "4.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-invoker.git", + "reference": "f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7", + "reference": "f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "ext-pcntl": "*", + "phpunit/phpunit": "^10.0" + }, + "suggest": { + "ext-pcntl": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Invoke callables with a timeout", + "homepage": "https://github.com/sebastianbergmann/php-invoker/", + "keywords": [ + "process" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-invoker/issues", + "source": "https://github.com/sebastianbergmann/php-invoker/tree/4.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T06:56:09+00:00" + }, + { + "name": "phpunit/php-text-template", + "version": "3.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-text-template.git", + "reference": "0c7b06ff49e3d5072f057eb1fa59258bf287a748" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/0c7b06ff49e3d5072f057eb1fa59258bf287a748", + "reference": "0c7b06ff49e3d5072f057eb1fa59258bf287a748", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Simple template engine.", + "homepage": "https://github.com/sebastianbergmann/php-text-template/", + "keywords": [ + "template" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-text-template/issues", + "security": "https://github.com/sebastianbergmann/php-text-template/security/policy", + "source": "https://github.com/sebastianbergmann/php-text-template/tree/3.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-08-31T14:07:24+00:00" + }, + { + "name": "phpunit/php-timer", + "version": "6.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-timer.git", + "reference": "e2a2d67966e740530f4a3343fe2e030ffdc1161d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/e2a2d67966e740530f4a3343fe2e030ffdc1161d", + "reference": "e2a2d67966e740530f4a3343fe2e030ffdc1161d", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "6.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Utility class for timing", + "homepage": "https://github.com/sebastianbergmann/php-timer/", + "keywords": [ + "timer" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-timer/issues", + "source": "https://github.com/sebastianbergmann/php-timer/tree/6.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T06:57:52+00:00" + }, + { + "name": "phpunit/phpunit", + "version": "10.3.5", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/phpunit.git", + "reference": "747c3b2038f1139e3dcd9886a3f5a948648b7503" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/747c3b2038f1139e3dcd9886a3f5a948648b7503", + "reference": "747c3b2038f1139e3dcd9886a3f5a948648b7503", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-json": "*", + "ext-libxml": "*", + "ext-mbstring": "*", + "ext-xml": "*", + "ext-xmlwriter": "*", + "myclabs/deep-copy": "^1.10.1", + "phar-io/manifest": "^2.0.3", + "phar-io/version": "^3.0.2", + "php": ">=8.1", + "phpunit/php-code-coverage": "^10.1.5", + "phpunit/php-file-iterator": "^4.0", + "phpunit/php-invoker": "^4.0", + "phpunit/php-text-template": "^3.0", + "phpunit/php-timer": "^6.0", + "sebastian/cli-parser": "^2.0", + "sebastian/code-unit": "^2.0", + "sebastian/comparator": "^5.0", + "sebastian/diff": "^5.0", + "sebastian/environment": "^6.0", + "sebastian/exporter": "^5.1", + "sebastian/global-state": "^6.0.1", + "sebastian/object-enumerator": "^5.0", + "sebastian/recursion-context": "^5.0", + "sebastian/type": "^4.0", + "sebastian/version": "^4.0" + }, + "suggest": { + "ext-soap": "To be able to generate mocks based on WSDL files" + }, + "bin": [ + "phpunit" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "10.3-dev" + } + }, + "autoload": { + "files": [ + "src/Framework/Assert/Functions.php" + ], + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "The PHP Unit Testing framework.", + "homepage": "https://phpunit.de/", + "keywords": [ + "phpunit", + "testing", + "xunit" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/phpunit/issues", + "security": "https://github.com/sebastianbergmann/phpunit/security/policy", + "source": "https://github.com/sebastianbergmann/phpunit/tree/10.3.5" + }, + "funding": [ + { + "url": "https://phpunit.de/sponsors.html", + "type": "custom" + }, + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/phpunit/phpunit", + "type": "tidelift" + } + ], + "time": "2023-09-19T05:42:37+00:00" + }, + { + "name": "sebastian/cli-parser", + "version": "2.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/cli-parser.git", + "reference": "efdc130dbbbb8ef0b545a994fd811725c5282cae" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/efdc130dbbbb8ef0b545a994fd811725c5282cae", + "reference": "efdc130dbbbb8ef0b545a994fd811725c5282cae", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for parsing CLI options", + "homepage": "https://github.com/sebastianbergmann/cli-parser", + "support": { + "issues": "https://github.com/sebastianbergmann/cli-parser/issues", + "source": "https://github.com/sebastianbergmann/cli-parser/tree/2.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T06:58:15+00:00" + }, + { + "name": "sebastian/code-unit", + "version": "2.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/code-unit.git", + "reference": "a81fee9eef0b7a76af11d121767abc44c104e503" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/a81fee9eef0b7a76af11d121767abc44c104e503", + "reference": "a81fee9eef0b7a76af11d121767abc44c104e503", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Collection of value objects that represent the PHP code units", + "homepage": "https://github.com/sebastianbergmann/code-unit", + "support": { + "issues": "https://github.com/sebastianbergmann/code-unit/issues", + "source": "https://github.com/sebastianbergmann/code-unit/tree/2.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T06:58:43+00:00" + }, + { + "name": "sebastian/code-unit-reverse-lookup", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git", + "reference": "5e3a687f7d8ae33fb362c5c0743794bbb2420a1d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/5e3a687f7d8ae33fb362c5c0743794bbb2420a1d", + "reference": "5e3a687f7d8ae33fb362c5c0743794bbb2420a1d", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Looks up which function or method a line of code belongs to", + "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/", + "support": { + "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues", + "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/3.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T06:59:15+00:00" + }, + { + "name": "sebastian/comparator", + "version": "5.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/comparator.git", + "reference": "2db5010a484d53ebf536087a70b4a5423c102372" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/2db5010a484d53ebf536087a70b4a5423c102372", + "reference": "2db5010a484d53ebf536087a70b4a5423c102372", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-mbstring": "*", + "php": ">=8.1", + "sebastian/diff": "^5.0", + "sebastian/exporter": "^5.0" + }, + "require-dev": { + "phpunit/phpunit": "^10.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Volker Dusch", + "email": "github@wallbash.com" + }, + { + "name": "Bernhard Schussek", + "email": "bschussek@2bepublished.at" + } + ], + "description": "Provides the functionality to compare PHP values for equality", + "homepage": "https://github.com/sebastianbergmann/comparator", + "keywords": [ + "comparator", + "compare", + "equality" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/comparator/issues", + "security": "https://github.com/sebastianbergmann/comparator/security/policy", + "source": "https://github.com/sebastianbergmann/comparator/tree/5.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-08-14T13:18:12+00:00" + }, + { + "name": "sebastian/complexity", + "version": "3.1.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/complexity.git", + "reference": "68cfb347a44871f01e33ab0ef8215966432f6957" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/68cfb347a44871f01e33ab0ef8215966432f6957", + "reference": "68cfb347a44871f01e33ab0ef8215966432f6957", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^4.10", + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for calculating the complexity of PHP code units", + "homepage": "https://github.com/sebastianbergmann/complexity", + "support": { + "issues": "https://github.com/sebastianbergmann/complexity/issues", + "security": "https://github.com/sebastianbergmann/complexity/security/policy", + "source": "https://github.com/sebastianbergmann/complexity/tree/3.1.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-09-28T11:50:59+00:00" + }, + { + "name": "sebastian/diff", + "version": "5.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/diff.git", + "reference": "912dc2fbe3e3c1e7873313cc801b100b6c68c87b" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/912dc2fbe3e3c1e7873313cc801b100b6c68c87b", + "reference": "912dc2fbe3e3c1e7873313cc801b100b6c68c87b", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0", + "symfony/process": "^4.2 || ^5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Kore Nordmann", + "email": "mail@kore-nordmann.de" + } + ], + "description": "Diff implementation", + "homepage": "https://github.com/sebastianbergmann/diff", + "keywords": [ + "diff", + "udiff", + "unidiff", + "unified diff" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/diff/issues", + "security": "https://github.com/sebastianbergmann/diff/security/policy", + "source": "https://github.com/sebastianbergmann/diff/tree/5.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-05-01T07:48:21+00:00" + }, + { + "name": "sebastian/environment", + "version": "6.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/environment.git", + "reference": "43c751b41d74f96cbbd4e07b7aec9675651e2951" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/43c751b41d74f96cbbd4e07b7aec9675651e2951", + "reference": "43c751b41d74f96cbbd4e07b7aec9675651e2951", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "suggest": { + "ext-posix": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "6.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Provides functionality to handle HHVM/PHP environments", + "homepage": "https://github.com/sebastianbergmann/environment", + "keywords": [ + "Xdebug", + "environment", + "hhvm" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/environment/issues", + "security": "https://github.com/sebastianbergmann/environment/security/policy", + "source": "https://github.com/sebastianbergmann/environment/tree/6.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-04-11T05:39:26+00:00" + }, + { + "name": "sebastian/exporter", + "version": "5.1.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/exporter.git", + "reference": "64f51654862e0f5e318db7e9dcc2292c63cdbddc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/64f51654862e0f5e318db7e9dcc2292c63cdbddc", + "reference": "64f51654862e0f5e318db7e9dcc2292c63cdbddc", + "shasum": "" + }, + "require": { + "ext-mbstring": "*", + "php": ">=8.1", + "sebastian/recursion-context": "^5.0" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "5.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Volker Dusch", + "email": "github@wallbash.com" + }, + { + "name": "Adam Harvey", + "email": "aharvey@php.net" + }, + { + "name": "Bernhard Schussek", + "email": "bschussek@gmail.com" + } + ], + "description": "Provides the functionality to export PHP variables for visualization", + "homepage": "https://www.github.com/sebastianbergmann/exporter", + "keywords": [ + "export", + "exporter" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/exporter/issues", + "security": "https://github.com/sebastianbergmann/exporter/security/policy", + "source": "https://github.com/sebastianbergmann/exporter/tree/5.1.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-09-24T13:22:09+00:00" + }, + { + "name": "sebastian/global-state", + "version": "6.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/global-state.git", + "reference": "7ea9ead78f6d380d2a667864c132c2f7b83055e4" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/7ea9ead78f6d380d2a667864c132c2f7b83055e4", + "reference": "7ea9ead78f6d380d2a667864c132c2f7b83055e4", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "sebastian/object-reflector": "^3.0", + "sebastian/recursion-context": "^5.0" + }, + "require-dev": { + "ext-dom": "*", + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "6.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Snapshotting of global state", + "homepage": "http://www.github.com/sebastianbergmann/global-state", + "keywords": [ + "global state" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/global-state/issues", + "security": "https://github.com/sebastianbergmann/global-state/security/policy", + "source": "https://github.com/sebastianbergmann/global-state/tree/6.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-07-19T07:19:23+00:00" + }, + { + "name": "sebastian/lines-of-code", + "version": "2.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/lines-of-code.git", + "reference": "649e40d279e243d985aa8fb6e74dd5bb28dc185d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/649e40d279e243d985aa8fb6e74dd5bb28dc185d", + "reference": "649e40d279e243d985aa8fb6e74dd5bb28dc185d", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^4.10", + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for counting the lines of code in PHP source code", + "homepage": "https://github.com/sebastianbergmann/lines-of-code", + "support": { + "issues": "https://github.com/sebastianbergmann/lines-of-code/issues", + "security": "https://github.com/sebastianbergmann/lines-of-code/security/policy", + "source": "https://github.com/sebastianbergmann/lines-of-code/tree/2.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-08-31T09:25:50+00:00" + }, + { + "name": "sebastian/object-enumerator", + "version": "5.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/object-enumerator.git", + "reference": "202d0e344a580d7f7d04b3fafce6933e59dae906" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/202d0e344a580d7f7d04b3fafce6933e59dae906", + "reference": "202d0e344a580d7f7d04b3fafce6933e59dae906", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "sebastian/object-reflector": "^3.0", + "sebastian/recursion-context": "^5.0" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Traverses array structures and object graphs to enumerate all referenced objects", + "homepage": "https://github.com/sebastianbergmann/object-enumerator/", + "support": { + "issues": "https://github.com/sebastianbergmann/object-enumerator/issues", + "source": "https://github.com/sebastianbergmann/object-enumerator/tree/5.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T07:08:32+00:00" + }, + { + "name": "sebastian/object-reflector", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/object-reflector.git", + "reference": "24ed13d98130f0e7122df55d06c5c4942a577957" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/24ed13d98130f0e7122df55d06c5c4942a577957", + "reference": "24ed13d98130f0e7122df55d06c5c4942a577957", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Allows reflection of object attributes, including inherited and non-public ones", + "homepage": "https://github.com/sebastianbergmann/object-reflector/", + "support": { + "issues": "https://github.com/sebastianbergmann/object-reflector/issues", + "source": "https://github.com/sebastianbergmann/object-reflector/tree/3.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T07:06:18+00:00" + }, + { + "name": "sebastian/recursion-context", + "version": "5.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/recursion-context.git", + "reference": "05909fb5bc7df4c52992396d0116aed689f93712" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/05909fb5bc7df4c52992396d0116aed689f93712", + "reference": "05909fb5bc7df4c52992396d0116aed689f93712", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Adam Harvey", + "email": "aharvey@php.net" + } + ], + "description": "Provides functionality to recursively process PHP variables", + "homepage": "https://github.com/sebastianbergmann/recursion-context", + "support": { + "issues": "https://github.com/sebastianbergmann/recursion-context/issues", + "source": "https://github.com/sebastianbergmann/recursion-context/tree/5.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T07:05:40+00:00" + }, + { + "name": "sebastian/type", + "version": "4.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/type.git", + "reference": "462699a16464c3944eefc02ebdd77882bd3925bf" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/462699a16464c3944eefc02ebdd77882bd3925bf", + "reference": "462699a16464c3944eefc02ebdd77882bd3925bf", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "require-dev": { + "phpunit/phpunit": "^10.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Collection of value objects that represent the types of the PHP type system", + "homepage": "https://github.com/sebastianbergmann/type", + "support": { + "issues": "https://github.com/sebastianbergmann/type/issues", + "source": "https://github.com/sebastianbergmann/type/tree/4.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-03T07:10:45+00:00" + }, + { + "name": "sebastian/version", + "version": "4.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/version.git", + "reference": "c51fa83a5d8f43f1402e3f32a005e6262244ef17" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c51fa83a5d8f43f1402e3f32a005e6262244ef17", + "reference": "c51fa83a5d8f43f1402e3f32a005e6262244ef17", + "shasum": "" + }, + "require": { + "php": ">=8.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library that helps with managing the version number of Git-hosted PHP projects", + "homepage": "https://github.com/sebastianbergmann/version", + "support": { + "issues": "https://github.com/sebastianbergmann/version/issues", + "source": "https://github.com/sebastianbergmann/version/tree/4.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2023-02-07T11:34:05+00:00" + }, + { + "name": "spatie/backtrace", + "version": "1.5.3", + "source": { + "type": "git", + "url": "https://github.com/spatie/backtrace.git", + "reference": "483f76a82964a0431aa836b6ed0edde0c248e3ab" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/spatie/backtrace/zipball/483f76a82964a0431aa836b6ed0edde0c248e3ab", + "reference": "483f76a82964a0431aa836b6ed0edde0c248e3ab", + "shasum": "" + }, + "require": { + "php": "^7.3|^8.0" + }, + "require-dev": { + "ext-json": "*", + "phpunit/phpunit": "^9.3", + "spatie/phpunit-snapshot-assertions": "^4.2", + "symfony/var-dumper": "^5.1" + }, + "type": "library", + "autoload": { + "psr-4": { + "Spatie\\Backtrace\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Freek Van de Herten", + "email": "freek@spatie.be", + "homepage": "https://spatie.be", + "role": "Developer" + } + ], + "description": "A better backtrace", + "homepage": "https://github.com/spatie/backtrace", + "keywords": [ + "Backtrace", + "spatie" + ], + "support": { + "source": "https://github.com/spatie/backtrace/tree/1.5.3" + }, + "funding": [ + { + "url": "https://github.com/sponsors/spatie", + "type": "github" + }, + { + "url": "https://spatie.be/open-source/support-us", + "type": "other" + } + ], + "time": "2023-06-28T12:59:17+00:00" + }, + { + "name": "spatie/flare-client-php", + "version": "1.4.2", + "source": { + "type": "git", + "url": "https://github.com/spatie/flare-client-php.git", + "reference": "5f2c6a7a0d2c1d90c12559dc7828fd942911a544" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/spatie/flare-client-php/zipball/5f2c6a7a0d2c1d90c12559dc7828fd942911a544", + "reference": "5f2c6a7a0d2c1d90c12559dc7828fd942911a544", + "shasum": "" + }, + "require": { + "illuminate/pipeline": "^8.0|^9.0|^10.0", + "nesbot/carbon": "^2.62.1", + "php": "^8.0", + "spatie/backtrace": "^1.5.2", + "symfony/http-foundation": "^5.0|^6.0", + "symfony/mime": "^5.2|^6.0", + "symfony/process": "^5.2|^6.0", + "symfony/var-dumper": "^5.2|^6.0" + }, + "require-dev": { + "dms/phpunit-arraysubset-asserts": "^0.3.0", + "pestphp/pest": "^1.20", + "phpstan/extension-installer": "^1.1", + "phpstan/phpstan-deprecation-rules": "^1.0", + "phpstan/phpstan-phpunit": "^1.0", + "spatie/phpunit-snapshot-assertions": "^4.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.3.x-dev" + } + }, + "autoload": { + "files": [ + "src/helpers.php" + ], + "psr-4": { + "Spatie\\FlareClient\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Send PHP errors to Flare", + "homepage": "https://github.com/spatie/flare-client-php", + "keywords": [ + "exception", + "flare", + "reporting", + "spatie" + ], + "support": { + "issues": "https://github.com/spatie/flare-client-php/issues", + "source": "https://github.com/spatie/flare-client-php/tree/1.4.2" + }, + "funding": [ + { + "url": "https://github.com/spatie", + "type": "github" + } + ], + "time": "2023-07-28T08:07:24+00:00" + }, + { + "name": "spatie/ignition", + "version": "1.11.2", + "source": { + "type": "git", + "url": "https://github.com/spatie/ignition.git", + "reference": "48b23411ca4bfbc75c75dfc638b6b36159c375aa" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/spatie/ignition/zipball/48b23411ca4bfbc75c75dfc638b6b36159c375aa", + "reference": "48b23411ca4bfbc75c75dfc638b6b36159c375aa", + "shasum": "" + }, + "require": { + "ext-json": "*", + "ext-mbstring": "*", + "php": "^8.0", + "spatie/backtrace": "^1.5.3", + "spatie/flare-client-php": "^1.4.0", + "symfony/console": "^5.4|^6.0", + "symfony/var-dumper": "^5.4|^6.0" + }, + "require-dev": { + "illuminate/cache": "^9.52", + "mockery/mockery": "^1.4", + "pestphp/pest": "^1.20", + "phpstan/extension-installer": "^1.1", + "phpstan/phpstan-deprecation-rules": "^1.0", + "phpstan/phpstan-phpunit": "^1.0", + "psr/simple-cache-implementation": "*", + "symfony/cache": "^6.0", + "symfony/process": "^5.4|^6.0", + "vlucas/phpdotenv": "^5.5" + }, + "suggest": { + "openai-php/client": "Require get solutions from OpenAI", + "simple-cache-implementation": "To cache solutions from OpenAI" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.5.x-dev" + } + }, + "autoload": { + "psr-4": { + "Spatie\\Ignition\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Spatie", + "email": "info@spatie.be", + "role": "Developer" + } + ], + "description": "A beautiful error page for PHP applications.", + "homepage": "https://flareapp.io/ignition", + "keywords": [ + "error", + "flare", + "laravel", + "page" + ], + "support": { + "docs": "https://flareapp.io/docs/ignition-for-laravel/introduction", + "forum": "https://twitter.com/flareappio", + "issues": "https://github.com/spatie/ignition/issues", + "source": "https://github.com/spatie/ignition" + }, + "funding": [ + { + "url": "https://github.com/spatie", + "type": "github" + } + ], + "time": "2023-09-19T15:29:52+00:00" + }, + { + "name": "spatie/laravel-ignition", + "version": "2.3.0", + "source": { + "type": "git", + "url": "https://github.com/spatie/laravel-ignition.git", + "reference": "4ed813d16edb5a1ab0d7f4b1d116c37ee8cdf3c0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/spatie/laravel-ignition/zipball/4ed813d16edb5a1ab0d7f4b1d116c37ee8cdf3c0", + "reference": "4ed813d16edb5a1ab0d7f4b1d116c37ee8cdf3c0", + "shasum": "" + }, + "require": { + "ext-curl": "*", + "ext-json": "*", + "ext-mbstring": "*", + "illuminate/support": "^10.0", + "php": "^8.1", + "spatie/flare-client-php": "^1.3.5", + "spatie/ignition": "^1.9", + "symfony/console": "^6.2.3", + "symfony/var-dumper": "^6.2.3" + }, + "require-dev": { + "livewire/livewire": "^2.11", + "mockery/mockery": "^1.5.1", + "openai-php/client": "^0.3.4", + "orchestra/testbench": "^8.0", + "pestphp/pest": "^1.22.3", + "phpstan/extension-installer": "^1.2", + "phpstan/phpstan-deprecation-rules": "^1.1.1", + "phpstan/phpstan-phpunit": "^1.3.3", + "vlucas/phpdotenv": "^5.5" + }, + "suggest": { + "openai-php/client": "Require get solutions from OpenAI", + "psr/simple-cache-implementation": "Needed to cache solutions from OpenAI" + }, + "type": "library", + "extra": { + "laravel": { + "providers": [ + "Spatie\\LaravelIgnition\\IgnitionServiceProvider" + ], + "aliases": { + "Flare": "Spatie\\LaravelIgnition\\Facades\\Flare" + } + } + }, + "autoload": { + "files": [ + "src/helpers.php" + ], + "psr-4": { + "Spatie\\LaravelIgnition\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Spatie", + "email": "info@spatie.be", + "role": "Developer" + } + ], + "description": "A beautiful error page for Laravel applications.", + "homepage": "https://flareapp.io/ignition", + "keywords": [ + "error", + "flare", + "laravel", + "page" + ], + "support": { + "docs": "https://flareapp.io/docs/ignition-for-laravel/introduction", + "forum": "https://twitter.com/flareappio", + "issues": "https://github.com/spatie/laravel-ignition/issues", + "source": "https://github.com/spatie/laravel-ignition" + }, + "funding": [ + { + "url": "https://github.com/spatie", + "type": "github" + } + ], + "time": "2023-08-23T06:24:34+00:00" + }, + { + "name": "symfony/yaml", + "version": "v6.3.3", + "source": { + "type": "git", + "url": "https://github.com/symfony/yaml.git", + "reference": "e23292e8c07c85b971b44c1c4b87af52133e2add" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/yaml/zipball/e23292e8c07c85b971b44c1c4b87af52133e2add", + "reference": "e23292e8c07c85b971b44c1c4b87af52133e2add", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-ctype": "^1.8" + }, + "conflict": { + "symfony/console": "<5.4" + }, + "require-dev": { + "symfony/console": "^5.4|^6.0" + }, + "bin": [ + "Resources/bin/yaml-lint" + ], + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Yaml\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Loads and dumps YAML files", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/yaml/tree/v6.3.3" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2023-07-31T07:08:24+00:00" + }, + { + "name": "theseer/tokenizer", + "version": "1.2.1", + "source": { + "type": "git", + "url": "https://github.com/theseer/tokenizer.git", + "reference": "34a41e998c2183e22995f158c581e7b5e755ab9e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/theseer/tokenizer/zipball/34a41e998c2183e22995f158c581e7b5e755ab9e", + "reference": "34a41e998c2183e22995f158c581e7b5e755ab9e", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-tokenizer": "*", + "ext-xmlwriter": "*", + "php": "^7.2 || ^8.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + } + ], + "description": "A small library for converting tokenized PHP source code into XML and potentially other formats", + "support": { + "issues": "https://github.com/theseer/tokenizer/issues", + "source": "https://github.com/theseer/tokenizer/tree/1.2.1" + }, + "funding": [ + { + "url": "https://github.com/theseer", + "type": "github" + } + ], + "time": "2021-07-28T10:34:58+00:00" + } + ], + "aliases": [], + "minimum-stability": "stable", + "stability-flags": [], + "prefer-stable": true, + "prefer-lowest": false, + "platform": { + "php": "^8.1" + }, + "platform-dev": [], + "plugin-api-version": "2.3.0" +} diff --git a/config/app.php b/config/app.php new file mode 100644 index 00000000..4c231b47 --- /dev/null +++ b/config/app.php @@ -0,0 +1,188 @@ + env('APP_NAME', 'Laravel'), + + /* + |-------------------------------------------------------------------------- + | Application Environment + |-------------------------------------------------------------------------- + | + | This value determines the "environment" your application is currently + | running in. This may determine how you prefer to configure various + | services the application utilizes. Set this in your ".env" file. + | + */ + + 'env' => env('APP_ENV', 'production'), + + /* + |-------------------------------------------------------------------------- + | Application Debug Mode + |-------------------------------------------------------------------------- + | + | When your application is in debug mode, detailed error messages with + | stack traces will be shown on every error that occurs within your + | application. If disabled, a simple generic error page is shown. + | + */ + + 'debug' => (bool) env('APP_DEBUG', false), + + /* + |-------------------------------------------------------------------------- + | Application URL + |-------------------------------------------------------------------------- + | + | This URL is used by the console to properly generate URLs when using + | the Artisan command line tool. You should set this to the root of + | your application so that it is used when running Artisan tasks. + | + */ + + 'url' => env('APP_URL', 'http://localhost'), + + 'asset_url' => env('ASSET_URL'), + + /* + |-------------------------------------------------------------------------- + | Application Timezone + |-------------------------------------------------------------------------- + | + | Here you may specify the default timezone for your application, which + | will be used by the PHP date and date-time functions. We have gone + | ahead and set this to a sensible default for you out of the box. + | + */ + + 'timezone' => 'UTC', + + /* + |-------------------------------------------------------------------------- + | Application Locale Configuration + |-------------------------------------------------------------------------- + | + | The application locale determines the default locale that will be used + | by the translation service provider. You are free to set this value + | to any of the locales which will be supported by the application. + | + */ + + 'locale' => 'en', + + /* + |-------------------------------------------------------------------------- + | Application Fallback Locale + |-------------------------------------------------------------------------- + | + | The fallback locale determines the locale to use when the current one + | is not available. You may change the value to correspond to any of + | the language folders that are provided through your application. + | + */ + + 'fallback_locale' => 'en', + + /* + |-------------------------------------------------------------------------- + | Faker Locale + |-------------------------------------------------------------------------- + | + | This locale will be used by the Faker PHP library when generating fake + | data for your database seeds. For example, this will be used to get + | localized telephone numbers, street address information and more. + | + */ + + 'faker_locale' => 'en_US', + + /* + |-------------------------------------------------------------------------- + | Encryption Key + |-------------------------------------------------------------------------- + | + | This key is used by the Illuminate encrypter service and should be set + | to a random, 32 character string, otherwise these encrypted strings + | will not be safe. Please do this before deploying an application! + | + */ + + 'key' => env('APP_KEY'), + + 'cipher' => 'AES-256-CBC', + + /* + |-------------------------------------------------------------------------- + | Maintenance Mode Driver + |-------------------------------------------------------------------------- + | + | These configuration options determine the driver used to determine and + | manage Laravel's "maintenance mode" status. The "cache" driver will + | allow maintenance mode to be controlled across multiple machines. + | + | Supported drivers: "file", "cache" + | + */ + + 'maintenance' => [ + 'driver' => 'file', + // 'store' => 'redis', + ], + + /* + |-------------------------------------------------------------------------- + | Autoloaded Service Providers + |-------------------------------------------------------------------------- + | + | The service providers listed here will be automatically loaded on the + | request to your application. Feel free to add your own services to + | this array to grant expanded functionality to your applications. + | + */ + + 'providers' => ServiceProvider::defaultProviders()->merge([ + /* + * Package Service Providers... + */ + + /* + * Application Service Providers... + */ + App\Providers\AppServiceProvider::class, + App\Providers\AuthServiceProvider::class, + // App\Providers\BroadcastServiceProvider::class, + App\Providers\EventServiceProvider::class, + App\Providers\RouteServiceProvider::class, + ])->toArray(), + + /* + |-------------------------------------------------------------------------- + | Class Aliases + |-------------------------------------------------------------------------- + | + | This array of class aliases will be registered when this application + | is started. However, feel free to register as many as you wish as + | the aliases are "lazy" loaded so they don't hinder performance. + | + */ + + 'aliases' => Facade::defaultAliases()->merge([ + // 'Example' => App\Facades\Example::class, + ])->toArray(), + +]; diff --git a/config/auth.php b/config/auth.php new file mode 100644 index 00000000..9548c15d --- /dev/null +++ b/config/auth.php @@ -0,0 +1,115 @@ + [ + 'guard' => 'web', + 'passwords' => 'users', + ], + + /* + |-------------------------------------------------------------------------- + | Authentication Guards + |-------------------------------------------------------------------------- + | + | Next, you may define every authentication guard for your application. + | Of course, a great default configuration has been defined for you + | here which uses session storage and the Eloquent user provider. + | + | All authentication drivers have a user provider. This defines how the + | users are actually retrieved out of your database or other storage + | mechanisms used by this application to persist your user's data. + | + | Supported: "session" + | + */ + + 'guards' => [ + 'web' => [ + 'driver' => 'session', + 'provider' => 'users', + ], + ], + + /* + |-------------------------------------------------------------------------- + | User Providers + |-------------------------------------------------------------------------- + | + | All authentication drivers have a user provider. This defines how the + | users are actually retrieved out of your database or other storage + | mechanisms used by this application to persist your user's data. + | + | If you have multiple user tables or models you may configure multiple + | sources which represent each model / table. These sources may then + | be assigned to any extra authentication guards you have defined. + | + | Supported: "database", "eloquent" + | + */ + + 'providers' => [ + 'users' => [ + 'driver' => 'eloquent', + 'model' => App\Models\User::class, + ], + + // 'users' => [ + // 'driver' => 'database', + // 'table' => 'users', + // ], + ], + + /* + |-------------------------------------------------------------------------- + | Resetting Passwords + |-------------------------------------------------------------------------- + | + | You may specify multiple password reset configurations if you have more + | than one user table or model in the application and you want to have + | separate password reset settings based on the specific user types. + | + | The expiry time is the number of minutes that each reset token will be + | considered valid. This security feature keeps tokens short-lived so + | they have less time to be guessed. You may change this as needed. + | + | The throttle setting is the number of seconds a user must wait before + | generating more password reset tokens. This prevents the user from + | quickly generating a very large amount of password reset tokens. + | + */ + + 'passwords' => [ + 'users' => [ + 'provider' => 'users', + 'table' => 'password_reset_tokens', + 'expire' => 60, + 'throttle' => 60, + ], + ], + + /* + |-------------------------------------------------------------------------- + | Password Confirmation Timeout + |-------------------------------------------------------------------------- + | + | Here you may define the amount of seconds before a password confirmation + | times out and the user is prompted to re-enter their password via the + | confirmation screen. By default, the timeout lasts for three hours. + | + */ + + 'password_timeout' => 10800, + +]; diff --git a/config/broadcasting.php b/config/broadcasting.php new file mode 100644 index 00000000..24104853 --- /dev/null +++ b/config/broadcasting.php @@ -0,0 +1,71 @@ + env('BROADCAST_DRIVER', 'null'), + + /* + |-------------------------------------------------------------------------- + | Broadcast Connections + |-------------------------------------------------------------------------- + | + | Here you may define all of the broadcast connections that will be used + | to broadcast events to other systems or over websockets. Samples of + | each available type of connection are provided inside this array. + | + */ + + 'connections' => [ + + 'pusher' => [ + 'driver' => 'pusher', + 'key' => env('PUSHER_APP_KEY'), + 'secret' => env('PUSHER_APP_SECRET'), + 'app_id' => env('PUSHER_APP_ID'), + 'options' => [ + 'cluster' => env('PUSHER_APP_CLUSTER'), + 'host' => env('PUSHER_HOST') ?: 'api-'.env('PUSHER_APP_CLUSTER', 'mt1').'.pusher.com', + 'port' => env('PUSHER_PORT', 443), + 'scheme' => env('PUSHER_SCHEME', 'https'), + 'encrypted' => true, + 'useTLS' => env('PUSHER_SCHEME', 'https') === 'https', + ], + 'client_options' => [ + // Guzzle client options: https://docs.guzzlephp.org/en/stable/request-options.html + ], + ], + + 'ably' => [ + 'driver' => 'ably', + 'key' => env('ABLY_KEY'), + ], + + 'redis' => [ + 'driver' => 'redis', + 'connection' => 'default', + ], + + 'log' => [ + 'driver' => 'log', + ], + + 'null' => [ + 'driver' => 'null', + ], + + ], + +]; diff --git a/config/cache.php b/config/cache.php new file mode 100644 index 00000000..d4171e22 --- /dev/null +++ b/config/cache.php @@ -0,0 +1,111 @@ + env('CACHE_DRIVER', 'file'), + + /* + |-------------------------------------------------------------------------- + | Cache Stores + |-------------------------------------------------------------------------- + | + | Here you may define all of the cache "stores" for your application as + | well as their drivers. You may even define multiple stores for the + | same cache driver to group types of items stored in your caches. + | + | Supported drivers: "apc", "array", "database", "file", + | "memcached", "redis", "dynamodb", "octane", "null" + | + */ + + 'stores' => [ + + 'apc' => [ + 'driver' => 'apc', + ], + + 'array' => [ + 'driver' => 'array', + 'serialize' => false, + ], + + 'database' => [ + 'driver' => 'database', + 'table' => 'cache', + 'connection' => null, + 'lock_connection' => null, + ], + + 'file' => [ + 'driver' => 'file', + 'path' => storage_path('framework/cache/data'), + 'lock_path' => storage_path('framework/cache/data'), + ], + + 'memcached' => [ + 'driver' => 'memcached', + 'persistent_id' => env('MEMCACHED_PERSISTENT_ID'), + 'sasl' => [ + env('MEMCACHED_USERNAME'), + env('MEMCACHED_PASSWORD'), + ], + 'options' => [ + // Memcached::OPT_CONNECT_TIMEOUT => 2000, + ], + 'servers' => [ + [ + 'host' => env('MEMCACHED_HOST', '127.0.0.1'), + 'port' => env('MEMCACHED_PORT', 11211), + 'weight' => 100, + ], + ], + ], + + 'redis' => [ + 'driver' => 'redis', + 'connection' => 'cache', + 'lock_connection' => 'default', + ], + + 'dynamodb' => [ + 'driver' => 'dynamodb', + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'), + 'table' => env('DYNAMODB_CACHE_TABLE', 'cache'), + 'endpoint' => env('DYNAMODB_ENDPOINT'), + ], + + 'octane' => [ + 'driver' => 'octane', + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Cache Key Prefix + |-------------------------------------------------------------------------- + | + | When utilizing the APC, database, memcached, Redis, or DynamoDB cache + | stores there might be other applications using the same cache. For + | that reason, you may prefix every cache key to avoid collisions. + | + */ + + 'prefix' => env('CACHE_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_cache_'), + +]; diff --git a/config/cors.php b/config/cors.php new file mode 100644 index 00000000..8a39e6da --- /dev/null +++ b/config/cors.php @@ -0,0 +1,34 @@ + ['api/*', 'sanctum/csrf-cookie'], + + 'allowed_methods' => ['*'], + + 'allowed_origins' => ['*'], + + 'allowed_origins_patterns' => [], + + 'allowed_headers' => ['*'], + + 'exposed_headers' => [], + + 'max_age' => 0, + + 'supports_credentials' => false, + +]; diff --git a/config/database.php b/config/database.php new file mode 100644 index 00000000..137ad18c --- /dev/null +++ b/config/database.php @@ -0,0 +1,151 @@ + env('DB_CONNECTION', 'mysql'), + + /* + |-------------------------------------------------------------------------- + | Database Connections + |-------------------------------------------------------------------------- + | + | Here are each of the database connections setup for your application. + | Of course, examples of configuring each database platform that is + | supported by Laravel is shown below to make development simple. + | + | + | All database work in Laravel is done through the PHP PDO facilities + | so make sure you have the driver for your particular database of + | choice installed on your machine before you begin development. + | + */ + + 'connections' => [ + + 'sqlite' => [ + 'driver' => 'sqlite', + 'url' => env('DATABASE_URL'), + 'database' => env('DB_DATABASE', database_path('database.sqlite')), + 'prefix' => '', + 'foreign_key_constraints' => env('DB_FOREIGN_KEYS', true), + ], + + 'mysql' => [ + 'driver' => 'mysql', + 'url' => env('DATABASE_URL'), + 'host' => env('DB_HOST', '127.0.0.1'), + 'port' => env('DB_PORT', '3306'), + 'database' => env('DB_DATABASE', 'forge'), + 'username' => env('DB_USERNAME', 'forge'), + 'password' => env('DB_PASSWORD', ''), + 'unix_socket' => env('DB_SOCKET', ''), + 'charset' => 'utf8mb4', + 'collation' => 'utf8mb4_unicode_ci', + 'prefix' => '', + 'prefix_indexes' => true, + 'strict' => true, + 'engine' => null, + 'options' => extension_loaded('pdo_mysql') ? array_filter([ + PDO::MYSQL_ATTR_SSL_CA => env('MYSQL_ATTR_SSL_CA'), + ]) : [], + ], + + 'pgsql' => [ + 'driver' => 'pgsql', + 'url' => env('DATABASE_URL'), + 'host' => env('DB_HOST', '127.0.0.1'), + 'port' => env('DB_PORT', '5432'), + 'database' => env('DB_DATABASE', 'forge'), + 'username' => env('DB_USERNAME', 'forge'), + 'password' => env('DB_PASSWORD', ''), + 'charset' => 'utf8', + 'prefix' => '', + 'prefix_indexes' => true, + 'search_path' => 'public', + 'sslmode' => 'prefer', + ], + + 'sqlsrv' => [ + 'driver' => 'sqlsrv', + 'url' => env('DATABASE_URL'), + 'host' => env('DB_HOST', 'localhost'), + 'port' => env('DB_PORT', '1433'), + 'database' => env('DB_DATABASE', 'forge'), + 'username' => env('DB_USERNAME', 'forge'), + 'password' => env('DB_PASSWORD', ''), + 'charset' => 'utf8', + 'prefix' => '', + 'prefix_indexes' => true, + // 'encrypt' => env('DB_ENCRYPT', 'yes'), + // 'trust_server_certificate' => env('DB_TRUST_SERVER_CERTIFICATE', 'false'), + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Migration Repository Table + |-------------------------------------------------------------------------- + | + | This table keeps track of all the migrations that have already run for + | your application. Using this information, we can determine which of + | the migrations on disk haven't actually been run in the database. + | + */ + + 'migrations' => 'migrations', + + /* + |-------------------------------------------------------------------------- + | Redis Databases + |-------------------------------------------------------------------------- + | + | Redis is an open source, fast, and advanced key-value store that also + | provides a richer body of commands than a typical key-value system + | such as APC or Memcached. Laravel makes it easy to dig right in. + | + */ + + 'redis' => [ + + 'client' => env('REDIS_CLIENT', 'phpredis'), + + 'options' => [ + 'cluster' => env('REDIS_CLUSTER', 'redis'), + 'prefix' => env('REDIS_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_database_'), + ], + + 'default' => [ + 'url' => env('REDIS_URL'), + 'host' => env('REDIS_HOST', '127.0.0.1'), + 'username' => env('REDIS_USERNAME'), + 'password' => env('REDIS_PASSWORD'), + 'port' => env('REDIS_PORT', '6379'), + 'database' => env('REDIS_DB', '0'), + ], + + 'cache' => [ + 'url' => env('REDIS_URL'), + 'host' => env('REDIS_HOST', '127.0.0.1'), + 'username' => env('REDIS_USERNAME'), + 'password' => env('REDIS_PASSWORD'), + 'port' => env('REDIS_PORT', '6379'), + 'database' => env('REDIS_CACHE_DB', '1'), + ], + + ], + +]; diff --git a/config/filesystems.php b/config/filesystems.php new file mode 100644 index 00000000..299850ea --- /dev/null +++ b/config/filesystems.php @@ -0,0 +1,92 @@ + env('FILESYSTEM_DISK', 'article_images'), + + /* + |-------------------------------------------------------------------------- + | Filesystem Disks + |-------------------------------------------------------------------------- + | + | Here you may configure as many filesystem "disks" as you wish, and you + | may even configure multiple disks of the same driver. Defaults have + | been set up for each driver as an example of the required values. + | + | Supported Drivers: "local", "ftp", "sftp", "s3" + | + */ + + 'disks' => [ + + 'local' => [ + 'driver' => 'local', + 'root' => storage_path('app'), + 'throw' => false, + ], + /* + 'public' => [ + 'driver' => 'local', + 'root' => storage_path('app/public'), + 'url' => env('APP_URL').'/storage', + 'visibility' => 'public', + 'throw' => false, + ], + */ + 'article_images' => [ + 'driver' => 'local', + 'root' => storage_path('../public/article_images'), + 'url' => env('APP_URL').'/article_images', + 'visibility' => 'public', + 'throw' => false, + ], + + 'legacy_images' => [ + 'driver' => 'local', + 'root' => storage_path('../public/legacy_images'), + 'url' => env('APP_URL').'/legacy_images', + 'visibility' => 'public', + 'throw' => false, + ], + + 's3' => [ + 'driver' => 's3', + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'region' => env('AWS_DEFAULT_REGION'), + 'bucket' => env('AWS_BUCKET'), + 'url' => env('AWS_URL'), + 'endpoint' => env('AWS_ENDPOINT'), + 'use_path_style_endpoint' => env('AWS_USE_PATH_STYLE_ENDPOINT', false), + 'throw' => false, + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Symbolic Links + |-------------------------------------------------------------------------- + | + | Here you may configure the symbolic links that will be created when the + | `storage:link` Artisan command is executed. The array keys should be + | the locations of the links and the values should be their targets. + | + */ + + 'links' => [ + public_path('storage') => storage_path('app/public'), + ], + +]; diff --git a/config/hashing.php b/config/hashing.php new file mode 100644 index 00000000..bcd3be4c --- /dev/null +++ b/config/hashing.php @@ -0,0 +1,52 @@ + 'bcrypt', + + /* + |-------------------------------------------------------------------------- + | Bcrypt Options + |-------------------------------------------------------------------------- + | + | Here you may specify the configuration options that should be used when + | passwords are hashed using the Bcrypt algorithm. This will allow you + | to control the amount of time it takes to hash the given password. + | + */ + + 'bcrypt' => [ + 'rounds' => env('BCRYPT_ROUNDS', 10), + ], + + /* + |-------------------------------------------------------------------------- + | Argon Options + |-------------------------------------------------------------------------- + | + | Here you may specify the configuration options that should be used when + | passwords are hashed using the Argon algorithm. These will allow you + | to control the amount of time it takes to hash the given password. + | + */ + + 'argon' => [ + 'memory' => 65536, + 'threads' => 1, + 'time' => 4, + ], + +]; diff --git a/config/logging.php b/config/logging.php new file mode 100644 index 00000000..c44d2763 --- /dev/null +++ b/config/logging.php @@ -0,0 +1,131 @@ + env('LOG_CHANNEL', 'stack'), + + /* + |-------------------------------------------------------------------------- + | Deprecations Log Channel + |-------------------------------------------------------------------------- + | + | This option controls the log channel that should be used to log warnings + | regarding deprecated PHP and library features. This allows you to get + | your application ready for upcoming major versions of dependencies. + | + */ + + 'deprecations' => [ + 'channel' => env('LOG_DEPRECATIONS_CHANNEL', 'null'), + 'trace' => false, + ], + + /* + |-------------------------------------------------------------------------- + | Log Channels + |-------------------------------------------------------------------------- + | + | Here you may configure the log channels for your application. Out of + | the box, Laravel uses the Monolog PHP logging library. This gives + | you a variety of powerful log handlers / formatters to utilize. + | + | Available Drivers: "single", "daily", "slack", "syslog", + | "errorlog", "monolog", + | "custom", "stack" + | + */ + + 'channels' => [ + 'stack' => [ + 'driver' => 'stack', + 'channels' => ['single'], + 'ignore_exceptions' => false, + ], + + 'single' => [ + 'driver' => 'single', + 'path' => storage_path('logs/laravel.log'), + 'level' => env('LOG_LEVEL', 'debug'), + 'replace_placeholders' => true, + ], + + 'daily' => [ + 'driver' => 'daily', + 'path' => storage_path('logs/laravel.log'), + 'level' => env('LOG_LEVEL', 'debug'), + 'days' => 14, + 'replace_placeholders' => true, + ], + + 'slack' => [ + 'driver' => 'slack', + 'url' => env('LOG_SLACK_WEBHOOK_URL'), + 'username' => 'Laravel Log', + 'emoji' => ':boom:', + 'level' => env('LOG_LEVEL', 'critical'), + 'replace_placeholders' => true, + ], + + 'papertrail' => [ + 'driver' => 'monolog', + 'level' => env('LOG_LEVEL', 'debug'), + 'handler' => env('LOG_PAPERTRAIL_HANDLER', SyslogUdpHandler::class), + 'handler_with' => [ + 'host' => env('PAPERTRAIL_URL'), + 'port' => env('PAPERTRAIL_PORT'), + 'connectionString' => 'tls://'.env('PAPERTRAIL_URL').':'.env('PAPERTRAIL_PORT'), + ], + 'processors' => [PsrLogMessageProcessor::class], + ], + + 'stderr' => [ + 'driver' => 'monolog', + 'level' => env('LOG_LEVEL', 'debug'), + 'handler' => StreamHandler::class, + 'formatter' => env('LOG_STDERR_FORMATTER'), + 'with' => [ + 'stream' => 'php://stderr', + ], + 'processors' => [PsrLogMessageProcessor::class], + ], + + 'syslog' => [ + 'driver' => 'syslog', + 'level' => env('LOG_LEVEL', 'debug'), + 'facility' => LOG_USER, + 'replace_placeholders' => true, + ], + + 'errorlog' => [ + 'driver' => 'errorlog', + 'level' => env('LOG_LEVEL', 'debug'), + 'replace_placeholders' => true, + ], + + 'null' => [ + 'driver' => 'monolog', + 'handler' => NullHandler::class, + ], + + 'emergency' => [ + 'path' => storage_path('logs/laravel.log'), + ], + ], + +]; diff --git a/config/mail.php b/config/mail.php new file mode 100644 index 00000000..e652bd02 --- /dev/null +++ b/config/mail.php @@ -0,0 +1,125 @@ + env('MAIL_MAILER', 'smtp'), + + /* + |-------------------------------------------------------------------------- + | Mailer Configurations + |-------------------------------------------------------------------------- + | + | Here you may configure all of the mailers used by your application plus + | their respective settings. Several examples have been configured for + | you and you are free to add your own as your application requires. + | + | Laravel supports a variety of mail "transport" drivers to be used while + | sending an e-mail. You will specify which one you are using for your + | mailers below. You are free to add additional mailers as required. + | + | Supported: "smtp", "sendmail", "mailgun", "ses", "ses-v2", + | "postmark", "log", "array", "failover" + | + */ + + 'mailers' => [ + 'smtp' => [ + 'transport' => 'smtp', + 'url' => env('MAIL_URL'), + 'host' => env('MAIL_HOST', 'smtp.mailgun.org'), + 'port' => env('MAIL_PORT', 587), + 'encryption' => env('MAIL_ENCRYPTION', 'tls'), + 'username' => env('MAIL_USERNAME'), + 'password' => env('MAIL_PASSWORD'), + 'timeout' => null, + 'local_domain' => env('MAIL_EHLO_DOMAIN'), + ], + + 'ses' => [ + 'transport' => 'ses', + ], + + 'mailgun' => [ + 'transport' => 'mailgun', + // 'client' => [ + // 'timeout' => 5, + // ], + ], + + 'postmark' => [ + 'transport' => 'postmark', + // 'client' => [ + // 'timeout' => 5, + // ], + ], + + 'sendmail' => [ + 'transport' => 'sendmail', + 'path' => env('MAIL_SENDMAIL_PATH', '/usr/sbin/sendmail -bs -i'), + ], + + 'log' => [ + 'transport' => 'log', + 'channel' => env('MAIL_LOG_CHANNEL'), + ], + + 'array' => [ + 'transport' => 'array', + ], + + 'failover' => [ + 'transport' => 'failover', + 'mailers' => [ + 'smtp', + 'log', + ], + ], + ], + + /* + |-------------------------------------------------------------------------- + | Global "From" Address + |-------------------------------------------------------------------------- + | + | You may wish for all e-mails sent by your application to be sent from + | the same address. Here, you may specify a name and address that is + | used globally for all e-mails that are sent by your application. + | + */ + + 'from' => [ + 'address' => env('MAIL_FROM_ADDRESS', 'hello@example.com'), + 'name' => env('MAIL_FROM_NAME', 'Example'), + ], + + /* + |-------------------------------------------------------------------------- + | Markdown Mail Settings + |-------------------------------------------------------------------------- + | + | If you are using Markdown based email rendering, you may configure your + | theme and component paths here, allowing you to customize the design + | of the emails. Or, you may simply stick with the Laravel defaults! + | + */ + + 'markdown' => [ + 'theme' => 'default', + + 'paths' => [ + resource_path('views/vendor/mail'), + ], + ], + +]; diff --git a/config/queue.php b/config/queue.php new file mode 100644 index 00000000..01c6b054 --- /dev/null +++ b/config/queue.php @@ -0,0 +1,109 @@ + env('QUEUE_CONNECTION', 'sync'), + + /* + |-------------------------------------------------------------------------- + | Queue Connections + |-------------------------------------------------------------------------- + | + | Here you may configure the connection information for each server that + | is used by your application. A default configuration has been added + | for each back-end shipped with Laravel. You are free to add more. + | + | Drivers: "sync", "database", "beanstalkd", "sqs", "redis", "null" + | + */ + + 'connections' => [ + + 'sync' => [ + 'driver' => 'sync', + ], + + 'database' => [ + 'driver' => 'database', + 'table' => 'jobs', + 'queue' => 'default', + 'retry_after' => 90, + 'after_commit' => false, + ], + + 'beanstalkd' => [ + 'driver' => 'beanstalkd', + 'host' => 'localhost', + 'queue' => 'default', + 'retry_after' => 90, + 'block_for' => 0, + 'after_commit' => false, + ], + + 'sqs' => [ + 'driver' => 'sqs', + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'prefix' => env('SQS_PREFIX', 'https://sqs.us-east-1.amazonaws.com/your-account-id'), + 'queue' => env('SQS_QUEUE', 'default'), + 'suffix' => env('SQS_SUFFIX'), + 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'), + 'after_commit' => false, + ], + + 'redis' => [ + 'driver' => 'redis', + 'connection' => 'default', + 'queue' => env('REDIS_QUEUE', 'default'), + 'retry_after' => 90, + 'block_for' => null, + 'after_commit' => false, + ], + + ], + + /* + |-------------------------------------------------------------------------- + | Job Batching + |-------------------------------------------------------------------------- + | + | The following options configure the database and table that store job + | batching information. These options can be updated to any database + | connection and table which has been defined by your application. + | + */ + + 'batching' => [ + 'database' => env('DB_CONNECTION', 'mysql'), + 'table' => 'job_batches', + ], + + /* + |-------------------------------------------------------------------------- + | Failed Queue Jobs + |-------------------------------------------------------------------------- + | + | These options configure the behavior of failed queue job logging so you + | can control which database and table are used to store the jobs that + | have failed. You may change them to any database / table you wish. + | + */ + + 'failed' => [ + 'driver' => env('QUEUE_FAILED_DRIVER', 'database-uuids'), + 'database' => env('DB_CONNECTION', 'mysql'), + 'table' => 'failed_jobs', + ], + +]; diff --git a/config/sanctum.php b/config/sanctum.php new file mode 100644 index 00000000..529cfdc9 --- /dev/null +++ b/config/sanctum.php @@ -0,0 +1,67 @@ + explode(',', env('SANCTUM_STATEFUL_DOMAINS', sprintf( + '%s%s', + 'localhost,localhost:3000,127.0.0.1,127.0.0.1:8000,::1', + Sanctum::currentApplicationUrlWithPort() + ))), + + /* + |-------------------------------------------------------------------------- + | Sanctum Guards + |-------------------------------------------------------------------------- + | + | This array contains the authentication guards that will be checked when + | Sanctum is trying to authenticate a request. If none of these guards + | are able to authenticate the request, Sanctum will use the bearer + | token that's present on an incoming request for authentication. + | + */ + + 'guard' => ['web'], + + /* + |-------------------------------------------------------------------------- + | Expiration Minutes + |-------------------------------------------------------------------------- + | + | This value controls the number of minutes until an issued token will be + | considered expired. If this value is null, personal access tokens do + | not expire. This won't tweak the lifetime of first-party sessions. + | + */ + + 'expiration' => null, + + /* + |-------------------------------------------------------------------------- + | Sanctum Middleware + |-------------------------------------------------------------------------- + | + | When authenticating your first-party SPA with Sanctum you may need to + | customize some of the middleware Sanctum uses while processing the + | request. You may change the middleware listed below as required. + | + */ + + 'middleware' => [ + 'verify_csrf_token' => App\Http\Middleware\VerifyCsrfToken::class, + 'encrypt_cookies' => App\Http\Middleware\EncryptCookies::class, + ], + +]; diff --git a/config/services.php b/config/services.php new file mode 100644 index 00000000..0ace530e --- /dev/null +++ b/config/services.php @@ -0,0 +1,34 @@ + [ + 'domain' => env('MAILGUN_DOMAIN'), + 'secret' => env('MAILGUN_SECRET'), + 'endpoint' => env('MAILGUN_ENDPOINT', 'api.mailgun.net'), + 'scheme' => 'https', + ], + + 'postmark' => [ + 'token' => env('POSTMARK_TOKEN'), + ], + + 'ses' => [ + 'key' => env('AWS_ACCESS_KEY_ID'), + 'secret' => env('AWS_SECRET_ACCESS_KEY'), + 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'), + ], + +]; diff --git a/config/session.php b/config/session.php new file mode 100644 index 00000000..8fed97c0 --- /dev/null +++ b/config/session.php @@ -0,0 +1,201 @@ + env('SESSION_DRIVER', 'file'), + + /* + |-------------------------------------------------------------------------- + | Session Lifetime + |-------------------------------------------------------------------------- + | + | Here you may specify the number of minutes that you wish the session + | to be allowed to remain idle before it expires. If you want them + | to immediately expire on the browser closing, set that option. + | + */ + + 'lifetime' => env('SESSION_LIFETIME', 120), + + 'expire_on_close' => false, + + /* + |-------------------------------------------------------------------------- + | Session Encryption + |-------------------------------------------------------------------------- + | + | This option allows you to easily specify that all of your session data + | should be encrypted before it is stored. All encryption will be run + | automatically by Laravel and you can use the Session like normal. + | + */ + + 'encrypt' => false, + + /* + |-------------------------------------------------------------------------- + | Session File Location + |-------------------------------------------------------------------------- + | + | When using the native session driver, we need a location where session + | files may be stored. A default has been set for you but a different + | location may be specified. This is only needed for file sessions. + | + */ + + 'files' => storage_path('framework/sessions'), + + /* + |-------------------------------------------------------------------------- + | Session Database Connection + |-------------------------------------------------------------------------- + | + | When using the "database" or "redis" session drivers, you may specify a + | connection that should be used to manage these sessions. This should + | correspond to a connection in your database configuration options. + | + */ + + 'connection' => env('SESSION_CONNECTION'), + + /* + |-------------------------------------------------------------------------- + | Session Database Table + |-------------------------------------------------------------------------- + | + | When using the "database" session driver, you may specify the table we + | should use to manage the sessions. Of course, a sensible default is + | provided for you; however, you are free to change this as needed. + | + */ + + 'table' => 'sessions', + + /* + |-------------------------------------------------------------------------- + | Session Cache Store + |-------------------------------------------------------------------------- + | + | While using one of the framework's cache driven session backends you may + | list a cache store that should be used for these sessions. This value + | must match with one of the application's configured cache "stores". + | + | Affects: "apc", "dynamodb", "memcached", "redis" + | + */ + + 'store' => env('SESSION_STORE'), + + /* + |-------------------------------------------------------------------------- + | Session Sweeping Lottery + |-------------------------------------------------------------------------- + | + | Some session drivers must manually sweep their storage location to get + | rid of old sessions from storage. Here are the chances that it will + | happen on a given request. By default, the odds are 2 out of 100. + | + */ + + 'lottery' => [2, 100], + + /* + |-------------------------------------------------------------------------- + | Session Cookie Name + |-------------------------------------------------------------------------- + | + | Here you may change the name of the cookie used to identify a session + | instance by ID. The name specified here will get used every time a + | new session cookie is created by the framework for every driver. + | + */ + + 'cookie' => env( + 'SESSION_COOKIE', + Str::slug(env('APP_NAME', 'laravel'), '_').'_session' + ), + + /* + |-------------------------------------------------------------------------- + | Session Cookie Path + |-------------------------------------------------------------------------- + | + | The session cookie path determines the path for which the cookie will + | be regarded as available. Typically, this will be the root path of + | your application but you are free to change this when necessary. + | + */ + + 'path' => '/', + + /* + |-------------------------------------------------------------------------- + | Session Cookie Domain + |-------------------------------------------------------------------------- + | + | Here you may change the domain of the cookie used to identify a session + | in your application. This will determine which domains the cookie is + | available to in your application. A sensible default has been set. + | + */ + + 'domain' => env('SESSION_DOMAIN'), + + /* + |-------------------------------------------------------------------------- + | HTTPS Only Cookies + |-------------------------------------------------------------------------- + | + | By setting this option to true, session cookies will only be sent back + | to the server if the browser has a HTTPS connection. This will keep + | the cookie from being sent to you when it can't be done securely. + | + */ + + 'secure' => env('SESSION_SECURE_COOKIE'), + + /* + |-------------------------------------------------------------------------- + | HTTP Access Only + |-------------------------------------------------------------------------- + | + | Setting this value to true will prevent JavaScript from accessing the + | value of the cookie and the cookie will only be accessible through + | the HTTP protocol. You are free to modify this option if needed. + | + */ + + 'http_only' => true, + + /* + |-------------------------------------------------------------------------- + | Same-Site Cookies + |-------------------------------------------------------------------------- + | + | This option determines how your cookies behave when cross-site requests + | take place, and can be used to mitigate CSRF attacks. By default, we + | will set this value to "lax" since this is a secure default value. + | + | Supported: "lax", "strict", "none", null + | + */ + + 'same_site' => 'lax', + +]; diff --git a/config/view.php b/config/view.php new file mode 100644 index 00000000..22b8a18d --- /dev/null +++ b/config/view.php @@ -0,0 +1,36 @@ + [ + resource_path('views'), + ], + + /* + |-------------------------------------------------------------------------- + | Compiled View Path + |-------------------------------------------------------------------------- + | + | This option determines where all the compiled Blade templates will be + | stored for your application. Typically, this is within the storage + | directory. However, as usual, you are free to change this value. + | + */ + + 'compiled' => env( + 'VIEW_COMPILED_PATH', + realpath(storage_path('framework/views')) + ), + +]; diff --git a/database/.gitignore b/database/.gitignore new file mode 100644 index 00000000..9b19b93c --- /dev/null +++ b/database/.gitignore @@ -0,0 +1 @@ +*.sqlite* diff --git a/database/factories/ArticleFactory.php b/database/factories/ArticleFactory.php new file mode 100644 index 00000000..c46cb9e0 --- /dev/null +++ b/database/factories/ArticleFactory.php @@ -0,0 +1,27 @@ + + */ +class ArticleFactory extends Factory { + /** + * Define the model's default state. + * + * @return array + */ + public function definition(): array { + return [ + 'title' => $this->faker->text(rand(25,50)), + 'fulltext' => $this->faker->text(rand(300,1000)), + 'image' => RandomImage::getLegacyImageUri(env('PERCENTAGE_OF_ARTICLES_WITH_IMAGES',100)), + 'category_id' => Category::orderByRaw('rand()')->first()->id, + 'user_id' => null + ]; + } +} \ No newline at end of file diff --git a/database/factories/CategoryFactory.php b/database/factories/CategoryFactory.php new file mode 100644 index 00000000..92e415db --- /dev/null +++ b/database/factories/CategoryFactory.php @@ -0,0 +1,21 @@ + + */ +class CategoryFactory extends Factory { + /** + * Define the model's default state. + * + * @return array + */ + public function definition(): array { + return [ + 'name' => $this->faker->text(30) + ]; + } +} \ No newline at end of file diff --git a/database/factories/TagFactory.php b/database/factories/TagFactory.php new file mode 100644 index 00000000..b0ac5257 --- /dev/null +++ b/database/factories/TagFactory.php @@ -0,0 +1,21 @@ + + */ +class TagFactory extends Factory { + /** + * Define the model's default state. + * + * @return array + */ + public function definition(): array { + return [ + 'name' => $this->faker->text(15) + ]; + } +} \ No newline at end of file diff --git a/database/factories/UserFactory.php b/database/factories/UserFactory.php new file mode 100644 index 00000000..a6ecc0af --- /dev/null +++ b/database/factories/UserFactory.php @@ -0,0 +1,38 @@ + + */ +class UserFactory extends Factory +{ + /** + * Define the model's default state. + * + * @return array + */ + public function definition(): array + { + return [ + 'name' => fake()->name(), + 'email' => fake()->unique()->safeEmail(), + 'email_verified_at' => now(), + 'password' => '$2y$10$92IXUNpkjO0rOQ5byMi.Ye4oKoEa3Ro9llC/.og/at2.uheWG/igi', // password + 'remember_token' => Str::random(10), + ]; + } + + /** + * Indicate that the model's email address should be unverified. + */ + public function unverified(): static + { + return $this->state(fn (array $attributes) => [ + 'email_verified_at' => null, + ]); + } +} diff --git a/database/migrations/2014_10_12_000000_create_users_table.php b/database/migrations/2014_10_12_000000_create_users_table.php new file mode 100644 index 00000000..444fafb7 --- /dev/null +++ b/database/migrations/2014_10_12_000000_create_users_table.php @@ -0,0 +1,32 @@ +id(); + $table->string('name'); + $table->string('email')->unique(); + $table->timestamp('email_verified_at')->nullable(); + $table->string('password'); + $table->rememberToken(); + $table->timestamps(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('users'); + } +}; diff --git a/database/migrations/2014_10_12_100000_create_password_reset_tokens_table.php b/database/migrations/2014_10_12_100000_create_password_reset_tokens_table.php new file mode 100644 index 00000000..81a7229b --- /dev/null +++ b/database/migrations/2014_10_12_100000_create_password_reset_tokens_table.php @@ -0,0 +1,28 @@ +string('email')->primary(); + $table->string('token'); + $table->timestamp('created_at')->nullable(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('password_reset_tokens'); + } +}; diff --git a/database/migrations/2019_08_19_000000_create_failed_jobs_table.php b/database/migrations/2019_08_19_000000_create_failed_jobs_table.php new file mode 100644 index 00000000..249da817 --- /dev/null +++ b/database/migrations/2019_08_19_000000_create_failed_jobs_table.php @@ -0,0 +1,32 @@ +id(); + $table->string('uuid')->unique(); + $table->text('connection'); + $table->text('queue'); + $table->longText('payload'); + $table->longText('exception'); + $table->timestamp('failed_at')->useCurrent(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('failed_jobs'); + } +}; diff --git a/database/migrations/2019_12_14_000001_create_personal_access_tokens_table.php b/database/migrations/2019_12_14_000001_create_personal_access_tokens_table.php new file mode 100644 index 00000000..e828ad81 --- /dev/null +++ b/database/migrations/2019_12_14_000001_create_personal_access_tokens_table.php @@ -0,0 +1,33 @@ +id(); + $table->morphs('tokenable'); + $table->string('name'); + $table->string('token', 64)->unique(); + $table->text('abilities')->nullable(); + $table->timestamp('last_used_at')->nullable(); + $table->timestamp('expires_at')->nullable(); + $table->timestamps(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('personal_access_tokens'); + } +}; diff --git a/database/migrations/2023_09_30_142130_create_categories_table.php b/database/migrations/2023_09_30_142130_create_categories_table.php new file mode 100644 index 00000000..3db6b98b --- /dev/null +++ b/database/migrations/2023_09_30_142130_create_categories_table.php @@ -0,0 +1,26 @@ +id(); + $table->string('name'); + $table->timestamps(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('categories'); + } +}; \ No newline at end of file diff --git a/database/migrations/2023_09_30_145327_create_tags_table.php b/database/migrations/2023_09_30_145327_create_tags_table.php new file mode 100644 index 00000000..92d1269c --- /dev/null +++ b/database/migrations/2023_09_30_145327_create_tags_table.php @@ -0,0 +1,26 @@ +id(); + $table->string('name'); + $table->timestamps(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('tags'); + } +}; \ No newline at end of file diff --git a/database/migrations/2023_09_30_151223_create_articles_table.php b/database/migrations/2023_09_30_151223_create_articles_table.php new file mode 100644 index 00000000..7304a83e --- /dev/null +++ b/database/migrations/2023_09_30_151223_create_articles_table.php @@ -0,0 +1,32 @@ +id(); + $table->string('title'); + $table->text('fulltext'); + $table->string('image')->nullable()->index(); + $table->foreignId('category_id')->constrained()->cascadeOnUpdate()->cascadeOnDelete(); + $table->foreignId('user_id')->nullable()->constrained()->cascadeOnUpdate()->nullOnDelete(); + $table->timestamps(); + $table->unique(['category_id', 'id']); + $table->unique(['user_id', 'id']); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('articles'); + } +}; \ No newline at end of file diff --git a/database/migrations/2023_09_30_174547_create_article_tag_table.php b/database/migrations/2023_09_30_174547_create_article_tag_table.php new file mode 100644 index 00000000..e50a850b --- /dev/null +++ b/database/migrations/2023_09_30_174547_create_article_tag_table.php @@ -0,0 +1,26 @@ +foreignId('article_id')->constrained()->cascadeOnUpdate()->cascadeOnDelete(); + $table->foreignId('tag_id')->constrained()->cascadeOnUpdate()->cascadeOnDelete(); + $table->primary(['article_id', 'tag_id']); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::dropIfExists('article_tag'); + } +}; \ No newline at end of file diff --git a/database/seeders/ArticleSeeder.php b/database/seeders/ArticleSeeder.php new file mode 100644 index 00000000..31f70876 --- /dev/null +++ b/database/seeders/ArticleSeeder.php @@ -0,0 +1,18 @@ + 0) Article::factory(env('ARTICLES_TO_SEED'), [ + 'user_id' => User::first()->id + ])->create(); + } +} \ No newline at end of file diff --git a/database/seeders/ArticleTagSeeder.php b/database/seeders/ArticleTagSeeder.php new file mode 100644 index 00000000..7d9c8456 --- /dev/null +++ b/database/seeders/ArticleTagSeeder.php @@ -0,0 +1,19 @@ + 0) $article->tags()->attach(Tag::orderByRaw('rand()')->limit($qty)->get()->pluck('id')); + } + } +} \ No newline at end of file diff --git a/database/seeders/CategorySeeder.php b/database/seeders/CategorySeeder.php new file mode 100644 index 00000000..3efb17d5 --- /dev/null +++ b/database/seeders/CategorySeeder.php @@ -0,0 +1,13 @@ + 0) Category::factory(env('CATEGORIES_TO_SEED'))->create(); + } +} \ No newline at end of file diff --git a/database/seeders/DatabaseSeeder.php b/database/seeders/DatabaseSeeder.php new file mode 100644 index 00000000..4e1c4852 --- /dev/null +++ b/database/seeders/DatabaseSeeder.php @@ -0,0 +1,16 @@ +call([ UserSeeder::class ]); + $this->call([ CategorySeeder::class ]); + $this->call([ TagSeeder::class ]); + $this->call([ ArticleSeeder::class ]); + $this->call([ ArticleTagSeeder::class ]); + } +} \ No newline at end of file diff --git a/database/seeders/TagSeeder.php b/database/seeders/TagSeeder.php new file mode 100644 index 00000000..9b501296 --- /dev/null +++ b/database/seeders/TagSeeder.php @@ -0,0 +1,13 @@ + 0) Tag::factory(env('TAGS_TO_SEED'))->create(); + } +} \ No newline at end of file diff --git a/database/seeders/UserSeeder.php b/database/seeders/UserSeeder.php new file mode 100644 index 00000000..afbe54ae --- /dev/null +++ b/database/seeders/UserSeeder.php @@ -0,0 +1,18 @@ + env('DEFAULT_USER_NAME'), + 'email' => env('DEFAULT_USER_EMAIL'), + 'password' => Hash::make(env('DEFAULT_USER_PASSWORD')) + ]); + } +} \ No newline at end of file diff --git a/gitimages/image01.png b/gitimages/image01.png new file mode 100644 index 00000000..be54cd09 Binary files /dev/null and b/gitimages/image01.png differ diff --git a/gitimages/image02.png b/gitimages/image02.png new file mode 100644 index 00000000..b509a1e7 Binary files /dev/null and b/gitimages/image02.png differ diff --git a/package-lock.json b/package-lock.json new file mode 100644 index 00000000..eb4986f9 --- /dev/null +++ b/package-lock.json @@ -0,0 +1,1783 @@ +{ + "name": "article_crud", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "devDependencies": { + "@tailwindcss/forms": "^0.5.2", + "alpinejs": "^3.4.2", + "autoprefixer": "^10.4.2", + "axios": "^1.1.2", + "laravel-vite-plugin": "^0.8.0", + "postcss": "^8.4.6", + "tailwindcss": "^3.1.0", + "vite": "^4.0.0" + } + }, + "node_modules/@alloc/quick-lru": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@alloc/quick-lru/-/quick-lru-5.2.0.tgz", + "integrity": "sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.18.20.tgz", + "integrity": "sha512-fyi7TDI/ijKKNZTUJAQqiG5T7YjJXgnzkURqmGj13C6dCqckZBLdl4h7bkhHt/t0WP+zO9/zwroDvANaOqO5Sw==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.18.20.tgz", + "integrity": "sha512-Nz4rJcchGDtENV0eMKUNa6L12zz2zBDXuhj/Vjh18zGqB44Bi7MBMSXjgunJgjRhCmKOjnPuZp4Mb6OKqtMHLQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.18.20.tgz", + "integrity": "sha512-8GDdlePJA8D6zlZYJV/jnrRAi6rOiNaCC/JclcXpB+KIuvfBN4owLtgzY2bsxnx666XjJx2kDPUmnTtR8qKQUg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.18.20.tgz", + "integrity": "sha512-bxRHW5kHU38zS2lPTPOyuyTm+S+eobPUnTNkdJEfAddYgEcll4xkT8DB9d2008DtTbl7uJag2HuE5NZAZgnNEA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.18.20.tgz", + "integrity": "sha512-pc5gxlMDxzm513qPGbCbDukOdsGtKhfxD1zJKXjCCcU7ju50O7MeAZ8c4krSJcOIJGFR+qx21yMMVYwiQvyTyQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.18.20.tgz", + "integrity": "sha512-yqDQHy4QHevpMAaxhhIwYPMv1NECwOvIpGCZkECn8w2WFHXjEwrBn3CeNIYsibZ/iZEUemj++M26W3cNR5h+Tw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.18.20.tgz", + "integrity": "sha512-tgWRPPuQsd3RmBZwarGVHZQvtzfEBOreNuxEMKFcd5DaDn2PbBxfwLcj4+aenoh7ctXcbXmOQIn8HI6mCSw5MQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.18.20.tgz", + "integrity": "sha512-/5bHkMWnq1EgKr1V+Ybz3s1hWXok7mDFUMQ4cG10AfW3wL02PSZi5kFpYKrptDsgb2WAJIvRcDm+qIvXf/apvg==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.18.20.tgz", + "integrity": "sha512-2YbscF+UL7SQAVIpnWvYwM+3LskyDmPhe31pE7/aoTMFKKzIc9lLbyGUpmmb8a8AixOL61sQ/mFh3jEjHYFvdA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.18.20.tgz", + "integrity": "sha512-P4etWwq6IsReT0E1KHU40bOnzMHoH73aXp96Fs8TIT6z9Hu8G6+0SHSw9i2isWrD2nbx2qo5yUqACgdfVGx7TA==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.18.20.tgz", + "integrity": "sha512-nXW8nqBTrOpDLPgPY9uV+/1DjxoQ7DoB2N8eocyq8I9XuqJ7BiAMDMf9n1xZM9TgW0J8zrquIb/A7s3BJv7rjg==", + "cpu": [ + "loong64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.18.20.tgz", + "integrity": "sha512-d5NeaXZcHp8PzYy5VnXV3VSd2D328Zb+9dEq5HE6bw6+N86JVPExrA6O68OPwobntbNJ0pzCpUFZTo3w0GyetQ==", + "cpu": [ + "mips64el" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.18.20.tgz", + "integrity": "sha512-WHPyeScRNcmANnLQkq6AfyXRFr5D6N2sKgkFo2FqguP44Nw2eyDlbTdZwd9GYk98DZG9QItIiTlFLHJHjxP3FA==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.18.20.tgz", + "integrity": "sha512-WSxo6h5ecI5XH34KC7w5veNnKkju3zBRLEQNY7mv5mtBmrP/MjNBCAlsM2u5hDBlS3NGcTQpoBvRzqBcRtpq1A==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.18.20.tgz", + "integrity": "sha512-+8231GMs3mAEth6Ja1iK0a1sQ3ohfcpzpRLH8uuc5/KVDFneH6jtAJLFGafpzpMRO6DzJ6AvXKze9LfFMrIHVQ==", + "cpu": [ + "s390x" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.18.20.tgz", + "integrity": "sha512-UYqiqemphJcNsFEskc73jQ7B9jgwjWrSayxawS6UVFZGWrAAtkzjxSqnoclCXxWtfwLdzU+vTpcNYhpn43uP1w==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.18.20.tgz", + "integrity": "sha512-iO1c++VP6xUBUmltHZoMtCUdPlnPGdBom6IrO4gyKPFFVBKioIImVooR5I83nTew5UOYrk3gIJhbZh8X44y06A==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.18.20.tgz", + "integrity": "sha512-e5e4YSsuQfX4cxcygw/UCPIEP6wbIL+se3sxPdCiMbFLBWu0eiZOJ7WoD+ptCLrmjZBK1Wk7I6D/I3NglUGOxg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.18.20.tgz", + "integrity": "sha512-kDbFRFp0YpTQVVrqUd5FTYmWo45zGaXe0X8E1G/LKFC0v8x0vWrhOWSLITcCn63lmZIxfOMXtCfti/RxN/0wnQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.18.20.tgz", + "integrity": "sha512-ddYFR6ItYgoaq4v4JmQQaAI5s7npztfV4Ag6NrhiaW0RrnOXqBkgwZLofVTlq1daVTQNhtI5oieTvkRPfZrePg==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.18.20.tgz", + "integrity": "sha512-Wv7QBi3ID/rROT08SABTS7eV4hX26sVduqDOTe1MvGMjNd3EjOz4b7zeexIR62GTIEKrfJXKL9LFxTYgkyeu7g==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.18.20.tgz", + "integrity": "sha512-kTdfRcSiDfQca/y9QIkng02avJ+NCaQvrMejlsB3RRv5sE9rRoeBPISaZpKxHELzRxZyLvNts1P27W3wV+8geQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.3.tgz", + "integrity": "sha512-HLhSWOLRi875zjjMG/r+Nv0oCW8umGb0BgEhyX3dDX3egwZtB8PqLnjz3yedt8R5StBrzcg4aBpnh8UA9D1BoQ==", + "dev": true, + "dependencies": { + "@jridgewell/set-array": "^1.0.1", + "@jridgewell/sourcemap-codec": "^1.4.10", + "@jridgewell/trace-mapping": "^0.3.9" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.1.tgz", + "integrity": "sha512-dSYZh7HhCDtCKm4QakX0xFpsRDqjjtZf/kjI/v3T3Nwt5r8/qz/M19F9ySyOqU94SXBmeG9ttTul+YnR4LOxFA==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/set-array": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.1.2.tgz", + "integrity": "sha512-xnkseuNADM0gt2bs+BvhO0p78Mk762YnZdsuzFV018NoG1Sj1SCQvpSqa7XUaTam5vAGasABV9qXASMKnFMwMw==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.4.15", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz", + "integrity": "sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==", + "dev": true + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.19", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.19.tgz", + "integrity": "sha512-kf37QtfW+Hwx/buWGMPcR60iF9ziHa6r/CZJIHbmcm4+0qrXiVdxegAH0F6yddEVQ7zdkjcGCgCzUu+BcbhQxw==", + "dev": true, + "dependencies": { + "@jridgewell/resolve-uri": "^3.1.0", + "@jridgewell/sourcemap-codec": "^1.4.14" + } + }, + "node_modules/@nodelib/fs.scandir": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", + "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "2.0.5", + "run-parallel": "^1.1.9" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.stat": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", + "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.walk": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", + "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", + "dev": true, + "dependencies": { + "@nodelib/fs.scandir": "2.1.5", + "fastq": "^1.6.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@tailwindcss/forms": { + "version": "0.5.6", + "resolved": "https://registry.npmjs.org/@tailwindcss/forms/-/forms-0.5.6.tgz", + "integrity": "sha512-Fw+2BJ0tmAwK/w01tEFL5TiaJBX1NLT1/YbWgvm7ws3Qcn11kiXxzNTEQDMs5V3mQemhB56l3u0i9dwdzSQldA==", + "dev": true, + "dependencies": { + "mini-svg-data-uri": "^1.2.3" + }, + "peerDependencies": { + "tailwindcss": ">=3.0.0 || >= 3.0.0-alpha.1" + } + }, + "node_modules/@vue/reactivity": { + "version": "3.1.5", + "resolved": "https://registry.npmjs.org/@vue/reactivity/-/reactivity-3.1.5.tgz", + "integrity": "sha512-1tdfLmNjWG6t/CsPldh+foumYFo3cpyCHgBYQ34ylaMsJ+SNHQ1kApMIa8jN+i593zQuaw3AdWH0nJTARzCFhg==", + "dev": true, + "dependencies": { + "@vue/shared": "3.1.5" + } + }, + "node_modules/@vue/shared": { + "version": "3.1.5", + "resolved": "https://registry.npmjs.org/@vue/shared/-/shared-3.1.5.tgz", + "integrity": "sha512-oJ4F3TnvpXaQwZJNF3ZK+kLPHKarDmJjJ6jyzVNDKH9md1dptjC7lWR//jrGuLdek/U6iltWxqAnYOu8gCiOvA==", + "dev": true + }, + "node_modules/alpinejs": { + "version": "3.13.0", + "resolved": "https://registry.npmjs.org/alpinejs/-/alpinejs-3.13.0.tgz", + "integrity": "sha512-7FYR1Yz3evIjlJD1mZ3SYWSw+jlOmQGeQ1QiSufSQ6J84XMQFkzxm6OobiZ928SfqhGdoIp2SsABNsS4rXMMJw==", + "dev": true, + "dependencies": { + "@vue/reactivity": "~3.1.1" + } + }, + "node_modules/any-promise": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", + "integrity": "sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==", + "dev": true + }, + "node_modules/anymatch": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", + "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", + "dev": true, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/arg": { + "version": "5.0.2", + "resolved": "https://registry.npmjs.org/arg/-/arg-5.0.2.tgz", + "integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==", + "dev": true + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==", + "dev": true + }, + "node_modules/autoprefixer": { + "version": "10.4.16", + "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.16.tgz", + "integrity": "sha512-7vd3UC6xKp0HLfua5IjZlcXvGAGy7cBAXTg2lyQ/8WpNhd6SiZ8Be+xm3FyBSYJx5GKcpRCzBh7RH4/0dnY+uQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/autoprefixer" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "browserslist": "^4.21.10", + "caniuse-lite": "^1.0.30001538", + "fraction.js": "^4.3.6", + "normalize-range": "^0.1.2", + "picocolors": "^1.0.0", + "postcss-value-parser": "^4.2.0" + }, + "bin": { + "autoprefixer": "bin/autoprefixer" + }, + "engines": { + "node": "^10 || ^12 || >=14" + }, + "peerDependencies": { + "postcss": "^8.1.0" + } + }, + "node_modules/axios": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/axios/-/axios-1.5.1.tgz", + "integrity": "sha512-Q28iYCWzNHjAm+yEAot5QaAMxhMghWLFVf7rRdwhUI+c2jix2DUXjAHXVi+s1ibs3mjPO/cCgbA++3BjD0vP/A==", + "dev": true, + "dependencies": { + "follow-redirects": "^1.15.0", + "form-data": "^4.0.0", + "proxy-from-env": "^1.1.0" + } + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "dev": true + }, + "node_modules/binary-extensions": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", + "integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dev": true, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "dependencies": { + "fill-range": "^7.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/browserslist": { + "version": "4.22.1", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.22.1.tgz", + "integrity": "sha512-FEVc202+2iuClEhZhrWy6ZiAcRLvNMyYcxZ8raemul1DYVOVdFsbqckWLdsixQZCpJlwe77Z3UTalE7jsjnKfQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "caniuse-lite": "^1.0.30001541", + "electron-to-chromium": "^1.4.535", + "node-releases": "^2.0.13", + "update-browserslist-db": "^1.0.13" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/camelcase-css": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz", + "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001541", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001541.tgz", + "integrity": "sha512-bLOsqxDgTqUBkzxbNlSBt8annkDpQB9NdzdTbO2ooJ+eC/IQcvDspDc058g84ejCelF7vHUx57KIOjEecOHXaw==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ] + }, + "node_modules/chokidar": { + "version": "3.5.3", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.3.tgz", + "integrity": "sha512-Dr3sfKRP6oTcjf2JmUmFJfeVMvXBdegxB0iVQ5eb2V10uFJUCAS8OByZdVAyVb8xXNz3GjjTgj9kLWsZTqE6kw==", + "dev": true, + "funding": [ + { + "type": "individual", + "url": "https://paulmillr.com/funding/" + } + ], + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/chokidar/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dev": true, + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/commander": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/commander/-/commander-4.1.1.tgz", + "integrity": "sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", + "dev": true + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "dev": true, + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==", + "dev": true, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/didyoumean": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz", + "integrity": "sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw==", + "dev": true + }, + "node_modules/dlv": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/dlv/-/dlv-1.1.3.tgz", + "integrity": "sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==", + "dev": true + }, + "node_modules/electron-to-chromium": { + "version": "1.4.537", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.4.537.tgz", + "integrity": "sha512-W1+g9qs9hviII0HAwOdehGYkr+zt7KKdmCcJcjH0mYg6oL8+ioT3Skjmt7BLoAQqXhjf40AXd+HlR4oAWMlXjA==", + "dev": true + }, + "node_modules/esbuild": { + "version": "0.18.20", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.18.20.tgz", + "integrity": "sha512-ceqxoedUrcayh7Y7ZX6NdbbDzGROiyVBgC4PriJThBKSVPWnnFHZAkfI1lJT8QFkOwH4qOS2SJkS4wvpGl8BpA==", + "dev": true, + "hasInstallScript": true, + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=12" + }, + "optionalDependencies": { + "@esbuild/android-arm": "0.18.20", + "@esbuild/android-arm64": "0.18.20", + "@esbuild/android-x64": "0.18.20", + "@esbuild/darwin-arm64": "0.18.20", + "@esbuild/darwin-x64": "0.18.20", + "@esbuild/freebsd-arm64": "0.18.20", + "@esbuild/freebsd-x64": "0.18.20", + "@esbuild/linux-arm": "0.18.20", + "@esbuild/linux-arm64": "0.18.20", + "@esbuild/linux-ia32": "0.18.20", + "@esbuild/linux-loong64": "0.18.20", + "@esbuild/linux-mips64el": "0.18.20", + "@esbuild/linux-ppc64": "0.18.20", + "@esbuild/linux-riscv64": "0.18.20", + "@esbuild/linux-s390x": "0.18.20", + "@esbuild/linux-x64": "0.18.20", + "@esbuild/netbsd-x64": "0.18.20", + "@esbuild/openbsd-x64": "0.18.20", + "@esbuild/sunos-x64": "0.18.20", + "@esbuild/win32-arm64": "0.18.20", + "@esbuild/win32-ia32": "0.18.20", + "@esbuild/win32-x64": "0.18.20" + } + }, + "node_modules/escalade": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz", + "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/fast-glob": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.1.tgz", + "integrity": "sha512-kNFPyjhh5cKjrUltxs+wFx+ZkbRaxxmZ+X0ZU31SOsxCEtP9VPgtq2teZw1DebupL5GmDaNQ6yKMMVcM41iqDg==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "^2.0.2", + "@nodelib/fs.walk": "^1.2.3", + "glob-parent": "^5.1.2", + "merge2": "^1.3.0", + "micromatch": "^4.0.4" + }, + "engines": { + "node": ">=8.6.0" + } + }, + "node_modules/fast-glob/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/fastq": { + "version": "1.15.0", + "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.15.0.tgz", + "integrity": "sha512-wBrocU2LCXXa+lWBt8RoIRD89Fi8OdABODa/kEnyeyjS5aZO5/GNvI5sEINADqP/h8M29UHTHUb53sUu5Ihqdw==", + "dev": true, + "dependencies": { + "reusify": "^1.0.4" + } + }, + "node_modules/fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/follow-redirects": { + "version": "1.15.3", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.3.tgz", + "integrity": "sha512-1VzOtuEM8pC9SFU1E+8KfTjZyMztRsgEfwQl44z8A25uy13jSzTj6dyK2Df52iV0vgHCfBwLhDWevLn95w5v6Q==", + "dev": true, + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "engines": { + "node": ">=4.0" + }, + "peerDependenciesMeta": { + "debug": { + "optional": true + } + } + }, + "node_modules/form-data": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.0.tgz", + "integrity": "sha512-ETEklSGi5t0QMZuiXoA/Q6vcnxcLQP5vdugSpuAyi6SVGi2clPPp+xgEhuMaHC+zGgn31Kd235W35f7Hykkaww==", + "dev": true, + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.8", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/fraction.js": { + "version": "4.3.6", + "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-4.3.6.tgz", + "integrity": "sha512-n2aZ9tNfYDwaHhvFTkhFErqOMIb8uyzSQ+vGJBjZyanAKZVbGUQ1sngfk9FdkBw7G26O7AgNjLcecLffD1c7eg==", + "dev": true, + "engines": { + "node": "*" + }, + "funding": { + "type": "patreon", + "url": "https://github.com/sponsors/rawify" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==", + "dev": true + }, + "node_modules/fsevents": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", + "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", + "dev": true, + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", + "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==", + "dev": true + }, + "node_modules/glob": { + "version": "7.1.6", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", + "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", + "dev": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/glob-parent": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", + "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.3" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/has": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", + "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.1" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==", + "dev": true, + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "dev": true + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-core-module": { + "version": "2.13.0", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.13.0.tgz", + "integrity": "sha512-Z7dk6Qo8pOCp3l4tsX2C5ZVas4V+UxwQodwZhLopL91TX8UyyHEXafPcyoeeWuLrwzHcr3igO78wNLwHJHsMCQ==", + "dev": true, + "dependencies": { + "has": "^1.0.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/jiti": { + "version": "1.20.0", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-1.20.0.tgz", + "integrity": "sha512-3TV69ZbrvV6U5DfQimop50jE9Dl6J8O1ja1dvBbMba/sZ3YBEQqJ2VZRoQPVnhlzjNtU1vaXRZVrVjU4qtm8yA==", + "dev": true, + "bin": { + "jiti": "bin/jiti.js" + } + }, + "node_modules/laravel-vite-plugin": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/laravel-vite-plugin/-/laravel-vite-plugin-0.8.1.tgz", + "integrity": "sha512-fxzUDjOA37kOsYq8dP+3oPIlw8/kJVXwu0hOXLun82R1LpV02shGeWGYKx2lbpKffL5I0sfPPjfqbYxuqBluAA==", + "dev": true, + "dependencies": { + "picocolors": "^1.0.0", + "vite-plugin-full-reload": "^1.0.5" + }, + "engines": { + "node": ">=14" + }, + "peerDependencies": { + "vite": "^3.0.0 || ^4.0.0" + } + }, + "node_modules/lilconfig": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-2.1.0.tgz", + "integrity": "sha512-utWOt/GHzuUxnLKxB6dk81RoOeoNeHgbrXiuGk4yyF5qlRz+iIVWu56E2fqGHFrXz0QNUhLB/8nKqvRH66JKGQ==", + "dev": true, + "engines": { + "node": ">=10" + } + }, + "node_modules/lines-and-columns": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz", + "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==", + "dev": true + }, + "node_modules/merge2": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz", + "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/micromatch": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.5.tgz", + "integrity": "sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA==", + "dev": true, + "dependencies": { + "braces": "^3.0.2", + "picomatch": "^2.3.1" + }, + "engines": { + "node": ">=8.6" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "dev": true, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "dev": true, + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mini-svg-data-uri": { + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/mini-svg-data-uri/-/mini-svg-data-uri-1.4.4.tgz", + "integrity": "sha512-r9deDe9p5FJUPZAk3A59wGH7Ii9YrjjWw0jmw/liSbHl2CHiyXj6FcDXDu2K3TjVAXqiJdaw3xxwlZZr9E6nHg==", + "dev": true, + "bin": { + "mini-svg-data-uri": "cli.js" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/mz": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz", + "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==", + "dev": true, + "dependencies": { + "any-promise": "^1.0.0", + "object-assign": "^4.0.1", + "thenify-all": "^1.0.0" + } + }, + "node_modules/nanoid": { + "version": "3.3.6", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.6.tgz", + "integrity": "sha512-BGcqMMJuToF7i1rt+2PWSNVnWIkGCU78jBG3RxO/bZlnZPK2Cmi2QaffxGO/2RvWi9sL+FAiRiXMgsyxQ1DIDA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/node-releases": { + "version": "2.0.13", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.13.tgz", + "integrity": "sha512-uYr7J37ae/ORWdZeQ1xxMJe3NtdmqMC/JZK+geofDrkLUApKRHPd18/TxtBOJ4A0/+uUIliorNrfYV6s1b02eQ==", + "dev": true + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize-range": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz", + "integrity": "sha512-bdok/XvKII3nUpklnV6P2hxtMNrCboOjAcyBuQnWEhO665FwrSNRxU+AqpsyvO6LgGYPspN+lu5CLtw4jPRKNA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-hash": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/object-hash/-/object-hash-3.0.0.tgz", + "integrity": "sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", + "dev": true, + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-parse": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz", + "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==", + "dev": true + }, + "node_modules/picocolors": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.0.tgz", + "integrity": "sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==", + "dev": true + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "dev": true, + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pirates": { + "version": "4.0.6", + "resolved": "https://registry.npmjs.org/pirates/-/pirates-4.0.6.tgz", + "integrity": "sha512-saLsH7WeYYPiD25LDuLRRY/i+6HaPYr6G1OUlN39otzkSTxKnubR9RTxS3/Kk50s1g2JTgFwWQDQyplC5/SHZg==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss": { + "version": "8.4.31", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.31.tgz", + "integrity": "sha512-PS08Iboia9mts/2ygV3eLpY5ghnUcfLV/EXTOW1E2qYxJKGGBUtNjN76FYHnMs36RmARn41bC0AZmn+rR0OVpQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "nanoid": "^3.3.6", + "picocolors": "^1.0.0", + "source-map-js": "^1.0.2" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/postcss-import": { + "version": "15.1.0", + "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-15.1.0.tgz", + "integrity": "sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew==", + "dev": true, + "dependencies": { + "postcss-value-parser": "^4.0.0", + "read-cache": "^1.0.0", + "resolve": "^1.1.7" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "postcss": "^8.0.0" + } + }, + "node_modules/postcss-js": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.0.1.tgz", + "integrity": "sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw==", + "dev": true, + "dependencies": { + "camelcase-css": "^2.0.1" + }, + "engines": { + "node": "^12 || ^14 || >= 16" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.4.21" + } + }, + "node_modules/postcss-load-config": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-4.0.1.tgz", + "integrity": "sha512-vEJIc8RdiBRu3oRAI0ymerOn+7rPuMvRXslTvZUKZonDHFIczxztIyJ1urxM1x9JXEikvpWWTUUqal5j/8QgvA==", + "dev": true, + "dependencies": { + "lilconfig": "^2.0.5", + "yaml": "^2.1.1" + }, + "engines": { + "node": ">= 14" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": ">=8.0.9", + "ts-node": ">=9.0.0" + }, + "peerDependenciesMeta": { + "postcss": { + "optional": true + }, + "ts-node": { + "optional": true + } + } + }, + "node_modules/postcss-nested": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.0.1.tgz", + "integrity": "sha512-mEp4xPMi5bSWiMbsgoPfcP74lsWLHkQbZc3sY+jWYd65CUwXrUaTp0fmNpa01ZcETKlIgUdFN/MpS2xZtqL9dQ==", + "dev": true, + "dependencies": { + "postcss-selector-parser": "^6.0.11" + }, + "engines": { + "node": ">=12.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.2.14" + } + }, + "node_modules/postcss-selector-parser": { + "version": "6.0.13", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.13.tgz", + "integrity": "sha512-EaV1Gl4mUEV4ddhDnv/xtj7sxwrwxdetHdWUGnT4VJQf+4d05v6lHYZr8N573k5Z0BViss7BDhfWtKS3+sfAqQ==", + "dev": true, + "dependencies": { + "cssesc": "^3.0.0", + "util-deprecate": "^1.0.2" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/postcss-value-parser": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", + "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==", + "dev": true + }, + "node_modules/proxy-from-env": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz", + "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg==", + "dev": true + }, + "node_modules/queue-microtask": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz", + "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/read-cache": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz", + "integrity": "sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA==", + "dev": true, + "dependencies": { + "pify": "^2.3.0" + } + }, + "node_modules/readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dev": true, + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/resolve": { + "version": "1.22.6", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.6.tgz", + "integrity": "sha512-njhxM7mV12JfufShqGy3Rz8j11RPdLy4xi15UurGJeoHLfJpVXKdh3ueuOqbYUcDZnffr6X739JBo5LzyahEsw==", + "dev": true, + "dependencies": { + "is-core-module": "^2.13.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/reusify": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", + "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", + "dev": true, + "engines": { + "iojs": ">=1.0.0", + "node": ">=0.10.0" + } + }, + "node_modules/rollup": { + "version": "3.29.4", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-3.29.4.tgz", + "integrity": "sha512-oWzmBZwvYrU0iJHtDmhsm662rC15FRXmcjCk1xD771dFDx5jJ02ufAQQTn0etB2emNk4J9EZg/yWKpsn9BWGRw==", + "dev": true, + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=14.18.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/run-parallel": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", + "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "dependencies": { + "queue-microtask": "^1.2.2" + } + }, + "node_modules/source-map-js": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.0.2.tgz", + "integrity": "sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/sucrase": { + "version": "3.34.0", + "resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.34.0.tgz", + "integrity": "sha512-70/LQEZ07TEcxiU2dz51FKaE6hCTWC6vr7FOk3Gr0U60C3shtAN+H+BFr9XlYe5xqf3RA8nrc+VIwzCfnxuXJw==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.2", + "commander": "^4.0.0", + "glob": "7.1.6", + "lines-and-columns": "^1.1.6", + "mz": "^2.7.0", + "pirates": "^4.0.1", + "ts-interface-checker": "^0.1.9" + }, + "bin": { + "sucrase": "bin/sucrase", + "sucrase-node": "bin/sucrase-node" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/supports-preserve-symlinks-flag": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz", + "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/tailwindcss": { + "version": "3.3.3", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-3.3.3.tgz", + "integrity": "sha512-A0KgSkef7eE4Mf+nKJ83i75TMyq8HqY3qmFIJSWy8bNt0v1lG7jUcpGpoTFxAwYcWOphcTBLPPJg+bDfhDf52w==", + "dev": true, + "dependencies": { + "@alloc/quick-lru": "^5.2.0", + "arg": "^5.0.2", + "chokidar": "^3.5.3", + "didyoumean": "^1.2.2", + "dlv": "^1.1.3", + "fast-glob": "^3.2.12", + "glob-parent": "^6.0.2", + "is-glob": "^4.0.3", + "jiti": "^1.18.2", + "lilconfig": "^2.1.0", + "micromatch": "^4.0.5", + "normalize-path": "^3.0.0", + "object-hash": "^3.0.0", + "picocolors": "^1.0.0", + "postcss": "^8.4.23", + "postcss-import": "^15.1.0", + "postcss-js": "^4.0.1", + "postcss-load-config": "^4.0.1", + "postcss-nested": "^6.0.1", + "postcss-selector-parser": "^6.0.11", + "resolve": "^1.22.2", + "sucrase": "^3.32.0" + }, + "bin": { + "tailwind": "lib/cli.js", + "tailwindcss": "lib/cli.js" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/thenify": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz", + "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==", + "dev": true, + "dependencies": { + "any-promise": "^1.0.0" + } + }, + "node_modules/thenify-all": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz", + "integrity": "sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==", + "dev": true, + "dependencies": { + "thenify": ">= 3.1.0 < 4" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/ts-interface-checker": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz", + "integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==", + "dev": true + }, + "node_modules/update-browserslist-db": { + "version": "1.0.13", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.0.13.tgz", + "integrity": "sha512-xebP81SNcPuNpPP3uzeW1NYXxI3rxyJzF3pD6sH4jE7o/IX+WtSpwnVU+qIsDPyk0d3hmFQ7mjqc6AtV604hbg==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "escalade": "^3.1.1", + "picocolors": "^1.0.0" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "dev": true + }, + "node_modules/vite": { + "version": "4.4.9", + "resolved": "https://registry.npmjs.org/vite/-/vite-4.4.9.tgz", + "integrity": "sha512-2mbUn2LlUmNASWwSCNSJ/EG2HuSRTnVNaydp6vMCm5VIqJsjMfbIWtbH2kDuwUVW5mMUKKZvGPX/rqeqVvv1XA==", + "dev": true, + "dependencies": { + "esbuild": "^0.18.10", + "postcss": "^8.4.27", + "rollup": "^3.27.1" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^14.18.0 || >=16.0.0" + }, + "funding": { + "url": "https://github.com/vitejs/vite?sponsor=1" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + }, + "peerDependencies": { + "@types/node": ">= 14", + "less": "*", + "lightningcss": "^1.21.0", + "sass": "*", + "stylus": "*", + "sugarss": "*", + "terser": "^5.4.0" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "less": { + "optional": true + }, + "lightningcss": { + "optional": true + }, + "sass": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + } + } + }, + "node_modules/vite-plugin-full-reload": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/vite-plugin-full-reload/-/vite-plugin-full-reload-1.0.5.tgz", + "integrity": "sha512-kVZFDFWr0DxiHn6MuDVTQf7gnWIdETGlZh0hvTiMXzRN80vgF4PKbONSq8U1d0WtHsKaFODTQgJeakLacoPZEQ==", + "dev": true, + "dependencies": { + "picocolors": "^1.0.0", + "picomatch": "^2.3.1" + }, + "peerDependencies": { + "vite": "^2 || ^3 || ^4" + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", + "dev": true + }, + "node_modules/yaml": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/yaml/-/yaml-2.3.2.tgz", + "integrity": "sha512-N/lyzTPaJasoDmfV7YTrYCI0G/3ivm/9wdG0aHuheKowWQwGTsK0Eoiw6utmzAnI6pkJa0DUVygvp3spqqEKXg==", + "dev": true, + "engines": { + "node": ">= 14" + } + } + } +} diff --git a/package.json b/package.json new file mode 100644 index 00000000..37c91af0 --- /dev/null +++ b/package.json @@ -0,0 +1,18 @@ +{ + "private": true, + "type": "module", + "scripts": { + "dev": "vite", + "build": "vite build" + }, + "devDependencies": { + "@tailwindcss/forms": "^0.5.2", + "alpinejs": "^3.4.2", + "autoprefixer": "^10.4.2", + "axios": "^1.1.2", + "laravel-vite-plugin": "^0.8.0", + "postcss": "^8.4.6", + "tailwindcss": "^3.1.0", + "vite": "^4.0.0" + } +} diff --git a/phpunit.xml b/phpunit.xml new file mode 100644 index 00000000..f112c0c8 --- /dev/null +++ b/phpunit.xml @@ -0,0 +1,31 @@ + + + + + tests/Unit + + + tests/Feature + + + + + app + + + + + + + + + + + + + + diff --git a/postcss.config.js b/postcss.config.js new file mode 100644 index 00000000..49c0612d --- /dev/null +++ b/postcss.config.js @@ -0,0 +1,6 @@ +export default { + plugins: { + tailwindcss: {}, + autoprefixer: {}, + }, +}; diff --git a/public/.htaccess b/public/.htaccess new file mode 100644 index 00000000..3aec5e27 --- /dev/null +++ b/public/.htaccess @@ -0,0 +1,21 @@ + + + Options -MultiViews -Indexes + + + RewriteEngine On + + # Handle Authorization Header + RewriteCond %{HTTP:Authorization} . + RewriteRule .* - [E=HTTP_AUTHORIZATION:%{HTTP:Authorization}] + + # Redirect Trailing Slashes If Not A Folder... + RewriteCond %{REQUEST_FILENAME} !-d + RewriteCond %{REQUEST_URI} (.+)/$ + RewriteRule ^ %1 [L,R=301] + + # Send Requests To Front Controller... + RewriteCond %{REQUEST_FILENAME} !-d + RewriteCond %{REQUEST_FILENAME} !-f + RewriteRule ^ index.php [L] + diff --git a/public/avatar.png b/public/avatar.png new file mode 100644 index 00000000..95a2e612 Binary files /dev/null and b/public/avatar.png differ diff --git a/public/build/assets/app-71d69702.css b/public/build/assets/app-71d69702.css new file mode 100644 index 00000000..a0fdaea5 --- /dev/null +++ b/public/build/assets/app-71d69702.css @@ -0,0 +1 @@ +@import"https://fonts.googleapis.com/css2?family=Kanit:ital,wght@0,100;0,200;0,300;0,400;0,500;0,600;0,700;0,800;0,900;1,100;1,200;1,300;1,400;1,500;1,600;1,700;1,800;1,900&family=Martian+Mono:wght@100;200;300;400;500;600;700;800&display=swap";*,:before,:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:#e5e7eb}:before,:after{--tw-content: ""}html{line-height:1.5;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4;font-family:Kanit,ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji";font-feature-settings:normal;font-variation-settings:normal}body{margin:0;line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}button,input,optgroup,select,textarea{font-family:inherit;font-feature-settings:inherit;font-variation-settings:inherit;font-size:100%;font-weight:inherit;line-height:inherit;color:inherit;margin:0;padding:0}button,select{text-transform:none}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button;background-color:transparent;background-image:none}:-moz-focusring{outline:auto}:-moz-ui-invalid{box-shadow:none}progress{vertical-align:baseline}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}summary{display:list-item}blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre{margin:0}fieldset{margin:0;padding:0}legend{padding:0}ol,ul,menu{list-style:none;margin:0;padding:0}dialog{padding:0}textarea{resize:vertical}input::-moz-placeholder,textarea::-moz-placeholder{opacity:1;color:#9ca3af}input::placeholder,textarea::placeholder{opacity:1;color:#9ca3af}button,[role=button]{cursor:pointer}:disabled{cursor:default}img,svg,video,canvas,audio,iframe,embed,object{display:block;vertical-align:middle}img,video{max-width:100%;height:auto}[hidden]{display:none}[type=text],input:where(:not([type])),[type=email],[type=url],[type=password],[type=number],[type=date],[type=datetime-local],[type=month],[type=search],[type=tel],[type=time],[type=week],[multiple],textarea,select{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:#fff;border-color:#6b7280;border-width:1px;border-radius:0;padding:.5rem .75rem;font-size:1rem;line-height:1.5rem;--tw-shadow: 0 0 #0000}[type=text]:focus,input:where(:not([type])):focus,[type=email]:focus,[type=url]:focus,[type=password]:focus,[type=number]:focus,[type=date]:focus,[type=datetime-local]:focus,[type=month]:focus,[type=search]:focus,[type=tel]:focus,[type=time]:focus,[type=week]:focus,[multiple]:focus,textarea:focus,select:focus{outline:2px solid transparent;outline-offset:2px;--tw-ring-inset: var(--tw-empty, );--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: #2563eb;--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow);border-color:#2563eb}input::-moz-placeholder,textarea::-moz-placeholder{color:#6b7280;opacity:1}input::placeholder,textarea::placeholder{color:#6b7280;opacity:1}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-date-and-time-value{min-height:1.5em;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit,::-webkit-datetime-edit-year-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute-field,::-webkit-datetime-edit-second-field,::-webkit-datetime-edit-millisecond-field,::-webkit-datetime-edit-meridiem-field{padding-top:0;padding-bottom:0}select{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='none' viewBox='0 0 20 20'%3e%3cpath stroke='%236b7280' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M6 8l4 4 4-4'/%3e%3c/svg%3e");background-position:right .5rem center;background-repeat:no-repeat;background-size:1.5em 1.5em;padding-right:2.5rem;-webkit-print-color-adjust:exact;print-color-adjust:exact}[multiple],[size]:where(select:not([size="1"])){background-image:initial;background-position:initial;background-repeat:unset;background-size:initial;padding-right:.75rem;-webkit-print-color-adjust:unset;print-color-adjust:unset}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:0;-webkit-print-color-adjust:exact;print-color-adjust:exact;display:inline-block;vertical-align:middle;background-origin:border-box;-webkit-user-select:none;-moz-user-select:none;user-select:none;flex-shrink:0;height:1rem;width:1rem;color:#2563eb;background-color:#fff;border-color:#6b7280;border-width:1px;--tw-shadow: 0 0 #0000}[type=checkbox]{border-radius:0}[type=radio]{border-radius:100%}[type=checkbox]:focus,[type=radio]:focus{outline:2px solid transparent;outline-offset:2px;--tw-ring-inset: var(--tw-empty, );--tw-ring-offset-width: 2px;--tw-ring-offset-color: #fff;--tw-ring-color: #2563eb;--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}[type=checkbox]:checked,[type=radio]:checked{border-color:transparent;background-color:currentColor;background-size:100% 100%;background-position:center;background-repeat:no-repeat}[type=checkbox]:checked{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 16 16' fill='white' xmlns='http://www.w3.org/2000/svg'%3e%3cpath d='M12.207 4.793a1 1 0 010 1.414l-5 5a1 1 0 01-1.414 0l-2-2a1 1 0 011.414-1.414L6.5 9.086l4.293-4.293a1 1 0 011.414 0z'/%3e%3c/svg%3e")}[type=radio]:checked{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 16 16' fill='white' xmlns='http://www.w3.org/2000/svg'%3e%3ccircle cx='8' cy='8' r='3'/%3e%3c/svg%3e")}[type=checkbox]:checked:hover,[type=checkbox]:checked:focus,[type=radio]:checked:hover,[type=radio]:checked:focus{border-color:transparent;background-color:currentColor}[type=checkbox]:indeterminate{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='none' viewBox='0 0 16 16'%3e%3cpath stroke='white' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M4 8h8'/%3e%3c/svg%3e");border-color:transparent;background-color:currentColor;background-size:100% 100%;background-position:center;background-repeat:no-repeat}[type=checkbox]:indeterminate:hover,[type=checkbox]:indeterminate:focus{border-color:transparent;background-color:currentColor}[type=file]{background:unset;border-color:inherit;border-width:0;border-radius:0;padding:0;font-size:unset;line-height:inherit}[type=file]:focus{outline:1px solid ButtonText;outline:1px auto -webkit-focus-ring-color}*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }.fixed{position:fixed}.absolute{position:absolute}.relative{position:relative}.inset-0{top:0;right:0;bottom:0;left:0}.left-0{left:0}.right-0{right:0}.z-0{z-index:0}.z-50{z-index:50}.float-left{float:left}.mx-3{margin-left:.75rem;margin-right:.75rem}.mx-auto{margin-left:auto;margin-right:auto}.-ml-px{margin-left:-1px}.-mr-2{margin-right:-.5rem}.mb-0{margin-bottom:0}.mb-0\.5{margin-bottom:.125rem}.mb-1{margin-bottom:.25rem}.mb-1\.5{margin-bottom:.375rem}.mb-2{margin-bottom:.5rem}.mb-4{margin-bottom:1rem}.mb-6{margin-bottom:1.5rem}.ml-1{margin-left:.25rem}.ml-2{margin-left:.5rem}.ml-3{margin-left:.75rem}.ml-4{margin-left:1rem}.ml-6{margin-left:1.5rem}.mr-2{margin-right:.5rem}.mr-6{margin-right:1.5rem}.mr-7{margin-right:1.75rem}.mt-1{margin-top:.25rem}.mt-1\.5{margin-top:.375rem}.mt-2{margin-top:.5rem}.mt-3{margin-top:.75rem}.mt-4{margin-top:1rem}.mt-5{margin-top:1.25rem}.mt-6{margin-top:1.5rem}.mt-7{margin-top:1.75rem}.block{display:block}.flex{display:flex}.inline-flex{display:inline-flex}.table{display:table}.grid{display:grid}.hidden{display:none}.h-16{height:4rem}.h-20{height:5rem}.h-4{height:1rem}.h-5{height:1.25rem}.h-6{height:1.5rem}.h-64{height:16rem}.h-9{height:2.25rem}.min-h-screen{min-height:100vh}.w-20{width:5rem}.w-28{width:7rem}.w-4{width:1rem}.w-48{width:12rem}.w-5{width:1.25rem}.w-56{width:14rem}.w-6{width:1.5rem}.w-auto{width:auto}.w-full{width:100%}.max-w-7xl{max-width:80rem}.flex-1{flex:1 1 0%}.shrink-0{flex-shrink:0}.border-collapse{border-collapse:collapse}.origin-top{transform-origin:top}.origin-top-left{transform-origin:top left}.origin-top-right{transform-origin:top right}.translate-y-0{--tw-translate-y: 0px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.translate-y-4{--tw-translate-y: 1rem;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scale-100{--tw-scale-x: 1;--tw-scale-y: 1;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scale-95{--tw-scale-x: .95;--tw-scale-y: .95;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.cursor-default{cursor:default}.grid-cols-1{grid-template-columns:repeat(1,minmax(0,1fr))}.flex-col{flex-direction:column}.items-center{align-items:center}.justify-end{justify-content:flex-end}.justify-center{justify-content:center}.justify-between{justify-content:space-between}.justify-items-center{justify-items:center}.gap-3{gap:.75rem}.space-x-8>:not([hidden])~:not([hidden]){--tw-space-x-reverse: 0;margin-right:calc(2rem * var(--tw-space-x-reverse));margin-left:calc(2rem * calc(1 - var(--tw-space-x-reverse)))}.space-y-1>:not([hidden])~:not([hidden]){--tw-space-y-reverse: 0;margin-top:calc(.25rem * calc(1 - var(--tw-space-y-reverse)));margin-bottom:calc(.25rem * var(--tw-space-y-reverse))}.overflow-hidden{overflow:hidden}.overflow-y-auto{overflow-y:auto}.overflow-y-hidden{overflow-y:hidden}.whitespace-nowrap{white-space:nowrap}.rounded{border-radius:.25rem}.rounded-full{border-radius:9999px}.rounded-lg{border-radius:.5rem}.rounded-md{border-radius:.375rem}.rounded-sm{border-radius:.125rem}.rounded-l-md{border-top-left-radius:.375rem;border-bottom-left-radius:.375rem}.rounded-r-md{border-top-right-radius:.375rem;border-bottom-right-radius:.375rem}.border{border-width:1px}.border-b{border-bottom-width:1px}.border-b-2{border-bottom-width:2px}.border-l-4{border-left-width:4px}.border-t{border-top-width:1px}.border-gray-100{--tw-border-opacity: 1;border-color:rgb(243 244 246 / var(--tw-border-opacity))}.border-gray-200{--tw-border-opacity: 1;border-color:rgb(229 231 235 / var(--tw-border-opacity))}.border-gray-300{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity))}.border-gray-400{--tw-border-opacity: 1;border-color:rgb(156 163 175 / var(--tw-border-opacity))}.border-indigo-400{--tw-border-opacity: 1;border-color:rgb(129 140 248 / var(--tw-border-opacity))}.border-transparent{border-color:transparent}.bg-cyan-700{--tw-bg-opacity: 1;background-color:rgb(14 116 144 / var(--tw-bg-opacity))}.bg-emerald-700{--tw-bg-opacity: 1;background-color:rgb(4 120 87 / var(--tw-bg-opacity))}.bg-gray-100{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity))}.bg-gray-500{--tw-bg-opacity: 1;background-color:rgb(107 114 128 / var(--tw-bg-opacity))}.bg-gray-800{--tw-bg-opacity: 1;background-color:rgb(31 41 55 / var(--tw-bg-opacity))}.bg-indigo-50{--tw-bg-opacity: 1;background-color:rgb(238 242 255 / var(--tw-bg-opacity))}.bg-red-600{--tw-bg-opacity: 1;background-color:rgb(220 38 38 / var(--tw-bg-opacity))}.bg-red-900{--tw-bg-opacity: 1;background-color:rgb(127 29 29 / var(--tw-bg-opacity))}.bg-slate-50{--tw-bg-opacity: 1;background-color:rgb(248 250 252 / var(--tw-bg-opacity))}.bg-teal-700{--tw-bg-opacity: 1;background-color:rgb(15 118 110 / var(--tw-bg-opacity))}.bg-white{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity))}.fill-current{fill:currentColor}.p-2{padding:.5rem}.p-4{padding:1rem}.p-6{padding:1.5rem}.px-1{padding-left:.25rem;padding-right:.25rem}.px-2{padding-left:.5rem;padding-right:.5rem}.px-3{padding-left:.75rem;padding-right:.75rem}.px-4{padding-left:1rem;padding-right:1rem}.px-6{padding-left:1.5rem;padding-right:1.5rem}.py-1{padding-top:.25rem;padding-bottom:.25rem}.py-12{padding-top:3rem;padding-bottom:3rem}.py-2{padding-top:.5rem;padding-bottom:.5rem}.py-4{padding-top:1rem;padding-bottom:1rem}.py-6{padding-top:1.5rem;padding-bottom:1.5rem}.py-7{padding-top:1.75rem;padding-bottom:1.75rem}.pb-1{padding-bottom:.25rem}.pb-1\.5{padding-bottom:.375rem}.pb-3{padding-bottom:.75rem}.pl-3{padding-left:.75rem}.pr-4{padding-right:1rem}.pt-1{padding-top:.25rem}.pt-2{padding-top:.5rem}.pt-4{padding-top:1rem}.pt-6{padding-top:1.5rem}.text-left{text-align:left}.font-martianmono{font-family:Martian Mono}.font-sans{font-family:Kanit,ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji"}.text-base{font-size:1rem;line-height:1.5rem}.text-lg{font-size:1.125rem;line-height:1.75rem}.text-sm{font-size:.875rem;line-height:1.25rem}.text-xl{font-size:1.25rem;line-height:1.75rem}.text-xs{font-size:.75rem;line-height:1rem}.font-bold{font-weight:700}.font-extralight{font-weight:200}.font-light{font-weight:300}.font-medium{font-weight:500}.font-normal{font-weight:400}.font-semibold{font-weight:600}.uppercase{text-transform:uppercase}.italic{font-style:italic}.leading-4{line-height:1rem}.leading-5{line-height:1.25rem}.leading-tight{line-height:1.25}.tracking-widest{letter-spacing:.1em}.text-cyan-800{--tw-text-opacity: 1;color:rgb(21 94 117 / var(--tw-text-opacity))}.text-gray-400{--tw-text-opacity: 1;color:rgb(156 163 175 / var(--tw-text-opacity))}.text-gray-50{--tw-text-opacity: 1;color:rgb(249 250 251 / var(--tw-text-opacity))}.text-gray-500{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity))}.text-gray-600{--tw-text-opacity: 1;color:rgb(75 85 99 / var(--tw-text-opacity))}.text-gray-700{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity))}.text-gray-800{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity))}.text-gray-900{--tw-text-opacity: 1;color:rgb(17 24 39 / var(--tw-text-opacity))}.text-gray-950{--tw-text-opacity: 1;color:rgb(3 7 18 / var(--tw-text-opacity))}.text-green-600{--tw-text-opacity: 1;color:rgb(22 163 74 / var(--tw-text-opacity))}.text-indigo-600{--tw-text-opacity: 1;color:rgb(79 70 229 / var(--tw-text-opacity))}.text-indigo-700{--tw-text-opacity: 1;color:rgb(67 56 202 / var(--tw-text-opacity))}.text-pink-950{--tw-text-opacity: 1;color:rgb(80 7 36 / var(--tw-text-opacity))}.text-red-600{--tw-text-opacity: 1;color:rgb(220 38 38 / var(--tw-text-opacity))}.text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity))}.underline{text-decoration-line:underline}.antialiased{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.opacity-0{opacity:0}.opacity-100{opacity:1}.opacity-75{opacity:.75}.shadow{--tw-shadow: 0 1px 3px 0 rgb(0 0 0 / .1), 0 1px 2px -1px rgb(0 0 0 / .1);--tw-shadow-colored: 0 1px 3px 0 var(--tw-shadow-color), 0 1px 2px -1px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-lg{--tw-shadow: 0 10px 15px -3px rgb(0 0 0 / .1), 0 4px 6px -4px rgb(0 0 0 / .1);--tw-shadow-colored: 0 10px 15px -3px var(--tw-shadow-color), 0 4px 6px -4px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-md{--tw-shadow: 0 4px 6px -1px rgb(0 0 0 / .1), 0 2px 4px -2px rgb(0 0 0 / .1);--tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-sm{--tw-shadow: 0 1px 2px 0 rgb(0 0 0 / .05);--tw-shadow-colored: 0 1px 2px 0 var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-xl{--tw-shadow: 0 20px 25px -5px rgb(0 0 0 / .1), 0 8px 10px -6px rgb(0 0 0 / .1);--tw-shadow-colored: 0 20px 25px -5px var(--tw-shadow-color), 0 8px 10px -6px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.ring-1{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.ring-black{--tw-ring-opacity: 1;--tw-ring-color: rgb(0 0 0 / var(--tw-ring-opacity))}.ring-gray-300{--tw-ring-opacity: 1;--tw-ring-color: rgb(209 213 219 / var(--tw-ring-opacity))}.ring-opacity-5{--tw-ring-opacity: .05}.filter{filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.transition{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,-webkit-backdrop-filter;transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter;transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter,-webkit-backdrop-filter;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.transition-all{transition-property:all;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.duration-150{transition-duration:.15s}.duration-200{transition-duration:.2s}.duration-300{transition-duration:.3s}.duration-75{transition-duration:75ms}.ease-in{transition-timing-function:cubic-bezier(.4,0,1,1)}.ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}.ease-out{transition-timing-function:cubic-bezier(0,0,.2,1)}.hover\:border-gray-300:hover{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity))}.hover\:bg-gray-100:hover{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity))}.hover\:bg-gray-50:hover{--tw-bg-opacity: 1;background-color:rgb(249 250 251 / var(--tw-bg-opacity))}.hover\:bg-gray-700:hover{--tw-bg-opacity: 1;background-color:rgb(55 65 81 / var(--tw-bg-opacity))}.hover\:bg-red-500:hover{--tw-bg-opacity: 1;background-color:rgb(239 68 68 / var(--tw-bg-opacity))}.hover\:text-gray-400:hover{--tw-text-opacity: 1;color:rgb(156 163 175 / var(--tw-text-opacity))}.hover\:text-gray-500:hover{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity))}.hover\:text-gray-700:hover{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity))}.hover\:text-gray-800:hover{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity))}.hover\:text-gray-900:hover{--tw-text-opacity: 1;color:rgb(17 24 39 / var(--tw-text-opacity))}.hover\:underline:hover{text-decoration-line:underline}.focus\:z-10:focus{z-index:10}.focus\:border-blue-300:focus{--tw-border-opacity: 1;border-color:rgb(147 197 253 / var(--tw-border-opacity))}.focus\:border-gray-300:focus{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity))}.focus\:border-gray-900:focus{--tw-border-opacity: 1;border-color:rgb(17 24 39 / var(--tw-border-opacity))}.focus\:border-indigo-300:focus{--tw-border-opacity: 1;border-color:rgb(165 180 252 / var(--tw-border-opacity))}.focus\:border-indigo-500:focus{--tw-border-opacity: 1;border-color:rgb(99 102 241 / var(--tw-border-opacity))}.focus\:border-indigo-700:focus{--tw-border-opacity: 1;border-color:rgb(67 56 202 / var(--tw-border-opacity))}.focus\:bg-gray-100:focus{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity))}.focus\:bg-gray-50:focus{--tw-bg-opacity: 1;background-color:rgb(249 250 251 / var(--tw-bg-opacity))}.focus\:bg-gray-700:focus{--tw-bg-opacity: 1;background-color:rgb(55 65 81 / var(--tw-bg-opacity))}.focus\:bg-indigo-100:focus{--tw-bg-opacity: 1;background-color:rgb(224 231 255 / var(--tw-bg-opacity))}.focus\:text-gray-500:focus{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity))}.focus\:text-gray-700:focus{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity))}.focus\:text-gray-800:focus{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity))}.focus\:text-indigo-800:focus{--tw-text-opacity: 1;color:rgb(55 48 163 / var(--tw-text-opacity))}.focus\:outline-none:focus{outline:2px solid transparent;outline-offset:2px}.focus\:ring:focus{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(3px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.focus\:ring-2:focus{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.focus\:ring-indigo-200:focus{--tw-ring-opacity: 1;--tw-ring-color: rgb(199 210 254 / var(--tw-ring-opacity))}.focus\:ring-indigo-500:focus{--tw-ring-opacity: 1;--tw-ring-color: rgb(99 102 241 / var(--tw-ring-opacity))}.focus\:ring-red-500:focus{--tw-ring-opacity: 1;--tw-ring-color: rgb(239 68 68 / var(--tw-ring-opacity))}.focus\:ring-opacity-50:focus{--tw-ring-opacity: .5}.focus\:ring-offset-2:focus{--tw-ring-offset-width: 2px}.active\:bg-gray-100:active{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity))}.active\:bg-gray-900:active{--tw-bg-opacity: 1;background-color:rgb(17 24 39 / var(--tw-bg-opacity))}.active\:bg-red-700:active{--tw-bg-opacity: 1;background-color:rgb(185 28 28 / var(--tw-bg-opacity))}.active\:text-gray-500:active{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity))}.active\:text-gray-700:active{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity))}.disabled\:opacity-25:disabled{opacity:.25}@media (min-width: 640px){.sm\:-my-px{margin-top:-1px;margin-bottom:-1px}.sm\:mx-auto{margin-left:auto;margin-right:auto}.sm\:ml-0{margin-left:0}.sm\:ml-10{margin-left:2.5rem}.sm\:ml-6{margin-left:1.5rem}.sm\:flex{display:flex}.sm\:hidden{display:none}.sm\:w-full{width:100%}.sm\:max-w-2xl{max-width:42rem}.sm\:max-w-lg{max-width:32rem}.sm\:max-w-md{max-width:28rem}.sm\:max-w-sm{max-width:24rem}.sm\:max-w-xl{max-width:36rem}.sm\:flex-1{flex:1 1 0%}.sm\:translate-y-0{--tw-translate-y: 0px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.sm\:scale-100{--tw-scale-x: 1;--tw-scale-y: 1;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.sm\:scale-95{--tw-scale-x: .95;--tw-scale-y: .95;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.sm\:grid-cols-2{grid-template-columns:repeat(2,minmax(0,1fr))}.sm\:items-center{align-items:center}.sm\:justify-center{justify-content:center}.sm\:justify-between{justify-content:space-between}.sm\:rounded-lg{border-radius:.5rem}.sm\:px-0{padding-left:0;padding-right:0}.sm\:px-6{padding-left:1.5rem;padding-right:1.5rem}.sm\:pt-0{padding-top:0}}@media (min-width: 768px){.md\:grid-cols-3{grid-template-columns:repeat(3,minmax(0,1fr))}}@media (min-width: 1024px){.lg\:grid-cols-4{grid-template-columns:repeat(4,minmax(0,1fr))}.lg\:px-8{padding-left:2rem;padding-right:2rem}}@media (min-width: 1280px){.xl\:grid-cols-5{grid-template-columns:repeat(5,minmax(0,1fr))}}@media (min-width: 1536px){.\32xl\:grid-cols-6{grid-template-columns:repeat(6,minmax(0,1fr))}} diff --git a/public/build/assets/app-7c0572f8.js b/public/build/assets/app-7c0572f8.js new file mode 100644 index 00000000..d3a4ebbe --- /dev/null +++ b/public/build/assets/app-7c0572f8.js @@ -0,0 +1,9 @@ +function xn(e,t){return function(){return e.apply(t,arguments)}}const{toString:Qr}=Object.prototype,{getPrototypeOf:wt}=Object,Ne=(e=>t=>{const n=Qr.call(t);return e[n]||(e[n]=n.slice(8,-1).toLowerCase())})(Object.create(null)),F=e=>(e=e.toLowerCase(),t=>Ne(t)===e),Me=e=>t=>typeof t===e,{isArray:Q}=Array,le=Me("undefined");function Zr(e){return e!==null&&!le(e)&&e.constructor!==null&&!le(e.constructor)&&C(e.constructor.isBuffer)&&e.constructor.isBuffer(e)}const wn=F("ArrayBuffer");function ei(e){let t;return typeof ArrayBuffer<"u"&&ArrayBuffer.isView?t=ArrayBuffer.isView(e):t=e&&e.buffer&&wn(e.buffer),t}const ti=Me("string"),C=Me("function"),En=Me("number"),Fe=e=>e!==null&&typeof e=="object",ni=e=>e===!0||e===!1,Se=e=>{if(Ne(e)!=="object")return!1;const t=wt(e);return(t===null||t===Object.prototype||Object.getPrototypeOf(t)===null)&&!(Symbol.toStringTag in e)&&!(Symbol.iterator in e)},ri=F("Date"),ii=F("File"),si=F("Blob"),oi=F("FileList"),ai=e=>Fe(e)&&C(e.pipe),ci=e=>{let t;return e&&(typeof FormData=="function"&&e instanceof FormData||C(e.append)&&((t=Ne(e))==="formdata"||t==="object"&&C(e.toString)&&e.toString()==="[object FormData]"))},ui=F("URLSearchParams"),li=e=>e.trim?e.trim():e.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,"");function de(e,t,{allOwnKeys:n=!1}={}){if(e===null||typeof e>"u")return;let r,i;if(typeof e!="object"&&(e=[e]),Q(e))for(r=0,i=e.length;r0;)if(i=n[r],t===i.toLowerCase())return i;return null}const An=(()=>typeof globalThis<"u"?globalThis:typeof self<"u"?self:typeof window<"u"?window:global)(),vn=e=>!le(e)&&e!==An;function Qe(){const{caseless:e}=vn(this)&&this||{},t={},n=(r,i)=>{const s=e&&Sn(t,i)||i;Se(t[s])&&Se(r)?t[s]=Qe(t[s],r):Se(r)?t[s]=Qe({},r):Q(r)?t[s]=r.slice():t[s]=r};for(let r=0,i=arguments.length;r(de(t,(i,s)=>{n&&C(i)?e[s]=xn(i,n):e[s]=i},{allOwnKeys:r}),e),di=e=>(e.charCodeAt(0)===65279&&(e=e.slice(1)),e),pi=(e,t,n,r)=>{e.prototype=Object.create(t.prototype,r),e.prototype.constructor=e,Object.defineProperty(e,"super",{value:t.prototype}),n&&Object.assign(e.prototype,n)},hi=(e,t,n,r)=>{let i,s,o;const a={};if(t=t||{},e==null)return t;do{for(i=Object.getOwnPropertyNames(e),s=i.length;s-- >0;)o=i[s],(!r||r(o,e,t))&&!a[o]&&(t[o]=e[o],a[o]=!0);e=n!==!1&&wt(e)}while(e&&(!n||n(e,t))&&e!==Object.prototype);return t},_i=(e,t,n)=>{e=String(e),(n===void 0||n>e.length)&&(n=e.length),n-=t.length;const r=e.indexOf(t,n);return r!==-1&&r===n},mi=e=>{if(!e)return null;if(Q(e))return e;let t=e.length;if(!En(t))return null;const n=new Array(t);for(;t-- >0;)n[t]=e[t];return n},yi=(e=>t=>e&&t instanceof e)(typeof Uint8Array<"u"&&wt(Uint8Array)),gi=(e,t)=>{const r=(e&&e[Symbol.iterator]).call(e);let i;for(;(i=r.next())&&!i.done;){const s=i.value;t.call(e,s[0],s[1])}},bi=(e,t)=>{let n;const r=[];for(;(n=e.exec(t))!==null;)r.push(n);return r},xi=F("HTMLFormElement"),wi=e=>e.toLowerCase().replace(/[-_\s]([a-z\d])(\w*)/g,function(n,r,i){return r.toUpperCase()+i}),Gt=(({hasOwnProperty:e})=>(t,n)=>e.call(t,n))(Object.prototype),Ei=F("RegExp"),On=(e,t)=>{const n=Object.getOwnPropertyDescriptors(e),r={};de(n,(i,s)=>{let o;(o=t(i,s,e))!==!1&&(r[s]=o||i)}),Object.defineProperties(e,r)},Si=e=>{On(e,(t,n)=>{if(C(e)&&["arguments","caller","callee"].indexOf(n)!==-1)return!1;const r=e[n];if(C(r)){if(t.enumerable=!1,"writable"in t){t.writable=!1;return}t.set||(t.set=()=>{throw Error("Can not rewrite read-only method '"+n+"'")})}})},Ai=(e,t)=>{const n={},r=i=>{i.forEach(s=>{n[s]=!0})};return Q(e)?r(e):r(String(e).split(t)),n},vi=()=>{},Oi=(e,t)=>(e=+e,Number.isFinite(e)?e:t),ze="abcdefghijklmnopqrstuvwxyz",Xt="0123456789",Rn={DIGIT:Xt,ALPHA:ze,ALPHA_DIGIT:ze+ze.toUpperCase()+Xt},Ri=(e=16,t=Rn.ALPHA_DIGIT)=>{let n="";const{length:r}=t;for(;e--;)n+=t[Math.random()*r|0];return n};function Ci(e){return!!(e&&C(e.append)&&e[Symbol.toStringTag]==="FormData"&&e[Symbol.iterator])}const Ti=e=>{const t=new Array(10),n=(r,i)=>{if(Fe(r)){if(t.indexOf(r)>=0)return;if(!("toJSON"in r)){t[i]=r;const s=Q(r)?[]:{};return de(r,(o,a)=>{const u=n(o,i+1);!le(u)&&(s[a]=u)}),t[i]=void 0,s}}return r};return n(e,0)},Pi=F("AsyncFunction"),Ni=e=>e&&(Fe(e)||C(e))&&C(e.then)&&C(e.catch),f={isArray:Q,isArrayBuffer:wn,isBuffer:Zr,isFormData:ci,isArrayBufferView:ei,isString:ti,isNumber:En,isBoolean:ni,isObject:Fe,isPlainObject:Se,isUndefined:le,isDate:ri,isFile:ii,isBlob:si,isRegExp:Ei,isFunction:C,isStream:ai,isURLSearchParams:ui,isTypedArray:yi,isFileList:oi,forEach:de,merge:Qe,extend:fi,trim:li,stripBOM:di,inherits:pi,toFlatObject:hi,kindOf:Ne,kindOfTest:F,endsWith:_i,toArray:mi,forEachEntry:gi,matchAll:bi,isHTMLForm:xi,hasOwnProperty:Gt,hasOwnProp:Gt,reduceDescriptors:On,freezeMethods:Si,toObjectSet:Ai,toCamelCase:wi,noop:vi,toFiniteNumber:Oi,findKey:Sn,global:An,isContextDefined:vn,ALPHABET:Rn,generateString:Ri,isSpecCompliantForm:Ci,toJSONObject:Ti,isAsyncFn:Pi,isThenable:Ni};function g(e,t,n,r,i){Error.call(this),Error.captureStackTrace?Error.captureStackTrace(this,this.constructor):this.stack=new Error().stack,this.message=e,this.name="AxiosError",t&&(this.code=t),n&&(this.config=n),r&&(this.request=r),i&&(this.response=i)}f.inherits(g,Error,{toJSON:function(){return{message:this.message,name:this.name,description:this.description,number:this.number,fileName:this.fileName,lineNumber:this.lineNumber,columnNumber:this.columnNumber,stack:this.stack,config:f.toJSONObject(this.config),code:this.code,status:this.response&&this.response.status?this.response.status:null}}});const Cn=g.prototype,Tn={};["ERR_BAD_OPTION_VALUE","ERR_BAD_OPTION","ECONNABORTED","ETIMEDOUT","ERR_NETWORK","ERR_FR_TOO_MANY_REDIRECTS","ERR_DEPRECATED","ERR_BAD_RESPONSE","ERR_BAD_REQUEST","ERR_CANCELED","ERR_NOT_SUPPORT","ERR_INVALID_URL"].forEach(e=>{Tn[e]={value:e}});Object.defineProperties(g,Tn);Object.defineProperty(Cn,"isAxiosError",{value:!0});g.from=(e,t,n,r,i,s)=>{const o=Object.create(Cn);return f.toFlatObject(e,o,function(u){return u!==Error.prototype},a=>a!=="isAxiosError"),g.call(o,e.message,t,n,r,i),o.cause=e,o.name=e.name,s&&Object.assign(o,s),o};const Mi=null;function Ze(e){return f.isPlainObject(e)||f.isArray(e)}function Pn(e){return f.endsWith(e,"[]")?e.slice(0,-2):e}function Yt(e,t,n){return e?e.concat(t).map(function(i,s){return i=Pn(i),!n&&s?"["+i+"]":i}).join(n?".":""):t}function Fi(e){return f.isArray(e)&&!e.some(Ze)}const Li=f.toFlatObject(f,{},null,function(t){return/^is[A-Z]/.test(t)});function Le(e,t,n){if(!f.isObject(e))throw new TypeError("target must be an object");t=t||new FormData,n=f.toFlatObject(n,{metaTokens:!0,dots:!1,indexes:!1},!1,function(m,h){return!f.isUndefined(h[m])});const r=n.metaTokens,i=n.visitor||c,s=n.dots,o=n.indexes,u=(n.Blob||typeof Blob<"u"&&Blob)&&f.isSpecCompliantForm(t);if(!f.isFunction(i))throw new TypeError("visitor must be a function");function l(p){if(p===null)return"";if(f.isDate(p))return p.toISOString();if(!u&&f.isBlob(p))throw new g("Blob is not supported. Use a Buffer instead.");return f.isArrayBuffer(p)||f.isTypedArray(p)?u&&typeof Blob=="function"?new Blob([p]):Buffer.from(p):p}function c(p,m,h){let y=p;if(p&&!h&&typeof p=="object"){if(f.endsWith(m,"{}"))m=r?m:m.slice(0,-2),p=JSON.stringify(p);else if(f.isArray(p)&&Fi(p)||(f.isFileList(p)||f.endsWith(m,"[]"))&&(y=f.toArray(p)))return m=Pn(m),y.forEach(function(E,R){!(f.isUndefined(E)||E===null)&&t.append(o===!0?Yt([m],R,s):o===null?m:m+"[]",l(E))}),!1}return Ze(p)?!0:(t.append(Yt(h,m,s),l(p)),!1)}const d=[],_=Object.assign(Li,{defaultVisitor:c,convertValue:l,isVisitable:Ze});function b(p,m){if(!f.isUndefined(p)){if(d.indexOf(p)!==-1)throw Error("Circular reference detected in "+m.join("."));d.push(p),f.forEach(p,function(y,x){(!(f.isUndefined(y)||y===null)&&i.call(t,y,f.isString(x)?x.trim():x,m,_))===!0&&b(y,m?m.concat(x):[x])}),d.pop()}}if(!f.isObject(e))throw new TypeError("data must be an object");return b(e),t}function Qt(e){const t={"!":"%21","'":"%27","(":"%28",")":"%29","~":"%7E","%20":"+","%00":"\0"};return encodeURIComponent(e).replace(/[!'()~]|%20|%00/g,function(r){return t[r]})}function Et(e,t){this._pairs=[],e&&Le(e,this,t)}const Nn=Et.prototype;Nn.append=function(t,n){this._pairs.push([t,n])};Nn.toString=function(t){const n=t?function(r){return t.call(this,r,Qt)}:Qt;return this._pairs.map(function(i){return n(i[0])+"="+n(i[1])},"").join("&")};function Ii(e){return encodeURIComponent(e).replace(/%3A/gi,":").replace(/%24/g,"$").replace(/%2C/gi,",").replace(/%20/g,"+").replace(/%5B/gi,"[").replace(/%5D/gi,"]")}function Mn(e,t,n){if(!t)return e;const r=n&&n.encode||Ii,i=n&&n.serialize;let s;if(i?s=i(t,n):s=f.isURLSearchParams(t)?t.toString():new Et(t,n).toString(r),s){const o=e.indexOf("#");o!==-1&&(e=e.slice(0,o)),e+=(e.indexOf("?")===-1?"?":"&")+s}return e}class Bi{constructor(){this.handlers=[]}use(t,n,r){return this.handlers.push({fulfilled:t,rejected:n,synchronous:r?r.synchronous:!1,runWhen:r?r.runWhen:null}),this.handlers.length-1}eject(t){this.handlers[t]&&(this.handlers[t]=null)}clear(){this.handlers&&(this.handlers=[])}forEach(t){f.forEach(this.handlers,function(r){r!==null&&t(r)})}}const Zt=Bi,Fn={silentJSONParsing:!0,forcedJSONParsing:!0,clarifyTimeoutError:!1},ji=typeof URLSearchParams<"u"?URLSearchParams:Et,Di=typeof FormData<"u"?FormData:null,$i=typeof Blob<"u"?Blob:null,Ui=(()=>{let e;return typeof navigator<"u"&&((e=navigator.product)==="ReactNative"||e==="NativeScript"||e==="NS")?!1:typeof window<"u"&&typeof document<"u"})(),ki=(()=>typeof WorkerGlobalScope<"u"&&self instanceof WorkerGlobalScope&&typeof self.importScripts=="function")(),M={isBrowser:!0,classes:{URLSearchParams:ji,FormData:Di,Blob:$i},isStandardBrowserEnv:Ui,isStandardBrowserWebWorkerEnv:ki,protocols:["http","https","file","blob","url","data"]};function Hi(e,t){return Le(e,new M.classes.URLSearchParams,Object.assign({visitor:function(n,r,i,s){return M.isNode&&f.isBuffer(n)?(this.append(r,n.toString("base64")),!1):s.defaultVisitor.apply(this,arguments)}},t))}function qi(e){return f.matchAll(/\w+|\[(\w*)]/g,e).map(t=>t[0]==="[]"?"":t[1]||t[0])}function zi(e){const t={},n=Object.keys(e);let r;const i=n.length;let s;for(r=0;r=n.length;return o=!o&&f.isArray(i)?i.length:o,u?(f.hasOwnProp(i,o)?i[o]=[i[o],r]:i[o]=r,!a):((!i[o]||!f.isObject(i[o]))&&(i[o]=[]),t(n,r,i[o],s)&&f.isArray(i[o])&&(i[o]=zi(i[o])),!a)}if(f.isFormData(e)&&f.isFunction(e.entries)){const n={};return f.forEachEntry(e,(r,i)=>{t(qi(r),i,n,0)}),n}return null}function Ki(e,t,n){if(f.isString(e))try{return(t||JSON.parse)(e),f.trim(e)}catch(r){if(r.name!=="SyntaxError")throw r}return(n||JSON.stringify)(e)}const St={transitional:Fn,adapter:["xhr","http"],transformRequest:[function(t,n){const r=n.getContentType()||"",i=r.indexOf("application/json")>-1,s=f.isObject(t);if(s&&f.isHTMLForm(t)&&(t=new FormData(t)),f.isFormData(t))return i&&i?JSON.stringify(Ln(t)):t;if(f.isArrayBuffer(t)||f.isBuffer(t)||f.isStream(t)||f.isFile(t)||f.isBlob(t))return t;if(f.isArrayBufferView(t))return t.buffer;if(f.isURLSearchParams(t))return n.setContentType("application/x-www-form-urlencoded;charset=utf-8",!1),t.toString();let a;if(s){if(r.indexOf("application/x-www-form-urlencoded")>-1)return Hi(t,this.formSerializer).toString();if((a=f.isFileList(t))||r.indexOf("multipart/form-data")>-1){const u=this.env&&this.env.FormData;return Le(a?{"files[]":t}:t,u&&new u,this.formSerializer)}}return s||i?(n.setContentType("application/json",!1),Ki(t)):t}],transformResponse:[function(t){const n=this.transitional||St.transitional,r=n&&n.forcedJSONParsing,i=this.responseType==="json";if(t&&f.isString(t)&&(r&&!this.responseType||i)){const o=!(n&&n.silentJSONParsing)&&i;try{return JSON.parse(t)}catch(a){if(o)throw a.name==="SyntaxError"?g.from(a,g.ERR_BAD_RESPONSE,this,null,this.response):a}}return t}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,maxBodyLength:-1,env:{FormData:M.classes.FormData,Blob:M.classes.Blob},validateStatus:function(t){return t>=200&&t<300},headers:{common:{Accept:"application/json, text/plain, */*","Content-Type":void 0}}};f.forEach(["delete","get","head","post","put","patch"],e=>{St.headers[e]={}});const At=St,Ji=f.toObjectSet(["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"]),Wi=e=>{const t={};let n,r,i;return e&&e.split(` +`).forEach(function(o){i=o.indexOf(":"),n=o.substring(0,i).trim().toLowerCase(),r=o.substring(i+1).trim(),!(!n||t[n]&&Ji[n])&&(n==="set-cookie"?t[n]?t[n].push(r):t[n]=[r]:t[n]=t[n]?t[n]+", "+r:r)}),t},en=Symbol("internals");function re(e){return e&&String(e).trim().toLowerCase()}function Ae(e){return e===!1||e==null?e:f.isArray(e)?e.map(Ae):String(e)}function Vi(e){const t=Object.create(null),n=/([^\s,;=]+)\s*(?:=\s*([^,;]+))?/g;let r;for(;r=n.exec(e);)t[r[1]]=r[2];return t}const Gi=e=>/^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(e.trim());function Ke(e,t,n,r,i){if(f.isFunction(r))return r.call(this,t,n);if(i&&(t=n),!!f.isString(t)){if(f.isString(r))return t.indexOf(r)!==-1;if(f.isRegExp(r))return r.test(t)}}function Xi(e){return e.trim().toLowerCase().replace(/([a-z\d])(\w*)/g,(t,n,r)=>n.toUpperCase()+r)}function Yi(e,t){const n=f.toCamelCase(" "+t);["get","set","has"].forEach(r=>{Object.defineProperty(e,r+n,{value:function(i,s,o){return this[r].call(this,t,i,s,o)},configurable:!0})})}class Ie{constructor(t){t&&this.set(t)}set(t,n,r){const i=this;function s(a,u,l){const c=re(u);if(!c)throw new Error("header name must be a non-empty string");const d=f.findKey(i,c);(!d||i[d]===void 0||l===!0||l===void 0&&i[d]!==!1)&&(i[d||u]=Ae(a))}const o=(a,u)=>f.forEach(a,(l,c)=>s(l,c,u));return f.isPlainObject(t)||t instanceof this.constructor?o(t,n):f.isString(t)&&(t=t.trim())&&!Gi(t)?o(Wi(t),n):t!=null&&s(n,t,r),this}get(t,n){if(t=re(t),t){const r=f.findKey(this,t);if(r){const i=this[r];if(!n)return i;if(n===!0)return Vi(i);if(f.isFunction(n))return n.call(this,i,r);if(f.isRegExp(n))return n.exec(i);throw new TypeError("parser must be boolean|regexp|function")}}}has(t,n){if(t=re(t),t){const r=f.findKey(this,t);return!!(r&&this[r]!==void 0&&(!n||Ke(this,this[r],r,n)))}return!1}delete(t,n){const r=this;let i=!1;function s(o){if(o=re(o),o){const a=f.findKey(r,o);a&&(!n||Ke(r,r[a],a,n))&&(delete r[a],i=!0)}}return f.isArray(t)?t.forEach(s):s(t),i}clear(t){const n=Object.keys(this);let r=n.length,i=!1;for(;r--;){const s=n[r];(!t||Ke(this,this[s],s,t,!0))&&(delete this[s],i=!0)}return i}normalize(t){const n=this,r={};return f.forEach(this,(i,s)=>{const o=f.findKey(r,s);if(o){n[o]=Ae(i),delete n[s];return}const a=t?Xi(s):String(s).trim();a!==s&&delete n[s],n[a]=Ae(i),r[a]=!0}),this}concat(...t){return this.constructor.concat(this,...t)}toJSON(t){const n=Object.create(null);return f.forEach(this,(r,i)=>{r!=null&&r!==!1&&(n[i]=t&&f.isArray(r)?r.join(", "):r)}),n}[Symbol.iterator](){return Object.entries(this.toJSON())[Symbol.iterator]()}toString(){return Object.entries(this.toJSON()).map(([t,n])=>t+": "+n).join(` +`)}get[Symbol.toStringTag](){return"AxiosHeaders"}static from(t){return t instanceof this?t:new this(t)}static concat(t,...n){const r=new this(t);return n.forEach(i=>r.set(i)),r}static accessor(t){const r=(this[en]=this[en]={accessors:{}}).accessors,i=this.prototype;function s(o){const a=re(o);r[a]||(Yi(i,o),r[a]=!0)}return f.isArray(t)?t.forEach(s):s(t),this}}Ie.accessor(["Content-Type","Content-Length","Accept","Accept-Encoding","User-Agent","Authorization"]);f.reduceDescriptors(Ie.prototype,({value:e},t)=>{let n=t[0].toUpperCase()+t.slice(1);return{get:()=>e,set(r){this[n]=r}}});f.freezeMethods(Ie);const L=Ie;function Je(e,t){const n=this||At,r=t||n,i=L.from(r.headers);let s=r.data;return f.forEach(e,function(a){s=a.call(n,s,i.normalize(),t?t.status:void 0)}),i.normalize(),s}function In(e){return!!(e&&e.__CANCEL__)}function pe(e,t,n){g.call(this,e??"canceled",g.ERR_CANCELED,t,n),this.name="CanceledError"}f.inherits(pe,g,{__CANCEL__:!0});function Qi(e,t,n){const r=n.config.validateStatus;!n.status||!r||r(n.status)?e(n):t(new g("Request failed with status code "+n.status,[g.ERR_BAD_REQUEST,g.ERR_BAD_RESPONSE][Math.floor(n.status/100)-4],n.config,n.request,n))}const Zi=M.isStandardBrowserEnv?function(){return{write:function(n,r,i,s,o,a){const u=[];u.push(n+"="+encodeURIComponent(r)),f.isNumber(i)&&u.push("expires="+new Date(i).toGMTString()),f.isString(s)&&u.push("path="+s),f.isString(o)&&u.push("domain="+o),a===!0&&u.push("secure"),document.cookie=u.join("; ")},read:function(n){const r=document.cookie.match(new RegExp("(^|;\\s*)("+n+")=([^;]*)"));return r?decodeURIComponent(r[3]):null},remove:function(n){this.write(n,"",Date.now()-864e5)}}}():function(){return{write:function(){},read:function(){return null},remove:function(){}}}();function es(e){return/^([a-z][a-z\d+\-.]*:)?\/\//i.test(e)}function ts(e,t){return t?e.replace(/\/+$/,"")+"/"+t.replace(/^\/+/,""):e}function Bn(e,t){return e&&!es(t)?ts(e,t):t}const ns=M.isStandardBrowserEnv?function(){const t=/(msie|trident)/i.test(navigator.userAgent),n=document.createElement("a");let r;function i(s){let o=s;return t&&(n.setAttribute("href",o),o=n.href),n.setAttribute("href",o),{href:n.href,protocol:n.protocol?n.protocol.replace(/:$/,""):"",host:n.host,search:n.search?n.search.replace(/^\?/,""):"",hash:n.hash?n.hash.replace(/^#/,""):"",hostname:n.hostname,port:n.port,pathname:n.pathname.charAt(0)==="/"?n.pathname:"/"+n.pathname}}return r=i(window.location.href),function(o){const a=f.isString(o)?i(o):o;return a.protocol===r.protocol&&a.host===r.host}}():function(){return function(){return!0}}();function rs(e){const t=/^([-+\w]{1,25})(:?\/\/|:)/.exec(e);return t&&t[1]||""}function is(e,t){e=e||10;const n=new Array(e),r=new Array(e);let i=0,s=0,o;return t=t!==void 0?t:1e3,function(u){const l=Date.now(),c=r[s];o||(o=l),n[i]=u,r[i]=l;let d=s,_=0;for(;d!==i;)_+=n[d++],d=d%e;if(i=(i+1)%e,i===s&&(s=(s+1)%e),l-o{const s=i.loaded,o=i.lengthComputable?i.total:void 0,a=s-n,u=r(a),l=s<=o;n=s;const c={loaded:s,total:o,progress:o?s/o:void 0,bytes:a,rate:u||void 0,estimated:u&&o&&l?(o-s)/u:void 0,event:i};c[t?"download":"upload"]=!0,e(c)}}const ss=typeof XMLHttpRequest<"u",os=ss&&function(e){return new Promise(function(n,r){let i=e.data;const s=L.from(e.headers).normalize(),o=e.responseType;let a;function u(){e.cancelToken&&e.cancelToken.unsubscribe(a),e.signal&&e.signal.removeEventListener("abort",a)}let l;f.isFormData(i)&&(M.isStandardBrowserEnv||M.isStandardBrowserWebWorkerEnv?s.setContentType(!1):s.getContentType(/^\s*multipart\/form-data/)?f.isString(l=s.getContentType())&&s.setContentType(l.replace(/^\s*(multipart\/form-data);+/,"$1")):s.setContentType("multipart/form-data"));let c=new XMLHttpRequest;if(e.auth){const p=e.auth.username||"",m=e.auth.password?unescape(encodeURIComponent(e.auth.password)):"";s.set("Authorization","Basic "+btoa(p+":"+m))}const d=Bn(e.baseURL,e.url);c.open(e.method.toUpperCase(),Mn(d,e.params,e.paramsSerializer),!0),c.timeout=e.timeout;function _(){if(!c)return;const p=L.from("getAllResponseHeaders"in c&&c.getAllResponseHeaders()),h={data:!o||o==="text"||o==="json"?c.responseText:c.response,status:c.status,statusText:c.statusText,headers:p,config:e,request:c};Qi(function(x){n(x),u()},function(x){r(x),u()},h),c=null}if("onloadend"in c?c.onloadend=_:c.onreadystatechange=function(){!c||c.readyState!==4||c.status===0&&!(c.responseURL&&c.responseURL.indexOf("file:")===0)||setTimeout(_)},c.onabort=function(){c&&(r(new g("Request aborted",g.ECONNABORTED,e,c)),c=null)},c.onerror=function(){r(new g("Network Error",g.ERR_NETWORK,e,c)),c=null},c.ontimeout=function(){let m=e.timeout?"timeout of "+e.timeout+"ms exceeded":"timeout exceeded";const h=e.transitional||Fn;e.timeoutErrorMessage&&(m=e.timeoutErrorMessage),r(new g(m,h.clarifyTimeoutError?g.ETIMEDOUT:g.ECONNABORTED,e,c)),c=null},M.isStandardBrowserEnv){const p=(e.withCredentials||ns(d))&&e.xsrfCookieName&&Zi.read(e.xsrfCookieName);p&&s.set(e.xsrfHeaderName,p)}i===void 0&&s.setContentType(null),"setRequestHeader"in c&&f.forEach(s.toJSON(),function(m,h){c.setRequestHeader(h,m)}),f.isUndefined(e.withCredentials)||(c.withCredentials=!!e.withCredentials),o&&o!=="json"&&(c.responseType=e.responseType),typeof e.onDownloadProgress=="function"&&c.addEventListener("progress",tn(e.onDownloadProgress,!0)),typeof e.onUploadProgress=="function"&&c.upload&&c.upload.addEventListener("progress",tn(e.onUploadProgress)),(e.cancelToken||e.signal)&&(a=p=>{c&&(r(!p||p.type?new pe(null,e,c):p),c.abort(),c=null)},e.cancelToken&&e.cancelToken.subscribe(a),e.signal&&(e.signal.aborted?a():e.signal.addEventListener("abort",a)));const b=rs(d);if(b&&M.protocols.indexOf(b)===-1){r(new g("Unsupported protocol "+b+":",g.ERR_BAD_REQUEST,e));return}c.send(i||null)})},et={http:Mi,xhr:os};f.forEach(et,(e,t)=>{if(e){try{Object.defineProperty(e,"name",{value:t})}catch{}Object.defineProperty(e,"adapterName",{value:t})}});const nn=e=>`- ${e}`,as=e=>f.isFunction(e)||e===null||e===!1,jn={getAdapter:e=>{e=f.isArray(e)?e:[e];const{length:t}=e;let n,r;const i={};for(let s=0;s`adapter ${a} `+(u===!1?"is not supported by the environment":"is not available in the build"));let o=t?s.length>1?`since : +`+s.map(nn).join(` +`):" "+nn(s[0]):"as no adapter specified";throw new g("There is no suitable adapter to dispatch the request "+o,"ERR_NOT_SUPPORT")}return r},adapters:et};function We(e){if(e.cancelToken&&e.cancelToken.throwIfRequested(),e.signal&&e.signal.aborted)throw new pe(null,e)}function rn(e){return We(e),e.headers=L.from(e.headers),e.data=Je.call(e,e.transformRequest),["post","put","patch"].indexOf(e.method)!==-1&&e.headers.setContentType("application/x-www-form-urlencoded",!1),jn.getAdapter(e.adapter||At.adapter)(e).then(function(r){return We(e),r.data=Je.call(e,e.transformResponse,r),r.headers=L.from(r.headers),r},function(r){return In(r)||(We(e),r&&r.response&&(r.response.data=Je.call(e,e.transformResponse,r.response),r.response.headers=L.from(r.response.headers))),Promise.reject(r)})}const sn=e=>e instanceof L?e.toJSON():e;function G(e,t){t=t||{};const n={};function r(l,c,d){return f.isPlainObject(l)&&f.isPlainObject(c)?f.merge.call({caseless:d},l,c):f.isPlainObject(c)?f.merge({},c):f.isArray(c)?c.slice():c}function i(l,c,d){if(f.isUndefined(c)){if(!f.isUndefined(l))return r(void 0,l,d)}else return r(l,c,d)}function s(l,c){if(!f.isUndefined(c))return r(void 0,c)}function o(l,c){if(f.isUndefined(c)){if(!f.isUndefined(l))return r(void 0,l)}else return r(void 0,c)}function a(l,c,d){if(d in t)return r(l,c);if(d in e)return r(void 0,l)}const u={url:s,method:s,data:s,baseURL:o,transformRequest:o,transformResponse:o,paramsSerializer:o,timeout:o,timeoutMessage:o,withCredentials:o,adapter:o,responseType:o,xsrfCookieName:o,xsrfHeaderName:o,onUploadProgress:o,onDownloadProgress:o,decompress:o,maxContentLength:o,maxBodyLength:o,beforeRedirect:o,transport:o,httpAgent:o,httpsAgent:o,cancelToken:o,socketPath:o,responseEncoding:o,validateStatus:a,headers:(l,c)=>i(sn(l),sn(c),!0)};return f.forEach(Object.keys(Object.assign({},e,t)),function(c){const d=u[c]||i,_=d(e[c],t[c],c);f.isUndefined(_)&&d!==a||(n[c]=_)}),n}const Dn="1.5.1",vt={};["object","boolean","number","function","string","symbol"].forEach((e,t)=>{vt[e]=function(r){return typeof r===e||"a"+(t<1?"n ":" ")+e}});const on={};vt.transitional=function(t,n,r){function i(s,o){return"[Axios v"+Dn+"] Transitional option '"+s+"'"+o+(r?". "+r:"")}return(s,o,a)=>{if(t===!1)throw new g(i(o," has been removed"+(n?" in "+n:"")),g.ERR_DEPRECATED);return n&&!on[o]&&(on[o]=!0,console.warn(i(o," has been deprecated since v"+n+" and will be removed in the near future"))),t?t(s,o,a):!0}};function cs(e,t,n){if(typeof e!="object")throw new g("options must be an object",g.ERR_BAD_OPTION_VALUE);const r=Object.keys(e);let i=r.length;for(;i-- >0;){const s=r[i],o=t[s];if(o){const a=e[s],u=a===void 0||o(a,s,e);if(u!==!0)throw new g("option "+s+" must be "+u,g.ERR_BAD_OPTION_VALUE);continue}if(n!==!0)throw new g("Unknown option "+s,g.ERR_BAD_OPTION)}}const tt={assertOptions:cs,validators:vt},B=tt.validators;class Re{constructor(t){this.defaults=t,this.interceptors={request:new Zt,response:new Zt}}request(t,n){typeof t=="string"?(n=n||{},n.url=t):n=t||{},n=G(this.defaults,n);const{transitional:r,paramsSerializer:i,headers:s}=n;r!==void 0&&tt.assertOptions(r,{silentJSONParsing:B.transitional(B.boolean),forcedJSONParsing:B.transitional(B.boolean),clarifyTimeoutError:B.transitional(B.boolean)},!1),i!=null&&(f.isFunction(i)?n.paramsSerializer={serialize:i}:tt.assertOptions(i,{encode:B.function,serialize:B.function},!0)),n.method=(n.method||this.defaults.method||"get").toLowerCase();let o=s&&f.merge(s.common,s[n.method]);s&&f.forEach(["delete","get","head","post","put","patch","common"],p=>{delete s[p]}),n.headers=L.concat(o,s);const a=[];let u=!0;this.interceptors.request.forEach(function(m){typeof m.runWhen=="function"&&m.runWhen(n)===!1||(u=u&&m.synchronous,a.unshift(m.fulfilled,m.rejected))});const l=[];this.interceptors.response.forEach(function(m){l.push(m.fulfilled,m.rejected)});let c,d=0,_;if(!u){const p=[rn.bind(this),void 0];for(p.unshift.apply(p,a),p.push.apply(p,l),_=p.length,c=Promise.resolve(n);d<_;)c=c.then(p[d++],p[d++]);return c}_=a.length;let b=n;for(d=0;d<_;){const p=a[d++],m=a[d++];try{b=p(b)}catch(h){m.call(this,h);break}}try{c=rn.call(this,b)}catch(p){return Promise.reject(p)}for(d=0,_=l.length;d<_;)c=c.then(l[d++],l[d++]);return c}getUri(t){t=G(this.defaults,t);const n=Bn(t.baseURL,t.url);return Mn(n,t.params,t.paramsSerializer)}}f.forEach(["delete","get","head","options"],function(t){Re.prototype[t]=function(n,r){return this.request(G(r||{},{method:t,url:n,data:(r||{}).data}))}});f.forEach(["post","put","patch"],function(t){function n(r){return function(s,o,a){return this.request(G(a||{},{method:t,headers:r?{"Content-Type":"multipart/form-data"}:{},url:s,data:o}))}}Re.prototype[t]=n(),Re.prototype[t+"Form"]=n(!0)});const ve=Re;class Ot{constructor(t){if(typeof t!="function")throw new TypeError("executor must be a function.");let n;this.promise=new Promise(function(s){n=s});const r=this;this.promise.then(i=>{if(!r._listeners)return;let s=r._listeners.length;for(;s-- >0;)r._listeners[s](i);r._listeners=null}),this.promise.then=i=>{let s;const o=new Promise(a=>{r.subscribe(a),s=a}).then(i);return o.cancel=function(){r.unsubscribe(s)},o},t(function(s,o,a){r.reason||(r.reason=new pe(s,o,a),n(r.reason))})}throwIfRequested(){if(this.reason)throw this.reason}subscribe(t){if(this.reason){t(this.reason);return}this._listeners?this._listeners.push(t):this._listeners=[t]}unsubscribe(t){if(!this._listeners)return;const n=this._listeners.indexOf(t);n!==-1&&this._listeners.splice(n,1)}static source(){let t;return{token:new Ot(function(i){t=i}),cancel:t}}}const us=Ot;function ls(e){return function(n){return e.apply(null,n)}}function fs(e){return f.isObject(e)&&e.isAxiosError===!0}const nt={Continue:100,SwitchingProtocols:101,Processing:102,EarlyHints:103,Ok:200,Created:201,Accepted:202,NonAuthoritativeInformation:203,NoContent:204,ResetContent:205,PartialContent:206,MultiStatus:207,AlreadyReported:208,ImUsed:226,MultipleChoices:300,MovedPermanently:301,Found:302,SeeOther:303,NotModified:304,UseProxy:305,Unused:306,TemporaryRedirect:307,PermanentRedirect:308,BadRequest:400,Unauthorized:401,PaymentRequired:402,Forbidden:403,NotFound:404,MethodNotAllowed:405,NotAcceptable:406,ProxyAuthenticationRequired:407,RequestTimeout:408,Conflict:409,Gone:410,LengthRequired:411,PreconditionFailed:412,PayloadTooLarge:413,UriTooLong:414,UnsupportedMediaType:415,RangeNotSatisfiable:416,ExpectationFailed:417,ImATeapot:418,MisdirectedRequest:421,UnprocessableEntity:422,Locked:423,FailedDependency:424,TooEarly:425,UpgradeRequired:426,PreconditionRequired:428,TooManyRequests:429,RequestHeaderFieldsTooLarge:431,UnavailableForLegalReasons:451,InternalServerError:500,NotImplemented:501,BadGateway:502,ServiceUnavailable:503,GatewayTimeout:504,HttpVersionNotSupported:505,VariantAlsoNegotiates:506,InsufficientStorage:507,LoopDetected:508,NotExtended:510,NetworkAuthenticationRequired:511};Object.entries(nt).forEach(([e,t])=>{nt[t]=e});const ds=nt;function $n(e){const t=new ve(e),n=xn(ve.prototype.request,t);return f.extend(n,ve.prototype,t,{allOwnKeys:!0}),f.extend(n,t,null,{allOwnKeys:!0}),n.create=function(i){return $n(G(e,i))},n}const S=$n(At);S.Axios=ve;S.CanceledError=pe;S.CancelToken=us;S.isCancel=In;S.VERSION=Dn;S.toFormData=Le;S.AxiosError=g;S.Cancel=S.CanceledError;S.all=function(t){return Promise.all(t)};S.spread=ls;S.isAxiosError=fs;S.mergeConfig=G;S.AxiosHeaders=L;S.formToJSON=e=>Ln(f.isHTMLForm(e)?new FormData(e):e);S.getAdapter=jn.getAdapter;S.HttpStatusCode=ds;S.default=S;const ps=S;window.axios=ps;window.axios.defaults.headers.common["X-Requested-With"]="XMLHttpRequest";var rt=!1,it=!1,z=[],st=-1;function hs(e){_s(e)}function _s(e){z.includes(e)||z.push(e),ms()}function Un(e){let t=z.indexOf(e);t!==-1&&t>st&&z.splice(t,1)}function ms(){!it&&!rt&&(rt=!0,queueMicrotask(ys))}function ys(){rt=!1,it=!0;for(let e=0;ee.effect(t,{scheduler:n=>{ot?hs(n):n()}}),kn=e.raw}function an(e){ee=e}function xs(e){let t=()=>{};return[r=>{let i=ee(r);return e._x_effects||(e._x_effects=new Set,e._x_runEffects=()=>{e._x_effects.forEach(s=>s())}),e._x_effects.add(i),t=()=>{i!==void 0&&(e._x_effects.delete(i),he(i))},i},()=>{t()}]}function ae(e,t,n={}){e.dispatchEvent(new CustomEvent(t,{detail:n,bubbles:!0,composed:!0,cancelable:!0}))}function D(e,t){if(typeof ShadowRoot=="function"&&e instanceof ShadowRoot){Array.from(e.children).forEach(i=>D(i,t));return}let n=!1;if(t(e,()=>n=!0),n)return;let r=e.firstElementChild;for(;r;)D(r,t),r=r.nextElementSibling}function $(e,...t){console.warn(`Alpine Warning: ${e}`,...t)}var cn=!1;function ws(){cn&&$("Alpine has already been initialized on this page. Calling Alpine.start() more than once can cause problems."),cn=!0,document.body||$("Unable to initialize. Trying to load Alpine before `` is available. Did you forget to add `defer` in Alpine's `