From 414c4774e472ce526e3875b51dde3fb0eb710635 Mon Sep 17 00:00:00 2001 From: Aziz Rourou <77583912+AzizRourou@users.noreply.github.com> Date: Fri, 7 May 2021 23:33:22 +0100 Subject: [PATCH] commit --- file.js | 272 + node_modules/.bin/detect-libc | 1 + node_modules/.bin/is-ci | 1 + node_modules/.bin/mime | 1 + node_modules/.bin/mkdirp | 1 + node_modules/.bin/node-pre-gyp | 1 + node_modules/.bin/nodemon | 1 + node_modules/.bin/nodetouch | 1 + node_modules/.bin/nopt | 1 + node_modules/.bin/rc | 1 + node_modules/.bin/rimraf | 1 + node_modules/.bin/semver | 1 + .../@mapbox/node-pre-gyp/CHANGELOG.md | 485 + node_modules/@mapbox/node-pre-gyp/LICENSE | 27 + node_modules/@mapbox/node-pre-gyp/README.md | 742 ++ .../@mapbox/node-pre-gyp/bin/node-pre-gyp | 4 + .../@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd | 2 + .../@mapbox/node-pre-gyp/contributing.md | 10 + .../@mapbox/node-pre-gyp/lib/build.js | 51 + .../@mapbox/node-pre-gyp/lib/clean.js | 31 + .../@mapbox/node-pre-gyp/lib/configure.js | 52 + node_modules/@mapbox/node-pre-gyp/lib/info.js | 38 + .../@mapbox/node-pre-gyp/lib/install.js | 235 + node_modules/@mapbox/node-pre-gyp/lib/main.js | 125 + .../@mapbox/node-pre-gyp/lib/node-pre-gyp.js | 304 + .../@mapbox/node-pre-gyp/lib/package.js | 73 + .../@mapbox/node-pre-gyp/lib/pre-binding.js | 34 + .../@mapbox/node-pre-gyp/lib/publish.js | 81 + .../@mapbox/node-pre-gyp/lib/rebuild.js | 20 + .../@mapbox/node-pre-gyp/lib/reinstall.js | 19 + .../@mapbox/node-pre-gyp/lib/reveal.js | 32 + .../@mapbox/node-pre-gyp/lib/testbinary.js | 79 + .../@mapbox/node-pre-gyp/lib/testpackage.js | 53 + .../@mapbox/node-pre-gyp/lib/unpublish.js | 41 + .../node-pre-gyp/lib/util/abi_crosswalk.json | 2454 +++++ .../@mapbox/node-pre-gyp/lib/util/compile.js | 93 + .../node-pre-gyp/lib/util/handle_gyp_opts.js | 102 + .../@mapbox/node-pre-gyp/lib/util/napi.js | 205 + .../lib/util/nw-pre-gyp/index.html | 26 + .../lib/util/nw-pre-gyp/package.json | 9 + .../@mapbox/node-pre-gyp/lib/util/s3_setup.js | 163 + .../node-pre-gyp/lib/util/versioning.js | 335 + .../node-pre-gyp/node_modules/.bin/nopt | 1 + .../node-pre-gyp/node_modules/.bin/semver | 1 + .../node_modules/nopt/CHANGELOG.md | 58 + .../node-pre-gyp/node_modules/nopt/LICENSE | 15 + .../node-pre-gyp/node_modules/nopt/README.md | 213 + .../node_modules/nopt/bin/nopt.js | 54 + .../node_modules/nopt/lib/nopt.js | 441 + .../node_modules/nopt/package.json | 67 + .../node_modules/semver/CHANGELOG.md | 111 + .../node-pre-gyp/node_modules/semver/LICENSE | 15 + .../node_modules/semver/README.md | 566 ++ .../node_modules/semver/bin/semver.js | 173 + .../node_modules/semver/classes/comparator.js | 135 + .../node_modules/semver/classes/index.js | 5 + .../node_modules/semver/classes/range.js | 510 + .../node_modules/semver/classes/semver.js | 287 + .../node_modules/semver/functions/clean.js | 6 + .../node_modules/semver/functions/cmp.js | 48 + .../node_modules/semver/functions/coerce.js | 51 + .../semver/functions/compare-build.js | 7 + .../semver/functions/compare-loose.js | 3 + .../node_modules/semver/functions/compare.js | 5 + .../node_modules/semver/functions/diff.js | 23 + .../node_modules/semver/functions/eq.js | 3 + .../node_modules/semver/functions/gt.js | 3 + .../node_modules/semver/functions/gte.js | 3 + .../node_modules/semver/functions/inc.js | 15 + .../node_modules/semver/functions/lt.js | 3 + .../node_modules/semver/functions/lte.js | 3 + .../node_modules/semver/functions/major.js | 3 + .../node_modules/semver/functions/minor.js | 3 + .../node_modules/semver/functions/neq.js | 3 + .../node_modules/semver/functions/parse.js | 33 + .../node_modules/semver/functions/patch.js | 3 + .../semver/functions/prerelease.js | 6 + .../node_modules/semver/functions/rcompare.js | 3 + .../node_modules/semver/functions/rsort.js | 3 + .../semver/functions/satisfies.js | 10 + .../node_modules/semver/functions/sort.js | 3 + .../node_modules/semver/functions/valid.js | 6 + .../node-pre-gyp/node_modules/semver/index.js | 48 + .../node_modules/semver/internal/constants.js | 17 + .../node_modules/semver/internal/debug.js | 9 + .../semver/internal/identifiers.js | 23 + .../semver/internal/parse-options.js | 11 + .../node_modules/semver/internal/re.js | 182 + .../node_modules/semver/package.json | 73 + .../node_modules/semver/preload.js | 2 + .../node_modules/semver/range.bnf | 16 + .../node_modules/semver/ranges/gtr.js | 4 + .../node_modules/semver/ranges/intersects.js | 7 + .../node_modules/semver/ranges/ltr.js | 4 + .../semver/ranges/max-satisfying.js | 25 + .../semver/ranges/min-satisfying.js | 24 + .../node_modules/semver/ranges/min-version.js | 60 + .../node_modules/semver/ranges/outside.js | 80 + .../node_modules/semver/ranges/simplify.js | 44 + .../node_modules/semver/ranges/subset.js | 222 + .../semver/ranges/to-comparators.js | 8 + .../node_modules/semver/ranges/valid.js | 11 + .../@mapbox/node-pre-gyp/package.json | 101 + node_modules/@sindresorhus/is/dist/index.d.ts | 132 + node_modules/@sindresorhus/is/dist/index.js | 245 + .../@sindresorhus/is/dist/index.js.map | 1 + node_modules/@sindresorhus/is/license | 9 + node_modules/@sindresorhus/is/package.json | 96 + node_modules/@sindresorhus/is/readme.md | 451 + node_modules/@szmarczak/http-timer/LICENSE | 21 + node_modules/@szmarczak/http-timer/README.md | 70 + .../@szmarczak/http-timer/package.json | 75 + .../@szmarczak/http-timer/source/index.js | 99 + node_modules/abbrev/LICENSE | 46 + node_modules/abbrev/README.md | 23 + node_modules/abbrev/abbrev.js | 61 + node_modules/abbrev/package.json | 56 + node_modules/accepts/HISTORY.md | 236 + node_modules/accepts/LICENSE | 23 + node_modules/accepts/README.md | 142 + node_modules/accepts/index.js | 238 + node_modules/accepts/package.json | 86 + node_modules/agent-base/README.md | 145 + node_modules/agent-base/dist/src/index.d.ts | 78 + node_modules/agent-base/dist/src/index.js | 203 + node_modules/agent-base/dist/src/index.js.map | 1 + .../agent-base/dist/src/promisify.d.ts | 4 + node_modules/agent-base/dist/src/promisify.js | 18 + .../agent-base/dist/src/promisify.js.map | 1 + .../agent-base/node_modules/debug/LICENSE | 19 + .../agent-base/node_modules/debug/README.md | 455 + .../node_modules/debug/package.json | 101 + .../node_modules/debug/src/browser.js | 269 + .../node_modules/debug/src/common.js | 261 + .../node_modules/debug/src/index.js | 10 + .../agent-base/node_modules/debug/src/node.js | 263 + .../agent-base/node_modules/ms/index.js | 162 + .../agent-base/node_modules/ms/license.md | 21 + .../agent-base/node_modules/ms/package.json | 69 + .../agent-base/node_modules/ms/readme.md | 60 + node_modules/agent-base/package.json | 94 + node_modules/agent-base/src/index.ts | 345 + node_modules/agent-base/src/promisify.ts | 33 + node_modules/ansi-align/CHANGELOG.md | 51 + node_modules/ansi-align/LICENSE | 13 + node_modules/ansi-align/README.md | 80 + node_modules/ansi-align/index.js | 61 + .../node_modules/string-width/index.js | 39 + .../node_modules/string-width/license | 9 + .../node_modules/string-width/package.json | 88 + .../node_modules/string-width/readme.md | 45 + node_modules/ansi-align/package.json | 74 + node_modules/ansi-regex/index.js | 14 + node_modules/ansi-regex/license | 9 + node_modules/ansi-regex/package.json | 85 + node_modules/ansi-regex/readme.md | 87 + node_modules/ansi-styles/index.d.ts | 345 + node_modules/ansi-styles/index.js | 163 + node_modules/ansi-styles/license | 9 + node_modules/ansi-styles/package.json | 88 + node_modules/ansi-styles/readme.md | 152 + node_modules/anymatch/LICENSE | 15 + node_modules/anymatch/README.md | 87 + node_modules/anymatch/index.d.ts | 19 + node_modules/anymatch/index.js | 104 + node_modules/anymatch/package.json | 76 + node_modules/aproba/LICENSE | 14 + node_modules/aproba/README.md | 94 + node_modules/aproba/index.js | 105 + node_modules/aproba/package.json | 62 + node_modules/are-we-there-yet/CHANGES.md | 37 + node_modules/are-we-there-yet/LICENSE | 5 + node_modules/are-we-there-yet/README.md | 195 + node_modules/are-we-there-yet/index.js | 4 + node_modules/are-we-there-yet/package.json | 63 + node_modules/are-we-there-yet/tracker-base.js | 11 + .../are-we-there-yet/tracker-group.js | 107 + .../are-we-there-yet/tracker-stream.js | 36 + node_modules/are-we-there-yet/tracker.js | 30 + node_modules/array-flatten/LICENSE | 21 + node_modules/array-flatten/README.md | 43 + node_modules/array-flatten/array-flatten.js | 64 + node_modules/array-flatten/package.json | 64 + .../balanced-match/.github/FUNDING.yml | 2 + node_modules/balanced-match/LICENSE.md | 21 + node_modules/balanced-match/README.md | 97 + node_modules/balanced-match/index.js | 62 + node_modules/balanced-match/package.json | 76 + node_modules/basic-auth/HISTORY.md | 52 + node_modules/basic-auth/LICENSE | 24 + node_modules/basic-auth/README.md | 113 + node_modules/basic-auth/index.js | 133 + node_modules/basic-auth/package.json | 73 + node_modules/bcrypt/.editorconfig | 19 + node_modules/bcrypt/.travis.yml | 63 + node_modules/bcrypt/CHANGELOG.md | 171 + node_modules/bcrypt/ISSUE_TEMPLATE.md | 18 + node_modules/bcrypt/LICENSE | 19 + node_modules/bcrypt/Makefile | 19 + node_modules/bcrypt/README.md | 374 + node_modules/bcrypt/SECURITY.md | 15 + node_modules/bcrypt/appveyor.yml | 50 + node_modules/bcrypt/bcrypt.js | 236 + node_modules/bcrypt/binding.gyp | 57 + node_modules/bcrypt/examples/async_compare.js | 21 + .../bcrypt/examples/forever_gen_salt.js | 8 + .../lib/binding/napi-v3/bcrypt_lib.node | Bin 0 -> 91768 bytes node_modules/bcrypt/package.json | 163 + node_modules/bcrypt/promises.js | 42 + node_modules/bcrypt/src/bcrypt.cc | 315 + node_modules/bcrypt/src/bcrypt_node.cc | 286 + node_modules/bcrypt/src/blowfish.cc | 679 ++ node_modules/bcrypt/src/node_blf.h | 132 + node_modules/bcrypt/test/async.js | 181 + node_modules/bcrypt/test/implementation.js | 53 + node_modules/bcrypt/test/promise.js | 252 + node_modules/bcrypt/test/repetitions.js | 118 + node_modules/bcrypt/test/sync.js | 137 + node_modules/bcrypt/test_alpine.sh | 12 + .../binary-extensions/binary-extensions.json | 260 + .../binary-extensions.json.d.ts | 3 + node_modules/binary-extensions/index.d.ts | 14 + node_modules/binary-extensions/index.js | 1 + node_modules/binary-extensions/license | 9 + node_modules/binary-extensions/package.json | 70 + node_modules/binary-extensions/readme.md | 41 + node_modules/body-parser/HISTORY.md | 609 ++ node_modules/body-parser/LICENSE | 23 + node_modules/body-parser/README.md | 443 + node_modules/body-parser/index.js | 157 + node_modules/body-parser/lib/read.js | 181 + node_modules/body-parser/lib/types/json.js | 230 + node_modules/body-parser/lib/types/raw.js | 101 + node_modules/body-parser/lib/types/text.js | 121 + .../body-parser/lib/types/urlencoded.js | 284 + node_modules/body-parser/package.json | 91 + node_modules/boxen/index.d.ts | 175 + node_modules/boxen/index.js | 139 + node_modules/boxen/license | 9 + node_modules/boxen/package.json | 83 + node_modules/boxen/readme.md | 187 + node_modules/brace-expansion/LICENSE | 21 + node_modules/brace-expansion/README.md | 129 + node_modules/brace-expansion/index.js | 201 + node_modules/brace-expansion/package.json | 75 + node_modules/braces/CHANGELOG.md | 184 + node_modules/braces/LICENSE | 21 + node_modules/braces/README.md | 593 ++ node_modules/braces/index.js | 170 + node_modules/braces/lib/compile.js | 57 + node_modules/braces/lib/constants.js | 57 + node_modules/braces/lib/expand.js | 113 + node_modules/braces/lib/parse.js | 333 + node_modules/braces/lib/stringify.js | 32 + node_modules/braces/lib/utils.js | 112 + node_modules/braces/package.json | 123 + .../buffer-equal-constant-time/.npmignore | 2 + .../buffer-equal-constant-time/.travis.yml | 4 + .../buffer-equal-constant-time/LICENSE.txt | 12 + .../buffer-equal-constant-time/README.md | 50 + .../buffer-equal-constant-time/index.js | 41 + .../buffer-equal-constant-time/package.json | 55 + .../buffer-equal-constant-time/test.js | 42 + node_modules/bytes/History.md | 87 + node_modules/bytes/LICENSE | 23 + node_modules/bytes/Readme.md | 126 + node_modules/bytes/index.js | 162 + node_modules/bytes/package.json | 84 + node_modules/cacheable-request/LICENSE | 21 + node_modules/cacheable-request/README.md | 206 + .../node_modules/get-stream/buffer-stream.js | 52 + .../node_modules/get-stream/index.d.ts | 108 + .../node_modules/get-stream/index.js | 60 + .../node_modules/get-stream/license | 9 + .../node_modules/get-stream/package.json | 82 + .../node_modules/get-stream/readme.md | 124 + .../node_modules/lowercase-keys/index.d.ts | 16 + .../node_modules/lowercase-keys/index.js | 10 + .../node_modules/lowercase-keys/license | 9 + .../node_modules/lowercase-keys/package.json | 70 + .../node_modules/lowercase-keys/readme.md | 32 + node_modules/cacheable-request/package.json | 94 + node_modules/cacheable-request/src/index.js | 251 + node_modules/camelcase/index.d.ts | 63 + node_modules/camelcase/index.js | 76 + node_modules/camelcase/license | 9 + node_modules/camelcase/package.json | 75 + node_modules/camelcase/readme.md | 99 + node_modules/chalk/index.d.ts | 411 + node_modules/chalk/license | 9 + .../chalk/node_modules/has-flag/index.d.ts | 39 + .../chalk/node_modules/has-flag/index.js | 8 + .../chalk/node_modules/has-flag/license | 9 + .../chalk/node_modules/has-flag/package.json | 78 + .../chalk/node_modules/has-flag/readme.md | 89 + .../node_modules/supports-color/browser.js | 5 + .../node_modules/supports-color/index.js | 135 + .../chalk/node_modules/supports-color/license | 9 + .../node_modules/supports-color/package.json | 85 + .../node_modules/supports-color/readme.md | 76 + node_modules/chalk/package.json | 96 + node_modules/chalk/readme.md | 304 + node_modules/chalk/source/index.js | 233 + node_modules/chalk/source/templates.js | 134 + node_modules/chalk/source/util.js | 39 + node_modules/chokidar/LICENSE | 21 + node_modules/chokidar/README.md | 307 + node_modules/chokidar/index.js | 967 ++ node_modules/chokidar/lib/constants.js | 63 + node_modules/chokidar/lib/fsevents-handler.js | 523 ++ node_modules/chokidar/lib/nodefs-handler.js | 646 ++ node_modules/chokidar/package.json | 112 + node_modules/chokidar/types/index.d.ts | 187 + node_modules/chownr/LICENSE | 15 + node_modules/chownr/README.md | 3 + node_modules/chownr/chownr.js | 167 + node_modules/chownr/package.json | 65 + node_modules/ci-info/CHANGELOG.md | 78 + node_modules/ci-info/LICENSE | 21 + node_modules/ci-info/README.md | 108 + node_modules/ci-info/index.js | 66 + node_modules/ci-info/package.json | 65 + node_modules/ci-info/vendors.json | 153 + node_modules/cli-boxes/boxes.json | 58 + node_modules/cli-boxes/index.d.ts | 113 + node_modules/cli-boxes/index.js | 6 + node_modules/cli-boxes/license | 9 + node_modules/cli-boxes/package.json | 74 + node_modules/cli-boxes/readme.md | 105 + node_modules/clone-response/LICENSE | 21 + node_modules/clone-response/README.md | 62 + node_modules/clone-response/package.json | 73 + node_modules/clone-response/src/index.js | 17 + node_modules/code-point-at/index.js | 32 + node_modules/code-point-at/license | 21 + node_modules/code-point-at/package.json | 70 + node_modules/code-point-at/readme.md | 32 + node_modules/color-convert/CHANGELOG.md | 54 + node_modules/color-convert/LICENSE | 21 + node_modules/color-convert/README.md | 68 + node_modules/color-convert/conversions.js | 839 ++ node_modules/color-convert/index.js | 81 + node_modules/color-convert/package.json | 83 + node_modules/color-convert/route.js | 97 + node_modules/color-name/LICENSE | 8 + node_modules/color-name/README.md | 11 + node_modules/color-name/index.js | 152 + node_modules/color-name/package.json | 56 + node_modules/concat-map/.travis.yml | 4 + node_modules/concat-map/LICENSE | 18 + node_modules/concat-map/README.markdown | 62 + node_modules/concat-map/example/map.js | 6 + node_modules/concat-map/index.js | 13 + node_modules/concat-map/package.json | 88 + node_modules/concat-map/test/map.js | 39 + node_modules/configstore/index.js | 109 + node_modules/configstore/license | 25 + node_modules/configstore/package.json | 78 + node_modules/configstore/readme.md | 141 + node_modules/console-control-strings/LICENSE | 13 + .../console-control-strings/README.md | 145 + .../console-control-strings/README.md~ | 140 + node_modules/console-control-strings/index.js | 125 + .../console-control-strings/package.json | 61 + node_modules/content-disposition/HISTORY.md | 55 + node_modules/content-disposition/LICENSE | 22 + node_modules/content-disposition/README.md | 148 + node_modules/content-disposition/index.js | 458 + node_modules/content-disposition/package.json | 79 + node_modules/content-type/HISTORY.md | 24 + node_modules/content-type/LICENSE | 22 + node_modules/content-type/README.md | 92 + node_modules/content-type/index.js | 222 + node_modules/content-type/package.json | 76 + node_modules/cookie-signature/.npmignore | 4 + node_modules/cookie-signature/History.md | 38 + node_modules/cookie-signature/Readme.md | 42 + node_modules/cookie-signature/index.js | 51 + node_modules/cookie-signature/package.json | 57 + node_modules/cookie/HISTORY.md | 123 + node_modules/cookie/LICENSE | 24 + node_modules/cookie/README.md | 253 + node_modules/cookie/index.js | 198 + node_modules/cookie/package.json | 78 + node_modules/core-util-is/LICENSE | 19 + node_modules/core-util-is/README.md | 3 + node_modules/core-util-is/float.patch | 604 ++ node_modules/core-util-is/lib/util.js | 107 + node_modules/core-util-is/package.json | 62 + node_modules/core-util-is/test.js | 68 + node_modules/crypto-random-string/index.d.ts | 17 + node_modules/crypto-random-string/index.js | 10 + node_modules/crypto-random-string/license | 9 + .../crypto-random-string/package.json | 72 + node_modules/crypto-random-string/readme.md | 51 + node_modules/debug/.coveralls.yml | 1 + node_modules/debug/.eslintrc | 11 + node_modules/debug/.npmignore | 9 + node_modules/debug/.travis.yml | 14 + node_modules/debug/CHANGELOG.md | 362 + node_modules/debug/LICENSE | 19 + node_modules/debug/Makefile | 50 + node_modules/debug/README.md | 312 + node_modules/debug/component.json | 19 + node_modules/debug/karma.conf.js | 70 + node_modules/debug/node.js | 1 + node_modules/debug/package.json | 91 + node_modules/debug/src/browser.js | 185 + node_modules/debug/src/debug.js | 202 + node_modules/debug/src/index.js | 10 + node_modules/debug/src/inspector-log.js | 15 + node_modules/debug/src/node.js | 248 + node_modules/decompress-response/index.js | 29 + node_modules/decompress-response/license | 21 + node_modules/decompress-response/package.json | 85 + node_modules/decompress-response/readme.md | 31 + node_modules/deep-extend/CHANGELOG.md | 46 + node_modules/deep-extend/LICENSE | 20 + node_modules/deep-extend/README.md | 91 + node_modules/deep-extend/index.js | 1 + node_modules/deep-extend/lib/deep-extend.js | 150 + node_modules/deep-extend/package.json | 92 + node_modules/defer-to-connect/LICENSE | 21 + node_modules/defer-to-connect/README.md | 38 + node_modules/defer-to-connect/dist/index.d.ts | 10 + node_modules/defer-to-connect/dist/index.js | 45 + node_modules/defer-to-connect/package.json | 101 + node_modules/delegates/.npmignore | 1 + node_modules/delegates/History.md | 22 + node_modules/delegates/License | 20 + node_modules/delegates/Makefile | 8 + node_modules/delegates/Readme.md | 94 + node_modules/delegates/index.js | 121 + node_modules/delegates/package.json | 48 + node_modules/delegates/test/index.js | 94 + node_modules/depd/History.md | 96 + node_modules/depd/LICENSE | 22 + node_modules/depd/Readme.md | 280 + node_modules/depd/index.js | 522 ++ node_modules/depd/lib/browser/index.js | 77 + .../depd/lib/compat/callsite-tostring.js | 103 + .../depd/lib/compat/event-listener-count.js | 22 + node_modules/depd/lib/compat/index.js | 79 + node_modules/depd/package.json | 79 + node_modules/destroy/LICENSE | 22 + node_modules/destroy/README.md | 60 + node_modules/destroy/index.js | 75 + node_modules/destroy/package.json | 71 + node_modules/detect-libc/.npmignore | 7 + node_modules/detect-libc/LICENSE | 201 + node_modules/detect-libc/README.md | 78 + node_modules/detect-libc/bin/detect-libc.js | 18 + node_modules/detect-libc/lib/detect-libc.js | 92 + node_modules/detect-libc/package.json | 70 + node_modules/dot-prop/index.d.ts | 101 + node_modules/dot-prop/index.js | 142 + node_modules/dot-prop/license | 9 + node_modules/dot-prop/package.json | 77 + node_modules/dot-prop/readme.md | 117 + node_modules/dotenv/.github/FUNDING.yml | 1 + node_modules/dotenv/CHANGELOG.md | 198 + node_modules/dotenv/LICENSE | 23 + node_modules/dotenv/README.md | 273 + node_modules/dotenv/config.js | 11 + node_modules/dotenv/lib/cli-options.js | 13 + node_modules/dotenv/lib/env-options.js | 18 + node_modules/dotenv/lib/main.js | 113 + node_modules/dotenv/package.json | 85 + node_modules/dotenv/types/index.d.ts | 59 + node_modules/dotenv/types/test.ts | 19 + node_modules/dotenv/types/tsconfig.json | 15 + node_modules/dotenv/types/tslint.json | 6 + node_modules/duplexer3/LICENSE.md | 26 + node_modules/duplexer3/README.md | 115 + node_modules/duplexer3/index.js | 76 + node_modules/duplexer3/package.json | 64 + node_modules/ecdsa-sig-formatter/CODEOWNERS | 1 + node_modules/ecdsa-sig-formatter/LICENSE | 201 + node_modules/ecdsa-sig-formatter/README.md | 65 + node_modules/ecdsa-sig-formatter/package.json | 73 + .../src/ecdsa-sig-formatter.d.ts | 17 + .../src/ecdsa-sig-formatter.js | 187 + .../src/param-bytes-for-alg.js | 23 + node_modules/ee-first/LICENSE | 22 + node_modules/ee-first/README.md | 80 + node_modules/ee-first/index.js | 95 + node_modules/ee-first/package.json | 63 + node_modules/emoji-regex/LICENSE-MIT.txt | 20 + node_modules/emoji-regex/README.md | 73 + node_modules/emoji-regex/es2015/index.js | 6 + node_modules/emoji-regex/es2015/text.js | 6 + node_modules/emoji-regex/index.d.ts | 5 + node_modules/emoji-regex/index.js | 6 + node_modules/emoji-regex/package.json | 78 + node_modules/emoji-regex/text.js | 6 + node_modules/encodeurl/HISTORY.md | 14 + node_modules/encodeurl/LICENSE | 22 + node_modules/encodeurl/README.md | 128 + node_modules/encodeurl/index.js | 60 + node_modules/encodeurl/package.json | 78 + node_modules/end-of-stream/LICENSE | 21 + node_modules/end-of-stream/README.md | 54 + node_modules/end-of-stream/index.js | 94 + node_modules/end-of-stream/package.json | 65 + node_modules/escape-goat/index.d.ts | 62 + node_modules/escape-goat/index.js | 33 + node_modules/escape-goat/license | 9 + node_modules/escape-goat/package.json | 77 + node_modules/escape-goat/readme.md | 76 + node_modules/escape-html/LICENSE | 24 + node_modules/escape-html/Readme.md | 43 + node_modules/escape-html/index.js | 78 + node_modules/escape-html/package.json | 59 + node_modules/etag/HISTORY.md | 83 + node_modules/etag/LICENSE | 22 + node_modules/etag/README.md | 159 + node_modules/etag/index.js | 131 + node_modules/etag/package.json | 86 + node_modules/express/History.md | 3477 +++++++ node_modules/express/LICENSE | 24 + node_modules/express/Readme.md | 155 + node_modules/express/index.js | 11 + node_modules/express/lib/application.js | 644 ++ node_modules/express/lib/express.js | 116 + node_modules/express/lib/middleware/init.js | 43 + node_modules/express/lib/middleware/query.js | 47 + node_modules/express/lib/request.js | 525 ++ node_modules/express/lib/response.js | 1142 +++ node_modules/express/lib/router/index.js | 662 ++ node_modules/express/lib/router/layer.js | 181 + node_modules/express/lib/router/route.js | 216 + node_modules/express/lib/utils.js | 306 + node_modules/express/lib/view.js | 182 + node_modules/express/package.json | 154 + node_modules/fill-range/LICENSE | 21 + node_modules/fill-range/README.md | 237 + node_modules/fill-range/index.js | 249 + node_modules/fill-range/package.json | 114 + node_modules/finalhandler/HISTORY.md | 187 + node_modules/finalhandler/LICENSE | 22 + node_modules/finalhandler/README.md | 148 + node_modules/finalhandler/index.js | 331 + node_modules/finalhandler/package.json | 80 + node_modules/forwarded/HISTORY.md | 16 + node_modules/forwarded/LICENSE | 22 + node_modules/forwarded/README.md | 57 + node_modules/forwarded/index.js | 76 + node_modules/forwarded/package.json | 78 + node_modules/fresh/HISTORY.md | 70 + node_modules/fresh/LICENSE | 23 + node_modules/fresh/README.md | 119 + node_modules/fresh/index.js | 137 + node_modules/fresh/package.json | 90 + node_modules/fs-minipass/LICENSE | 15 + node_modules/fs-minipass/README.md | 70 + node_modules/fs-minipass/index.js | 422 + node_modules/fs-minipass/package.json | 68 + node_modules/fs.realpath/LICENSE | 43 + node_modules/fs.realpath/README.md | 33 + node_modules/fs.realpath/index.js | 66 + node_modules/fs.realpath/old.js | 303 + node_modules/fs.realpath/package.json | 59 + node_modules/fsevents/LICENSE | 22 + node_modules/fsevents/README.md | 83 + node_modules/fsevents/fsevents.d.ts | 46 + node_modules/fsevents/fsevents.js | 82 + node_modules/fsevents/fsevents.node | Bin 0 -> 147128 bytes node_modules/fsevents/package.json | 87 + node_modules/gauge/CHANGELOG.md | 160 + node_modules/gauge/LICENSE | 13 + node_modules/gauge/README.md | 399 + node_modules/gauge/base-theme.js | 14 + node_modules/gauge/error.js | 24 + node_modules/gauge/has-color.js | 12 + node_modules/gauge/index.js | 233 + .../gauge/node_modules/ansi-regex/index.js | 4 + .../gauge/node_modules/ansi-regex/license | 21 + .../node_modules/ansi-regex/package.json | 108 + .../gauge/node_modules/ansi-regex/readme.md | 39 + .../is-fullwidth-code-point/index.js | 46 + .../is-fullwidth-code-point/license | 21 + .../is-fullwidth-code-point/package.json | 77 + .../is-fullwidth-code-point/readme.md | 39 + .../gauge/node_modules/string-width/index.js | 37 + .../gauge/node_modules/string-width/license | 21 + .../node_modules/string-width/package.json | 88 + .../gauge/node_modules/string-width/readme.md | 42 + .../gauge/node_modules/strip-ansi/index.js | 6 + .../gauge/node_modules/strip-ansi/license | 21 + .../node_modules/strip-ansi/package.json | 102 + .../gauge/node_modules/strip-ansi/readme.md | 33 + node_modules/gauge/package.json | 94 + node_modules/gauge/plumbing.js | 48 + node_modules/gauge/process.js | 3 + node_modules/gauge/progress-bar.js | 35 + node_modules/gauge/render-template.js | 181 + node_modules/gauge/set-immediate.js | 7 + node_modules/gauge/set-interval.js | 3 + node_modules/gauge/spin.js | 5 + node_modules/gauge/template-item.js | 73 + node_modules/gauge/theme-set.js | 115 + node_modules/gauge/themes.js | 54 + node_modules/gauge/wide-truncate.js | 25 + node_modules/get-stream/buffer-stream.js | 51 + node_modules/get-stream/index.js | 50 + node_modules/get-stream/license | 9 + node_modules/get-stream/package.json | 78 + node_modules/get-stream/readme.md | 123 + node_modules/glob-parent/CHANGELOG.md | 110 + node_modules/glob-parent/LICENSE | 15 + node_modules/glob-parent/README.md | 137 + node_modules/glob-parent/index.js | 42 + node_modules/glob-parent/package.json | 90 + node_modules/glob/LICENSE | 21 + node_modules/glob/README.md | 375 + node_modules/glob/changelog.md | 67 + node_modules/glob/common.js | 240 + node_modules/glob/glob.js | 790 ++ node_modules/glob/package.json | 79 + node_modules/glob/sync.js | 486 + node_modules/global-dirs/index.d.ts | 60 + node_modules/global-dirs/index.js | 118 + node_modules/global-dirs/license | 9 + node_modules/global-dirs/package.json | 88 + node_modules/global-dirs/readme.md | 72 + node_modules/got/license | 9 + node_modules/got/package.json | 106 + node_modules/got/readme.md | 1237 +++ node_modules/got/source/as-promise.js | 108 + node_modules/got/source/as-stream.js | 93 + node_modules/got/source/create.js | 79 + node_modules/got/source/errors.js | 107 + node_modules/got/source/get-response.js | 31 + node_modules/got/source/index.js | 60 + node_modules/got/source/known-hook-events.js | 10 + node_modules/got/source/merge.js | 73 + .../got/source/normalize-arguments.js | 265 + node_modules/got/source/progress.js | 96 + .../got/source/request-as-event-emitter.js | 312 + node_modules/got/source/utils/deep-freeze.js | 12 + .../got/source/utils/get-body-size.js | 32 + node_modules/got/source/utils/is-form-data.js | 4 + node_modules/got/source/utils/timed-out.js | 160 + .../got/source/utils/url-to-options.js | 25 + node_modules/graceful-fs/LICENSE | 15 + node_modules/graceful-fs/README.md | 133 + node_modules/graceful-fs/clone.js | 23 + node_modules/graceful-fs/graceful-fs.js | 373 + node_modules/graceful-fs/legacy-streams.js | 118 + node_modules/graceful-fs/package.json | 79 + node_modules/graceful-fs/polyfills.js | 346 + node_modules/has-flag/index.js | 8 + node_modules/has-flag/license | 9 + node_modules/has-flag/package.json | 76 + node_modules/has-flag/readme.md | 70 + node_modules/has-unicode/LICENSE | 14 + node_modules/has-unicode/README.md | 43 + node_modules/has-unicode/index.js | 16 + node_modules/has-unicode/package.json | 58 + node_modules/has-yarn/index.d.ts | 16 + node_modules/has-yarn/index.js | 9 + node_modules/has-yarn/license | 9 + node_modules/has-yarn/package.json | 71 + node_modules/has-yarn/readme.md | 60 + node_modules/http-cache-semantics/LICENSE | 9 + node_modules/http-cache-semantics/README.md | 203 + node_modules/http-cache-semantics/index.js | 673 ++ .../http-cache-semantics/package.json | 60 + node_modules/http-errors/HISTORY.md | 149 + node_modules/http-errors/LICENSE | 23 + node_modules/http-errors/README.md | 163 + node_modules/http-errors/index.js | 266 + node_modules/http-errors/package.json | 93 + node_modules/https-proxy-agent/README.md | 137 + .../https-proxy-agent/dist/agent.d.ts | 30 + node_modules/https-proxy-agent/dist/agent.js | 180 + .../https-proxy-agent/dist/agent.js.map | 1 + .../https-proxy-agent/dist/index.d.ts | 23 + node_modules/https-proxy-agent/dist/index.js | 14 + .../https-proxy-agent/dist/index.js.map | 1 + .../dist/parse-proxy-response.d.ts | 7 + .../dist/parse-proxy-response.js | 66 + .../dist/parse-proxy-response.js.map | 1 + .../node_modules/debug/LICENSE | 19 + .../node_modules/debug/README.md | 455 + .../node_modules/debug/package.json | 101 + .../node_modules/debug/src/browser.js | 269 + .../node_modules/debug/src/common.js | 261 + .../node_modules/debug/src/index.js | 10 + .../node_modules/debug/src/node.js | 263 + .../node_modules/ms/index.js | 162 + .../node_modules/ms/license.md | 21 + .../node_modules/ms/package.json | 69 + .../node_modules/ms/readme.md | 60 + node_modules/https-proxy-agent/package.json | 86 + node_modules/iconv-lite/Changelog.md | 162 + node_modules/iconv-lite/LICENSE | 21 + node_modules/iconv-lite/README.md | 156 + .../iconv-lite/encodings/dbcs-codec.js | 555 ++ .../iconv-lite/encodings/dbcs-data.js | 176 + node_modules/iconv-lite/encodings/index.js | 22 + node_modules/iconv-lite/encodings/internal.js | 188 + .../iconv-lite/encodings/sbcs-codec.js | 72 + .../encodings/sbcs-data-generated.js | 451 + .../iconv-lite/encodings/sbcs-data.js | 174 + .../encodings/tables/big5-added.json | 122 + .../iconv-lite/encodings/tables/cp936.json | 264 + .../iconv-lite/encodings/tables/cp949.json | 273 + .../iconv-lite/encodings/tables/cp950.json | 177 + .../iconv-lite/encodings/tables/eucjp.json | 182 + .../encodings/tables/gb18030-ranges.json | 1 + .../encodings/tables/gbk-added.json | 55 + .../iconv-lite/encodings/tables/shiftjis.json | 125 + node_modules/iconv-lite/encodings/utf16.js | 177 + node_modules/iconv-lite/encodings/utf7.js | 290 + node_modules/iconv-lite/lib/bom-handling.js | 52 + node_modules/iconv-lite/lib/extend-node.js | 217 + node_modules/iconv-lite/lib/index.d.ts | 24 + node_modules/iconv-lite/lib/index.js | 153 + node_modules/iconv-lite/lib/streams.js | 121 + node_modules/iconv-lite/package.json | 77 + node_modules/ignore-by-default/LICENSE | 14 + node_modules/ignore-by-default/README.md | 26 + node_modules/ignore-by-default/index.js | 12 + node_modules/ignore-by-default/package.json | 62 + node_modules/import-lazy/index.js | 53 + node_modules/import-lazy/license | 21 + node_modules/import-lazy/package.json | 76 + node_modules/import-lazy/readme.md | 64 + node_modules/imurmurhash/README.md | 122 + node_modules/imurmurhash/imurmurhash.js | 138 + node_modules/imurmurhash/imurmurhash.min.js | 12 + node_modules/imurmurhash/package.json | 63 + node_modules/inflight/LICENSE | 15 + node_modules/inflight/README.md | 37 + node_modules/inflight/inflight.js | 54 + node_modules/inflight/package.json | 58 + node_modules/inherits/LICENSE | 16 + node_modules/inherits/README.md | 42 + node_modules/inherits/inherits.js | 7 + node_modules/inherits/inherits_browser.js | 23 + node_modules/inherits/package.json | 61 + node_modules/ini/LICENSE | 15 + node_modules/ini/README.md | 102 + node_modules/ini/ini.js | 206 + node_modules/ini/package.json | 67 + node_modules/ipaddr.js/LICENSE | 19 + node_modules/ipaddr.js/README.md | 233 + node_modules/ipaddr.js/ipaddr.min.js | 1 + node_modules/ipaddr.js/lib/ipaddr.js | 673 ++ node_modules/ipaddr.js/lib/ipaddr.js.d.ts | 68 + node_modules/ipaddr.js/package.json | 70 + node_modules/is-binary-path/index.d.ts | 17 + node_modules/is-binary-path/index.js | 7 + node_modules/is-binary-path/license | 9 + node_modules/is-binary-path/package.json | 72 + node_modules/is-binary-path/readme.md | 34 + node_modules/is-ci/CHANGELOG.md | 14 + node_modules/is-ci/LICENSE | 21 + node_modules/is-ci/README.md | 50 + node_modules/is-ci/bin.js | 4 + node_modules/is-ci/index.js | 3 + node_modules/is-ci/package.json | 69 + node_modules/is-extglob/LICENSE | 21 + node_modules/is-extglob/README.md | 107 + node_modules/is-extglob/index.js | 20 + node_modules/is-extglob/package.json | 100 + node_modules/is-fullwidth-code-point/index.js | 46 + node_modules/is-fullwidth-code-point/license | 21 + .../is-fullwidth-code-point/package.json | 77 + .../is-fullwidth-code-point/readme.md | 39 + node_modules/is-glob/LICENSE | 21 + node_modules/is-glob/README.md | 206 + node_modules/is-glob/index.js | 48 + node_modules/is-glob/package.json | 122 + node_modules/is-installed-globally/index.d.ts | 19 + node_modules/is-installed-globally/index.js | 15 + node_modules/is-installed-globally/license | 9 + .../is-installed-globally/package.json | 86 + node_modules/is-installed-globally/readme.md | 34 + node_modules/is-npm/index.d.ts | 41 + node_modules/is-npm/index.js | 9 + node_modules/is-npm/license | 9 + node_modules/is-npm/package.json | 69 + node_modules/is-npm/readme.md | 59 + node_modules/is-number/LICENSE | 21 + node_modules/is-number/README.md | 187 + node_modules/is-number/index.js | 18 + node_modules/is-number/package.json | 122 + node_modules/is-obj/index.d.ts | 22 + node_modules/is-obj/index.js | 6 + node_modules/is-obj/license | 9 + node_modules/is-obj/package.json | 66 + node_modules/is-obj/readme.md | 39 + node_modules/is-path-inside/index.d.ts | 27 + node_modules/is-path-inside/index.js | 12 + node_modules/is-path-inside/license | 9 + node_modules/is-path-inside/package.json | 68 + node_modules/is-path-inside/readme.md | 63 + node_modules/is-typedarray/LICENSE.md | 18 + node_modules/is-typedarray/README.md | 16 + node_modules/is-typedarray/index.js | 41 + node_modules/is-typedarray/package.json | 60 + node_modules/is-typedarray/test.js | 34 + node_modules/is-yarn-global/.travis.yml | 4 + node_modules/is-yarn-global/LICENSE | 21 + node_modules/is-yarn-global/README.md | 28 + node_modules/is-yarn-global/index.js | 12 + node_modules/is-yarn-global/package.json | 50 + node_modules/isarray/.npmignore | 1 + node_modules/isarray/.travis.yml | 4 + node_modules/isarray/Makefile | 6 + node_modules/isarray/README.md | 60 + node_modules/isarray/component.json | 19 + node_modules/isarray/index.js | 5 + node_modules/isarray/package.json | 73 + node_modules/isarray/test.js | 20 + node_modules/json-buffer/.npmignore | 3 + node_modules/json-buffer/.travis.yml | 3 + node_modules/json-buffer/LICENSE | 22 + node_modules/json-buffer/README.md | 24 + node_modules/json-buffer/index.js | 58 + node_modules/json-buffer/package.json | 66 + node_modules/json-buffer/test/index.js | 63 + node_modules/jsonwebtoken/CHANGELOG.md | 476 + node_modules/jsonwebtoken/LICENSE | 21 + node_modules/jsonwebtoken/README.md | 375 + node_modules/jsonwebtoken/decode.js | 30 + node_modules/jsonwebtoken/index.js | 8 + .../jsonwebtoken/lib/JsonWebTokenError.js | 14 + .../jsonwebtoken/lib/NotBeforeError.js | 13 + .../jsonwebtoken/lib/TokenExpiredError.js | 13 + node_modules/jsonwebtoken/lib/psSupported.js | 3 + node_modules/jsonwebtoken/lib/timespan.js | 18 + .../jsonwebtoken/node_modules/ms/index.js | 162 + .../jsonwebtoken/node_modules/ms/license.md | 21 + .../jsonwebtoken/node_modules/ms/package.json | 70 + .../jsonwebtoken/node_modules/ms/readme.md | 59 + node_modules/jsonwebtoken/package.json | 100 + node_modules/jsonwebtoken/sign.js | 206 + node_modules/jsonwebtoken/verify.js | 225 + node_modules/jwa/LICENSE | 17 + node_modules/jwa/README.md | 150 + node_modules/jwa/index.js | 252 + node_modules/jwa/package.json | 69 + node_modules/jws/CHANGELOG.md | 34 + node_modules/jws/LICENSE | 17 + node_modules/jws/index.js | 22 + node_modules/jws/lib/data-stream.js | 55 + node_modules/jws/lib/sign-stream.js | 78 + node_modules/jws/lib/tostring.js | 10 + node_modules/jws/lib/verify-stream.js | 120 + node_modules/jws/package.json | 64 + node_modules/jws/readme.md | 255 + node_modules/keyv/LICENSE | 21 + node_modules/keyv/README.md | 276 + node_modules/keyv/package.json | 78 + node_modules/keyv/src/index.js | 103 + node_modules/latest-version/index.d.ts | 42 + node_modules/latest-version/index.js | 11 + node_modules/latest-version/license | 9 + node_modules/latest-version/package.json | 74 + node_modules/latest-version/readme.md | 42 + node_modules/lodash.includes/LICENSE | 47 + node_modules/lodash.includes/README.md | 18 + node_modules/lodash.includes/index.js | 745 ++ node_modules/lodash.includes/package.json | 69 + node_modules/lodash.isboolean/LICENSE | 22 + node_modules/lodash.isboolean/README.md | 18 + node_modules/lodash.isboolean/index.js | 70 + node_modules/lodash.isboolean/package.json | 69 + node_modules/lodash.isinteger/LICENSE | 47 + node_modules/lodash.isinteger/README.md | 18 + node_modules/lodash.isinteger/index.js | 265 + node_modules/lodash.isinteger/package.json | 69 + node_modules/lodash.isnumber/LICENSE | 22 + node_modules/lodash.isnumber/README.md | 18 + node_modules/lodash.isnumber/index.js | 79 + node_modules/lodash.isnumber/package.json | 69 + node_modules/lodash.isplainobject/LICENSE | 47 + node_modules/lodash.isplainobject/README.md | 18 + node_modules/lodash.isplainobject/index.js | 139 + .../lodash.isplainobject/package.json | 69 + node_modules/lodash.isstring/LICENSE | 22 + node_modules/lodash.isstring/README.md | 18 + node_modules/lodash.isstring/index.js | 95 + node_modules/lodash.isstring/package.json | 69 + node_modules/lodash.once/LICENSE | 47 + node_modules/lodash.once/README.md | 18 + node_modules/lodash.once/index.js | 294 + node_modules/lodash.once/package.json | 69 + node_modules/lowercase-keys/index.js | 11 + node_modules/lowercase-keys/license | 21 + node_modules/lowercase-keys/package.json | 68 + node_modules/lowercase-keys/readme.md | 33 + node_modules/lru-cache/LICENSE | 15 + node_modules/lru-cache/README.md | 166 + node_modules/lru-cache/index.js | 334 + node_modules/lru-cache/package.json | 69 + node_modules/make-dir/index.d.ts | 66 + node_modules/make-dir/index.js | 156 + node_modules/make-dir/license | 9 + .../make-dir/node_modules/.bin/semver | 1 + .../make-dir/node_modules/semver/CHANGELOG.md | 70 + .../make-dir/node_modules/semver/LICENSE | 15 + .../make-dir/node_modules/semver/README.md | 443 + .../node_modules/semver/bin/semver.js | 174 + .../make-dir/node_modules/semver/package.json | 60 + .../make-dir/node_modules/semver/range.bnf | 16 + .../make-dir/node_modules/semver/semver.js | 1596 ++++ node_modules/make-dir/package.json | 91 + node_modules/make-dir/readme.md | 125 + node_modules/media-typer/HISTORY.md | 22 + node_modules/media-typer/LICENSE | 22 + node_modules/media-typer/README.md | 81 + node_modules/media-typer/index.js | 270 + node_modules/media-typer/package.json | 61 + node_modules/merge-descriptors/HISTORY.md | 21 + node_modules/merge-descriptors/LICENSE | 23 + node_modules/merge-descriptors/README.md | 48 + node_modules/merge-descriptors/index.js | 60 + node_modules/merge-descriptors/package.json | 69 + node_modules/methods/HISTORY.md | 29 + node_modules/methods/LICENSE | 24 + node_modules/methods/README.md | 51 + node_modules/methods/index.js | 69 + node_modules/methods/package.json | 79 + node_modules/mime-db/HISTORY.md | 473 + node_modules/mime-db/LICENSE | 22 + node_modules/mime-db/README.md | 100 + node_modules/mime-db/db.json | 8323 +++++++++++++++++ node_modules/mime-db/index.js | 11 + node_modules/mime-db/package.json | 102 + node_modules/mime-types/HISTORY.md | 363 + node_modules/mime-types/LICENSE | 23 + node_modules/mime-types/README.md | 113 + node_modules/mime-types/index.js | 188 + node_modules/mime-types/package.json | 88 + node_modules/mime/.npmignore | 0 node_modules/mime/CHANGELOG.md | 164 + node_modules/mime/LICENSE | 21 + node_modules/mime/README.md | 90 + node_modules/mime/cli.js | 8 + node_modules/mime/mime.js | 108 + node_modules/mime/package.json | 73 + node_modules/mime/src/build.js | 53 + node_modules/mime/src/test.js | 60 + node_modules/mime/types.json | 1 + node_modules/mimic-response/index.js | 32 + node_modules/mimic-response/license | 9 + node_modules/mimic-response/package.json | 71 + node_modules/mimic-response/readme.md | 54 + node_modules/minimatch/LICENSE | 15 + node_modules/minimatch/README.md | 209 + node_modules/minimatch/minimatch.js | 923 ++ node_modules/minimatch/package.json | 63 + node_modules/minimist/.travis.yml | 8 + node_modules/minimist/LICENSE | 18 + node_modules/minimist/example/parse.js | 2 + node_modules/minimist/index.js | 245 + node_modules/minimist/package.json | 73 + node_modules/minimist/readme.markdown | 95 + node_modules/minimist/test/all_bool.js | 32 + node_modules/minimist/test/bool.js | 178 + node_modules/minimist/test/dash.js | 31 + node_modules/minimist/test/default_bool.js | 35 + node_modules/minimist/test/dotted.js | 22 + node_modules/minimist/test/kv_short.js | 16 + node_modules/minimist/test/long.js | 31 + node_modules/minimist/test/num.js | 36 + node_modules/minimist/test/parse.js | 197 + node_modules/minimist/test/parse_modified.js | 9 + node_modules/minimist/test/proto.js | 44 + node_modules/minimist/test/short.js | 67 + node_modules/minimist/test/stop_early.js | 15 + node_modules/minimist/test/unknown.js | 102 + node_modules/minimist/test/whitespace.js | 8 + node_modules/minipass/LICENSE | 15 + node_modules/minipass/README.md | 613 ++ node_modules/minipass/index.js | 545 ++ node_modules/minipass/package.json | 74 + node_modules/minizlib/LICENSE | 26 + node_modules/minizlib/README.md | 60 + node_modules/minizlib/constants.js | 115 + node_modules/minizlib/index.js | 348 + node_modules/minizlib/package.json | 75 + node_modules/mkdirp/CHANGELOG.md | 15 + node_modules/mkdirp/LICENSE | 21 + node_modules/mkdirp/bin/cmd.js | 68 + node_modules/mkdirp/index.js | 31 + node_modules/mkdirp/lib/find-made.js | 29 + node_modules/mkdirp/lib/mkdirp-manual.js | 64 + node_modules/mkdirp/lib/mkdirp-native.js | 39 + node_modules/mkdirp/lib/opts-arg.js | 23 + node_modules/mkdirp/lib/path-arg.js | 29 + node_modules/mkdirp/lib/use-native.js | 10 + node_modules/mkdirp/package.json | 75 + node_modules/mkdirp/readme.markdown | 266 + node_modules/morgan/HISTORY.md | 215 + node_modules/morgan/LICENSE | 23 + node_modules/morgan/README.md | 417 + node_modules/morgan/index.js | 544 ++ .../morgan/node_modules/depd/History.md | 103 + node_modules/morgan/node_modules/depd/LICENSE | 22 + .../morgan/node_modules/depd/Readme.md | 280 + .../morgan/node_modules/depd/index.js | 538 ++ .../node_modules/depd/lib/browser/index.js | 77 + .../morgan/node_modules/depd/package.json | 80 + node_modules/morgan/package.json | 92 + node_modules/ms/index.js | 152 + node_modules/ms/license.md | 21 + node_modules/ms/package.json | 69 + node_modules/ms/readme.md | 51 + node_modules/negotiator/HISTORY.md | 103 + node_modules/negotiator/LICENSE | 24 + node_modules/negotiator/README.md | 203 + node_modules/negotiator/index.js | 124 + node_modules/negotiator/lib/charset.js | 169 + node_modules/negotiator/lib/encoding.js | 184 + node_modules/negotiator/lib/language.js | 179 + node_modules/negotiator/lib/mediaType.js | 294 + node_modules/negotiator/package.json | 84 + node_modules/node-addon-api/.clang-format | 111 + node_modules/node-addon-api/.editorconfig | 8 + .../node-addon-api/.github/workflows/ci.yml | 55 + .../.github/workflows/linter.yml | 24 + .../.github/workflows/stale.yml | 18 + node_modules/node-addon-api/.travis.yml | 58 + node_modules/node-addon-api/CHANGELOG.md | 626 ++ .../node-addon-api/CODE_OF_CONDUCT.md | 4 + node_modules/node-addon-api/CONTRIBUTING.md | 66 + node_modules/node-addon-api/LICENSE.md | 13 + node_modules/node-addon-api/README.md | 273 + node_modules/node-addon-api/appveyor.yml | 37 + .../node-addon-api/benchmark/README.md | 47 + .../node-addon-api/benchmark/binding.gyp | 25 + .../node-addon-api/benchmark/function_args.cc | 217 + .../node-addon-api/benchmark/function_args.js | 60 + .../node-addon-api/benchmark/index.js | 34 + .../benchmark/property_descriptor.cc | 91 + .../benchmark/property_descriptor.js | 37 + node_modules/node-addon-api/common.gypi | 21 + node_modules/node-addon-api/doc/addon.md | 157 + node_modules/node-addon-api/doc/array.md | 81 + .../node-addon-api/doc/array_buffer.md | 149 + .../node-addon-api/doc/async_context.md | 86 + .../node-addon-api/doc/async_operations.md | 31 + .../node-addon-api/doc/async_worker.md | 427 + .../doc/async_worker_variants.md | 557 ++ node_modules/node-addon-api/doc/bigint.md | 97 + node_modules/node-addon-api/doc/boolean.md | 68 + node_modules/node-addon-api/doc/buffer.md | 144 + .../node-addon-api/doc/callback_scope.md | 54 + .../node-addon-api/doc/callbackinfo.md | 97 + .../node-addon-api/doc/checker-tool.md | 32 + .../doc/class_property_descriptor.md | 117 + node_modules/node-addon-api/doc/cmake-js.md | 68 + .../node-addon-api/doc/conversion-tool.md | 28 + .../node-addon-api/doc/creating_a_release.md | 62 + node_modules/node-addon-api/doc/dataview.md | 248 + node_modules/node-addon-api/doc/date.md | 68 + node_modules/node-addon-api/doc/env.md | 132 + node_modules/node-addon-api/doc/error.md | 120 + .../node-addon-api/doc/error_handling.md | 186 + .../doc/escapable_handle_scope.md | 82 + node_modules/node-addon-api/doc/external.md | 63 + node_modules/node-addon-api/doc/function.md | 402 + .../node-addon-api/doc/function_reference.md | 238 + node_modules/node-addon-api/doc/generator.md | 13 + .../node-addon-api/doc/handle_scope.md | 65 + node_modules/node-addon-api/doc/hierarchy.md | 91 + .../node-addon-api/doc/instance_wrap.md | 408 + .../node-addon-api/doc/memory_management.md | 27 + node_modules/node-addon-api/doc/name.md | 29 + node_modules/node-addon-api/doc/node-gyp.md | 82 + node_modules/node-addon-api/doc/number.md | 163 + node_modules/node-addon-api/doc/object.md | 279 + .../doc/object_lifetime_management.md | 83 + .../node-addon-api/doc/object_reference.md | 117 + .../node-addon-api/doc/object_wrap.md | 561 ++ .../node-addon-api/doc/prebuild_tools.md | 16 + node_modules/node-addon-api/doc/promises.md | 79 + .../node-addon-api/doc/property_descriptor.md | 286 + .../node-addon-api/doc/range_error.md | 59 + node_modules/node-addon-api/doc/reference.md | 111 + node_modules/node-addon-api/doc/setup.md | 81 + node_modules/node-addon-api/doc/string.md | 93 + node_modules/node-addon-api/doc/symbol.md | 48 + node_modules/node-addon-api/doc/threadsafe.md | 121 + .../node-addon-api/doc/threadsafe_function.md | 290 + node_modules/node-addon-api/doc/type_error.md | 59 + .../node-addon-api/doc/typed_array.md | 78 + .../node-addon-api/doc/typed_array_of.md | 137 + .../doc/typed_threadsafe_function.md | 307 + node_modules/node-addon-api/doc/value.md | 340 + .../node-addon-api/doc/version_management.md | 43 + node_modules/node-addon-api/except.gypi | 16 + node_modules/node-addon-api/index.js | 11 + .../node-addon-api/napi-inl.deprecated.h | 192 + node_modules/node-addon-api/napi-inl.h | 5633 +++++++++++ node_modules/node-addon-api/napi.h | 2638 ++++++ node_modules/node-addon-api/node_api.gyp | 9 + node_modules/node-addon-api/noexcept.gypi | 16 + node_modules/node-addon-api/nothing.c | 0 .../node-addon-api/package-support.json | 21 + node_modules/node-addon-api/package.json | 372 + node_modules/node-addon-api/tools/README.md | 73 + .../node-addon-api/tools/check-napi.js | 100 + .../node-addon-api/tools/clang-format.js | 47 + .../node-addon-api/tools/conversion.js | 309 + node_modules/node-fetch/CHANGELOG.md | 272 + node_modules/node-fetch/LICENSE.md | 22 + node_modules/node-fetch/README.md | 590 ++ node_modules/node-fetch/browser.js | 25 + node_modules/node-fetch/lib/index.es.js | 1640 ++++ node_modules/node-fetch/lib/index.js | 1649 ++++ node_modules/node-fetch/lib/index.mjs | 1638 ++++ node_modules/node-fetch/package.json | 93 + node_modules/nodemon/.eslintrc.json | 19 + node_modules/nodemon/.jshintrc | 16 + node_modules/nodemon/.travis.yml | 17 + node_modules/nodemon/LICENSE | 21 + node_modules/nodemon/README.md | 379 + node_modules/nodemon/bin/nodemon.js | 16 + node_modules/nodemon/bin/postinstall.js | 29 + node_modules/nodemon/commitlint.config.js | 3 + node_modules/nodemon/doc/cli/authors.txt | 8 + node_modules/nodemon/doc/cli/config.txt | 44 + node_modules/nodemon/doc/cli/help.txt | 29 + node_modules/nodemon/doc/cli/logo.txt | 20 + node_modules/nodemon/doc/cli/options.txt | 36 + node_modules/nodemon/doc/cli/topics.txt | 8 + node_modules/nodemon/doc/cli/usage.txt | 3 + node_modules/nodemon/doc/cli/whoami.txt | 9 + node_modules/nodemon/lib/cli/index.js | 49 + node_modules/nodemon/lib/cli/parse.js | 230 + node_modules/nodemon/lib/config/command.js | 43 + node_modules/nodemon/lib/config/defaults.js | 28 + node_modules/nodemon/lib/config/exec.js | 225 + node_modules/nodemon/lib/config/index.js | 93 + node_modules/nodemon/lib/config/load.js | 256 + node_modules/nodemon/lib/help/index.js | 27 + node_modules/nodemon/lib/index.js | 1 + node_modules/nodemon/lib/monitor/index.js | 4 + node_modules/nodemon/lib/monitor/match.js | 276 + node_modules/nodemon/lib/monitor/run.js | 474 + node_modules/nodemon/lib/monitor/signals.js | 34 + node_modules/nodemon/lib/monitor/watch.js | 239 + node_modules/nodemon/lib/nodemon.js | 311 + node_modules/nodemon/lib/rules/add.js | 89 + node_modules/nodemon/lib/rules/index.js | 53 + node_modules/nodemon/lib/rules/parse.js | 43 + node_modules/nodemon/lib/spawn.js | 55 + node_modules/nodemon/lib/utils/bus.js | 44 + node_modules/nodemon/lib/utils/clone.js | 40 + node_modules/nodemon/lib/utils/colour.js | 26 + node_modules/nodemon/lib/utils/index.js | 102 + node_modules/nodemon/lib/utils/log.js | 82 + node_modules/nodemon/lib/utils/merge.js | 47 + node_modules/nodemon/lib/version.js | 100 + .../nodemon/node_modules/debug/CHANGELOG.md | 395 + .../nodemon/node_modules/debug/LICENSE | 19 + .../nodemon/node_modules/debug/README.md | 437 + .../nodemon/node_modules/debug/node.js | 1 + .../nodemon/node_modules/debug/package.json | 90 + .../nodemon/node_modules/debug/src/browser.js | 180 + .../nodemon/node_modules/debug/src/common.js | 249 + .../nodemon/node_modules/debug/src/index.js | 12 + .../nodemon/node_modules/debug/src/node.js | 177 + node_modules/nodemon/node_modules/ms/index.js | 162 + .../nodemon/node_modules/ms/license.md | 21 + .../nodemon/node_modules/ms/package.json | 70 + .../nodemon/node_modules/ms/readme.md | 59 + node_modules/nodemon/package.json | 103 + node_modules/nopt/.npmignore | 0 node_modules/nopt/LICENSE | 23 + node_modules/nopt/README.md | 208 + node_modules/nopt/bin/nopt.js | 44 + node_modules/nopt/examples/my-program.js | 30 + node_modules/nopt/lib/nopt.js | 552 ++ node_modules/nopt/package.json | 60 + node_modules/normalize-path/LICENSE | 21 + node_modules/normalize-path/README.md | 127 + node_modules/normalize-path/index.js | 35 + node_modules/normalize-path/package.json | 115 + node_modules/normalize-url/index.d.ts | 216 + node_modules/normalize-url/index.js | 221 + node_modules/normalize-url/license | 9 + node_modules/normalize-url/package.json | 76 + node_modules/normalize-url/readme.md | 232 + node_modules/npmlog/CHANGELOG.md | 49 + node_modules/npmlog/LICENSE | 15 + node_modules/npmlog/README.md | 216 + node_modules/npmlog/log.js | 309 + node_modules/npmlog/package.json | 61 + node_modules/number-is-nan/index.js | 4 + node_modules/number-is-nan/license | 21 + node_modules/number-is-nan/package.json | 67 + node_modules/number-is-nan/readme.md | 28 + node_modules/object-assign/index.js | 90 + node_modules/object-assign/license | 21 + node_modules/object-assign/package.json | 74 + node_modules/object-assign/readme.md | 61 + node_modules/on-finished/HISTORY.md | 88 + node_modules/on-finished/LICENSE | 23 + node_modules/on-finished/README.md | 154 + node_modules/on-finished/index.js | 196 + node_modules/on-finished/package.json | 73 + node_modules/on-headers/HISTORY.md | 21 + node_modules/on-headers/LICENSE | 22 + node_modules/on-headers/README.md | 81 + node_modules/on-headers/index.js | 132 + node_modules/on-headers/package.json | 77 + node_modules/once/LICENSE | 15 + node_modules/once/README.md | 79 + node_modules/once/once.js | 42 + node_modules/once/package.json | 67 + node_modules/p-cancelable/index.d.ts | 168 + node_modules/p-cancelable/index.js | 103 + node_modules/p-cancelable/license | 9 + node_modules/p-cancelable/package.json | 81 + node_modules/p-cancelable/readme.md | 155 + node_modules/package-json/index.d.ts | 199 + node_modules/package-json/index.js | 115 + node_modules/package-json/license | 9 + .../package-json/node_modules/.bin/semver | 1 + .../node_modules/semver/CHANGELOG.md | 70 + .../package-json/node_modules/semver/LICENSE | 15 + .../node_modules/semver/README.md | 443 + .../node_modules/semver/bin/semver.js | 174 + .../node_modules/semver/package.json | 60 + .../node_modules/semver/range.bnf | 16 + .../node_modules/semver/semver.js | 1596 ++++ node_modules/package-json/package.json | 78 + node_modules/package-json/readme.md | 118 + node_modules/parseurl/HISTORY.md | 58 + node_modules/parseurl/LICENSE | 24 + node_modules/parseurl/README.md | 133 + node_modules/parseurl/index.js | 158 + node_modules/parseurl/package.json | 81 + node_modules/path-is-absolute/index.js | 20 + node_modules/path-is-absolute/license | 21 + node_modules/path-is-absolute/package.json | 75 + node_modules/path-is-absolute/readme.md | 59 + node_modules/path-to-regexp/History.md | 36 + node_modules/path-to-regexp/LICENSE | 21 + node_modules/path-to-regexp/Readme.md | 35 + node_modules/path-to-regexp/index.js | 129 + node_modules/path-to-regexp/package.json | 59 + node_modules/picomatch/CHANGELOG.md | 120 + node_modules/picomatch/LICENSE | 21 + node_modules/picomatch/README.md | 691 ++ node_modules/picomatch/index.js | 3 + node_modules/picomatch/lib/constants.js | 179 + node_modules/picomatch/lib/parse.js | 1078 +++ node_modules/picomatch/lib/picomatch.js | 339 + node_modules/picomatch/lib/scan.js | 385 + node_modules/picomatch/lib/utils.js | 64 + node_modules/picomatch/package.json | 113 + node_modules/prepend-http/index.js | 15 + node_modules/prepend-http/license | 9 + node_modules/prepend-http/package.json | 67 + node_modules/prepend-http/readme.md | 56 + node_modules/process-nextick-args/index.js | 45 + node_modules/process-nextick-args/license.md | 19 + .../process-nextick-args/package.json | 50 + node_modules/process-nextick-args/readme.md | 18 + node_modules/proxy-addr/HISTORY.md | 155 + node_modules/proxy-addr/LICENSE | 22 + node_modules/proxy-addr/README.md | 155 + node_modules/proxy-addr/index.js | 327 + node_modules/proxy-addr/package.json | 82 + node_modules/pstree.remy/.travis.yml | 8 + node_modules/pstree.remy/LICENSE | 7 + node_modules/pstree.remy/README.md | 26 + node_modules/pstree.remy/lib/index.js | 37 + node_modules/pstree.remy/lib/tree.js | 37 + node_modules/pstree.remy/lib/utils.js | 53 + node_modules/pstree.remy/package.json | 64 + .../pstree.remy/tests/fixtures/index.js | 13 + node_modules/pstree.remy/tests/fixtures/out1 | 10 + node_modules/pstree.remy/tests/fixtures/out2 | 29 + node_modules/pstree.remy/tests/index.test.js | 51 + node_modules/pump/.travis.yml | 5 + node_modules/pump/LICENSE | 21 + node_modules/pump/README.md | 65 + node_modules/pump/index.js | 82 + node_modules/pump/package.json | 60 + node_modules/pump/test-browser.js | 66 + node_modules/pump/test-node.js | 53 + node_modules/pupa/index.d.ts | 32 + node_modules/pupa/index.js | 39 + node_modules/pupa/license | 9 + node_modules/pupa/package.json | 79 + node_modules/pupa/readme.md | 63 + node_modules/qs/.editorconfig | 30 + node_modules/qs/.eslintignore | 1 + node_modules/qs/.eslintrc | 21 + node_modules/qs/CHANGELOG.md | 256 + node_modules/qs/LICENSE | 28 + node_modules/qs/README.md | 570 ++ node_modules/qs/dist/qs.js | 782 ++ node_modules/qs/lib/formats.js | 18 + node_modules/qs/lib/index.js | 11 + node_modules/qs/lib/parse.js | 242 + node_modules/qs/lib/stringify.js | 269 + node_modules/qs/lib/utils.js | 230 + node_modules/qs/package.json | 87 + node_modules/qs/test/.eslintrc | 17 + node_modules/qs/test/index.js | 7 + node_modules/qs/test/parse.js | 676 ++ node_modules/qs/test/stringify.js | 679 ++ node_modules/qs/test/utils.js | 136 + node_modules/range-parser/HISTORY.md | 56 + node_modules/range-parser/LICENSE | 23 + node_modules/range-parser/README.md | 84 + node_modules/range-parser/index.js | 162 + node_modules/range-parser/package.json | 91 + node_modules/raw-body/HISTORY.md | 270 + node_modules/raw-body/LICENSE | 22 + node_modules/raw-body/README.md | 219 + node_modules/raw-body/index.d.ts | 87 + node_modules/raw-body/index.js | 286 + node_modules/raw-body/package.json | 90 + node_modules/rc/LICENSE.APACHE2 | 15 + node_modules/rc/LICENSE.BSD | 26 + node_modules/rc/LICENSE.MIT | 24 + node_modules/rc/README.md | 227 + node_modules/rc/browser.js | 7 + node_modules/rc/cli.js | 4 + node_modules/rc/index.js | 53 + node_modules/rc/lib/utils.js | 104 + node_modules/rc/package.json | 65 + node_modules/rc/test/ini.js | 16 + node_modules/rc/test/nested-env-vars.js | 50 + node_modules/rc/test/test.js | 59 + node_modules/readable-stream/.travis.yml | 34 + node_modules/readable-stream/CONTRIBUTING.md | 38 + node_modules/readable-stream/GOVERNANCE.md | 136 + node_modules/readable-stream/LICENSE | 47 + node_modules/readable-stream/README.md | 58 + .../doc/wg-meetings/2015-01-30.md | 60 + .../readable-stream/duplex-browser.js | 1 + node_modules/readable-stream/duplex.js | 1 + .../readable-stream/lib/_stream_duplex.js | 131 + .../lib/_stream_passthrough.js | 47 + .../readable-stream/lib/_stream_readable.js | 1019 ++ .../readable-stream/lib/_stream_transform.js | 214 + .../readable-stream/lib/_stream_writable.js | 687 ++ .../lib/internal/streams/BufferList.js | 79 + .../lib/internal/streams/destroy.js | 74 + .../lib/internal/streams/stream-browser.js | 1 + .../lib/internal/streams/stream.js | 1 + node_modules/readable-stream/package.json | 81 + node_modules/readable-stream/passthrough.js | 1 + .../readable-stream/readable-browser.js | 7 + node_modules/readable-stream/readable.js | 19 + node_modules/readable-stream/transform.js | 1 + .../readable-stream/writable-browser.js | 1 + node_modules/readable-stream/writable.js | 8 + node_modules/readdirp/LICENSE | 21 + node_modules/readdirp/README.md | 122 + node_modules/readdirp/index.d.ts | 43 + node_modules/readdirp/index.js | 282 + node_modules/readdirp/package.json | 158 + node_modules/registry-auth-token/CHANGELOG.md | 134 + node_modules/registry-auth-token/LICENSE | 21 + node_modules/registry-auth-token/README.md | 65 + node_modules/registry-auth-token/base64.js | 12 + node_modules/registry-auth-token/index.js | 142 + node_modules/registry-auth-token/package.json | 76 + .../registry-auth-token/registry-url.js | 5 + node_modules/registry-url/index.d.ts | 33 + node_modules/registry-url/index.js | 12 + node_modules/registry-url/license | 9 + node_modules/registry-url/package.json | 76 + node_modules/registry-url/readme.md | 50 + node_modules/responselike/LICENSE | 19 + node_modules/responselike/README.md | 77 + node_modules/responselike/package.json | 69 + node_modules/responselike/src/index.js | 34 + node_modules/rimraf/CHANGELOG.md | 65 + node_modules/rimraf/LICENSE | 15 + node_modules/rimraf/README.md | 101 + node_modules/rimraf/bin.js | 68 + node_modules/rimraf/package.json | 70 + node_modules/rimraf/rimraf.js | 360 + node_modules/safe-buffer/LICENSE | 21 + node_modules/safe-buffer/README.md | 584 ++ node_modules/safe-buffer/index.d.ts | 187 + node_modules/safe-buffer/index.js | 62 + node_modules/safe-buffer/package.json | 63 + node_modules/safer-buffer/LICENSE | 21 + node_modules/safer-buffer/Porting-Buffer.md | 268 + node_modules/safer-buffer/Readme.md | 156 + node_modules/safer-buffer/dangerous.js | 58 + node_modules/safer-buffer/package.json | 60 + node_modules/safer-buffer/safer.js | 77 + node_modules/safer-buffer/tests.js | 406 + node_modules/semver-diff/index.d.ts | 58 + node_modules/semver-diff/index.js | 13 + node_modules/semver-diff/license | 9 + .../semver-diff/node_modules/.bin/semver | 1 + .../node_modules/semver/CHANGELOG.md | 70 + .../semver-diff/node_modules/semver/LICENSE | 15 + .../semver-diff/node_modules/semver/README.md | 443 + .../node_modules/semver/bin/semver.js | 174 + .../node_modules/semver/package.json | 60 + .../semver-diff/node_modules/semver/range.bnf | 16 + .../semver-diff/node_modules/semver/semver.js | 1596 ++++ node_modules/semver-diff/package.json | 69 + node_modules/semver-diff/readme.md | 77 + node_modules/semver/CHANGELOG.md | 39 + node_modules/semver/LICENSE | 15 + node_modules/semver/README.md | 412 + node_modules/semver/bin/semver | 160 + node_modules/semver/package.json | 60 + node_modules/semver/range.bnf | 16 + node_modules/semver/semver.js | 1483 +++ node_modules/send/HISTORY.md | 496 + node_modules/send/LICENSE | 23 + node_modules/send/README.md | 329 + node_modules/send/index.js | 1129 +++ node_modules/send/node_modules/ms/index.js | 162 + node_modules/send/node_modules/ms/license.md | 21 + .../send/node_modules/ms/package.json | 69 + node_modules/send/node_modules/ms/readme.md | 60 + node_modules/send/package.json | 106 + node_modules/serve-static/HISTORY.md | 451 + node_modules/serve-static/LICENSE | 25 + node_modules/serve-static/README.md | 259 + node_modules/serve-static/index.js | 210 + node_modules/serve-static/package.json | 77 + node_modules/set-blocking/CHANGELOG.md | 26 + node_modules/set-blocking/LICENSE.txt | 14 + node_modules/set-blocking/README.md | 31 + node_modules/set-blocking/index.js | 7 + node_modules/set-blocking/package.json | 70 + node_modules/setprototypeof/LICENSE | 13 + node_modules/setprototypeof/README.md | 31 + node_modules/setprototypeof/index.d.ts | 2 + node_modules/setprototypeof/index.js | 17 + node_modules/setprototypeof/package.json | 64 + node_modules/setprototypeof/test/index.js | 24 + node_modules/signal-exit/CHANGELOG.md | 35 + node_modules/signal-exit/LICENSE.txt | 16 + node_modules/signal-exit/README.md | 39 + node_modules/signal-exit/index.js | 163 + node_modules/signal-exit/package.json | 66 + node_modules/signal-exit/signals.js | 53 + node_modules/statuses/HISTORY.md | 65 + node_modules/statuses/LICENSE | 23 + node_modules/statuses/README.md | 127 + node_modules/statuses/codes.json | 66 + node_modules/statuses/index.js | 113 + node_modules/statuses/package.json | 90 + node_modules/string-width/index.d.ts | 29 + node_modules/string-width/index.js | 47 + node_modules/string-width/license | 9 + .../node_modules/ansi-regex/index.d.ts | 37 + .../node_modules/ansi-regex/index.js | 10 + .../node_modules/ansi-regex/license | 9 + .../node_modules/ansi-regex/package.json | 87 + .../node_modules/ansi-regex/readme.md | 78 + .../node_modules/emoji-regex/LICENSE-MIT.txt | 20 + .../node_modules/emoji-regex/README.md | 73 + .../node_modules/emoji-regex/es2015/index.js | 6 + .../node_modules/emoji-regex/es2015/text.js | 6 + .../node_modules/emoji-regex/index.d.ts | 23 + .../node_modules/emoji-regex/index.js | 6 + .../node_modules/emoji-regex/package.json | 77 + .../node_modules/emoji-regex/text.js | 6 + .../is-fullwidth-code-point/index.d.ts | 17 + .../is-fullwidth-code-point/index.js | 50 + .../is-fullwidth-code-point/license | 9 + .../is-fullwidth-code-point/package.json | 74 + .../is-fullwidth-code-point/readme.md | 39 + .../node_modules/strip-ansi/index.d.ts | 17 + .../node_modules/strip-ansi/index.js | 4 + .../node_modules/strip-ansi/license | 9 + .../node_modules/strip-ansi/package.json | 86 + .../node_modules/strip-ansi/readme.md | 46 + node_modules/string-width/package.json | 89 + node_modules/string-width/readme.md | 50 + node_modules/string_decoder/.travis.yml | 50 + node_modules/string_decoder/LICENSE | 48 + node_modules/string_decoder/README.md | 47 + .../string_decoder/lib/string_decoder.js | 296 + node_modules/string_decoder/package.json | 59 + node_modules/strip-ansi/index.d.ts | 15 + node_modules/strip-ansi/index.js | 7 + node_modules/strip-ansi/license | 9 + node_modules/strip-ansi/package.json | 86 + node_modules/strip-ansi/readme.md | 61 + node_modules/strip-json-comments/index.js | 70 + node_modules/strip-json-comments/license | 21 + node_modules/strip-json-comments/package.json | 74 + node_modules/strip-json-comments/readme.md | 64 + node_modules/supports-color/browser.js | 5 + node_modules/supports-color/index.js | 131 + node_modules/supports-color/license | 9 + node_modules/supports-color/package.json | 85 + node_modules/supports-color/readme.md | 66 + node_modules/tar/CHANGELOG.md | 68 + node_modules/tar/LICENSE | 15 + node_modules/tar/README.md | 1042 +++ node_modules/tar/index.js | 18 + node_modules/tar/lib/create.js | 104 + node_modules/tar/lib/extract.js | 106 + node_modules/tar/lib/get-write-flag.js | 20 + node_modules/tar/lib/header.js | 288 + node_modules/tar/lib/high-level-opt.js | 29 + node_modules/tar/lib/large-numbers.js | 99 + node_modules/tar/lib/list.js | 131 + node_modules/tar/lib/mkdir.js | 206 + node_modules/tar/lib/mode-fix.js | 23 + node_modules/tar/lib/pack.js | 407 + node_modules/tar/lib/parse.js | 481 + node_modules/tar/lib/path-reservations.js | 125 + node_modules/tar/lib/pax.js | 143 + node_modules/tar/lib/read-entry.js | 99 + node_modules/tar/lib/replace.js | 222 + node_modules/tar/lib/types.js | 44 + node_modules/tar/lib/unpack.js | 680 ++ node_modules/tar/lib/update.js | 36 + node_modules/tar/lib/warn-mixin.js | 21 + node_modules/tar/lib/winchars.js | 23 + node_modules/tar/lib/write-entry.js | 435 + node_modules/tar/package.json | 90 + node_modules/term-size/index.d.ts | 21 + node_modules/term-size/index.js | 72 + node_modules/term-size/license | 9 + node_modules/term-size/package.json | 75 + node_modules/term-size/readme.md | 48 + node_modules/term-size/vendor/.DS_Store | Bin 0 -> 8196 bytes node_modules/term-size/vendor/macos/.DS_Store | Bin 0 -> 6148 bytes node_modules/term-size/vendor/macos/term-size | Bin 0 -> 27264 bytes .../term-size/vendor/windows/term-size.exe | Bin 0 -> 17408 bytes node_modules/to-readable-stream/index.js | 11 + node_modules/to-readable-stream/license | 9 + node_modules/to-readable-stream/package.json | 72 + node_modules/to-readable-stream/readme.md | 42 + node_modules/to-regex-range/LICENSE | 21 + node_modules/to-regex-range/README.md | 305 + node_modules/to-regex-range/index.js | 288 + node_modules/to-regex-range/package.json | 125 + node_modules/toidentifier/LICENSE | 21 + node_modules/toidentifier/README.md | 61 + node_modules/toidentifier/index.js | 30 + node_modules/toidentifier/package.json | 76 + node_modules/touch/LICENSE | 15 + node_modules/touch/README.md | 52 + node_modules/touch/bin/nodetouch.js | 112 + node_modules/touch/index.js | 224 + node_modules/touch/package.json | 64 + node_modules/type-fest/index.d.ts | 20 + node_modules/type-fest/license | 9 + node_modules/type-fest/package.json | 83 + node_modules/type-fest/readme.md | 635 ++ node_modules/type-fest/source/basic.d.ts | 67 + node_modules/type-fest/source/except.d.ts | 22 + .../type-fest/source/literal-union.d.ts | 33 + .../type-fest/source/merge-exclusive.d.ts | 39 + node_modules/type-fest/source/merge.d.ts | 22 + node_modules/type-fest/source/mutable.d.ts | 22 + node_modules/type-fest/source/opaque.d.ts | 40 + .../type-fest/source/package-json.d.ts | 501 + .../type-fest/source/partial-deep.d.ts | 72 + node_modules/type-fest/source/promisable.d.ts | 23 + .../type-fest/source/readonly-deep.d.ts | 59 + .../source/require-at-least-one.d.ts | 32 + .../type-fest/source/require-exactly-one.d.ts | 36 + .../type-fest/source/set-optional.d.ts | 32 + .../type-fest/source/set-required.d.ts | 32 + node_modules/type-is/HISTORY.md | 259 + node_modules/type-is/LICENSE | 23 + node_modules/type-is/README.md | 170 + node_modules/type-is/index.js | 266 + node_modules/type-is/package.json | 85 + node_modules/typedarray-to-buffer/.airtap.yml | 15 + node_modules/typedarray-to-buffer/.travis.yml | 11 + node_modules/typedarray-to-buffer/LICENSE | 21 + node_modules/typedarray-to-buffer/README.md | 85 + node_modules/typedarray-to-buffer/index.js | 25 + .../typedarray-to-buffer/package.json | 75 + .../typedarray-to-buffer/test/basic.js | 50 + node_modules/undefsafe/.jscsrc | 13 + node_modules/undefsafe/.jshintrc | 16 + node_modules/undefsafe/.npmignore | 2 + node_modules/undefsafe/.travis.yml | 18 + node_modules/undefsafe/LICENSE | 22 + node_modules/undefsafe/README.md | 63 + node_modules/undefsafe/example.js | 14 + node_modules/undefsafe/lib/undefsafe.js | 125 + node_modules/undefsafe/package.json | 67 + node_modules/unique-string/index.d.ts | 16 + node_modules/unique-string/index.js | 4 + node_modules/unique-string/license | 9 + node_modules/unique-string/package.json | 72 + node_modules/unique-string/readme.md | 32 + node_modules/unpipe/HISTORY.md | 4 + node_modules/unpipe/LICENSE | 22 + node_modules/unpipe/README.md | 43 + node_modules/unpipe/index.js | 69 + node_modules/unpipe/package.json | 63 + node_modules/update-notifier/check.js | 28 + node_modules/update-notifier/index.js | 187 + node_modules/update-notifier/license | 9 + node_modules/update-notifier/package.json | 96 + node_modules/update-notifier/readme.md | 223 + node_modules/url-parse-lax/index.js | 12 + node_modules/url-parse-lax/license | 9 + node_modules/url-parse-lax/package.json | 74 + node_modules/url-parse-lax/readme.md | 127 + node_modules/util-deprecate/History.md | 16 + node_modules/util-deprecate/LICENSE | 24 + node_modules/util-deprecate/README.md | 53 + node_modules/util-deprecate/browser.js | 67 + node_modules/util-deprecate/node.js | 6 + node_modules/util-deprecate/package.json | 56 + node_modules/utils-merge/.npmignore | 9 + node_modules/utils-merge/LICENSE | 20 + node_modules/utils-merge/README.md | 34 + node_modules/utils-merge/index.js | 23 + node_modules/utils-merge/package.json | 66 + node_modules/vary/HISTORY.md | 39 + node_modules/vary/LICENSE | 22 + node_modules/vary/README.md | 101 + node_modules/vary/index.js | 149 + node_modules/vary/package.json | 78 + node_modules/wide-align/LICENSE | 14 + node_modules/wide-align/README.md | 47 + node_modules/wide-align/align.js | 65 + .../node_modules/ansi-regex/index.js | 10 + .../node_modules/ansi-regex/license | 9 + .../node_modules/ansi-regex/package.json | 85 + .../node_modules/ansi-regex/readme.md | 46 + .../node_modules/string-width/index.js | 36 + .../node_modules/string-width/license | 9 + .../node_modules/string-width/package.json | 87 + .../node_modules/string-width/readme.md | 42 + .../node_modules/strip-ansi/index.js | 4 + .../node_modules/strip-ansi/license | 9 + .../node_modules/strip-ansi/package.json | 84 + .../node_modules/strip-ansi/readme.md | 39 + node_modules/wide-align/package.json | 68 + node_modules/widest-line/index.d.ts | 21 + node_modules/widest-line/index.js | 16 + node_modules/widest-line/license | 9 + node_modules/widest-line/package.json | 86 + node_modules/widest-line/readme.md | 34 + node_modules/wrappy/LICENSE | 15 + node_modules/wrappy/README.md | 36 + node_modules/wrappy/package.json | 58 + node_modules/wrappy/wrappy.js | 33 + node_modules/write-file-atomic/CHANGELOG.md | 32 + node_modules/write-file-atomic/LICENSE | 6 + node_modules/write-file-atomic/README.md | 72 + node_modules/write-file-atomic/index.js | 259 + node_modules/write-file-atomic/package.json | 77 + node_modules/xdg-basedir/index.d.ts | 81 + node_modules/xdg-basedir/index.js | 28 + node_modules/xdg-basedir/license | 9 + node_modules/xdg-basedir/package.json | 74 + node_modules/xdg-basedir/readme.md | 60 + node_modules/yallist/LICENSE | 15 + node_modules/yallist/README.md | 204 + node_modules/yallist/iterator.js | 8 + node_modules/yallist/package.json | 65 + node_modules/yallist/yallist.js | 426 + package-lock.json | 1851 ++++ package.json | 30 + 1672 files changed, 198899 insertions(+) create mode 100644 file.js create mode 120000 node_modules/.bin/detect-libc create mode 120000 node_modules/.bin/is-ci create mode 120000 node_modules/.bin/mime create mode 120000 node_modules/.bin/mkdirp create mode 120000 node_modules/.bin/node-pre-gyp create mode 120000 node_modules/.bin/nodemon create mode 120000 node_modules/.bin/nodetouch create mode 120000 node_modules/.bin/nopt create mode 120000 node_modules/.bin/rc create mode 120000 node_modules/.bin/rimraf create mode 120000 node_modules/.bin/semver create mode 100644 node_modules/@mapbox/node-pre-gyp/CHANGELOG.md create mode 100644 node_modules/@mapbox/node-pre-gyp/LICENSE create mode 100644 node_modules/@mapbox/node-pre-gyp/README.md create mode 100755 node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp create mode 100644 node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd create mode 100644 node_modules/@mapbox/node-pre-gyp/contributing.md create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/build.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/clean.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/configure.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/info.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/install.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/main.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/package.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/publish.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/rebuild.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/reinstall.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/reveal.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/testbinary.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/testpackage.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/unpublish.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/compile.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/napi.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js create mode 100644 node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js create mode 120000 node_modules/@mapbox/node-pre-gyp/node_modules/.bin/nopt create mode 120000 node_modules/@mapbox/node-pre-gyp/node_modules/.bin/semver create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/nopt/CHANGELOG.md create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/nopt/LICENSE create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/nopt/README.md create mode 100755 node_modules/@mapbox/node-pre-gyp/node_modules/nopt/bin/nopt.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/nopt/lib/nopt.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/nopt/package.json create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/CHANGELOG.md create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/LICENSE create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/README.md create mode 100755 node_modules/@mapbox/node-pre-gyp/node_modules/semver/bin/semver.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/comparator.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/index.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/range.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/semver.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/clean.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/cmp.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/coerce.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-build.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-loose.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/diff.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/eq.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gt.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gte.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/inc.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lt.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lte.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/major.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/minor.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/neq.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/parse.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/patch.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/prerelease.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rcompare.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rsort.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/satisfies.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/sort.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/valid.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/index.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/constants.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/debug.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/identifiers.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/parse-options.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/re.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/package.json create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/preload.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/range.bnf create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/gtr.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/intersects.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/ltr.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/max-satisfying.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-satisfying.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-version.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/outside.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/simplify.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/subset.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/to-comparators.js create mode 100644 node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/valid.js create mode 100644 node_modules/@mapbox/node-pre-gyp/package.json create mode 100644 node_modules/@sindresorhus/is/dist/index.d.ts create mode 100644 node_modules/@sindresorhus/is/dist/index.js create mode 100644 node_modules/@sindresorhus/is/dist/index.js.map create mode 100644 node_modules/@sindresorhus/is/license create mode 100644 node_modules/@sindresorhus/is/package.json create mode 100644 node_modules/@sindresorhus/is/readme.md create mode 100755 node_modules/@szmarczak/http-timer/LICENSE create mode 100755 node_modules/@szmarczak/http-timer/README.md create mode 100755 node_modules/@szmarczak/http-timer/package.json create mode 100755 node_modules/@szmarczak/http-timer/source/index.js create mode 100644 node_modules/abbrev/LICENSE create mode 100644 node_modules/abbrev/README.md create mode 100644 node_modules/abbrev/abbrev.js create mode 100644 node_modules/abbrev/package.json create mode 100644 node_modules/accepts/HISTORY.md create mode 100644 node_modules/accepts/LICENSE create mode 100644 node_modules/accepts/README.md create mode 100644 node_modules/accepts/index.js create mode 100644 node_modules/accepts/package.json create mode 100644 node_modules/agent-base/README.md create mode 100644 node_modules/agent-base/dist/src/index.d.ts create mode 100644 node_modules/agent-base/dist/src/index.js create mode 100644 node_modules/agent-base/dist/src/index.js.map create mode 100644 node_modules/agent-base/dist/src/promisify.d.ts create mode 100644 node_modules/agent-base/dist/src/promisify.js create mode 100644 node_modules/agent-base/dist/src/promisify.js.map create mode 100644 node_modules/agent-base/node_modules/debug/LICENSE create mode 100644 node_modules/agent-base/node_modules/debug/README.md create mode 100644 node_modules/agent-base/node_modules/debug/package.json create mode 100644 node_modules/agent-base/node_modules/debug/src/browser.js create mode 100644 node_modules/agent-base/node_modules/debug/src/common.js create mode 100644 node_modules/agent-base/node_modules/debug/src/index.js create mode 100644 node_modules/agent-base/node_modules/debug/src/node.js create mode 100644 node_modules/agent-base/node_modules/ms/index.js create mode 100644 node_modules/agent-base/node_modules/ms/license.md create mode 100644 node_modules/agent-base/node_modules/ms/package.json create mode 100644 node_modules/agent-base/node_modules/ms/readme.md create mode 100644 node_modules/agent-base/package.json create mode 100644 node_modules/agent-base/src/index.ts create mode 100644 node_modules/agent-base/src/promisify.ts create mode 100644 node_modules/ansi-align/CHANGELOG.md create mode 100644 node_modules/ansi-align/LICENSE create mode 100644 node_modules/ansi-align/README.md create mode 100644 node_modules/ansi-align/index.js create mode 100644 node_modules/ansi-align/node_modules/string-width/index.js create mode 100644 node_modules/ansi-align/node_modules/string-width/license create mode 100644 node_modules/ansi-align/node_modules/string-width/package.json create mode 100644 node_modules/ansi-align/node_modules/string-width/readme.md create mode 100644 node_modules/ansi-align/package.json create mode 100644 node_modules/ansi-regex/index.js create mode 100644 node_modules/ansi-regex/license create mode 100644 node_modules/ansi-regex/package.json create mode 100644 node_modules/ansi-regex/readme.md create mode 100644 node_modules/ansi-styles/index.d.ts create mode 100644 node_modules/ansi-styles/index.js create mode 100644 node_modules/ansi-styles/license create mode 100644 node_modules/ansi-styles/package.json create mode 100644 node_modules/ansi-styles/readme.md create mode 100644 node_modules/anymatch/LICENSE create mode 100644 node_modules/anymatch/README.md create mode 100644 node_modules/anymatch/index.d.ts create mode 100644 node_modules/anymatch/index.js create mode 100644 node_modules/anymatch/package.json create mode 100644 node_modules/aproba/LICENSE create mode 100644 node_modules/aproba/README.md create mode 100644 node_modules/aproba/index.js create mode 100644 node_modules/aproba/package.json create mode 100644 node_modules/are-we-there-yet/CHANGES.md create mode 100644 node_modules/are-we-there-yet/LICENSE create mode 100644 node_modules/are-we-there-yet/README.md create mode 100644 node_modules/are-we-there-yet/index.js create mode 100644 node_modules/are-we-there-yet/package.json create mode 100644 node_modules/are-we-there-yet/tracker-base.js create mode 100644 node_modules/are-we-there-yet/tracker-group.js create mode 100644 node_modules/are-we-there-yet/tracker-stream.js create mode 100644 node_modules/are-we-there-yet/tracker.js create mode 100644 node_modules/array-flatten/LICENSE create mode 100644 node_modules/array-flatten/README.md create mode 100644 node_modules/array-flatten/array-flatten.js create mode 100644 node_modules/array-flatten/package.json create mode 100644 node_modules/balanced-match/.github/FUNDING.yml create mode 100644 node_modules/balanced-match/LICENSE.md create mode 100644 node_modules/balanced-match/README.md create mode 100644 node_modules/balanced-match/index.js create mode 100644 node_modules/balanced-match/package.json create mode 100644 node_modules/basic-auth/HISTORY.md create mode 100644 node_modules/basic-auth/LICENSE create mode 100644 node_modules/basic-auth/README.md create mode 100644 node_modules/basic-auth/index.js create mode 100644 node_modules/basic-auth/package.json create mode 100644 node_modules/bcrypt/.editorconfig create mode 100644 node_modules/bcrypt/.travis.yml create mode 100644 node_modules/bcrypt/CHANGELOG.md create mode 100644 node_modules/bcrypt/ISSUE_TEMPLATE.md create mode 100644 node_modules/bcrypt/LICENSE create mode 100644 node_modules/bcrypt/Makefile create mode 100644 node_modules/bcrypt/README.md create mode 100644 node_modules/bcrypt/SECURITY.md create mode 100644 node_modules/bcrypt/appveyor.yml create mode 100644 node_modules/bcrypt/bcrypt.js create mode 100644 node_modules/bcrypt/binding.gyp create mode 100644 node_modules/bcrypt/examples/async_compare.js create mode 100644 node_modules/bcrypt/examples/forever_gen_salt.js create mode 100755 node_modules/bcrypt/lib/binding/napi-v3/bcrypt_lib.node create mode 100644 node_modules/bcrypt/package.json create mode 100644 node_modules/bcrypt/promises.js create mode 100644 node_modules/bcrypt/src/bcrypt.cc create mode 100644 node_modules/bcrypt/src/bcrypt_node.cc create mode 100644 node_modules/bcrypt/src/blowfish.cc create mode 100644 node_modules/bcrypt/src/node_blf.h create mode 100644 node_modules/bcrypt/test/async.js create mode 100644 node_modules/bcrypt/test/implementation.js create mode 100644 node_modules/bcrypt/test/promise.js create mode 100644 node_modules/bcrypt/test/repetitions.js create mode 100644 node_modules/bcrypt/test/sync.js create mode 100755 node_modules/bcrypt/test_alpine.sh create mode 100644 node_modules/binary-extensions/binary-extensions.json create mode 100644 node_modules/binary-extensions/binary-extensions.json.d.ts create mode 100644 node_modules/binary-extensions/index.d.ts create mode 100644 node_modules/binary-extensions/index.js create mode 100644 node_modules/binary-extensions/license create mode 100644 node_modules/binary-extensions/package.json create mode 100644 node_modules/binary-extensions/readme.md create mode 100644 node_modules/body-parser/HISTORY.md create mode 100644 node_modules/body-parser/LICENSE create mode 100644 node_modules/body-parser/README.md create mode 100644 node_modules/body-parser/index.js create mode 100644 node_modules/body-parser/lib/read.js create mode 100644 node_modules/body-parser/lib/types/json.js create mode 100644 node_modules/body-parser/lib/types/raw.js create mode 100644 node_modules/body-parser/lib/types/text.js create mode 100644 node_modules/body-parser/lib/types/urlencoded.js create mode 100644 node_modules/body-parser/package.json create mode 100644 node_modules/boxen/index.d.ts create mode 100644 node_modules/boxen/index.js create mode 100644 node_modules/boxen/license create mode 100644 node_modules/boxen/package.json create mode 100644 node_modules/boxen/readme.md create mode 100644 node_modules/brace-expansion/LICENSE create mode 100644 node_modules/brace-expansion/README.md create mode 100644 node_modules/brace-expansion/index.js create mode 100644 node_modules/brace-expansion/package.json create mode 100644 node_modules/braces/CHANGELOG.md create mode 100644 node_modules/braces/LICENSE create mode 100644 node_modules/braces/README.md create mode 100644 node_modules/braces/index.js create mode 100644 node_modules/braces/lib/compile.js create mode 100644 node_modules/braces/lib/constants.js create mode 100644 node_modules/braces/lib/expand.js create mode 100644 node_modules/braces/lib/parse.js create mode 100644 node_modules/braces/lib/stringify.js create mode 100644 node_modules/braces/lib/utils.js create mode 100644 node_modules/braces/package.json create mode 100644 node_modules/buffer-equal-constant-time/.npmignore create mode 100644 node_modules/buffer-equal-constant-time/.travis.yml create mode 100644 node_modules/buffer-equal-constant-time/LICENSE.txt create mode 100644 node_modules/buffer-equal-constant-time/README.md create mode 100644 node_modules/buffer-equal-constant-time/index.js create mode 100644 node_modules/buffer-equal-constant-time/package.json create mode 100644 node_modules/buffer-equal-constant-time/test.js create mode 100644 node_modules/bytes/History.md create mode 100644 node_modules/bytes/LICENSE create mode 100644 node_modules/bytes/Readme.md create mode 100644 node_modules/bytes/index.js create mode 100644 node_modules/bytes/package.json create mode 100644 node_modules/cacheable-request/LICENSE create mode 100644 node_modules/cacheable-request/README.md create mode 100644 node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js create mode 100644 node_modules/cacheable-request/node_modules/get-stream/index.d.ts create mode 100644 node_modules/cacheable-request/node_modules/get-stream/index.js create mode 100644 node_modules/cacheable-request/node_modules/get-stream/license create mode 100644 node_modules/cacheable-request/node_modules/get-stream/package.json create mode 100644 node_modules/cacheable-request/node_modules/get-stream/readme.md create mode 100644 node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts create mode 100644 node_modules/cacheable-request/node_modules/lowercase-keys/index.js create mode 100644 node_modules/cacheable-request/node_modules/lowercase-keys/license create mode 100644 node_modules/cacheable-request/node_modules/lowercase-keys/package.json create mode 100644 node_modules/cacheable-request/node_modules/lowercase-keys/readme.md create mode 100644 node_modules/cacheable-request/package.json create mode 100644 node_modules/cacheable-request/src/index.js create mode 100644 node_modules/camelcase/index.d.ts create mode 100644 node_modules/camelcase/index.js create mode 100644 node_modules/camelcase/license create mode 100644 node_modules/camelcase/package.json create mode 100644 node_modules/camelcase/readme.md create mode 100644 node_modules/chalk/index.d.ts create mode 100644 node_modules/chalk/license create mode 100644 node_modules/chalk/node_modules/has-flag/index.d.ts create mode 100644 node_modules/chalk/node_modules/has-flag/index.js create mode 100644 node_modules/chalk/node_modules/has-flag/license create mode 100644 node_modules/chalk/node_modules/has-flag/package.json create mode 100644 node_modules/chalk/node_modules/has-flag/readme.md create mode 100644 node_modules/chalk/node_modules/supports-color/browser.js create mode 100644 node_modules/chalk/node_modules/supports-color/index.js create mode 100644 node_modules/chalk/node_modules/supports-color/license create mode 100644 node_modules/chalk/node_modules/supports-color/package.json create mode 100644 node_modules/chalk/node_modules/supports-color/readme.md create mode 100644 node_modules/chalk/package.json create mode 100644 node_modules/chalk/readme.md create mode 100644 node_modules/chalk/source/index.js create mode 100644 node_modules/chalk/source/templates.js create mode 100644 node_modules/chalk/source/util.js create mode 100644 node_modules/chokidar/LICENSE create mode 100644 node_modules/chokidar/README.md create mode 100644 node_modules/chokidar/index.js create mode 100644 node_modules/chokidar/lib/constants.js create mode 100644 node_modules/chokidar/lib/fsevents-handler.js create mode 100644 node_modules/chokidar/lib/nodefs-handler.js create mode 100644 node_modules/chokidar/package.json create mode 100644 node_modules/chokidar/types/index.d.ts create mode 100644 node_modules/chownr/LICENSE create mode 100644 node_modules/chownr/README.md create mode 100644 node_modules/chownr/chownr.js create mode 100644 node_modules/chownr/package.json create mode 100644 node_modules/ci-info/CHANGELOG.md create mode 100644 node_modules/ci-info/LICENSE create mode 100644 node_modules/ci-info/README.md create mode 100644 node_modules/ci-info/index.js create mode 100644 node_modules/ci-info/package.json create mode 100644 node_modules/ci-info/vendors.json create mode 100644 node_modules/cli-boxes/boxes.json create mode 100644 node_modules/cli-boxes/index.d.ts create mode 100644 node_modules/cli-boxes/index.js create mode 100644 node_modules/cli-boxes/license create mode 100644 node_modules/cli-boxes/package.json create mode 100644 node_modules/cli-boxes/readme.md create mode 100644 node_modules/clone-response/LICENSE create mode 100644 node_modules/clone-response/README.md create mode 100644 node_modules/clone-response/package.json create mode 100644 node_modules/clone-response/src/index.js create mode 100644 node_modules/code-point-at/index.js create mode 100644 node_modules/code-point-at/license create mode 100644 node_modules/code-point-at/package.json create mode 100644 node_modules/code-point-at/readme.md create mode 100644 node_modules/color-convert/CHANGELOG.md create mode 100644 node_modules/color-convert/LICENSE create mode 100644 node_modules/color-convert/README.md create mode 100644 node_modules/color-convert/conversions.js create mode 100644 node_modules/color-convert/index.js create mode 100644 node_modules/color-convert/package.json create mode 100644 node_modules/color-convert/route.js create mode 100644 node_modules/color-name/LICENSE create mode 100644 node_modules/color-name/README.md create mode 100644 node_modules/color-name/index.js create mode 100644 node_modules/color-name/package.json create mode 100644 node_modules/concat-map/.travis.yml create mode 100644 node_modules/concat-map/LICENSE create mode 100644 node_modules/concat-map/README.markdown create mode 100644 node_modules/concat-map/example/map.js create mode 100644 node_modules/concat-map/index.js create mode 100644 node_modules/concat-map/package.json create mode 100644 node_modules/concat-map/test/map.js create mode 100644 node_modules/configstore/index.js create mode 100644 node_modules/configstore/license create mode 100644 node_modules/configstore/package.json create mode 100644 node_modules/configstore/readme.md create mode 100644 node_modules/console-control-strings/LICENSE create mode 100644 node_modules/console-control-strings/README.md create mode 100644 node_modules/console-control-strings/README.md~ create mode 100644 node_modules/console-control-strings/index.js create mode 100644 node_modules/console-control-strings/package.json create mode 100644 node_modules/content-disposition/HISTORY.md create mode 100644 node_modules/content-disposition/LICENSE create mode 100644 node_modules/content-disposition/README.md create mode 100644 node_modules/content-disposition/index.js create mode 100644 node_modules/content-disposition/package.json create mode 100644 node_modules/content-type/HISTORY.md create mode 100644 node_modules/content-type/LICENSE create mode 100644 node_modules/content-type/README.md create mode 100644 node_modules/content-type/index.js create mode 100644 node_modules/content-type/package.json create mode 100644 node_modules/cookie-signature/.npmignore create mode 100644 node_modules/cookie-signature/History.md create mode 100644 node_modules/cookie-signature/Readme.md create mode 100644 node_modules/cookie-signature/index.js create mode 100644 node_modules/cookie-signature/package.json create mode 100644 node_modules/cookie/HISTORY.md create mode 100644 node_modules/cookie/LICENSE create mode 100644 node_modules/cookie/README.md create mode 100644 node_modules/cookie/index.js create mode 100644 node_modules/cookie/package.json create mode 100644 node_modules/core-util-is/LICENSE create mode 100644 node_modules/core-util-is/README.md create mode 100644 node_modules/core-util-is/float.patch create mode 100644 node_modules/core-util-is/lib/util.js create mode 100644 node_modules/core-util-is/package.json create mode 100644 node_modules/core-util-is/test.js create mode 100644 node_modules/crypto-random-string/index.d.ts create mode 100644 node_modules/crypto-random-string/index.js create mode 100644 node_modules/crypto-random-string/license create mode 100644 node_modules/crypto-random-string/package.json create mode 100644 node_modules/crypto-random-string/readme.md create mode 100644 node_modules/debug/.coveralls.yml create mode 100644 node_modules/debug/.eslintrc create mode 100644 node_modules/debug/.npmignore create mode 100644 node_modules/debug/.travis.yml create mode 100644 node_modules/debug/CHANGELOG.md create mode 100644 node_modules/debug/LICENSE create mode 100644 node_modules/debug/Makefile create mode 100644 node_modules/debug/README.md create mode 100644 node_modules/debug/component.json create mode 100644 node_modules/debug/karma.conf.js create mode 100644 node_modules/debug/node.js create mode 100644 node_modules/debug/package.json create mode 100644 node_modules/debug/src/browser.js create mode 100644 node_modules/debug/src/debug.js create mode 100644 node_modules/debug/src/index.js create mode 100644 node_modules/debug/src/inspector-log.js create mode 100644 node_modules/debug/src/node.js create mode 100644 node_modules/decompress-response/index.js create mode 100644 node_modules/decompress-response/license create mode 100644 node_modules/decompress-response/package.json create mode 100644 node_modules/decompress-response/readme.md create mode 100644 node_modules/deep-extend/CHANGELOG.md create mode 100644 node_modules/deep-extend/LICENSE create mode 100644 node_modules/deep-extend/README.md create mode 100644 node_modules/deep-extend/index.js create mode 100644 node_modules/deep-extend/lib/deep-extend.js create mode 100644 node_modules/deep-extend/package.json create mode 100644 node_modules/defer-to-connect/LICENSE create mode 100644 node_modules/defer-to-connect/README.md create mode 100644 node_modules/defer-to-connect/dist/index.d.ts create mode 100644 node_modules/defer-to-connect/dist/index.js create mode 100644 node_modules/defer-to-connect/package.json create mode 100644 node_modules/delegates/.npmignore create mode 100644 node_modules/delegates/History.md create mode 100644 node_modules/delegates/License create mode 100644 node_modules/delegates/Makefile create mode 100644 node_modules/delegates/Readme.md create mode 100644 node_modules/delegates/index.js create mode 100644 node_modules/delegates/package.json create mode 100644 node_modules/delegates/test/index.js create mode 100644 node_modules/depd/History.md create mode 100644 node_modules/depd/LICENSE create mode 100644 node_modules/depd/Readme.md create mode 100644 node_modules/depd/index.js create mode 100644 node_modules/depd/lib/browser/index.js create mode 100644 node_modules/depd/lib/compat/callsite-tostring.js create mode 100644 node_modules/depd/lib/compat/event-listener-count.js create mode 100644 node_modules/depd/lib/compat/index.js create mode 100644 node_modules/depd/package.json create mode 100644 node_modules/destroy/LICENSE create mode 100644 node_modules/destroy/README.md create mode 100644 node_modules/destroy/index.js create mode 100644 node_modules/destroy/package.json create mode 100644 node_modules/detect-libc/.npmignore create mode 100644 node_modules/detect-libc/LICENSE create mode 100644 node_modules/detect-libc/README.md create mode 100755 node_modules/detect-libc/bin/detect-libc.js create mode 100644 node_modules/detect-libc/lib/detect-libc.js create mode 100644 node_modules/detect-libc/package.json create mode 100644 node_modules/dot-prop/index.d.ts create mode 100644 node_modules/dot-prop/index.js create mode 100644 node_modules/dot-prop/license create mode 100644 node_modules/dot-prop/package.json create mode 100644 node_modules/dot-prop/readme.md create mode 100644 node_modules/dotenv/.github/FUNDING.yml create mode 100644 node_modules/dotenv/CHANGELOG.md create mode 100644 node_modules/dotenv/LICENSE create mode 100644 node_modules/dotenv/README.md create mode 100644 node_modules/dotenv/config.js create mode 100644 node_modules/dotenv/lib/cli-options.js create mode 100644 node_modules/dotenv/lib/env-options.js create mode 100644 node_modules/dotenv/lib/main.js create mode 100644 node_modules/dotenv/package.json create mode 100644 node_modules/dotenv/types/index.d.ts create mode 100644 node_modules/dotenv/types/test.ts create mode 100644 node_modules/dotenv/types/tsconfig.json create mode 100644 node_modules/dotenv/types/tslint.json create mode 100644 node_modules/duplexer3/LICENSE.md create mode 100644 node_modules/duplexer3/README.md create mode 100644 node_modules/duplexer3/index.js create mode 100644 node_modules/duplexer3/package.json create mode 100644 node_modules/ecdsa-sig-formatter/CODEOWNERS create mode 100644 node_modules/ecdsa-sig-formatter/LICENSE create mode 100644 node_modules/ecdsa-sig-formatter/README.md create mode 100644 node_modules/ecdsa-sig-formatter/package.json create mode 100644 node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts create mode 100644 node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.js create mode 100644 node_modules/ecdsa-sig-formatter/src/param-bytes-for-alg.js create mode 100644 node_modules/ee-first/LICENSE create mode 100644 node_modules/ee-first/README.md create mode 100644 node_modules/ee-first/index.js create mode 100644 node_modules/ee-first/package.json create mode 100644 node_modules/emoji-regex/LICENSE-MIT.txt create mode 100644 node_modules/emoji-regex/README.md create mode 100644 node_modules/emoji-regex/es2015/index.js create mode 100644 node_modules/emoji-regex/es2015/text.js create mode 100644 node_modules/emoji-regex/index.d.ts create mode 100644 node_modules/emoji-regex/index.js create mode 100644 node_modules/emoji-regex/package.json create mode 100644 node_modules/emoji-regex/text.js create mode 100644 node_modules/encodeurl/HISTORY.md create mode 100644 node_modules/encodeurl/LICENSE create mode 100644 node_modules/encodeurl/README.md create mode 100644 node_modules/encodeurl/index.js create mode 100644 node_modules/encodeurl/package.json create mode 100644 node_modules/end-of-stream/LICENSE create mode 100644 node_modules/end-of-stream/README.md create mode 100644 node_modules/end-of-stream/index.js create mode 100644 node_modules/end-of-stream/package.json create mode 100644 node_modules/escape-goat/index.d.ts create mode 100644 node_modules/escape-goat/index.js create mode 100644 node_modules/escape-goat/license create mode 100644 node_modules/escape-goat/package.json create mode 100644 node_modules/escape-goat/readme.md create mode 100644 node_modules/escape-html/LICENSE create mode 100644 node_modules/escape-html/Readme.md create mode 100644 node_modules/escape-html/index.js create mode 100644 node_modules/escape-html/package.json create mode 100644 node_modules/etag/HISTORY.md create mode 100644 node_modules/etag/LICENSE create mode 100644 node_modules/etag/README.md create mode 100644 node_modules/etag/index.js create mode 100644 node_modules/etag/package.json create mode 100644 node_modules/express/History.md create mode 100644 node_modules/express/LICENSE create mode 100644 node_modules/express/Readme.md create mode 100644 node_modules/express/index.js create mode 100644 node_modules/express/lib/application.js create mode 100644 node_modules/express/lib/express.js create mode 100644 node_modules/express/lib/middleware/init.js create mode 100644 node_modules/express/lib/middleware/query.js create mode 100644 node_modules/express/lib/request.js create mode 100644 node_modules/express/lib/response.js create mode 100644 node_modules/express/lib/router/index.js create mode 100644 node_modules/express/lib/router/layer.js create mode 100644 node_modules/express/lib/router/route.js create mode 100644 node_modules/express/lib/utils.js create mode 100644 node_modules/express/lib/view.js create mode 100644 node_modules/express/package.json create mode 100644 node_modules/fill-range/LICENSE create mode 100644 node_modules/fill-range/README.md create mode 100644 node_modules/fill-range/index.js create mode 100644 node_modules/fill-range/package.json create mode 100644 node_modules/finalhandler/HISTORY.md create mode 100644 node_modules/finalhandler/LICENSE create mode 100644 node_modules/finalhandler/README.md create mode 100644 node_modules/finalhandler/index.js create mode 100644 node_modules/finalhandler/package.json create mode 100644 node_modules/forwarded/HISTORY.md create mode 100644 node_modules/forwarded/LICENSE create mode 100644 node_modules/forwarded/README.md create mode 100644 node_modules/forwarded/index.js create mode 100644 node_modules/forwarded/package.json create mode 100644 node_modules/fresh/HISTORY.md create mode 100644 node_modules/fresh/LICENSE create mode 100644 node_modules/fresh/README.md create mode 100644 node_modules/fresh/index.js create mode 100644 node_modules/fresh/package.json create mode 100644 node_modules/fs-minipass/LICENSE create mode 100644 node_modules/fs-minipass/README.md create mode 100644 node_modules/fs-minipass/index.js create mode 100644 node_modules/fs-minipass/package.json create mode 100644 node_modules/fs.realpath/LICENSE create mode 100644 node_modules/fs.realpath/README.md create mode 100644 node_modules/fs.realpath/index.js create mode 100644 node_modules/fs.realpath/old.js create mode 100644 node_modules/fs.realpath/package.json create mode 100644 node_modules/fsevents/LICENSE create mode 100644 node_modules/fsevents/README.md create mode 100644 node_modules/fsevents/fsevents.d.ts create mode 100644 node_modules/fsevents/fsevents.js create mode 100755 node_modules/fsevents/fsevents.node create mode 100644 node_modules/fsevents/package.json create mode 100644 node_modules/gauge/CHANGELOG.md create mode 100644 node_modules/gauge/LICENSE create mode 100644 node_modules/gauge/README.md create mode 100644 node_modules/gauge/base-theme.js create mode 100644 node_modules/gauge/error.js create mode 100644 node_modules/gauge/has-color.js create mode 100644 node_modules/gauge/index.js create mode 100644 node_modules/gauge/node_modules/ansi-regex/index.js create mode 100644 node_modules/gauge/node_modules/ansi-regex/license create mode 100644 node_modules/gauge/node_modules/ansi-regex/package.json create mode 100644 node_modules/gauge/node_modules/ansi-regex/readme.md create mode 100644 node_modules/gauge/node_modules/is-fullwidth-code-point/index.js create mode 100644 node_modules/gauge/node_modules/is-fullwidth-code-point/license create mode 100644 node_modules/gauge/node_modules/is-fullwidth-code-point/package.json create mode 100644 node_modules/gauge/node_modules/is-fullwidth-code-point/readme.md create mode 100644 node_modules/gauge/node_modules/string-width/index.js create mode 100644 node_modules/gauge/node_modules/string-width/license create mode 100644 node_modules/gauge/node_modules/string-width/package.json create mode 100644 node_modules/gauge/node_modules/string-width/readme.md create mode 100644 node_modules/gauge/node_modules/strip-ansi/index.js create mode 100644 node_modules/gauge/node_modules/strip-ansi/license create mode 100644 node_modules/gauge/node_modules/strip-ansi/package.json create mode 100644 node_modules/gauge/node_modules/strip-ansi/readme.md create mode 100644 node_modules/gauge/package.json create mode 100644 node_modules/gauge/plumbing.js create mode 100644 node_modules/gauge/process.js create mode 100644 node_modules/gauge/progress-bar.js create mode 100644 node_modules/gauge/render-template.js create mode 100644 node_modules/gauge/set-immediate.js create mode 100644 node_modules/gauge/set-interval.js create mode 100644 node_modules/gauge/spin.js create mode 100644 node_modules/gauge/template-item.js create mode 100644 node_modules/gauge/theme-set.js create mode 100644 node_modules/gauge/themes.js create mode 100644 node_modules/gauge/wide-truncate.js create mode 100644 node_modules/get-stream/buffer-stream.js create mode 100644 node_modules/get-stream/index.js create mode 100644 node_modules/get-stream/license create mode 100644 node_modules/get-stream/package.json create mode 100644 node_modules/get-stream/readme.md create mode 100644 node_modules/glob-parent/CHANGELOG.md create mode 100644 node_modules/glob-parent/LICENSE create mode 100644 node_modules/glob-parent/README.md create mode 100644 node_modules/glob-parent/index.js create mode 100644 node_modules/glob-parent/package.json create mode 100644 node_modules/glob/LICENSE create mode 100644 node_modules/glob/README.md create mode 100644 node_modules/glob/changelog.md create mode 100644 node_modules/glob/common.js create mode 100644 node_modules/glob/glob.js create mode 100644 node_modules/glob/package.json create mode 100644 node_modules/glob/sync.js create mode 100644 node_modules/global-dirs/index.d.ts create mode 100644 node_modules/global-dirs/index.js create mode 100644 node_modules/global-dirs/license create mode 100644 node_modules/global-dirs/package.json create mode 100644 node_modules/global-dirs/readme.md create mode 100644 node_modules/got/license create mode 100644 node_modules/got/package.json create mode 100644 node_modules/got/readme.md create mode 100644 node_modules/got/source/as-promise.js create mode 100644 node_modules/got/source/as-stream.js create mode 100644 node_modules/got/source/create.js create mode 100644 node_modules/got/source/errors.js create mode 100644 node_modules/got/source/get-response.js create mode 100644 node_modules/got/source/index.js create mode 100644 node_modules/got/source/known-hook-events.js create mode 100644 node_modules/got/source/merge.js create mode 100644 node_modules/got/source/normalize-arguments.js create mode 100644 node_modules/got/source/progress.js create mode 100644 node_modules/got/source/request-as-event-emitter.js create mode 100644 node_modules/got/source/utils/deep-freeze.js create mode 100644 node_modules/got/source/utils/get-body-size.js create mode 100644 node_modules/got/source/utils/is-form-data.js create mode 100644 node_modules/got/source/utils/timed-out.js create mode 100644 node_modules/got/source/utils/url-to-options.js create mode 100644 node_modules/graceful-fs/LICENSE create mode 100644 node_modules/graceful-fs/README.md create mode 100644 node_modules/graceful-fs/clone.js create mode 100644 node_modules/graceful-fs/graceful-fs.js create mode 100644 node_modules/graceful-fs/legacy-streams.js create mode 100644 node_modules/graceful-fs/package.json create mode 100644 node_modules/graceful-fs/polyfills.js create mode 100644 node_modules/has-flag/index.js create mode 100644 node_modules/has-flag/license create mode 100644 node_modules/has-flag/package.json create mode 100644 node_modules/has-flag/readme.md create mode 100644 node_modules/has-unicode/LICENSE create mode 100644 node_modules/has-unicode/README.md create mode 100644 node_modules/has-unicode/index.js create mode 100644 node_modules/has-unicode/package.json create mode 100644 node_modules/has-yarn/index.d.ts create mode 100644 node_modules/has-yarn/index.js create mode 100644 node_modules/has-yarn/license create mode 100644 node_modules/has-yarn/package.json create mode 100644 node_modules/has-yarn/readme.md create mode 100644 node_modules/http-cache-semantics/LICENSE create mode 100644 node_modules/http-cache-semantics/README.md create mode 100644 node_modules/http-cache-semantics/index.js create mode 100644 node_modules/http-cache-semantics/package.json create mode 100644 node_modules/http-errors/HISTORY.md create mode 100644 node_modules/http-errors/LICENSE create mode 100644 node_modules/http-errors/README.md create mode 100644 node_modules/http-errors/index.js create mode 100644 node_modules/http-errors/package.json create mode 100644 node_modules/https-proxy-agent/README.md create mode 100644 node_modules/https-proxy-agent/dist/agent.d.ts create mode 100644 node_modules/https-proxy-agent/dist/agent.js create mode 100644 node_modules/https-proxy-agent/dist/agent.js.map create mode 100644 node_modules/https-proxy-agent/dist/index.d.ts create mode 100644 node_modules/https-proxy-agent/dist/index.js create mode 100644 node_modules/https-proxy-agent/dist/index.js.map create mode 100644 node_modules/https-proxy-agent/dist/parse-proxy-response.d.ts create mode 100644 node_modules/https-proxy-agent/dist/parse-proxy-response.js create mode 100644 node_modules/https-proxy-agent/dist/parse-proxy-response.js.map create mode 100644 node_modules/https-proxy-agent/node_modules/debug/LICENSE create mode 100644 node_modules/https-proxy-agent/node_modules/debug/README.md create mode 100644 node_modules/https-proxy-agent/node_modules/debug/package.json create mode 100644 node_modules/https-proxy-agent/node_modules/debug/src/browser.js create mode 100644 node_modules/https-proxy-agent/node_modules/debug/src/common.js create mode 100644 node_modules/https-proxy-agent/node_modules/debug/src/index.js create mode 100644 node_modules/https-proxy-agent/node_modules/debug/src/node.js create mode 100644 node_modules/https-proxy-agent/node_modules/ms/index.js create mode 100644 node_modules/https-proxy-agent/node_modules/ms/license.md create mode 100644 node_modules/https-proxy-agent/node_modules/ms/package.json create mode 100644 node_modules/https-proxy-agent/node_modules/ms/readme.md create mode 100644 node_modules/https-proxy-agent/package.json create mode 100644 node_modules/iconv-lite/Changelog.md create mode 100644 node_modules/iconv-lite/LICENSE create mode 100644 node_modules/iconv-lite/README.md create mode 100644 node_modules/iconv-lite/encodings/dbcs-codec.js create mode 100644 node_modules/iconv-lite/encodings/dbcs-data.js create mode 100644 node_modules/iconv-lite/encodings/index.js create mode 100644 node_modules/iconv-lite/encodings/internal.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-codec.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-data-generated.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-data.js create mode 100644 node_modules/iconv-lite/encodings/tables/big5-added.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp936.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp949.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp950.json create mode 100644 node_modules/iconv-lite/encodings/tables/eucjp.json create mode 100644 node_modules/iconv-lite/encodings/tables/gb18030-ranges.json create mode 100644 node_modules/iconv-lite/encodings/tables/gbk-added.json create mode 100644 node_modules/iconv-lite/encodings/tables/shiftjis.json create mode 100644 node_modules/iconv-lite/encodings/utf16.js create mode 100644 node_modules/iconv-lite/encodings/utf7.js create mode 100644 node_modules/iconv-lite/lib/bom-handling.js create mode 100644 node_modules/iconv-lite/lib/extend-node.js create mode 100644 node_modules/iconv-lite/lib/index.d.ts create mode 100644 node_modules/iconv-lite/lib/index.js create mode 100644 node_modules/iconv-lite/lib/streams.js create mode 100644 node_modules/iconv-lite/package.json create mode 100644 node_modules/ignore-by-default/LICENSE create mode 100644 node_modules/ignore-by-default/README.md create mode 100644 node_modules/ignore-by-default/index.js create mode 100644 node_modules/ignore-by-default/package.json create mode 100644 node_modules/import-lazy/index.js create mode 100644 node_modules/import-lazy/license create mode 100644 node_modules/import-lazy/package.json create mode 100644 node_modules/import-lazy/readme.md create mode 100644 node_modules/imurmurhash/README.md create mode 100644 node_modules/imurmurhash/imurmurhash.js create mode 100644 node_modules/imurmurhash/imurmurhash.min.js create mode 100644 node_modules/imurmurhash/package.json create mode 100644 node_modules/inflight/LICENSE create mode 100644 node_modules/inflight/README.md create mode 100644 node_modules/inflight/inflight.js create mode 100644 node_modules/inflight/package.json create mode 100644 node_modules/inherits/LICENSE create mode 100644 node_modules/inherits/README.md create mode 100644 node_modules/inherits/inherits.js create mode 100644 node_modules/inherits/inherits_browser.js create mode 100644 node_modules/inherits/package.json create mode 100644 node_modules/ini/LICENSE create mode 100644 node_modules/ini/README.md create mode 100644 node_modules/ini/ini.js create mode 100644 node_modules/ini/package.json create mode 100644 node_modules/ipaddr.js/LICENSE create mode 100644 node_modules/ipaddr.js/README.md create mode 100644 node_modules/ipaddr.js/ipaddr.min.js create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js.d.ts create mode 100644 node_modules/ipaddr.js/package.json create mode 100644 node_modules/is-binary-path/index.d.ts create mode 100644 node_modules/is-binary-path/index.js create mode 100644 node_modules/is-binary-path/license create mode 100644 node_modules/is-binary-path/package.json create mode 100644 node_modules/is-binary-path/readme.md create mode 100644 node_modules/is-ci/CHANGELOG.md create mode 100644 node_modules/is-ci/LICENSE create mode 100644 node_modules/is-ci/README.md create mode 100755 node_modules/is-ci/bin.js create mode 100644 node_modules/is-ci/index.js create mode 100644 node_modules/is-ci/package.json create mode 100644 node_modules/is-extglob/LICENSE create mode 100644 node_modules/is-extglob/README.md create mode 100644 node_modules/is-extglob/index.js create mode 100644 node_modules/is-extglob/package.json create mode 100644 node_modules/is-fullwidth-code-point/index.js create mode 100644 node_modules/is-fullwidth-code-point/license create mode 100644 node_modules/is-fullwidth-code-point/package.json create mode 100644 node_modules/is-fullwidth-code-point/readme.md create mode 100644 node_modules/is-glob/LICENSE create mode 100644 node_modules/is-glob/README.md create mode 100644 node_modules/is-glob/index.js create mode 100644 node_modules/is-glob/package.json create mode 100644 node_modules/is-installed-globally/index.d.ts create mode 100644 node_modules/is-installed-globally/index.js create mode 100644 node_modules/is-installed-globally/license create mode 100644 node_modules/is-installed-globally/package.json create mode 100644 node_modules/is-installed-globally/readme.md create mode 100644 node_modules/is-npm/index.d.ts create mode 100644 node_modules/is-npm/index.js create mode 100644 node_modules/is-npm/license create mode 100644 node_modules/is-npm/package.json create mode 100644 node_modules/is-npm/readme.md create mode 100644 node_modules/is-number/LICENSE create mode 100644 node_modules/is-number/README.md create mode 100644 node_modules/is-number/index.js create mode 100644 node_modules/is-number/package.json create mode 100644 node_modules/is-obj/index.d.ts create mode 100644 node_modules/is-obj/index.js create mode 100644 node_modules/is-obj/license create mode 100644 node_modules/is-obj/package.json create mode 100644 node_modules/is-obj/readme.md create mode 100644 node_modules/is-path-inside/index.d.ts create mode 100644 node_modules/is-path-inside/index.js create mode 100644 node_modules/is-path-inside/license create mode 100644 node_modules/is-path-inside/package.json create mode 100644 node_modules/is-path-inside/readme.md create mode 100644 node_modules/is-typedarray/LICENSE.md create mode 100644 node_modules/is-typedarray/README.md create mode 100644 node_modules/is-typedarray/index.js create mode 100644 node_modules/is-typedarray/package.json create mode 100644 node_modules/is-typedarray/test.js create mode 100644 node_modules/is-yarn-global/.travis.yml create mode 100644 node_modules/is-yarn-global/LICENSE create mode 100644 node_modules/is-yarn-global/README.md create mode 100644 node_modules/is-yarn-global/index.js create mode 100644 node_modules/is-yarn-global/package.json create mode 100644 node_modules/isarray/.npmignore create mode 100644 node_modules/isarray/.travis.yml create mode 100644 node_modules/isarray/Makefile create mode 100644 node_modules/isarray/README.md create mode 100644 node_modules/isarray/component.json create mode 100644 node_modules/isarray/index.js create mode 100644 node_modules/isarray/package.json create mode 100644 node_modules/isarray/test.js create mode 100644 node_modules/json-buffer/.npmignore create mode 100644 node_modules/json-buffer/.travis.yml create mode 100644 node_modules/json-buffer/LICENSE create mode 100644 node_modules/json-buffer/README.md create mode 100644 node_modules/json-buffer/index.js create mode 100644 node_modules/json-buffer/package.json create mode 100644 node_modules/json-buffer/test/index.js create mode 100644 node_modules/jsonwebtoken/CHANGELOG.md create mode 100644 node_modules/jsonwebtoken/LICENSE create mode 100644 node_modules/jsonwebtoken/README.md create mode 100644 node_modules/jsonwebtoken/decode.js create mode 100644 node_modules/jsonwebtoken/index.js create mode 100644 node_modules/jsonwebtoken/lib/JsonWebTokenError.js create mode 100644 node_modules/jsonwebtoken/lib/NotBeforeError.js create mode 100644 node_modules/jsonwebtoken/lib/TokenExpiredError.js create mode 100644 node_modules/jsonwebtoken/lib/psSupported.js create mode 100644 node_modules/jsonwebtoken/lib/timespan.js create mode 100644 node_modules/jsonwebtoken/node_modules/ms/index.js create mode 100644 node_modules/jsonwebtoken/node_modules/ms/license.md create mode 100644 node_modules/jsonwebtoken/node_modules/ms/package.json create mode 100644 node_modules/jsonwebtoken/node_modules/ms/readme.md create mode 100644 node_modules/jsonwebtoken/package.json create mode 100644 node_modules/jsonwebtoken/sign.js create mode 100644 node_modules/jsonwebtoken/verify.js create mode 100644 node_modules/jwa/LICENSE create mode 100644 node_modules/jwa/README.md create mode 100644 node_modules/jwa/index.js create mode 100644 node_modules/jwa/package.json create mode 100644 node_modules/jws/CHANGELOG.md create mode 100644 node_modules/jws/LICENSE create mode 100644 node_modules/jws/index.js create mode 100644 node_modules/jws/lib/data-stream.js create mode 100644 node_modules/jws/lib/sign-stream.js create mode 100644 node_modules/jws/lib/tostring.js create mode 100644 node_modules/jws/lib/verify-stream.js create mode 100644 node_modules/jws/package.json create mode 100644 node_modules/jws/readme.md create mode 100644 node_modules/keyv/LICENSE create mode 100644 node_modules/keyv/README.md create mode 100644 node_modules/keyv/package.json create mode 100644 node_modules/keyv/src/index.js create mode 100644 node_modules/latest-version/index.d.ts create mode 100644 node_modules/latest-version/index.js create mode 100644 node_modules/latest-version/license create mode 100644 node_modules/latest-version/package.json create mode 100644 node_modules/latest-version/readme.md create mode 100644 node_modules/lodash.includes/LICENSE create mode 100644 node_modules/lodash.includes/README.md create mode 100644 node_modules/lodash.includes/index.js create mode 100644 node_modules/lodash.includes/package.json create mode 100644 node_modules/lodash.isboolean/LICENSE create mode 100644 node_modules/lodash.isboolean/README.md create mode 100644 node_modules/lodash.isboolean/index.js create mode 100644 node_modules/lodash.isboolean/package.json create mode 100644 node_modules/lodash.isinteger/LICENSE create mode 100644 node_modules/lodash.isinteger/README.md create mode 100644 node_modules/lodash.isinteger/index.js create mode 100644 node_modules/lodash.isinteger/package.json create mode 100644 node_modules/lodash.isnumber/LICENSE create mode 100644 node_modules/lodash.isnumber/README.md create mode 100644 node_modules/lodash.isnumber/index.js create mode 100644 node_modules/lodash.isnumber/package.json create mode 100644 node_modules/lodash.isplainobject/LICENSE create mode 100644 node_modules/lodash.isplainobject/README.md create mode 100644 node_modules/lodash.isplainobject/index.js create mode 100644 node_modules/lodash.isplainobject/package.json create mode 100644 node_modules/lodash.isstring/LICENSE create mode 100644 node_modules/lodash.isstring/README.md create mode 100644 node_modules/lodash.isstring/index.js create mode 100644 node_modules/lodash.isstring/package.json create mode 100644 node_modules/lodash.once/LICENSE create mode 100644 node_modules/lodash.once/README.md create mode 100644 node_modules/lodash.once/index.js create mode 100644 node_modules/lodash.once/package.json create mode 100644 node_modules/lowercase-keys/index.js create mode 100644 node_modules/lowercase-keys/license create mode 100644 node_modules/lowercase-keys/package.json create mode 100644 node_modules/lowercase-keys/readme.md create mode 100644 node_modules/lru-cache/LICENSE create mode 100644 node_modules/lru-cache/README.md create mode 100644 node_modules/lru-cache/index.js create mode 100644 node_modules/lru-cache/package.json create mode 100644 node_modules/make-dir/index.d.ts create mode 100644 node_modules/make-dir/index.js create mode 100644 node_modules/make-dir/license create mode 120000 node_modules/make-dir/node_modules/.bin/semver create mode 100644 node_modules/make-dir/node_modules/semver/CHANGELOG.md create mode 100644 node_modules/make-dir/node_modules/semver/LICENSE create mode 100644 node_modules/make-dir/node_modules/semver/README.md create mode 100755 node_modules/make-dir/node_modules/semver/bin/semver.js create mode 100644 node_modules/make-dir/node_modules/semver/package.json create mode 100644 node_modules/make-dir/node_modules/semver/range.bnf create mode 100644 node_modules/make-dir/node_modules/semver/semver.js create mode 100644 node_modules/make-dir/package.json create mode 100644 node_modules/make-dir/readme.md create mode 100644 node_modules/media-typer/HISTORY.md create mode 100644 node_modules/media-typer/LICENSE create mode 100644 node_modules/media-typer/README.md create mode 100644 node_modules/media-typer/index.js create mode 100644 node_modules/media-typer/package.json create mode 100644 node_modules/merge-descriptors/HISTORY.md create mode 100644 node_modules/merge-descriptors/LICENSE create mode 100644 node_modules/merge-descriptors/README.md create mode 100644 node_modules/merge-descriptors/index.js create mode 100644 node_modules/merge-descriptors/package.json create mode 100644 node_modules/methods/HISTORY.md create mode 100644 node_modules/methods/LICENSE create mode 100644 node_modules/methods/README.md create mode 100644 node_modules/methods/index.js create mode 100644 node_modules/methods/package.json create mode 100644 node_modules/mime-db/HISTORY.md create mode 100644 node_modules/mime-db/LICENSE create mode 100644 node_modules/mime-db/README.md create mode 100644 node_modules/mime-db/db.json create mode 100644 node_modules/mime-db/index.js create mode 100644 node_modules/mime-db/package.json create mode 100644 node_modules/mime-types/HISTORY.md create mode 100644 node_modules/mime-types/LICENSE create mode 100644 node_modules/mime-types/README.md create mode 100644 node_modules/mime-types/index.js create mode 100644 node_modules/mime-types/package.json create mode 100644 node_modules/mime/.npmignore create mode 100644 node_modules/mime/CHANGELOG.md create mode 100644 node_modules/mime/LICENSE create mode 100644 node_modules/mime/README.md create mode 100755 node_modules/mime/cli.js create mode 100644 node_modules/mime/mime.js create mode 100644 node_modules/mime/package.json create mode 100755 node_modules/mime/src/build.js create mode 100644 node_modules/mime/src/test.js create mode 100644 node_modules/mime/types.json create mode 100644 node_modules/mimic-response/index.js create mode 100644 node_modules/mimic-response/license create mode 100644 node_modules/mimic-response/package.json create mode 100644 node_modules/mimic-response/readme.md create mode 100644 node_modules/minimatch/LICENSE create mode 100644 node_modules/minimatch/README.md create mode 100644 node_modules/minimatch/minimatch.js create mode 100644 node_modules/minimatch/package.json create mode 100644 node_modules/minimist/.travis.yml create mode 100644 node_modules/minimist/LICENSE create mode 100644 node_modules/minimist/example/parse.js create mode 100644 node_modules/minimist/index.js create mode 100644 node_modules/minimist/package.json create mode 100644 node_modules/minimist/readme.markdown create mode 100644 node_modules/minimist/test/all_bool.js create mode 100644 node_modules/minimist/test/bool.js create mode 100644 node_modules/minimist/test/dash.js create mode 100644 node_modules/minimist/test/default_bool.js create mode 100644 node_modules/minimist/test/dotted.js create mode 100644 node_modules/minimist/test/kv_short.js create mode 100644 node_modules/minimist/test/long.js create mode 100644 node_modules/minimist/test/num.js create mode 100644 node_modules/minimist/test/parse.js create mode 100644 node_modules/minimist/test/parse_modified.js create mode 100644 node_modules/minimist/test/proto.js create mode 100644 node_modules/minimist/test/short.js create mode 100644 node_modules/minimist/test/stop_early.js create mode 100644 node_modules/minimist/test/unknown.js create mode 100644 node_modules/minimist/test/whitespace.js create mode 100644 node_modules/minipass/LICENSE create mode 100644 node_modules/minipass/README.md create mode 100644 node_modules/minipass/index.js create mode 100644 node_modules/minipass/package.json create mode 100644 node_modules/minizlib/LICENSE create mode 100644 node_modules/minizlib/README.md create mode 100644 node_modules/minizlib/constants.js create mode 100644 node_modules/minizlib/index.js create mode 100644 node_modules/minizlib/package.json create mode 100644 node_modules/mkdirp/CHANGELOG.md create mode 100644 node_modules/mkdirp/LICENSE create mode 100755 node_modules/mkdirp/bin/cmd.js create mode 100644 node_modules/mkdirp/index.js create mode 100644 node_modules/mkdirp/lib/find-made.js create mode 100644 node_modules/mkdirp/lib/mkdirp-manual.js create mode 100644 node_modules/mkdirp/lib/mkdirp-native.js create mode 100644 node_modules/mkdirp/lib/opts-arg.js create mode 100644 node_modules/mkdirp/lib/path-arg.js create mode 100644 node_modules/mkdirp/lib/use-native.js create mode 100644 node_modules/mkdirp/package.json create mode 100644 node_modules/mkdirp/readme.markdown create mode 100644 node_modules/morgan/HISTORY.md create mode 100644 node_modules/morgan/LICENSE create mode 100644 node_modules/morgan/README.md create mode 100644 node_modules/morgan/index.js create mode 100644 node_modules/morgan/node_modules/depd/History.md create mode 100644 node_modules/morgan/node_modules/depd/LICENSE create mode 100644 node_modules/morgan/node_modules/depd/Readme.md create mode 100644 node_modules/morgan/node_modules/depd/index.js create mode 100644 node_modules/morgan/node_modules/depd/lib/browser/index.js create mode 100644 node_modules/morgan/node_modules/depd/package.json create mode 100644 node_modules/morgan/package.json create mode 100644 node_modules/ms/index.js create mode 100644 node_modules/ms/license.md create mode 100644 node_modules/ms/package.json create mode 100644 node_modules/ms/readme.md create mode 100644 node_modules/negotiator/HISTORY.md create mode 100644 node_modules/negotiator/LICENSE create mode 100644 node_modules/negotiator/README.md create mode 100644 node_modules/negotiator/index.js create mode 100644 node_modules/negotiator/lib/charset.js create mode 100644 node_modules/negotiator/lib/encoding.js create mode 100644 node_modules/negotiator/lib/language.js create mode 100644 node_modules/negotiator/lib/mediaType.js create mode 100644 node_modules/negotiator/package.json create mode 100644 node_modules/node-addon-api/.clang-format create mode 100644 node_modules/node-addon-api/.editorconfig create mode 100644 node_modules/node-addon-api/.github/workflows/ci.yml create mode 100644 node_modules/node-addon-api/.github/workflows/linter.yml create mode 100644 node_modules/node-addon-api/.github/workflows/stale.yml create mode 100644 node_modules/node-addon-api/.travis.yml create mode 100644 node_modules/node-addon-api/CHANGELOG.md create mode 100644 node_modules/node-addon-api/CODE_OF_CONDUCT.md create mode 100644 node_modules/node-addon-api/CONTRIBUTING.md create mode 100644 node_modules/node-addon-api/LICENSE.md create mode 100644 node_modules/node-addon-api/README.md create mode 100644 node_modules/node-addon-api/appveyor.yml create mode 100644 node_modules/node-addon-api/benchmark/README.md create mode 100644 node_modules/node-addon-api/benchmark/binding.gyp create mode 100644 node_modules/node-addon-api/benchmark/function_args.cc create mode 100644 node_modules/node-addon-api/benchmark/function_args.js create mode 100644 node_modules/node-addon-api/benchmark/index.js create mode 100644 node_modules/node-addon-api/benchmark/property_descriptor.cc create mode 100644 node_modules/node-addon-api/benchmark/property_descriptor.js create mode 100644 node_modules/node-addon-api/common.gypi create mode 100644 node_modules/node-addon-api/doc/addon.md create mode 100644 node_modules/node-addon-api/doc/array.md create mode 100644 node_modules/node-addon-api/doc/array_buffer.md create mode 100644 node_modules/node-addon-api/doc/async_context.md create mode 100644 node_modules/node-addon-api/doc/async_operations.md create mode 100644 node_modules/node-addon-api/doc/async_worker.md create mode 100644 node_modules/node-addon-api/doc/async_worker_variants.md create mode 100644 node_modules/node-addon-api/doc/bigint.md create mode 100644 node_modules/node-addon-api/doc/boolean.md create mode 100644 node_modules/node-addon-api/doc/buffer.md create mode 100644 node_modules/node-addon-api/doc/callback_scope.md create mode 100644 node_modules/node-addon-api/doc/callbackinfo.md create mode 100644 node_modules/node-addon-api/doc/checker-tool.md create mode 100644 node_modules/node-addon-api/doc/class_property_descriptor.md create mode 100644 node_modules/node-addon-api/doc/cmake-js.md create mode 100644 node_modules/node-addon-api/doc/conversion-tool.md create mode 100644 node_modules/node-addon-api/doc/creating_a_release.md create mode 100644 node_modules/node-addon-api/doc/dataview.md create mode 100644 node_modules/node-addon-api/doc/date.md create mode 100644 node_modules/node-addon-api/doc/env.md create mode 100644 node_modules/node-addon-api/doc/error.md create mode 100644 node_modules/node-addon-api/doc/error_handling.md create mode 100644 node_modules/node-addon-api/doc/escapable_handle_scope.md create mode 100644 node_modules/node-addon-api/doc/external.md create mode 100644 node_modules/node-addon-api/doc/function.md create mode 100644 node_modules/node-addon-api/doc/function_reference.md create mode 100644 node_modules/node-addon-api/doc/generator.md create mode 100644 node_modules/node-addon-api/doc/handle_scope.md create mode 100644 node_modules/node-addon-api/doc/hierarchy.md create mode 100644 node_modules/node-addon-api/doc/instance_wrap.md create mode 100644 node_modules/node-addon-api/doc/memory_management.md create mode 100644 node_modules/node-addon-api/doc/name.md create mode 100644 node_modules/node-addon-api/doc/node-gyp.md create mode 100644 node_modules/node-addon-api/doc/number.md create mode 100644 node_modules/node-addon-api/doc/object.md create mode 100644 node_modules/node-addon-api/doc/object_lifetime_management.md create mode 100644 node_modules/node-addon-api/doc/object_reference.md create mode 100644 node_modules/node-addon-api/doc/object_wrap.md create mode 100644 node_modules/node-addon-api/doc/prebuild_tools.md create mode 100644 node_modules/node-addon-api/doc/promises.md create mode 100644 node_modules/node-addon-api/doc/property_descriptor.md create mode 100644 node_modules/node-addon-api/doc/range_error.md create mode 100644 node_modules/node-addon-api/doc/reference.md create mode 100644 node_modules/node-addon-api/doc/setup.md create mode 100644 node_modules/node-addon-api/doc/string.md create mode 100644 node_modules/node-addon-api/doc/symbol.md create mode 100644 node_modules/node-addon-api/doc/threadsafe.md create mode 100644 node_modules/node-addon-api/doc/threadsafe_function.md create mode 100644 node_modules/node-addon-api/doc/type_error.md create mode 100644 node_modules/node-addon-api/doc/typed_array.md create mode 100644 node_modules/node-addon-api/doc/typed_array_of.md create mode 100644 node_modules/node-addon-api/doc/typed_threadsafe_function.md create mode 100644 node_modules/node-addon-api/doc/value.md create mode 100644 node_modules/node-addon-api/doc/version_management.md create mode 100644 node_modules/node-addon-api/except.gypi create mode 100644 node_modules/node-addon-api/index.js create mode 100644 node_modules/node-addon-api/napi-inl.deprecated.h create mode 100644 node_modules/node-addon-api/napi-inl.h create mode 100644 node_modules/node-addon-api/napi.h create mode 100644 node_modules/node-addon-api/node_api.gyp create mode 100644 node_modules/node-addon-api/noexcept.gypi create mode 100644 node_modules/node-addon-api/nothing.c create mode 100644 node_modules/node-addon-api/package-support.json create mode 100644 node_modules/node-addon-api/package.json create mode 100644 node_modules/node-addon-api/tools/README.md create mode 100644 node_modules/node-addon-api/tools/check-napi.js create mode 100644 node_modules/node-addon-api/tools/clang-format.js create mode 100755 node_modules/node-addon-api/tools/conversion.js create mode 100644 node_modules/node-fetch/CHANGELOG.md create mode 100644 node_modules/node-fetch/LICENSE.md create mode 100644 node_modules/node-fetch/README.md create mode 100644 node_modules/node-fetch/browser.js create mode 100644 node_modules/node-fetch/lib/index.es.js create mode 100644 node_modules/node-fetch/lib/index.js create mode 100644 node_modules/node-fetch/lib/index.mjs create mode 100644 node_modules/node-fetch/package.json create mode 100644 node_modules/nodemon/.eslintrc.json create mode 100644 node_modules/nodemon/.jshintrc create mode 100644 node_modules/nodemon/.travis.yml create mode 100644 node_modules/nodemon/LICENSE create mode 100644 node_modules/nodemon/README.md create mode 100755 node_modules/nodemon/bin/nodemon.js create mode 100755 node_modules/nodemon/bin/postinstall.js create mode 100644 node_modules/nodemon/commitlint.config.js create mode 100644 node_modules/nodemon/doc/cli/authors.txt create mode 100644 node_modules/nodemon/doc/cli/config.txt create mode 100644 node_modules/nodemon/doc/cli/help.txt create mode 100644 node_modules/nodemon/doc/cli/logo.txt create mode 100644 node_modules/nodemon/doc/cli/options.txt create mode 100644 node_modules/nodemon/doc/cli/topics.txt create mode 100644 node_modules/nodemon/doc/cli/usage.txt create mode 100644 node_modules/nodemon/doc/cli/whoami.txt create mode 100644 node_modules/nodemon/lib/cli/index.js create mode 100644 node_modules/nodemon/lib/cli/parse.js create mode 100644 node_modules/nodemon/lib/config/command.js create mode 100644 node_modules/nodemon/lib/config/defaults.js create mode 100644 node_modules/nodemon/lib/config/exec.js create mode 100644 node_modules/nodemon/lib/config/index.js create mode 100644 node_modules/nodemon/lib/config/load.js create mode 100644 node_modules/nodemon/lib/help/index.js create mode 100644 node_modules/nodemon/lib/index.js create mode 100644 node_modules/nodemon/lib/monitor/index.js create mode 100644 node_modules/nodemon/lib/monitor/match.js create mode 100644 node_modules/nodemon/lib/monitor/run.js create mode 100644 node_modules/nodemon/lib/monitor/signals.js create mode 100644 node_modules/nodemon/lib/monitor/watch.js create mode 100644 node_modules/nodemon/lib/nodemon.js create mode 100644 node_modules/nodemon/lib/rules/add.js create mode 100644 node_modules/nodemon/lib/rules/index.js create mode 100644 node_modules/nodemon/lib/rules/parse.js create mode 100644 node_modules/nodemon/lib/spawn.js create mode 100644 node_modules/nodemon/lib/utils/bus.js create mode 100644 node_modules/nodemon/lib/utils/clone.js create mode 100644 node_modules/nodemon/lib/utils/colour.js create mode 100644 node_modules/nodemon/lib/utils/index.js create mode 100644 node_modules/nodemon/lib/utils/log.js create mode 100644 node_modules/nodemon/lib/utils/merge.js create mode 100644 node_modules/nodemon/lib/version.js create mode 100644 node_modules/nodemon/node_modules/debug/CHANGELOG.md create mode 100644 node_modules/nodemon/node_modules/debug/LICENSE create mode 100644 node_modules/nodemon/node_modules/debug/README.md create mode 100644 node_modules/nodemon/node_modules/debug/node.js create mode 100644 node_modules/nodemon/node_modules/debug/package.json create mode 100644 node_modules/nodemon/node_modules/debug/src/browser.js create mode 100644 node_modules/nodemon/node_modules/debug/src/common.js create mode 100644 node_modules/nodemon/node_modules/debug/src/index.js create mode 100644 node_modules/nodemon/node_modules/debug/src/node.js create mode 100644 node_modules/nodemon/node_modules/ms/index.js create mode 100644 node_modules/nodemon/node_modules/ms/license.md create mode 100644 node_modules/nodemon/node_modules/ms/package.json create mode 100644 node_modules/nodemon/node_modules/ms/readme.md create mode 100644 node_modules/nodemon/package.json create mode 100644 node_modules/nopt/.npmignore create mode 100644 node_modules/nopt/LICENSE create mode 100644 node_modules/nopt/README.md create mode 100755 node_modules/nopt/bin/nopt.js create mode 100755 node_modules/nopt/examples/my-program.js create mode 100644 node_modules/nopt/lib/nopt.js create mode 100644 node_modules/nopt/package.json create mode 100644 node_modules/normalize-path/LICENSE create mode 100644 node_modules/normalize-path/README.md create mode 100644 node_modules/normalize-path/index.js create mode 100644 node_modules/normalize-path/package.json create mode 100644 node_modules/normalize-url/index.d.ts create mode 100644 node_modules/normalize-url/index.js create mode 100644 node_modules/normalize-url/license create mode 100644 node_modules/normalize-url/package.json create mode 100644 node_modules/normalize-url/readme.md create mode 100644 node_modules/npmlog/CHANGELOG.md create mode 100644 node_modules/npmlog/LICENSE create mode 100644 node_modules/npmlog/README.md create mode 100644 node_modules/npmlog/log.js create mode 100644 node_modules/npmlog/package.json create mode 100644 node_modules/number-is-nan/index.js create mode 100644 node_modules/number-is-nan/license create mode 100644 node_modules/number-is-nan/package.json create mode 100644 node_modules/number-is-nan/readme.md create mode 100644 node_modules/object-assign/index.js create mode 100644 node_modules/object-assign/license create mode 100644 node_modules/object-assign/package.json create mode 100644 node_modules/object-assign/readme.md create mode 100644 node_modules/on-finished/HISTORY.md create mode 100644 node_modules/on-finished/LICENSE create mode 100644 node_modules/on-finished/README.md create mode 100644 node_modules/on-finished/index.js create mode 100644 node_modules/on-finished/package.json create mode 100644 node_modules/on-headers/HISTORY.md create mode 100644 node_modules/on-headers/LICENSE create mode 100644 node_modules/on-headers/README.md create mode 100644 node_modules/on-headers/index.js create mode 100644 node_modules/on-headers/package.json create mode 100644 node_modules/once/LICENSE create mode 100644 node_modules/once/README.md create mode 100644 node_modules/once/once.js create mode 100644 node_modules/once/package.json create mode 100644 node_modules/p-cancelable/index.d.ts create mode 100644 node_modules/p-cancelable/index.js create mode 100644 node_modules/p-cancelable/license create mode 100644 node_modules/p-cancelable/package.json create mode 100644 node_modules/p-cancelable/readme.md create mode 100644 node_modules/package-json/index.d.ts create mode 100644 node_modules/package-json/index.js create mode 100644 node_modules/package-json/license create mode 120000 node_modules/package-json/node_modules/.bin/semver create mode 100644 node_modules/package-json/node_modules/semver/CHANGELOG.md create mode 100644 node_modules/package-json/node_modules/semver/LICENSE create mode 100644 node_modules/package-json/node_modules/semver/README.md create mode 100755 node_modules/package-json/node_modules/semver/bin/semver.js create mode 100644 node_modules/package-json/node_modules/semver/package.json create mode 100644 node_modules/package-json/node_modules/semver/range.bnf create mode 100644 node_modules/package-json/node_modules/semver/semver.js create mode 100644 node_modules/package-json/package.json create mode 100644 node_modules/package-json/readme.md create mode 100644 node_modules/parseurl/HISTORY.md create mode 100644 node_modules/parseurl/LICENSE create mode 100644 node_modules/parseurl/README.md create mode 100644 node_modules/parseurl/index.js create mode 100644 node_modules/parseurl/package.json create mode 100644 node_modules/path-is-absolute/index.js create mode 100644 node_modules/path-is-absolute/license create mode 100644 node_modules/path-is-absolute/package.json create mode 100644 node_modules/path-is-absolute/readme.md create mode 100644 node_modules/path-to-regexp/History.md create mode 100644 node_modules/path-to-regexp/LICENSE create mode 100644 node_modules/path-to-regexp/Readme.md create mode 100644 node_modules/path-to-regexp/index.js create mode 100644 node_modules/path-to-regexp/package.json create mode 100644 node_modules/picomatch/CHANGELOG.md create mode 100644 node_modules/picomatch/LICENSE create mode 100644 node_modules/picomatch/README.md create mode 100644 node_modules/picomatch/index.js create mode 100644 node_modules/picomatch/lib/constants.js create mode 100644 node_modules/picomatch/lib/parse.js create mode 100644 node_modules/picomatch/lib/picomatch.js create mode 100644 node_modules/picomatch/lib/scan.js create mode 100644 node_modules/picomatch/lib/utils.js create mode 100644 node_modules/picomatch/package.json create mode 100644 node_modules/prepend-http/index.js create mode 100644 node_modules/prepend-http/license create mode 100644 node_modules/prepend-http/package.json create mode 100644 node_modules/prepend-http/readme.md create mode 100644 node_modules/process-nextick-args/index.js create mode 100644 node_modules/process-nextick-args/license.md create mode 100644 node_modules/process-nextick-args/package.json create mode 100644 node_modules/process-nextick-args/readme.md create mode 100644 node_modules/proxy-addr/HISTORY.md create mode 100644 node_modules/proxy-addr/LICENSE create mode 100644 node_modules/proxy-addr/README.md create mode 100644 node_modules/proxy-addr/index.js create mode 100644 node_modules/proxy-addr/package.json create mode 100644 node_modules/pstree.remy/.travis.yml create mode 100644 node_modules/pstree.remy/LICENSE create mode 100644 node_modules/pstree.remy/README.md create mode 100644 node_modules/pstree.remy/lib/index.js create mode 100644 node_modules/pstree.remy/lib/tree.js create mode 100644 node_modules/pstree.remy/lib/utils.js create mode 100644 node_modules/pstree.remy/package.json create mode 100644 node_modules/pstree.remy/tests/fixtures/index.js create mode 100644 node_modules/pstree.remy/tests/fixtures/out1 create mode 100644 node_modules/pstree.remy/tests/fixtures/out2 create mode 100644 node_modules/pstree.remy/tests/index.test.js create mode 100644 node_modules/pump/.travis.yml create mode 100644 node_modules/pump/LICENSE create mode 100644 node_modules/pump/README.md create mode 100644 node_modules/pump/index.js create mode 100644 node_modules/pump/package.json create mode 100644 node_modules/pump/test-browser.js create mode 100644 node_modules/pump/test-node.js create mode 100644 node_modules/pupa/index.d.ts create mode 100644 node_modules/pupa/index.js create mode 100644 node_modules/pupa/license create mode 100644 node_modules/pupa/package.json create mode 100644 node_modules/pupa/readme.md create mode 100644 node_modules/qs/.editorconfig create mode 100644 node_modules/qs/.eslintignore create mode 100644 node_modules/qs/.eslintrc create mode 100644 node_modules/qs/CHANGELOG.md create mode 100644 node_modules/qs/LICENSE create mode 100644 node_modules/qs/README.md create mode 100644 node_modules/qs/dist/qs.js create mode 100644 node_modules/qs/lib/formats.js create mode 100644 node_modules/qs/lib/index.js create mode 100644 node_modules/qs/lib/parse.js create mode 100644 node_modules/qs/lib/stringify.js create mode 100644 node_modules/qs/lib/utils.js create mode 100644 node_modules/qs/package.json create mode 100644 node_modules/qs/test/.eslintrc create mode 100644 node_modules/qs/test/index.js create mode 100644 node_modules/qs/test/parse.js create mode 100644 node_modules/qs/test/stringify.js create mode 100644 node_modules/qs/test/utils.js create mode 100644 node_modules/range-parser/HISTORY.md create mode 100644 node_modules/range-parser/LICENSE create mode 100644 node_modules/range-parser/README.md create mode 100644 node_modules/range-parser/index.js create mode 100644 node_modules/range-parser/package.json create mode 100644 node_modules/raw-body/HISTORY.md create mode 100644 node_modules/raw-body/LICENSE create mode 100644 node_modules/raw-body/README.md create mode 100644 node_modules/raw-body/index.d.ts create mode 100644 node_modules/raw-body/index.js create mode 100644 node_modules/raw-body/package.json create mode 100644 node_modules/rc/LICENSE.APACHE2 create mode 100644 node_modules/rc/LICENSE.BSD create mode 100644 node_modules/rc/LICENSE.MIT create mode 100644 node_modules/rc/README.md create mode 100644 node_modules/rc/browser.js create mode 100755 node_modules/rc/cli.js create mode 100755 node_modules/rc/index.js create mode 100644 node_modules/rc/lib/utils.js create mode 100644 node_modules/rc/package.json create mode 100644 node_modules/rc/test/ini.js create mode 100644 node_modules/rc/test/nested-env-vars.js create mode 100644 node_modules/rc/test/test.js create mode 100644 node_modules/readable-stream/.travis.yml create mode 100644 node_modules/readable-stream/CONTRIBUTING.md create mode 100644 node_modules/readable-stream/GOVERNANCE.md create mode 100644 node_modules/readable-stream/LICENSE create mode 100644 node_modules/readable-stream/README.md create mode 100644 node_modules/readable-stream/doc/wg-meetings/2015-01-30.md create mode 100644 node_modules/readable-stream/duplex-browser.js create mode 100644 node_modules/readable-stream/duplex.js create mode 100644 node_modules/readable-stream/lib/_stream_duplex.js create mode 100644 node_modules/readable-stream/lib/_stream_passthrough.js create mode 100644 node_modules/readable-stream/lib/_stream_readable.js create mode 100644 node_modules/readable-stream/lib/_stream_transform.js create mode 100644 node_modules/readable-stream/lib/_stream_writable.js create mode 100644 node_modules/readable-stream/lib/internal/streams/BufferList.js create mode 100644 node_modules/readable-stream/lib/internal/streams/destroy.js create mode 100644 node_modules/readable-stream/lib/internal/streams/stream-browser.js create mode 100644 node_modules/readable-stream/lib/internal/streams/stream.js create mode 100644 node_modules/readable-stream/package.json create mode 100644 node_modules/readable-stream/passthrough.js create mode 100644 node_modules/readable-stream/readable-browser.js create mode 100644 node_modules/readable-stream/readable.js create mode 100644 node_modules/readable-stream/transform.js create mode 100644 node_modules/readable-stream/writable-browser.js create mode 100644 node_modules/readable-stream/writable.js create mode 100644 node_modules/readdirp/LICENSE create mode 100644 node_modules/readdirp/README.md create mode 100644 node_modules/readdirp/index.d.ts create mode 100644 node_modules/readdirp/index.js create mode 100644 node_modules/readdirp/package.json create mode 100644 node_modules/registry-auth-token/CHANGELOG.md create mode 100644 node_modules/registry-auth-token/LICENSE create mode 100644 node_modules/registry-auth-token/README.md create mode 100644 node_modules/registry-auth-token/base64.js create mode 100644 node_modules/registry-auth-token/index.js create mode 100644 node_modules/registry-auth-token/package.json create mode 100644 node_modules/registry-auth-token/registry-url.js create mode 100644 node_modules/registry-url/index.d.ts create mode 100644 node_modules/registry-url/index.js create mode 100644 node_modules/registry-url/license create mode 100644 node_modules/registry-url/package.json create mode 100644 node_modules/registry-url/readme.md create mode 100644 node_modules/responselike/LICENSE create mode 100644 node_modules/responselike/README.md create mode 100644 node_modules/responselike/package.json create mode 100644 node_modules/responselike/src/index.js create mode 100644 node_modules/rimraf/CHANGELOG.md create mode 100644 node_modules/rimraf/LICENSE create mode 100644 node_modules/rimraf/README.md create mode 100755 node_modules/rimraf/bin.js create mode 100644 node_modules/rimraf/package.json create mode 100644 node_modules/rimraf/rimraf.js create mode 100644 node_modules/safe-buffer/LICENSE create mode 100644 node_modules/safe-buffer/README.md create mode 100644 node_modules/safe-buffer/index.d.ts create mode 100644 node_modules/safe-buffer/index.js create mode 100644 node_modules/safe-buffer/package.json create mode 100644 node_modules/safer-buffer/LICENSE create mode 100644 node_modules/safer-buffer/Porting-Buffer.md create mode 100644 node_modules/safer-buffer/Readme.md create mode 100644 node_modules/safer-buffer/dangerous.js create mode 100644 node_modules/safer-buffer/package.json create mode 100644 node_modules/safer-buffer/safer.js create mode 100644 node_modules/safer-buffer/tests.js create mode 100644 node_modules/semver-diff/index.d.ts create mode 100644 node_modules/semver-diff/index.js create mode 100644 node_modules/semver-diff/license create mode 120000 node_modules/semver-diff/node_modules/.bin/semver create mode 100644 node_modules/semver-diff/node_modules/semver/CHANGELOG.md create mode 100644 node_modules/semver-diff/node_modules/semver/LICENSE create mode 100644 node_modules/semver-diff/node_modules/semver/README.md create mode 100755 node_modules/semver-diff/node_modules/semver/bin/semver.js create mode 100644 node_modules/semver-diff/node_modules/semver/package.json create mode 100644 node_modules/semver-diff/node_modules/semver/range.bnf create mode 100644 node_modules/semver-diff/node_modules/semver/semver.js create mode 100644 node_modules/semver-diff/package.json create mode 100644 node_modules/semver-diff/readme.md create mode 100644 node_modules/semver/CHANGELOG.md create mode 100644 node_modules/semver/LICENSE create mode 100644 node_modules/semver/README.md create mode 100755 node_modules/semver/bin/semver create mode 100644 node_modules/semver/package.json create mode 100644 node_modules/semver/range.bnf create mode 100644 node_modules/semver/semver.js create mode 100644 node_modules/send/HISTORY.md create mode 100644 node_modules/send/LICENSE create mode 100644 node_modules/send/README.md create mode 100644 node_modules/send/index.js create mode 100644 node_modules/send/node_modules/ms/index.js create mode 100644 node_modules/send/node_modules/ms/license.md create mode 100644 node_modules/send/node_modules/ms/package.json create mode 100644 node_modules/send/node_modules/ms/readme.md create mode 100644 node_modules/send/package.json create mode 100644 node_modules/serve-static/HISTORY.md create mode 100644 node_modules/serve-static/LICENSE create mode 100644 node_modules/serve-static/README.md create mode 100644 node_modules/serve-static/index.js create mode 100644 node_modules/serve-static/package.json create mode 100644 node_modules/set-blocking/CHANGELOG.md create mode 100644 node_modules/set-blocking/LICENSE.txt create mode 100644 node_modules/set-blocking/README.md create mode 100644 node_modules/set-blocking/index.js create mode 100644 node_modules/set-blocking/package.json create mode 100644 node_modules/setprototypeof/LICENSE create mode 100644 node_modules/setprototypeof/README.md create mode 100644 node_modules/setprototypeof/index.d.ts create mode 100644 node_modules/setprototypeof/index.js create mode 100644 node_modules/setprototypeof/package.json create mode 100644 node_modules/setprototypeof/test/index.js create mode 100644 node_modules/signal-exit/CHANGELOG.md create mode 100644 node_modules/signal-exit/LICENSE.txt create mode 100644 node_modules/signal-exit/README.md create mode 100644 node_modules/signal-exit/index.js create mode 100644 node_modules/signal-exit/package.json create mode 100644 node_modules/signal-exit/signals.js create mode 100644 node_modules/statuses/HISTORY.md create mode 100644 node_modules/statuses/LICENSE create mode 100644 node_modules/statuses/README.md create mode 100644 node_modules/statuses/codes.json create mode 100644 node_modules/statuses/index.js create mode 100644 node_modules/statuses/package.json create mode 100644 node_modules/string-width/index.d.ts create mode 100644 node_modules/string-width/index.js create mode 100644 node_modules/string-width/license create mode 100644 node_modules/string-width/node_modules/ansi-regex/index.d.ts create mode 100644 node_modules/string-width/node_modules/ansi-regex/index.js create mode 100644 node_modules/string-width/node_modules/ansi-regex/license create mode 100644 node_modules/string-width/node_modules/ansi-regex/package.json create mode 100644 node_modules/string-width/node_modules/ansi-regex/readme.md create mode 100644 node_modules/string-width/node_modules/emoji-regex/LICENSE-MIT.txt create mode 100644 node_modules/string-width/node_modules/emoji-regex/README.md create mode 100644 node_modules/string-width/node_modules/emoji-regex/es2015/index.js create mode 100644 node_modules/string-width/node_modules/emoji-regex/es2015/text.js create mode 100644 node_modules/string-width/node_modules/emoji-regex/index.d.ts create mode 100644 node_modules/string-width/node_modules/emoji-regex/index.js create mode 100644 node_modules/string-width/node_modules/emoji-regex/package.json create mode 100644 node_modules/string-width/node_modules/emoji-regex/text.js create mode 100644 node_modules/string-width/node_modules/is-fullwidth-code-point/index.d.ts create mode 100644 node_modules/string-width/node_modules/is-fullwidth-code-point/index.js create mode 100644 node_modules/string-width/node_modules/is-fullwidth-code-point/license create mode 100644 node_modules/string-width/node_modules/is-fullwidth-code-point/package.json create mode 100644 node_modules/string-width/node_modules/is-fullwidth-code-point/readme.md create mode 100644 node_modules/string-width/node_modules/strip-ansi/index.d.ts create mode 100644 node_modules/string-width/node_modules/strip-ansi/index.js create mode 100644 node_modules/string-width/node_modules/strip-ansi/license create mode 100644 node_modules/string-width/node_modules/strip-ansi/package.json create mode 100644 node_modules/string-width/node_modules/strip-ansi/readme.md create mode 100644 node_modules/string-width/package.json create mode 100644 node_modules/string-width/readme.md create mode 100644 node_modules/string_decoder/.travis.yml create mode 100644 node_modules/string_decoder/LICENSE create mode 100644 node_modules/string_decoder/README.md create mode 100644 node_modules/string_decoder/lib/string_decoder.js create mode 100644 node_modules/string_decoder/package.json create mode 100644 node_modules/strip-ansi/index.d.ts create mode 100644 node_modules/strip-ansi/index.js create mode 100644 node_modules/strip-ansi/license create mode 100644 node_modules/strip-ansi/package.json create mode 100644 node_modules/strip-ansi/readme.md create mode 100644 node_modules/strip-json-comments/index.js create mode 100644 node_modules/strip-json-comments/license create mode 100644 node_modules/strip-json-comments/package.json create mode 100644 node_modules/strip-json-comments/readme.md create mode 100644 node_modules/supports-color/browser.js create mode 100644 node_modules/supports-color/index.js create mode 100644 node_modules/supports-color/license create mode 100644 node_modules/supports-color/package.json create mode 100644 node_modules/supports-color/readme.md create mode 100644 node_modules/tar/CHANGELOG.md create mode 100644 node_modules/tar/LICENSE create mode 100644 node_modules/tar/README.md create mode 100644 node_modules/tar/index.js create mode 100644 node_modules/tar/lib/create.js create mode 100644 node_modules/tar/lib/extract.js create mode 100644 node_modules/tar/lib/get-write-flag.js create mode 100644 node_modules/tar/lib/header.js create mode 100644 node_modules/tar/lib/high-level-opt.js create mode 100644 node_modules/tar/lib/large-numbers.js create mode 100644 node_modules/tar/lib/list.js create mode 100644 node_modules/tar/lib/mkdir.js create mode 100644 node_modules/tar/lib/mode-fix.js create mode 100644 node_modules/tar/lib/pack.js create mode 100644 node_modules/tar/lib/parse.js create mode 100644 node_modules/tar/lib/path-reservations.js create mode 100644 node_modules/tar/lib/pax.js create mode 100644 node_modules/tar/lib/read-entry.js create mode 100644 node_modules/tar/lib/replace.js create mode 100644 node_modules/tar/lib/types.js create mode 100644 node_modules/tar/lib/unpack.js create mode 100644 node_modules/tar/lib/update.js create mode 100644 node_modules/tar/lib/warn-mixin.js create mode 100644 node_modules/tar/lib/winchars.js create mode 100644 node_modules/tar/lib/write-entry.js create mode 100644 node_modules/tar/package.json create mode 100644 node_modules/term-size/index.d.ts create mode 100644 node_modules/term-size/index.js create mode 100644 node_modules/term-size/license create mode 100644 node_modules/term-size/package.json create mode 100644 node_modules/term-size/readme.md create mode 100644 node_modules/term-size/vendor/.DS_Store create mode 100644 node_modules/term-size/vendor/macos/.DS_Store create mode 100755 node_modules/term-size/vendor/macos/term-size create mode 100644 node_modules/term-size/vendor/windows/term-size.exe create mode 100644 node_modules/to-readable-stream/index.js create mode 100644 node_modules/to-readable-stream/license create mode 100644 node_modules/to-readable-stream/package.json create mode 100644 node_modules/to-readable-stream/readme.md create mode 100644 node_modules/to-regex-range/LICENSE create mode 100644 node_modules/to-regex-range/README.md create mode 100644 node_modules/to-regex-range/index.js create mode 100644 node_modules/to-regex-range/package.json create mode 100644 node_modules/toidentifier/LICENSE create mode 100644 node_modules/toidentifier/README.md create mode 100644 node_modules/toidentifier/index.js create mode 100644 node_modules/toidentifier/package.json create mode 100644 node_modules/touch/LICENSE create mode 100644 node_modules/touch/README.md create mode 100755 node_modules/touch/bin/nodetouch.js create mode 100644 node_modules/touch/index.js create mode 100644 node_modules/touch/package.json create mode 100644 node_modules/type-fest/index.d.ts create mode 100644 node_modules/type-fest/license create mode 100644 node_modules/type-fest/package.json create mode 100644 node_modules/type-fest/readme.md create mode 100644 node_modules/type-fest/source/basic.d.ts create mode 100644 node_modules/type-fest/source/except.d.ts create mode 100644 node_modules/type-fest/source/literal-union.d.ts create mode 100644 node_modules/type-fest/source/merge-exclusive.d.ts create mode 100644 node_modules/type-fest/source/merge.d.ts create mode 100644 node_modules/type-fest/source/mutable.d.ts create mode 100644 node_modules/type-fest/source/opaque.d.ts create mode 100644 node_modules/type-fest/source/package-json.d.ts create mode 100644 node_modules/type-fest/source/partial-deep.d.ts create mode 100644 node_modules/type-fest/source/promisable.d.ts create mode 100644 node_modules/type-fest/source/readonly-deep.d.ts create mode 100644 node_modules/type-fest/source/require-at-least-one.d.ts create mode 100644 node_modules/type-fest/source/require-exactly-one.d.ts create mode 100644 node_modules/type-fest/source/set-optional.d.ts create mode 100644 node_modules/type-fest/source/set-required.d.ts create mode 100644 node_modules/type-is/HISTORY.md create mode 100644 node_modules/type-is/LICENSE create mode 100644 node_modules/type-is/README.md create mode 100644 node_modules/type-is/index.js create mode 100644 node_modules/type-is/package.json create mode 100644 node_modules/typedarray-to-buffer/.airtap.yml create mode 100644 node_modules/typedarray-to-buffer/.travis.yml create mode 100644 node_modules/typedarray-to-buffer/LICENSE create mode 100644 node_modules/typedarray-to-buffer/README.md create mode 100644 node_modules/typedarray-to-buffer/index.js create mode 100644 node_modules/typedarray-to-buffer/package.json create mode 100644 node_modules/typedarray-to-buffer/test/basic.js create mode 100644 node_modules/undefsafe/.jscsrc create mode 100644 node_modules/undefsafe/.jshintrc create mode 100644 node_modules/undefsafe/.npmignore create mode 100644 node_modules/undefsafe/.travis.yml create mode 100644 node_modules/undefsafe/LICENSE create mode 100644 node_modules/undefsafe/README.md create mode 100644 node_modules/undefsafe/example.js create mode 100644 node_modules/undefsafe/lib/undefsafe.js create mode 100644 node_modules/undefsafe/package.json create mode 100644 node_modules/unique-string/index.d.ts create mode 100644 node_modules/unique-string/index.js create mode 100644 node_modules/unique-string/license create mode 100644 node_modules/unique-string/package.json create mode 100644 node_modules/unique-string/readme.md create mode 100644 node_modules/unpipe/HISTORY.md create mode 100644 node_modules/unpipe/LICENSE create mode 100644 node_modules/unpipe/README.md create mode 100644 node_modules/unpipe/index.js create mode 100644 node_modules/unpipe/package.json create mode 100644 node_modules/update-notifier/check.js create mode 100644 node_modules/update-notifier/index.js create mode 100644 node_modules/update-notifier/license create mode 100644 node_modules/update-notifier/package.json create mode 100644 node_modules/update-notifier/readme.md create mode 100644 node_modules/url-parse-lax/index.js create mode 100644 node_modules/url-parse-lax/license create mode 100644 node_modules/url-parse-lax/package.json create mode 100644 node_modules/url-parse-lax/readme.md create mode 100644 node_modules/util-deprecate/History.md create mode 100644 node_modules/util-deprecate/LICENSE create mode 100644 node_modules/util-deprecate/README.md create mode 100644 node_modules/util-deprecate/browser.js create mode 100644 node_modules/util-deprecate/node.js create mode 100644 node_modules/util-deprecate/package.json create mode 100644 node_modules/utils-merge/.npmignore create mode 100644 node_modules/utils-merge/LICENSE create mode 100644 node_modules/utils-merge/README.md create mode 100644 node_modules/utils-merge/index.js create mode 100644 node_modules/utils-merge/package.json create mode 100644 node_modules/vary/HISTORY.md create mode 100644 node_modules/vary/LICENSE create mode 100644 node_modules/vary/README.md create mode 100644 node_modules/vary/index.js create mode 100644 node_modules/vary/package.json create mode 100644 node_modules/wide-align/LICENSE create mode 100644 node_modules/wide-align/README.md create mode 100644 node_modules/wide-align/align.js create mode 100644 node_modules/wide-align/node_modules/ansi-regex/index.js create mode 100644 node_modules/wide-align/node_modules/ansi-regex/license create mode 100644 node_modules/wide-align/node_modules/ansi-regex/package.json create mode 100644 node_modules/wide-align/node_modules/ansi-regex/readme.md create mode 100644 node_modules/wide-align/node_modules/string-width/index.js create mode 100644 node_modules/wide-align/node_modules/string-width/license create mode 100644 node_modules/wide-align/node_modules/string-width/package.json create mode 100644 node_modules/wide-align/node_modules/string-width/readme.md create mode 100644 node_modules/wide-align/node_modules/strip-ansi/index.js create mode 100644 node_modules/wide-align/node_modules/strip-ansi/license create mode 100644 node_modules/wide-align/node_modules/strip-ansi/package.json create mode 100644 node_modules/wide-align/node_modules/strip-ansi/readme.md create mode 100644 node_modules/wide-align/package.json create mode 100644 node_modules/widest-line/index.d.ts create mode 100644 node_modules/widest-line/index.js create mode 100644 node_modules/widest-line/license create mode 100644 node_modules/widest-line/package.json create mode 100644 node_modules/widest-line/readme.md create mode 100644 node_modules/wrappy/LICENSE create mode 100644 node_modules/wrappy/README.md create mode 100644 node_modules/wrappy/package.json create mode 100644 node_modules/wrappy/wrappy.js create mode 100644 node_modules/write-file-atomic/CHANGELOG.md create mode 100644 node_modules/write-file-atomic/LICENSE create mode 100644 node_modules/write-file-atomic/README.md create mode 100644 node_modules/write-file-atomic/index.js create mode 100644 node_modules/write-file-atomic/package.json create mode 100644 node_modules/xdg-basedir/index.d.ts create mode 100644 node_modules/xdg-basedir/index.js create mode 100644 node_modules/xdg-basedir/license create mode 100644 node_modules/xdg-basedir/package.json create mode 100644 node_modules/xdg-basedir/readme.md create mode 100644 node_modules/yallist/LICENSE create mode 100644 node_modules/yallist/README.md create mode 100644 node_modules/yallist/iterator.js create mode 100644 node_modules/yallist/package.json create mode 100644 node_modules/yallist/yallist.js create mode 100644 package-lock.json create mode 100644 package.json diff --git a/file.js b/file.js new file mode 100644 index 00000000..f7503125 --- /dev/null +++ b/file.js @@ -0,0 +1,272 @@ +const express = require('express'); +const app = express(); +const bcrypt = require('bcrypt'); +const jwt = require('jsonwebtoken'); +const dotenv = require("dotenv"); +dotenv.config(); +const mongoose = require('mongoose'); +mongoose.connect('mongodb://localhost:27017/assignment-1', { + useNewUrlParser: true, + useUnifiedTopology: true +}); +mongoose.connection.on('error', console.error.bind(console, 'connection error:')); +mongoose.connection.once('open', function(){console.log('We are connected to the database.')}); +mongoose.set('useFindAndModify', false); +const userSchema = new mongoose.Schema({ + username: String, + email: String, + Password: String +}); +const listSchema = new mongoose.Schema({ + name: String, + user_id: {type:mongoose.Schema.Types.ObjectId,ref:'users'}, + created_at: String, + updated_at: String +}); +const categorySchema = new mongoose.Schema({ + name: String, + user_id:{type:mongoose.Schema.Types.ObjectId,ref:'user'}, + created_at: String, + updated_at: String +}); +const itemSchema = new mongoose.Schema({ + name: String, + category_id: {type:mongoose.Schema.Types.ObjectId,ref:'categories'}, + user_id: {type:mongoose.Schema.Types.ObjectId,ref:'users'}, + note: String, + image: String, + created_at: String, + updated_at: String, + list_id:[{type:mongoose.Schema.Types.ObjectId,ref:'lists'}] +}); +const userModel = mongoose.model('user', userSchema); +const listsModel = mongoose.model('lists', listSchema); +const categoriesModel = mongoose.model('categories', categorySchema); +const itemsModel = mongoose.model('items', itemSchema); +app.use(express.json()); + + + + +//authentification + +//users' login +app.post('/user', async (req, res) => { + try{ + const user = await userModel.findOne({email: req.body.email}); + if(!user){ + res.send('Email does not exist. Check again.') + }else{ + const match = await bcrypt.compare(req.body.Password, user.Password); + if(!match){ + res.send("Wrong password. Please try again."); + }else{ + res.send(jwt.sign({id: user._id}, 'anysecret')); + } + } + }catch(error){ + res.send("User not found. Please try again."); + console.log(error); + } +}); + +//sign up for new users +app.post('/user', async (req, res) => { + try{ + req.body.Password = await bcrypt.hash(req.body.Password, 12); + const user = await userModel.create(req.body); + res.json({ + message: "New user registred successfully.", + user + }) + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +//get user info +app.get('/user', async (req, res) => { + try{ + const user= await userModel.find(); + res.json(user); + }catch(error){ + res.send("Sorry, an error("+error+") occured. Please try again.") + } +}); + + + + +//lists + +//get user's lists +app.get('/lists', async (req, res) => { + res.json(await listsModel.find()); +}); + +//create a list +app.post('/lists', async (req, res) => { + try{ + await listsModel.create(req.body); + res.send("List created successfully."); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +//update list +app.put('/lists/:id', async (req, res, next) => { + listsModel.findOneAndUpdate({_id: req.params.id}, { + $set:{ + name:req.body.name, + user_id:req.body.user_id, + created_at:req.body.created_at, + updated_at:req.body.updated_at + } + }).then(result => { + res.status(200).json({ + updated_product:result + }) + }).catch(err=>{ + res.status(500).json({error:err}) + }) +}); + +//delete list by id +app.delete('/lists/:id', async (req, res) => { + try{ + await listsModel.findByIdAndRemove(req.params.id); + res.send('List deleted successfully.'); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +//get list's items +app.get('/lists/:id/items', async (req, res) => { + try{ + const use = await listsModel.findById(req.params.id); + const x = await itemsModel.find({list: req.params.id}); + res.json({x,use}); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +//add an item to a list +app.post('/lists/:id/items', async (req, res) => { + try{ + const use = await itemsModel.findById(req.body.id); + use.list_id.push(req.params.id); + await use.save(); + res.json(use); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +//update an item of a list +//app.put(... + +//delete an item of a list +//app.delete('/lists/:id/items', async (req, res) =>{... + + + + +//items + +//get items +app.get('/items', async (req, res) => { + res.json(await itemsModel.find()); +}); + +//create item +app.post('/items', async (req, res) => { + try { + await itemsModel.create(req.body); + res.send("Item created successfully."); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +// update item +app.put('/items/:id', async (req, res) => { + await itemsModel.findByIdAndUpdate({_id: req.body.id},{ + $set:{ + name:req.body.name, + category_id:req.body.category_id, + user_id:req.body.user_id, + note:req.body.note, + image:req.body.image, + created_at:req.body.created_at, + updated_at:req.body.updated_at + } + + }).then(result => { + res.status(200).json({updated_product:result}) + }).catch(err=>{ + res.status(500).json({error:err}) + }) +}); + +// delete item +app.delete('/items/:id', async (req, res) => { + try{ + await itemsModel.findByIdAndRemove(req.params.id); + res.send("Item deleted successfully.") + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + + + + +//categories + +//get categories by user +app.get('/categories/', async (req, res) => { + res.json(await categoriesModel.findById(req.params.id)); +}); + +//create category +app.post('/categories', async (req, res) => { + try { + await categoriesModel.create(req.body); + res.send("Category created successfully"); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + +//update category +app.put('/categories/:id', async (req, res, next) => { + await categoriesModel.findByIdAndUpdate({_id: req.params.id},{ + $set:{ + name:req.body.name, + user_id:req.body.user_id, + created_at:req.body.created_at, + updated_at:req.body.updated_at + } + }).then(result => { + res.status(200).json({updated_product:result}) + }).catch(err => {res.status(500).json({error:err})}) +}); + +//delete category +app.delete('/categories/:id', async (req, res) => { +try{ + await categoriesModel.findByIdAndRemove(req.params.id); + res.send("Category deleted successfully."); + }catch(error){ + res.send("Sorry, an error("+error+") occured, please try again."); + } +}); + + + + +app.listen(3000, () => {console.log("Connected to the server."); +}); \ No newline at end of file diff --git a/node_modules/.bin/detect-libc b/node_modules/.bin/detect-libc new file mode 120000 index 00000000..b4c4b767 --- /dev/null +++ b/node_modules/.bin/detect-libc @@ -0,0 +1 @@ +../detect-libc/bin/detect-libc.js \ No newline at end of file diff --git a/node_modules/.bin/is-ci b/node_modules/.bin/is-ci new file mode 120000 index 00000000..fe6aca6f --- /dev/null +++ b/node_modules/.bin/is-ci @@ -0,0 +1 @@ +../is-ci/bin.js \ No newline at end of file diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime new file mode 120000 index 00000000..fbb7ee0e --- /dev/null +++ b/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/node_modules/.bin/mkdirp b/node_modules/.bin/mkdirp new file mode 120000 index 00000000..017896ce --- /dev/null +++ b/node_modules/.bin/mkdirp @@ -0,0 +1 @@ +../mkdirp/bin/cmd.js \ No newline at end of file diff --git a/node_modules/.bin/node-pre-gyp b/node_modules/.bin/node-pre-gyp new file mode 120000 index 00000000..2946e6a5 --- /dev/null +++ b/node_modules/.bin/node-pre-gyp @@ -0,0 +1 @@ +../@mapbox/node-pre-gyp/bin/node-pre-gyp \ No newline at end of file diff --git a/node_modules/.bin/nodemon b/node_modules/.bin/nodemon new file mode 120000 index 00000000..1056ddc1 --- /dev/null +++ b/node_modules/.bin/nodemon @@ -0,0 +1 @@ +../nodemon/bin/nodemon.js \ No newline at end of file diff --git a/node_modules/.bin/nodetouch b/node_modules/.bin/nodetouch new file mode 120000 index 00000000..3409fdb7 --- /dev/null +++ b/node_modules/.bin/nodetouch @@ -0,0 +1 @@ +../touch/bin/nodetouch.js \ No newline at end of file diff --git a/node_modules/.bin/nopt b/node_modules/.bin/nopt new file mode 120000 index 00000000..6b6566ea --- /dev/null +++ b/node_modules/.bin/nopt @@ -0,0 +1 @@ +../nopt/bin/nopt.js \ No newline at end of file diff --git a/node_modules/.bin/rc b/node_modules/.bin/rc new file mode 120000 index 00000000..48b3cda7 --- /dev/null +++ b/node_modules/.bin/rc @@ -0,0 +1 @@ +../rc/cli.js \ No newline at end of file diff --git a/node_modules/.bin/rimraf b/node_modules/.bin/rimraf new file mode 120000 index 00000000..4cd49a49 --- /dev/null +++ b/node_modules/.bin/rimraf @@ -0,0 +1 @@ +../rimraf/bin.js \ No newline at end of file diff --git a/node_modules/.bin/semver b/node_modules/.bin/semver new file mode 120000 index 00000000..317eb293 --- /dev/null +++ b/node_modules/.bin/semver @@ -0,0 +1 @@ +../semver/bin/semver \ No newline at end of file diff --git a/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md b/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md new file mode 100644 index 00000000..aa2bbba9 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md @@ -0,0 +1,485 @@ +# node-pre-gyp changelog + +## 1.0.4 +- Added node v16 to the internal node releases listing + +## 1.0.3 +- Improved support configuring s3 uploads (solves https://github.com/mapbox/node-pre-gyp/issues/571) + - New options added in https://github.com/mapbox/node-pre-gyp/pull/576: 'bucket', 'region', and `s3ForcePathStyle` + +## 1.0.2 +- Fixed regression in proxy support (https://github.com/mapbox/node-pre-gyp/issues/572) + +## 1.0.1 +- Switched from mkdirp@1.0.4 to make-dir@3.1.0 to avoid this bug: https://github.com/isaacs/node-mkdirp/issues/31 + +## 1.0.0 +- Module is now name-spaced at `@mapbox/node-pre-gyp` and the original `node-pre-gyp` is deprecated. +- New: support for staging and production s3 targets (see README.md) +- BREAKING: no longer supporting `node_pre_gyp_accessKeyId` & `node_pre_gyp_secretAccessKey`, use `AWS_ACCESS_KEY_ID` & `AWS_SECRET_ACCESS_KEY` instead to authenticate against s3 for `info`, `publish`, and `unpublish` commands. +- Dropped node v6 support, added node v14 support +- Switched tests to use mapbox-owned bucket for testing +- Added coverage tracking and linting with eslint +- Added back support for symlinks inside the tarball +- Upgraded all test apps to N-API/node-addon-api +- New: support for staging and production s3 targets (see README.md) +- Added `node_pre_gyp_s3_host` env var which has priority over the `--s3_host` option or default. +- Replaced needle with node-fetch +- Added proxy support for node-fetch +- Upgraded to mkdirp@1.x + +## 0.17.0 +- Got travis + appveyor green again +- Added support for more node versions + +## 0.16.0 + +- Added Node 15 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/520) + +## 0.15.0 + +- Bump dependency on `mkdirp` from `^0.5.1` to `^0.5.3` (https://github.com/mapbox/node-pre-gyp/pull/492) +- Bump dependency on `needle` from `^2.2.1` to `^2.5.0` (https://github.com/mapbox/node-pre-gyp/pull/502) +- Added Node 14 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/501) + +## 0.14.0 + +- Defer modules requires in napi.js (https://github.com/mapbox/node-pre-gyp/pull/434) +- Bump dependency on `tar` from `^4` to `^4.4.2` (https://github.com/mapbox/node-pre-gyp/pull/454) +- Support extracting compiled binary from local offline mirror (https://github.com/mapbox/node-pre-gyp/pull/459) +- Added Node 13 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/483) + +## 0.13.0 + +- Added Node 12 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/449) + +## 0.12.0 + +- Fixed double-build problem with node v10 (https://github.com/mapbox/node-pre-gyp/pull/428) +- Added node 11 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/422) + +## 0.11.0 + +- Fixed double-install problem with node v10 +- Significant N-API improvements (https://github.com/mapbox/node-pre-gyp/pull/405) + +## 0.10.3 + +- Now will use `request` over `needle` if request is installed. By default `needle` is used for `https`. This should unbreak proxy support that regressed in v0.9.0 + +## 0.10.2 + +- Fixed rc/deep-extent security vulnerability +- Fixed broken reinstall script do to incorrectly named get_best_napi_version + +## 0.10.1 + +- Fix needle error event (@medns) + +## 0.10.0 + +- Allow for a single-level module path when packing @allenluce (https://github.com/mapbox/node-pre-gyp/pull/371) +- Log warnings instead of errors when falling back @xzyfer (https://github.com/mapbox/node-pre-gyp/pull/366) +- Add Node.js v10 support to tests (https://github.com/mapbox/node-pre-gyp/pull/372) +- Remove retire.js from CI (https://github.com/mapbox/node-pre-gyp/pull/372) +- Remove support for Node.js v4 due to [EOL on April 30th, 2018](https://github.com/nodejs/Release/blob/7dd52354049cae99eed0e9fe01345b0722a86fde/schedule.json#L14) +- Update appveyor tests to install default NPM version instead of NPM v2.x for all Windows builds (https://github.com/mapbox/node-pre-gyp/pull/375) + +## 0.9.1 + +- Fixed regression (in v0.9.0) with support for http redirects @allenluce (https://github.com/mapbox/node-pre-gyp/pull/361) + +## 0.9.0 + +- Switched from using `request` to `needle` to reduce size of module deps (https://github.com/mapbox/node-pre-gyp/pull/350) + +## 0.8.0 + +- N-API support (@inspiredware) + +## 0.7.1 + +- Upgraded to tar v4.x + +## 0.7.0 + + - Updated request and hawk (#347) + - Dropped node v0.10.x support + +## 0.6.40 + + - Improved error reporting if an install fails + +## 0.6.39 + + - Support for node v9 + - Support for versioning on `{libc}` to allow binaries to work on non-glic linux systems like alpine linux + + +## 0.6.38 + + - Maintaining compatibility (for v0.6.x series) with node v0.10.x + +## 0.6.37 + + - Solved one part of #276: now now deduce the node ABI from the major version for node >= 2 even when not stored in the abi_crosswalk.json + - Fixed docs to avoid mentioning the deprecated and dangerous `prepublish` in package.json (#291) + - Add new node versions to crosswalk + - Ported tests to use tape instead of mocha + - Got appveyor tests passing by downgrading npm and node-gyp + +## 0.6.36 + + - Removed the running of `testbinary` during install. Because this was regressed for so long, it is too dangerous to re-enable by default. Developers needing validation can call `node-pre-gyp testbinary` directory. + - Fixed regression in v0.6.35 for electron installs (now skipping binary validation which is not yet supported for electron) + +## 0.6.35 + + - No longer recommending `npm ls` in `prepublish` (#291) + - Fixed testbinary command (#283) @szdavid92 + +## 0.6.34 + + - Added new node versions to crosswalk, including v8 + - Upgraded deps to latest versions, started using `^` instead of `~` for all deps. + +## 0.6.33 + + - Improved support for yarn + +## 0.6.32 + + - Honor npm configuration for CA bundles (@heikkipora) + - Add node-pre-gyp and npm versions to user agent (@addaleax) + - Updated various deps + - Add known node version for v7.x + +## 0.6.31 + + - Updated various deps + +## 0.6.30 + + - Update to npmlog@4.x and semver@5.3.x + - Add known node version for v6.5.0 + +## 0.6.29 + + - Add known node versions for v0.10.45, v0.12.14, v4.4.4, v5.11.1, and v6.1.0 + +## 0.6.28 + + - Now more verbose when remote binaries are not available. This is needed since npm is increasingly more quiet by default + and users need to know why builds are falling back to source compiles that might then error out. + +## 0.6.27 + + - Add known node version for node v6 + - Stopped bundling dependencies + - Documented method for module authors to avoid bundling node-pre-gyp + - See https://github.com/mapbox/node-pre-gyp/tree/master#configuring for details + +## 0.6.26 + + - Skip validation for nw runtime (https://github.com/mapbox/node-pre-gyp/pull/181) via @fleg + +## 0.6.25 + + - Improved support for auto-detection of electron runtime in `node-pre-gyp.find()` + - Pull request from @enlight - https://github.com/mapbox/node-pre-gyp/pull/187 + - Add known node version for 4.4.1 and 5.9.1 + +## 0.6.24 + + - Add known node version for 5.8.0, 5.9.0, and 4.4.0. + +## 0.6.23 + + - Add known node version for 0.10.43, 0.12.11, 4.3.2, and 5.7.1. + +## 0.6.22 + + - Add known node version for 4.3.1, and 5.7.0. + +## 0.6.21 + + - Add known node version for 0.10.42, 0.12.10, 4.3.0, and 5.6.0. + +## 0.6.20 + + - Add known node version for 4.2.5, 4.2.6, 5.4.0, 5.4.1,and 5.5.0. + +## 0.6.19 + + - Add known node version for 4.2.4 + +## 0.6.18 + + - Add new known node versions for 0.10.x, 0.12.x, 4.x, and 5.x + +## 0.6.17 + + - Re-tagged to fix packaging problem of `Error: Cannot find module 'isarray'` + +## 0.6.16 + + - Added known version in crosswalk for 5.1.0. + +## 0.6.15 + + - Upgraded tar-pack (https://github.com/mapbox/node-pre-gyp/issues/182) + - Support custom binary hosting mirror (https://github.com/mapbox/node-pre-gyp/pull/170) + - Added known version in crosswalk for 4.2.2. + +## 0.6.14 + + - Added node 5.x version + +## 0.6.13 + + - Added more known node 4.x versions + +## 0.6.12 + + - Added support for [Electron](http://electron.atom.io/). Just pass the `--runtime=electron` flag when building/installing. Thanks @zcbenz + +## 0.6.11 + + - Added known node and io.js versions including more 3.x and 4.x versions + +## 0.6.10 + + - Added known node and io.js versions including 3.x and 4.x versions + - Upgraded `tar` dep + +## 0.6.9 + + - Upgraded `rc` dep + - Updated known io.js version: v2.4.0 + +## 0.6.8 + + - Upgraded `semver` and `rimraf` deps + - Updated known node and io.js versions + +## 0.6.7 + + - Fixed `node_abi` versions for io.js 1.1.x -> 1.8.x (should be 43, but was stored as 42) (refs https://github.com/iojs/build/issues/94) + +## 0.6.6 + + - Updated with known io.js 2.0.0 version + +## 0.6.5 + + - Now respecting `npm_config_node_gyp` (https://github.com/npm/npm/pull/4887) + - Updated to semver@4.3.2 + - Updated known node v0.12.x versions and io.js 1.x versions. + +## 0.6.4 + + - Improved support for `io.js` (@fengmk2) + - Test coverage improvements (@mikemorris) + - Fixed support for `--dist-url` that regressed in 0.6.3 + +## 0.6.3 + + - Added support for passing raw options to node-gyp using `--` separator. Flags passed after + the `--` to `node-pre-gyp configure` will be passed directly to gyp while flags passed + after the `--` will be passed directly to make/visual studio. + - Added `node-pre-gyp configure` command to be able to call `node-gyp configure` directly + - Fix issue with require validation not working on windows 7 (@edgarsilva) + +## 0.6.2 + + - Support for io.js >= v1.0.2 + - Deferred require of `request` and `tar` to help speed up command line usage of `node-pre-gyp`. + +## 0.6.1 + + - Fixed bundled `tar` version + +## 0.6.0 + + - BREAKING: node odd releases like v0.11.x now use `major.minor.patch` for `{node_abi}` instead of `NODE_MODULE_VERSION` (#124) + - Added support for `toolset` option in versioning. By default is an empty string but `--toolset` can be passed to publish or install to select alternative binaries that target a custom toolset like C++11. For example to target Visual Studio 2014 modules like node-sqlite3 use `--toolset=v140`. + - Added support for `--no-rollback` option to request that a failed binary test does not remove the binary module leaves it in place. + - Added support for `--update-binary` option to request an existing binary be re-installed and the check for a valid local module be skipped. + - Added support for passing build options from `npm` through `node-pre-gyp` to `node-gyp`: `--nodedir`, `--disturl`, `--python`, and `--msvs_version` + +## 0.5.31 + + - Added support for deducing node_abi for node.js runtime from previous release if the series is even + - Added support for --target=0.10.33 + +## 0.5.30 + + - Repackaged with latest bundled deps + +## 0.5.29 + + - Added support for semver `build`. + - Fixed support for downloading from urls that include `+`. + +## 0.5.28 + + - Now reporting unix style paths only in reveal command + +## 0.5.27 + + - Fixed support for auto-detecting s3 bucket name when it contains `.` - @taavo + - Fixed support for installing when path contains a `'` - @halfdan + - Ported tests to mocha + +## 0.5.26 + + - Fix node-webkit support when `--target` option is not provided + +## 0.5.25 + + - Fix bundling of deps + +## 0.5.24 + + - Updated ABI crosswalk to incldue node v0.10.30 and v0.10.31 + +## 0.5.23 + + - Added `reveal` command. Pass no options to get all versioning data as json. Pass a second arg to grab a single versioned property value + - Added support for `--silent` (shortcut for `--loglevel=silent`) + +## 0.5.22 + + - Fixed node-webkit versioning name (NOTE: node-webkit support still experimental) + +## 0.5.21 + + - New package to fix `shasum check failed` error with v0.5.20 + +## 0.5.20 + + - Now versioning node-webkit binaries based on major.minor.patch - assuming no compatible ABI across versions (#90) + +## 0.5.19 + + - Updated to know about more node-webkit releases + +## 0.5.18 + + - Updated to know about more node-webkit releases + +## 0.5.17 + + - Updated to know about node v0.10.29 release + +## 0.5.16 + + - Now supporting all aws-sdk configuration parameters (http://docs.aws.amazon.com/AWSJavaScriptSDK/guide/node-configuring.html) (#86) + +## 0.5.15 + + - Fixed installation of windows packages sub directories on unix systems (#84) + +## 0.5.14 + + - Finished support for cross building using `--target_platform` option (#82) + - Now skipping binary validation on install if target arch/platform do not match the host. + - Removed multi-arch validing for OS X since it required a FAT node.js binary + +## 0.5.13 + + - Fix problem in 0.5.12 whereby the wrong versions of mkdirp and semver where bundled. + +## 0.5.12 + + - Improved support for node-webkit (@Mithgol) + +## 0.5.11 + + - Updated target versions listing + +## 0.5.10 + + - Fixed handling of `-debug` flag passed directory to node-pre-gyp (#72) + - Added optional second arg to `node_pre_gyp.find` to customize the default versioning options used to locate the runtime binary + - Failed install due to `testbinary` check failure no longer leaves behind binary (#70) + +## 0.5.9 + + - Fixed regression in `testbinary` command causing installs to fail on windows with 0.5.7 (#60) + +## 0.5.8 + + - Started bundling deps + +## 0.5.7 + + - Fixed the `testbinary` check, which is used to determine whether to re-download or source compile, to work even in complex dependency situations (#63) + - Exposed the internal `testbinary` command in node-pre-gyp command line tool + - Fixed minor bug so that `fallback_to_build` option is always respected + +## 0.5.6 + + - Added support for versioning on the `name` value in `package.json` (#57). + - Moved to using streams for reading tarball when publishing (#52) + +## 0.5.5 + + - Improved binary validation that also now works with node-webkit (@Mithgol) + - Upgraded test apps to work with node v0.11.x + - Improved test coverage + +## 0.5.4 + + - No longer depends on external install of node-gyp for compiling builds. + +## 0.5.3 + + - Reverted fix for debian/nodejs since it broke windows (#45) + +## 0.5.2 + + - Support for debian systems where the node binary is named `nodejs` (#45) + - Added `bin/node-pre-gyp.cmd` to be able to run command on windows locally (npm creates an .npm automatically when globally installed) + - Updated abi-crosswalk with node v0.10.26 entry. + +## 0.5.1 + + - Various minor bug fixes, several improving windows support for publishing. + +## 0.5.0 + + - Changed property names in `binary` object: now required are `module_name`, `module_path`, and `host`. + - Now `module_path` supports versioning, which allows developers to opt-in to using a versioned install path (#18). + - Added `remote_path` which also supports versioning. + - Changed `remote_uri` to `host`. + +## 0.4.2 + + - Added support for `--target` flag to request cross-compile against a specific node/node-webkit version. + - Added preliminary support for node-webkit + - Fixed support for `--target_arch` option being respected in all cases. + +## 0.4.1 + + - Fixed exception when only stderr is available in binary test (@bendi / #31) + +## 0.4.0 + + - Enforce only `https:` based remote publishing access. + - Added `node-pre-gyp info` command to display listing of published binaries + - Added support for changing the directory node-pre-gyp should build in with the `-C/--directory` option. + - Added support for S3 prefixes. + +## 0.3.1 + + - Added `unpublish` command. + - Fixed module path construction in tests. + - Added ability to disable falling back to build behavior via `npm install --fallback-to-build=false` which overrides setting in a depedencies package.json `install` target. + +## 0.3.0 + + - Support for packaging all files in `module_path` directory - see `app4` for example + - Added `testpackage` command. + - Changed `clean` command to only delete `.node` not entire `build` directory since node-gyp will handle that. + - `.node` modules must be in a folder of there own since tar-pack will remove everything when it unpacks. diff --git a/node_modules/@mapbox/node-pre-gyp/LICENSE b/node_modules/@mapbox/node-pre-gyp/LICENSE new file mode 100644 index 00000000..8f5fce91 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/LICENSE @@ -0,0 +1,27 @@ +Copyright (c), Mapbox + +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, +are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright notice, + this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + * Neither the name of node-pre-gyp nor the names of its contributors + may be used to endorse or promote products derived from this software + without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR +CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/@mapbox/node-pre-gyp/README.md b/node_modules/@mapbox/node-pre-gyp/README.md new file mode 100644 index 00000000..0b0ee670 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/README.md @@ -0,0 +1,742 @@ +# @mapbox/node-pre-gyp + +#### @mapbox/node-pre-gyp makes it easy to publish and install Node.js C++ addons from binaries + +[![Build Status](https://travis-ci.com/mapbox/node-pre-gyp.svg?branch=master)](https://travis-ci.com/mapbox/node-pre-gyp) +[![Build status](https://ci.appveyor.com/api/projects/status/3nxewb425y83c0gv)](https://ci.appveyor.com/project/Mapbox/node-pre-gyp) + +`@mapbox/node-pre-gyp` stands between [npm](https://github.com/npm/npm) and [node-gyp](https://github.com/Tootallnate/node-gyp) and offers a cross-platform method of binary deployment. + +### Special note on previous package + +On Feb 9th, 2021 `@mapbox/node-pre-gyp@1.0.0` was [released](./CHANGELOG.md). Older, unscoped versions that are not part of the `@mapbox` org are deprecated and only `@mapbox/node-pre-gyp` will see updates going forward. To upgrade to the new package do: + +``` +npm uninstall node-pre-gyp --save +npm install @mapbox/node-pre-gyp --save +``` + +### Features + + - A command line tool called `node-pre-gyp` that can install your package's C++ module from a binary. + - A variety of developer targeted commands for packaging, testing, and publishing binaries. + - A JavaScript module that can dynamically require your installed binary: `require('@mapbox/node-pre-gyp').find` + +For a hello world example of a module packaged with `node-pre-gyp` see and [the wiki ](https://github.com/mapbox/node-pre-gyp/wiki/Modules-using-node-pre-gyp) for real world examples. + +## Credits + + - The module is modeled after [node-gyp](https://github.com/Tootallnate/node-gyp) by [@Tootallnate](https://github.com/Tootallnate) + - Motivation for initial development came from [@ErisDS](https://github.com/ErisDS) and the [Ghost Project](https://github.com/TryGhost/Ghost). + - Development is sponsored by [Mapbox](https://www.mapbox.com/) + +## FAQ + +See the [Frequently Ask Questions](https://github.com/mapbox/node-pre-gyp/wiki/FAQ). + +## Depends + + - Node.js >= node v8.x + +## Install + +`node-pre-gyp` is designed to be installed as a local dependency of your Node.js C++ addon and accessed like: + + ./node_modules/.bin/node-pre-gyp --help + +But you can also install it globally: + + npm install @mapbox/node-pre-gyp -g + +## Usage + +### Commands + +View all possible commands: + + node-pre-gyp --help + +- clean - Remove the entire folder containing the compiled .node module +- install - Install pre-built binary for module +- reinstall - Run "clean" and "install" at once +- build - Compile the module by dispatching to node-gyp or nw-gyp +- rebuild - Run "clean" and "build" at once +- package - Pack binary into tarball +- testpackage - Test that the staged package is valid +- publish - Publish pre-built binary +- unpublish - Unpublish pre-built binary +- info - Fetch info on published binaries + +You can also chain commands: + + node-pre-gyp clean build unpublish publish info + +### Options + +Options include: + + - `-C/--directory`: run the command in this directory + - `--build-from-source`: build from source instead of using pre-built binary + - `--update-binary`: reinstall by replacing previously installed local binary with remote binary + - `--runtime=node-webkit`: customize the runtime: `node`, `electron` and `node-webkit` are the valid options + - `--fallback-to-build`: fallback to building from source if pre-built binary is not available + - `--target=0.4.0`: Pass the target node or node-webkit version to compile against + - `--target_arch=ia32`: Pass the target arch and override the host `arch`. Valid values are 'ia32','x64', or `arm`. + - `--target_platform=win32`: Pass the target platform and override the host `platform`. Valid values are `linux`, `darwin`, `win32`, `sunos`, `freebsd`, `openbsd`, and `aix`. + +Both `--build-from-source` and `--fallback-to-build` can be passed alone or they can provide values. You can pass `--fallback-to-build=false` to override the option as declared in package.json. In addition to being able to pass `--build-from-source` you can also pass `--build-from-source=myapp` where `myapp` is the name of your module. + +For example: `npm install --build-from-source=myapp`. This is useful if: + + - `myapp` is referenced in the package.json of a larger app and therefore `myapp` is being installed as a dependency with `npm install`. + - The larger app also depends on other modules installed with `node-pre-gyp` + - You only want to trigger a source compile for `myapp` and the other modules. + +### Configuring + +This is a guide to configuring your module to use node-pre-gyp. + +#### 1) Add new entries to your `package.json` + + - Add `@mapbox/node-pre-gyp` to `dependencies` + - Add `aws-sdk` as a `devDependency` + - Add a custom `install` script + - Declare a `binary` object + +This looks like: + +```js + "dependencies" : { + "@mapbox/node-pre-gyp": "1.x" + }, + "devDependencies": { + "aws-sdk": "2.x" + } + "scripts": { + "install": "node-pre-gyp install --fallback-to-build" + }, + "binary": { + "module_name": "your_module", + "module_path": "./lib/binding/", + "host": "https://your_module.s3-us-west-1.amazonaws.com" + } +``` + +For a full example see [node-addon-examples's package.json](https://github.com/springmeyer/node-addon-example/blob/master/package.json). + +Let's break this down: + + - Dependencies need to list `node-pre-gyp` + - Your devDependencies should list `aws-sdk` so that you can run `node-pre-gyp publish` locally or a CI system. We recommend using `devDependencies` only since `aws-sdk` is large and not needed for `node-pre-gyp install` since it only uses http to fetch binaries + - Your `scripts` section should override the `install` target with `"install": "node-pre-gyp install --fallback-to-build"`. This allows node-pre-gyp to be used instead of the default npm behavior of always source compiling with `node-gyp` directly. + - Your package.json should contain a `binary` section describing key properties you provide to allow node-pre-gyp to package optimally. They are detailed below. + +Note: in the past we recommended putting `@mapbox/node-pre-gyp` in the `bundledDependencies`, but we no longer recommend this. In the past there were npm bugs (with node versions 0.10.x) that could lead to node-pre-gyp not being available at the right time during install (unless we bundled). This should no longer be the case. Also, for a time we recommended using `"preinstall": "npm install @mapbox/node-pre-gyp"` as an alternative method to avoid needing to bundle. But this did not behave predictably across all npm versions - see https://github.com/mapbox/node-pre-gyp/issues/260 for the details. So we do not recommend using `preinstall` to install `@mapbox/node-pre-gyp`. More history on this at https://github.com/strongloop/fsevents/issues/157#issuecomment-265545908. + +##### The `binary` object has three required properties + +###### module_name + +The name of your native node module. This value must: + + - Match the name passed to [the NODE_MODULE macro](http://nodejs.org/api/addons.html#addons_hello_world) + - Must be a valid C variable name (e.g. it cannot contain `-`) + - Should not include the `.node` extension. + +###### module_path + +The location your native module is placed after a build. This should be an empty directory without other Javascript files. This entire directory will be packaged in the binary tarball. When installing from a remote package this directory will be overwritten with the contents of the tarball. + +Note: This property supports variables based on [Versioning](#versioning). + +###### host + +A url to the remote location where you've published tarball binaries (must be `https` not `http`). + +It is highly recommended that you use Amazon S3. The reasons are: + + - Various node-pre-gyp commands like `publish` and `info` only work with an S3 host. + - S3 is a very solid hosting platform for distributing large files. + - We provide detail documentation for using [S3 hosting](#s3-hosting) with node-pre-gyp. + +Why then not require S3? Because while some applications using node-pre-gyp need to distribute binaries as large as 20-30 MB, others might have very small binaries and might wish to store them in a GitHub repo. This is not recommended, but if an author really wants to host in a non-S3 location then it should be possible. + +It should also be mentioned that there is an optional and entirely separate npm module called [node-pre-gyp-github](https://github.com/bchr02/node-pre-gyp-github) which is intended to complement node-pre-gyp and be installed along with it. It provides the ability to store and publish your binaries within your repositories GitHub Releases if you would rather not use S3 directly. Installation and usage instructions can be found [here](https://github.com/bchr02/node-pre-gyp-github), but the basic premise is that instead of using the ```node-pre-gyp publish``` command you would use ```node-pre-gyp-github publish```. + +##### The `binary` object other optional S3 properties + +If you are not using a standard s3 path like `bucket_name.s3(.-)region.amazonaws.com`, you might get an error on `publish` because node-pre-gyp extracts the region and bucket from the `host` url. For example, you may have an on-premises s3-compatible storage server, or may have configured a specific dns redirecting to an s3 endpoint. In these cases, you can explicitly set the `region` and `bucket` properties to tell node-pre-gyp to use these values instead of guessing from the `host` property. The following values can be used in the `binary` section: + +###### host + +The url to the remote server root location (must be `https` not `http`). + +###### bucket + +The bucket name where your tarball binaries should be located. + +###### region + +Your S3 server region. + +###### s3ForcePathStyle + +Set `s3ForcePathStyle` to true if the endpoint url should not be prefixed with the bucket name. If false (default), the server endpoint would be constructed as `bucket_name.your_server.com`. + +##### The `binary` object has optional properties + +###### remote_path + +It **is recommended** that you customize this property. This is an extra path to use for publishing and finding remote tarballs. The default value for `remote_path` is `""` meaning that if you do not provide it then all packages will be published at the base of the `host`. It is recommended to provide a value like `./{name}/v{version}` to help organize remote packages in the case that you choose to publish multiple node addons to the same `host`. + +Note: This property supports variables based on [Versioning](#versioning). + +###### package_name + +It is **not recommended** to override this property unless you are also overriding the `remote_path`. This is the versioned name of the remote tarball containing the binary `.node` module and any supporting files you've placed inside the `module_path` directory. Unless you specify `package_name` in your `package.json` then it defaults to `{module_name}-v{version}-{node_abi}-{platform}-{arch}.tar.gz` which allows your binary to work across node versions, platforms, and architectures. If you are using `remote_path` that is also versioned by `./{module_name}/v{version}` then you could remove these variables from the `package_name` and just use: `{node_abi}-{platform}-{arch}.tar.gz`. Then your remote tarball will be looked up at, for example, `https://example.com/your-module/v0.1.0/node-v11-linux-x64.tar.gz`. + +Avoiding the version of your module in the `package_name` and instead only embedding in a directory name can be useful when you want to make a quick tag of your module that does not change any C++ code. In this case you can just copy binaries to the new version behind the scenes like: + +```sh +aws s3 sync --acl public-read s3://mapbox-node-binary/sqlite3/v3.0.3/ s3://mapbox-node-binary/sqlite3/v3.0.4/ +``` + +Note: This property supports variables based on [Versioning](#versioning). + +#### 2) Add a new target to binding.gyp + +`node-pre-gyp` calls out to `node-gyp` to compile the module and passes variables along like [module_name](#module_name) and [module_path](#module_path). + +A new target must be added to `binding.gyp` that moves the compiled `.node` module from `./build/Release/module_name.node` into the directory specified by `module_path`. + +Add a target like this at the end of your `targets` list: + +```js + { + "target_name": "action_after_build", + "type": "none", + "dependencies": [ "<(module_name)" ], + "copies": [ + { + "files": [ "<(PRODUCT_DIR)/<(module_name).node" ], + "destination": "<(module_path)" + } + ] + } +``` + +For a full example see [node-addon-example's binding.gyp](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/binding.gyp). + +#### 3) Dynamically require your `.node` + +Inside the main js file that requires your addon module you are likely currently doing: + +```js +var binding = require('../build/Release/binding.node'); +``` + +or: + +```js +var bindings = require('./bindings') +``` + +Change those lines to: + +```js +var binary = require('@mapbox/node-pre-gyp'); +var path = require('path'); +var binding_path = binary.find(path.resolve(path.join(__dirname,'./package.json'))); +var binding = require(binding_path); +``` + +For a full example see [node-addon-example's index.js](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/index.js#L1-L4) + +#### 4) Build and package your app + +Now build your module from source: + + npm install --build-from-source + +The `--build-from-source` tells `node-pre-gyp` to not look for a remote package and instead dispatch to node-gyp to build. + +Now `node-pre-gyp` should now also be installed as a local dependency so the command line tool it offers can be found at `./node_modules/.bin/node-pre-gyp`. + +#### 5) Test + +Now `npm test` should work just as it did before. + +#### 6) Publish the tarball + +Then package your app: + + ./node_modules/.bin/node-pre-gyp package + +Once packaged, now you can publish: + + ./node_modules/.bin/node-pre-gyp publish + +Currently the `publish` command pushes your binary to S3. This requires: + + - You have installed `aws-sdk` with `npm install aws-sdk` + - You have created a bucket already. + - The `host` points to an S3 http or https endpoint. + - You have configured node-pre-gyp to read your S3 credentials (see [S3 hosting](#s3-hosting) for details). + +You can also host your binaries elsewhere. To do this requires: + + - You manually publish the binary created by the `package` command to an `https` endpoint + - Ensure that the `host` value points to your custom `https` endpoint. + +#### 7) Automate builds + +Now you need to publish builds for all the platforms and node versions you wish to support. This is best automated. + + - See [Appveyor Automation](#appveyor-automation) for how to auto-publish builds on Windows. + - See [Travis Automation](#travis-automation) for how to auto-publish builds on OS X and Linux. + +#### 8) You're done! + +Now publish your module to the npm registry. Users will now be able to install your module from a binary. + +What will happen is this: + +1. `npm install ` will pull from the npm registry +2. npm will run the `install` script which will call out to `node-pre-gyp` +3. `node-pre-gyp` will fetch the binary `.node` module and unpack in the right place +4. Assuming that all worked, you are done + +If a a binary was not available for a given platform and `--fallback-to-build` was used then `node-gyp rebuild` will be called to try to source compile the module. + +#### 9) One more option + +It may be that you want to work with two s3 buckets, one for staging and one for production; this +arrangement makes it less likely to accidentally overwrite a production binary. It also allows the production +environment to have more restrictive permissions than staging while still enabling publishing when +developing and testing. + +The binary.host property can be set at execution time. In order to do so all of the following conditions +must be true. + +- binary.host is falsey or not present +- binary.staging_host is not empty +- binary.production_host is not empty + +If any of these checks fail then the operation will not perform execution time determination of the s3 target. + +If the command being executed is "publish" then the default is set to `binary.staging_host`. In all other cases +the default is `binary.production_host`. + +The command-line options `--s3_host=staging` or `--s3_host=production` override the default. If `s3_host` +is present and not `staging` or `production` an exception is thrown. + +This allows installing from staging by specifying `--s3_host=staging`. And it requires specifying +`--s3_option=production` in order to publish to production making accidental publishing less likely. + +## Node-API Considerations + +[Node-API](https://nodejs.org/api/n-api.html#n_api_node_api), which was previously known as N-API, is an ABI-stable alternative to previous technologies such as [nan](https://github.com/nodejs/nan) which are tied to a specific Node runtime engine. Node-API is Node runtime engine agnostic and guarantees modules created today will continue to run, without changes, into the future. + +Using `node-pre-gyp` with Node-API projects requires a handful of additional configuration values and imposes some additional requirements. + +The most significant difference is that an Node-API module can be coded to target multiple Node-API versions. Therefore, an Node-API module must declare in its `package.json` file which Node-API versions the module is designed to run against. In addition, since multiple builds may be required for a single module, path and file names must be specified in way that avoids naming conflicts. + +### The `napi_versions` array property + +A Node-API module must declare in its `package.json` file, the Node-API versions the module is intended to support. This is accomplished by including an `napi-versions` array property in the `binary` object. For example: + +```js +"binary": { + "module_name": "your_module", + "module_path": "your_module_path", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +If the `napi_versions` array property is *not* present, `node-pre-gyp` operates as it always has. Including the `napi_versions` array property instructs `node-pre-gyp` that this is a Node-API module build. + +When the `napi_versions` array property is present, `node-pre-gyp` fires off multiple operations, one for each of the Node-API versions in the array. In the example above, two operations are initiated, one for Node-API version 1 and second for Node-API version 3. How this version number is communicated is described next. + +### The `napi_build_version` value + +For each of the Node-API module operations `node-pre-gyp` initiates, it ensures that the `napi_build_version` is set appropriately. + +This value is of importance in two areas: + +1. The C/C++ code which needs to know against which Node-API version it should compile. +2. `node-pre-gyp` itself which must assign appropriate path and file names to avoid collisions. + +### Defining `NAPI_VERSION` for the C/C++ code + +The `napi_build_version` value is communicated to the C/C++ code by adding this code to the `binding.gyp` file: + +``` +"defines": [ + "NAPI_VERSION=<(napi_build_version)", +] +``` + +This ensures that `NAPI_VERSION`, an integer value, is declared appropriately to the C/C++ code for each build. + +> Note that earlier versions of this document recommended defining the symbol `NAPI_BUILD_VERSION`. `NAPI_VERSION` is preferred because it used by the Node-API C/C++ headers to configure the specific Node-API versions being requested. + +### Path and file naming requirements in `package.json` + +Since `node-pre-gyp` fires off multiple operations for each request, it is essential that path and file names be created in such a way as to avoid collisions. This is accomplished by imposing additional path and file naming requirements. + +Specifically, when performing Node-API builds, the `{napi_build_version}` text configuration value *must* be present in the `module_path` property. In addition, the `{napi_build_version}` text configuration value *must* be present in either the `remote_path` or `package_name` property. (No problem if it's in both.) + +Here's an example: + +```js +"binary": { + "module_name": "your_module", + "module_path": "./lib/binding/napi-v{napi_build_version}", + "remote_path": "./{module_name}/v{version}/{configuration}/", + "package_name": "{platform}-{arch}-napi-v{napi_build_version}.tar.gz", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +## Supporting both Node-API and NAN builds + +You may have a legacy native add-on that you wish to continue supporting for those versions of Node that do not support Node-API, as you add Node-API support for later Node versions. This can be accomplished by specifying the `node_napi_label` configuration value in the package.json `binary.package_name` property. + +Placing the configuration value `node_napi_label` in the package.json `binary.package_name` property instructs `node-pre-gyp` to build all viable Node-API binaries supported by the current Node instance. If the current Node instance does not support Node-API, `node-pre-gyp` will request a traditional, non-Node-API build. + +The configuration value `node_napi_label` is set by `node-pre-gyp` to the type of build created, `napi` or `node`, and the version number. For Node-API builds, the string contains the Node-API version nad has values like `napi-v3`. For traditional, non-Node-API builds, the string contains the ABI version with values like `node-v46`. + +Here's how the `binary` configuration above might be changed to support both Node-API and NAN builds: + +```js +"binary": { + "module_name": "your_module", + "module_path": "./lib/binding/{node_napi_label}", + "remote_path": "./{module_name}/v{version}/{configuration}/", + "package_name": "{platform}-{arch}-{node_napi_label}.tar.gz", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +The C/C++ symbol `NAPI_VERSION` can be used to distinguish Node-API and non-Node-API builds. The value of `NAPI_VERSION` is set to the integer Node-API version for Node-API builds and is set to `0` for non-Node-API builds. + +For example: + +```C +#if NAPI_VERSION +// Node-API code goes here +#else +// NAN code goes here +#endif +``` + +### Two additional configuration values + +The following two configuration values, which were implemented in previous versions of `node-pre-gyp`, continue to exist, but have been replaced by the `node_napi_label` configuration value described above. + +1. `napi_version` If Node-API is supported by the currently executing Node instance, this value is the Node-API version number supported by Node. If Node-API is not supported, this value is an empty string. + +2. `node_abi_napi` If the value returned for `napi_version` is non empty, this value is `'napi'`. If the value returned for `napi_version` is empty, this value is the value returned for `node_abi`. + +These values are present for use in the `binding.gyp` file and may be used as `{napi_version}` and `{node_abi_napi}` for text substituion in the `binary` properties of the `package.json` file. + +## S3 Hosting + +You can host wherever you choose but S3 is cheap, `node-pre-gyp publish` expects it, and S3 can be integrated well with [Travis.ci](http://travis-ci.org) to automate builds for OS X and Ubuntu, and with [Appveyor](http://appveyor.com) to automate builds for Windows. Here is an approach to do this: + +First, get setup locally and test the workflow: + +#### 1) Create an S3 bucket + +And have your **key** and **secret key** ready for writing to the bucket. + +It is recommended to create a IAM user with a policy that only gives permissions to the specific bucket you plan to publish to. This can be done in the [IAM console](https://console.aws.amazon.com/iam/) by: 1) adding a new user, 2) choosing `Attach User Policy`, 3) Using the `Policy Generator`, 4) selecting `Amazon S3` for the service, 5) adding the actions: `DeleteObject`, `GetObject`, `GetObjectAcl`, `ListBucket`, `HeadBucket`, `PutObject`, `PutObjectAcl`, 6) adding an ARN of `arn:aws:s3:::bucket/*` (replacing `bucket` with your bucket name), and finally 7) clicking `Add Statement` and saving the policy. It should generate a policy like: + +```js +{ + "Version": "2012-10-17", + "Statement": [ + { + "Sid": "objects", + "Effect": "Allow", + "Action": [ + "s3:PutObject", + "s3:GetObjectAcl", + "s3:GetObject", + "s3:DeleteObject", + "s3:PutObjectAcl" + ], + "Resource": "arn:aws:s3:::your-bucket-name/*" + }, + { + "Sid": "bucket", + "Effect": "Allow", + "Action": "s3:ListBucket", + "Resource": "arn:aws:s3:::your-bucket-name" + }, + { + "Sid": "buckets", + "Effect": "Allow", + "Action": "s3:HeadBucket", + "Resource": "*" + } + ] +} +``` + +#### 2) Install node-pre-gyp + +Either install it globally: + + npm install node-pre-gyp -g + +Or put the local version on your PATH + + export PATH=`pwd`/node_modules/.bin/:$PATH + +#### 3) Configure AWS credentials + +It is recommended to configure the AWS JS SDK v2 used internally by `node-pre-gyp` by setting these environment variables: + +- AWS_ACCESS_KEY_ID +- AWS_SECRET_ACCESS_KEY + +But also you can also use the `Shared Config File` mentioned [in the AWS JS SDK v2 docs](https://docs.aws.amazon.com/sdk-for-javascript/v2/developer-guide/configuring-the-jssdk.html) + +#### 4) Package and publish your build + +Install the `aws-sdk`: + + npm install aws-sdk + +Then publish: + + node-pre-gyp package publish + +Note: if you hit an error like `Hostname/IP doesn't match certificate's altnames` it may mean that you need to provide the `region` option in your config. + +## Appveyor Automation + +[Appveyor](http://www.appveyor.com/) can build binaries and publish the results per commit and supports: + + - Windows Visual Studio 2013 and related compilers + - Both 64 bit (x64) and 32 bit (x86) build configurations + - Multiple Node.js versions + +For an example of doing this see [node-sqlite3's appveyor.yml](https://github.com/mapbox/node-sqlite3/blob/master/appveyor.yml). + +Below is a guide to getting set up: + +#### 1) Create a free Appveyor account + +Go to https://ci.appveyor.com/signup/free and sign in with your GitHub account. + +#### 2) Create a new project + +Go to https://ci.appveyor.com/projects/new and select the GitHub repo for your module + +#### 3) Add appveyor.yml and push it + +Once you have committed an `appveyor.yml` ([appveyor.yml reference](http://www.appveyor.com/docs/appveyor-yml)) to your GitHub repo and pushed it AppVeyor should automatically start building your project. + +#### 4) Create secure variables + +Encrypt your S3 AWS keys by going to and hitting the `encrypt` button. + +Then paste the result into your `appveyor.yml` + +```yml +environment: + AWS_ACCESS_KEY_ID: + secure: Dn9HKdLNYvDgPdQOzRq/DqZ/MPhjknRHB1o+/lVU8MA= + AWS_SECRET_ACCESS_KEY: + secure: W1rwNoSnOku1r+28gnoufO8UA8iWADmL1LiiwH9IOkIVhDTNGdGPJqAlLjNqwLnL +``` + +NOTE: keys are per account but not per repo (this is difference than Travis where keys are per repo but not related to the account used to encrypt them). + +#### 5) Hook up publishing + +Just put `node-pre-gyp package publish` in your `appveyor.yml` after `npm install`. + +#### 6) Publish when you want + +You might wish to publish binaries only on a specific commit. To do this you could borrow from the [Travis CI idea of commit keywords](http://about.travis-ci.org/docs/user/how-to-skip-a-build/) and add special handling for commit messages with `[publish binary]`: + + SET CM=%APPVEYOR_REPO_COMMIT_MESSAGE% + if not "%CM%" == "%CM:[publish binary]=%" node-pre-gyp --msvs_version=2013 publish + +If your commit message contains special characters (e.g. `&`) this method might fail. An alternative is to use PowerShell, which gives you additional possibilities, like ignoring case by using `ToLower()`: + + ps: if($env:APPVEYOR_REPO_COMMIT_MESSAGE.ToLower().Contains('[publish binary]')) { node-pre-gyp --msvs_version=2013 publish } + +Remember this publishing is not the same as `npm publish`. We're just talking about the binary module here and not your entire npm package. + +## Travis Automation + +[Travis](https://travis-ci.org/) can push to S3 after a successful build and supports both: + + - Ubuntu Precise and OS X (64 bit) + - Multiple Node.js versions + +For an example of doing this see [node-add-example's .travis.yml](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/.travis.yml). + +Note: if you need 32 bit binaries, this can be done from a 64 bit Travis machine. See [the node-sqlite3 scripts for an example of doing this](https://github.com/mapbox/node-sqlite3/blob/bae122aa6a2b8a45f6b717fab24e207740e32b5d/scripts/build_against_node.sh#L54-L74). + +Below is a guide to getting set up: + +#### 1) Install the Travis gem + + gem install travis + +#### 2) Create secure variables + +Make sure you run this command from within the directory of your module. + +Use `travis-encrypt` like: + + travis encrypt node_pre_gyp_accessKeyId=${node_pre_gyp_accessKeyId} + travis encrypt node_pre_gyp_secretAccessKey=${node_pre_gyp_secretAccessKey} + +Then put those values in your `.travis.yml` like: + +```yaml +env: + global: + - secure: F+sEL/v56CzHqmCSSES4pEyC9NeQlkoR0Gs/ZuZxX1ytrj8SKtp3MKqBj7zhIclSdXBz4Ev966Da5ctmcTd410p0b240MV6BVOkLUtkjZJyErMBOkeb8n8yVfSoeMx8RiIhBmIvEn+rlQq+bSFis61/JkE9rxsjkGRZi14hHr4M= + - secure: o2nkUQIiABD139XS6L8pxq3XO5gch27hvm/gOdV+dzNKc/s2KomVPWcOyXNxtJGhtecAkABzaW8KHDDi5QL1kNEFx6BxFVMLO8rjFPsMVaBG9Ks6JiDQkkmrGNcnVdxI/6EKTLHTH5WLsz8+J7caDBzvKbEfTux5EamEhxIWgrI= +``` + +More details on Travis encryption at http://about.travis-ci.org/docs/user/encryption-keys/. + +#### 3) Hook up publishing + +Just put `node-pre-gyp package publish` in your `.travis.yml` after `npm install`. + +##### OS X publishing + +If you want binaries for OS X in addition to linux you can enable [multi-os for Travis](http://docs.travis-ci.com/user/multi-os/#Setting-.travis.yml) + +Use a configuration like: + +```yml + +language: cpp + +os: +- linux +- osx + +env: + matrix: + - NODE_VERSION="4" + - NODE_VERSION="6" + +before_install: +- rm -rf ~/.nvm/ && git clone --depth 1 https://github.com/creationix/nvm.git ~/.nvm +- source ~/.nvm/nvm.sh +- nvm install $NODE_VERSION +- nvm use $NODE_VERSION +``` + +See [Travis OS X Gotchas](#travis-os-x-gotchas) for why we replace `language: node_js` and `node_js:` sections with `language: cpp` and a custom matrix. + +Also create platform specific sections for any deps that need install. For example if you need libpng: + +```yml +- if [ $(uname -s) == 'Linux' ]; then apt-get install libpng-dev; fi; +- if [ $(uname -s) == 'Darwin' ]; then brew install libpng; fi; +``` + +For detailed multi-OS examples see [node-mapnik](https://github.com/mapnik/node-mapnik/blob/master/.travis.yml) and [node-sqlite3](https://github.com/mapbox/node-sqlite3/blob/master/.travis.yml). + +##### Travis OS X Gotchas + +First, unlike the Travis Linux machines, the OS X machines do not put `node-pre-gyp` on PATH by default. To do so you will need to: + +```sh +export PATH=$(pwd)/node_modules/.bin:${PATH} +``` + +Second, the OS X machines do not support using a matrix for installing different Node.js versions. So you need to bootstrap the installation of Node.js in a cross platform way. + +By doing: + +```yml +env: + matrix: + - NODE_VERSION="4" + - NODE_VERSION="6" + +before_install: + - rm -rf ~/.nvm/ && git clone --depth 1 https://github.com/creationix/nvm.git ~/.nvm + - source ~/.nvm/nvm.sh + - nvm install $NODE_VERSION + - nvm use $NODE_VERSION +``` + +You can easily recreate the previous behavior of this matrix: + +```yml +node_js: + - "4" + - "6" +``` + +#### 4) Publish when you want + +You might wish to publish binaries only on a specific commit. To do this you could borrow from the [Travis CI idea of commit keywords](http://about.travis-ci.org/docs/user/how-to-skip-a-build/) and add special handling for commit messages with `[publish binary]`: + + COMMIT_MESSAGE=$(git log --format=%B --no-merges -n 1 | tr -d '\n') + if [[ ${COMMIT_MESSAGE} =~ "[publish binary]" ]]; then node-pre-gyp publish; fi; + +Then you can trigger new binaries to be built like: + + git commit -a -m "[publish binary]" + +Or, if you don't have any changes to make simply run: + + git commit --allow-empty -m "[publish binary]" + +WARNING: if you are working in a pull request and publishing binaries from there then you will want to avoid double publishing when Travis CI builds both the `push` and `pr`. You only want to run the publish on the `push` commit. See https://github.com/Project-OSRM/node-osrm/blob/8eb837abe2e2e30e595093d16e5354bc5c573575/scripts/is_pr_merge.sh which is called from https://github.com/Project-OSRM/node-osrm/blob/8eb837abe2e2e30e595093d16e5354bc5c573575/scripts/publish.sh for an example of how to do this. + +Remember this publishing is not the same as `npm publish`. We're just talking about the binary module here and not your entire npm package. To automate the publishing of your entire package to npm on Travis see http://about.travis-ci.org/docs/user/deployment/npm/ + +# Versioning + +The `binary` properties of `module_path`, `remote_path`, and `package_name` support variable substitution. The strings are evaluated by `node-pre-gyp` depending on your system and any custom build flags you passed. + + - `node_abi`: The node C++ `ABI` number. This value is available in Javascript as `process.versions.modules` as of [`>= v0.10.4 >= v0.11.7`](https://github.com/joyent/node/commit/ccabd4a6fa8a6eb79d29bc3bbe9fe2b6531c2d8e) and in C++ as the `NODE_MODULE_VERSION` define much earlier. For versions of Node before this was available we fallback to the V8 major and minor version. + - `platform` matches node's `process.platform` like `linux`, `darwin`, and `win32` unless the user passed the `--target_platform` option to override. + - `arch` matches node's `process.arch` like `x64` or `ia32` unless the user passes the `--target_arch` option to override. + - `libc` matches `require('detect-libc').family` like `glibc` or `musl` unless the user passes the `--target_libc` option to override. + - `configuration` - Either 'Release' or 'Debug' depending on if `--debug` is passed during the build. + - `module_name` - the `binary.module_name` attribute from `package.json`. + - `version` - the semver `version` value for your module from `package.json` (NOTE: ignores the `semver.build` property). + - `major`, `minor`, `patch`, and `prelease` match the individual semver values for your module's `version` + - `build` - the sevmer `build` value. For example it would be `this.that` if your package.json `version` was `v1.0.0+this.that` + - `prerelease` - the semver `prerelease` value. For example it would be `alpha.beta` if your package.json `version` was `v1.0.0-alpha.beta` + + +The options are visible in the code at + +# Download binary files from a mirror + +S3 is broken in China for the well known reason. + +Using the `npm` config argument: `--{module_name}_binary_host_mirror` can download binary files through a mirror, `-` in `module_name` will be replaced with `_`. + +e.g.: Install [v8-profiler](https://www.npmjs.com/package/v8-profiler) from `npm`. + +```bash +$ npm install v8-profiler --profiler_binary_host_mirror=https://npm.taobao.org/mirrors/node-inspector/ +``` + +e.g.: Install [canvas-prebuilt](https://www.npmjs.com/package/canvas-prebuilt) from `npm`. + +```bash +$ npm install canvas-prebuilt --canvas_prebuilt_binary_host_mirror=https://npm.taobao.org/mirrors/canvas-prebuilt/ +``` diff --git a/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp b/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp new file mode 100755 index 00000000..c38d34d1 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp @@ -0,0 +1,4 @@ +#!/usr/bin/env node +'use strict'; + +require('../lib/main'); diff --git a/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd b/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd new file mode 100644 index 00000000..46e14b54 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd @@ -0,0 +1,2 @@ +@echo off +node "%~dp0\node-pre-gyp" %* diff --git a/node_modules/@mapbox/node-pre-gyp/contributing.md b/node_modules/@mapbox/node-pre-gyp/contributing.md new file mode 100644 index 00000000..4038fa6a --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/contributing.md @@ -0,0 +1,10 @@ +# Contributing + + +### Releasing a new version: + +- Ensure tests are passing on travis and appveyor +- Run `node scripts/abi_crosswalk.js` and commit any changes +- Update the changelog +- Tag a new release like: `git tag -a v0.6.34 -m "tagging v0.6.34" && git push --tags` +- Run `npm publish` diff --git a/node_modules/@mapbox/node-pre-gyp/lib/build.js b/node_modules/@mapbox/node-pre-gyp/lib/build.js new file mode 100644 index 00000000..e8a1459d --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/build.js @@ -0,0 +1,51 @@ +'use strict'; + +module.exports = exports = build; + +exports.usage = 'Attempts to compile the module by dispatching to node-gyp or nw-gyp'; + +const napi = require('./util/napi.js'); +const compile = require('./util/compile.js'); +const handle_gyp_opts = require('./util/handle_gyp_opts.js'); +const configure = require('./configure.js'); + +function do_build(gyp, argv, callback) { + handle_gyp_opts(gyp, argv, (err, result) => { + let final_args = ['build'].concat(result.gyp).concat(result.pre); + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + if (!err && result.opts.napi_build_version) { + napi.swap_build_dir_in(result.opts.napi_build_version); + } + compile.run_gyp(final_args, result.opts, (err2) => { + if (result.opts.napi_build_version) { + napi.swap_build_dir_out(result.opts.napi_build_version); + } + return callback(err2); + }); + }); +} + +function build(gyp, argv, callback) { + + // Form up commands to pass to node-gyp: + // We map `node-pre-gyp build` to `node-gyp configure build` so that we do not + // trigger a clean and therefore do not pay the penalty of a full recompile + if (argv.length && (argv.indexOf('rebuild') > -1)) { + argv.shift(); // remove `rebuild` + // here we map `node-pre-gyp rebuild` to `node-gyp rebuild` which internally means + // "clean + configure + build" and triggers a full recompile + compile.run_gyp(['clean'], {}, (err3) => { + if (err3) return callback(err3); + configure(gyp, argv, (err4) => { + if (err4) return callback(err4); + return do_build(gyp, argv, callback); + }); + }); + } else { + return do_build(gyp, argv, callback); + } +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/clean.js b/node_modules/@mapbox/node-pre-gyp/lib/clean.js new file mode 100644 index 00000000..e6933923 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/clean.js @@ -0,0 +1,31 @@ +'use strict'; + +module.exports = exports = clean; + +exports.usage = 'Removes the entire folder containing the compiled .node module'; + +const rm = require('rimraf'); +const exists = require('fs').exists || require('path').exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const path = require('path'); + +function clean(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const to_delete = opts.module_path; + if (!to_delete) { + return callback(new Error('module_path is empty, refusing to delete')); + } else if (path.normalize(to_delete) === path.normalize(process.cwd())) { + return callback(new Error('module_path is not set, refusing to delete')); + } else { + exists(to_delete, (found) => { + if (found) { + if (!gyp.opts.silent_clean) console.log('[' + package_json.name + '] Removing "%s"', to_delete); + return rm(to_delete, callback); + } + return callback(); + }); + } +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/configure.js b/node_modules/@mapbox/node-pre-gyp/lib/configure.js new file mode 100644 index 00000000..1337c0cb --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/configure.js @@ -0,0 +1,52 @@ +'use strict'; + +module.exports = exports = configure; + +exports.usage = 'Attempts to configure node-gyp or nw-gyp build'; + +const napi = require('./util/napi.js'); +const compile = require('./util/compile.js'); +const handle_gyp_opts = require('./util/handle_gyp_opts.js'); + +function configure(gyp, argv, callback) { + handle_gyp_opts(gyp, argv, (err, result) => { + let final_args = result.gyp.concat(result.pre); + // pull select node-gyp configure options out of the npm environ + const known_gyp_args = ['dist-url', 'python', 'nodedir', 'msvs_version']; + known_gyp_args.forEach((key) => { + const val = gyp.opts[key] || gyp.opts[key.replace('-', '_')]; + if (val) { + final_args.push('--' + key + '=' + val); + } + }); + // --ensure=false tell node-gyp to re-install node development headers + // but it is only respected by node-gyp install, so we have to call install + // as a separate step if the user passes it + if (gyp.opts.ensure === false) { + const install_args = final_args.concat(['install', '--ensure=false']); + compile.run_gyp(install_args, result.opts, (err2) => { + if (err2) return callback(err2); + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + compile.run_gyp(['configure'].concat(final_args), result.opts, (err3) => { + return callback(err3); + }); + }); + } else { + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + compile.run_gyp(['configure'].concat(final_args), result.opts, (err4) => { + if (!err4 && result.opts.napi_build_version) { + napi.swap_build_dir_out(result.opts.napi_build_version); + } + return callback(err4); + }); + } + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/info.js b/node_modules/@mapbox/node-pre-gyp/lib/info.js new file mode 100644 index 00000000..ba22f327 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/info.js @@ -0,0 +1,38 @@ +'use strict'; + +module.exports = exports = info; + +exports.usage = 'Lists all published binaries (requires aws-sdk)'; + +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const s3_setup = require('./util/s3_setup.js'); + +function info(gyp, argv, callback) { + const package_json = gyp.package_json; + const opts = versioning.evaluate(package_json, gyp.opts); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + const s3_opts = { + Bucket: config.bucket, + Prefix: config.prefix + }; + s3.listObjects(s3_opts, (err, meta) => { + if (err && err.code === 'NotFound') { + return callback(new Error('[' + package_json.name + '] Not found: https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + config.prefix)); + } else if (err) { + return callback(err); + } else { + log.verbose(JSON.stringify(meta, null, 1)); + if (meta && meta.Contents) { + meta.Contents.forEach((obj) => { + console.log(obj.Key); + }); + } else { + console.error('[' + package_json.name + '] No objects found at https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + config.prefix); + } + return callback(); + } + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/install.js b/node_modules/@mapbox/node-pre-gyp/lib/install.js new file mode 100644 index 00000000..617dd866 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/install.js @@ -0,0 +1,235 @@ +'use strict'; + +module.exports = exports = install; + +exports.usage = 'Attempts to install pre-built binary for module'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const existsAsync = fs.exists || path.exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const makeDir = require('make-dir'); +// for fetching binaries +const fetch = require('node-fetch'); +const tar = require('tar'); + +let npgVersion = 'unknown'; +try { + // Read own package.json to get the current node-pre-pyp version. + const ownPackageJSON = fs.readFileSync(path.join(__dirname, '..', 'package.json'), 'utf8'); + npgVersion = JSON.parse(ownPackageJSON).version; +} catch (e) { + // do nothing +} + +function place_binary(uri, targetDir, opts, callback) { + log.http('GET', uri); + + // Try getting version info from the currently running npm. + const envVersionInfo = process.env.npm_config_user_agent || + 'node ' + process.version; + + const sanitized = uri.replace('+', '%2B'); + const requestOpts = { + uri: sanitized, + headers: { + 'User-Agent': 'node-pre-gyp (v' + npgVersion + ', ' + envVersionInfo + ')' + }, + follow_max: 10 + }; + + if (opts.cafile) { + try { + requestOpts.ca = fs.readFileSync(opts.cafile); + } catch (e) { + return callback(e); + } + } else if (opts.ca) { + requestOpts.ca = opts.ca; + } + + const proxyUrl = opts.proxy || + process.env.http_proxy || + process.env.HTTP_PROXY || + process.env.npm_config_proxy; + let agent; + if (proxyUrl) { + const ProxyAgent = require('https-proxy-agent'); + agent = new ProxyAgent(proxyUrl); + log.http('download', 'proxy agent configured using: "%s"', proxyUrl); + } + + fetch(sanitized, { agent }) + .then((res) => { + if (!res.ok) { + throw new Error(`response status ${res.status} ${res.statusText} on ${sanitized}`); + } + const dataStream = res.body; + + return new Promise((resolve, reject) => { + let extractions = 0; + const countExtractions = (entry) => { + extractions += 1; + log.info('install', 'unpacking %s', entry.path); + }; + + dataStream.pipe(extract(targetDir, countExtractions)) + .on('error', (e) => { + reject(e); + }); + dataStream.on('end', () => { + resolve(`extracted file count: ${extractions}`); + }); + dataStream.on('error', (e) => { + reject(e); + }); + }); + }) + .then((text) => { + log.info(text); + callback(); + }) + .catch((e) => { + log.error(`install ${e.message}`); + callback(e); + }); +} + +function extract(to, onentry) { + return tar.extract({ + cwd: to, + strip: 1, + onentry + }); +} + +function extract_from_local(from, targetDir, callback) { + if (!fs.existsSync(from)) { + return callback(new Error('Cannot find file ' + from)); + } + log.info('Found local file to extract from ' + from); + + // extract helpers + let extractCount = 0; + function countExtractions(entry) { + extractCount += 1; + log.info('install', 'unpacking ' + entry.path); + } + function afterExtract(err) { + if (err) return callback(err); + if (extractCount === 0) { + return callback(new Error('There was a fatal problem while extracting the tarball')); + } + log.info('tarball', 'done parsing tarball'); + callback(); + } + + fs.createReadStream(from).pipe(extract(targetDir, countExtractions)) + .on('close', afterExtract) + .on('error', afterExtract); +} + +function do_build(gyp, argv, callback) { + const args = ['rebuild'].concat(argv); + gyp.todo.push({ name: 'build', args: args }); + process.nextTick(callback); +} + +function print_fallback_error(err, opts, package_json) { + const fallback_message = ' (falling back to source compile with node-gyp)'; + let full_message = ''; + if (err.statusCode !== undefined) { + // If we got a network response it but failed to download + // it means remote binaries are not available, so let's try to help + // the user/developer with the info to debug why + full_message = 'Pre-built binaries not found for ' + package_json.name + '@' + package_json.version; + full_message += ' and ' + opts.runtime + '@' + (opts.target || process.versions.node) + ' (' + opts.node_abi + ' ABI, ' + opts.libc + ')'; + full_message += fallback_message; + log.warn('Tried to download(' + err.statusCode + '): ' + opts.hosted_tarball); + log.warn(full_message); + log.http(err.message); + } else { + // If we do not have a statusCode that means an unexpected error + // happened and prevented an http response, so we output the exact error + full_message = 'Pre-built binaries not installable for ' + package_json.name + '@' + package_json.version; + full_message += ' and ' + opts.runtime + '@' + (opts.target || process.versions.node) + ' (' + opts.node_abi + ' ABI, ' + opts.libc + ')'; + full_message += fallback_message; + log.warn(full_message); + log.warn('Hit error ' + err.message); + } +} + +// +// install +// +function install(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const source_build = gyp.opts['build-from-source'] || gyp.opts.build_from_source; + const update_binary = gyp.opts['update-binary'] || gyp.opts.update_binary; + const should_do_source_build = source_build === package_json.name || (source_build === true || source_build === 'true'); + if (should_do_source_build) { + log.info('build', 'requesting source compile'); + return do_build(gyp, argv, callback); + } else { + const fallback_to_build = gyp.opts['fallback-to-build'] || gyp.opts.fallback_to_build; + let should_do_fallback_build = fallback_to_build === package_json.name || (fallback_to_build === true || fallback_to_build === 'true'); + // but allow override from npm + if (process.env.npm_config_argv) { + const cooked = JSON.parse(process.env.npm_config_argv).cooked; + const match = cooked.indexOf('--fallback-to-build'); + if (match > -1 && cooked.length > match && cooked[match + 1] === 'false') { + should_do_fallback_build = false; + log.info('install', 'Build fallback disabled via npm flag: --fallback-to-build=false'); + } + } + let opts; + try { + opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + } catch (err) { + return callback(err); + } + + opts.ca = gyp.opts.ca; + opts.cafile = gyp.opts.cafile; + + const from = opts.hosted_tarball; + const to = opts.module_path; + const binary_module = path.join(to, opts.module_name + '.node'); + existsAsync(binary_module, (found) => { + if (!update_binary) { + if (found) { + console.log('[' + package_json.name + '] Success: "' + binary_module + '" already installed'); + console.log('Pass --update-binary to reinstall or --build-from-source to recompile'); + return callback(); + } + log.info('check', 'checked for "' + binary_module + '" (not found)'); + } + + makeDir(to).then(() => { + const fileName = from.startsWith('file://') && from.slice('file://'.length); + if (fileName) { + extract_from_local(fileName, to, after_place); + } else { + place_binary(from, to, opts, after_place); + } + }).catch((err) => { + after_place(err); + }); + + function after_place(err) { + if (err && should_do_fallback_build) { + print_fallback_error(err, opts, package_json); + return do_build(gyp, argv, callback); + } else if (err) { + return callback(err); + } else { + console.log('[' + package_json.name + '] Success: "' + binary_module + '" is installed via remote'); + return callback(); + } + } + }); + } +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/main.js b/node_modules/@mapbox/node-pre-gyp/lib/main.js new file mode 100644 index 00000000..bae32acb --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/main.js @@ -0,0 +1,125 @@ +'use strict'; + +/** + * Set the title. + */ + +process.title = 'node-pre-gyp'; + +const node_pre_gyp = require('../'); +const log = require('npmlog'); + +/** + * Process and execute the selected commands. + */ + +const prog = new node_pre_gyp.Run({ argv: process.argv }); +let completed = false; + +if (prog.todo.length === 0) { + if (~process.argv.indexOf('-v') || ~process.argv.indexOf('--version')) { + console.log('v%s', prog.version); + process.exit(0); + } else if (~process.argv.indexOf('-h') || ~process.argv.indexOf('--help')) { + console.log('%s', prog.usage()); + process.exit(0); + } + console.log('%s', prog.usage()); + process.exit(1); +} + +// if --no-color is passed +if (prog.opts && Object.hasOwnProperty.call(prog, 'color') && !prog.opts.color) { + log.disableColor(); +} + +log.info('it worked if it ends with', 'ok'); +log.verbose('cli', process.argv); +log.info('using', process.title + '@%s', prog.version); +log.info('using', 'node@%s | %s | %s', process.versions.node, process.platform, process.arch); + + +/** + * Change dir if -C/--directory was passed. + */ + +const dir = prog.opts.directory; +if (dir) { + const fs = require('fs'); + try { + const stat = fs.statSync(dir); + if (stat.isDirectory()) { + log.info('chdir', dir); + process.chdir(dir); + } else { + log.warn('chdir', dir + ' is not a directory'); + } + } catch (e) { + if (e.code === 'ENOENT') { + log.warn('chdir', dir + ' is not a directory'); + } else { + log.warn('chdir', 'error during chdir() "%s"', e.message); + } + } +} + +function run() { + const command = prog.todo.shift(); + if (!command) { + // done! + completed = true; + log.info('ok'); + return; + } + + // set binary.host when appropriate. host determines the s3 target bucket. + const target = prog.setBinaryHostProperty(command.name); + if (target && ['install', 'publish', 'unpublish', 'info'].indexOf(command.name) >= 0) { + log.info('using binary.host: ' + prog.package_json.binary.host); + } + + prog.commands[command.name](command.args, function(err) { + if (err) { + log.error(command.name + ' error'); + log.error('stack', err.stack); + errorMessage(); + log.error('not ok'); + console.log(err.message); + return process.exit(1); + } + const args_array = [].slice.call(arguments, 1); + if (args_array.length) { + console.log.apply(console, args_array); + } + // now run the next command in the queue + process.nextTick(run); + }); +} + +process.on('exit', (code) => { + if (!completed && !code) { + log.error('Completion callback never invoked!'); + errorMessage(); + process.exit(6); + } +}); + +process.on('uncaughtException', (err) => { + log.error('UNCAUGHT EXCEPTION'); + log.error('stack', err.stack); + errorMessage(); + process.exit(7); +}); + +function errorMessage() { + // copied from npm's lib/util/error-handler.js + const os = require('os'); + log.error('System', os.type() + ' ' + os.release()); + log.error('command', process.argv.map(JSON.stringify).join(' ')); + log.error('cwd', process.cwd()); + log.error('node -v', process.version); + log.error(process.title + ' -v', 'v' + prog.package.version); +} + +// start running the given commands! +run(); diff --git a/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js b/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js new file mode 100644 index 00000000..0234480e --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js @@ -0,0 +1,304 @@ +'use strict'; + +/** + * Module exports. + */ + +module.exports = exports; + +/** + * Module dependencies. + */ + +// load mocking control function for accessing s3 via https. the function is a noop always returning +// false if not mocking. +exports.mockS3Http = require('./util/s3_setup').get_mockS3Http(); +exports.mockS3Http('on'); +const mocking = exports.mockS3Http('get'); + + +const fs = require('fs'); +const path = require('path'); +const nopt = require('nopt'); +const log = require('npmlog'); +log.disableProgress(); +const napi = require('./util/napi.js'); + +const EE = require('events').EventEmitter; +const inherits = require('util').inherits; +const cli_commands = [ + 'clean', + 'install', + 'reinstall', + 'build', + 'rebuild', + 'package', + 'testpackage', + 'publish', + 'unpublish', + 'info', + 'testbinary', + 'reveal', + 'configure' +]; +const aliases = {}; + +// differentiate node-pre-gyp's logs from npm's +log.heading = 'node-pre-gyp'; + +if (mocking) { + log.warn(`mocking s3 to ${process.env.node_pre_gyp_mock_s3}`); +} + +exports.find = require('./pre-binding').find; + +// +// in the following, "my_module" is using node-pre-gyp to +// prebuild and install pre-built binaries. "main_module" +// is using "my_module". +// +// "bin/node-pre-gyp" invokes Run() without a path. the +// expectation is that the working directory is the package +// root "my_module". this is true because in all cases npm is +// executing a script in the context of "my_module". +// +// "pre-binding.find()" is executed by "my_module" but in the +// context of "main_module". this is because "main_module" is +// executing and requires "my_module" which is then executing +// "pre-binding.find()" via "node-pre-gyp.find()", so the working +// directory is that of "main_module". +// +// that's why "find()" must pass the path to package.json. +// +function Run({ package_json_path = './package.json', argv }) { + this.package_json_path = package_json_path; + this.commands = {}; + + const self = this; + cli_commands.forEach((command) => { + self.commands[command] = function(argvx, callback) { + log.verbose('command', command, argvx); + return require('./' + command)(self, argvx, callback); + }; + }); + + this.parseArgv(argv); + + // this is set to true after the binary.host property was set to + // either staging_host or production_host. + this.binaryHostSet = false; +} +inherits(Run, EE); +exports.Run = Run; +const proto = Run.prototype; + +/** + * Export the contents of the package.json. + */ + +proto.package = require('../package.json'); + +/** + * nopt configuration definitions + */ + +proto.configDefs = { + help: Boolean, // everywhere + arch: String, // 'configure' + debug: Boolean, // 'build' + directory: String, // bin + proxy: String, // 'install' + loglevel: String // everywhere +}; + +/** + * nopt shorthands + */ + +proto.shorthands = { + release: '--no-debug', + C: '--directory', + debug: '--debug', + j: '--jobs', + silent: '--loglevel=silent', + silly: '--loglevel=silly', + verbose: '--loglevel=verbose' +}; + +/** + * expose the command aliases for the bin file to use. + */ + +proto.aliases = aliases; + +/** + * Parses the given argv array and sets the 'opts', 'argv', + * 'command', and 'package_json' properties. + */ + +proto.parseArgv = function parseOpts(argv) { + this.opts = nopt(this.configDefs, this.shorthands, argv); + this.argv = this.opts.argv.remain.slice(); + const commands = this.todo = []; + + // create a copy of the argv array with aliases mapped + argv = this.argv.map((arg) => { + // is this an alias? + if (arg in this.aliases) { + arg = this.aliases[arg]; + } + return arg; + }); + + // process the mapped args into "command" objects ("name" and "args" props) + argv.slice().forEach((arg) => { + if (arg in this.commands) { + const args = argv.splice(0, argv.indexOf(arg)); + argv.shift(); + if (commands.length > 0) { + commands[commands.length - 1].args = args; + } + commands.push({ name: arg, args: [] }); + } + }); + if (commands.length > 0) { + commands[commands.length - 1].args = argv.splice(0); + } + + + // if a directory was specified package.json is assumed to be relative + // to it. + let package_json_path = this.package_json_path; + if (this.opts.directory) { + package_json_path = path.join(this.opts.directory, package_json_path); + } + + this.package_json = JSON.parse(fs.readFileSync(package_json_path)); + + // expand commands entries for multiple napi builds + this.todo = napi.expand_commands(this.package_json, this.opts, commands); + + // support for inheriting config env variables from npm + const npm_config_prefix = 'npm_config_'; + Object.keys(process.env).forEach((name) => { + if (name.indexOf(npm_config_prefix) !== 0) return; + const val = process.env[name]; + if (name === npm_config_prefix + 'loglevel') { + log.level = val; + } else { + // add the user-defined options to the config + name = name.substring(npm_config_prefix.length); + // avoid npm argv clobber already present args + // which avoids problem of 'npm test' calling + // script that runs unique npm install commands + if (name === 'argv') { + if (this.opts.argv && + this.opts.argv.remain && + this.opts.argv.remain.length) { + // do nothing + } else { + this.opts[name] = val; + } + } else { + this.opts[name] = val; + } + } + }); + + if (this.opts.loglevel) { + log.level = this.opts.loglevel; + } + log.resume(); +}; + +/** + * allow the binary.host property to be set at execution time. + * + * for this to take effect requires all the following to be true. + * - binary is a property in package.json + * - binary.host is falsey + * - binary.staging_host is not empty + * - binary.production_host is not empty + * + * if any of the previous checks fail then the function returns an empty string + * and makes no changes to package.json's binary property. + * + * + * if command is "publish" then the default is set to "binary.staging_host" + * if command is not "publish" the the default is set to "binary.production_host" + * + * if the command-line option '--s3_host' is set to "staging" or "production" then + * "binary.host" is set to the specified "staging_host" or "production_host". if + * '--s3_host' is any other value an exception is thrown. + * + * if '--s3_host' is not present then "binary.host" is set to the default as above. + * + * this strategy was chosen so that any command other than "publish" uses "production" + * as the default without requiring any command-line options but that "publish" requires + * '--s3_host production_host' to be specified in order to *really* publish. publishing + * to staging can be done freely without worrying about disturbing any production releases. + */ +proto.setBinaryHostProperty = function(command) { + if (this.binaryHostSet) { + return this.package_json.binary.host; + } + const p = this.package_json; + // don't set anything if host is present. it must be left blank to trigger this. + if (!p || !p.binary || p.binary.host) { + return ''; + } + // and both staging and production must be present. errors will be reported later. + if (!p.binary.staging_host || !p.binary.production_host) { + return ''; + } + let target = 'production_host'; + if (command === 'publish') { + target = 'staging_host'; + } + // the environment variable has priority over the default or the command line. if + // either the env var or the command line option are invalid throw an error. + const npg_s3_host = process.env.node_pre_gyp_s3_host; + if (npg_s3_host === 'staging' || npg_s3_host === 'production') { + target = `${npg_s3_host}_host`; + } else if (this.opts['s3_host'] === 'staging' || this.opts['s3_host'] === 'production') { + target = `${this.opts['s3_host']}_host`; + } else if (this.opts['s3_host'] || npg_s3_host) { + throw new Error(`invalid s3_host ${this.opts['s3_host'] || npg_s3_host}`); + } + + p.binary.host = p.binary[target]; + this.binaryHostSet = true; + + return p.binary.host; +}; + +/** + * Returns the usage instructions for node-pre-gyp. + */ + +proto.usage = function usage() { + const str = [ + '', + ' Usage: node-pre-gyp [options]', + '', + ' where is one of:', + cli_commands.map((c) => { + return ' - ' + c + ' - ' + require('./' + c).usage; + }).join('\n'), + '', + 'node-pre-gyp@' + this.version + ' ' + path.resolve(__dirname, '..'), + 'node@' + process.versions.node + ].join('\n'); + return str; +}; + +/** + * Version number getter. + */ + +Object.defineProperty(proto, 'version', { + get: function() { + return this.package.version; + }, + enumerable: true +}); diff --git a/node_modules/@mapbox/node-pre-gyp/lib/package.js b/node_modules/@mapbox/node-pre-gyp/lib/package.js new file mode 100644 index 00000000..07349846 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/package.js @@ -0,0 +1,73 @@ +'use strict'; + +module.exports = exports = _package; + +exports.usage = 'Packs binary (and enclosing directory) into locally staged tarball'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const existsAsync = fs.exists || path.exists; +const makeDir = require('make-dir'); +const tar = require('tar'); + +function readdirSync(dir) { + let list = []; + const files = fs.readdirSync(dir); + + files.forEach((file) => { + const stats = fs.lstatSync(path.join(dir, file)); + if (stats.isDirectory()) { + list = list.concat(readdirSync(path.join(dir, file))); + } else { + list.push(path.join(dir, file)); + } + }); + return list; +} + +function _package(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const from = opts.module_path; + const binary_module = path.join(from, opts.module_name + '.node'); + existsAsync(binary_module, (found) => { + if (!found) { + return callback(new Error('Cannot package because ' + binary_module + ' missing: run `node-pre-gyp rebuild` first')); + } + const tarball = opts.staged_tarball; + const filter_func = function(entry) { + const basename = path.basename(entry); + if (basename.length && basename[0] !== '.') { + console.log('packing ' + entry); + return true; + } else { + console.log('skipping ' + entry); + } + return false; + }; + makeDir(path.dirname(tarball)).then(() => { + let files = readdirSync(from); + const base = path.basename(from); + files = files.map((file) => { + return path.join(base, path.relative(from, file)); + }); + tar.create({ + portable: false, + gzip: true, + filter: filter_func, + file: tarball, + cwd: path.dirname(from) + }, files, (err2) => { + if (err2) console.error('[' + package_json.name + '] ' + err2.message); + else log.info('package', 'Binary staged at "' + tarball + '"'); + return callback(err2); + }); + }).catch((err) => { + return callback(err); + }); + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js b/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js new file mode 100644 index 00000000..e110fe38 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js @@ -0,0 +1,34 @@ +'use strict'; + +const npg = require('..'); +const versioning = require('../lib/util/versioning.js'); +const napi = require('../lib/util/napi.js'); +const existsSync = require('fs').existsSync || require('path').existsSync; +const path = require('path'); + +module.exports = exports; + +exports.usage = 'Finds the require path for the node-pre-gyp installed module'; + +exports.validate = function(package_json, opts) { + versioning.validate_config(package_json, opts); +}; + +exports.find = function(package_json_path, opts) { + if (!existsSync(package_json_path)) { + throw new Error(package_json_path + 'does not exist'); + } + const prog = new npg.Run({ package_json_path, argv: process.argv }); + prog.setBinaryHostProperty(); + const package_json = prog.package_json; + + versioning.validate_config(package_json, opts); + let napi_build_version; + if (napi.get_napi_build_versions(package_json, opts)) { + napi_build_version = napi.get_best_napi_build_version(package_json, opts); + } + opts = opts || {}; + if (!opts.module_root) opts.module_root = path.dirname(package_json_path); + const meta = versioning.evaluate(package_json, opts, napi_build_version); + return meta.module; +}; diff --git a/node_modules/@mapbox/node-pre-gyp/lib/publish.js b/node_modules/@mapbox/node-pre-gyp/lib/publish.js new file mode 100644 index 00000000..8367b150 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/publish.js @@ -0,0 +1,81 @@ +'use strict'; + +module.exports = exports = publish; + +exports.usage = 'Publishes pre-built binary (requires aws-sdk)'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const s3_setup = require('./util/s3_setup.js'); +const existsAsync = fs.exists || path.exists; +const url = require('url'); + +function publish(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const tarball = opts.staged_tarball; + existsAsync(tarball, (found) => { + if (!found) { + return callback(new Error('Cannot publish because ' + tarball + ' missing: run `node-pre-gyp package` first')); + } + + log.info('publish', 'Detecting s3 credentials'); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + + const key_name = url.resolve(config.prefix, opts.package_name); + const s3_opts = { + Bucket: config.bucket, + Key: key_name + }; + log.info('publish', 'Authenticating with s3'); + log.info('publish', config); + + log.info('publish', 'Checking for existing binary at ' + opts.hosted_path); + s3.headObject(s3_opts, (err, meta) => { + if (meta) log.info('publish', JSON.stringify(meta)); + if (err && err.code === 'NotFound') { + // we are safe to publish because + // the object does not already exist + log.info('publish', 'Preparing to put object'); + const s3_put_opts = { + ACL: 'public-read', + Body: fs.createReadStream(tarball), + Key: key_name, + Bucket: config.bucket + }; + log.info('publish', 'Putting object', s3_put_opts.ACL, s3_put_opts.Bucket, s3_put_opts.Key); + try { + s3.putObject(s3_put_opts, (err2, resp) => { + log.info('publish', 'returned from putting object'); + if (err2) { + log.info('publish', 's3 putObject error: "' + err2 + '"'); + return callback(err2); + } + if (resp) log.info('publish', 's3 putObject response: "' + JSON.stringify(resp) + '"'); + log.info('publish', 'successfully put object'); + console.log('[' + package_json.name + '] published to ' + opts.hosted_path); + return callback(); + }); + } catch (err3) { + log.info('publish', 's3 putObject error: "' + err3 + '"'); + return callback(err3); + } + } else if (err) { + log.info('publish', 's3 headObject error: "' + err + '"'); + return callback(err); + } else { + log.error('publish', 'Cannot publish over existing version'); + log.error('publish', "Update the 'version' field in package.json and try again"); + log.error('publish', 'If the previous version was published in error see:'); + log.error('publish', '\t node-pre-gyp unpublish'); + return callback(new Error('Failed publishing to ' + opts.hosted_path)); + } + }); + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js b/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js new file mode 100644 index 00000000..31510fbd --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js @@ -0,0 +1,20 @@ +'use strict'; + +module.exports = exports = rebuild; + +exports.usage = 'Runs "clean" and "build" at once'; + +const napi = require('./util/napi.js'); + +function rebuild(gyp, argv, callback) { + const package_json = gyp.package_json; + let commands = [ + { name: 'clean', args: [] }, + { name: 'build', args: ['rebuild'] } + ]; + commands = napi.expand_commands(package_json, gyp.opts, commands); + for (let i = commands.length; i !== 0; i--) { + gyp.todo.unshift(commands[i - 1]); + } + process.nextTick(callback); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js b/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js new file mode 100644 index 00000000..a29b5c9b --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js @@ -0,0 +1,19 @@ +'use strict'; + +module.exports = exports = rebuild; + +exports.usage = 'Runs "clean" and "install" at once'; + +const napi = require('./util/napi.js'); + +function rebuild(gyp, argv, callback) { + const package_json = gyp.package_json; + let installArgs = []; + const napi_build_version = napi.get_best_napi_build_version(package_json, gyp.opts); + if (napi_build_version != null) installArgs = [napi.get_command_arg(napi_build_version)]; + gyp.todo.unshift( + { name: 'clean', args: [] }, + { name: 'install', args: installArgs } + ); + process.nextTick(callback); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/reveal.js b/node_modules/@mapbox/node-pre-gyp/lib/reveal.js new file mode 100644 index 00000000..7255e5f0 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/reveal.js @@ -0,0 +1,32 @@ +'use strict'; + +module.exports = exports = reveal; + +exports.usage = 'Reveals data on the versioned binary'; + +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); + +function unix_paths(key, val) { + return val && val.replace ? val.replace(/\\/g, '/') : val; +} + +function reveal(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + let hit = false; + // if a second arg is passed look to see + // if it is a known option + // console.log(JSON.stringify(gyp.opts,null,1)) + const remain = gyp.opts.argv.remain[gyp.opts.argv.remain.length - 1]; + if (remain && Object.hasOwnProperty.call(opts, remain)) { + console.log(opts[remain].replace(/\\/g, '/')); + hit = true; + } + // otherwise return all options as json + if (!hit) { + console.log(JSON.stringify(opts, unix_paths, 2)); + } + return callback(); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js b/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js new file mode 100644 index 00000000..429cb130 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js @@ -0,0 +1,79 @@ +'use strict'; + +module.exports = exports = testbinary; + +exports.usage = 'Tests that the binary.node can be required'; + +const path = require('path'); +const log = require('npmlog'); +const cp = require('child_process'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); + +function testbinary(gyp, argv, callback) { + const args = []; + const options = {}; + let shell_cmd = process.execPath; + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + // skip validation for runtimes we don't explicitly support (like electron) + if (opts.runtime && + opts.runtime !== 'node-webkit' && + opts.runtime !== 'node') { + return callback(); + } + const nw = (opts.runtime && opts.runtime === 'node-webkit'); + // ensure on windows that / are used for require path + const binary_module = opts.module.replace(/\\/g, '/'); + if ((process.arch !== opts.target_arch) || + (process.platform !== opts.target_platform)) { + let msg = 'skipping validation since host platform/arch ('; + msg += process.platform + '/' + process.arch + ')'; + msg += ' does not match target ('; + msg += opts.target_platform + '/' + opts.target_arch + ')'; + log.info('validate', msg); + return callback(); + } + if (nw) { + options.timeout = 5000; + if (process.platform === 'darwin') { + shell_cmd = 'node-webkit'; + } else if (process.platform === 'win32') { + shell_cmd = 'nw.exe'; + } else { + shell_cmd = 'nw'; + } + const modulePath = path.resolve(binary_module); + const appDir = path.join(__dirname, 'util', 'nw-pre-gyp'); + args.push(appDir); + args.push(modulePath); + log.info('validate', "Running test command: '" + shell_cmd + ' ' + args.join(' ') + "'"); + cp.execFile(shell_cmd, args, options, (err, stdout, stderr) => { + // check for normal timeout for node-webkit + if (err) { + if (err.killed === true && err.signal && err.signal.indexOf('SIG') > -1) { + return callback(); + } + const stderrLog = stderr.toString(); + log.info('stderr', stderrLog); + if (/^\s*Xlib:\s*extension\s*"RANDR"\s*missing\s*on\s*display\s*":\d+\.\d+"\.\s*$/.test(stderrLog)) { + log.info('RANDR', 'stderr contains only RANDR error, ignored'); + return callback(); + } + return callback(err); + } + return callback(); + }); + return; + } + args.push('--eval'); + args.push("require('" + binary_module.replace(/'/g, '\'') + "')"); + log.info('validate', "Running test command: '" + shell_cmd + ' ' + args.join(' ') + "'"); + cp.execFile(shell_cmd, args, options, (err, stdout, stderr) => { + if (err) { + return callback(err, { stdout: stdout, stderr: stderr }); + } + return callback(); + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js b/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js new file mode 100644 index 00000000..fab1911b --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js @@ -0,0 +1,53 @@ +'use strict'; + +module.exports = exports = testpackage; + +exports.usage = 'Tests that the staged package is valid'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const existsAsync = fs.exists || path.exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const testbinary = require('./testbinary.js'); +const tar = require('tar'); +const makeDir = require('make-dir'); + +function testpackage(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const tarball = opts.staged_tarball; + existsAsync(tarball, (found) => { + if (!found) { + return callback(new Error('Cannot test package because ' + tarball + ' missing: run `node-pre-gyp package` first')); + } + const to = opts.module_path; + function filter_func(entry) { + log.info('install', 'unpacking [' + entry.path + ']'); + } + + makeDir(to).then(() => { + tar.extract({ + file: tarball, + cwd: to, + strip: 1, + onentry: filter_func + }).then(after_extract, callback); + }).catch((err) => { + return callback(err); + }); + + function after_extract() { + testbinary(gyp, argv, (err) => { + if (err) { + return callback(err); + } else { + console.log('[' + package_json.name + '] Package appears valid'); + return callback(); + } + }); + } + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js b/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js new file mode 100644 index 00000000..12c9f561 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js @@ -0,0 +1,41 @@ +'use strict'; + +module.exports = exports = unpublish; + +exports.usage = 'Unpublishes pre-built binary (requires aws-sdk)'; + +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const s3_setup = require('./util/s3_setup.js'); +const url = require('url'); + +function unpublish(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + const key_name = url.resolve(config.prefix, opts.package_name); + const s3_opts = { + Bucket: config.bucket, + Key: key_name + }; + s3.headObject(s3_opts, (err, meta) => { + if (err && err.code === 'NotFound') { + console.log('[' + package_json.name + '] Not found: https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + s3_opts.Key); + return callback(); + } else if (err) { + return callback(err); + } else { + log.info('unpublish', JSON.stringify(meta)); + s3.deleteObject(s3_opts, (err2, resp) => { + if (err2) return callback(err2); + log.info(JSON.stringify(resp)); + console.log('[' + package_json.name + '] Success: removed https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + s3_opts.Key); + return callback(); + }); + } + }); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json b/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json new file mode 100644 index 00000000..33b75102 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json @@ -0,0 +1,2454 @@ +{ + "0.1.14": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.15": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.16": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.17": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.18": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.19": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.20": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.21": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.22": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.23": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.24": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.25": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.26": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.27": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.28": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.29": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.30": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.31": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.32": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.33": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.90": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.91": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.92": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.93": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.94": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.95": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.96": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.97": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.98": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.99": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.100": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.101": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.102": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.103": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.104": { + "node_abi": null, + "v8": "2.3" + }, + "0.2.0": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.1": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.2": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.3": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.4": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.5": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.6": { + "node_abi": 1, + "v8": "2.3" + }, + "0.3.0": { + "node_abi": 1, + "v8": "2.5" + }, + "0.3.1": { + "node_abi": 1, + "v8": "2.5" + }, + "0.3.2": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.3": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.4": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.5": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.6": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.7": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.8": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.0": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.1": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.2": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.3": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.4": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.5": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.6": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.7": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.8": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.9": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.10": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.11": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.12": { + "node_abi": 1, + "v8": "3.1" + }, + "0.5.0": { + "node_abi": 1, + "v8": "3.1" + }, + "0.5.1": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.2": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.3": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.4": { + "node_abi": 1, + "v8": "3.5" + }, + "0.5.5": { + "node_abi": 1, + "v8": "3.5" + }, + "0.5.6": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.7": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.8": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.9": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.10": { + "node_abi": 1, + "v8": "3.7" + }, + "0.6.0": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.1": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.2": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.3": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.4": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.5": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.6": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.7": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.8": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.9": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.10": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.11": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.12": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.13": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.14": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.15": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.16": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.17": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.18": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.19": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.20": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.21": { + "node_abi": 1, + "v8": "3.6" + }, + "0.7.0": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.1": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.2": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.3": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.4": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.5": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.6": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.7": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.8": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.9": { + "node_abi": 1, + "v8": "3.11" + }, + "0.7.10": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.11": { + "node_abi": 1, + "v8": "3.11" + }, + "0.7.12": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.0": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.1": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.2": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.3": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.4": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.5": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.6": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.7": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.8": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.9": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.10": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.11": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.12": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.13": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.14": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.15": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.16": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.17": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.18": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.19": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.20": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.21": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.22": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.23": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.24": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.25": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.26": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.27": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.28": { + "node_abi": 1, + "v8": "3.11" + }, + "0.9.0": { + "node_abi": 1, + "v8": "3.11" + }, + "0.9.1": { + "node_abi": 10, + "v8": "3.11" + }, + "0.9.2": { + "node_abi": 10, + "v8": "3.11" + }, + "0.9.3": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.4": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.5": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.6": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.7": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.8": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.9": { + "node_abi": 11, + "v8": "3.15" + }, + "0.9.10": { + "node_abi": 11, + "v8": "3.15" + }, + "0.9.11": { + "node_abi": 11, + "v8": "3.14" + }, + "0.9.12": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.0": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.1": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.2": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.3": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.4": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.5": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.6": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.7": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.8": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.9": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.10": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.11": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.12": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.13": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.14": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.15": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.16": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.17": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.18": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.19": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.20": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.21": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.22": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.23": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.24": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.25": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.26": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.27": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.28": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.29": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.30": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.31": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.32": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.33": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.34": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.35": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.36": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.37": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.38": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.39": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.40": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.41": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.42": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.43": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.44": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.45": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.46": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.47": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.48": { + "node_abi": 11, + "v8": "3.14" + }, + "0.11.0": { + "node_abi": 12, + "v8": "3.17" + }, + "0.11.1": { + "node_abi": 12, + "v8": "3.18" + }, + "0.11.2": { + "node_abi": 12, + "v8": "3.19" + }, + "0.11.3": { + "node_abi": 12, + "v8": "3.19" + }, + "0.11.4": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.5": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.6": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.7": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.8": { + "node_abi": 13, + "v8": "3.21" + }, + "0.11.9": { + "node_abi": 13, + "v8": "3.22" + }, + "0.11.10": { + "node_abi": 13, + "v8": "3.22" + }, + "0.11.11": { + "node_abi": 14, + "v8": "3.22" + }, + "0.11.12": { + "node_abi": 14, + "v8": "3.22" + }, + "0.11.13": { + "node_abi": 14, + "v8": "3.25" + }, + "0.11.14": { + "node_abi": 14, + "v8": "3.26" + }, + "0.11.15": { + "node_abi": 14, + "v8": "3.28" + }, + "0.11.16": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.0": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.1": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.2": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.3": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.4": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.5": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.6": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.7": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.8": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.9": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.10": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.11": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.12": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.13": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.14": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.15": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.16": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.17": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.18": { + "node_abi": 14, + "v8": "3.28" + }, + "1.0.0": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.1": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.2": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.3": { + "node_abi": 42, + "v8": "4.1" + }, + "1.0.4": { + "node_abi": 42, + "v8": "4.1" + }, + "1.1.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.2.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.3.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.5.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.5.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.4": { + "node_abi": 43, + "v8": "4.1" + }, + "1.7.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.4": { + "node_abi": 43, + "v8": "4.1" + }, + "2.0.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.0.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.0.2": { + "node_abi": 44, + "v8": "4.2" + }, + "2.1.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.2.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.2.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.2": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.3": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.4": { + "node_abi": 44, + "v8": "4.2" + }, + "2.4.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.5.0": { + "node_abi": 44, + "v8": "4.2" + }, + "3.0.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.1.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.2.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.3.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.3.1": { + "node_abi": 45, + "v8": "4.4" + }, + "4.0.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.7": { + "node_abi": 46, + "v8": "4.5" + }, + "4.5.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.7": { + "node_abi": 46, + "v8": "4.5" + }, + "4.9.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.9.1": { + "node_abi": 46, + "v8": "4.5" + }, + "5.0.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.1.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.1.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.2.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.3.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.4.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.4.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.5.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.6.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.7.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.7.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.8.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.9.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.9.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.10.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.10.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.11.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.11.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.12.0": { + "node_abi": 47, + "v8": "4.6" + }, + "6.0.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.1.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.1": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.2": { + "node_abi": 48, + "v8": "5.0" + }, + "6.3.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.3.1": { + "node_abi": 48, + "v8": "5.0" + }, + "6.4.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.5.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.6.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.7.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.8.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.8.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.5": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.5": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.13.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.13.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.15.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.15.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.16.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.17.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.17.1": { + "node_abi": 48, + "v8": "5.1" + }, + "7.0.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.1.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.2.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.2.1": { + "node_abi": 51, + "v8": "5.4" + }, + "7.3.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.4.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.5.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.6.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.1": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.2": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.3": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.4": { + "node_abi": 51, + "v8": "5.5" + }, + "7.8.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.9.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.10.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.10.1": { + "node_abi": 51, + "v8": "5.5" + }, + "8.0.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.1": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.2": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.3": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.4": { + "node_abi": 57, + "v8": "5.8" + }, + "8.2.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.2.1": { + "node_abi": 57, + "v8": "5.8" + }, + "8.3.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.4.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.5.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.6.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.7.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.8.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.8.1": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.1": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.2": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.3": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.4": { + "node_abi": 57, + "v8": "6.1" + }, + "8.10.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.2": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.3": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.4": { + "node_abi": 57, + "v8": "6.2" + }, + "8.12.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.13.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.14.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.14.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.15.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.15.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.2": { + "node_abi": 57, + "v8": "6.2" + }, + "8.17.0": { + "node_abi": 57, + "v8": "6.2" + }, + "9.0.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.1.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.2.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.2.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.3.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.4.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.5.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.6.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.6.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.7.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.7.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.8.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.9.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.10.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.10.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.2": { + "node_abi": 59, + "v8": "6.2" + }, + "10.0.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.1.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.2.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.2.1": { + "node_abi": 64, + "v8": "6.6" + }, + "10.3.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.4.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.4.1": { + "node_abi": 64, + "v8": "6.7" + }, + "10.5.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.6.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.7.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.8.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.9.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.10.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.11.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.12.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.13.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.17.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.18.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.18.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.19.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.20.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.20.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.21.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.22.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.22.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.24.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.24.1": { + "node_abi": 64, + "v8": "6.8" + }, + "11.0.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.1.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.2.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.3.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.4.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.5.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.6.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.7.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.8.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.9.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.10.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.10.1": { + "node_abi": 67, + "v8": "7.0" + }, + "11.11.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.12.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.13.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.14.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.15.0": { + "node_abi": 67, + "v8": "7.0" + }, + "12.0.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.1.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.2.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.3.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.3.1": { + "node_abi": 72, + "v8": "7.4" + }, + "12.4.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.5.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.6.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.7.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.8.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.8.1": { + "node_abi": 72, + "v8": "7.5" + }, + "12.9.0": { + "node_abi": 72, + "v8": "7.6" + }, + "12.9.1": { + "node_abi": 72, + "v8": "7.6" + }, + "12.10.0": { + "node_abi": 72, + "v8": "7.6" + }, + "12.11.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.11.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.12.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.13.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.13.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.14.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.14.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.15.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.16.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.17.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.4": { + "node_abi": 72, + "v8": "7.8" + }, + "12.19.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.19.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.21.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.1": { + "node_abi": 72, + "v8": "7.8" + }, + "13.0.0": { + "node_abi": 79, + "v8": "7.8" + }, + "13.0.1": { + "node_abi": 79, + "v8": "7.8" + }, + "13.1.0": { + "node_abi": 79, + "v8": "7.8" + }, + "13.2.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.3.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.4.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.5.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.6.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.7.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.8.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.9.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.10.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.10.1": { + "node_abi": 79, + "v8": "7.9" + }, + "13.11.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.12.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.13.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.14.0": { + "node_abi": 79, + "v8": "7.9" + }, + "14.0.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.1.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.2.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.3.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.4.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.5.0": { + "node_abi": 83, + "v8": "8.3" + }, + "14.6.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.7.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.8.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.9.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.10.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.10.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.11.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.12.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.13.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.13.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.14.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.2": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.3": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.4": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.5": { + "node_abi": 83, + "v8": "8.4" + }, + "14.16.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.16.1": { + "node_abi": 83, + "v8": "8.4" + }, + "15.0.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.0.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.1.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.2.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.2.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.3.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.4.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.5.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.5.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.6.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.7.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.8.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.9.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.10.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.11.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.12.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.13.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.14.0": { + "node_abi": 88, + "v8": "8.6" + }, + "16.0.0": { + "node_abi": 93, + "v8": "9.0" + } +} \ No newline at end of file diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js b/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js new file mode 100644 index 00000000..956e5aa6 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js @@ -0,0 +1,93 @@ +'use strict'; + +module.exports = exports; + +const fs = require('fs'); +const path = require('path'); +const win = process.platform === 'win32'; +const existsSync = fs.existsSync || path.existsSync; +const cp = require('child_process'); + +// try to build up the complete path to node-gyp +/* priority: + - node-gyp on ENV:npm_config_node_gyp (https://github.com/npm/npm/pull/4887) + - node-gyp on NODE_PATH + - node-gyp inside npm on NODE_PATH (ignore on iojs) + - node-gyp inside npm beside node exe +*/ +function which_node_gyp() { + let node_gyp_bin; + if (process.env.npm_config_node_gyp) { + try { + node_gyp_bin = process.env.npm_config_node_gyp; + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + } + try { + const node_gyp_main = require.resolve('node-gyp'); // eslint-disable-line node/no-missing-require + node_gyp_bin = path.join(path.dirname( + path.dirname(node_gyp_main)), + 'bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + if (process.execPath.indexOf('iojs') === -1) { + try { + const npm_main = require.resolve('npm'); // eslint-disable-line node/no-missing-require + node_gyp_bin = path.join(path.dirname( + path.dirname(npm_main)), + 'node_modules/node-gyp/bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + } + const npm_base = path.join(path.dirname( + path.dirname(process.execPath)), + 'lib/node_modules/npm/'); + node_gyp_bin = path.join(npm_base, 'node_modules/node-gyp/bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } +} + +module.exports.run_gyp = function(args, opts, callback) { + let shell_cmd = ''; + const cmd_args = []; + if (opts.runtime && opts.runtime === 'node-webkit') { + shell_cmd = 'nw-gyp'; + if (win) shell_cmd += '.cmd'; + } else { + const node_gyp_path = which_node_gyp(); + if (node_gyp_path) { + shell_cmd = process.execPath; + cmd_args.push(node_gyp_path); + } else { + shell_cmd = 'node-gyp'; + if (win) shell_cmd += '.cmd'; + } + } + const final_args = cmd_args.concat(args); + const cmd = cp.spawn(shell_cmd, final_args, { cwd: undefined, env: process.env, stdio: [0, 1, 2] }); + cmd.on('error', (err) => { + if (err) { + return callback(new Error("Failed to execute '" + shell_cmd + ' ' + final_args.join(' ') + "' (" + err + ')')); + } + callback(null, opts); + }); + cmd.on('close', (code) => { + if (code && code !== 0) { + return callback(new Error("Failed to execute '" + shell_cmd + ' ' + final_args.join(' ') + "' (" + code + ')')); + } + callback(null, opts); + }); +}; diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js b/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js new file mode 100644 index 00000000..d702f785 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js @@ -0,0 +1,102 @@ +'use strict'; + +module.exports = exports = handle_gyp_opts; + +const versioning = require('./versioning.js'); +const napi = require('./napi.js'); + +/* + +Here we gather node-pre-gyp generated options (from versioning) and pass them along to node-gyp. + +We massage the args and options slightly to account for differences in what commands mean between +node-pre-gyp and node-gyp (e.g. see the difference between "build" and "rebuild" below) + +Keep in mind: the values inside `argv` and `gyp.opts` below are different depending on whether +node-pre-gyp is called directory, or if it is called in a `run-script` phase of npm. + +We also try to preserve any command line options that might have been passed to npm or node-pre-gyp. +But this is fairly difficult without passing way to much through. For example `gyp.opts` contains all +the process.env and npm pushes a lot of variables into process.env which node-pre-gyp inherits. So we have +to be very selective about what we pass through. + +For example: + +`npm install --build-from-source` will give: + +argv == [ 'rebuild' ] +gyp.opts.argv == { remain: [ 'install' ], + cooked: [ 'install', '--fallback-to-build' ], + original: [ 'install', '--fallback-to-build' ] } + +`./bin/node-pre-gyp build` will give: + +argv == [] +gyp.opts.argv == { remain: [ 'build' ], + cooked: [ 'build' ], + original: [ '-C', 'test/app1', 'build' ] } + +*/ + +// select set of node-pre-gyp versioning info +// to share with node-gyp +const share_with_node_gyp = [ + 'module', + 'module_name', + 'module_path', + 'napi_version', + 'node_abi_napi', + 'napi_build_version', + 'node_napi_label' +]; + +function handle_gyp_opts(gyp, argv, callback) { + + // Collect node-pre-gyp specific variables to pass to node-gyp + const node_pre_gyp_options = []; + // generate custom node-pre-gyp versioning info + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(gyp.package_json, gyp.opts, napi_build_version); + share_with_node_gyp.forEach((key) => { + const val = opts[key]; + if (val) { + node_pre_gyp_options.push('--' + key + '=' + val); + } else if (key === 'napi_build_version') { + node_pre_gyp_options.push('--' + key + '=0'); + } else { + if (key !== 'napi_version' && key !== 'node_abi_napi') + return callback(new Error('Option ' + key + ' required but not found by node-pre-gyp')); + } + }); + + // Collect options that follow the special -- which disables nopt parsing + const unparsed_options = []; + let double_hyphen_found = false; + gyp.opts.argv.original.forEach((opt) => { + if (double_hyphen_found) { + unparsed_options.push(opt); + } + if (opt === '--') { + double_hyphen_found = true; + } + }); + + // We try respect and pass through remaining command + // line options (like --foo=bar) to node-gyp + const cooked = gyp.opts.argv.cooked; + const node_gyp_options = []; + cooked.forEach((value) => { + if (value.length > 2 && value.slice(0, 2) === '--') { + const key = value.slice(2); + const val = cooked[cooked.indexOf(value) + 1]; + if (val && val.indexOf('--') === -1) { // handle '--foo=bar' or ['--foo','bar'] + node_gyp_options.push('--' + key + '=' + val); + } else { // pass through --foo + node_gyp_options.push(value); + } + } + }); + + const result = { 'opts': opts, 'gyp': node_gyp_options, 'pre': node_pre_gyp_options, 'unparsed': unparsed_options }; + return callback(null, result); +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js b/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js new file mode 100644 index 00000000..5d14ad6d --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js @@ -0,0 +1,205 @@ +'use strict'; + +const fs = require('fs'); + +module.exports = exports; + +const versionArray = process.version + .substr(1) + .replace(/-.*$/, '') + .split('.') + .map((item) => { + return +item; + }); + +const napi_multiple_commands = [ + 'build', + 'clean', + 'configure', + 'package', + 'publish', + 'reveal', + 'testbinary', + 'testpackage', + 'unpublish' +]; + +const napi_build_version_tag = 'napi_build_version='; + +module.exports.get_napi_version = function() { + // returns the non-zero numeric napi version or undefined if napi is not supported. + // correctly supporting target requires an updated cross-walk + let version = process.versions.napi; // can be undefined + if (!version) { // this code should never need to be updated + if (versionArray[0] === 9 && versionArray[1] >= 3) version = 2; // 9.3.0+ + else if (versionArray[0] === 8) version = 1; // 8.0.0+ + } + return version; +}; + +module.exports.get_napi_version_as_string = function(target) { + // returns the napi version as a string or an empty string if napi is not supported. + const version = module.exports.get_napi_version(target); + return version ? '' + version : ''; +}; + +module.exports.validate_package_json = function(package_json, opts) { // throws Error + + const binary = package_json.binary; + const module_path_ok = pathOK(binary.module_path); + const remote_path_ok = pathOK(binary.remote_path); + const package_name_ok = pathOK(binary.package_name); + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts, true); + const napi_build_versions_raw = module.exports.get_napi_build_versions_raw(package_json); + + if (napi_build_versions) { + napi_build_versions.forEach((napi_build_version)=> { + if (!(parseInt(napi_build_version, 10) === napi_build_version && napi_build_version > 0)) { + throw new Error('All values specified in napi_versions must be positive integers.'); + } + }); + } + + if (napi_build_versions && (!module_path_ok || (!remote_path_ok && !package_name_ok))) { + throw new Error('When napi_versions is specified; module_path and either remote_path or ' + + "package_name must contain the substitution string '{napi_build_version}`."); + } + + if ((module_path_ok || remote_path_ok || package_name_ok) && !napi_build_versions_raw) { + throw new Error("When the substitution string '{napi_build_version}` is specified in " + + 'module_path, remote_path, or package_name; napi_versions must also be specified.'); + } + + if (napi_build_versions && !module.exports.get_best_napi_build_version(package_json, opts) && + module.exports.build_napi_only(package_json)) { + throw new Error( + 'The Node-API version of this Node instance is ' + module.exports.get_napi_version(opts ? opts.target : undefined) + '. ' + + 'This module supports Node-API version(s) ' + module.exports.get_napi_build_versions_raw(package_json) + '. ' + + 'This Node instance cannot run this module.'); + } + + if (napi_build_versions_raw && !napi_build_versions && module.exports.build_napi_only(package_json)) { + throw new Error( + 'The Node-API version of this Node instance is ' + module.exports.get_napi_version(opts ? opts.target : undefined) + '. ' + + 'This module supports Node-API version(s) ' + module.exports.get_napi_build_versions_raw(package_json) + '. ' + + 'This Node instance cannot run this module.'); + } + +}; + +function pathOK(path) { + return path && (path.indexOf('{napi_build_version}') !== -1 || path.indexOf('{node_napi_label}') !== -1); +} + +module.exports.expand_commands = function(package_json, opts, commands) { + const expanded_commands = []; + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts); + commands.forEach((command)=> { + if (napi_build_versions && command.name === 'install') { + const napi_build_version = module.exports.get_best_napi_build_version(package_json, opts); + const args = napi_build_version ? [napi_build_version_tag + napi_build_version] : []; + expanded_commands.push({ name: command.name, args: args }); + } else if (napi_build_versions && napi_multiple_commands.indexOf(command.name) !== -1) { + napi_build_versions.forEach((napi_build_version)=> { + const args = command.args.slice(); + args.push(napi_build_version_tag + napi_build_version); + expanded_commands.push({ name: command.name, args: args }); + }); + } else { + expanded_commands.push(command); + } + }); + return expanded_commands; +}; + +module.exports.get_napi_build_versions = function(package_json, opts, warnings) { // opts may be undefined + const log = require('npmlog'); + let napi_build_versions = []; + const supported_napi_version = module.exports.get_napi_version(opts ? opts.target : undefined); + // remove duplicates, verify each napi version can actaully be built + if (package_json.binary && package_json.binary.napi_versions) { + package_json.binary.napi_versions.forEach((napi_version) => { + const duplicated = napi_build_versions.indexOf(napi_version) !== -1; + if (!duplicated && supported_napi_version && napi_version <= supported_napi_version) { + napi_build_versions.push(napi_version); + } else if (warnings && !duplicated && supported_napi_version) { + log.info('This Node instance does not support builds for Node-API version', napi_version); + } + }); + } + if (opts && opts['build-latest-napi-version-only']) { + let latest_version = 0; + napi_build_versions.forEach((napi_version) => { + if (napi_version > latest_version) latest_version = napi_version; + }); + napi_build_versions = latest_version ? [latest_version] : []; + } + return napi_build_versions.length ? napi_build_versions : undefined; +}; + +module.exports.get_napi_build_versions_raw = function(package_json) { + const napi_build_versions = []; + // remove duplicates + if (package_json.binary && package_json.binary.napi_versions) { + package_json.binary.napi_versions.forEach((napi_version) => { + if (napi_build_versions.indexOf(napi_version) === -1) { + napi_build_versions.push(napi_version); + } + }); + } + return napi_build_versions.length ? napi_build_versions : undefined; +}; + +module.exports.get_command_arg = function(napi_build_version) { + return napi_build_version_tag + napi_build_version; +}; + +module.exports.get_napi_build_version_from_command_args = function(command_args) { + for (let i = 0; i < command_args.length; i++) { + const arg = command_args[i]; + if (arg.indexOf(napi_build_version_tag) === 0) { + return parseInt(arg.substr(napi_build_version_tag.length), 10); + } + } + return undefined; +}; + +module.exports.swap_build_dir_out = function(napi_build_version) { + if (napi_build_version) { + const rm = require('rimraf'); + rm.sync(module.exports.get_build_dir(napi_build_version)); + fs.renameSync('build', module.exports.get_build_dir(napi_build_version)); + } +}; + +module.exports.swap_build_dir_in = function(napi_build_version) { + if (napi_build_version) { + const rm = require('rimraf'); + rm.sync('build'); + fs.renameSync(module.exports.get_build_dir(napi_build_version), 'build'); + } +}; + +module.exports.get_build_dir = function(napi_build_version) { + return 'build-tmp-napi-v' + napi_build_version; +}; + +module.exports.get_best_napi_build_version = function(package_json, opts) { + let best_napi_build_version = 0; + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts); + if (napi_build_versions) { + const our_napi_version = module.exports.get_napi_version(opts ? opts.target : undefined); + napi_build_versions.forEach((napi_build_version)=> { + if (napi_build_version > best_napi_build_version && + napi_build_version <= our_napi_version) { + best_napi_build_version = napi_build_version; + } + }); + } + return best_napi_build_version === 0 ? undefined : best_napi_build_version; +}; + +module.exports.build_napi_only = function(package_json) { + return package_json.binary && package_json.binary.package_name && + package_json.binary.package_name.indexOf('{node_napi_label}') === -1; +}; diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html b/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html new file mode 100644 index 00000000..244466c4 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html @@ -0,0 +1,26 @@ + + + + +Node-webkit-based module test + + + +

Node-webkit-based module test

+ + diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json b/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json new file mode 100644 index 00000000..71d03f82 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json @@ -0,0 +1,9 @@ +{ +"main": "index.html", +"name": "nw-pre-gyp-module-test", +"description": "Node-webkit-based module test.", +"version": "0.0.1", +"window": { + "show": false +} +} diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js b/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js new file mode 100644 index 00000000..6b1b1a6c --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js @@ -0,0 +1,163 @@ +'use strict'; + +module.exports = exports; + +const url = require('url'); +const fs = require('fs'); +const path = require('path'); + +module.exports.detect = function(opts, config) { + const to = opts.hosted_path; + const uri = url.parse(to); + config.prefix = (!uri.pathname || uri.pathname === '/') ? '' : uri.pathname.replace('/', ''); + if (opts.bucket && opts.region) { + config.bucket = opts.bucket; + config.region = opts.region; + config.endpoint = opts.host; + config.s3ForcePathStyle = opts.s3ForcePathStyle; + } else { + const parts = uri.hostname.split('.s3'); + const bucket = parts[0]; + if (!bucket) { + return; + } + if (!config.bucket) { + config.bucket = bucket; + } + if (!config.region) { + const region = parts[1].slice(1).split('.')[0]; + if (region === 'amazonaws') { + config.region = 'us-east-1'; + } else { + config.region = region; + } + } + } +}; + +module.exports.get_s3 = function(config) { + + if (process.env.node_pre_gyp_mock_s3) { + // here we're mocking. node_pre_gyp_mock_s3 is the scratch directory + // for the mock code. + const AWSMock = require('mock-aws-s3'); + const os = require('os'); + + AWSMock.config.basePath = `${os.tmpdir()}/mock`; + + const s3 = AWSMock.S3(); + + // wrapped callback maker. fs calls return code of ENOENT but AWS.S3 returns + // NotFound. + const wcb = (fn) => (err, ...args) => { + if (err && err.code === 'ENOENT') { + err.code = 'NotFound'; + } + return fn(err, ...args); + }; + + return { + listObjects(params, callback) { + return s3.listObjects(params, wcb(callback)); + }, + headObject(params, callback) { + return s3.headObject(params, wcb(callback)); + }, + deleteObject(params, callback) { + return s3.deleteObject(params, wcb(callback)); + }, + putObject(params, callback) { + return s3.putObject(params, wcb(callback)); + } + }; + } + + // if not mocking then setup real s3. + const AWS = require('aws-sdk'); + + AWS.config.update(config); + const s3 = new AWS.S3(); + + // need to change if additional options need to be specified. + return { + listObjects(params, callback) { + return s3.listObjects(params, callback); + }, + headObject(params, callback) { + return s3.headObject(params, callback); + }, + deleteObject(params, callback) { + return s3.deleteObject(params, callback); + }, + putObject(params, callback) { + return s3.putObject(params, callback); + } + }; + + + +}; + +// +// function to get the mocking control function. if not mocking it returns a no-op. +// +// if mocking it sets up the mock http interceptors that use the mocked s3 file system +// to fulfill reponses. +module.exports.get_mockS3Http = function() { + let mock_s3 = false; + if (!process.env.node_pre_gyp_mock_s3) { + return () => mock_s3; + } + + const nock = require('nock'); + // the bucket used for testing, as addressed by https. + const host = 'https://mapbox-node-pre-gyp-public-testing-bucket.s3.us-east-1.amazonaws.com'; + const mockDir = process.env.node_pre_gyp_mock_s3 + '/mapbox-node-pre-gyp-public-testing-bucket'; + + // function to setup interceptors. they are "turned off" by setting mock_s3 to false. + const mock_http = () => { + // eslint-disable-next-line no-unused-vars + function get(uri, requestBody) { + const filepath = path.join(mockDir, uri.replace('%2B', '+')); + + try { + fs.accessSync(filepath, fs.constants.R_OK); + } catch (e) { + return [404, 'not found\n']; + } + + // the mock s3 functions just write to disk, so just read from it. + return [200, fs.createReadStream(filepath)]; + } + + // eslint-disable-next-line no-unused-vars + return nock(host) + .persist() + .get(() => mock_s3) // mock any uri for s3 when true + .reply(get); + }; + + // setup interceptors. they check the mock_s3 flag to determine whether to intercept. + mock_http(nock, host, mockDir); + // function to turn matching all requests to s3 on/off. + const mockS3Http = (action) => { + const previous = mock_s3; + if (action === 'off') { + mock_s3 = false; + } else if (action === 'on') { + mock_s3 = true; + } else if (action !== 'get') { + throw new Error(`illegal action for setMockHttp ${action}`); + } + return previous; + }; + + // call mockS3Http with the argument + // - 'on' - turn it on + // - 'off' - turn it off (used by fetch.test.js so it doesn't interfere with redirects) + // - 'get' - return true or false for 'on' or 'off' + return mockS3Http; +}; + + + diff --git a/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js b/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js new file mode 100644 index 00000000..4409d7c7 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js @@ -0,0 +1,335 @@ +'use strict'; + +module.exports = exports; + +const path = require('path'); +const semver = require('semver'); +const url = require('url'); +const detect_libc = require('detect-libc'); +const napi = require('./napi.js'); + +let abi_crosswalk; + +// This is used for unit testing to provide a fake +// ABI crosswalk that emulates one that is not updated +// for the current version +if (process.env.NODE_PRE_GYP_ABI_CROSSWALK) { + abi_crosswalk = require(process.env.NODE_PRE_GYP_ABI_CROSSWALK); +} else { + abi_crosswalk = require('./abi_crosswalk.json'); +} + +const major_versions = {}; +Object.keys(abi_crosswalk).forEach((v) => { + const major = v.split('.')[0]; + if (!major_versions[major]) { + major_versions[major] = v; + } +}); + +function get_electron_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_electron_abi requires valid runtime arg'); + } + if (typeof target_version === 'undefined') { + // erroneous CLI call + throw new Error('Empty target version is not supported if electron is the target.'); + } + // Electron guarantees that patch version update won't break native modules. + const sem_ver = semver.parse(target_version); + return runtime + '-v' + sem_ver.major + '.' + sem_ver.minor; +} +module.exports.get_electron_abi = get_electron_abi; + +function get_node_webkit_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_node_webkit_abi requires valid runtime arg'); + } + if (typeof target_version === 'undefined') { + // erroneous CLI call + throw new Error('Empty target version is not supported if node-webkit is the target.'); + } + return runtime + '-v' + target_version; +} +module.exports.get_node_webkit_abi = get_node_webkit_abi; + +function get_node_abi(runtime, versions) { + if (!runtime) { + throw new Error('get_node_abi requires valid runtime arg'); + } + if (!versions) { + throw new Error('get_node_abi requires valid process.versions object'); + } + const sem_ver = semver.parse(versions.node); + if (sem_ver.major === 0 && sem_ver.minor % 2) { // odd series + // https://github.com/mapbox/node-pre-gyp/issues/124 + return runtime + '-v' + versions.node; + } else { + // process.versions.modules added in >= v0.10.4 and v0.11.7 + // https://github.com/joyent/node/commit/ccabd4a6fa8a6eb79d29bc3bbe9fe2b6531c2d8e + return versions.modules ? runtime + '-v' + (+versions.modules) : + 'v8-' + versions.v8.split('.').slice(0, 2).join('.'); + } +} +module.exports.get_node_abi = get_node_abi; + +function get_runtime_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_runtime_abi requires valid runtime arg'); + } + if (runtime === 'node-webkit') { + return get_node_webkit_abi(runtime, target_version || process.versions['node-webkit']); + } else if (runtime === 'electron') { + return get_electron_abi(runtime, target_version || process.versions.electron); + } else { + if (runtime !== 'node') { + throw new Error("Unknown Runtime: '" + runtime + "'"); + } + if (!target_version) { + return get_node_abi(runtime, process.versions); + } else { + let cross_obj; + // abi_crosswalk generated with ./scripts/abi_crosswalk.js + if (abi_crosswalk[target_version]) { + cross_obj = abi_crosswalk[target_version]; + } else { + const target_parts = target_version.split('.').map((i) => { return +i; }); + if (target_parts.length !== 3) { // parse failed + throw new Error('Unknown target version: ' + target_version); + } + /* + The below code tries to infer the last known ABI compatible version + that we have recorded in the abi_crosswalk.json when an exact match + is not possible. The reasons for this to exist are complicated: + + - We support passing --target to be able to allow developers to package binaries for versions of node + that are not the same one as they are running. This might also be used in combination with the + --target_arch or --target_platform flags to also package binaries for alternative platforms + - When --target is passed we can't therefore determine the ABI (process.versions.modules) from the node + version that is running in memory + - So, therefore node-pre-gyp keeps an "ABI crosswalk" (lib/util/abi_crosswalk.json) to be able to look + this info up for all versions + - But we cannot easily predict what the future ABI will be for released versions + - And node-pre-gyp needs to be a `bundledDependency` in apps that depend on it in order to work correctly + by being fully available at install time. + - So, the speed of node releases and the bundled nature of node-pre-gyp mean that a new node-pre-gyp release + need to happen for every node.js/io.js/node-webkit/nw.js/atom-shell/etc release that might come online if + you want the `--target` flag to keep working for the latest version + - Which is impractical ^^ + - Hence the below code guesses about future ABI to make the need to update node-pre-gyp less demanding. + + In practice then you can have a dependency of your app like `node-sqlite3` that bundles a `node-pre-gyp` that + only knows about node v0.10.33 in the `abi_crosswalk.json` but target node v0.10.34 (which is assumed to be + ABI compatible with v0.10.33). + + TODO: use semver module instead of custom version parsing + */ + const major = target_parts[0]; + let minor = target_parts[1]; + let patch = target_parts[2]; + // io.js: yeah if node.js ever releases 1.x this will break + // but that is unlikely to happen: https://github.com/iojs/io.js/pull/253#issuecomment-69432616 + if (major === 1) { + // look for last release that is the same major version + // e.g. we assume io.js 1.x is ABI compatible with >= 1.0.0 + while (true) { + if (minor > 0) --minor; + if (patch > 0) --patch; + const new_iojs_target = '' + major + '.' + minor + '.' + patch; + if (abi_crosswalk[new_iojs_target]) { + cross_obj = abi_crosswalk[new_iojs_target]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + new_iojs_target + ' as ABI compatible target'); + break; + } + if (minor === 0 && patch === 0) { + break; + } + } + } else if (major >= 2) { + // look for last release that is the same major version + if (major_versions[major]) { + cross_obj = abi_crosswalk[major_versions[major]]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + major_versions[major] + ' as ABI compatible target'); + } + } else if (major === 0) { // node.js + if (target_parts[1] % 2 === 0) { // for stable/even node.js series + // look for the last release that is the same minor release + // e.g. we assume node 0.10.x is ABI compatible with >= 0.10.0 + while (--patch > 0) { + const new_node_target = '' + major + '.' + minor + '.' + patch; + if (abi_crosswalk[new_node_target]) { + cross_obj = abi_crosswalk[new_node_target]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + new_node_target + ' as ABI compatible target'); + break; + } + } + } + } + } + if (!cross_obj) { + throw new Error('Unsupported target version: ' + target_version); + } + // emulate process.versions + const versions_obj = { + node: target_version, + v8: cross_obj.v8 + '.0', + // abi_crosswalk uses 1 for node versions lacking process.versions.modules + // process.versions.modules added in >= v0.10.4 and v0.11.7 + modules: cross_obj.node_abi > 1 ? cross_obj.node_abi : undefined + }; + return get_node_abi(runtime, versions_obj); + } + } +} +module.exports.get_runtime_abi = get_runtime_abi; + +const required_parameters = [ + 'module_name', + 'module_path', + 'host' +]; + +function validate_config(package_json, opts) { + const msg = package_json.name + ' package.json is not node-pre-gyp ready:\n'; + const missing = []; + if (!package_json.main) { + missing.push('main'); + } + if (!package_json.version) { + missing.push('version'); + } + if (!package_json.name) { + missing.push('name'); + } + if (!package_json.binary) { + missing.push('binary'); + } + const o = package_json.binary; + if (o) { + required_parameters.forEach((p) => { + if (!o[p] || typeof o[p] !== 'string') { + missing.push('binary.' + p); + } + }); + } + + if (missing.length >= 1) { + throw new Error(msg + 'package.json must declare these properties: \n' + missing.join('\n')); + } + if (o) { + // enforce https over http + const protocol = url.parse(o.host).protocol; + if (protocol === 'http:') { + throw new Error("'host' protocol (" + protocol + ") is invalid - only 'https:' is accepted"); + } + } + napi.validate_package_json(package_json, opts); +} + +module.exports.validate_config = validate_config; + +function eval_template(template, opts) { + Object.keys(opts).forEach((key) => { + const pattern = '{' + key + '}'; + while (template.indexOf(pattern) > -1) { + template = template.replace(pattern, opts[key]); + } + }); + return template; +} + +// url.resolve needs single trailing slash +// to behave correctly, otherwise a double slash +// may end up in the url which breaks requests +// and a lacking slash may not lead to proper joining +function fix_slashes(pathname) { + if (pathname.slice(-1) !== '/') { + return pathname + '/'; + } + return pathname; +} + +// remove double slashes +// note: path.normalize will not work because +// it will convert forward to back slashes +function drop_double_slashes(pathname) { + return pathname.replace(/\/\//g, '/'); +} + +function get_process_runtime(versions) { + let runtime = 'node'; + if (versions['node-webkit']) { + runtime = 'node-webkit'; + } else if (versions.electron) { + runtime = 'electron'; + } + return runtime; +} + +module.exports.get_process_runtime = get_process_runtime; + +const default_package_name = '{module_name}-v{version}-{node_abi}-{platform}-{arch}.tar.gz'; +const default_remote_path = ''; + +module.exports.evaluate = function(package_json, options, napi_build_version) { + options = options || {}; + validate_config(package_json, options); // options is a suitable substitute for opts in this case + const v = package_json.version; + const module_version = semver.parse(v); + const runtime = options.runtime || get_process_runtime(process.versions); + const opts = { + name: package_json.name, + configuration: options.debug ? 'Debug' : 'Release', + debug: options.debug, + module_name: package_json.binary.module_name, + version: module_version.version, + prerelease: module_version.prerelease.length ? module_version.prerelease.join('.') : '', + build: module_version.build.length ? module_version.build.join('.') : '', + major: module_version.major, + minor: module_version.minor, + patch: module_version.patch, + runtime: runtime, + node_abi: get_runtime_abi(runtime, options.target), + node_abi_napi: napi.get_napi_version(options.target) ? 'napi' : get_runtime_abi(runtime, options.target), + napi_version: napi.get_napi_version(options.target), // non-zero numeric, undefined if unsupported + napi_build_version: napi_build_version || '', + node_napi_label: napi_build_version ? 'napi-v' + napi_build_version : get_runtime_abi(runtime, options.target), + target: options.target || '', + platform: options.target_platform || process.platform, + target_platform: options.target_platform || process.platform, + arch: options.target_arch || process.arch, + target_arch: options.target_arch || process.arch, + libc: options.target_libc || detect_libc.family || 'unknown', + module_main: package_json.main, + toolset: options.toolset || '', // address https://github.com/mapbox/node-pre-gyp/issues/119 + bucket: package_json.binary.bucket, + region: package_json.binary.region, + s3ForcePathStyle: package_json.binary.s3ForcePathStyle || false + }; + // support host mirror with npm config `--{module_name}_binary_host_mirror` + // e.g.: https://github.com/node-inspector/v8-profiler/blob/master/package.json#L25 + // > npm install v8-profiler --profiler_binary_host_mirror=https://npm.taobao.org/mirrors/node-inspector/ + const validModuleName = opts.module_name.replace('-', '_'); + const host = process.env['npm_config_' + validModuleName + '_binary_host_mirror'] || package_json.binary.host; + opts.host = fix_slashes(eval_template(host, opts)); + opts.module_path = eval_template(package_json.binary.module_path, opts); + // now we resolve the module_path to ensure it is absolute so that binding.gyp variables work predictably + if (options.module_root) { + // resolve relative to known module root: works for pre-binding require + opts.module_path = path.join(options.module_root, opts.module_path); + } else { + // resolve relative to current working directory: works for node-pre-gyp commands + opts.module_path = path.resolve(opts.module_path); + } + opts.module = path.join(opts.module_path, opts.module_name + '.node'); + opts.remote_path = package_json.binary.remote_path ? drop_double_slashes(fix_slashes(eval_template(package_json.binary.remote_path, opts))) : default_remote_path; + const package_name = package_json.binary.package_name ? package_json.binary.package_name : default_package_name; + opts.package_name = eval_template(package_name, opts); + opts.staged_tarball = path.join('build/stage', opts.remote_path, opts.package_name); + opts.hosted_path = url.resolve(opts.host, opts.remote_path); + opts.hosted_tarball = url.resolve(opts.hosted_path, opts.package_name); + return opts; +}; diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/.bin/nopt b/node_modules/@mapbox/node-pre-gyp/node_modules/.bin/nopt new file mode 120000 index 00000000..6b6566ea --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/.bin/nopt @@ -0,0 +1 @@ +../nopt/bin/nopt.js \ No newline at end of file diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/.bin/semver b/node_modules/@mapbox/node-pre-gyp/node_modules/.bin/semver new file mode 120000 index 00000000..5aaadf42 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/.bin/semver @@ -0,0 +1 @@ +../semver/bin/semver.js \ No newline at end of file diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/CHANGELOG.md b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/CHANGELOG.md new file mode 100644 index 00000000..82a09fb4 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/CHANGELOG.md @@ -0,0 +1,58 @@ +### v4.0.1 (2016-12-14) + +#### WHOOPS + +* [`fb9b1ce`](https://github.com/npm/nopt/commit/fb9b1ce57b3c69b4f7819015be87719204f77ef6) + Merged so many patches at once that the code fencing + ([@adius](https://github.com/adius)) added got broken. Sorry, + ([@adius](https://github.com/adius))! + ([@othiym23](https://github.com/othiym23)) + +### v4.0.0 (2016-12-13) + +#### BREAKING CHANGES + +* [`651d447`](https://github.com/npm/nopt/commit/651d4473946096d341a480bbe56793de3fc706aa) + When parsing String-typed arguments, if the next value is `""`, don't simply + swallow it. ([@samjonester](https://github.com/samjonester)) + +#### PERFORMANCE TWEAKS + +* [`3370ce8`](https://github.com/npm/nopt/commit/3370ce87a7618ba228883861db84ddbcdff252a9) + Simplify initialization. ([@elidoran](https://github.com/elidoran)) +* [`356e58e`](https://github.com/npm/nopt/commit/356e58e3b3b431a4b1af7fd7bdee44c2c0526a09) + Store `Array.isArray(types[arg])` for reuse. + ([@elidoran](https://github.com/elidoran)) +* [`0d95e90`](https://github.com/npm/nopt/commit/0d95e90515844f266015b56d2c80b94e5d14a07e) + Interpret single-item type arrays as a single type. + ([@samjonester](https://github.com/samjonester)) +* [`07c69d3`](https://github.com/npm/nopt/commit/07c69d38b5186450941fbb505550becb78a0e925) + Simplify key-value extraction. ([@elidoran](https://github.com/elidoran)) +* [`39b6e5c`](https://github.com/npm/nopt/commit/39b6e5c65ac47f60cd43a1fbeece5cd4c834c254) + Only call `Date.parse(val)` once. ([@elidoran](https://github.com/elidoran)) +* [`934943d`](https://github.com/npm/nopt/commit/934943dffecb55123a2b15959fe2a359319a5dbd) + Use `osenv.home()` to find a user's home directory instead of assuming it's + always `$HOME`. ([@othiym23](https://github.com/othiym23)) + +#### TEST & CI IMPROVEMENTS + +* [`326ffff`](https://github.com/npm/nopt/commit/326ffff7f78a00bcd316adecf69075f8a8093619) + Fix `/tmp` test to work on Windows. + ([@elidoran](https://github.com/elidoran)) +* [`c89d31a`](https://github.com/npm/nopt/commit/c89d31a49d14f2238bc6672db08da697bbc57f1b) + Only run Windows tests on Windows, only run Unix tests on a Unix. + ([@elidoran](https://github.com/elidoran)) +* [`affd3d1`](https://github.com/npm/nopt/commit/affd3d1d0addffa93006397b2013b18447339366) + Refresh Travis to run the tests against the currently-supported batch of npm + versions. ([@helio](https://github.com/helio)-frota) +* [`55f9449`](https://github.com/npm/nopt/commit/55f94497d163ed4d16dd55fd6c4fb95cc440e66d) + `tap@8.0.1` ([@othiym23](https://github.com/othiym23)) + +#### DOC TWEAKS + +* [`5271229`](https://github.com/npm/nopt/commit/5271229ee7c810217dd51616c086f5d9ab224581) + Use JavaScript code block for syntax highlighting. + ([@adius](https://github.com/adius)) +* [`c0d156f`](https://github.com/npm/nopt/commit/c0d156f229f9994c5dfcec4a8886eceff7a07682) + The code sample in the README had `many2: [ oneThing ]`, and now it has + `many2: [ two, things ]`. ([@silkentrance](https://github.com/silkentrance)) diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/LICENSE b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/LICENSE new file mode 100644 index 00000000..19129e31 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/README.md b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/README.md new file mode 100644 index 00000000..a99531c0 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/README.md @@ -0,0 +1,213 @@ +If you want to write an option parser, and have it be good, there are +two ways to do it. The Right Way, and the Wrong Way. + +The Wrong Way is to sit down and write an option parser. We've all done +that. + +The Right Way is to write some complex configurable program with so many +options that you hit the limit of your frustration just trying to +manage them all, and defer it with duct-tape solutions until you see +exactly to the core of the problem, and finally snap and write an +awesome option parser. + +If you want to write an option parser, don't write an option parser. +Write a package manager, or a source control system, or a service +restarter, or an operating system. You probably won't end up with a +good one of those, but if you don't give up, and you are relentless and +diligent enough in your procrastination, you may just end up with a very +nice option parser. + +## USAGE + +```javascript +// my-program.js +var nopt = require("nopt") + , Stream = require("stream").Stream + , path = require("path") + , knownOpts = { "foo" : [String, null] + , "bar" : [Stream, Number] + , "baz" : path + , "bloo" : [ "big", "medium", "small" ] + , "flag" : Boolean + , "pick" : Boolean + , "many1" : [String, Array] + , "many2" : [path, Array] + } + , shortHands = { "foofoo" : ["--foo", "Mr. Foo"] + , "b7" : ["--bar", "7"] + , "m" : ["--bloo", "medium"] + , "p" : ["--pick"] + , "f" : ["--flag"] + } + // everything is optional. + // knownOpts and shorthands default to {} + // arg list defaults to process.argv + // slice defaults to 2 + , parsed = nopt(knownOpts, shortHands, process.argv, 2) +console.log(parsed) +``` + +This would give you support for any of the following: + +```console +$ node my-program.js --foo "blerp" --no-flag +{ "foo" : "blerp", "flag" : false } + +$ node my-program.js ---bar 7 --foo "Mr. Hand" --flag +{ bar: 7, foo: "Mr. Hand", flag: true } + +$ node my-program.js --foo "blerp" -f -----p +{ foo: "blerp", flag: true, pick: true } + +$ node my-program.js -fp --foofoo +{ foo: "Mr. Foo", flag: true, pick: true } + +$ node my-program.js --foofoo -- -fp # -- stops the flag parsing. +{ foo: "Mr. Foo", argv: { remain: ["-fp"] } } + +$ node my-program.js --blatzk -fp # unknown opts are ok. +{ blatzk: true, flag: true, pick: true } + +$ node my-program.js --blatzk=1000 -fp # but you need to use = if they have a value +{ blatzk: 1000, flag: true, pick: true } + +$ node my-program.js --no-blatzk -fp # unless they start with "no-" +{ blatzk: false, flag: true, pick: true } + +$ node my-program.js --baz b/a/z # known paths are resolved. +{ baz: "/Users/isaacs/b/a/z" } + +# if Array is one of the types, then it can take many +# values, and will always be an array. The other types provided +# specify what types are allowed in the list. + +$ node my-program.js --many1 5 --many1 null --many1 foo +{ many1: ["5", "null", "foo"] } + +$ node my-program.js --many2 foo --many2 bar +{ many2: ["/path/to/foo", "path/to/bar"] } +``` + +Read the tests at the bottom of `lib/nopt.js` for more examples of +what this puppy can do. + +## Types + +The following types are supported, and defined on `nopt.typeDefs` + +* String: A normal string. No parsing is done. +* path: A file system path. Gets resolved against cwd if not absolute. +* url: A url. If it doesn't parse, it isn't accepted. +* Number: Must be numeric. +* Date: Must parse as a date. If it does, and `Date` is one of the options, + then it will return a Date object, not a string. +* Boolean: Must be either `true` or `false`. If an option is a boolean, + then it does not need a value, and its presence will imply `true` as + the value. To negate boolean flags, do `--no-whatever` or `--whatever + false` +* NaN: Means that the option is strictly not allowed. Any value will + fail. +* Stream: An object matching the "Stream" class in node. Valuable + for use when validating programmatically. (npm uses this to let you + supply any WriteStream on the `outfd` and `logfd` config options.) +* Array: If `Array` is specified as one of the types, then the value + will be parsed as a list of options. This means that multiple values + can be specified, and that the value will always be an array. + +If a type is an array of values not on this list, then those are +considered valid values. For instance, in the example above, the +`--bloo` option can only be one of `"big"`, `"medium"`, or `"small"`, +and any other value will be rejected. + +When parsing unknown fields, `"true"`, `"false"`, and `"null"` will be +interpreted as their JavaScript equivalents. + +You can also mix types and values, or multiple types, in a list. For +instance `{ blah: [Number, null] }` would allow a value to be set to +either a Number or null. When types are ordered, this implies a +preference, and the first type that can be used to properly interpret +the value will be used. + +To define a new type, add it to `nopt.typeDefs`. Each item in that +hash is an object with a `type` member and a `validate` method. The +`type` member is an object that matches what goes in the type list. The +`validate` method is a function that gets called with `validate(data, +key, val)`. Validate methods should assign `data[key]` to the valid +value of `val` if it can be handled properly, or return boolean +`false` if it cannot. + +You can also call `nopt.clean(data, types, typeDefs)` to clean up a +config object and remove its invalid properties. + +## Error Handling + +By default, nopt outputs a warning to standard error when invalid values for +known options are found. You can change this behavior by assigning a method +to `nopt.invalidHandler`. This method will be called with +the offending `nopt.invalidHandler(key, val, types)`. + +If no `nopt.invalidHandler` is assigned, then it will console.error +its whining. If it is assigned to boolean `false` then the warning is +suppressed. + +## Abbreviations + +Yes, they are supported. If you define options like this: + +```javascript +{ "foolhardyelephants" : Boolean +, "pileofmonkeys" : Boolean } +``` + +Then this will work: + +```bash +node program.js --foolhar --pil +node program.js --no-f --pileofmon +# etc. +``` + +## Shorthands + +Shorthands are a hash of shorter option names to a snippet of args that +they expand to. + +If multiple one-character shorthands are all combined, and the +combination does not unambiguously match any other option or shorthand, +then they will be broken up into their constituent parts. For example: + +```json +{ "s" : ["--loglevel", "silent"] +, "g" : "--global" +, "f" : "--force" +, "p" : "--parseable" +, "l" : "--long" +} +``` + +```bash +npm ls -sgflp +# just like doing this: +npm ls --loglevel silent --global --force --long --parseable +``` + +## The Rest of the args + +The config object returned by nopt is given a special member called +`argv`, which is an object with the following fields: + +* `remain`: The remaining args after all the parsing has occurred. +* `original`: The args as they originally appeared. +* `cooked`: The args after flags and shorthands are expanded. + +## Slicing + +Node programs are called with more or less the exact argv as it appears +in C land, after the v8 and node-specific options have been plucked off. +As such, `argv[0]` is always `node` and `argv[1]` is always the +JavaScript program being run. + +That's usually not very useful to you. So they're sliced off by +default. If you want them, then you can pass in `0` as the last +argument, or any other number that you'd like to slice off the start of +the list. diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/bin/nopt.js b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/bin/nopt.js new file mode 100755 index 00000000..3232d4c5 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/bin/nopt.js @@ -0,0 +1,54 @@ +#!/usr/bin/env node +var nopt = require("../lib/nopt") + , path = require("path") + , types = { num: Number + , bool: Boolean + , help: Boolean + , list: Array + , "num-list": [Number, Array] + , "str-list": [String, Array] + , "bool-list": [Boolean, Array] + , str: String + , clear: Boolean + , config: Boolean + , length: Number + , file: path + } + , shorthands = { s: [ "--str", "astring" ] + , b: [ "--bool" ] + , nb: [ "--no-bool" ] + , tft: [ "--bool-list", "--no-bool-list", "--bool-list", "true" ] + , "?": ["--help"] + , h: ["--help"] + , H: ["--help"] + , n: [ "--num", "125" ] + , c: ["--config"] + , l: ["--length"] + , f: ["--file"] + } + , parsed = nopt( types + , shorthands + , process.argv + , 2 ) + +console.log("parsed", parsed) + +if (parsed.help) { + console.log("") + console.log("nopt cli tester") + console.log("") + console.log("types") + console.log(Object.keys(types).map(function M (t) { + var type = types[t] + if (Array.isArray(type)) { + return [t, type.map(function (type) { return type.name })] + } + return [t, type && type.name] + }).reduce(function (s, i) { + s[i[0]] = i[1] + return s + }, {})) + console.log("") + console.log("shorthands") + console.log(shorthands) +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/lib/nopt.js b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/lib/nopt.js new file mode 100644 index 00000000..ecfa5da9 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/lib/nopt.js @@ -0,0 +1,441 @@ +// info about each config option. + +var debug = process.env.DEBUG_NOPT || process.env.NOPT_DEBUG + ? function () { console.error.apply(console, arguments) } + : function () {} + +var url = require("url") + , path = require("path") + , Stream = require("stream").Stream + , abbrev = require("abbrev") + , os = require("os") + +module.exports = exports = nopt +exports.clean = clean + +exports.typeDefs = + { String : { type: String, validate: validateString } + , Boolean : { type: Boolean, validate: validateBoolean } + , url : { type: url, validate: validateUrl } + , Number : { type: Number, validate: validateNumber } + , path : { type: path, validate: validatePath } + , Stream : { type: Stream, validate: validateStream } + , Date : { type: Date, validate: validateDate } + } + +function nopt (types, shorthands, args, slice) { + args = args || process.argv + types = types || {} + shorthands = shorthands || {} + if (typeof slice !== "number") slice = 2 + + debug(types, shorthands, args, slice) + + args = args.slice(slice) + var data = {} + , key + , argv = { + remain: [], + cooked: args, + original: args.slice(0) + } + + parse(args, data, argv.remain, types, shorthands) + // now data is full + clean(data, types, exports.typeDefs) + data.argv = argv + Object.defineProperty(data.argv, 'toString', { value: function () { + return this.original.map(JSON.stringify).join(" ") + }, enumerable: false }) + return data +} + +function clean (data, types, typeDefs) { + typeDefs = typeDefs || exports.typeDefs + var remove = {} + , typeDefault = [false, true, null, String, Array] + + Object.keys(data).forEach(function (k) { + if (k === "argv") return + var val = data[k] + , isArray = Array.isArray(val) + , type = types[k] + if (!isArray) val = [val] + if (!type) type = typeDefault + if (type === Array) type = typeDefault.concat(Array) + if (!Array.isArray(type)) type = [type] + + debug("val=%j", val) + debug("types=", type) + val = val.map(function (val) { + // if it's an unknown value, then parse false/true/null/numbers/dates + if (typeof val === "string") { + debug("string %j", val) + val = val.trim() + if ((val === "null" && ~type.indexOf(null)) + || (val === "true" && + (~type.indexOf(true) || ~type.indexOf(Boolean))) + || (val === "false" && + (~type.indexOf(false) || ~type.indexOf(Boolean)))) { + val = JSON.parse(val) + debug("jsonable %j", val) + } else if (~type.indexOf(Number) && !isNaN(val)) { + debug("convert to number", val) + val = +val + } else if (~type.indexOf(Date) && !isNaN(Date.parse(val))) { + debug("convert to date", val) + val = new Date(val) + } + } + + if (!types.hasOwnProperty(k)) { + return val + } + + // allow `--no-blah` to set 'blah' to null if null is allowed + if (val === false && ~type.indexOf(null) && + !(~type.indexOf(false) || ~type.indexOf(Boolean))) { + val = null + } + + var d = {} + d[k] = val + debug("prevalidated val", d, val, types[k]) + if (!validate(d, k, val, types[k], typeDefs)) { + if (exports.invalidHandler) { + exports.invalidHandler(k, val, types[k], data) + } else if (exports.invalidHandler !== false) { + debug("invalid: "+k+"="+val, types[k]) + } + return remove + } + debug("validated val", d, val, types[k]) + return d[k] + }).filter(function (val) { return val !== remove }) + + // if we allow Array specifically, then an empty array is how we + // express 'no value here', not null. Allow it. + if (!val.length && type.indexOf(Array) === -1) { + debug('VAL HAS NO LENGTH, DELETE IT', val, k, type.indexOf(Array)) + delete data[k] + } + else if (isArray) { + debug(isArray, data[k], val) + data[k] = val + } else data[k] = val[0] + + debug("k=%s val=%j", k, val, data[k]) + }) +} + +function validateString (data, k, val) { + data[k] = String(val) +} + +function validatePath (data, k, val) { + if (val === true) return false + if (val === null) return true + + val = String(val) + + var isWin = process.platform === 'win32' + , homePattern = isWin ? /^~(\/|\\)/ : /^~\// + , home = os.homedir() + + if (home && val.match(homePattern)) { + data[k] = path.resolve(home, val.substr(2)) + } else { + data[k] = path.resolve(val) + } + return true +} + +function validateNumber (data, k, val) { + debug("validate Number %j %j %j", k, val, isNaN(val)) + if (isNaN(val)) return false + data[k] = +val +} + +function validateDate (data, k, val) { + var s = Date.parse(val) + debug("validate Date %j %j %j", k, val, s) + if (isNaN(s)) return false + data[k] = new Date(val) +} + +function validateBoolean (data, k, val) { + if (val instanceof Boolean) val = val.valueOf() + else if (typeof val === "string") { + if (!isNaN(val)) val = !!(+val) + else if (val === "null" || val === "false") val = false + else val = true + } else val = !!val + data[k] = val +} + +function validateUrl (data, k, val) { + val = url.parse(String(val)) + if (!val.host) return false + data[k] = val.href +} + +function validateStream (data, k, val) { + if (!(val instanceof Stream)) return false + data[k] = val +} + +function validate (data, k, val, type, typeDefs) { + // arrays are lists of types. + if (Array.isArray(type)) { + for (var i = 0, l = type.length; i < l; i ++) { + if (type[i] === Array) continue + if (validate(data, k, val, type[i], typeDefs)) return true + } + delete data[k] + return false + } + + // an array of anything? + if (type === Array) return true + + // NaN is poisonous. Means that something is not allowed. + if (type !== type) { + debug("Poison NaN", k, val, type) + delete data[k] + return false + } + + // explicit list of values + if (val === type) { + debug("Explicitly allowed %j", val) + // if (isArray) (data[k] = data[k] || []).push(val) + // else data[k] = val + data[k] = val + return true + } + + // now go through the list of typeDefs, validate against each one. + var ok = false + , types = Object.keys(typeDefs) + for (var i = 0, l = types.length; i < l; i ++) { + debug("test type %j %j %j", k, val, types[i]) + var t = typeDefs[types[i]] + if (t && + ((type && type.name && t.type && t.type.name) ? (type.name === t.type.name) : (type === t.type))) { + var d = {} + ok = false !== t.validate(d, k, val) + val = d[k] + if (ok) { + // if (isArray) (data[k] = data[k] || []).push(val) + // else data[k] = val + data[k] = val + break + } + } + } + debug("OK? %j (%j %j %j)", ok, k, val, types[i]) + + if (!ok) delete data[k] + return ok +} + +function parse (args, data, remain, types, shorthands) { + debug("parse", args, data, remain) + + var key = null + , abbrevs = abbrev(Object.keys(types)) + , shortAbbr = abbrev(Object.keys(shorthands)) + + for (var i = 0; i < args.length; i ++) { + var arg = args[i] + debug("arg", arg) + + if (arg.match(/^-{2,}$/)) { + // done with keys. + // the rest are args. + remain.push.apply(remain, args.slice(i + 1)) + args[i] = "--" + break + } + var hadEq = false + if (arg.charAt(0) === "-" && arg.length > 1) { + var at = arg.indexOf('=') + if (at > -1) { + hadEq = true + var v = arg.substr(at + 1) + arg = arg.substr(0, at) + args.splice(i, 1, arg, v) + } + + // see if it's a shorthand + // if so, splice and back up to re-parse it. + var shRes = resolveShort(arg, shorthands, shortAbbr, abbrevs) + debug("arg=%j shRes=%j", arg, shRes) + if (shRes) { + debug(arg, shRes) + args.splice.apply(args, [i, 1].concat(shRes)) + if (arg !== shRes[0]) { + i -- + continue + } + } + arg = arg.replace(/^-+/, "") + var no = null + while (arg.toLowerCase().indexOf("no-") === 0) { + no = !no + arg = arg.substr(3) + } + + if (abbrevs[arg]) arg = abbrevs[arg] + + var argType = types[arg] + var isTypeArray = Array.isArray(argType) + if (isTypeArray && argType.length === 1) { + isTypeArray = false + argType = argType[0] + } + + var isArray = argType === Array || + isTypeArray && argType.indexOf(Array) !== -1 + + // allow unknown things to be arrays if specified multiple times. + if (!types.hasOwnProperty(arg) && data.hasOwnProperty(arg)) { + if (!Array.isArray(data[arg])) + data[arg] = [data[arg]] + isArray = true + } + + var val + , la = args[i + 1] + + var isBool = typeof no === 'boolean' || + argType === Boolean || + isTypeArray && argType.indexOf(Boolean) !== -1 || + (typeof argType === 'undefined' && !hadEq) || + (la === "false" && + (argType === null || + isTypeArray && ~argType.indexOf(null))) + + if (isBool) { + // just set and move along + val = !no + // however, also support --bool true or --bool false + if (la === "true" || la === "false") { + val = JSON.parse(la) + la = null + if (no) val = !val + i ++ + } + + // also support "foo":[Boolean, "bar"] and "--foo bar" + if (isTypeArray && la) { + if (~argType.indexOf(la)) { + // an explicit type + val = la + i ++ + } else if ( la === "null" && ~argType.indexOf(null) ) { + // null allowed + val = null + i ++ + } else if ( !la.match(/^-{2,}[^-]/) && + !isNaN(la) && + ~argType.indexOf(Number) ) { + // number + val = +la + i ++ + } else if ( !la.match(/^-[^-]/) && ~argType.indexOf(String) ) { + // string + val = la + i ++ + } + } + + if (isArray) (data[arg] = data[arg] || []).push(val) + else data[arg] = val + + continue + } + + if (argType === String) { + if (la === undefined) { + la = "" + } else if (la.match(/^-{1,2}[^-]+/)) { + la = "" + i -- + } + } + + if (la && la.match(/^-{2,}$/)) { + la = undefined + i -- + } + + val = la === undefined ? true : la + if (isArray) (data[arg] = data[arg] || []).push(val) + else data[arg] = val + + i ++ + continue + } + remain.push(arg) + } +} + +function resolveShort (arg, shorthands, shortAbbr, abbrevs) { + // handle single-char shorthands glommed together, like + // npm ls -glp, but only if there is one dash, and only if + // all of the chars are single-char shorthands, and it's + // not a match to some other abbrev. + arg = arg.replace(/^-+/, '') + + // if it's an exact known option, then don't go any further + if (abbrevs[arg] === arg) + return null + + // if it's an exact known shortopt, same deal + if (shorthands[arg]) { + // make it an array, if it's a list of words + if (shorthands[arg] && !Array.isArray(shorthands[arg])) + shorthands[arg] = shorthands[arg].split(/\s+/) + + return shorthands[arg] + } + + // first check to see if this arg is a set of single-char shorthands + var singles = shorthands.___singles + if (!singles) { + singles = Object.keys(shorthands).filter(function (s) { + return s.length === 1 + }).reduce(function (l,r) { + l[r] = true + return l + }, {}) + shorthands.___singles = singles + debug('shorthand singles', singles) + } + + var chrs = arg.split("").filter(function (c) { + return singles[c] + }) + + if (chrs.join("") === arg) return chrs.map(function (c) { + return shorthands[c] + }).reduce(function (l, r) { + return l.concat(r) + }, []) + + + // if it's an arg abbrev, and not a literal shorthand, then prefer the arg + if (abbrevs[arg] && !shorthands[arg]) + return null + + // if it's an abbr for a shorthand, then use that + if (shortAbbr[arg]) + arg = shortAbbr[arg] + + // make it an array, if it's a list of words + if (shorthands[arg] && !Array.isArray(shorthands[arg])) + shorthands[arg] = shorthands[arg].split(/\s+/) + + return shorthands[arg] +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/package.json b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/package.json new file mode 100644 index 00000000..dc50b8c3 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/nopt/package.json @@ -0,0 +1,67 @@ +{ + "_from": "nopt@^5.0.0", + "_id": "nopt@5.0.0", + "_inBundle": false, + "_integrity": "sha512-Tbj67rffqceeLpcRXrT7vKAN8CwfPeIBgM7E6iBkmKLV7bEMwpGgYLGv0jACUsECaa/vuxP0IjEont6umdMgtQ==", + "_location": "/@mapbox/node-pre-gyp/nopt", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "nopt@^5.0.0", + "name": "nopt", + "escapedName": "nopt", + "rawSpec": "^5.0.0", + "saveSpec": null, + "fetchSpec": "^5.0.0" + }, + "_requiredBy": [ + "/@mapbox/node-pre-gyp" + ], + "_resolved": "https://registry.npmjs.org/nopt/-/nopt-5.0.0.tgz", + "_shasum": "530942bb58a512fccafe53fe210f13a25355dc88", + "_spec": "nopt@^5.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/@mapbox/node-pre-gyp", + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + }, + "bin": { + "nopt": "bin/nopt.js" + }, + "bugs": { + "url": "https://github.com/npm/nopt/issues" + }, + "bundleDependencies": false, + "dependencies": { + "abbrev": "1" + }, + "deprecated": false, + "description": "Option parsing for Node, supporting types, shorthands, etc. Used by npm.", + "devDependencies": { + "tap": "^14.10.6" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "bin", + "lib" + ], + "homepage": "https://github.com/npm/nopt#readme", + "license": "ISC", + "main": "lib/nopt.js", + "name": "nopt", + "repository": { + "type": "git", + "url": "git+https://github.com/npm/nopt.git" + }, + "scripts": { + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "preversion": "npm test", + "test": "tap test/*.js" + }, + "version": "5.0.0" +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/CHANGELOG.md b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/CHANGELOG.md new file mode 100644 index 00000000..220af176 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/CHANGELOG.md @@ -0,0 +1,111 @@ +# changes log + +## 7.3.0 + +* Add `subset(r1, r2)` method to determine if `r1` range is entirely + contained by `r2` range. + +## 7.2.3 + +* Fix handling of `includePrelease` mode where version ranges like `1.0.0 - + 2.0.0` would include `3.0.0-pre` and not `1.0.0-pre`. + +## 7.2.2 + +* Fix bug where `2.0.0-pre` would be included in `^1.0.0` if + `includePrerelease` was set to true. + +## 7.2.0 + +* Add `simplifyRange` method to attempt to generate a more human-readable + range expression that is equivalent to a supplied range, for a given set + of versions. + +## 7.1.2 + +* Remove fancy lazy-loading logic, as it was causing problems for webpack + users. + +## 7.1.0 + +* Add `require('semver/preload')` to load the entire module without using + lazy getter methods. + +## 7.0.0 + +* Refactor module into separate files for better tree-shaking +* Drop support for very old node versions, use const/let, `=>` functions, + and classes. + +## 6.3.0 + +* Expose the token enum on the exports + +## 6.2.0 + +* Coerce numbers to strings when passed to semver.coerce() +* Add `rtl` option to coerce from right to left + +## 6.1.3 + +* Handle X-ranges properly in includePrerelease mode + +## 6.1.2 + +* Do not throw when testing invalid version strings + +## 6.1.1 + +* Add options support for semver.coerce() +* Handle undefined version passed to Range.test + +## 6.1.0 + +* Add semver.compareBuild function +* Support `*` in semver.intersects + +## 6.0 + +* Fix `intersects` logic. + + This is technically a bug fix, but since it is also a change to behavior + that may require users updating their code, it is marked as a major + version increment. + +## 5.7 + +* Add `minVersion` method + +## 5.6 + +* Move boolean `loose` param to an options object, with + backwards-compatibility protection. +* Add ability to opt out of special prerelease version handling with + the `includePrerelease` option flag. + +## 5.5 + +* Add version coercion capabilities + +## 5.4 + +* Add intersection checking + +## 5.3 + +* Add `minSatisfying` method + +## 5.2 + +* Add `prerelease(v)` that returns prerelease components + +## 5.1 + +* Add Backus-Naur for ranges +* Remove excessively cute inspection methods + +## 5.0 + +* Remove AMD/Browserified build artifacts +* Fix ltr and gtr when using the `*` range +* Fix for range `*` with a prerelease identifier diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/LICENSE b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/LICENSE new file mode 100644 index 00000000..19129e31 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/README.md b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/README.md new file mode 100644 index 00000000..9bef045a --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/README.md @@ -0,0 +1,566 @@ +semver(1) -- The semantic versioner for npm +=========================================== + +## Install + +```bash +npm install semver +```` + +## Usage + +As a node module: + +```js +const semver = require('semver') + +semver.valid('1.2.3') // '1.2.3' +semver.valid('a.b.c') // null +semver.clean(' =v1.2.3 ') // '1.2.3' +semver.satisfies('1.2.3', '1.x || >=2.5.0 || 5.0.0 - 7.2.3') // true +semver.gt('1.2.3', '9.8.7') // false +semver.lt('1.2.3', '9.8.7') // true +semver.minVersion('>=1.0.0') // '1.0.0' +semver.valid(semver.coerce('v2')) // '2.0.0' +semver.valid(semver.coerce('42.6.7.9.3-alpha')) // '42.6.7' +``` + +You can also just load the module for the function that you care about, if +you'd like to minimize your footprint. + +```js +// load the whole API at once in a single object +const semver = require('semver') + +// or just load the bits you need +// all of them listed here, just pick and choose what you want + +// classes +const SemVer = require('semver/classes/semver') +const Comparator = require('semver/classes/comparator') +const Range = require('semver/classes/range') + +// functions for working with versions +const semverParse = require('semver/functions/parse') +const semverValid = require('semver/functions/valid') +const semverClean = require('semver/functions/clean') +const semverInc = require('semver/functions/inc') +const semverDiff = require('semver/functions/diff') +const semverMajor = require('semver/functions/major') +const semverMinor = require('semver/functions/minor') +const semverPatch = require('semver/functions/patch') +const semverPrerelease = require('semver/functions/prerelease') +const semverCompare = require('semver/functions/compare') +const semverRcompare = require('semver/functions/rcompare') +const semverCompareLoose = require('semver/functions/compare-loose') +const semverCompareBuild = require('semver/functions/compare-build') +const semverSort = require('semver/functions/sort') +const semverRsort = require('semver/functions/rsort') + +// low-level comparators between versions +const semverGt = require('semver/functions/gt') +const semverLt = require('semver/functions/lt') +const semverEq = require('semver/functions/eq') +const semverNeq = require('semver/functions/neq') +const semverGte = require('semver/functions/gte') +const semverLte = require('semver/functions/lte') +const semverCmp = require('semver/functions/cmp') +const semverCoerce = require('semver/functions/coerce') + +// working with ranges +const semverSatisfies = require('semver/functions/satisfies') +const semverMaxSatisfying = require('semver/ranges/max-satisfying') +const semverMinSatisfying = require('semver/ranges/min-satisfying') +const semverToComparators = require('semver/ranges/to-comparators') +const semverMinVersion = require('semver/ranges/min-version') +const semverValidRange = require('semver/ranges/valid') +const semverOutside = require('semver/ranges/outside') +const semverGtr = require('semver/ranges/gtr') +const semverLtr = require('semver/ranges/ltr') +const semverIntersects = require('semver/ranges/intersects') +const simplifyRange = require('semver/ranges/simplify') +const rangeSubset = require('semver/ranges/subset') +``` + +As a command-line utility: + +``` +$ semver -h + +A JavaScript implementation of the https://semver.org/ specification +Copyright Isaac Z. Schlueter + +Usage: semver [options] [ [...]] +Prints valid versions sorted by SemVer precedence + +Options: +-r --range + Print versions that match the specified range. + +-i --increment [] + Increment a version by the specified level. Level can + be one of: major, minor, patch, premajor, preminor, + prepatch, or prerelease. Default level is 'patch'. + Only one version may be specified. + +--preid + Identifier to be used to prefix premajor, preminor, + prepatch or prerelease version increments. + +-l --loose + Interpret versions and ranges loosely + +-p --include-prerelease + Always include prerelease versions in range matching + +-c --coerce + Coerce a string into SemVer if possible + (does not imply --loose) + +--rtl + Coerce version strings right to left + +--ltr + Coerce version strings left to right (default) + +Program exits successfully if any valid version satisfies +all supplied ranges, and prints all satisfying versions. + +If no satisfying versions are found, then exits failure. + +Versions are printed in ascending order, so supplying +multiple versions to the utility will just sort them. +``` + +## Versions + +A "version" is described by the `v2.0.0` specification found at +. + +A leading `"="` or `"v"` character is stripped off and ignored. + +## Ranges + +A `version range` is a set of `comparators` which specify versions +that satisfy the range. + +A `comparator` is composed of an `operator` and a `version`. The set +of primitive `operators` is: + +* `<` Less than +* `<=` Less than or equal to +* `>` Greater than +* `>=` Greater than or equal to +* `=` Equal. If no operator is specified, then equality is assumed, + so this operator is optional, but MAY be included. + +For example, the comparator `>=1.2.7` would match the versions +`1.2.7`, `1.2.8`, `2.5.3`, and `1.3.9`, but not the versions `1.2.6` +or `1.1.0`. + +Comparators can be joined by whitespace to form a `comparator set`, +which is satisfied by the **intersection** of all of the comparators +it includes. + +A range is composed of one or more comparator sets, joined by `||`. A +version matches a range if and only if every comparator in at least +one of the `||`-separated comparator sets is satisfied by the version. + +For example, the range `>=1.2.7 <1.3.0` would match the versions +`1.2.7`, `1.2.8`, and `1.2.99`, but not the versions `1.2.6`, `1.3.0`, +or `1.1.0`. + +The range `1.2.7 || >=1.2.9 <2.0.0` would match the versions `1.2.7`, +`1.2.9`, and `1.4.6`, but not the versions `1.2.8` or `2.0.0`. + +### Prerelease Tags + +If a version has a prerelease tag (for example, `1.2.3-alpha.3`) then +it will only be allowed to satisfy comparator sets if at least one +comparator with the same `[major, minor, patch]` tuple also has a +prerelease tag. + +For example, the range `>1.2.3-alpha.3` would be allowed to match the +version `1.2.3-alpha.7`, but it would *not* be satisfied by +`3.4.5-alpha.9`, even though `3.4.5-alpha.9` is technically "greater +than" `1.2.3-alpha.3` according to the SemVer sort rules. The version +range only accepts prerelease tags on the `1.2.3` version. The +version `3.4.5` *would* satisfy the range, because it does not have a +prerelease flag, and `3.4.5` is greater than `1.2.3-alpha.7`. + +The purpose for this behavior is twofold. First, prerelease versions +frequently are updated very quickly, and contain many breaking changes +that are (by the author's design) not yet fit for public consumption. +Therefore, by default, they are excluded from range matching +semantics. + +Second, a user who has opted into using a prerelease version has +clearly indicated the intent to use *that specific* set of +alpha/beta/rc versions. By including a prerelease tag in the range, +the user is indicating that they are aware of the risk. However, it +is still not appropriate to assume that they have opted into taking a +similar risk on the *next* set of prerelease versions. + +Note that this behavior can be suppressed (treating all prerelease +versions as if they were normal versions, for the purpose of range +matching) by setting the `includePrerelease` flag on the options +object to any +[functions](https://github.com/npm/node-semver#functions) that do +range matching. + +#### Prerelease Identifiers + +The method `.inc` takes an additional `identifier` string argument that +will append the value of the string as a prerelease identifier: + +```javascript +semver.inc('1.2.3', 'prerelease', 'beta') +// '1.2.4-beta.0' +``` + +command-line example: + +```bash +$ semver 1.2.3 -i prerelease --preid beta +1.2.4-beta.0 +``` + +Which then can be used to increment further: + +```bash +$ semver 1.2.4-beta.0 -i prerelease +1.2.4-beta.1 +``` + +### Advanced Range Syntax + +Advanced range syntax desugars to primitive comparators in +deterministic ways. + +Advanced ranges may be combined in the same way as primitive +comparators using white space or `||`. + +#### Hyphen Ranges `X.Y.Z - A.B.C` + +Specifies an inclusive set. + +* `1.2.3 - 2.3.4` := `>=1.2.3 <=2.3.4` + +If a partial version is provided as the first version in the inclusive +range, then the missing pieces are replaced with zeroes. + +* `1.2 - 2.3.4` := `>=1.2.0 <=2.3.4` + +If a partial version is provided as the second version in the +inclusive range, then all versions that start with the supplied parts +of the tuple are accepted, but nothing that would be greater than the +provided tuple parts. + +* `1.2.3 - 2.3` := `>=1.2.3 <2.4.0-0` +* `1.2.3 - 2` := `>=1.2.3 <3.0.0-0` + +#### X-Ranges `1.2.x` `1.X` `1.2.*` `*` + +Any of `X`, `x`, or `*` may be used to "stand in" for one of the +numeric values in the `[major, minor, patch]` tuple. + +* `*` := `>=0.0.0` (Any version satisfies) +* `1.x` := `>=1.0.0 <2.0.0-0` (Matching major version) +* `1.2.x` := `>=1.2.0 <1.3.0-0` (Matching major and minor versions) + +A partial version range is treated as an X-Range, so the special +character is in fact optional. + +* `""` (empty string) := `*` := `>=0.0.0` +* `1` := `1.x.x` := `>=1.0.0 <2.0.0-0` +* `1.2` := `1.2.x` := `>=1.2.0 <1.3.0-0` + +#### Tilde Ranges `~1.2.3` `~1.2` `~1` + +Allows patch-level changes if a minor version is specified on the +comparator. Allows minor-level changes if not. + +* `~1.2.3` := `>=1.2.3 <1.(2+1).0` := `>=1.2.3 <1.3.0-0` +* `~1.2` := `>=1.2.0 <1.(2+1).0` := `>=1.2.0 <1.3.0-0` (Same as `1.2.x`) +* `~1` := `>=1.0.0 <(1+1).0.0` := `>=1.0.0 <2.0.0-0` (Same as `1.x`) +* `~0.2.3` := `>=0.2.3 <0.(2+1).0` := `>=0.2.3 <0.3.0-0` +* `~0.2` := `>=0.2.0 <0.(2+1).0` := `>=0.2.0 <0.3.0-0` (Same as `0.2.x`) +* `~0` := `>=0.0.0 <(0+1).0.0` := `>=0.0.0 <1.0.0-0` (Same as `0.x`) +* `~1.2.3-beta.2` := `>=1.2.3-beta.2 <1.3.0-0` Note that prereleases in + the `1.2.3` version will be allowed, if they are greater than or + equal to `beta.2`. So, `1.2.3-beta.4` would be allowed, but + `1.2.4-beta.2` would not, because it is a prerelease of a + different `[major, minor, patch]` tuple. + +#### Caret Ranges `^1.2.3` `^0.2.5` `^0.0.4` + +Allows changes that do not modify the left-most non-zero element in the +`[major, minor, patch]` tuple. In other words, this allows patch and +minor updates for versions `1.0.0` and above, patch updates for +versions `0.X >=0.1.0`, and *no* updates for versions `0.0.X`. + +Many authors treat a `0.x` version as if the `x` were the major +"breaking-change" indicator. + +Caret ranges are ideal when an author may make breaking changes +between `0.2.4` and `0.3.0` releases, which is a common practice. +However, it presumes that there will *not* be breaking changes between +`0.2.4` and `0.2.5`. It allows for changes that are presumed to be +additive (but non-breaking), according to commonly observed practices. + +* `^1.2.3` := `>=1.2.3 <2.0.0-0` +* `^0.2.3` := `>=0.2.3 <0.3.0-0` +* `^0.0.3` := `>=0.0.3 <0.0.4-0` +* `^1.2.3-beta.2` := `>=1.2.3-beta.2 <2.0.0-0` Note that prereleases in + the `1.2.3` version will be allowed, if they are greater than or + equal to `beta.2`. So, `1.2.3-beta.4` would be allowed, but + `1.2.4-beta.2` would not, because it is a prerelease of a + different `[major, minor, patch]` tuple. +* `^0.0.3-beta` := `>=0.0.3-beta <0.0.4-0` Note that prereleases in the + `0.0.3` version *only* will be allowed, if they are greater than or + equal to `beta`. So, `0.0.3-pr.2` would be allowed. + +When parsing caret ranges, a missing `patch` value desugars to the +number `0`, but will allow flexibility within that value, even if the +major and minor versions are both `0`. + +* `^1.2.x` := `>=1.2.0 <2.0.0-0` +* `^0.0.x` := `>=0.0.0 <0.1.0-0` +* `^0.0` := `>=0.0.0 <0.1.0-0` + +A missing `minor` and `patch` values will desugar to zero, but also +allow flexibility within those values, even if the major version is +zero. + +* `^1.x` := `>=1.0.0 <2.0.0-0` +* `^0.x` := `>=0.0.0 <1.0.0-0` + +### Range Grammar + +Putting all this together, here is a Backus-Naur grammar for ranges, +for the benefit of parser authors: + +```bnf +range-set ::= range ( logical-or range ) * +logical-or ::= ( ' ' ) * '||' ( ' ' ) * +range ::= hyphen | simple ( ' ' simple ) * | '' +hyphen ::= partial ' - ' partial +simple ::= primitive | partial | tilde | caret +primitive ::= ( '<' | '>' | '>=' | '<=' | '=' ) partial +partial ::= xr ( '.' xr ( '.' xr qualifier ? )? )? +xr ::= 'x' | 'X' | '*' | nr +nr ::= '0' | ['1'-'9'] ( ['0'-'9'] ) * +tilde ::= '~' partial +caret ::= '^' partial +qualifier ::= ( '-' pre )? ( '+' build )? +pre ::= parts +build ::= parts +parts ::= part ( '.' part ) * +part ::= nr | [-0-9A-Za-z]+ +``` + +## Functions + +All methods and classes take a final `options` object argument. All +options in this object are `false` by default. The options supported +are: + +- `loose` Be more forgiving about not-quite-valid semver strings. + (Any resulting output will always be 100% strict compliant, of + course.) For backwards compatibility reasons, if the `options` + argument is a boolean value instead of an object, it is interpreted + to be the `loose` param. +- `includePrerelease` Set to suppress the [default + behavior](https://github.com/npm/node-semver#prerelease-tags) of + excluding prerelease tagged versions from ranges unless they are + explicitly opted into. + +Strict-mode Comparators and Ranges will be strict about the SemVer +strings that they parse. + +* `valid(v)`: Return the parsed version, or null if it's not valid. +* `inc(v, release)`: Return the version incremented by the release + type (`major`, `premajor`, `minor`, `preminor`, `patch`, + `prepatch`, or `prerelease`), or null if it's not valid + * `premajor` in one call will bump the version up to the next major + version and down to a prerelease of that major version. + `preminor`, and `prepatch` work the same way. + * If called from a non-prerelease version, the `prerelease` will work the + same as `prepatch`. It increments the patch version, then makes a + prerelease. If the input version is already a prerelease it simply + increments it. +* `prerelease(v)`: Returns an array of prerelease components, or null + if none exist. Example: `prerelease('1.2.3-alpha.1') -> ['alpha', 1]` +* `major(v)`: Return the major version number. +* `minor(v)`: Return the minor version number. +* `patch(v)`: Return the patch version number. +* `intersects(r1, r2, loose)`: Return true if the two supplied ranges + or comparators intersect. +* `parse(v)`: Attempt to parse a string as a semantic version, returning either + a `SemVer` object or `null`. + +### Comparison + +* `gt(v1, v2)`: `v1 > v2` +* `gte(v1, v2)`: `v1 >= v2` +* `lt(v1, v2)`: `v1 < v2` +* `lte(v1, v2)`: `v1 <= v2` +* `eq(v1, v2)`: `v1 == v2` This is true if they're logically equivalent, + even if they're not the exact same string. You already know how to + compare strings. +* `neq(v1, v2)`: `v1 != v2` The opposite of `eq`. +* `cmp(v1, comparator, v2)`: Pass in a comparison string, and it'll call + the corresponding function above. `"==="` and `"!=="` do simple + string comparison, but are included for completeness. Throws if an + invalid comparison string is provided. +* `compare(v1, v2)`: Return `0` if `v1 == v2`, or `1` if `v1` is greater, or `-1` if + `v2` is greater. Sorts in ascending order if passed to `Array.sort()`. +* `rcompare(v1, v2)`: The reverse of compare. Sorts an array of versions + in descending order when passed to `Array.sort()`. +* `compareBuild(v1, v2)`: The same as `compare` but considers `build` when two versions + are equal. Sorts in ascending order if passed to `Array.sort()`. + `v2` is greater. Sorts in ascending order if passed to `Array.sort()`. +* `diff(v1, v2)`: Returns difference between two versions by the release type + (`major`, `premajor`, `minor`, `preminor`, `patch`, `prepatch`, or `prerelease`), + or null if the versions are the same. + +### Comparators + +* `intersects(comparator)`: Return true if the comparators intersect + +### Ranges + +* `validRange(range)`: Return the valid range or null if it's not valid +* `satisfies(version, range)`: Return true if the version satisfies the + range. +* `maxSatisfying(versions, range)`: Return the highest version in the list + that satisfies the range, or `null` if none of them do. +* `minSatisfying(versions, range)`: Return the lowest version in the list + that satisfies the range, or `null` if none of them do. +* `minVersion(range)`: Return the lowest version that can possibly match + the given range. +* `gtr(version, range)`: Return `true` if version is greater than all the + versions possible in the range. +* `ltr(version, range)`: Return `true` if version is less than all the + versions possible in the range. +* `outside(version, range, hilo)`: Return true if the version is outside + the bounds of the range in either the high or low direction. The + `hilo` argument must be either the string `'>'` or `'<'`. (This is + the function called by `gtr` and `ltr`.) +* `intersects(range)`: Return true if any of the ranges comparators intersect +* `simplifyRange(versions, range)`: Return a "simplified" range that + matches the same items in `versions` list as the range specified. Note + that it does *not* guarantee that it would match the same versions in all + cases, only for the set of versions provided. This is useful when + generating ranges by joining together multiple versions with `||` + programmatically, to provide the user with something a bit more + ergonomic. If the provided range is shorter in string-length than the + generated range, then that is returned. +* `subset(subRange, superRange)`: Return `true` if the `subRange` range is + entirely contained by the `superRange` range. + +Note that, since ranges may be non-contiguous, a version might not be +greater than a range, less than a range, *or* satisfy a range! For +example, the range `1.2 <1.2.9 || >2.0.0` would have a hole from `1.2.9` +until `2.0.0`, so the version `1.2.10` would not be greater than the +range (because `2.0.1` satisfies, which is higher), nor less than the +range (since `1.2.8` satisfies, which is lower), and it also does not +satisfy the range. + +If you want to know if a version satisfies or does not satisfy a +range, use the `satisfies(version, range)` function. + +### Coercion + +* `coerce(version, options)`: Coerces a string to semver if possible + +This aims to provide a very forgiving translation of a non-semver string to +semver. It looks for the first digit in a string, and consumes all +remaining characters which satisfy at least a partial semver (e.g., `1`, +`1.2`, `1.2.3`) up to the max permitted length (256 characters). Longer +versions are simply truncated (`4.6.3.9.2-alpha2` becomes `4.6.3`). All +surrounding text is simply ignored (`v3.4 replaces v3.3.1` becomes +`3.4.0`). Only text which lacks digits will fail coercion (`version one` +is not valid). The maximum length for any semver component considered for +coercion is 16 characters; longer components will be ignored +(`10000000000000000.4.7.4` becomes `4.7.4`). The maximum value for any +semver component is `Number.MAX_SAFE_INTEGER || (2**53 - 1)`; higher value +components are invalid (`9999999999999999.4.7.4` is likely invalid). + +If the `options.rtl` flag is set, then `coerce` will return the right-most +coercible tuple that does not share an ending index with a longer coercible +tuple. For example, `1.2.3.4` will return `2.3.4` in rtl mode, not +`4.0.0`. `1.2.3/4` will return `4.0.0`, because the `4` is not a part of +any other overlapping SemVer tuple. + +### Clean + +* `clean(version)`: Clean a string to be a valid semver if possible + +This will return a cleaned and trimmed semver version. If the provided +version is not valid a null will be returned. This does not work for +ranges. + +ex. +* `s.clean(' = v 2.1.5foo')`: `null` +* `s.clean(' = v 2.1.5foo', { loose: true })`: `'2.1.5-foo'` +* `s.clean(' = v 2.1.5-foo')`: `null` +* `s.clean(' = v 2.1.5-foo', { loose: true })`: `'2.1.5-foo'` +* `s.clean('=v2.1.5')`: `'2.1.5'` +* `s.clean(' =v2.1.5')`: `2.1.5` +* `s.clean(' 2.1.5 ')`: `'2.1.5'` +* `s.clean('~1.0.0')`: `null` + +## Exported Modules + + + +You may pull in just the part of this semver utility that you need, if you +are sensitive to packing and tree-shaking concerns. The main +`require('semver')` export uses getter functions to lazily load the parts +of the API that are used. + +The following modules are available: + +* `require('semver')` +* `require('semver/classes')` +* `require('semver/classes/comparator')` +* `require('semver/classes/range')` +* `require('semver/classes/semver')` +* `require('semver/functions/clean')` +* `require('semver/functions/cmp')` +* `require('semver/functions/coerce')` +* `require('semver/functions/compare')` +* `require('semver/functions/compare-build')` +* `require('semver/functions/compare-loose')` +* `require('semver/functions/diff')` +* `require('semver/functions/eq')` +* `require('semver/functions/gt')` +* `require('semver/functions/gte')` +* `require('semver/functions/inc')` +* `require('semver/functions/lt')` +* `require('semver/functions/lte')` +* `require('semver/functions/major')` +* `require('semver/functions/minor')` +* `require('semver/functions/neq')` +* `require('semver/functions/parse')` +* `require('semver/functions/patch')` +* `require('semver/functions/prerelease')` +* `require('semver/functions/rcompare')` +* `require('semver/functions/rsort')` +* `require('semver/functions/satisfies')` +* `require('semver/functions/sort')` +* `require('semver/functions/valid')` +* `require('semver/ranges/gtr')` +* `require('semver/ranges/intersects')` +* `require('semver/ranges/ltr')` +* `require('semver/ranges/max-satisfying')` +* `require('semver/ranges/min-satisfying')` +* `require('semver/ranges/min-version')` +* `require('semver/ranges/outside')` +* `require('semver/ranges/to-comparators')` +* `require('semver/ranges/valid')` diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/bin/semver.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/bin/semver.js new file mode 100755 index 00000000..73fe2953 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/bin/semver.js @@ -0,0 +1,173 @@ +#!/usr/bin/env node +// Standalone semver comparison program. +// Exits successfully and prints matching version(s) if +// any supplied version is valid and passes all tests. + +const argv = process.argv.slice(2) + +let versions = [] + +const range = [] + +let inc = null + +const version = require('../package.json').version + +let loose = false + +let includePrerelease = false + +let coerce = false + +let rtl = false + +let identifier + +const semver = require('../') + +let reverse = false + +const options = {} + +const main = () => { + if (!argv.length) return help() + while (argv.length) { + let a = argv.shift() + const indexOfEqualSign = a.indexOf('=') + if (indexOfEqualSign !== -1) { + a = a.slice(0, indexOfEqualSign) + argv.unshift(a.slice(indexOfEqualSign + 1)) + } + switch (a) { + case '-rv': case '-rev': case '--rev': case '--reverse': + reverse = true + break + case '-l': case '--loose': + loose = true + break + case '-p': case '--include-prerelease': + includePrerelease = true + break + case '-v': case '--version': + versions.push(argv.shift()) + break + case '-i': case '--inc': case '--increment': + switch (argv[0]) { + case 'major': case 'minor': case 'patch': case 'prerelease': + case 'premajor': case 'preminor': case 'prepatch': + inc = argv.shift() + break + default: + inc = 'patch' + break + } + break + case '--preid': + identifier = argv.shift() + break + case '-r': case '--range': + range.push(argv.shift()) + break + case '-c': case '--coerce': + coerce = true + break + case '--rtl': + rtl = true + break + case '--ltr': + rtl = false + break + case '-h': case '--help': case '-?': + return help() + default: + versions.push(a) + break + } + } + + const options = { loose: loose, includePrerelease: includePrerelease, rtl: rtl } + + versions = versions.map((v) => { + return coerce ? (semver.coerce(v, options) || { version: v }).version : v + }).filter((v) => { + return semver.valid(v) + }) + if (!versions.length) return fail() + if (inc && (versions.length !== 1 || range.length)) { return failInc() } + + for (let i = 0, l = range.length; i < l; i++) { + versions = versions.filter((v) => { + return semver.satisfies(v, range[i], options) + }) + if (!versions.length) return fail() + } + return success(versions) +} + + +const failInc = () => { + console.error('--inc can only be used on a single version with no range') + fail() +} + +const fail = () => process.exit(1) + +const success = () => { + const compare = reverse ? 'rcompare' : 'compare' + versions.sort((a, b) => { + return semver[compare](a, b, options) + }).map((v) => { + return semver.clean(v, options) + }).map((v) => { + return inc ? semver.inc(v, inc, options, identifier) : v + }).forEach((v, i, _) => { console.log(v) }) +} + +const help = () => console.log( +`SemVer ${version} + +A JavaScript implementation of the https://semver.org/ specification +Copyright Isaac Z. Schlueter + +Usage: semver [options] [ [...]] +Prints valid versions sorted by SemVer precedence + +Options: +-r --range + Print versions that match the specified range. + +-i --increment [] + Increment a version by the specified level. Level can + be one of: major, minor, patch, premajor, preminor, + prepatch, or prerelease. Default level is 'patch'. + Only one version may be specified. + +--preid + Identifier to be used to prefix premajor, preminor, + prepatch or prerelease version increments. + +-l --loose + Interpret versions and ranges loosely + +-p --include-prerelease + Always include prerelease versions in range matching + +-c --coerce + Coerce a string into SemVer if possible + (does not imply --loose) + +--rtl + Coerce version strings right to left + +--ltr + Coerce version strings left to right (default) + +Program exits successfully if any valid version satisfies +all supplied ranges, and prints all satisfying versions. + +If no satisfying versions are found, then exits failure. + +Versions are printed in ascending order, so supplying +multiple versions to the utility will just sort them.`) + +main() diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/comparator.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/comparator.js new file mode 100644 index 00000000..dbbef2d8 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/comparator.js @@ -0,0 +1,135 @@ +const ANY = Symbol('SemVer ANY') +// hoisted class for cyclic dependency +class Comparator { + static get ANY () { + return ANY + } + constructor (comp, options) { + options = parseOptions(options) + + if (comp instanceof Comparator) { + if (comp.loose === !!options.loose) { + return comp + } else { + comp = comp.value + } + } + + debug('comparator', comp, options) + this.options = options + this.loose = !!options.loose + this.parse(comp) + + if (this.semver === ANY) { + this.value = '' + } else { + this.value = this.operator + this.semver.version + } + + debug('comp', this) + } + + parse (comp) { + const r = this.options.loose ? re[t.COMPARATORLOOSE] : re[t.COMPARATOR] + const m = comp.match(r) + + if (!m) { + throw new TypeError(`Invalid comparator: ${comp}`) + } + + this.operator = m[1] !== undefined ? m[1] : '' + if (this.operator === '=') { + this.operator = '' + } + + // if it literally is just '>' or '' then allow anything. + if (!m[2]) { + this.semver = ANY + } else { + this.semver = new SemVer(m[2], this.options.loose) + } + } + + toString () { + return this.value + } + + test (version) { + debug('Comparator.test', version, this.options.loose) + + if (this.semver === ANY || version === ANY) { + return true + } + + if (typeof version === 'string') { + try { + version = new SemVer(version, this.options) + } catch (er) { + return false + } + } + + return cmp(version, this.operator, this.semver, this.options) + } + + intersects (comp, options) { + if (!(comp instanceof Comparator)) { + throw new TypeError('a Comparator is required') + } + + if (!options || typeof options !== 'object') { + options = { + loose: !!options, + includePrerelease: false + } + } + + if (this.operator === '') { + if (this.value === '') { + return true + } + return new Range(comp.value, options).test(this.value) + } else if (comp.operator === '') { + if (comp.value === '') { + return true + } + return new Range(this.value, options).test(comp.semver) + } + + const sameDirectionIncreasing = + (this.operator === '>=' || this.operator === '>') && + (comp.operator === '>=' || comp.operator === '>') + const sameDirectionDecreasing = + (this.operator === '<=' || this.operator === '<') && + (comp.operator === '<=' || comp.operator === '<') + const sameSemVer = this.semver.version === comp.semver.version + const differentDirectionsInclusive = + (this.operator === '>=' || this.operator === '<=') && + (comp.operator === '>=' || comp.operator === '<=') + const oppositeDirectionsLessThan = + cmp(this.semver, '<', comp.semver, options) && + (this.operator === '>=' || this.operator === '>') && + (comp.operator === '<=' || comp.operator === '<') + const oppositeDirectionsGreaterThan = + cmp(this.semver, '>', comp.semver, options) && + (this.operator === '<=' || this.operator === '<') && + (comp.operator === '>=' || comp.operator === '>') + + return ( + sameDirectionIncreasing || + sameDirectionDecreasing || + (sameSemVer && differentDirectionsInclusive) || + oppositeDirectionsLessThan || + oppositeDirectionsGreaterThan + ) + } +} + +module.exports = Comparator + +const parseOptions = require('../internal/parse-options') +const {re, t} = require('../internal/re') +const cmp = require('../functions/cmp') +const debug = require('../internal/debug') +const SemVer = require('./semver') +const Range = require('./range') diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/index.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/index.js new file mode 100644 index 00000000..198b84d6 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/index.js @@ -0,0 +1,5 @@ +module.exports = { + SemVer: require('./semver.js'), + Range: require('./range.js'), + Comparator: require('./comparator.js') +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/range.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/range.js new file mode 100644 index 00000000..aa04f6bf --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/range.js @@ -0,0 +1,510 @@ +// hoisted class for cyclic dependency +class Range { + constructor (range, options) { + options = parseOptions(options) + + if (range instanceof Range) { + if ( + range.loose === !!options.loose && + range.includePrerelease === !!options.includePrerelease + ) { + return range + } else { + return new Range(range.raw, options) + } + } + + if (range instanceof Comparator) { + // just put it in the set and return + this.raw = range.value + this.set = [[range]] + this.format() + return this + } + + this.options = options + this.loose = !!options.loose + this.includePrerelease = !!options.includePrerelease + + // First, split based on boolean or || + this.raw = range + this.set = range + .split(/\s*\|\|\s*/) + // map the range to a 2d array of comparators + .map(range => this.parseRange(range.trim())) + // throw out any comparator lists that are empty + // this generally means that it was not a valid range, which is allowed + // in loose mode, but will still throw if the WHOLE range is invalid. + .filter(c => c.length) + + if (!this.set.length) { + throw new TypeError(`Invalid SemVer Range: ${range}`) + } + + // if we have any that are not the null set, throw out null sets. + if (this.set.length > 1) { + // keep the first one, in case they're all null sets + const first = this.set[0] + this.set = this.set.filter(c => !isNullSet(c[0])) + if (this.set.length === 0) + this.set = [first] + else if (this.set.length > 1) { + // if we have any that are *, then the range is just * + for (const c of this.set) { + if (c.length === 1 && isAny(c[0])) { + this.set = [c] + break + } + } + } + } + + this.format() + } + + format () { + this.range = this.set + .map((comps) => { + return comps.join(' ').trim() + }) + .join('||') + .trim() + return this.range + } + + toString () { + return this.range + } + + parseRange (range) { + range = range.trim() + + // memoize range parsing for performance. + // this is a very hot path, and fully deterministic. + const memoOpts = Object.keys(this.options).join(',') + const memoKey = `parseRange:${memoOpts}:${range}` + const cached = cache.get(memoKey) + if (cached) + return cached + + const loose = this.options.loose + // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` + const hr = loose ? re[t.HYPHENRANGELOOSE] : re[t.HYPHENRANGE] + range = range.replace(hr, hyphenReplace(this.options.includePrerelease)) + debug('hyphen replace', range) + // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` + range = range.replace(re[t.COMPARATORTRIM], comparatorTrimReplace) + debug('comparator trim', range, re[t.COMPARATORTRIM]) + + // `~ 1.2.3` => `~1.2.3` + range = range.replace(re[t.TILDETRIM], tildeTrimReplace) + + // `^ 1.2.3` => `^1.2.3` + range = range.replace(re[t.CARETTRIM], caretTrimReplace) + + // normalize spaces + range = range.split(/\s+/).join(' ') + + // At this point, the range is completely trimmed and + // ready to be split into comparators. + + const compRe = loose ? re[t.COMPARATORLOOSE] : re[t.COMPARATOR] + const rangeList = range + .split(' ') + .map(comp => parseComparator(comp, this.options)) + .join(' ') + .split(/\s+/) + // >=0.0.0 is equivalent to * + .map(comp => replaceGTE0(comp, this.options)) + // in loose mode, throw out any that are not valid comparators + .filter(this.options.loose ? comp => !!comp.match(compRe) : () => true) + .map(comp => new Comparator(comp, this.options)) + + // if any comparators are the null set, then replace with JUST null set + // if more than one comparator, remove any * comparators + // also, don't include the same comparator more than once + const l = rangeList.length + const rangeMap = new Map() + for (const comp of rangeList) { + if (isNullSet(comp)) + return [comp] + rangeMap.set(comp.value, comp) + } + if (rangeMap.size > 1 && rangeMap.has('')) + rangeMap.delete('') + + const result = [...rangeMap.values()] + cache.set(memoKey, result) + return result + } + + intersects (range, options) { + if (!(range instanceof Range)) { + throw new TypeError('a Range is required') + } + + return this.set.some((thisComparators) => { + return ( + isSatisfiable(thisComparators, options) && + range.set.some((rangeComparators) => { + return ( + isSatisfiable(rangeComparators, options) && + thisComparators.every((thisComparator) => { + return rangeComparators.every((rangeComparator) => { + return thisComparator.intersects(rangeComparator, options) + }) + }) + ) + }) + ) + }) + } + + // if ANY of the sets match ALL of its comparators, then pass + test (version) { + if (!version) { + return false + } + + if (typeof version === 'string') { + try { + version = new SemVer(version, this.options) + } catch (er) { + return false + } + } + + for (let i = 0; i < this.set.length; i++) { + if (testSet(this.set[i], version, this.options)) { + return true + } + } + return false + } +} +module.exports = Range + +const LRU = require('lru-cache') +const cache = new LRU({ max: 1000 }) + +const parseOptions = require('../internal/parse-options') +const Comparator = require('./comparator') +const debug = require('../internal/debug') +const SemVer = require('./semver') +const { + re, + t, + comparatorTrimReplace, + tildeTrimReplace, + caretTrimReplace +} = require('../internal/re') + +const isNullSet = c => c.value === '<0.0.0-0' +const isAny = c => c.value === '' + +// take a set of comparators and determine whether there +// exists a version which can satisfy it +const isSatisfiable = (comparators, options) => { + let result = true + const remainingComparators = comparators.slice() + let testComparator = remainingComparators.pop() + + while (result && remainingComparators.length) { + result = remainingComparators.every((otherComparator) => { + return testComparator.intersects(otherComparator, options) + }) + + testComparator = remainingComparators.pop() + } + + return result +} + +// comprised of xranges, tildes, stars, and gtlt's at this point. +// already replaced the hyphen ranges +// turn into a set of JUST comparators. +const parseComparator = (comp, options) => { + debug('comp', comp, options) + comp = replaceCarets(comp, options) + debug('caret', comp) + comp = replaceTildes(comp, options) + debug('tildes', comp) + comp = replaceXRanges(comp, options) + debug('xrange', comp) + comp = replaceStars(comp, options) + debug('stars', comp) + return comp +} + +const isX = id => !id || id.toLowerCase() === 'x' || id === '*' + +// ~, ~> --> * (any, kinda silly) +// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0-0 +// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0-0 +// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0-0 +// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0-0 +// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0-0 +const replaceTildes = (comp, options) => + comp.trim().split(/\s+/).map((comp) => { + return replaceTilde(comp, options) + }).join(' ') + +const replaceTilde = (comp, options) => { + const r = options.loose ? re[t.TILDELOOSE] : re[t.TILDE] + return comp.replace(r, (_, M, m, p, pr) => { + debug('tilde', comp, _, M, m, p, pr) + let ret + + if (isX(M)) { + ret = '' + } else if (isX(m)) { + ret = `>=${M}.0.0 <${+M + 1}.0.0-0` + } else if (isX(p)) { + // ~1.2 == >=1.2.0 <1.3.0-0 + ret = `>=${M}.${m}.0 <${M}.${+m + 1}.0-0` + } else if (pr) { + debug('replaceTilde pr', pr) + ret = `>=${M}.${m}.${p}-${pr + } <${M}.${+m + 1}.0-0` + } else { + // ~1.2.3 == >=1.2.3 <1.3.0-0 + ret = `>=${M}.${m}.${p + } <${M}.${+m + 1}.0-0` + } + + debug('tilde return', ret) + return ret + }) +} + +// ^ --> * (any, kinda silly) +// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0-0 +// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0-0 +// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0-0 +// ^1.2.3 --> >=1.2.3 <2.0.0-0 +// ^1.2.0 --> >=1.2.0 <2.0.0-0 +const replaceCarets = (comp, options) => + comp.trim().split(/\s+/).map((comp) => { + return replaceCaret(comp, options) + }).join(' ') + +const replaceCaret = (comp, options) => { + debug('caret', comp, options) + const r = options.loose ? re[t.CARETLOOSE] : re[t.CARET] + const z = options.includePrerelease ? '-0' : '' + return comp.replace(r, (_, M, m, p, pr) => { + debug('caret', comp, _, M, m, p, pr) + let ret + + if (isX(M)) { + ret = '' + } else if (isX(m)) { + ret = `>=${M}.0.0${z} <${+M + 1}.0.0-0` + } else if (isX(p)) { + if (M === '0') { + ret = `>=${M}.${m}.0${z} <${M}.${+m + 1}.0-0` + } else { + ret = `>=${M}.${m}.0${z} <${+M + 1}.0.0-0` + } + } else if (pr) { + debug('replaceCaret pr', pr) + if (M === '0') { + if (m === '0') { + ret = `>=${M}.${m}.${p}-${pr + } <${M}.${m}.${+p + 1}-0` + } else { + ret = `>=${M}.${m}.${p}-${pr + } <${M}.${+m + 1}.0-0` + } + } else { + ret = `>=${M}.${m}.${p}-${pr + } <${+M + 1}.0.0-0` + } + } else { + debug('no pr') + if (M === '0') { + if (m === '0') { + ret = `>=${M}.${m}.${p + }${z} <${M}.${m}.${+p + 1}-0` + } else { + ret = `>=${M}.${m}.${p + }${z} <${M}.${+m + 1}.0-0` + } + } else { + ret = `>=${M}.${m}.${p + } <${+M + 1}.0.0-0` + } + } + + debug('caret return', ret) + return ret + }) +} + +const replaceXRanges = (comp, options) => { + debug('replaceXRanges', comp, options) + return comp.split(/\s+/).map((comp) => { + return replaceXRange(comp, options) + }).join(' ') +} + +const replaceXRange = (comp, options) => { + comp = comp.trim() + const r = options.loose ? re[t.XRANGELOOSE] : re[t.XRANGE] + return comp.replace(r, (ret, gtlt, M, m, p, pr) => { + debug('xRange', comp, ret, gtlt, M, m, p, pr) + const xM = isX(M) + const xm = xM || isX(m) + const xp = xm || isX(p) + const anyX = xp + + if (gtlt === '=' && anyX) { + gtlt = '' + } + + // if we're including prereleases in the match, then we need + // to fix this to -0, the lowest possible prerelease value + pr = options.includePrerelease ? '-0' : '' + + if (xM) { + if (gtlt === '>' || gtlt === '<') { + // nothing is allowed + ret = '<0.0.0-0' + } else { + // nothing is forbidden + ret = '*' + } + } else if (gtlt && anyX) { + // we know patch is an x, because we have any x at all. + // replace X with 0 + if (xm) { + m = 0 + } + p = 0 + + if (gtlt === '>') { + // >1 => >=2.0.0 + // >1.2 => >=1.3.0 + gtlt = '>=' + if (xm) { + M = +M + 1 + m = 0 + p = 0 + } else { + m = +m + 1 + p = 0 + } + } else if (gtlt === '<=') { + // <=0.7.x is actually <0.8.0, since any 0.7.x should + // pass. Similarly, <=7.x is actually <8.0.0, etc. + gtlt = '<' + if (xm) { + M = +M + 1 + } else { + m = +m + 1 + } + } + + if (gtlt === '<') + pr = '-0' + + ret = `${gtlt + M}.${m}.${p}${pr}` + } else if (xm) { + ret = `>=${M}.0.0${pr} <${+M + 1}.0.0-0` + } else if (xp) { + ret = `>=${M}.${m}.0${pr + } <${M}.${+m + 1}.0-0` + } + + debug('xRange return', ret) + + return ret + }) +} + +// Because * is AND-ed with everything else in the comparator, +// and '' means "any version", just remove the *s entirely. +const replaceStars = (comp, options) => { + debug('replaceStars', comp, options) + // Looseness is ignored here. star is always as loose as it gets! + return comp.trim().replace(re[t.STAR], '') +} + +const replaceGTE0 = (comp, options) => { + debug('replaceGTE0', comp, options) + return comp.trim() + .replace(re[options.includePrerelease ? t.GTE0PRE : t.GTE0], '') +} + +// This function is passed to string.replace(re[t.HYPHENRANGE]) +// M, m, patch, prerelease, build +// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 +// 1.2.3 - 3.4 => >=1.2.0 <3.5.0-0 Any 3.4.x will do +// 1.2 - 3.4 => >=1.2.0 <3.5.0-0 +const hyphenReplace = incPr => ($0, + from, fM, fm, fp, fpr, fb, + to, tM, tm, tp, tpr, tb) => { + if (isX(fM)) { + from = '' + } else if (isX(fm)) { + from = `>=${fM}.0.0${incPr ? '-0' : ''}` + } else if (isX(fp)) { + from = `>=${fM}.${fm}.0${incPr ? '-0' : ''}` + } else if (fpr) { + from = `>=${from}` + } else { + from = `>=${from}${incPr ? '-0' : ''}` + } + + if (isX(tM)) { + to = '' + } else if (isX(tm)) { + to = `<${+tM + 1}.0.0-0` + } else if (isX(tp)) { + to = `<${tM}.${+tm + 1}.0-0` + } else if (tpr) { + to = `<=${tM}.${tm}.${tp}-${tpr}` + } else if (incPr) { + to = `<${tM}.${tm}.${+tp + 1}-0` + } else { + to = `<=${to}` + } + + return (`${from} ${to}`).trim() +} + +const testSet = (set, version, options) => { + for (let i = 0; i < set.length; i++) { + if (!set[i].test(version)) { + return false + } + } + + if (version.prerelease.length && !options.includePrerelease) { + // Find the set of versions that are allowed to have prereleases + // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 + // That should allow `1.2.3-pr.2` to pass. + // However, `1.2.4-alpha.notready` should NOT be allowed, + // even though it's within the range set by the comparators. + for (let i = 0; i < set.length; i++) { + debug(set[i].semver) + if (set[i].semver === Comparator.ANY) { + continue + } + + if (set[i].semver.prerelease.length > 0) { + const allowed = set[i].semver + if (allowed.major === version.major && + allowed.minor === version.minor && + allowed.patch === version.patch) { + return true + } + } + } + + // Version has a -pre, but it's not one of the ones we like. + return false + } + + return true +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/semver.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/semver.js new file mode 100644 index 00000000..ed81a7ec --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/classes/semver.js @@ -0,0 +1,287 @@ +const debug = require('../internal/debug') +const { MAX_LENGTH, MAX_SAFE_INTEGER } = require('../internal/constants') +const { re, t } = require('../internal/re') + +const parseOptions = require('../internal/parse-options') +const { compareIdentifiers } = require('../internal/identifiers') +class SemVer { + constructor (version, options) { + options = parseOptions(options) + + if (version instanceof SemVer) { + if (version.loose === !!options.loose && + version.includePrerelease === !!options.includePrerelease) { + return version + } else { + version = version.version + } + } else if (typeof version !== 'string') { + throw new TypeError(`Invalid Version: ${version}`) + } + + if (version.length > MAX_LENGTH) { + throw new TypeError( + `version is longer than ${MAX_LENGTH} characters` + ) + } + + debug('SemVer', version, options) + this.options = options + this.loose = !!options.loose + // this isn't actually relevant for versions, but keep it so that we + // don't run into trouble passing this.options around. + this.includePrerelease = !!options.includePrerelease + + const m = version.trim().match(options.loose ? re[t.LOOSE] : re[t.FULL]) + + if (!m) { + throw new TypeError(`Invalid Version: ${version}`) + } + + this.raw = version + + // these are actually numbers + this.major = +m[1] + this.minor = +m[2] + this.patch = +m[3] + + if (this.major > MAX_SAFE_INTEGER || this.major < 0) { + throw new TypeError('Invalid major version') + } + + if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) { + throw new TypeError('Invalid minor version') + } + + if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) { + throw new TypeError('Invalid patch version') + } + + // numberify any prerelease numeric ids + if (!m[4]) { + this.prerelease = [] + } else { + this.prerelease = m[4].split('.').map((id) => { + if (/^[0-9]+$/.test(id)) { + const num = +id + if (num >= 0 && num < MAX_SAFE_INTEGER) { + return num + } + } + return id + }) + } + + this.build = m[5] ? m[5].split('.') : [] + this.format() + } + + format () { + this.version = `${this.major}.${this.minor}.${this.patch}` + if (this.prerelease.length) { + this.version += `-${this.prerelease.join('.')}` + } + return this.version + } + + toString () { + return this.version + } + + compare (other) { + debug('SemVer.compare', this.version, this.options, other) + if (!(other instanceof SemVer)) { + if (typeof other === 'string' && other === this.version) { + return 0 + } + other = new SemVer(other, this.options) + } + + if (other.version === this.version) { + return 0 + } + + return this.compareMain(other) || this.comparePre(other) + } + + compareMain (other) { + if (!(other instanceof SemVer)) { + other = new SemVer(other, this.options) + } + + return ( + compareIdentifiers(this.major, other.major) || + compareIdentifiers(this.minor, other.minor) || + compareIdentifiers(this.patch, other.patch) + ) + } + + comparePre (other) { + if (!(other instanceof SemVer)) { + other = new SemVer(other, this.options) + } + + // NOT having a prerelease is > having one + if (this.prerelease.length && !other.prerelease.length) { + return -1 + } else if (!this.prerelease.length && other.prerelease.length) { + return 1 + } else if (!this.prerelease.length && !other.prerelease.length) { + return 0 + } + + let i = 0 + do { + const a = this.prerelease[i] + const b = other.prerelease[i] + debug('prerelease compare', i, a, b) + if (a === undefined && b === undefined) { + return 0 + } else if (b === undefined) { + return 1 + } else if (a === undefined) { + return -1 + } else if (a === b) { + continue + } else { + return compareIdentifiers(a, b) + } + } while (++i) + } + + compareBuild (other) { + if (!(other instanceof SemVer)) { + other = new SemVer(other, this.options) + } + + let i = 0 + do { + const a = this.build[i] + const b = other.build[i] + debug('prerelease compare', i, a, b) + if (a === undefined && b === undefined) { + return 0 + } else if (b === undefined) { + return 1 + } else if (a === undefined) { + return -1 + } else if (a === b) { + continue + } else { + return compareIdentifiers(a, b) + } + } while (++i) + } + + // preminor will bump the version up to the next minor release, and immediately + // down to pre-release. premajor and prepatch work the same way. + inc (release, identifier) { + switch (release) { + case 'premajor': + this.prerelease.length = 0 + this.patch = 0 + this.minor = 0 + this.major++ + this.inc('pre', identifier) + break + case 'preminor': + this.prerelease.length = 0 + this.patch = 0 + this.minor++ + this.inc('pre', identifier) + break + case 'prepatch': + // If this is already a prerelease, it will bump to the next version + // drop any prereleases that might already exist, since they are not + // relevant at this point. + this.prerelease.length = 0 + this.inc('patch', identifier) + this.inc('pre', identifier) + break + // If the input is a non-prerelease version, this acts the same as + // prepatch. + case 'prerelease': + if (this.prerelease.length === 0) { + this.inc('patch', identifier) + } + this.inc('pre', identifier) + break + + case 'major': + // If this is a pre-major version, bump up to the same major version. + // Otherwise increment major. + // 1.0.0-5 bumps to 1.0.0 + // 1.1.0 bumps to 2.0.0 + if ( + this.minor !== 0 || + this.patch !== 0 || + this.prerelease.length === 0 + ) { + this.major++ + } + this.minor = 0 + this.patch = 0 + this.prerelease = [] + break + case 'minor': + // If this is a pre-minor version, bump up to the same minor version. + // Otherwise increment minor. + // 1.2.0-5 bumps to 1.2.0 + // 1.2.1 bumps to 1.3.0 + if (this.patch !== 0 || this.prerelease.length === 0) { + this.minor++ + } + this.patch = 0 + this.prerelease = [] + break + case 'patch': + // If this is not a pre-release version, it will increment the patch. + // If it is a pre-release it will bump up to the same patch version. + // 1.2.0-5 patches to 1.2.0 + // 1.2.0 patches to 1.2.1 + if (this.prerelease.length === 0) { + this.patch++ + } + this.prerelease = [] + break + // This probably shouldn't be used publicly. + // 1.0.0 'pre' would become 1.0.0-0 which is the wrong direction. + case 'pre': + if (this.prerelease.length === 0) { + this.prerelease = [0] + } else { + let i = this.prerelease.length + while (--i >= 0) { + if (typeof this.prerelease[i] === 'number') { + this.prerelease[i]++ + i = -2 + } + } + if (i === -1) { + // didn't increment anything + this.prerelease.push(0) + } + } + if (identifier) { + // 1.2.0-beta.1 bumps to 1.2.0-beta.2, + // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 + if (this.prerelease[0] === identifier) { + if (isNaN(this.prerelease[1])) { + this.prerelease = [identifier, 0] + } + } else { + this.prerelease = [identifier, 0] + } + } + break + + default: + throw new Error(`invalid increment argument: ${release}`) + } + this.format() + this.raw = this.version + return this + } +} + +module.exports = SemVer diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/clean.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/clean.js new file mode 100644 index 00000000..811fe6b8 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/clean.js @@ -0,0 +1,6 @@ +const parse = require('./parse') +const clean = (version, options) => { + const s = parse(version.trim().replace(/^[=v]+/, ''), options) + return s ? s.version : null +} +module.exports = clean diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/cmp.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/cmp.js new file mode 100644 index 00000000..3b89db77 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/cmp.js @@ -0,0 +1,48 @@ +const eq = require('./eq') +const neq = require('./neq') +const gt = require('./gt') +const gte = require('./gte') +const lt = require('./lt') +const lte = require('./lte') + +const cmp = (a, op, b, loose) => { + switch (op) { + case '===': + if (typeof a === 'object') + a = a.version + if (typeof b === 'object') + b = b.version + return a === b + + case '!==': + if (typeof a === 'object') + a = a.version + if (typeof b === 'object') + b = b.version + return a !== b + + case '': + case '=': + case '==': + return eq(a, b, loose) + + case '!=': + return neq(a, b, loose) + + case '>': + return gt(a, b, loose) + + case '>=': + return gte(a, b, loose) + + case '<': + return lt(a, b, loose) + + case '<=': + return lte(a, b, loose) + + default: + throw new TypeError(`Invalid operator: ${op}`) + } +} +module.exports = cmp diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/coerce.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/coerce.js new file mode 100644 index 00000000..106ca71c --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/coerce.js @@ -0,0 +1,51 @@ +const SemVer = require('../classes/semver') +const parse = require('./parse') +const {re, t} = require('../internal/re') + +const coerce = (version, options) => { + if (version instanceof SemVer) { + return version + } + + if (typeof version === 'number') { + version = String(version) + } + + if (typeof version !== 'string') { + return null + } + + options = options || {} + + let match = null + if (!options.rtl) { + match = version.match(re[t.COERCE]) + } else { + // Find the right-most coercible string that does not share + // a terminus with a more left-ward coercible string. + // Eg, '1.2.3.4' wants to coerce '2.3.4', not '3.4' or '4' + // + // Walk through the string checking with a /g regexp + // Manually set the index so as to pick up overlapping matches. + // Stop when we get a match that ends at the string end, since no + // coercible string can be more right-ward without the same terminus. + let next + while ((next = re[t.COERCERTL].exec(version)) && + (!match || match.index + match[0].length !== version.length) + ) { + if (!match || + next.index + next[0].length !== match.index + match[0].length) { + match = next + } + re[t.COERCERTL].lastIndex = next.index + next[1].length + next[2].length + } + // leave it in a clean state + re[t.COERCERTL].lastIndex = -1 + } + + if (match === null) + return null + + return parse(`${match[2]}.${match[3] || '0'}.${match[4] || '0'}`, options) +} +module.exports = coerce diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-build.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-build.js new file mode 100644 index 00000000..9eb881be --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-build.js @@ -0,0 +1,7 @@ +const SemVer = require('../classes/semver') +const compareBuild = (a, b, loose) => { + const versionA = new SemVer(a, loose) + const versionB = new SemVer(b, loose) + return versionA.compare(versionB) || versionA.compareBuild(versionB) +} +module.exports = compareBuild diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-loose.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-loose.js new file mode 100644 index 00000000..4881fbe0 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare-loose.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const compareLoose = (a, b) => compare(a, b, true) +module.exports = compareLoose diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare.js new file mode 100644 index 00000000..748b7afa --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/compare.js @@ -0,0 +1,5 @@ +const SemVer = require('../classes/semver') +const compare = (a, b, loose) => + new SemVer(a, loose).compare(new SemVer(b, loose)) + +module.exports = compare diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/diff.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/diff.js new file mode 100644 index 00000000..87200ef3 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/diff.js @@ -0,0 +1,23 @@ +const parse = require('./parse') +const eq = require('./eq') + +const diff = (version1, version2) => { + if (eq(version1, version2)) { + return null + } else { + const v1 = parse(version1) + const v2 = parse(version2) + const hasPre = v1.prerelease.length || v2.prerelease.length + const prefix = hasPre ? 'pre' : '' + const defaultResult = hasPre ? 'prerelease' : '' + for (const key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return prefix + key + } + } + } + return defaultResult // may be undefined + } +} +module.exports = diff diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/eq.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/eq.js new file mode 100644 index 00000000..271fed97 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/eq.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const eq = (a, b, loose) => compare(a, b, loose) === 0 +module.exports = eq diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gt.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gt.js new file mode 100644 index 00000000..d9b2156d --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gt.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const gt = (a, b, loose) => compare(a, b, loose) > 0 +module.exports = gt diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gte.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gte.js new file mode 100644 index 00000000..5aeaa634 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/gte.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const gte = (a, b, loose) => compare(a, b, loose) >= 0 +module.exports = gte diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/inc.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/inc.js new file mode 100644 index 00000000..aa4d83ab --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/inc.js @@ -0,0 +1,15 @@ +const SemVer = require('../classes/semver') + +const inc = (version, release, options, identifier) => { + if (typeof (options) === 'string') { + identifier = options + options = undefined + } + + try { + return new SemVer(version, options).inc(release, identifier).version + } catch (er) { + return null + } +} +module.exports = inc diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lt.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lt.js new file mode 100644 index 00000000..b440ab7d --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lt.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const lt = (a, b, loose) => compare(a, b, loose) < 0 +module.exports = lt diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lte.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lte.js new file mode 100644 index 00000000..6dcc9565 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/lte.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const lte = (a, b, loose) => compare(a, b, loose) <= 0 +module.exports = lte diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/major.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/major.js new file mode 100644 index 00000000..4283165e --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/major.js @@ -0,0 +1,3 @@ +const SemVer = require('../classes/semver') +const major = (a, loose) => new SemVer(a, loose).major +module.exports = major diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/minor.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/minor.js new file mode 100644 index 00000000..57b3455f --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/minor.js @@ -0,0 +1,3 @@ +const SemVer = require('../classes/semver') +const minor = (a, loose) => new SemVer(a, loose).minor +module.exports = minor diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/neq.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/neq.js new file mode 100644 index 00000000..f944c015 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/neq.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const neq = (a, b, loose) => compare(a, b, loose) !== 0 +module.exports = neq diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/parse.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/parse.js new file mode 100644 index 00000000..11f20f03 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/parse.js @@ -0,0 +1,33 @@ +const {MAX_LENGTH} = require('../internal/constants') +const { re, t } = require('../internal/re') +const SemVer = require('../classes/semver') + +const parseOptions = require('../internal/parse-options') +const parse = (version, options) => { + options = parseOptions(options) + + if (version instanceof SemVer) { + return version + } + + if (typeof version !== 'string') { + return null + } + + if (version.length > MAX_LENGTH) { + return null + } + + const r = options.loose ? re[t.LOOSE] : re[t.FULL] + if (!r.test(version)) { + return null + } + + try { + return new SemVer(version, options) + } catch (er) { + return null + } +} + +module.exports = parse diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/patch.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/patch.js new file mode 100644 index 00000000..63afca25 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/patch.js @@ -0,0 +1,3 @@ +const SemVer = require('../classes/semver') +const patch = (a, loose) => new SemVer(a, loose).patch +module.exports = patch diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/prerelease.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/prerelease.js new file mode 100644 index 00000000..06aa1324 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/prerelease.js @@ -0,0 +1,6 @@ +const parse = require('./parse') +const prerelease = (version, options) => { + const parsed = parse(version, options) + return (parsed && parsed.prerelease.length) ? parsed.prerelease : null +} +module.exports = prerelease diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rcompare.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rcompare.js new file mode 100644 index 00000000..0ac509e7 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rcompare.js @@ -0,0 +1,3 @@ +const compare = require('./compare') +const rcompare = (a, b, loose) => compare(b, a, loose) +module.exports = rcompare diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rsort.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rsort.js new file mode 100644 index 00000000..82404c5c --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/rsort.js @@ -0,0 +1,3 @@ +const compareBuild = require('./compare-build') +const rsort = (list, loose) => list.sort((a, b) => compareBuild(b, a, loose)) +module.exports = rsort diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/satisfies.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/satisfies.js new file mode 100644 index 00000000..50af1c19 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/satisfies.js @@ -0,0 +1,10 @@ +const Range = require('../classes/range') +const satisfies = (version, range, options) => { + try { + range = new Range(range, options) + } catch (er) { + return false + } + return range.test(version) +} +module.exports = satisfies diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/sort.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/sort.js new file mode 100644 index 00000000..4d10917a --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/sort.js @@ -0,0 +1,3 @@ +const compareBuild = require('./compare-build') +const sort = (list, loose) => list.sort((a, b) => compareBuild(a, b, loose)) +module.exports = sort diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/valid.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/valid.js new file mode 100644 index 00000000..f27bae10 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/functions/valid.js @@ -0,0 +1,6 @@ +const parse = require('./parse') +const valid = (version, options) => { + const v = parse(version, options) + return v ? v.version : null +} +module.exports = valid diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/index.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/index.js new file mode 100644 index 00000000..57e2ae64 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/index.js @@ -0,0 +1,48 @@ +// just pre-load all the stuff that index.js lazily exports +const internalRe = require('./internal/re') +module.exports = { + re: internalRe.re, + src: internalRe.src, + tokens: internalRe.t, + SEMVER_SPEC_VERSION: require('./internal/constants').SEMVER_SPEC_VERSION, + SemVer: require('./classes/semver'), + compareIdentifiers: require('./internal/identifiers').compareIdentifiers, + rcompareIdentifiers: require('./internal/identifiers').rcompareIdentifiers, + parse: require('./functions/parse'), + valid: require('./functions/valid'), + clean: require('./functions/clean'), + inc: require('./functions/inc'), + diff: require('./functions/diff'), + major: require('./functions/major'), + minor: require('./functions/minor'), + patch: require('./functions/patch'), + prerelease: require('./functions/prerelease'), + compare: require('./functions/compare'), + rcompare: require('./functions/rcompare'), + compareLoose: require('./functions/compare-loose'), + compareBuild: require('./functions/compare-build'), + sort: require('./functions/sort'), + rsort: require('./functions/rsort'), + gt: require('./functions/gt'), + lt: require('./functions/lt'), + eq: require('./functions/eq'), + neq: require('./functions/neq'), + gte: require('./functions/gte'), + lte: require('./functions/lte'), + cmp: require('./functions/cmp'), + coerce: require('./functions/coerce'), + Comparator: require('./classes/comparator'), + Range: require('./classes/range'), + satisfies: require('./functions/satisfies'), + toComparators: require('./ranges/to-comparators'), + maxSatisfying: require('./ranges/max-satisfying'), + minSatisfying: require('./ranges/min-satisfying'), + minVersion: require('./ranges/min-version'), + validRange: require('./ranges/valid'), + outside: require('./ranges/outside'), + gtr: require('./ranges/gtr'), + ltr: require('./ranges/ltr'), + intersects: require('./ranges/intersects'), + simplifyRange: require('./ranges/simplify'), + subset: require('./ranges/subset'), +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/constants.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/constants.js new file mode 100644 index 00000000..49df215a --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/constants.js @@ -0,0 +1,17 @@ +// Note: this is the semver.org version of the spec that it implements +// Not necessarily the package version of this code. +const SEMVER_SPEC_VERSION = '2.0.0' + +const MAX_LENGTH = 256 +const MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || + /* istanbul ignore next */ 9007199254740991 + +// Max safe segment length for coercion. +const MAX_SAFE_COMPONENT_LENGTH = 16 + +module.exports = { + SEMVER_SPEC_VERSION, + MAX_LENGTH, + MAX_SAFE_INTEGER, + MAX_SAFE_COMPONENT_LENGTH +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/debug.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/debug.js new file mode 100644 index 00000000..1c00e136 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/debug.js @@ -0,0 +1,9 @@ +const debug = ( + typeof process === 'object' && + process.env && + process.env.NODE_DEBUG && + /\bsemver\b/i.test(process.env.NODE_DEBUG) +) ? (...args) => console.error('SEMVER', ...args) + : () => {} + +module.exports = debug diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/identifiers.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/identifiers.js new file mode 100644 index 00000000..ed130942 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/identifiers.js @@ -0,0 +1,23 @@ +const numeric = /^[0-9]+$/ +const compareIdentifiers = (a, b) => { + const anum = numeric.test(a) + const bnum = numeric.test(b) + + if (anum && bnum) { + a = +a + b = +b + } + + return a === b ? 0 + : (anum && !bnum) ? -1 + : (bnum && !anum) ? 1 + : a < b ? -1 + : 1 +} + +const rcompareIdentifiers = (a, b) => compareIdentifiers(b, a) + +module.exports = { + compareIdentifiers, + rcompareIdentifiers +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/parse-options.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/parse-options.js new file mode 100644 index 00000000..42d2ebd6 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/parse-options.js @@ -0,0 +1,11 @@ +// parse out just the options we care about so we always get a consistent +// obj with keys in a consistent order. +const opts = ['includePrerelease', 'loose', 'rtl'] +const parseOptions = options => + !options ? {} + : typeof options !== 'object' ? { loose: true } + : opts.filter(k => options[k]).reduce((options, k) => { + options[k] = true + return options + }, {}) +module.exports = parseOptions diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/re.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/re.js new file mode 100644 index 00000000..54d4176d --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/internal/re.js @@ -0,0 +1,182 @@ +const { MAX_SAFE_COMPONENT_LENGTH } = require('./constants') +const debug = require('./debug') +exports = module.exports = {} + +// The actual regexps go on exports.re +const re = exports.re = [] +const src = exports.src = [] +const t = exports.t = {} +let R = 0 + +const createToken = (name, value, isGlobal) => { + const index = R++ + debug(index, value) + t[name] = index + src[index] = value + re[index] = new RegExp(value, isGlobal ? 'g' : undefined) +} + +// The following Regular Expressions can be used for tokenizing, +// validating, and parsing SemVer version strings. + +// ## Numeric Identifier +// A single `0`, or a non-zero digit followed by zero or more digits. + +createToken('NUMERICIDENTIFIER', '0|[1-9]\\d*') +createToken('NUMERICIDENTIFIERLOOSE', '[0-9]+') + +// ## Non-numeric Identifier +// Zero or more digits, followed by a letter or hyphen, and then zero or +// more letters, digits, or hyphens. + +createToken('NONNUMERICIDENTIFIER', '\\d*[a-zA-Z-][a-zA-Z0-9-]*') + +// ## Main Version +// Three dot-separated numeric identifiers. + +createToken('MAINVERSION', `(${src[t.NUMERICIDENTIFIER]})\\.` + + `(${src[t.NUMERICIDENTIFIER]})\\.` + + `(${src[t.NUMERICIDENTIFIER]})`) + +createToken('MAINVERSIONLOOSE', `(${src[t.NUMERICIDENTIFIERLOOSE]})\\.` + + `(${src[t.NUMERICIDENTIFIERLOOSE]})\\.` + + `(${src[t.NUMERICIDENTIFIERLOOSE]})`) + +// ## Pre-release Version Identifier +// A numeric identifier, or a non-numeric identifier. + +createToken('PRERELEASEIDENTIFIER', `(?:${src[t.NUMERICIDENTIFIER] +}|${src[t.NONNUMERICIDENTIFIER]})`) + +createToken('PRERELEASEIDENTIFIERLOOSE', `(?:${src[t.NUMERICIDENTIFIERLOOSE] +}|${src[t.NONNUMERICIDENTIFIER]})`) + +// ## Pre-release Version +// Hyphen, followed by one or more dot-separated pre-release version +// identifiers. + +createToken('PRERELEASE', `(?:-(${src[t.PRERELEASEIDENTIFIER] +}(?:\\.${src[t.PRERELEASEIDENTIFIER]})*))`) + +createToken('PRERELEASELOOSE', `(?:-?(${src[t.PRERELEASEIDENTIFIERLOOSE] +}(?:\\.${src[t.PRERELEASEIDENTIFIERLOOSE]})*))`) + +// ## Build Metadata Identifier +// Any combination of digits, letters, or hyphens. + +createToken('BUILDIDENTIFIER', '[0-9A-Za-z-]+') + +// ## Build Metadata +// Plus sign, followed by one or more period-separated build metadata +// identifiers. + +createToken('BUILD', `(?:\\+(${src[t.BUILDIDENTIFIER] +}(?:\\.${src[t.BUILDIDENTIFIER]})*))`) + +// ## Full Version String +// A main version, followed optionally by a pre-release version and +// build metadata. + +// Note that the only major, minor, patch, and pre-release sections of +// the version string are capturing groups. The build metadata is not a +// capturing group, because it should not ever be used in version +// comparison. + +createToken('FULLPLAIN', `v?${src[t.MAINVERSION] +}${src[t.PRERELEASE]}?${ + src[t.BUILD]}?`) + +createToken('FULL', `^${src[t.FULLPLAIN]}$`) + +// like full, but allows v1.2.3 and =1.2.3, which people do sometimes. +// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty +// common in the npm registry. +createToken('LOOSEPLAIN', `[v=\\s]*${src[t.MAINVERSIONLOOSE] +}${src[t.PRERELEASELOOSE]}?${ + src[t.BUILD]}?`) + +createToken('LOOSE', `^${src[t.LOOSEPLAIN]}$`) + +createToken('GTLT', '((?:<|>)?=?)') + +// Something like "2.*" or "1.2.x". +// Note that "x.x" is a valid xRange identifer, meaning "any version" +// Only the first item is strictly required. +createToken('XRANGEIDENTIFIERLOOSE', `${src[t.NUMERICIDENTIFIERLOOSE]}|x|X|\\*`) +createToken('XRANGEIDENTIFIER', `${src[t.NUMERICIDENTIFIER]}|x|X|\\*`) + +createToken('XRANGEPLAIN', `[v=\\s]*(${src[t.XRANGEIDENTIFIER]})` + + `(?:\\.(${src[t.XRANGEIDENTIFIER]})` + + `(?:\\.(${src[t.XRANGEIDENTIFIER]})` + + `(?:${src[t.PRERELEASE]})?${ + src[t.BUILD]}?` + + `)?)?`) + +createToken('XRANGEPLAINLOOSE', `[v=\\s]*(${src[t.XRANGEIDENTIFIERLOOSE]})` + + `(?:\\.(${src[t.XRANGEIDENTIFIERLOOSE]})` + + `(?:\\.(${src[t.XRANGEIDENTIFIERLOOSE]})` + + `(?:${src[t.PRERELEASELOOSE]})?${ + src[t.BUILD]}?` + + `)?)?`) + +createToken('XRANGE', `^${src[t.GTLT]}\\s*${src[t.XRANGEPLAIN]}$`) +createToken('XRANGELOOSE', `^${src[t.GTLT]}\\s*${src[t.XRANGEPLAINLOOSE]}$`) + +// Coercion. +// Extract anything that could conceivably be a part of a valid semver +createToken('COERCE', `${'(^|[^\\d])' + + '(\\d{1,'}${MAX_SAFE_COMPONENT_LENGTH}})` + + `(?:\\.(\\d{1,${MAX_SAFE_COMPONENT_LENGTH}}))?` + + `(?:\\.(\\d{1,${MAX_SAFE_COMPONENT_LENGTH}}))?` + + `(?:$|[^\\d])`) +createToken('COERCERTL', src[t.COERCE], true) + +// Tilde ranges. +// Meaning is "reasonably at or greater than" +createToken('LONETILDE', '(?:~>?)') + +createToken('TILDETRIM', `(\\s*)${src[t.LONETILDE]}\\s+`, true) +exports.tildeTrimReplace = '$1~' + +createToken('TILDE', `^${src[t.LONETILDE]}${src[t.XRANGEPLAIN]}$`) +createToken('TILDELOOSE', `^${src[t.LONETILDE]}${src[t.XRANGEPLAINLOOSE]}$`) + +// Caret ranges. +// Meaning is "at least and backwards compatible with" +createToken('LONECARET', '(?:\\^)') + +createToken('CARETTRIM', `(\\s*)${src[t.LONECARET]}\\s+`, true) +exports.caretTrimReplace = '$1^' + +createToken('CARET', `^${src[t.LONECARET]}${src[t.XRANGEPLAIN]}$`) +createToken('CARETLOOSE', `^${src[t.LONECARET]}${src[t.XRANGEPLAINLOOSE]}$`) + +// A simple gt/lt/eq thing, or just "" to indicate "any version" +createToken('COMPARATORLOOSE', `^${src[t.GTLT]}\\s*(${src[t.LOOSEPLAIN]})$|^$`) +createToken('COMPARATOR', `^${src[t.GTLT]}\\s*(${src[t.FULLPLAIN]})$|^$`) + +// An expression to strip any whitespace between the gtlt and the thing +// it modifies, so that `> 1.2.3` ==> `>1.2.3` +createToken('COMPARATORTRIM', `(\\s*)${src[t.GTLT] +}\\s*(${src[t.LOOSEPLAIN]}|${src[t.XRANGEPLAIN]})`, true) +exports.comparatorTrimReplace = '$1$2$3' + +// Something like `1.2.3 - 1.2.4` +// Note that these all use the loose form, because they'll be +// checked against either the strict or loose comparator form +// later. +createToken('HYPHENRANGE', `^\\s*(${src[t.XRANGEPLAIN]})` + + `\\s+-\\s+` + + `(${src[t.XRANGEPLAIN]})` + + `\\s*$`) + +createToken('HYPHENRANGELOOSE', `^\\s*(${src[t.XRANGEPLAINLOOSE]})` + + `\\s+-\\s+` + + `(${src[t.XRANGEPLAINLOOSE]})` + + `\\s*$`) + +// Star ranges basically just allow anything at all. +createToken('STAR', '(<|>)?=?\\s*\\*') +// >=0.0.0 is like a star +createToken('GTE0', '^\\s*>=\\s*0\.0\.0\\s*$') +createToken('GTE0PRE', '^\\s*>=\\s*0\.0\.0-0\\s*$') diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/package.json b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/package.json new file mode 100644 index 00000000..b6f663a6 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/package.json @@ -0,0 +1,73 @@ +{ + "_from": "semver@^7.3.4", + "_id": "semver@7.3.5", + "_inBundle": false, + "_integrity": "sha512-PoeGJYh8HK4BTO/a9Tf6ZG3veo/A7ZVsYrSA6J8ny9nb3B1VrpkuN+z9OE5wfE5p6H4LchYZsegiQgbJD94ZFQ==", + "_location": "/@mapbox/node-pre-gyp/semver", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "semver@^7.3.4", + "name": "semver", + "escapedName": "semver", + "rawSpec": "^7.3.4", + "saveSpec": null, + "fetchSpec": "^7.3.4" + }, + "_requiredBy": [ + "/@mapbox/node-pre-gyp" + ], + "_resolved": "https://registry.npmjs.org/semver/-/semver-7.3.5.tgz", + "_shasum": "0b621c879348d8998e4b0e4be94b3f12e6018ef7", + "_spec": "semver@^7.3.4", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/@mapbox/node-pre-gyp", + "bin": { + "semver": "bin/semver.js" + }, + "bugs": { + "url": "https://github.com/npm/node-semver/issues" + }, + "bundleDependencies": false, + "dependencies": { + "lru-cache": "^6.0.0" + }, + "deprecated": false, + "description": "The semantic version parser used by npm.", + "devDependencies": { + "tap": "^14.10.7" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "bin/**/*.js", + "range.bnf", + "classes/**/*.js", + "functions/**/*.js", + "internal/**/*.js", + "ranges/**/*.js", + "index.js", + "preload.js" + ], + "homepage": "https://github.com/npm/node-semver#readme", + "license": "ISC", + "main": "index.js", + "name": "semver", + "repository": { + "type": "git", + "url": "git+https://github.com/npm/node-semver.git" + }, + "scripts": { + "postpublish": "git push origin --follow-tags", + "postversion": "npm publish", + "preversion": "npm test", + "snap": "tap", + "test": "tap" + }, + "tap": { + "check-coverage": true, + "coverage-map": "map.js" + }, + "version": "7.3.5" +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/preload.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/preload.js new file mode 100644 index 00000000..947cd4f7 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/preload.js @@ -0,0 +1,2 @@ +// XXX remove in v8 or beyond +module.exports = require('./index.js') diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/range.bnf b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/range.bnf new file mode 100644 index 00000000..d4c6ae0d --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/range.bnf @@ -0,0 +1,16 @@ +range-set ::= range ( logical-or range ) * +logical-or ::= ( ' ' ) * '||' ( ' ' ) * +range ::= hyphen | simple ( ' ' simple ) * | '' +hyphen ::= partial ' - ' partial +simple ::= primitive | partial | tilde | caret +primitive ::= ( '<' | '>' | '>=' | '<=' | '=' ) partial +partial ::= xr ( '.' xr ( '.' xr qualifier ? )? )? +xr ::= 'x' | 'X' | '*' | nr +nr ::= '0' | [1-9] ( [0-9] ) * +tilde ::= '~' partial +caret ::= '^' partial +qualifier ::= ( '-' pre )? ( '+' build )? +pre ::= parts +build ::= parts +parts ::= part ( '.' part ) * +part ::= nr | [-0-9A-Za-z]+ diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/gtr.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/gtr.js new file mode 100644 index 00000000..db7e3559 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/gtr.js @@ -0,0 +1,4 @@ +// Determine if version is greater than all the versions possible in the range. +const outside = require('./outside') +const gtr = (version, range, options) => outside(version, range, '>', options) +module.exports = gtr diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/intersects.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/intersects.js new file mode 100644 index 00000000..3d1a6f31 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/intersects.js @@ -0,0 +1,7 @@ +const Range = require('../classes/range') +const intersects = (r1, r2, options) => { + r1 = new Range(r1, options) + r2 = new Range(r2, options) + return r1.intersects(r2) +} +module.exports = intersects diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/ltr.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/ltr.js new file mode 100644 index 00000000..528a885e --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/ltr.js @@ -0,0 +1,4 @@ +const outside = require('./outside') +// Determine if version is less than all the versions possible in the range +const ltr = (version, range, options) => outside(version, range, '<', options) +module.exports = ltr diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/max-satisfying.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/max-satisfying.js new file mode 100644 index 00000000..6e3d993c --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/max-satisfying.js @@ -0,0 +1,25 @@ +const SemVer = require('../classes/semver') +const Range = require('../classes/range') + +const maxSatisfying = (versions, range, options) => { + let max = null + let maxSV = null + let rangeObj = null + try { + rangeObj = new Range(range, options) + } catch (er) { + return null + } + versions.forEach((v) => { + if (rangeObj.test(v)) { + // satisfies(v, range, options) + if (!max || maxSV.compare(v) === -1) { + // compare(max, v, true) + max = v + maxSV = new SemVer(max, options) + } + } + }) + return max +} +module.exports = maxSatisfying diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-satisfying.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-satisfying.js new file mode 100644 index 00000000..9b60974e --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-satisfying.js @@ -0,0 +1,24 @@ +const SemVer = require('../classes/semver') +const Range = require('../classes/range') +const minSatisfying = (versions, range, options) => { + let min = null + let minSV = null + let rangeObj = null + try { + rangeObj = new Range(range, options) + } catch (er) { + return null + } + versions.forEach((v) => { + if (rangeObj.test(v)) { + // satisfies(v, range, options) + if (!min || minSV.compare(v) === 1) { + // compare(min, v, true) + min = v + minSV = new SemVer(min, options) + } + } + }) + return min +} +module.exports = minSatisfying diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-version.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-version.js new file mode 100644 index 00000000..2fac4129 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/min-version.js @@ -0,0 +1,60 @@ +const SemVer = require('../classes/semver') +const Range = require('../classes/range') +const gt = require('../functions/gt') + +const minVersion = (range, loose) => { + range = new Range(range, loose) + + let minver = new SemVer('0.0.0') + if (range.test(minver)) { + return minver + } + + minver = new SemVer('0.0.0-0') + if (range.test(minver)) { + return minver + } + + minver = null + for (let i = 0; i < range.set.length; ++i) { + const comparators = range.set[i] + + let setMin = null + comparators.forEach((comparator) => { + // Clone to avoid manipulating the comparator's semver object. + const compver = new SemVer(comparator.semver.version) + switch (comparator.operator) { + case '>': + if (compver.prerelease.length === 0) { + compver.patch++ + } else { + compver.prerelease.push(0) + } + compver.raw = compver.format() + /* fallthrough */ + case '': + case '>=': + if (!setMin || gt(compver, setMin)) { + setMin = compver + } + break + case '<': + case '<=': + /* Ignore maximum versions */ + break + /* istanbul ignore next */ + default: + throw new Error(`Unexpected operation: ${comparator.operator}`) + } + }) + if (setMin && (!minver || gt(minver, setMin))) + minver = setMin + } + + if (minver && range.test(minver)) { + return minver + } + + return null +} +module.exports = minVersion diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/outside.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/outside.js new file mode 100644 index 00000000..2a4b0a13 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/outside.js @@ -0,0 +1,80 @@ +const SemVer = require('../classes/semver') +const Comparator = require('../classes/comparator') +const {ANY} = Comparator +const Range = require('../classes/range') +const satisfies = require('../functions/satisfies') +const gt = require('../functions/gt') +const lt = require('../functions/lt') +const lte = require('../functions/lte') +const gte = require('../functions/gte') + +const outside = (version, range, hilo, options) => { + version = new SemVer(version, options) + range = new Range(range, options) + + let gtfn, ltefn, ltfn, comp, ecomp + switch (hilo) { + case '>': + gtfn = gt + ltefn = lte + ltfn = lt + comp = '>' + ecomp = '>=' + break + case '<': + gtfn = lt + ltefn = gte + ltfn = gt + comp = '<' + ecomp = '<=' + break + default: + throw new TypeError('Must provide a hilo val of "<" or ">"') + } + + // If it satisfies the range it is not outside + if (satisfies(version, range, options)) { + return false + } + + // From now on, variable terms are as if we're in "gtr" mode. + // but note that everything is flipped for the "ltr" function. + + for (let i = 0; i < range.set.length; ++i) { + const comparators = range.set[i] + + let high = null + let low = null + + comparators.forEach((comparator) => { + if (comparator.semver === ANY) { + comparator = new Comparator('>=0.0.0') + } + high = high || comparator + low = low || comparator + if (gtfn(comparator.semver, high.semver, options)) { + high = comparator + } else if (ltfn(comparator.semver, low.semver, options)) { + low = comparator + } + }) + + // If the edge version comparator has a operator then our version + // isn't outside it + if (high.operator === comp || high.operator === ecomp) { + return false + } + + // If the lowest version comparator has an operator and our version + // is less than it then it isn't higher than the range + if ((!low.operator || low.operator === comp) && + ltefn(version, low.semver)) { + return false + } else if (low.operator === ecomp && ltfn(version, low.semver)) { + return false + } + } + return true +} + +module.exports = outside diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/simplify.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/simplify.js new file mode 100644 index 00000000..b792f972 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/simplify.js @@ -0,0 +1,44 @@ +// given a set of versions and a range, create a "simplified" range +// that includes the same versions that the original range does +// If the original range is shorter than the simplified one, return that. +const satisfies = require('../functions/satisfies.js') +const compare = require('../functions/compare.js') +module.exports = (versions, range, options) => { + const set = [] + let min = null + let prev = null + const v = versions.sort((a, b) => compare(a, b, options)) + for (const version of v) { + const included = satisfies(version, range, options) + if (included) { + prev = version + if (!min) + min = version + } else { + if (prev) { + set.push([min, prev]) + } + prev = null + min = null + } + } + if (min) + set.push([min, null]) + + const ranges = [] + for (const [min, max] of set) { + if (min === max) + ranges.push(min) + else if (!max && min === v[0]) + ranges.push('*') + else if (!max) + ranges.push(`>=${min}`) + else if (min === v[0]) + ranges.push(`<=${max}`) + else + ranges.push(`${min} - ${max}`) + } + const simplified = ranges.join(' || ') + const original = typeof range.raw === 'string' ? range.raw : String(range) + return simplified.length < original.length ? simplified : range +} diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/subset.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/subset.js new file mode 100644 index 00000000..532fd136 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/subset.js @@ -0,0 +1,222 @@ +const Range = require('../classes/range.js') +const Comparator = require('../classes/comparator.js') +const { ANY } = Comparator +const satisfies = require('../functions/satisfies.js') +const compare = require('../functions/compare.js') + +// Complex range `r1 || r2 || ...` is a subset of `R1 || R2 || ...` iff: +// - Every simple range `r1, r2, ...` is a null set, OR +// - Every simple range `r1, r2, ...` which is not a null set is a subset of +// some `R1, R2, ...` +// +// Simple range `c1 c2 ...` is a subset of simple range `C1 C2 ...` iff: +// - If c is only the ANY comparator +// - If C is only the ANY comparator, return true +// - Else if in prerelease mode, return false +// - else replace c with `[>=0.0.0]` +// - If C is only the ANY comparator +// - if in prerelease mode, return true +// - else replace C with `[>=0.0.0]` +// - Let EQ be the set of = comparators in c +// - If EQ is more than one, return true (null set) +// - Let GT be the highest > or >= comparator in c +// - Let LT be the lowest < or <= comparator in c +// - If GT and LT, and GT.semver > LT.semver, return true (null set) +// - If any C is a = range, and GT or LT are set, return false +// - If EQ +// - If GT, and EQ does not satisfy GT, return true (null set) +// - If LT, and EQ does not satisfy LT, return true (null set) +// - If EQ satisfies every C, return true +// - Else return false +// - If GT +// - If GT.semver is lower than any > or >= comp in C, return false +// - If GT is >=, and GT.semver does not satisfy every C, return false +// - If GT.semver has a prerelease, and not in prerelease mode +// - If no C has a prerelease and the GT.semver tuple, return false +// - If LT +// - If LT.semver is greater than any < or <= comp in C, return false +// - If LT is <=, and LT.semver does not satisfy every C, return false +// - If GT.semver has a prerelease, and not in prerelease mode +// - If no C has a prerelease and the LT.semver tuple, return false +// - Else return true + +const subset = (sub, dom, options = {}) => { + if (sub === dom) + return true + + sub = new Range(sub, options) + dom = new Range(dom, options) + let sawNonNull = false + + OUTER: for (const simpleSub of sub.set) { + for (const simpleDom of dom.set) { + const isSub = simpleSubset(simpleSub, simpleDom, options) + sawNonNull = sawNonNull || isSub !== null + if (isSub) + continue OUTER + } + // the null set is a subset of everything, but null simple ranges in + // a complex range should be ignored. so if we saw a non-null range, + // then we know this isn't a subset, but if EVERY simple range was null, + // then it is a subset. + if (sawNonNull) + return false + } + return true +} + +const simpleSubset = (sub, dom, options) => { + if (sub === dom) + return true + + if (sub.length === 1 && sub[0].semver === ANY) { + if (dom.length === 1 && dom[0].semver === ANY) + return true + else if (options.includePrerelease) + sub = [ new Comparator('>=0.0.0-0') ] + else + sub = [ new Comparator('>=0.0.0') ] + } + + if (dom.length === 1 && dom[0].semver === ANY) { + if (options.includePrerelease) + return true + else + dom = [ new Comparator('>=0.0.0') ] + } + + const eqSet = new Set() + let gt, lt + for (const c of sub) { + if (c.operator === '>' || c.operator === '>=') + gt = higherGT(gt, c, options) + else if (c.operator === '<' || c.operator === '<=') + lt = lowerLT(lt, c, options) + else + eqSet.add(c.semver) + } + + if (eqSet.size > 1) + return null + + let gtltComp + if (gt && lt) { + gtltComp = compare(gt.semver, lt.semver, options) + if (gtltComp > 0) + return null + else if (gtltComp === 0 && (gt.operator !== '>=' || lt.operator !== '<=')) + return null + } + + // will iterate one or zero times + for (const eq of eqSet) { + if (gt && !satisfies(eq, String(gt), options)) + return null + + if (lt && !satisfies(eq, String(lt), options)) + return null + + for (const c of dom) { + if (!satisfies(eq, String(c), options)) + return false + } + + return true + } + + let higher, lower + let hasDomLT, hasDomGT + // if the subset has a prerelease, we need a comparator in the superset + // with the same tuple and a prerelease, or it's not a subset + let needDomLTPre = lt && + !options.includePrerelease && + lt.semver.prerelease.length ? lt.semver : false + let needDomGTPre = gt && + !options.includePrerelease && + gt.semver.prerelease.length ? gt.semver : false + // exception: <1.2.3-0 is the same as <1.2.3 + if (needDomLTPre && needDomLTPre.prerelease.length === 1 && + lt.operator === '<' && needDomLTPre.prerelease[0] === 0) { + needDomLTPre = false + } + + for (const c of dom) { + hasDomGT = hasDomGT || c.operator === '>' || c.operator === '>=' + hasDomLT = hasDomLT || c.operator === '<' || c.operator === '<=' + if (gt) { + if (needDomGTPre) { + if (c.semver.prerelease && c.semver.prerelease.length && + c.semver.major === needDomGTPre.major && + c.semver.minor === needDomGTPre.minor && + c.semver.patch === needDomGTPre.patch) { + needDomGTPre = false + } + } + if (c.operator === '>' || c.operator === '>=') { + higher = higherGT(gt, c, options) + if (higher === c && higher !== gt) + return false + } else if (gt.operator === '>=' && !satisfies(gt.semver, String(c), options)) + return false + } + if (lt) { + if (needDomLTPre) { + if (c.semver.prerelease && c.semver.prerelease.length && + c.semver.major === needDomLTPre.major && + c.semver.minor === needDomLTPre.minor && + c.semver.patch === needDomLTPre.patch) { + needDomLTPre = false + } + } + if (c.operator === '<' || c.operator === '<=') { + lower = lowerLT(lt, c, options) + if (lower === c && lower !== lt) + return false + } else if (lt.operator === '<=' && !satisfies(lt.semver, String(c), options)) + return false + } + if (!c.operator && (lt || gt) && gtltComp !== 0) + return false + } + + // if there was a < or >, and nothing in the dom, then must be false + // UNLESS it was limited by another range in the other direction. + // Eg, >1.0.0 <1.0.1 is still a subset of <2.0.0 + if (gt && hasDomLT && !lt && gtltComp !== 0) + return false + + if (lt && hasDomGT && !gt && gtltComp !== 0) + return false + + // we needed a prerelease range in a specific tuple, but didn't get one + // then this isn't a subset. eg >=1.2.3-pre is not a subset of >=1.0.0, + // because it includes prereleases in the 1.2.3 tuple + if (needDomGTPre || needDomLTPre) + return false + + return true +} + +// >=1.2.3 is lower than >1.2.3 +const higherGT = (a, b, options) => { + if (!a) + return b + const comp = compare(a.semver, b.semver, options) + return comp > 0 ? a + : comp < 0 ? b + : b.operator === '>' && a.operator === '>=' ? b + : a +} + +// <=1.2.3 is higher than <1.2.3 +const lowerLT = (a, b, options) => { + if (!a) + return b + const comp = compare(a.semver, b.semver, options) + return comp < 0 ? a + : comp > 0 ? b + : b.operator === '<' && a.operator === '<=' ? b + : a +} + +module.exports = subset diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/to-comparators.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/to-comparators.js new file mode 100644 index 00000000..6c8bc7e6 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/to-comparators.js @@ -0,0 +1,8 @@ +const Range = require('../classes/range') + +// Mostly just for testing and legacy API reasons +const toComparators = (range, options) => + new Range(range, options).set + .map(comp => comp.map(c => c.value).join(' ').trim().split(' ')) + +module.exports = toComparators diff --git a/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/valid.js b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/valid.js new file mode 100644 index 00000000..365f3568 --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/node_modules/semver/ranges/valid.js @@ -0,0 +1,11 @@ +const Range = require('../classes/range') +const validRange = (range, options) => { + try { + // Return '*' instead of '' so that truthiness works. + // This will throw if it's invalid anyway + return new Range(range, options).range || '*' + } catch (er) { + return null + } +} +module.exports = validRange diff --git a/node_modules/@mapbox/node-pre-gyp/package.json b/node_modules/@mapbox/node-pre-gyp/package.json new file mode 100644 index 00000000..0320886a --- /dev/null +++ b/node_modules/@mapbox/node-pre-gyp/package.json @@ -0,0 +1,101 @@ +{ + "_from": "@mapbox/node-pre-gyp@^1.0.0", + "_id": "@mapbox/node-pre-gyp@1.0.4", + "_inBundle": false, + "_integrity": "sha512-M669Qo4nRT7iDmQEjQYC7RU8Z6dpz9UmSbkJ1OFEja3uevCdLKh7IZZki7L1TZj02kRyl82snXFY8QqkyfowrQ==", + "_location": "/@mapbox/node-pre-gyp", + "_phantomChildren": { + "abbrev": "1.1.1", + "lru-cache": "6.0.0" + }, + "_requested": { + "type": "range", + "registry": true, + "raw": "@mapbox/node-pre-gyp@^1.0.0", + "name": "@mapbox/node-pre-gyp", + "escapedName": "@mapbox%2fnode-pre-gyp", + "scope": "@mapbox", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/bcrypt" + ], + "_resolved": "https://registry.npmjs.org/@mapbox/node-pre-gyp/-/node-pre-gyp-1.0.4.tgz", + "_shasum": "6c76e7a40138eac39e1a4dc869a083e43e236c00", + "_spec": "@mapbox/node-pre-gyp@^1.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/bcrypt", + "author": { + "name": "Dane Springmeyer", + "email": "dane@mapbox.com" + }, + "bin": { + "node-pre-gyp": "bin/node-pre-gyp" + }, + "bugs": { + "url": "https://github.com/mapbox/node-pre-gyp/issues" + }, + "bundleDependencies": false, + "dependencies": { + "detect-libc": "^1.0.3", + "https-proxy-agent": "^5.0.0", + "make-dir": "^3.1.0", + "node-fetch": "^2.6.1", + "nopt": "^5.0.0", + "npmlog": "^4.1.2", + "rimraf": "^3.0.2", + "semver": "^7.3.4", + "tar": "^6.1.0" + }, + "deprecated": false, + "description": "Node.js native addon binary install tool", + "devDependencies": { + "@mapbox/cloudfriend": "^4.6.0", + "@mapbox/eslint-config-mapbox": "^3.0.0", + "action-walk": "^2.2.0", + "aws-sdk": "^2.840.0", + "codecov": "^3.8.1", + "eslint": "^7.18.0", + "eslint-plugin-node": "^11.1.0", + "mock-aws-s3": "^4.0.1", + "nock": "^12.0.3", + "node-addon-api": "^3.1.0", + "nyc": "^15.1.0", + "tape": "^5.2.2", + "tar-fs": "^2.1.1" + }, + "homepage": "https://github.com/mapbox/node-pre-gyp#readme", + "keywords": [ + "native", + "addon", + "module", + "c", + "c++", + "bindings", + "binary" + ], + "license": "BSD-3-Clause", + "main": "./lib/node-pre-gyp.js", + "name": "@mapbox/node-pre-gyp", + "nyc": { + "all": true, + "skip-full": false, + "exclude": [ + "test/**" + ] + }, + "repository": { + "type": "git", + "url": "git://github.com/mapbox/node-pre-gyp.git" + }, + "scripts": { + "coverage": "nyc --all --include index.js --include lib/ npm test", + "fix": "npm run lint -- --fix", + "lint": "eslint bin/node-pre-gyp lib/*js lib/util/*js test/*js scripts/*js", + "test": "tape test/*test.js", + "update-crosswalk": "node scripts/abi_crosswalk.js", + "upload-coverage": "nyc report --reporter json && codecov --clear --flags=unit --file=./coverage/coverage-final.json" + }, + "version": "1.0.4" +} diff --git a/node_modules/@sindresorhus/is/dist/index.d.ts b/node_modules/@sindresorhus/is/dist/index.d.ts new file mode 100644 index 00000000..e94d30b7 --- /dev/null +++ b/node_modules/@sindresorhus/is/dist/index.d.ts @@ -0,0 +1,132 @@ +/// +/// +/// +/// +/// +declare type TypedArray = Int8Array | Uint8Array | Uint8ClampedArray | Int16Array | Uint16Array | Int32Array | Uint32Array | Float32Array | Float64Array; +declare type Primitive = null | undefined | string | number | boolean | Symbol; +export interface ArrayLike { + length: number; +} +export interface Class { + new (...args: any[]): T; +} +declare type DomElement = object & { + nodeType: 1; + nodeName: string; +}; +declare type NodeStream = object & { + pipe: Function; +}; +export declare const enum TypeName { + null = "null", + boolean = "boolean", + undefined = "undefined", + string = "string", + number = "number", + symbol = "symbol", + Function = "Function", + GeneratorFunction = "GeneratorFunction", + AsyncFunction = "AsyncFunction", + Observable = "Observable", + Array = "Array", + Buffer = "Buffer", + Object = "Object", + RegExp = "RegExp", + Date = "Date", + Error = "Error", + Map = "Map", + Set = "Set", + WeakMap = "WeakMap", + WeakSet = "WeakSet", + Int8Array = "Int8Array", + Uint8Array = "Uint8Array", + Uint8ClampedArray = "Uint8ClampedArray", + Int16Array = "Int16Array", + Uint16Array = "Uint16Array", + Int32Array = "Int32Array", + Uint32Array = "Uint32Array", + Float32Array = "Float32Array", + Float64Array = "Float64Array", + ArrayBuffer = "ArrayBuffer", + SharedArrayBuffer = "SharedArrayBuffer", + DataView = "DataView", + Promise = "Promise", + URL = "URL" +} +declare function is(value: unknown): TypeName; +declare namespace is { + const undefined: (value: unknown) => value is undefined; + const string: (value: unknown) => value is string; + const number: (value: unknown) => value is number; + const function_: (value: unknown) => value is Function; + const null_: (value: unknown) => value is null; + const class_: (value: unknown) => value is Class; + const boolean: (value: unknown) => value is boolean; + const symbol: (value: unknown) => value is Symbol; + const numericString: (value: unknown) => boolean; + const array: (arg: any) => arg is any[]; + const buffer: (input: unknown) => input is Buffer; + const nullOrUndefined: (value: unknown) => value is null | undefined; + const object: (value: unknown) => value is object; + const iterable: (value: unknown) => value is IterableIterator; + const asyncIterable: (value: unknown) => value is AsyncIterableIterator; + const generator: (value: unknown) => value is Generator; + const nativePromise: (value: unknown) => value is Promise; + const promise: (value: unknown) => value is Promise; + const generatorFunction: (value: unknown) => value is GeneratorFunction; + const asyncFunction: (value: unknown) => value is Function; + const boundFunction: (value: unknown) => value is Function; + const regExp: (value: unknown) => value is RegExp; + const date: (value: unknown) => value is Date; + const error: (value: unknown) => value is Error; + const map: (value: unknown) => value is Map; + const set: (value: unknown) => value is Set; + const weakMap: (value: unknown) => value is WeakMap; + const weakSet: (value: unknown) => value is WeakSet; + const int8Array: (value: unknown) => value is Int8Array; + const uint8Array: (value: unknown) => value is Uint8Array; + const uint8ClampedArray: (value: unknown) => value is Uint8ClampedArray; + const int16Array: (value: unknown) => value is Int16Array; + const uint16Array: (value: unknown) => value is Uint16Array; + const int32Array: (value: unknown) => value is Int32Array; + const uint32Array: (value: unknown) => value is Uint32Array; + const float32Array: (value: unknown) => value is Float32Array; + const float64Array: (value: unknown) => value is Float64Array; + const arrayBuffer: (value: unknown) => value is ArrayBuffer; + const sharedArrayBuffer: (value: unknown) => value is SharedArrayBuffer; + const dataView: (value: unknown) => value is DataView; + const directInstanceOf: (instance: unknown, klass: Class) => instance is T; + const urlInstance: (value: unknown) => value is URL; + const urlString: (value: unknown) => boolean; + const truthy: (value: unknown) => boolean; + const falsy: (value: unknown) => boolean; + const nan: (value: unknown) => boolean; + const primitive: (value: unknown) => value is Primitive; + const integer: (value: unknown) => value is number; + const safeInteger: (value: unknown) => value is number; + const plainObject: (value: unknown) => boolean; + const typedArray: (value: unknown) => value is TypedArray; + const arrayLike: (value: unknown) => value is ArrayLike; + const inRange: (value: number, range: number | number[]) => boolean; + const domElement: (value: unknown) => value is DomElement; + const observable: (value: unknown) => boolean; + const nodeStream: (value: unknown) => value is NodeStream; + const infinite: (value: unknown) => boolean; + const even: (value: number) => boolean; + const odd: (value: number) => boolean; + const emptyArray: (value: unknown) => boolean; + const nonEmptyArray: (value: unknown) => boolean; + const emptyString: (value: unknown) => boolean; + const nonEmptyString: (value: unknown) => boolean; + const emptyStringOrWhitespace: (value: unknown) => boolean; + const emptyObject: (value: unknown) => boolean; + const nonEmptyObject: (value: unknown) => boolean; + const emptySet: (value: unknown) => boolean; + const nonEmptySet: (value: unknown) => boolean; + const emptyMap: (value: unknown) => boolean; + const nonEmptyMap: (value: unknown) => boolean; + const any: (predicate: unknown, ...values: unknown[]) => boolean; + const all: (predicate: unknown, ...values: unknown[]) => boolean; +} +export default is; diff --git a/node_modules/@sindresorhus/is/dist/index.js b/node_modules/@sindresorhus/is/dist/index.js new file mode 100644 index 00000000..3cbafae1 --- /dev/null +++ b/node_modules/@sindresorhus/is/dist/index.js @@ -0,0 +1,245 @@ +"use strict"; +/// +/// +/// +/// +Object.defineProperty(exports, "__esModule", { value: true }); +// TODO: Use the `URL` global when targeting Node.js 10 +// tslint:disable-next-line +const URLGlobal = typeof URL === 'undefined' ? require('url').URL : URL; +const toString = Object.prototype.toString; +const isOfType = (type) => (value) => typeof value === type; +const isBuffer = (input) => !is.nullOrUndefined(input) && !is.nullOrUndefined(input.constructor) && is.function_(input.constructor.isBuffer) && input.constructor.isBuffer(input); +const getObjectType = (value) => { + const objectName = toString.call(value).slice(8, -1); + if (objectName) { + return objectName; + } + return null; +}; +const isObjectOfType = (type) => (value) => getObjectType(value) === type; +function is(value) { + switch (value) { + case null: + return "null" /* null */; + case true: + case false: + return "boolean" /* boolean */; + default: + } + switch (typeof value) { + case 'undefined': + return "undefined" /* undefined */; + case 'string': + return "string" /* string */; + case 'number': + return "number" /* number */; + case 'symbol': + return "symbol" /* symbol */; + default: + } + if (is.function_(value)) { + return "Function" /* Function */; + } + if (is.observable(value)) { + return "Observable" /* Observable */; + } + if (Array.isArray(value)) { + return "Array" /* Array */; + } + if (isBuffer(value)) { + return "Buffer" /* Buffer */; + } + const tagType = getObjectType(value); + if (tagType) { + return tagType; + } + if (value instanceof String || value instanceof Boolean || value instanceof Number) { + throw new TypeError('Please don\'t use object wrappers for primitive types'); + } + return "Object" /* Object */; +} +(function (is) { + // tslint:disable-next-line:strict-type-predicates + const isObject = (value) => typeof value === 'object'; + // tslint:disable:variable-name + is.undefined = isOfType('undefined'); + is.string = isOfType('string'); + is.number = isOfType('number'); + is.function_ = isOfType('function'); + // tslint:disable-next-line:strict-type-predicates + is.null_ = (value) => value === null; + is.class_ = (value) => is.function_(value) && value.toString().startsWith('class '); + is.boolean = (value) => value === true || value === false; + is.symbol = isOfType('symbol'); + // tslint:enable:variable-name + is.numericString = (value) => is.string(value) && value.length > 0 && !Number.isNaN(Number(value)); + is.array = Array.isArray; + is.buffer = isBuffer; + is.nullOrUndefined = (value) => is.null_(value) || is.undefined(value); + is.object = (value) => !is.nullOrUndefined(value) && (is.function_(value) || isObject(value)); + is.iterable = (value) => !is.nullOrUndefined(value) && is.function_(value[Symbol.iterator]); + is.asyncIterable = (value) => !is.nullOrUndefined(value) && is.function_(value[Symbol.asyncIterator]); + is.generator = (value) => is.iterable(value) && is.function_(value.next) && is.function_(value.throw); + is.nativePromise = (value) => isObjectOfType("Promise" /* Promise */)(value); + const hasPromiseAPI = (value) => !is.null_(value) && + isObject(value) && + is.function_(value.then) && + is.function_(value.catch); + is.promise = (value) => is.nativePromise(value) || hasPromiseAPI(value); + is.generatorFunction = isObjectOfType("GeneratorFunction" /* GeneratorFunction */); + is.asyncFunction = isObjectOfType("AsyncFunction" /* AsyncFunction */); + is.boundFunction = (value) => is.function_(value) && !value.hasOwnProperty('prototype'); + is.regExp = isObjectOfType("RegExp" /* RegExp */); + is.date = isObjectOfType("Date" /* Date */); + is.error = isObjectOfType("Error" /* Error */); + is.map = (value) => isObjectOfType("Map" /* Map */)(value); + is.set = (value) => isObjectOfType("Set" /* Set */)(value); + is.weakMap = (value) => isObjectOfType("WeakMap" /* WeakMap */)(value); + is.weakSet = (value) => isObjectOfType("WeakSet" /* WeakSet */)(value); + is.int8Array = isObjectOfType("Int8Array" /* Int8Array */); + is.uint8Array = isObjectOfType("Uint8Array" /* Uint8Array */); + is.uint8ClampedArray = isObjectOfType("Uint8ClampedArray" /* Uint8ClampedArray */); + is.int16Array = isObjectOfType("Int16Array" /* Int16Array */); + is.uint16Array = isObjectOfType("Uint16Array" /* Uint16Array */); + is.int32Array = isObjectOfType("Int32Array" /* Int32Array */); + is.uint32Array = isObjectOfType("Uint32Array" /* Uint32Array */); + is.float32Array = isObjectOfType("Float32Array" /* Float32Array */); + is.float64Array = isObjectOfType("Float64Array" /* Float64Array */); + is.arrayBuffer = isObjectOfType("ArrayBuffer" /* ArrayBuffer */); + is.sharedArrayBuffer = isObjectOfType("SharedArrayBuffer" /* SharedArrayBuffer */); + is.dataView = isObjectOfType("DataView" /* DataView */); + is.directInstanceOf = (instance, klass) => Object.getPrototypeOf(instance) === klass.prototype; + is.urlInstance = (value) => isObjectOfType("URL" /* URL */)(value); + is.urlString = (value) => { + if (!is.string(value)) { + return false; + } + try { + new URLGlobal(value); // tslint:disable-line no-unused-expression + return true; + } + catch (_a) { + return false; + } + }; + is.truthy = (value) => Boolean(value); + is.falsy = (value) => !value; + is.nan = (value) => Number.isNaN(value); + const primitiveTypes = new Set([ + 'undefined', + 'string', + 'number', + 'boolean', + 'symbol' + ]); + is.primitive = (value) => is.null_(value) || primitiveTypes.has(typeof value); + is.integer = (value) => Number.isInteger(value); + is.safeInteger = (value) => Number.isSafeInteger(value); + is.plainObject = (value) => { + // From: https://github.com/sindresorhus/is-plain-obj/blob/master/index.js + let prototype; + return getObjectType(value) === "Object" /* Object */ && + (prototype = Object.getPrototypeOf(value), prototype === null || // tslint:disable-line:ban-comma-operator + prototype === Object.getPrototypeOf({})); + }; + const typedArrayTypes = new Set([ + "Int8Array" /* Int8Array */, + "Uint8Array" /* Uint8Array */, + "Uint8ClampedArray" /* Uint8ClampedArray */, + "Int16Array" /* Int16Array */, + "Uint16Array" /* Uint16Array */, + "Int32Array" /* Int32Array */, + "Uint32Array" /* Uint32Array */, + "Float32Array" /* Float32Array */, + "Float64Array" /* Float64Array */ + ]); + is.typedArray = (value) => { + const objectType = getObjectType(value); + if (objectType === null) { + return false; + } + return typedArrayTypes.has(objectType); + }; + const isValidLength = (value) => is.safeInteger(value) && value > -1; + is.arrayLike = (value) => !is.nullOrUndefined(value) && !is.function_(value) && isValidLength(value.length); + is.inRange = (value, range) => { + if (is.number(range)) { + return value >= Math.min(0, range) && value <= Math.max(range, 0); + } + if (is.array(range) && range.length === 2) { + return value >= Math.min(...range) && value <= Math.max(...range); + } + throw new TypeError(`Invalid range: ${JSON.stringify(range)}`); + }; + const NODE_TYPE_ELEMENT = 1; + const DOM_PROPERTIES_TO_CHECK = [ + 'innerHTML', + 'ownerDocument', + 'style', + 'attributes', + 'nodeValue' + ]; + is.domElement = (value) => is.object(value) && value.nodeType === NODE_TYPE_ELEMENT && is.string(value.nodeName) && + !is.plainObject(value) && DOM_PROPERTIES_TO_CHECK.every(property => property in value); + is.observable = (value) => { + if (!value) { + return false; + } + if (value[Symbol.observable] && value === value[Symbol.observable]()) { + return true; + } + if (value['@@observable'] && value === value['@@observable']()) { + return true; + } + return false; + }; + is.nodeStream = (value) => !is.nullOrUndefined(value) && isObject(value) && is.function_(value.pipe) && !is.observable(value); + is.infinite = (value) => value === Infinity || value === -Infinity; + const isAbsoluteMod2 = (rem) => (value) => is.integer(value) && Math.abs(value % 2) === rem; + is.even = isAbsoluteMod2(0); + is.odd = isAbsoluteMod2(1); + const isWhiteSpaceString = (value) => is.string(value) && /\S/.test(value) === false; + is.emptyArray = (value) => is.array(value) && value.length === 0; + is.nonEmptyArray = (value) => is.array(value) && value.length > 0; + is.emptyString = (value) => is.string(value) && value.length === 0; + is.nonEmptyString = (value) => is.string(value) && value.length > 0; + is.emptyStringOrWhitespace = (value) => is.emptyString(value) || isWhiteSpaceString(value); + is.emptyObject = (value) => is.object(value) && !is.map(value) && !is.set(value) && Object.keys(value).length === 0; + is.nonEmptyObject = (value) => is.object(value) && !is.map(value) && !is.set(value) && Object.keys(value).length > 0; + is.emptySet = (value) => is.set(value) && value.size === 0; + is.nonEmptySet = (value) => is.set(value) && value.size > 0; + is.emptyMap = (value) => is.map(value) && value.size === 0; + is.nonEmptyMap = (value) => is.map(value) && value.size > 0; + const predicateOnArray = (method, predicate, values) => { + if (is.function_(predicate) === false) { + throw new TypeError(`Invalid predicate: ${JSON.stringify(predicate)}`); + } + if (values.length === 0) { + throw new TypeError('Invalid number of values'); + } + return method.call(values, predicate); + }; + // tslint:disable variable-name + is.any = (predicate, ...values) => predicateOnArray(Array.prototype.some, predicate, values); + is.all = (predicate, ...values) => predicateOnArray(Array.prototype.every, predicate, values); + // tslint:enable variable-name +})(is || (is = {})); +// Some few keywords are reserved, but we'll populate them for Node.js users +// See https://github.com/Microsoft/TypeScript/issues/2536 +Object.defineProperties(is, { + class: { + value: is.class_ + }, + function: { + value: is.function_ + }, + null: { + value: is.null_ + } +}); +exports.default = is; +// For CommonJS default export support +module.exports = is; +module.exports.default = is; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/node_modules/@sindresorhus/is/dist/index.js.map b/node_modules/@sindresorhus/is/dist/index.js.map new file mode 100644 index 00000000..cd827fc2 --- /dev/null +++ b/node_modules/@sindresorhus/is/dist/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../source/index.ts"],"names":[],"mappings":";AAAA,6BAA6B;AAC7B,0CAA0C;AAC1C,2CAA2C;AAC3C,0BAA0B;;AAE1B,uDAAuD;AACvD,2BAA2B;AAC3B,MAAM,SAAS,GAAG,OAAO,GAAG,KAAK,WAAW,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,CAAC;AAqDxE,MAAM,QAAQ,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC;AAC3C,MAAM,QAAQ,GAAG,CAAI,IAAY,EAAE,EAAE,CAAC,CAAC,KAAc,EAAc,EAAE,CAAC,OAAO,KAAK,KAAK,IAAI,CAAC;AAC5F,MAAM,QAAQ,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,CAAC,EAAE,CAAC,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,EAAE,CAAC,eAAe,CAAE,KAAgB,CAAC,WAAW,CAAC,IAAI,EAAE,CAAC,SAAS,CAAE,KAAgB,CAAC,WAAW,CAAC,QAAQ,CAAC,IAAK,KAAgB,CAAC,WAAW,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;AAEhP,MAAM,aAAa,GAAG,CAAC,KAAc,EAAmB,EAAE;IACzD,MAAM,UAAU,GAAG,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,KAAK,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC;IAErD,IAAI,UAAU,EAAE;QACf,OAAO,UAAsB,CAAC;KAC9B;IAED,OAAO,IAAI,CAAC;AACb,CAAC,CAAC;AAEF,MAAM,cAAc,GAAG,CAAI,IAAc,EAAE,EAAE,CAAC,CAAC,KAAc,EAAc,EAAE,CAAC,aAAa,CAAC,KAAK,CAAC,KAAK,IAAI,CAAC;AAE5G,SAAS,EAAE,CAAC,KAAc;IACzB,QAAQ,KAAK,EAAE;QACd,KAAK,IAAI;YACR,yBAAqB;QACtB,KAAK,IAAI,CAAC;QACV,KAAK,KAAK;YACT,+BAAwB;QACzB,QAAQ;KACR;IAED,QAAQ,OAAO,KAAK,EAAE;QACrB,KAAK,WAAW;YACf,mCAA0B;QAC3B,KAAK,QAAQ;YACZ,6BAAuB;QACxB,KAAK,QAAQ;YACZ,6BAAuB;QACxB,KAAK,QAAQ;YACZ,6BAAuB;QACxB,QAAQ;KACR;IAED,IAAI,EAAE,CAAC,SAAS,CAAC,KAAK,CAAC,EAAE;QACxB,iCAAyB;KACzB;IAED,IAAI,EAAE,CAAC,UAAU,CAAC,KAAK,CAAC,EAAE;QACzB,qCAA2B;KAC3B;IAED,IAAI,KAAK,CAAC,OAAO,CAAC,KAAK,CAAC,EAAE;QACzB,2BAAsB;KACtB;IAED,IAAI,QAAQ,CAAC,KAAK,CAAC,EAAE;QACpB,6BAAuB;KACvB;IAED,MAAM,OAAO,GAAG,aAAa,CAAC,KAAK,CAAC,CAAC;IACrC,IAAI,OAAO,EAAE;QACZ,OAAO,OAAO,CAAC;KACf;IAED,IAAI,KAAK,YAAY,MAAM,IAAI,KAAK,YAAY,OAAO,IAAI,KAAK,YAAY,MAAM,EAAE;QACnF,MAAM,IAAI,SAAS,CAAC,uDAAuD,CAAC,CAAC;KAC7E;IAED,6BAAuB;AACxB,CAAC;AAED,WAAU,EAAE;IACX,kDAAkD;IAClD,MAAM,QAAQ,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,OAAO,KAAK,KAAK,QAAQ,CAAC;IAEhF,+BAA+B;IAClB,YAAS,GAAG,QAAQ,CAAY,WAAW,CAAC,CAAC;IAC7C,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACpC,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACpC,YAAS,GAAG,QAAQ,CAAW,UAAU,CAAC,CAAC;IACxD,kDAAkD;IACrC,QAAK,GAAG,CAAC,KAAc,EAAiB,EAAE,CAAC,KAAK,KAAK,IAAI,CAAC;IAC1D,SAAM,GAAG,CAAC,KAAc,EAAkB,EAAE,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,QAAQ,EAAE,CAAC,UAAU,CAAC,QAAQ,CAAC,CAAC;IACvG,UAAO,GAAG,CAAC,KAAc,EAAoB,EAAE,CAAC,KAAK,KAAK,IAAI,IAAI,KAAK,KAAK,KAAK,CAAC;IAClF,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACjD,8BAA8B;IAEjB,gBAAa,GAAG,CAAC,KAAc,EAAW,EAAE,CACxD,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,KAAK,CAAC,MAAM,CAAC,KAAK,CAAC,CAAC,CAAC;IAEtD,QAAK,GAAG,KAAK,CAAC,OAAO,CAAC;IACtB,SAAM,GAAG,QAAQ,CAAC;IAElB,kBAAe,GAAG,CAAC,KAAc,EAA6B,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,CAAC;IAClG,SAAM,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,QAAQ,CAAC,KAAK,CAAC,CAAC,CAAC;IAC/G,WAAQ,GAAG,CAAC,KAAc,EAAsC,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAE,KAAmC,CAAC,MAAM,CAAC,QAAQ,CAAC,CAAC,CAAC;IAC/J,gBAAa,GAAG,CAAC,KAAc,EAA2C,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAE,KAAwC,CAAC,MAAM,CAAC,aAAa,CAAC,CAAC,CAAC;IACnL,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,GAAA,QAAQ,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,KAAK,CAAC,CAAC;IAEvH,gBAAa,GAAG,CAAC,KAAc,EAA6B,EAAE,CAC1E,cAAc,yBAAoC,CAAC,KAAK,CAAC,CAAC;IAE3D,MAAM,aAAa,GAAG,CAAC,KAAc,EAA6B,EAAE,CACnE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC;QACb,QAAQ,CAAC,KAAK,CAAY;QAC1B,GAAA,SAAS,CAAE,KAA0B,CAAC,IAAI,CAAC;QAC3C,GAAA,SAAS,CAAE,KAA0B,CAAC,KAAK,CAAC,CAAC;IAEjC,UAAO,GAAG,CAAC,KAAc,EAA6B,EAAE,CAAC,GAAA,aAAa,CAAC,KAAK,CAAC,IAAI,aAAa,CAAC,KAAK,CAAC,CAAC;IAEtG,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,gBAAa,GAAG,cAAc,qCAAkC,CAAC;IACjE,gBAAa,GAAG,CAAC,KAAc,EAAqB,EAAE,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,cAAc,CAAC,WAAW,CAAC,CAAC;IAE9G,SAAM,GAAG,cAAc,uBAAyB,CAAC;IACjD,OAAI,GAAG,cAAc,mBAAqB,CAAC;IAC3C,QAAK,GAAG,cAAc,qBAAuB,CAAC;IAC9C,MAAG,GAAG,CAAC,KAAc,EAAkC,EAAE,CAAC,cAAc,iBAAqC,CAAC,KAAK,CAAC,CAAC;IACrH,MAAG,GAAG,CAAC,KAAc,EAAyB,EAAE,CAAC,cAAc,iBAA4B,CAAC,KAAK,CAAC,CAAC;IACnG,UAAO,GAAG,CAAC,KAAc,EAAqC,EAAE,CAAC,cAAc,yBAA4C,CAAC,KAAK,CAAC,CAAC;IACnI,UAAO,GAAG,CAAC,KAAc,EAA4B,EAAE,CAAC,cAAc,yBAAmC,CAAC,KAAK,CAAC,CAAC;IAEjH,YAAS,GAAG,cAAc,6BAA+B,CAAC;IAC1D,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,eAAY,GAAG,cAAc,mCAAqC,CAAC;IACnE,eAAY,GAAG,cAAc,mCAAqC,CAAC;IAEnE,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,WAAQ,GAAG,cAAc,2BAA6B,CAAC;IAEvD,mBAAgB,GAAG,CAAI,QAAiB,EAAE,KAAe,EAAiB,EAAE,CAAC,MAAM,CAAC,cAAc,CAAC,QAAQ,CAAC,KAAK,KAAK,CAAC,SAAS,CAAC;IACjI,cAAW,GAAG,CAAC,KAAc,EAAgB,EAAE,CAAC,cAAc,iBAAmB,CAAC,KAAK,CAAC,CAAC;IAEzF,YAAS,GAAG,CAAC,KAAc,EAAE,EAAE;QAC3C,IAAI,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,EAAE;YACnB,OAAO,KAAK,CAAC;SACb;QAED,IAAI;YACH,IAAI,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,2CAA2C;YACjE,OAAO,IAAI,CAAC;SACZ;QAAC,WAAM;YACP,OAAO,KAAK,CAAC;SACb;IACF,CAAC,CAAC;IAEW,SAAM,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC;IAC5C,QAAK,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,CAAC,KAAK,CAAC;IAEnC,MAAG,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,MAAM,CAAC,KAAK,CAAC,KAAe,CAAC,CAAC;IAErE,MAAM,cAAc,GAAG,IAAI,GAAG,CAAC;QAC9B,WAAW;QACX,QAAQ;QACR,QAAQ;QACR,SAAS;QACT,QAAQ;KACR,CAAC,CAAC;IAEU,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,cAAc,CAAC,GAAG,CAAC,OAAO,KAAK,CAAC,CAAC;IAErG,UAAO,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,MAAM,CAAC,SAAS,CAAC,KAAe,CAAC,CAAC;IACjF,cAAW,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,MAAM,CAAC,aAAa,CAAC,KAAe,CAAC,CAAC;IAEzF,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE;QAC7C,0EAA0E;QAC1E,IAAI,SAAS,CAAC;QAEd,OAAO,aAAa,CAAC,KAAK,CAAC,0BAAoB;YAC9C,CAAC,SAAS,GAAG,MAAM,CAAC,cAAc,CAAC,KAAK,CAAC,EAAE,SAAS,KAAK,IAAI,IAAI,yCAAyC;gBACzG,SAAS,KAAK,MAAM,CAAC,cAAc,CAAC,EAAE,CAAC,CAAC,CAAC;IAC5C,CAAC,CAAC;IAEF,MAAM,eAAe,GAAG,IAAI,GAAG,CAAC;;;;;;;;;;KAU/B,CAAC,CAAC;IACU,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE;QACjE,MAAM,UAAU,GAAG,aAAa,CAAC,KAAK,CAAC,CAAC;QAExC,IAAI,UAAU,KAAK,IAAI,EAAE;YACxB,OAAO,KAAK,CAAC;SACb;QAED,OAAO,eAAe,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;IACxC,CAAC,CAAC;IAEF,MAAM,aAAa,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,KAAK,GAAG,CAAC,CAAC,CAAC;IAC9D,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,aAAa,CAAE,KAAmB,CAAC,MAAM,CAAC,CAAC;IAE/I,UAAO,GAAG,CAAC,KAAa,EAAE,KAAwB,EAAE,EAAE;QAClE,IAAI,GAAA,MAAM,CAAC,KAAK,CAAC,EAAE;YAClB,OAAO,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,CAAC,EAAE,KAAK,CAAC,IAAI,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;SAClE;QAED,IAAI,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,EAAE;YACvC,OAAO,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC,IAAI,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC,CAAC;SAClE;QAED,MAAM,IAAI,SAAS,CAAC,kBAAkB,IAAI,CAAC,SAAS,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC;IAChE,CAAC,CAAC;IAEF,MAAM,iBAAiB,GAAG,CAAC,CAAC;IAC5B,MAAM,uBAAuB,GAAG;QAC/B,WAAW;QACX,eAAe;QACf,OAAO;QACP,YAAY;QACZ,WAAW;KACX,CAAC;IAEW,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAK,KAAoB,CAAC,QAAQ,KAAK,iBAAiB,IAAI,GAAA,MAAM,CAAE,KAAoB,CAAC,QAAQ,CAAC;QACjL,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,uBAAuB,CAAC,KAAK,CAAC,QAAQ,CAAC,EAAE,CAAC,QAAQ,IAAK,KAAoB,CAAC,CAAC;IAExF,aAAU,GAAG,CAAC,KAAc,EAAE,EAAE;QAC5C,IAAI,CAAC,KAAK,EAAE;YACX,OAAO,KAAK,CAAC;SACb;QAED,IAAK,KAAa,CAAC,MAAM,CAAC,UAAU,CAAC,IAAI,KAAK,KAAM,KAAa,CAAC,MAAM,CAAC,UAAU,CAAC,EAAE,EAAE;YACvF,OAAO,IAAI,CAAC;SACZ;QAED,IAAK,KAAa,CAAC,cAAc,CAAC,IAAI,KAAK,KAAM,KAAa,CAAC,cAAc,CAAC,EAAE,EAAE;YACjF,OAAO,IAAI,CAAC;SACZ;QAED,OAAO,KAAK,CAAC;IACd,CAAC,CAAC;IAEW,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,QAAQ,CAAC,KAAK,CAAY,IAAI,GAAA,SAAS,CAAE,KAAoB,CAAC,IAAI,CAAC,IAAI,CAAC,GAAA,UAAU,CAAC,KAAK,CAAC,CAAC;IAE3K,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,KAAK,KAAK,QAAQ,IAAI,KAAK,KAAK,CAAC,QAAQ,CAAC;IAEtF,MAAM,cAAc,GAAG,CAAC,GAAW,EAAE,EAAE,CAAC,CAAC,KAAa,EAAE,EAAE,CAAC,GAAA,OAAO,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,GAAG,CAAC,CAAC,KAAK,GAAG,CAAC;IAC5F,OAAI,GAAG,cAAc,CAAC,CAAC,CAAC,CAAC;IACzB,MAAG,GAAG,cAAc,CAAC,CAAC,CAAC,CAAC;IAErC,MAAM,kBAAkB,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,KAAK,CAAC;IAE9E,aAAU,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,CAAC;IACpE,gBAAa,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;IAErE,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,CAAC;IACtE,iBAAc,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;IACvE,0BAAuB,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,kBAAkB,CAAC,KAAK,CAAC,CAAC;IAE9F,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,KAAK,CAAC,CAAC;IACjH,iBAAc,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,GAAG,CAAC,CAAC;IAElH,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,KAAK,CAAC,CAAC;IAC9D,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,GAAG,CAAC,CAAC;IAE/D,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,KAAK,CAAC,CAAC;IAC9D,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,GAAG,CAAC,CAAC;IAG5E,MAAM,gBAAgB,GAAG,CAAC,MAAmB,EAAE,SAAkB,EAAE,MAAiB,EAAE,EAAE;QACvF,IAAI,GAAA,SAAS,CAAC,SAAS,CAAC,KAAK,KAAK,EAAE;YACnC,MAAM,IAAI,SAAS,CAAC,sBAAsB,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,EAAE,CAAC,CAAC;SACvE;QAED,IAAI,MAAM,CAAC,MAAM,KAAK,CAAC,EAAE;YACxB,MAAM,IAAI,SAAS,CAAC,0BAA0B,CAAC,CAAC;SAChD;QAED,OAAO,MAAM,CAAC,IAAI,CAAC,MAAM,EAAE,SAAgB,CAAC,CAAC;IAC9C,CAAC,CAAC;IAEF,+BAA+B;IAClB,MAAG,GAAG,CAAC,SAAkB,EAAE,GAAG,MAAiB,EAAE,EAAE,CAAC,gBAAgB,CAAC,KAAK,CAAC,SAAS,CAAC,IAAI,EAAE,SAAS,EAAE,MAAM,CAAC,CAAC;IAC9G,MAAG,GAAG,CAAC,SAAkB,EAAE,GAAG,MAAiB,EAAE,EAAE,CAAC,gBAAgB,CAAC,KAAK,CAAC,SAAS,CAAC,KAAK,EAAE,SAAS,EAAE,MAAM,CAAC,CAAC;IAC5H,8BAA8B;AAC/B,CAAC,EAvNS,EAAE,KAAF,EAAE,QAuNX;AAED,4EAA4E;AAC5E,0DAA0D;AAC1D,MAAM,CAAC,gBAAgB,CAAC,EAAE,EAAE;IAC3B,KAAK,EAAE;QACN,KAAK,EAAE,EAAE,CAAC,MAAM;KAChB;IACD,QAAQ,EAAE;QACT,KAAK,EAAE,EAAE,CAAC,SAAS;KACnB;IACD,IAAI,EAAE;QACL,KAAK,EAAE,EAAE,CAAC,KAAK;KACf;CACD,CAAC,CAAC;AAEH,kBAAe,EAAE,CAAC;AAElB,sCAAsC;AACtC,MAAM,CAAC,OAAO,GAAG,EAAE,CAAC;AACpB,MAAM,CAAC,OAAO,CAAC,OAAO,GAAG,EAAE,CAAC"} \ No newline at end of file diff --git a/node_modules/@sindresorhus/is/license b/node_modules/@sindresorhus/is/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/@sindresorhus/is/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/@sindresorhus/is/package.json b/node_modules/@sindresorhus/is/package.json new file mode 100644 index 00000000..8d38a4ea --- /dev/null +++ b/node_modules/@sindresorhus/is/package.json @@ -0,0 +1,96 @@ +{ + "_from": "@sindresorhus/is@^0.14.0", + "_id": "@sindresorhus/is@0.14.0", + "_inBundle": false, + "_integrity": "sha512-9NET910DNaIPngYnLLPeg+Ogzqsi9uM4mSboU5y6p8S5DzMTVEsJZrawi+BoDNUVBa2DhJqQYUFvMDfgU062LQ==", + "_location": "/@sindresorhus/is", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@sindresorhus/is@^0.14.0", + "name": "@sindresorhus/is", + "escapedName": "@sindresorhus%2fis", + "scope": "@sindresorhus", + "rawSpec": "^0.14.0", + "saveSpec": null, + "fetchSpec": "^0.14.0" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/@sindresorhus/is/-/is-0.14.0.tgz", + "_shasum": "9fb3a3cf3132328151f353de4632e01e52102bea", + "_spec": "@sindresorhus/is@^0.14.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/got", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/is/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Type check values: `is.string('🦄') //=> true`", + "devDependencies": { + "@sindresorhus/tsconfig": "^0.1.0", + "@types/jsdom": "^11.12.0", + "@types/node": "^10.12.10", + "@types/tempy": "^0.2.0", + "@types/zen-observable": "^0.8.0", + "ava": "^0.25.0", + "del-cli": "^1.1.0", + "jsdom": "^11.6.2", + "rxjs": "^6.3.3", + "tempy": "^0.2.1", + "tslint": "^5.9.1", + "tslint-xo": "^0.10.0", + "typescript": "^3.2.1", + "zen-observable": "^0.8.8" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "dist" + ], + "homepage": "https://github.com/sindresorhus/is#readme", + "keywords": [ + "type", + "types", + "is", + "check", + "checking", + "validate", + "validation", + "utility", + "util", + "typeof", + "instanceof", + "object", + "assert", + "assertion", + "test", + "kind", + "primitive", + "verify", + "compare" + ], + "license": "MIT", + "main": "dist/index.js", + "name": "@sindresorhus/is", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/is.git" + }, + "scripts": { + "build": "del dist && tsc", + "lint": "tslint --format stylish --project .", + "prepublish": "npm run build && del dist/tests", + "test": "npm run lint && npm run build && ava dist/tests" + }, + "types": "dist/index.d.ts", + "version": "0.14.0" +} diff --git a/node_modules/@sindresorhus/is/readme.md b/node_modules/@sindresorhus/is/readme.md new file mode 100644 index 00000000..97c023b5 --- /dev/null +++ b/node_modules/@sindresorhus/is/readme.md @@ -0,0 +1,451 @@ +# is [![Build Status](https://travis-ci.org/sindresorhus/is.svg?branch=master)](https://travis-ci.org/sindresorhus/is) + +> Type check values: `is.string('🦄') //=> true` + + + + +## Install + +``` +$ npm install @sindresorhus/is +``` + + +## Usage + +```js +const is = require('@sindresorhus/is'); + +is('🦄'); +//=> 'string' + +is(new Map()); +//=> 'Map' + +is.number(6); +//=> true +``` + +When using `is` together with TypeScript, [type guards](http://www.typescriptlang.org/docs/handbook/advanced-types.html#type-guards-and-differentiating-types) are being used to infer the correct type inside if-else statements. + +```ts +import is from '@sindresorhus/is'; + +const padLeft = (value: string, padding: string | number) => { + if (is.number(padding)) { + // `padding` is typed as `number` + return Array(padding + 1).join(' ') + value; + } + + if (is.string(padding)) { + // `padding` is typed as `string` + return padding + value; + } + + throw new TypeError(`Expected 'padding' to be of type 'string' or 'number', got '${is(padding)}'.`); +} + +padLeft('🦄', 3); +//=> ' 🦄' + +padLeft('🦄', '🌈'); +//=> '🌈🦄' +``` + + +## API + +### is(value) + +Returns the type of `value`. + +Primitives are lowercase and object types are camelcase. + +Example: + +- `'undefined'` +- `'null'` +- `'string'` +- `'symbol'` +- `'Array'` +- `'Function'` +- `'Object'` + +Note: It will throw an error if you try to feed it object-wrapped primitives, as that's a bad practice. For example `new String('foo')`. + +### is.{method} + +All the below methods accept a value and returns a boolean for whether the value is of the desired type. + +#### Primitives + +##### .undefined(value) +##### .null(value) +##### .string(value) +##### .number(value) +##### .boolean(value) +##### .symbol(value) + +#### Built-in types + +##### .array(value) +##### .function(value) +##### .buffer(value) +##### .object(value) + +Keep in mind that [functions are objects too](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Functions). + +##### .numericString(value) + +Returns `true` for a string that represents a number. For example, `'42'` and `'-8'`. + +Note: `'NaN'` returns `false`, but `'Infinity'` and `'-Infinity'` return `true`. + +##### .regExp(value) +##### .date(value) +##### .error(value) +##### .nativePromise(value) +##### .promise(value) + +Returns `true` for any object with a `.then()` and `.catch()` method. Prefer this one over `.nativePromise()` as you usually want to allow userland promise implementations too. + +##### .generator(value) + +Returns `true` for any object that implements its own `.next()` and `.throw()` methods and has a function definition for `Symbol.iterator`. + +##### .generatorFunction(value) + +##### .asyncFunction(value) + +Returns `true` for any `async` function that can be called with the `await` operator. + +```js +is.asyncFunction(async () => {}); +// => true + +is.asyncFunction(() => {}); +// => false +``` + +##### .boundFunction(value) + +Returns `true` for any `bound` function. + +```js +is.boundFunction(() => {}); +// => true + +is.boundFunction(function () {}.bind(null)); +// => true + +is.boundFunction(function () {}); +// => false +``` + +##### .map(value) +##### .set(value) +##### .weakMap(value) +##### .weakSet(value) + +#### Typed arrays + +##### .int8Array(value) +##### .uint8Array(value) +##### .uint8ClampedArray(value) +##### .int16Array(value) +##### .uint16Array(value) +##### .int32Array(value) +##### .uint32Array(value) +##### .float32Array(value) +##### .float64Array(value) + +#### Structured data + +##### .arrayBuffer(value) +##### .sharedArrayBuffer(value) +##### .dataView(value) + +#### Emptiness + +##### .emptyString(value) + +Returns `true` if the value is a `string` and the `.length` is 0. + +##### .nonEmptyString(value) + +Returns `true` if the value is a `string` and the `.length` is more than 0. + +##### .emptyStringOrWhitespace(value) + +Returns `true` if `is.emptyString(value)` or if it's a `string` that is all whitespace. + +##### .emptyArray(value) + +Returns `true` if the value is an `Array` and the `.length` is 0. + +##### .nonEmptyArray(value) + +Returns `true` if the value is an `Array` and the `.length` is more than 0. + +##### .emptyObject(value) + +Returns `true` if the value is an `Object` and `Object.keys(value).length` is 0. + +Please note that `Object.keys` returns only own enumerable properties. Hence something like this can happen: + +```js +const object1 = {}; + +Object.defineProperty(object1, 'property1', { + value: 42, + writable: true, + enumerable: false, + configurable: true +}); + +is.emptyObject(object1); +// => true +``` + +##### .nonEmptyObject(value) + +Returns `true` if the value is an `Object` and `Object.keys(value).length` is more than 0. + +##### .emptySet(value) + +Returns `true` if the value is a `Set` and the `.size` is 0. + +##### .nonEmptySet(Value) + +Returns `true` if the value is a `Set` and the `.size` is more than 0. + +##### .emptyMap(value) + +Returns `true` if the value is a `Map` and the `.size` is 0. + +##### .nonEmptyMap(value) + +Returns `true` if the value is a `Map` and the `.size` is more than 0. + +#### Miscellaneous + +##### .directInstanceOf(value, class) + +Returns `true` if `value` is a direct instance of `class`. + +```js +is.directInstanceOf(new Error(), Error); +//=> true + +class UnicornError extends Error {} + +is.directInstanceOf(new UnicornError(), Error); +//=> false +``` + +##### .urlInstance(value) + +Returns `true` if `value` is an instance of the [`URL` class](https://developer.mozilla.org/en-US/docs/Web/API/URL). + +```js +const url = new URL('https://example.com'); + +is.urlInstance(url); +//=> true +``` + +### .url(value) + +Returns `true` if `value` is a URL string. + +Note: this only does basic checking using the [`URL` class](https://developer.mozilla.org/en-US/docs/Web/API/URL) constructor. + +```js +const url = 'https://example.com'; + +is.url(url); +//=> true + +is.url(new URL(url)); +//=> false +``` + +##### .truthy(value) + +Returns `true` for all values that evaluate to true in a boolean context: + +```js +is.truthy('🦄'); +//=> true + +is.truthy(undefined); +//=> false +``` + +##### .falsy(value) + +Returns `true` if `value` is one of: `false`, `0`, `''`, `null`, `undefined`, `NaN`. + +##### .nan(value) +##### .nullOrUndefined(value) +##### .primitive(value) + +JavaScript primitives are as follows: `null`, `undefined`, `string`, `number`, `boolean`, `symbol`. + +##### .integer(value) + +##### .safeInteger(value) + +Returns `true` if `value` is a [safe integer](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Number/isSafeInteger). + +##### .plainObject(value) + +An object is plain if it's created by either `{}`, `new Object()`, or `Object.create(null)`. + +##### .iterable(value) +##### .asyncIterable(value) +##### .class(value) + +Returns `true` for instances created by a class. + +##### .typedArray(value) + +##### .arrayLike(value) + +A `value` is array-like if it is not a function and has a `value.length` that is a safe integer greater than or equal to 0. + +```js +is.arrayLike(document.forms); +//=> true + +function foo() { + is.arrayLike(arguments); + //=> true +} +foo(); +``` + +##### .inRange(value, range) + +Check if `value` (number) is in the given `range`. The range is an array of two values, lower bound and upper bound, in no specific order. + +```js +is.inRange(3, [0, 5]); +is.inRange(3, [5, 0]); +is.inRange(0, [-2, 2]); +``` + +##### .inRange(value, upperBound) + +Check if `value` (number) is in the range of `0` to `upperBound`. + +```js +is.inRange(3, 10); +``` + +##### .domElement(value) + +Returns `true` if `value` is a DOM Element. + +##### .nodeStream(value) + +Returns `true` if `value` is a Node.js [stream](https://nodejs.org/api/stream.html). + +```js +const fs = require('fs'); + +is.nodeStream(fs.createReadStream('unicorn.png')); +//=> true +``` + +##### .observable(value) + +Returns `true` if `value` is an `Observable`. + +```js +const {Observable} = require('rxjs'); + +is.observable(new Observable()); +//=> true +``` + +##### .infinite(value) + +Check if `value` is `Infinity` or `-Infinity`. + +##### .even(value) + +Returns `true` if `value` is an even integer. + +##### .odd(value) + +Returns `true` if `value` is an odd integer. + +##### .any(predicate, ...values) + +Returns `true` if **any** of the input `values` returns true in the `predicate`: + +```js +is.any(is.string, {}, true, '🦄'); +//=> true + +is.any(is.boolean, 'unicorns', [], new Map()); +//=> false +``` + +##### .all(predicate, ...values) + +Returns `true` if **all** of the input `values` returns true in the `predicate`: + +```js +is.all(is.object, {}, new Map(), new Set()); +//=> true + +is.all(is.string, '🦄', [], 'unicorns'); +//=> false +``` + + +## FAQ + +### Why yet another type checking module? + +There are hundreds of type checking modules on npm, unfortunately, I couldn't find any that fit my needs: + +- Includes both type methods and ability to get the type +- Types of primitives returned as lowercase and object types as camelcase +- Covers all built-ins +- Unsurprising behavior +- Well-maintained +- Comprehensive test suite + +For the ones I found, pick 3 of these. + +The most common mistakes I noticed in these modules was using `instanceof` for type checking, forgetting that functions are objects, and omitting `symbol` as a primitive. + + +## Related + +- [ow](https://github.com/sindresorhus/ow) - Function argument validation for humans +- [is-stream](https://github.com/sindresorhus/is-stream) - Check if something is a Node.js stream +- [is-observable](https://github.com/sindresorhus/is-observable) - Check if a value is an Observable +- [file-type](https://github.com/sindresorhus/file-type) - Detect the file type of a Buffer/Uint8Array +- [is-ip](https://github.com/sindresorhus/is-ip) - Check if a string is an IP address +- [is-array-sorted](https://github.com/sindresorhus/is-array-sorted) - Check if an Array is sorted +- [is-error-constructor](https://github.com/sindresorhus/is-error-constructor) - Check if a value is an error constructor +- [is-empty-iterable](https://github.com/sindresorhus/is-empty-iterable) - Check if an Iterable is empty +- [is-blob](https://github.com/sindresorhus/is-blob) - Check if a value is a Blob - File-like object of immutable, raw data +- [has-emoji](https://github.com/sindresorhus/has-emoji) - Check whether a string has any emoji + + +## Created by + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Giora Guttsait](https://github.com/gioragutt) +- [Brandon Smith](https://github.com/brandon93s) + + +## License + +MIT diff --git a/node_modules/@szmarczak/http-timer/LICENSE b/node_modules/@szmarczak/http-timer/LICENSE new file mode 100755 index 00000000..15ad2e8d --- /dev/null +++ b/node_modules/@szmarczak/http-timer/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Szymon Marczak + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/@szmarczak/http-timer/README.md b/node_modules/@szmarczak/http-timer/README.md new file mode 100755 index 00000000..13279ed8 --- /dev/null +++ b/node_modules/@szmarczak/http-timer/README.md @@ -0,0 +1,70 @@ +# http-timer +> Timings for HTTP requests + +[![Build Status](https://travis-ci.org/szmarczak/http-timer.svg?branch=master)](https://travis-ci.org/szmarczak/http-timer) +[![Coverage Status](https://coveralls.io/repos/github/szmarczak/http-timer/badge.svg?branch=master)](https://coveralls.io/github/szmarczak/http-timer?branch=master) +[![install size](https://packagephobia.now.sh/badge?p=@szmarczak/http-timer)](https://packagephobia.now.sh/result?p=@szmarczak/http-timer) + +Inspired by the [`request` package](https://github.com/request/request). + +## Usage +```js +'use strict'; +const https = require('https'); +const timer = require('@szmarczak/http-timer'); + +const request = https.get('https://httpbin.org/anything'); +const timings = timer(request); + +request.on('response', response => { + response.on('data', () => {}); // Consume the data somehow + response.on('end', () => { + console.log(timings); + }); +}); + +// { start: 1535708511443, +// socket: 1535708511444, +// lookup: 1535708511444, +// connect: 1535708511582, +// upload: 1535708511887, +// response: 1535708512037, +// end: 1535708512040, +// phases: +// { wait: 1, +// dns: 0, +// tcp: 138, +// request: 305, +// firstByte: 150, +// download: 3, +// total: 597 } } +``` + +## API + +### timer(request) + +Returns: `Object` + +- `start` - Time when the request started. +- `socket` - Time when a socket was assigned to the request. +- `lookup` - Time when the DNS lookup finished. +- `connect` - Time when the socket successfully connected. +- `upload` - Time when the request finished uploading. +- `response` - Time when the request fired the `response` event. +- `end` - Time when the response fired the `end` event. +- `error` - Time when the request fired the `error` event. +- `phases` + - `wait` - `timings.socket - timings.start` + - `dns` - `timings.lookup - timings.socket` + - `tcp` - `timings.connect - timings.lookup` + - `request` - `timings.upload - timings.connect` + - `firstByte` - `timings.response - timings.upload` + - `download` - `timings.end - timings.response` + - `total` - `timings.end - timings.start` or `timings.error - timings.start` + +**Note**: The time is a `number` representing the milliseconds elapsed since the UNIX epoch. + +## License + +MIT diff --git a/node_modules/@szmarczak/http-timer/package.json b/node_modules/@szmarczak/http-timer/package.json new file mode 100755 index 00000000..ee2b3fbf --- /dev/null +++ b/node_modules/@szmarczak/http-timer/package.json @@ -0,0 +1,75 @@ +{ + "_from": "@szmarczak/http-timer@^1.1.2", + "_id": "@szmarczak/http-timer@1.1.2", + "_inBundle": false, + "_integrity": "sha512-XIB2XbzHTN6ieIjfIMV9hlVcfPU26s2vafYWQcZHWXHOxiaRZYEDKEwdl129Zyg50+foYV2jCgtrqSA6qNuNSA==", + "_location": "/@szmarczak/http-timer", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@szmarczak/http-timer@^1.1.2", + "name": "@szmarczak/http-timer", + "escapedName": "@szmarczak%2fhttp-timer", + "scope": "@szmarczak", + "rawSpec": "^1.1.2", + "saveSpec": null, + "fetchSpec": "^1.1.2" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/@szmarczak/http-timer/-/http-timer-1.1.2.tgz", + "_shasum": "b1665e2c461a2cd92f4c1bbf50d5454de0d4b421", + "_spec": "@szmarczak/http-timer@^1.1.2", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/got", + "author": { + "name": "Szymon Marczak" + }, + "bugs": { + "url": "https://github.com/szmarczak/http-timer/issues" + }, + "bundleDependencies": false, + "dependencies": { + "defer-to-connect": "^1.0.1" + }, + "deprecated": false, + "description": "Timings for HTTP requests", + "devDependencies": { + "ava": "^0.25.0", + "coveralls": "^3.0.2", + "nyc": "^12.0.2", + "p-event": "^2.1.0", + "xo": "^0.22.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "source" + ], + "homepage": "https://github.com/szmarczak/http-timer#readme", + "keywords": [ + "http", + "https", + "timer", + "timings" + ], + "license": "MIT", + "main": "source", + "name": "@szmarczak/http-timer", + "repository": { + "type": "git", + "url": "git+https://github.com/szmarczak/http-timer.git" + }, + "scripts": { + "coveralls": "nyc report --reporter=text-lcov | coveralls", + "test": "xo && nyc ava" + }, + "version": "1.1.2", + "xo": { + "rules": { + "unicorn/filename-case": "camelCase" + } + } +} diff --git a/node_modules/@szmarczak/http-timer/source/index.js b/node_modules/@szmarczak/http-timer/source/index.js new file mode 100755 index 00000000..e2945804 --- /dev/null +++ b/node_modules/@szmarczak/http-timer/source/index.js @@ -0,0 +1,99 @@ +'use strict'; +const deferToConnect = require('defer-to-connect'); + +module.exports = request => { + const timings = { + start: Date.now(), + socket: null, + lookup: null, + connect: null, + upload: null, + response: null, + end: null, + error: null, + phases: { + wait: null, + dns: null, + tcp: null, + request: null, + firstByte: null, + download: null, + total: null + } + }; + + const handleError = origin => { + const emit = origin.emit.bind(origin); + origin.emit = (event, ...args) => { + // Catches the `error` event + if (event === 'error') { + timings.error = Date.now(); + timings.phases.total = timings.error - timings.start; + + origin.emit = emit; + } + + // Saves the original behavior + return emit(event, ...args); + }; + }; + + let uploadFinished = false; + const onUpload = () => { + timings.upload = Date.now(); + timings.phases.request = timings.upload - timings.connect; + }; + + handleError(request); + + request.once('socket', socket => { + timings.socket = Date.now(); + timings.phases.wait = timings.socket - timings.start; + + const lookupListener = () => { + timings.lookup = Date.now(); + timings.phases.dns = timings.lookup - timings.socket; + }; + + socket.once('lookup', lookupListener); + + deferToConnect(socket, () => { + timings.connect = Date.now(); + + if (timings.lookup === null) { + socket.removeListener('lookup', lookupListener); + timings.lookup = timings.connect; + timings.phases.dns = timings.lookup - timings.socket; + } + + timings.phases.tcp = timings.connect - timings.lookup; + + if (uploadFinished && !timings.upload) { + onUpload(); + } + }); + }); + + request.once('finish', () => { + uploadFinished = true; + + if (timings.connect) { + onUpload(); + } + }); + + request.once('response', response => { + timings.response = Date.now(); + timings.phases.firstByte = timings.response - timings.upload; + + handleError(response); + + response.once('end', () => { + timings.end = Date.now(); + timings.phases.download = timings.end - timings.response; + timings.phases.total = timings.end - timings.start; + }); + }); + + return timings; +}; diff --git a/node_modules/abbrev/LICENSE b/node_modules/abbrev/LICENSE new file mode 100644 index 00000000..9bcfa9d7 --- /dev/null +++ b/node_modules/abbrev/LICENSE @@ -0,0 +1,46 @@ +This software is dual-licensed under the ISC and MIT licenses. +You may use this software under EITHER of the following licenses. + +---------- + +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +---------- + +Copyright Isaac Z. Schlueter and Contributors +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/abbrev/README.md b/node_modules/abbrev/README.md new file mode 100644 index 00000000..99746fe6 --- /dev/null +++ b/node_modules/abbrev/README.md @@ -0,0 +1,23 @@ +# abbrev-js + +Just like [ruby's Abbrev](http://apidock.com/ruby/Abbrev). + +Usage: + + var abbrev = require("abbrev"); + abbrev("foo", "fool", "folding", "flop"); + + // returns: + { fl: 'flop' + , flo: 'flop' + , flop: 'flop' + , fol: 'folding' + , fold: 'folding' + , foldi: 'folding' + , foldin: 'folding' + , folding: 'folding' + , foo: 'foo' + , fool: 'fool' + } + +This is handy for command-line scripts, or other cases where you want to be able to accept shorthands. diff --git a/node_modules/abbrev/abbrev.js b/node_modules/abbrev/abbrev.js new file mode 100644 index 00000000..7b1dc5d6 --- /dev/null +++ b/node_modules/abbrev/abbrev.js @@ -0,0 +1,61 @@ +module.exports = exports = abbrev.abbrev = abbrev + +abbrev.monkeyPatch = monkeyPatch + +function monkeyPatch () { + Object.defineProperty(Array.prototype, 'abbrev', { + value: function () { return abbrev(this) }, + enumerable: false, configurable: true, writable: true + }) + + Object.defineProperty(Object.prototype, 'abbrev', { + value: function () { return abbrev(Object.keys(this)) }, + enumerable: false, configurable: true, writable: true + }) +} + +function abbrev (list) { + if (arguments.length !== 1 || !Array.isArray(list)) { + list = Array.prototype.slice.call(arguments, 0) + } + for (var i = 0, l = list.length, args = [] ; i < l ; i ++) { + args[i] = typeof list[i] === "string" ? list[i] : String(list[i]) + } + + // sort them lexicographically, so that they're next to their nearest kin + args = args.sort(lexSort) + + // walk through each, seeing how much it has in common with the next and previous + var abbrevs = {} + , prev = "" + for (var i = 0, l = args.length ; i < l ; i ++) { + var current = args[i] + , next = args[i + 1] || "" + , nextMatches = true + , prevMatches = true + if (current === next) continue + for (var j = 0, cl = current.length ; j < cl ; j ++) { + var curChar = current.charAt(j) + nextMatches = nextMatches && curChar === next.charAt(j) + prevMatches = prevMatches && curChar === prev.charAt(j) + if (!nextMatches && !prevMatches) { + j ++ + break + } + } + prev = current + if (j === cl) { + abbrevs[current] = current + continue + } + for (var a = current.substr(0, j) ; j <= cl ; j ++) { + abbrevs[a] = current + a += current.charAt(j) + } + } + return abbrevs +} + +function lexSort (a, b) { + return a === b ? 0 : a > b ? 1 : -1 +} diff --git a/node_modules/abbrev/package.json b/node_modules/abbrev/package.json new file mode 100644 index 00000000..f0ea7a94 --- /dev/null +++ b/node_modules/abbrev/package.json @@ -0,0 +1,56 @@ +{ + "_from": "abbrev@1", + "_id": "abbrev@1.1.1", + "_inBundle": false, + "_integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==", + "_location": "/abbrev", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "abbrev@1", + "name": "abbrev", + "escapedName": "abbrev", + "rawSpec": "1", + "saveSpec": null, + "fetchSpec": "1" + }, + "_requiredBy": [ + "/nopt" + ], + "_resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", + "_shasum": "f8f2c887ad10bf67f634f005b6987fed3179aac8", + "_spec": "abbrev@1", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/nopt", + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me" + }, + "bugs": { + "url": "https://github.com/isaacs/abbrev-js/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Like ruby's abbrev module, but in js", + "devDependencies": { + "tap": "^10.1" + }, + "files": [ + "abbrev.js" + ], + "homepage": "https://github.com/isaacs/abbrev-js#readme", + "license": "ISC", + "main": "abbrev.js", + "name": "abbrev", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/isaacs/abbrev-js.git" + }, + "scripts": { + "postpublish": "git push origin --all; git push origin --tags", + "postversion": "npm publish", + "preversion": "npm test", + "test": "tap test.js --100" + }, + "version": "1.1.1" +} diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md new file mode 100644 index 00000000..0bf04178 --- /dev/null +++ b/node_modules/accepts/HISTORY.md @@ -0,0 +1,236 @@ +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE new file mode 100644 index 00000000..06166077 --- /dev/null +++ b/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md new file mode 100644 index 00000000..66a2f540 --- /dev/null +++ b/node_modules/accepts/README.md @@ -0,0 +1,142 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + + + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts +[travis-image]: https://badgen.net/travis/jshttp/accepts/master +[travis-url]: https://travis-ci.org/jshttp/accepts diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js new file mode 100644 index 00000000..e9b2f63f --- /dev/null +++ b/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json new file mode 100644 index 00000000..b5252ef8 --- /dev/null +++ b/node_modules/accepts/package.json @@ -0,0 +1,86 @@ +{ + "_from": "accepts@~1.3.7", + "_id": "accepts@1.3.7", + "_inBundle": false, + "_integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "_location": "/accepts", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "accepts@~1.3.7", + "name": "accepts", + "escapedName": "accepts", + "rawSpec": "~1.3.7", + "saveSpec": null, + "fetchSpec": "~1.3.7" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "_shasum": "531bc726517a3b2b41f850021c6cc15eaab507cd", + "_spec": "accepts@~1.3.7", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + }, + "deprecated": false, + "description": "Higher-level content negotiation", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "name": "accepts", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "1.3.7" +} diff --git a/node_modules/agent-base/README.md b/node_modules/agent-base/README.md new file mode 100644 index 00000000..256f1f32 --- /dev/null +++ b/node_modules/agent-base/README.md @@ -0,0 +1,145 @@ +agent-base +========== +### Turn a function into an [`http.Agent`][http.Agent] instance +[![Build Status](https://github.com/TooTallNate/node-agent-base/workflows/Node%20CI/badge.svg)](https://github.com/TooTallNate/node-agent-base/actions?workflow=Node+CI) + +This module provides an `http.Agent` generator. That is, you pass it an async +callback function, and it returns a new `http.Agent` instance that will invoke the +given callback function when sending outbound HTTP requests. + +#### Some subclasses: + +Here's some more interesting uses of `agent-base`. +Send a pull request to list yours! + + * [`http-proxy-agent`][http-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTP endpoints + * [`https-proxy-agent`][https-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTPS endpoints + * [`pac-proxy-agent`][pac-proxy-agent]: A PAC file proxy `http.Agent` implementation for HTTP and HTTPS + * [`socks-proxy-agent`][socks-proxy-agent]: A SOCKS proxy `http.Agent` implementation for HTTP and HTTPS + + +Installation +------------ + +Install with `npm`: + +``` bash +$ npm install agent-base +``` + + +Example +------- + +Here's a minimal example that creates a new `net.Socket` connection to the server +for every HTTP request (i.e. the equivalent of `agent: false` option): + +```js +var net = require('net'); +var tls = require('tls'); +var url = require('url'); +var http = require('http'); +var agent = require('agent-base'); + +var endpoint = 'http://nodejs.org/api/'; +var parsed = url.parse(endpoint); + +// This is the important part! +parsed.agent = agent(function (req, opts) { + var socket; + // `secureEndpoint` is true when using the https module + if (opts.secureEndpoint) { + socket = tls.connect(opts); + } else { + socket = net.connect(opts); + } + return socket; +}); + +// Everything else works just like normal... +http.get(parsed, function (res) { + console.log('"response" event!', res.headers); + res.pipe(process.stdout); +}); +``` + +Returning a Promise or using an `async` function is also supported: + +```js +agent(async function (req, opts) { + await sleep(1000); + // etc… +}); +``` + +Return another `http.Agent` instance to "pass through" the responsibility +for that HTTP request to that agent: + +```js +agent(function (req, opts) { + return opts.secureEndpoint ? https.globalAgent : http.globalAgent; +}); +``` + + +API +--- + +## Agent(Function callback[, Object options]) → [http.Agent][] + +Creates a base `http.Agent` that will execute the callback function `callback` +for every HTTP request that it is used as the `agent` for. The callback function +is responsible for creating a `stream.Duplex` instance of some kind that will be +used as the underlying socket in the HTTP request. + +The `options` object accepts the following properties: + + * `timeout` - Number - Timeout for the `callback()` function in milliseconds. Defaults to Infinity (optional). + +The callback function should have the following signature: + +### callback(http.ClientRequest req, Object options, Function cb) → undefined + +The ClientRequest `req` can be accessed to read request headers and +and the path, etc. The `options` object contains the options passed +to the `http.request()`/`https.request()` function call, and is formatted +to be directly passed to `net.connect()`/`tls.connect()`, or however +else you want a Socket to be created. Pass the created socket to +the callback function `cb` once created, and the HTTP request will +continue to proceed. + +If the `https` module is used to invoke the HTTP request, then the +`secureEndpoint` property on `options` _will be set to `true`_. + + +License +------- + +(The MIT License) + +Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +[http-proxy-agent]: https://github.com/TooTallNate/node-http-proxy-agent +[https-proxy-agent]: https://github.com/TooTallNate/node-https-proxy-agent +[pac-proxy-agent]: https://github.com/TooTallNate/node-pac-proxy-agent +[socks-proxy-agent]: https://github.com/TooTallNate/node-socks-proxy-agent +[http.Agent]: https://nodejs.org/api/http.html#http_class_http_agent diff --git a/node_modules/agent-base/dist/src/index.d.ts b/node_modules/agent-base/dist/src/index.d.ts new file mode 100644 index 00000000..bc4ab744 --- /dev/null +++ b/node_modules/agent-base/dist/src/index.d.ts @@ -0,0 +1,78 @@ +/// +import net from 'net'; +import http from 'http'; +import https from 'https'; +import { Duplex } from 'stream'; +import { EventEmitter } from 'events'; +declare function createAgent(opts?: createAgent.AgentOptions): createAgent.Agent; +declare function createAgent(callback: createAgent.AgentCallback, opts?: createAgent.AgentOptions): createAgent.Agent; +declare namespace createAgent { + interface ClientRequest extends http.ClientRequest { + _last?: boolean; + _hadError?: boolean; + method: string; + } + interface AgentRequestOptions { + host?: string; + path?: string; + port: number; + } + interface HttpRequestOptions extends AgentRequestOptions, Omit { + secureEndpoint: false; + } + interface HttpsRequestOptions extends AgentRequestOptions, Omit { + secureEndpoint: true; + } + type RequestOptions = HttpRequestOptions | HttpsRequestOptions; + type AgentLike = Pick | http.Agent; + type AgentCallbackReturn = Duplex | AgentLike; + type AgentCallbackCallback = (err?: Error | null, socket?: createAgent.AgentCallbackReturn) => void; + type AgentCallbackPromise = (req: createAgent.ClientRequest, opts: createAgent.RequestOptions) => createAgent.AgentCallbackReturn | Promise; + type AgentCallback = typeof Agent.prototype.callback; + type AgentOptions = { + timeout?: number; + }; + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + class Agent extends EventEmitter { + timeout: number | null; + maxFreeSockets: number; + maxTotalSockets: number; + maxSockets: number; + sockets: { + [key: string]: net.Socket[]; + }; + freeSockets: { + [key: string]: net.Socket[]; + }; + requests: { + [key: string]: http.IncomingMessage[]; + }; + options: https.AgentOptions; + private promisifiedCallback?; + private explicitDefaultPort?; + private explicitProtocol?; + constructor(callback?: createAgent.AgentCallback | createAgent.AgentOptions, _opts?: createAgent.AgentOptions); + get defaultPort(): number; + set defaultPort(v: number); + get protocol(): string; + set protocol(v: string); + callback(req: createAgent.ClientRequest, opts: createAgent.RequestOptions, fn: createAgent.AgentCallbackCallback): void; + callback(req: createAgent.ClientRequest, opts: createAgent.RequestOptions): createAgent.AgentCallbackReturn | Promise; + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req: ClientRequest, _opts: RequestOptions): void; + freeSocket(socket: net.Socket, opts: AgentOptions): void; + destroy(): void; + } +} +export = createAgent; diff --git a/node_modules/agent-base/dist/src/index.js b/node_modules/agent-base/dist/src/index.js new file mode 100644 index 00000000..bfd9e220 --- /dev/null +++ b/node_modules/agent-base/dist/src/index.js @@ -0,0 +1,203 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +const events_1 = require("events"); +const debug_1 = __importDefault(require("debug")); +const promisify_1 = __importDefault(require("./promisify")); +const debug = debug_1.default('agent-base'); +function isAgent(v) { + return Boolean(v) && typeof v.addRequest === 'function'; +} +function isSecureEndpoint() { + const { stack } = new Error(); + if (typeof stack !== 'string') + return false; + return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1); +} +function createAgent(callback, opts) { + return new createAgent.Agent(callback, opts); +} +(function (createAgent) { + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + class Agent extends events_1.EventEmitter { + constructor(callback, _opts) { + super(); + let opts = _opts; + if (typeof callback === 'function') { + this.callback = callback; + } + else if (callback) { + opts = callback; + } + // Timeout for the socket to be returned from the callback + this.timeout = null; + if (opts && typeof opts.timeout === 'number') { + this.timeout = opts.timeout; + } + // These aren't actually used by `agent-base`, but are required + // for the TypeScript definition files in `@types/node` :/ + this.maxFreeSockets = 1; + this.maxSockets = 1; + this.maxTotalSockets = Infinity; + this.sockets = {}; + this.freeSockets = {}; + this.requests = {}; + this.options = {}; + } + get defaultPort() { + if (typeof this.explicitDefaultPort === 'number') { + return this.explicitDefaultPort; + } + return isSecureEndpoint() ? 443 : 80; + } + set defaultPort(v) { + this.explicitDefaultPort = v; + } + get protocol() { + if (typeof this.explicitProtocol === 'string') { + return this.explicitProtocol; + } + return isSecureEndpoint() ? 'https:' : 'http:'; + } + set protocol(v) { + this.explicitProtocol = v; + } + callback(req, opts, fn) { + throw new Error('"agent-base" has no default implementation, you must subclass and override `callback()`'); + } + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req, _opts) { + const opts = Object.assign({}, _opts); + if (typeof opts.secureEndpoint !== 'boolean') { + opts.secureEndpoint = isSecureEndpoint(); + } + if (opts.host == null) { + opts.host = 'localhost'; + } + if (opts.port == null) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + if (opts.protocol == null) { + opts.protocol = opts.secureEndpoint ? 'https:' : 'http:'; + } + if (opts.host && opts.path) { + // If both a `host` and `path` are specified then it's most + // likely the result of a `url.parse()` call... we need to + // remove the `path` portion so that `net.connect()` doesn't + // attempt to open that as a unix socket file. + delete opts.path; + } + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + // Hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + let timedOut = false; + let timeoutId = null; + const timeoutMs = opts.timeout || this.timeout; + const onerror = (err) => { + if (req._hadError) + return; + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + }; + const ontimeout = () => { + timeoutId = null; + timedOut = true; + const err = new Error(`A "socket" was not created for HTTP request before ${timeoutMs}ms`); + err.code = 'ETIMEOUT'; + onerror(err); + }; + const callbackError = (err) => { + if (timedOut) + return; + if (timeoutId !== null) { + clearTimeout(timeoutId); + timeoutId = null; + } + onerror(err); + }; + const onsocket = (socket) => { + if (timedOut) + return; + if (timeoutId != null) { + clearTimeout(timeoutId); + timeoutId = null; + } + if (isAgent(socket)) { + // `socket` is actually an `http.Agent` instance, so + // relinquish responsibility for this `req` to the Agent + // from here on + debug('Callback returned another Agent instance %o', socket.constructor.name); + socket.addRequest(req, opts); + return; + } + if (socket) { + socket.once('free', () => { + this.freeSocket(socket, opts); + }); + req.onSocket(socket); + return; + } + const err = new Error(`no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\``); + onerror(err); + }; + if (typeof this.callback !== 'function') { + onerror(new Error('`callback` is not defined')); + return; + } + if (!this.promisifiedCallback) { + if (this.callback.length >= 3) { + debug('Converting legacy callback function to promise'); + this.promisifiedCallback = promisify_1.default(this.callback); + } + else { + this.promisifiedCallback = this.callback; + } + } + if (typeof timeoutMs === 'number' && timeoutMs > 0) { + timeoutId = setTimeout(ontimeout, timeoutMs); + } + if ('port' in opts && typeof opts.port !== 'number') { + opts.port = Number(opts.port); + } + try { + debug('Resolving socket for %o request: %o', opts.protocol, `${req.method} ${req.path}`); + Promise.resolve(this.promisifiedCallback(req, opts)).then(onsocket, callbackError); + } + catch (err) { + Promise.reject(err).catch(callbackError); + } + } + freeSocket(socket, opts) { + debug('Freeing socket %o %o', socket.constructor.name, opts); + socket.destroy(); + } + destroy() { + debug('Destroying agent %o', this.constructor.name); + } + } + createAgent.Agent = Agent; + // So that `instanceof` works correctly + createAgent.prototype = createAgent.Agent.prototype; +})(createAgent || (createAgent = {})); +module.exports = createAgent; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/node_modules/agent-base/dist/src/index.js.map b/node_modules/agent-base/dist/src/index.js.map new file mode 100644 index 00000000..bd118ab6 --- /dev/null +++ b/node_modules/agent-base/dist/src/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":";;;;AAIA,mCAAsC;AACtC,kDAAgC;AAChC,4DAAoC;AAEpC,MAAM,KAAK,GAAG,eAAW,CAAC,YAAY,CAAC,CAAC;AAExC,SAAS,OAAO,CAAC,CAAM;IACtB,OAAO,OAAO,CAAC,CAAC,CAAC,IAAI,OAAO,CAAC,CAAC,UAAU,KAAK,UAAU,CAAC;AACzD,CAAC;AAED,SAAS,gBAAgB;IACxB,MAAM,EAAE,KAAK,EAAE,GAAG,IAAI,KAAK,EAAE,CAAC;IAC9B,IAAI,OAAO,KAAK,KAAK,QAAQ;QAAE,OAAO,KAAK,CAAC;IAC5C,OAAO,KAAK,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,OAAO,CAAC,YAAY,CAAC,KAAK,CAAC,CAAC,IAAK,CAAC,CAAC,OAAO,CAAC,aAAa,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;AACxG,CAAC;AAOD,SAAS,WAAW,CACnB,QAA+D,EAC/D,IAA+B;IAE/B,OAAO,IAAI,WAAW,CAAC,KAAK,CAAC,QAAQ,EAAE,IAAI,CAAC,CAAC;AAC9C,CAAC;AAED,WAAU,WAAW;IAmDpB;;;;;;OAMG;IACH,MAAa,KAAM,SAAQ,qBAAY;QAmBtC,YACC,QAA+D,EAC/D,KAAgC;YAEhC,KAAK,EAAE,CAAC;YAER,IAAI,IAAI,GAAG,KAAK,CAAC;YACjB,IAAI,OAAO,QAAQ,KAAK,UAAU,EAAE;gBACnC,IAAI,CAAC,QAAQ,GAAG,QAAQ,CAAC;aACzB;iBAAM,IAAI,QAAQ,EAAE;gBACpB,IAAI,GAAG,QAAQ,CAAC;aAChB;YAED,0DAA0D;YAC1D,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC;YACpB,IAAI,IAAI,IAAI,OAAO,IAAI,CAAC,OAAO,KAAK,QAAQ,EAAE;gBAC7C,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;aAC5B;YAED,+DAA+D;YAC/D,0DAA0D;YAC1D,IAAI,CAAC,cAAc,GAAG,CAAC,CAAC;YACxB,IAAI,CAAC,UAAU,GAAG,CAAC,CAAC;YACpB,IAAI,CAAC,eAAe,GAAG,QAAQ,CAAC;YAChC,IAAI,CAAC,OAAO,GAAG,EAAE,CAAC;YAClB,IAAI,CAAC,WAAW,GAAG,EAAE,CAAC;YACtB,IAAI,CAAC,QAAQ,GAAG,EAAE,CAAC;YACnB,IAAI,CAAC,OAAO,GAAG,EAAE,CAAC;QACnB,CAAC;QAED,IAAI,WAAW;YACd,IAAI,OAAO,IAAI,CAAC,mBAAmB,KAAK,QAAQ,EAAE;gBACjD,OAAO,IAAI,CAAC,mBAAmB,CAAC;aAChC;YACD,OAAO,gBAAgB,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;QACtC,CAAC;QAED,IAAI,WAAW,CAAC,CAAS;YACxB,IAAI,CAAC,mBAAmB,GAAG,CAAC,CAAC;QAC9B,CAAC;QAED,IAAI,QAAQ;YACX,IAAI,OAAO,IAAI,CAAC,gBAAgB,KAAK,QAAQ,EAAE;gBAC9C,OAAO,IAAI,CAAC,gBAAgB,CAAC;aAC7B;YACD,OAAO,gBAAgB,EAAE,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;QAChD,CAAC;QAED,IAAI,QAAQ,CAAC,CAAS;YACrB,IAAI,CAAC,gBAAgB,GAAG,CAAC,CAAC;QAC3B,CAAC;QAaD,QAAQ,CACP,GAA8B,EAC9B,IAA8B,EAC9B,EAAsC;YAKtC,MAAM,IAAI,KAAK,CACd,yFAAyF,CACzF,CAAC;QACH,CAAC;QAED;;;;;WAKG;QACH,UAAU,CAAC,GAAkB,EAAE,KAAqB;YACnD,MAAM,IAAI,qBAAwB,KAAK,CAAE,CAAC;YAE1C,IAAI,OAAO,IAAI,CAAC,cAAc,KAAK,SAAS,EAAE;gBAC7C,IAAI,CAAC,cAAc,GAAG,gBAAgB,EAAE,CAAC;aACzC;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,EAAE;gBACtB,IAAI,CAAC,IAAI,GAAG,WAAW,CAAC;aACxB;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,EAAE;gBACtB,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;aAC3C;YAED,IAAI,IAAI,CAAC,QAAQ,IAAI,IAAI,EAAE;gBAC1B,IAAI,CAAC,QAAQ,GAAG,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;aACzD;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,CAAC,IAAI,EAAE;gBAC3B,2DAA2D;gBAC3D,0DAA0D;gBAC1D,4DAA4D;gBAC5D,8CAA8C;gBAC9C,OAAO,IAAI,CAAC,IAAI,CAAC;aACjB;YAED,OAAO,IAAI,CAAC,KAAK,CAAC;YAClB,OAAO,IAAI,CAAC,QAAQ,CAAC;YACrB,OAAO,IAAI,CAAC,aAAa,CAAC;YAC1B,OAAO,IAAI,CAAC,WAAW,CAAC;YACxB,OAAO,IAAI,CAAC,gBAAgB,CAAC;YAE7B,kCAAkC;YAClC,2CAA2C;YAC3C,GAAG,CAAC,KAAK,GAAG,IAAI,CAAC;YACjB,GAAG,CAAC,eAAe,GAAG,KAAK,CAAC;YAE5B,IAAI,QAAQ,GAAG,KAAK,CAAC;YACrB,IAAI,SAAS,GAAyC,IAAI,CAAC;YAC3D,MAAM,SAAS,GAAG,IAAI,CAAC,OAAO,IAAI,IAAI,CAAC,OAAO,CAAC;YAE/C,MAAM,OAAO,GAAG,CAAC,GAA0B,EAAE,EAAE;gBAC9C,IAAI,GAAG,CAAC,SAAS;oBAAE,OAAO;gBAC1B,GAAG,CAAC,IAAI,CAAC,OAAO,EAAE,GAAG,CAAC,CAAC;gBACvB,yDAAyD;gBACzD,iEAAiE;gBACjE,GAAG,CAAC,SAAS,GAAG,IAAI,CAAC;YACtB,CAAC,CAAC;YAEF,MAAM,SAAS,GAAG,GAAG,EAAE;gBACtB,SAAS,GAAG,IAAI,CAAC;gBACjB,QAAQ,GAAG,IAAI,CAAC;gBAChB,MAAM,GAAG,GAA0B,IAAI,KAAK,CAC3C,sDAAsD,SAAS,IAAI,CACnE,CAAC;gBACF,GAAG,CAAC,IAAI,GAAG,UAAU,CAAC;gBACtB,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,MAAM,aAAa,GAAG,CAAC,GAA0B,EAAE,EAAE;gBACpD,IAAI,QAAQ;oBAAE,OAAO;gBACrB,IAAI,SAAS,KAAK,IAAI,EAAE;oBACvB,YAAY,CAAC,SAAS,CAAC,CAAC;oBACxB,SAAS,GAAG,IAAI,CAAC;iBACjB;gBACD,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,MAAM,QAAQ,GAAG,CAAC,MAA2B,EAAE,EAAE;gBAChD,IAAI,QAAQ;oBAAE,OAAO;gBACrB,IAAI,SAAS,IAAI,IAAI,EAAE;oBACtB,YAAY,CAAC,SAAS,CAAC,CAAC;oBACxB,SAAS,GAAG,IAAI,CAAC;iBACjB;gBAED,IAAI,OAAO,CAAC,MAAM,CAAC,EAAE;oBACpB,oDAAoD;oBACpD,wDAAwD;oBACxD,eAAe;oBACf,KAAK,CACJ,6CAA6C,EAC7C,MAAM,CAAC,WAAW,CAAC,IAAI,CACvB,CAAC;oBACD,MAA4B,CAAC,UAAU,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC;oBACpD,OAAO;iBACP;gBAED,IAAI,MAAM,EAAE;oBACX,MAAM,CAAC,IAAI,CAAC,MAAM,EAAE,GAAG,EAAE;wBACxB,IAAI,CAAC,UAAU,CAAC,MAAoB,EAAE,IAAI,CAAC,CAAC;oBAC7C,CAAC,CAAC,CAAC;oBACH,GAAG,CAAC,QAAQ,CAAC,MAAoB,CAAC,CAAC;oBACnC,OAAO;iBACP;gBAED,MAAM,GAAG,GAAG,IAAI,KAAK,CACpB,qDAAqD,GAAG,CAAC,MAAM,IAAI,GAAG,CAAC,IAAI,IAAI,CAC/E,CAAC;gBACF,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,IAAI,OAAO,IAAI,CAAC,QAAQ,KAAK,UAAU,EAAE;gBACxC,OAAO,CAAC,IAAI,KAAK,CAAC,2BAA2B,CAAC,CAAC,CAAC;gBAChD,OAAO;aACP;YAED,IAAI,CAAC,IAAI,CAAC,mBAAmB,EAAE;gBAC9B,IAAI,IAAI,CAAC,QAAQ,CAAC,MAAM,IAAI,CAAC,EAAE;oBAC9B,KAAK,CAAC,gDAAgD,CAAC,CAAC;oBACxD,IAAI,CAAC,mBAAmB,GAAG,mBAAS,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;iBACpD;qBAAM;oBACN,IAAI,CAAC,mBAAmB,GAAG,IAAI,CAAC,QAAQ,CAAC;iBACzC;aACD;YAED,IAAI,OAAO,SAAS,KAAK,QAAQ,IAAI,SAAS,GAAG,CAAC,EAAE;gBACnD,SAAS,GAAG,UAAU,CAAC,SAAS,EAAE,SAAS,CAAC,CAAC;aAC7C;YAED,IAAI,MAAM,IAAI,IAAI,IAAI,OAAO,IAAI,CAAC,IAAI,KAAK,QAAQ,EAAE;gBACpD,IAAI,CAAC,IAAI,GAAG,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;aAC9B;YAED,IAAI;gBACH,KAAK,CACJ,qCAAqC,EACrC,IAAI,CAAC,QAAQ,EACb,GAAG,GAAG,CAAC,MAAM,IAAI,GAAG,CAAC,IAAI,EAAE,CAC3B,CAAC;gBACF,OAAO,CAAC,OAAO,CAAC,IAAI,CAAC,mBAAmB,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC,CAAC,IAAI,CACxD,QAAQ,EACR,aAAa,CACb,CAAC;aACF;YAAC,OAAO,GAAG,EAAE;gBACb,OAAO,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,KAAK,CAAC,aAAa,CAAC,CAAC;aACzC;QACF,CAAC;QAED,UAAU,CAAC,MAAkB,EAAE,IAAkB;YAChD,KAAK,CAAC,sBAAsB,EAAE,MAAM,CAAC,WAAW,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;YAC7D,MAAM,CAAC,OAAO,EAAE,CAAC;QAClB,CAAC;QAED,OAAO;YACN,KAAK,CAAC,qBAAqB,EAAE,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;QACrD,CAAC;KACD;IAxPY,iBAAK,QAwPjB,CAAA;IAED,uCAAuC;IACvC,WAAW,CAAC,SAAS,GAAG,WAAW,CAAC,KAAK,CAAC,SAAS,CAAC;AACrD,CAAC,EAtTS,WAAW,KAAX,WAAW,QAsTpB;AAED,iBAAS,WAAW,CAAC"} \ No newline at end of file diff --git a/node_modules/agent-base/dist/src/promisify.d.ts b/node_modules/agent-base/dist/src/promisify.d.ts new file mode 100644 index 00000000..02688696 --- /dev/null +++ b/node_modules/agent-base/dist/src/promisify.d.ts @@ -0,0 +1,4 @@ +import { ClientRequest, RequestOptions, AgentCallbackCallback, AgentCallbackPromise } from './index'; +declare type LegacyCallback = (req: ClientRequest, opts: RequestOptions, fn: AgentCallbackCallback) => void; +export default function promisify(fn: LegacyCallback): AgentCallbackPromise; +export {}; diff --git a/node_modules/agent-base/dist/src/promisify.js b/node_modules/agent-base/dist/src/promisify.js new file mode 100644 index 00000000..b2f6132a --- /dev/null +++ b/node_modules/agent-base/dist/src/promisify.js @@ -0,0 +1,18 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +function promisify(fn) { + return function (req, opts) { + return new Promise((resolve, reject) => { + fn.call(this, req, opts, (err, rtn) => { + if (err) { + reject(err); + } + else { + resolve(rtn); + } + }); + }); + }; +} +exports.default = promisify; +//# sourceMappingURL=promisify.js.map \ No newline at end of file diff --git a/node_modules/agent-base/dist/src/promisify.js.map b/node_modules/agent-base/dist/src/promisify.js.map new file mode 100644 index 00000000..4bff9bfc --- /dev/null +++ b/node_modules/agent-base/dist/src/promisify.js.map @@ -0,0 +1 @@ +{"version":3,"file":"promisify.js","sourceRoot":"","sources":["../../src/promisify.ts"],"names":[],"mappings":";;AAeA,SAAwB,SAAS,CAAC,EAAkB;IACnD,OAAO,UAAsB,GAAkB,EAAE,IAAoB;QACpE,OAAO,IAAI,OAAO,CAAC,CAAC,OAAO,EAAE,MAAM,EAAE,EAAE;YACtC,EAAE,CAAC,IAAI,CACN,IAAI,EACJ,GAAG,EACH,IAAI,EACJ,CAAC,GAA6B,EAAE,GAAyB,EAAE,EAAE;gBAC5D,IAAI,GAAG,EAAE;oBACR,MAAM,CAAC,GAAG,CAAC,CAAC;iBACZ;qBAAM;oBACN,OAAO,CAAC,GAAG,CAAC,CAAC;iBACb;YACF,CAAC,CACD,CAAC;QACH,CAAC,CAAC,CAAC;IACJ,CAAC,CAAC;AACH,CAAC;AAjBD,4BAiBC"} \ No newline at end of file diff --git a/node_modules/agent-base/node_modules/debug/LICENSE b/node_modules/agent-base/node_modules/debug/LICENSE new file mode 100644 index 00000000..658c933d --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/agent-base/node_modules/debug/README.md b/node_modules/agent-base/node_modules/debug/README.md new file mode 100644 index 00000000..88dae35d --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/README.md @@ -0,0 +1,455 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/agent-base/node_modules/debug/package.json b/node_modules/agent-base/node_modules/debug/package.json new file mode 100644 index 00000000..53bbbaed --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/package.json @@ -0,0 +1,101 @@ +{ + "_from": "debug@4", + "_id": "debug@4.3.1", + "_inBundle": false, + "_integrity": "sha512-doEwdvm4PCeK4K3RQN2ZC2BYUBaxwLARCqZmMjtF8a51J2Rb0xpVloFRnCODwqjpwnAoao4pelN8l3RJdv3gRQ==", + "_location": "/agent-base/debug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "debug@4", + "name": "debug", + "escapedName": "debug", + "rawSpec": "4", + "saveSpec": null, + "fetchSpec": "4" + }, + "_requiredBy": [ + "/agent-base" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-4.3.1.tgz", + "_shasum": "f0d229c505e0c6d8c49ac553d1b13dc183f6b2ee", + "_spec": "debug@4", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/agent-base", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + }, + { + "name": "Josh Junon", + "email": "josh@junon.me" + } + ], + "dependencies": { + "ms": "2.1.2" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "brfs": "^2.0.1", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "istanbul": "^0.4.5", + "karma": "^3.1.4", + "karma-browserify": "^6.0.0", + "karma-chrome-launcher": "^2.2.0", + "karma-mocha": "^1.3.0", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6.0" + }, + "files": [ + "src", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + }, + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "scripts": { + "lint": "xo", + "test": "npm run test:node && npm run test:browser && npm run lint", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls", + "test:node": "istanbul cover _mocha -- test.js" + }, + "version": "4.3.1" +} diff --git a/node_modules/agent-base/node_modules/debug/src/browser.js b/node_modules/agent-base/node_modules/debug/src/browser.js new file mode 100644 index 00000000..cd0fc35d --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/src/browser.js @@ -0,0 +1,269 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); +exports.destroy = (() => { + let warned = false; + + return () => { + if (!warned) { + warned = true; + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + }; +})(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.debug()` when available. + * No-op when `console.debug` is not a "function". + * If `console.debug` is not available, falls back + * to `console.log`. + * + * @api public + */ +exports.log = console.debug || console.log || (() => {}); + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/node_modules/agent-base/node_modules/debug/src/common.js b/node_modules/agent-base/node_modules/debug/src/common.js new file mode 100644 index 00000000..392a8e00 --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/src/common.js @@ -0,0 +1,261 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + createDebug.destroy = destroy; + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + let enableOverride = null; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return '%'; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.useColors = createDebug.useColors(); + debug.color = createDebug.selectColor(namespace); + debug.extend = extend; + debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. + + Object.defineProperty(debug, 'enabled', { + enumerable: true, + configurable: false, + get: () => enableOverride === null ? createDebug.enabled(namespace) : enableOverride, + set: v => { + enableOverride = v; + } + }); + + // Env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + return debug; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + + createDebug.names = []; + createDebug.skips = []; + + let i; + const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + const len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names.map(toNamespace), + ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + let i; + let len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + function toNamespace(regexp) { + return regexp.toString() + .substring(2, regexp.toString().length - 2) + .replace(/\.\*\?$/, '*'); + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + /** + * XXX DO NOT USE. This is a temporary stub function. + * XXX It WILL be removed in the next major release. + */ + function destroy() { + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/node_modules/agent-base/node_modules/debug/src/index.js b/node_modules/agent-base/node_modules/debug/src/index.js new file mode 100644 index 00000000..bf4c57f2 --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/agent-base/node_modules/debug/src/node.js b/node_modules/agent-base/node_modules/debug/src/node.js new file mode 100644 index 00000000..79bc085c --- /dev/null +++ b/node_modules/agent-base/node_modules/debug/src/node.js @@ -0,0 +1,263 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.destroy = util.deprecate( + () => {}, + 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' +); + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.format(...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n') + .map(str => str.trim()) + .join(' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/node_modules/agent-base/node_modules/ms/index.js b/node_modules/agent-base/node_modules/ms/index.js new file mode 100644 index 00000000..c4498bcc --- /dev/null +++ b/node_modules/agent-base/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isFinite(val)) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/node_modules/agent-base/node_modules/ms/license.md b/node_modules/agent-base/node_modules/ms/license.md new file mode 100644 index 00000000..69b61253 --- /dev/null +++ b/node_modules/agent-base/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/agent-base/node_modules/ms/package.json b/node_modules/agent-base/node_modules/ms/package.json new file mode 100644 index 00000000..6ff3e183 --- /dev/null +++ b/node_modules/agent-base/node_modules/ms/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ms@2.1.2", + "_id": "ms@2.1.2", + "_inBundle": false, + "_integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "_location": "/agent-base/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.1.2", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.1.2", + "saveSpec": null, + "fetchSpec": "2.1.2" + }, + "_requiredBy": [ + "/agent-base/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "_shasum": "d09d1f357b443f493382a8eb3ccd183872ae6009", + "_spec": "ms@2.1.2", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/agent-base/node_modules/debug", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny millisecond conversion utility", + "devDependencies": { + "eslint": "4.12.1", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.1.2" +} diff --git a/node_modules/agent-base/node_modules/ms/readme.md b/node_modules/agent-base/node_modules/ms/readme.md new file mode 100644 index 00000000..9a1996b1 --- /dev/null +++ b/node_modules/agent-base/node_modules/ms/readme.md @@ -0,0 +1,60 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Join the community on Spectrum](https://withspectrum.github.io/badge/badge.svg)](https://spectrum.chat/zeit) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/agent-base/package.json b/node_modules/agent-base/package.json new file mode 100644 index 00000000..23413d1e --- /dev/null +++ b/node_modules/agent-base/package.json @@ -0,0 +1,94 @@ +{ + "_from": "agent-base@6", + "_id": "agent-base@6.0.2", + "_inBundle": false, + "_integrity": "sha512-RZNwNclF7+MS/8bDg70amg32dyeZGZxiDuQmZxKLAlQjr3jGyLx+4Kkk58UO7D2QdgFIQCovuSuZESne6RG6XQ==", + "_location": "/agent-base", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "agent-base@6", + "name": "agent-base", + "escapedName": "agent-base", + "rawSpec": "6", + "saveSpec": null, + "fetchSpec": "6" + }, + "_requiredBy": [ + "/https-proxy-agent" + ], + "_resolved": "https://registry.npmjs.org/agent-base/-/agent-base-6.0.2.tgz", + "_shasum": "49fff58577cfee3f37176feab4c22e00f86d7f77", + "_spec": "agent-base@6", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/https-proxy-agent", + "author": { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io/" + }, + "bugs": { + "url": "https://github.com/TooTallNate/node-agent-base/issues" + }, + "bundleDependencies": false, + "dependencies": { + "debug": "4" + }, + "deprecated": false, + "description": "Turn a function into an `http.Agent` instance", + "devDependencies": { + "@types/debug": "4", + "@types/mocha": "^5.2.7", + "@types/node": "^14.0.20", + "@types/semver": "^7.1.0", + "@types/ws": "^6.0.3", + "@typescript-eslint/eslint-plugin": "1.6.0", + "@typescript-eslint/parser": "1.1.0", + "async-listen": "^1.2.0", + "cpy-cli": "^2.0.0", + "eslint": "5.16.0", + "eslint-config-airbnb": "17.1.0", + "eslint-config-prettier": "4.1.0", + "eslint-import-resolver-typescript": "1.1.1", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-jsx-a11y": "6.2.1", + "eslint-plugin-react": "7.12.4", + "mocha": "^6.2.0", + "rimraf": "^3.0.0", + "semver": "^7.1.2", + "typescript": "^3.5.3", + "ws": "^3.0.0" + }, + "engines": { + "node": ">= 6.0.0" + }, + "files": [ + "dist/src", + "src" + ], + "homepage": "https://github.com/TooTallNate/node-agent-base#readme", + "keywords": [ + "http", + "agent", + "base", + "barebones", + "https" + ], + "license": "MIT", + "main": "dist/src/index", + "name": "agent-base", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/node-agent-base.git" + }, + "scripts": { + "build": "tsc", + "postbuild": "cpy --parents src test '!**/*.ts' dist", + "prebuild": "rimraf dist", + "prepublishOnly": "npm run build", + "test": "mocha --reporter spec dist/test/*.js", + "test-lint": "eslint src --ext .js,.ts" + }, + "typings": "dist/src/index", + "version": "6.0.2" +} diff --git a/node_modules/agent-base/src/index.ts b/node_modules/agent-base/src/index.ts new file mode 100644 index 00000000..a47ccd49 --- /dev/null +++ b/node_modules/agent-base/src/index.ts @@ -0,0 +1,345 @@ +import net from 'net'; +import http from 'http'; +import https from 'https'; +import { Duplex } from 'stream'; +import { EventEmitter } from 'events'; +import createDebug from 'debug'; +import promisify from './promisify'; + +const debug = createDebug('agent-base'); + +function isAgent(v: any): v is createAgent.AgentLike { + return Boolean(v) && typeof v.addRequest === 'function'; +} + +function isSecureEndpoint(): boolean { + const { stack } = new Error(); + if (typeof stack !== 'string') return false; + return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1); +} + +function createAgent(opts?: createAgent.AgentOptions): createAgent.Agent; +function createAgent( + callback: createAgent.AgentCallback, + opts?: createAgent.AgentOptions +): createAgent.Agent; +function createAgent( + callback?: createAgent.AgentCallback | createAgent.AgentOptions, + opts?: createAgent.AgentOptions +) { + return new createAgent.Agent(callback, opts); +} + +namespace createAgent { + export interface ClientRequest extends http.ClientRequest { + _last?: boolean; + _hadError?: boolean; + method: string; + } + + export interface AgentRequestOptions { + host?: string; + path?: string; + // `port` on `http.RequestOptions` can be a string or undefined, + // but `net.TcpNetConnectOpts` expects only a number + port: number; + } + + export interface HttpRequestOptions + extends AgentRequestOptions, + Omit { + secureEndpoint: false; + } + + export interface HttpsRequestOptions + extends AgentRequestOptions, + Omit { + secureEndpoint: true; + } + + export type RequestOptions = HttpRequestOptions | HttpsRequestOptions; + + export type AgentLike = Pick | http.Agent; + + export type AgentCallbackReturn = Duplex | AgentLike; + + export type AgentCallbackCallback = ( + err?: Error | null, + socket?: createAgent.AgentCallbackReturn + ) => void; + + export type AgentCallbackPromise = ( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions + ) => + | createAgent.AgentCallbackReturn + | Promise; + + export type AgentCallback = typeof Agent.prototype.callback; + + export type AgentOptions = { + timeout?: number; + }; + + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + export class Agent extends EventEmitter { + public timeout: number | null; + public maxFreeSockets: number; + public maxTotalSockets: number; + public maxSockets: number; + public sockets: { + [key: string]: net.Socket[]; + }; + public freeSockets: { + [key: string]: net.Socket[]; + }; + public requests: { + [key: string]: http.IncomingMessage[]; + }; + public options: https.AgentOptions; + private promisifiedCallback?: createAgent.AgentCallbackPromise; + private explicitDefaultPort?: number; + private explicitProtocol?: string; + + constructor( + callback?: createAgent.AgentCallback | createAgent.AgentOptions, + _opts?: createAgent.AgentOptions + ) { + super(); + + let opts = _opts; + if (typeof callback === 'function') { + this.callback = callback; + } else if (callback) { + opts = callback; + } + + // Timeout for the socket to be returned from the callback + this.timeout = null; + if (opts && typeof opts.timeout === 'number') { + this.timeout = opts.timeout; + } + + // These aren't actually used by `agent-base`, but are required + // for the TypeScript definition files in `@types/node` :/ + this.maxFreeSockets = 1; + this.maxSockets = 1; + this.maxTotalSockets = Infinity; + this.sockets = {}; + this.freeSockets = {}; + this.requests = {}; + this.options = {}; + } + + get defaultPort(): number { + if (typeof this.explicitDefaultPort === 'number') { + return this.explicitDefaultPort; + } + return isSecureEndpoint() ? 443 : 80; + } + + set defaultPort(v: number) { + this.explicitDefaultPort = v; + } + + get protocol(): string { + if (typeof this.explicitProtocol === 'string') { + return this.explicitProtocol; + } + return isSecureEndpoint() ? 'https:' : 'http:'; + } + + set protocol(v: string) { + this.explicitProtocol = v; + } + + callback( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions, + fn: createAgent.AgentCallbackCallback + ): void; + callback( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions + ): + | createAgent.AgentCallbackReturn + | Promise; + callback( + req: createAgent.ClientRequest, + opts: createAgent.AgentOptions, + fn?: createAgent.AgentCallbackCallback + ): + | createAgent.AgentCallbackReturn + | Promise + | void { + throw new Error( + '"agent-base" has no default implementation, you must subclass and override `callback()`' + ); + } + + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req: ClientRequest, _opts: RequestOptions): void { + const opts: RequestOptions = { ..._opts }; + + if (typeof opts.secureEndpoint !== 'boolean') { + opts.secureEndpoint = isSecureEndpoint(); + } + + if (opts.host == null) { + opts.host = 'localhost'; + } + + if (opts.port == null) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + + if (opts.protocol == null) { + opts.protocol = opts.secureEndpoint ? 'https:' : 'http:'; + } + + if (opts.host && opts.path) { + // If both a `host` and `path` are specified then it's most + // likely the result of a `url.parse()` call... we need to + // remove the `path` portion so that `net.connect()` doesn't + // attempt to open that as a unix socket file. + delete opts.path; + } + + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + + // Hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + + let timedOut = false; + let timeoutId: ReturnType | null = null; + const timeoutMs = opts.timeout || this.timeout; + + const onerror = (err: NodeJS.ErrnoException) => { + if (req._hadError) return; + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + }; + + const ontimeout = () => { + timeoutId = null; + timedOut = true; + const err: NodeJS.ErrnoException = new Error( + `A "socket" was not created for HTTP request before ${timeoutMs}ms` + ); + err.code = 'ETIMEOUT'; + onerror(err); + }; + + const callbackError = (err: NodeJS.ErrnoException) => { + if (timedOut) return; + if (timeoutId !== null) { + clearTimeout(timeoutId); + timeoutId = null; + } + onerror(err); + }; + + const onsocket = (socket: AgentCallbackReturn) => { + if (timedOut) return; + if (timeoutId != null) { + clearTimeout(timeoutId); + timeoutId = null; + } + + if (isAgent(socket)) { + // `socket` is actually an `http.Agent` instance, so + // relinquish responsibility for this `req` to the Agent + // from here on + debug( + 'Callback returned another Agent instance %o', + socket.constructor.name + ); + (socket as createAgent.Agent).addRequest(req, opts); + return; + } + + if (socket) { + socket.once('free', () => { + this.freeSocket(socket as net.Socket, opts); + }); + req.onSocket(socket as net.Socket); + return; + } + + const err = new Error( + `no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\`` + ); + onerror(err); + }; + + if (typeof this.callback !== 'function') { + onerror(new Error('`callback` is not defined')); + return; + } + + if (!this.promisifiedCallback) { + if (this.callback.length >= 3) { + debug('Converting legacy callback function to promise'); + this.promisifiedCallback = promisify(this.callback); + } else { + this.promisifiedCallback = this.callback; + } + } + + if (typeof timeoutMs === 'number' && timeoutMs > 0) { + timeoutId = setTimeout(ontimeout, timeoutMs); + } + + if ('port' in opts && typeof opts.port !== 'number') { + opts.port = Number(opts.port); + } + + try { + debug( + 'Resolving socket for %o request: %o', + opts.protocol, + `${req.method} ${req.path}` + ); + Promise.resolve(this.promisifiedCallback(req, opts)).then( + onsocket, + callbackError + ); + } catch (err) { + Promise.reject(err).catch(callbackError); + } + } + + freeSocket(socket: net.Socket, opts: AgentOptions) { + debug('Freeing socket %o %o', socket.constructor.name, opts); + socket.destroy(); + } + + destroy() { + debug('Destroying agent %o', this.constructor.name); + } + } + + // So that `instanceof` works correctly + createAgent.prototype = createAgent.Agent.prototype; +} + +export = createAgent; diff --git a/node_modules/agent-base/src/promisify.ts b/node_modules/agent-base/src/promisify.ts new file mode 100644 index 00000000..60cc6627 --- /dev/null +++ b/node_modules/agent-base/src/promisify.ts @@ -0,0 +1,33 @@ +import { + Agent, + ClientRequest, + RequestOptions, + AgentCallbackCallback, + AgentCallbackPromise, + AgentCallbackReturn +} from './index'; + +type LegacyCallback = ( + req: ClientRequest, + opts: RequestOptions, + fn: AgentCallbackCallback +) => void; + +export default function promisify(fn: LegacyCallback): AgentCallbackPromise { + return function(this: Agent, req: ClientRequest, opts: RequestOptions) { + return new Promise((resolve, reject) => { + fn.call( + this, + req, + opts, + (err: Error | null | undefined, rtn?: AgentCallbackReturn) => { + if (err) { + reject(err); + } else { + resolve(rtn); + } + } + ); + }); + }; +} diff --git a/node_modules/ansi-align/CHANGELOG.md b/node_modules/ansi-align/CHANGELOG.md new file mode 100644 index 00000000..0db57f7b --- /dev/null +++ b/node_modules/ansi-align/CHANGELOG.md @@ -0,0 +1,51 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + + +# [3.0.0](https://github.com/nexdrew/ansi-align/compare/v2.0.0...v3.0.0) (2018-12-17) + + +### Bug Fixes + +* **package:** update string-width to version 3.0.0 ([#50](https://github.com/nexdrew/ansi-align/issues/50)) ([67f0d8f](https://github.com/nexdrew/ansi-align/commit/67f0d8f)) + + +### BREAKING CHANGES + +* **package:** Node 4 no longer supported, please update to Node 6+ or use ansi-align@2.0.0 + + + + +# [2.0.0](https://github.com/nexdrew/ansi-align/compare/v1.1.0...v2.0.0) (2017-05-01) + + +### Features + +* ES2015ify, dropping support for Node <4 ([#30](https://github.com/nexdrew/ansi-align/issues/30)) ([7b43f48](https://github.com/nexdrew/ansi-align/commit/7b43f48)) + + +### BREAKING CHANGES + +* Node 0.10 or 0.12 no longer supported, please update to Node 4+ or use ansi-align@1.1.0 + + + + +# [1.1.0](https://github.com/nexdrew/ansi-align/compare/v1.0.0...v1.1.0) (2016-06-06) + + +### Features + +* support left-alignment as no-op ([#3](https://github.com/nexdrew/ansi-align/issues/3)) ([e581db6](https://github.com/nexdrew/ansi-align/commit/e581db6)) + + + + +# 1.0.0 (2016-04-30) + + +### Features + +* initial commit ([1914d90](https://github.com/nexdrew/ansi-align/commit/1914d90)) diff --git a/node_modules/ansi-align/LICENSE b/node_modules/ansi-align/LICENSE new file mode 100644 index 00000000..ab601b65 --- /dev/null +++ b/node_modules/ansi-align/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2016, Contributors + +Permission to use, copy, modify, and/or distribute this software for any purpose +with or without fee is hereby granted, provided that the above copyright notice +and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS +OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF +THIS SOFTWARE. diff --git a/node_modules/ansi-align/README.md b/node_modules/ansi-align/README.md new file mode 100644 index 00000000..5e516825 --- /dev/null +++ b/node_modules/ansi-align/README.md @@ -0,0 +1,80 @@ +# ansi-align + +> align-text with ANSI support for CLIs + +[![Build Status](https://travis-ci.org/nexdrew/ansi-align.svg?branch=master)](https://travis-ci.org/nexdrew/ansi-align) +[![Coverage Status](https://coveralls.io/repos/github/nexdrew/ansi-align/badge.svg?branch=master)](https://coveralls.io/github/nexdrew/ansi-align?branch=master) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) +[![Greenkeeper badge](https://badges.greenkeeper.io/nexdrew/ansi-align.svg)](https://greenkeeper.io/) + +Easily center- or right- align a block of text, carefully ignoring ANSI escape codes. + +E.g. turn this: + +ansi text block no alignment :( + +Into this: + +ansi text block center aligned! + +## Install + +```sh +npm install --save ansi-align +``` + +```js +var ansiAlign = require('ansi-align') +``` + +## API + +### `ansiAlign(text, [opts])` + +Align the given text per the line with the greatest [`string-width`](https://github.com/sindresorhus/string-width), returning a new string (or array). + +#### Arguments + +- `text`: required, string or array + + The text to align. If a string is given, it will be split using either the `opts.split` value or `'\n'` by default. If an array is given, a different array of modified strings will be returned. + +- `opts`: optional, object + + Options to change behavior, see below. + +#### Options + +- `opts.align`: string, default `'center'` + + The alignment mode. Use `'center'` for center-alignment, `'right'` for right-alignment, or `'left'` for left-alignment. Note that the given `text` is assumed to be left-aligned already, so specifying `align: 'left'` just returns the `text` as is (no-op). + +- `opts.split`: string or RegExp, default `'\n'` + + The separator to use when splitting the text. Only used if text is given as a string. + +- `opts.pad`: string, default `' '` + + The value used to left-pad (prepend to) lines of lesser width. Will be repeated as necessary to adjust alignment to the line with the greatest width. + +### `ansiAlign.center(text)` + +Alias for `ansiAlign(text, { align: 'center' })`. + +### `ansiAlign.right(text)` + +Alias for `ansiAlign(text, { align: 'right' })`. + +### `ansiAlign.left(text)` + +Alias for `ansiAlign(text, { align: 'left' })`, which is a no-op. + +## Similar Packages + +- [`center-align`](https://github.com/jonschlinkert/center-align): Very close to this package, except it doesn't support ANSI codes. +- [`left-pad`](https://github.com/camwest/left-pad): Great for left-padding but does not support center alignment or ANSI codes. +- Pretty much anything by the [chalk](https://github.com/chalk) team + +## License + +ISC © Contributors diff --git a/node_modules/ansi-align/index.js b/node_modules/ansi-align/index.js new file mode 100644 index 00000000..67fa826d --- /dev/null +++ b/node_modules/ansi-align/index.js @@ -0,0 +1,61 @@ +'use strict' + +const stringWidth = require('string-width') + +function ansiAlign (text, opts) { + if (!text) return text + + opts = opts || {} + const align = opts.align || 'center' + + // short-circuit `align: 'left'` as no-op + if (align === 'left') return text + + const split = opts.split || '\n' + const pad = opts.pad || ' ' + const widthDiffFn = align !== 'right' ? halfDiff : fullDiff + + let returnString = false + if (!Array.isArray(text)) { + returnString = true + text = String(text).split(split) + } + + let width + let maxWidth = 0 + text = text.map(function (str) { + str = String(str) + width = stringWidth(str) + maxWidth = Math.max(width, maxWidth) + return { + str, + width + } + }).map(function (obj) { + return new Array(widthDiffFn(maxWidth, obj.width) + 1).join(pad) + obj.str + }) + + return returnString ? text.join(split) : text +} + +ansiAlign.left = function left (text) { + return ansiAlign(text, { align: 'left' }) +} + +ansiAlign.center = function center (text) { + return ansiAlign(text, { align: 'center' }) +} + +ansiAlign.right = function right (text) { + return ansiAlign(text, { align: 'right' }) +} + +module.exports = ansiAlign + +function halfDiff (maxWidth, curWidth) { + return Math.floor((maxWidth - curWidth) / 2) +} + +function fullDiff (maxWidth, curWidth) { + return maxWidth - curWidth +} diff --git a/node_modules/ansi-align/node_modules/string-width/index.js b/node_modules/ansi-align/node_modules/string-width/index.js new file mode 100644 index 00000000..33c9d6c0 --- /dev/null +++ b/node_modules/ansi-align/node_modules/string-width/index.js @@ -0,0 +1,39 @@ +'use strict'; +const stripAnsi = require('strip-ansi'); +const isFullwidthCodePoint = require('is-fullwidth-code-point'); +const emojiRegex = require('emoji-regex')(); + +module.exports = input => { + input = input.replace(emojiRegex, ' '); + + if (typeof input !== 'string' || input.length === 0) { + return 0; + } + + input = stripAnsi(input); + + let width = 0; + + for (let i = 0; i < input.length; i++) { + const code = input.codePointAt(i); + + // Ignore control characters + if (code <= 0x1F || (code >= 0x7F && code <= 0x9F)) { + continue; + } + + // Ignore combining characters + if (code >= 0x300 && code <= 0x36F) { + continue; + } + + // Surrogates + if (code > 0xFFFF) { + i++; + } + + width += isFullwidthCodePoint(code) ? 2 : 1; + } + + return width; +}; diff --git a/node_modules/ansi-align/node_modules/string-width/license b/node_modules/ansi-align/node_modules/string-width/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/ansi-align/node_modules/string-width/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ansi-align/node_modules/string-width/package.json b/node_modules/ansi-align/node_modules/string-width/package.json new file mode 100644 index 00000000..62acb8a0 --- /dev/null +++ b/node_modules/ansi-align/node_modules/string-width/package.json @@ -0,0 +1,88 @@ +{ + "_from": "string-width@^3.0.0", + "_id": "string-width@3.1.0", + "_inBundle": false, + "_integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "_location": "/ansi-align/string-width", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "string-width@^3.0.0", + "name": "string-width", + "escapedName": "string-width", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/ansi-align" + ], + "_resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "_shasum": "22767be21b62af1081574306f69ac51b62203961", + "_spec": "string-width@^3.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/ansi-align", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/string-width/issues" + }, + "bundleDependencies": false, + "dependencies": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + }, + "deprecated": false, + "description": "Get the visual width of a string - the number of columns required to display it", + "devDependencies": { + "ava": "^1.0.1", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/string-width#readme", + "keywords": [ + "string", + "str", + "character", + "char", + "unicode", + "width", + "visual", + "column", + "columns", + "fullwidth", + "full-width", + "full", + "ansi", + "escape", + "codes", + "cli", + "command-line", + "terminal", + "console", + "cjk", + "chinese", + "japanese", + "korean", + "fixed-width" + ], + "license": "MIT", + "name": "string-width", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/string-width.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.1.0" +} diff --git a/node_modules/ansi-align/node_modules/string-width/readme.md b/node_modules/ansi-align/node_modules/string-width/readme.md new file mode 100644 index 00000000..d39d95f5 --- /dev/null +++ b/node_modules/ansi-align/node_modules/string-width/readme.md @@ -0,0 +1,45 @@ +# string-width [![Build Status](https://travis-ci.org/sindresorhus/string-width.svg?branch=master)](https://travis-ci.org/sindresorhus/string-width) + +> Get the visual width of a string - the number of columns required to display it + +Some Unicode characters are [fullwidth](https://en.wikipedia.org/wiki/Halfwidth_and_fullwidth_forms) and use double the normal width. [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) are stripped and doesn't affect the width. + +Useful to be able to measure the actual width of command-line output. + + +## Install + +``` +$ npm install string-width +``` + + +## Usage + +```js +const stringWidth = require('string-width'); + +stringWidth('古'); +//=> 2 + +stringWidth('\u001b[1m古\u001b[22m'); +//=> 2 + +stringWidth('a'); +//=> 1 + +stringWidth('\u001B]8;;https://github.com\u0007Click\u001B]8;;\u0007'); +// => 5 +``` + + +## Related + +- [string-width-cli](https://github.com/sindresorhus/string-width-cli) - CLI for this module +- [string-length](https://github.com/sindresorhus/string-length) - Get the real length of a string +- [widest-line](https://github.com/sindresorhus/widest-line) - Get the visual width of the widest line in a string + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/ansi-align/package.json b/node_modules/ansi-align/package.json new file mode 100644 index 00000000..319a226d --- /dev/null +++ b/node_modules/ansi-align/package.json @@ -0,0 +1,74 @@ +{ + "_from": "ansi-align@^3.0.0", + "_id": "ansi-align@3.0.0", + "_inBundle": false, + "_integrity": "sha512-ZpClVKqXN3RGBmKibdfWzqCY4lnjEuoNzU5T0oEFpfd/z5qJHVarukridD4juLO2FXMiwUQxr9WqQtaYa8XRYw==", + "_location": "/ansi-align", + "_phantomChildren": { + "emoji-regex": "7.0.3", + "is-fullwidth-code-point": "2.0.0", + "strip-ansi": "5.2.0" + }, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-align@^3.0.0", + "name": "ansi-align", + "escapedName": "ansi-align", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/boxen" + ], + "_resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-3.0.0.tgz", + "_shasum": "b536b371cf687caaef236c18d3e21fe3797467cb", + "_spec": "ansi-align@^3.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/boxen", + "author": { + "name": "nexdrew" + }, + "bugs": { + "url": "https://github.com/nexdrew/ansi-align/issues" + }, + "bundleDependencies": false, + "dependencies": { + "string-width": "^3.0.0" + }, + "deprecated": false, + "description": "align-text with ANSI support for CLIs", + "devDependencies": { + "ava": "^1.0.1", + "chalk": "^2.4.1", + "coveralls": "^3.0.2", + "nyc": "^13.1.0", + "standard": "^12.0.1", + "standard-version": "^4.4.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/nexdrew/ansi-align#readme", + "keywords": [ + "ansi", + "align", + "cli", + "center", + "pad" + ], + "license": "ISC", + "main": "index.js", + "name": "ansi-align", + "repository": { + "type": "git", + "url": "git+https://github.com/nexdrew/ansi-align.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "pretest": "standard", + "release": "standard-version", + "test": "nyc ava" + }, + "version": "3.0.0" +} diff --git a/node_modules/ansi-regex/index.js b/node_modules/ansi-regex/index.js new file mode 100644 index 00000000..c2544800 --- /dev/null +++ b/node_modules/ansi-regex/index.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = options => { + options = Object.assign({ + onlyFirst: false + }, options); + + const pattern = [ + '[\\u001B\\u009B][[\\]()#;?]*(?:(?:(?:[a-zA-Z\\d]*(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]*)*)?\\u0007)', + '(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PR-TZcf-ntqry=><~]))' + ].join('|'); + + return new RegExp(pattern, options.onlyFirst ? undefined : 'g'); +}; diff --git a/node_modules/ansi-regex/license b/node_modules/ansi-regex/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/ansi-regex/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ansi-regex/package.json b/node_modules/ansi-regex/package.json new file mode 100644 index 00000000..d093d192 --- /dev/null +++ b/node_modules/ansi-regex/package.json @@ -0,0 +1,85 @@ +{ + "_from": "ansi-regex@^4.1.0", + "_id": "ansi-regex@4.1.0", + "_inBundle": false, + "_integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "_location": "/ansi-regex", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-regex@^4.1.0", + "name": "ansi-regex", + "escapedName": "ansi-regex", + "rawSpec": "^4.1.0", + "saveSpec": null, + "fetchSpec": "^4.1.0" + }, + "_requiredBy": [ + "/strip-ansi" + ], + "_resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "_shasum": "8b9f8f08cf1acb843756a839ca8c7e3168c51997", + "_spec": "ansi-regex@^4.1.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/strip-ansi", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/ansi-regex/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Regular expression for matching ANSI escape codes", + "devDependencies": { + "ava": "^0.25.0", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/chalk/ansi-regex#readme", + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "text", + "regex", + "regexp", + "re", + "match", + "test", + "find", + "pattern" + ], + "license": "MIT", + "name": "ansi-regex", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/ansi-regex.git" + }, + "scripts": { + "test": "xo && ava", + "view-supported": "node fixtures/view-codes.js" + }, + "version": "4.1.0" +} diff --git a/node_modules/ansi-regex/readme.md b/node_modules/ansi-regex/readme.md new file mode 100644 index 00000000..d19c4466 --- /dev/null +++ b/node_modules/ansi-regex/readme.md @@ -0,0 +1,87 @@ +# ansi-regex [![Build Status](https://travis-ci.org/chalk/ansi-regex.svg?branch=master)](https://travis-ci.org/chalk/ansi-regex) + +> Regular expression for matching [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
+ +--- + + +## Install + +``` +$ npm install ansi-regex +``` + + +## Usage + +```js +const ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001B[4mcake\u001B[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001B[4mcake\u001B[0m'.match(ansiRegex()); +//=> ['\u001B[4m', '\u001B[0m'] + +'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true})); +//=> ['\u001B[4m'] + +'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex()); +//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007'] +``` + + +## API + +### ansiRegex([options]) + +Returns a regex for matching ANSI escape codes. + +#### options + +##### onlyFirst + +Type: `boolean`
+Default: `false` *(Matches any ANSI escape codes in a string)* + +Match only the first ANSI escape. + + +## FAQ + +### Why do you test for codes not in the ECMA 48 standard? + +Some of the codes we run as a test are codes that we acquired finding various lists of non-standard or manufacturer specific codes. We test for both standard and non-standard codes, as most of them follow the same or similar format and can be safely matched in strings without the risk of removing actual string content. There are a few non-standard control codes that do not follow the traditional format (i.e. they end in numbers) thus forcing us to exclude them from the test because we cannot reliably match them. + +On the historical side, those ECMA standards were established in the early 90's whereas the VT100, for example, was designed in the mid/late 70's. At that point in time, control codes were still pretty ungoverned and engineers used them for a multitude of things, namely to activate hardware ports that may have been proprietary. Somewhere else you see a similar 'anarchy' of codes is in the x86 architecture for processors; there are a ton of "interrupts" that can mean different things on certain brands of processors, most of which have been phased out. + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +## License + +MIT diff --git a/node_modules/ansi-styles/index.d.ts b/node_modules/ansi-styles/index.d.ts new file mode 100644 index 00000000..44a907e5 --- /dev/null +++ b/node_modules/ansi-styles/index.d.ts @@ -0,0 +1,345 @@ +declare type CSSColor = + | 'aliceblue' + | 'antiquewhite' + | 'aqua' + | 'aquamarine' + | 'azure' + | 'beige' + | 'bisque' + | 'black' + | 'blanchedalmond' + | 'blue' + | 'blueviolet' + | 'brown' + | 'burlywood' + | 'cadetblue' + | 'chartreuse' + | 'chocolate' + | 'coral' + | 'cornflowerblue' + | 'cornsilk' + | 'crimson' + | 'cyan' + | 'darkblue' + | 'darkcyan' + | 'darkgoldenrod' + | 'darkgray' + | 'darkgreen' + | 'darkgrey' + | 'darkkhaki' + | 'darkmagenta' + | 'darkolivegreen' + | 'darkorange' + | 'darkorchid' + | 'darkred' + | 'darksalmon' + | 'darkseagreen' + | 'darkslateblue' + | 'darkslategray' + | 'darkslategrey' + | 'darkturquoise' + | 'darkviolet' + | 'deeppink' + | 'deepskyblue' + | 'dimgray' + | 'dimgrey' + | 'dodgerblue' + | 'firebrick' + | 'floralwhite' + | 'forestgreen' + | 'fuchsia' + | 'gainsboro' + | 'ghostwhite' + | 'gold' + | 'goldenrod' + | 'gray' + | 'green' + | 'greenyellow' + | 'grey' + | 'honeydew' + | 'hotpink' + | 'indianred' + | 'indigo' + | 'ivory' + | 'khaki' + | 'lavender' + | 'lavenderblush' + | 'lawngreen' + | 'lemonchiffon' + | 'lightblue' + | 'lightcoral' + | 'lightcyan' + | 'lightgoldenrodyellow' + | 'lightgray' + | 'lightgreen' + | 'lightgrey' + | 'lightpink' + | 'lightsalmon' + | 'lightseagreen' + | 'lightskyblue' + | 'lightslategray' + | 'lightslategrey' + | 'lightsteelblue' + | 'lightyellow' + | 'lime' + | 'limegreen' + | 'linen' + | 'magenta' + | 'maroon' + | 'mediumaquamarine' + | 'mediumblue' + | 'mediumorchid' + | 'mediumpurple' + | 'mediumseagreen' + | 'mediumslateblue' + | 'mediumspringgreen' + | 'mediumturquoise' + | 'mediumvioletred' + | 'midnightblue' + | 'mintcream' + | 'mistyrose' + | 'moccasin' + | 'navajowhite' + | 'navy' + | 'oldlace' + | 'olive' + | 'olivedrab' + | 'orange' + | 'orangered' + | 'orchid' + | 'palegoldenrod' + | 'palegreen' + | 'paleturquoise' + | 'palevioletred' + | 'papayawhip' + | 'peachpuff' + | 'peru' + | 'pink' + | 'plum' + | 'powderblue' + | 'purple' + | 'rebeccapurple' + | 'red' + | 'rosybrown' + | 'royalblue' + | 'saddlebrown' + | 'salmon' + | 'sandybrown' + | 'seagreen' + | 'seashell' + | 'sienna' + | 'silver' + | 'skyblue' + | 'slateblue' + | 'slategray' + | 'slategrey' + | 'snow' + | 'springgreen' + | 'steelblue' + | 'tan' + | 'teal' + | 'thistle' + | 'tomato' + | 'turquoise' + | 'violet' + | 'wheat' + | 'white' + | 'whitesmoke' + | 'yellow' + | 'yellowgreen'; + +declare namespace ansiStyles { + interface ColorConvert { + /** + The RGB color space. + + @param red - (`0`-`255`) + @param green - (`0`-`255`) + @param blue - (`0`-`255`) + */ + rgb(red: number, green: number, blue: number): string; + + /** + The RGB HEX color space. + + @param hex - A hexadecimal string containing RGB data. + */ + hex(hex: string): string; + + /** + @param keyword - A CSS color name. + */ + keyword(keyword: CSSColor): string; + + /** + The HSL color space. + + @param hue - (`0`-`360`) + @param saturation - (`0`-`100`) + @param lightness - (`0`-`100`) + */ + hsl(hue: number, saturation: number, lightness: number): string; + + /** + The HSV color space. + + @param hue - (`0`-`360`) + @param saturation - (`0`-`100`) + @param value - (`0`-`100`) + */ + hsv(hue: number, saturation: number, value: number): string; + + /** + The HSV color space. + + @param hue - (`0`-`360`) + @param whiteness - (`0`-`100`) + @param blackness - (`0`-`100`) + */ + hwb(hue: number, whiteness: number, blackness: number): string; + + /** + Use a [4-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4-bit) to set text color. + */ + ansi(ansi: number): string; + + /** + Use an [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set text color. + */ + ansi256(ansi: number): string; + } + + interface CSPair { + /** + The ANSI terminal control sequence for starting this style. + */ + readonly open: string; + + /** + The ANSI terminal control sequence for ending this style. + */ + readonly close: string; + } + + interface ColorBase { + readonly ansi: ColorConvert; + readonly ansi256: ColorConvert; + readonly ansi16m: ColorConvert; + + /** + The ANSI terminal control sequence for ending this color. + */ + readonly close: string; + } + + interface Modifier { + /** + Resets the current color chain. + */ + readonly reset: CSPair; + + /** + Make text bold. + */ + readonly bold: CSPair; + + /** + Emitting only a small amount of light. + */ + readonly dim: CSPair; + + /** + Make text italic. (Not widely supported) + */ + readonly italic: CSPair; + + /** + Make text underline. (Not widely supported) + */ + readonly underline: CSPair; + + /** + Inverse background and foreground colors. + */ + readonly inverse: CSPair; + + /** + Prints the text, but makes it invisible. + */ + readonly hidden: CSPair; + + /** + Puts a horizontal line through the center of the text. (Not widely supported) + */ + readonly strikethrough: CSPair; + } + + interface ForegroundColor { + readonly black: CSPair; + readonly red: CSPair; + readonly green: CSPair; + readonly yellow: CSPair; + readonly blue: CSPair; + readonly cyan: CSPair; + readonly magenta: CSPair; + readonly white: CSPair; + + /** + Alias for `blackBright`. + */ + readonly gray: CSPair; + + /** + Alias for `blackBright`. + */ + readonly grey: CSPair; + + readonly blackBright: CSPair; + readonly redBright: CSPair; + readonly greenBright: CSPair; + readonly yellowBright: CSPair; + readonly blueBright: CSPair; + readonly cyanBright: CSPair; + readonly magentaBright: CSPair; + readonly whiteBright: CSPair; + } + + interface BackgroundColor { + readonly bgBlack: CSPair; + readonly bgRed: CSPair; + readonly bgGreen: CSPair; + readonly bgYellow: CSPair; + readonly bgBlue: CSPair; + readonly bgCyan: CSPair; + readonly bgMagenta: CSPair; + readonly bgWhite: CSPair; + + /** + Alias for `bgBlackBright`. + */ + readonly bgGray: CSPair; + + /** + Alias for `bgBlackBright`. + */ + readonly bgGrey: CSPair; + + readonly bgBlackBright: CSPair; + readonly bgRedBright: CSPair; + readonly bgGreenBright: CSPair; + readonly bgYellowBright: CSPair; + readonly bgBlueBright: CSPair; + readonly bgCyanBright: CSPair; + readonly bgMagentaBright: CSPair; + readonly bgWhiteBright: CSPair; + } +} + +declare const ansiStyles: { + readonly modifier: ansiStyles.Modifier; + readonly color: ansiStyles.ForegroundColor & ansiStyles.ColorBase; + readonly bgColor: ansiStyles.BackgroundColor & ansiStyles.ColorBase; + readonly codes: ReadonlyMap; +} & ansiStyles.BackgroundColor & ansiStyles.ForegroundColor & ansiStyles.Modifier; + +export = ansiStyles; diff --git a/node_modules/ansi-styles/index.js b/node_modules/ansi-styles/index.js new file mode 100644 index 00000000..5d82581a --- /dev/null +++ b/node_modules/ansi-styles/index.js @@ -0,0 +1,163 @@ +'use strict'; + +const wrapAnsi16 = (fn, offset) => (...args) => { + const code = fn(...args); + return `\u001B[${code + offset}m`; +}; + +const wrapAnsi256 = (fn, offset) => (...args) => { + const code = fn(...args); + return `\u001B[${38 + offset};5;${code}m`; +}; + +const wrapAnsi16m = (fn, offset) => (...args) => { + const rgb = fn(...args); + return `\u001B[${38 + offset};2;${rgb[0]};${rgb[1]};${rgb[2]}m`; +}; + +const ansi2ansi = n => n; +const rgb2rgb = (r, g, b) => [r, g, b]; + +const setLazyProperty = (object, property, get) => { + Object.defineProperty(object, property, { + get: () => { + const value = get(); + + Object.defineProperty(object, property, { + value, + enumerable: true, + configurable: true + }); + + return value; + }, + enumerable: true, + configurable: true + }); +}; + +/** @type {typeof import('color-convert')} */ +let colorConvert; +const makeDynamicStyles = (wrap, targetSpace, identity, isBackground) => { + if (colorConvert === undefined) { + colorConvert = require('color-convert'); + } + + const offset = isBackground ? 10 : 0; + const styles = {}; + + for (const [sourceSpace, suite] of Object.entries(colorConvert)) { + const name = sourceSpace === 'ansi16' ? 'ansi' : sourceSpace; + if (sourceSpace === targetSpace) { + styles[name] = wrap(identity, offset); + } else if (typeof suite === 'object') { + styles[name] = wrap(suite[targetSpace], offset); + } + } + + return styles; +}; + +function assembleStyles() { + const codes = new Map(); + const styles = { + modifier: { + reset: [0, 0], + // 21 isn't widely supported and 22 does the same thing + bold: [1, 22], + dim: [2, 22], + italic: [3, 23], + underline: [4, 24], + inverse: [7, 27], + hidden: [8, 28], + strikethrough: [9, 29] + }, + color: { + black: [30, 39], + red: [31, 39], + green: [32, 39], + yellow: [33, 39], + blue: [34, 39], + magenta: [35, 39], + cyan: [36, 39], + white: [37, 39], + + // Bright color + blackBright: [90, 39], + redBright: [91, 39], + greenBright: [92, 39], + yellowBright: [93, 39], + blueBright: [94, 39], + magentaBright: [95, 39], + cyanBright: [96, 39], + whiteBright: [97, 39] + }, + bgColor: { + bgBlack: [40, 49], + bgRed: [41, 49], + bgGreen: [42, 49], + bgYellow: [43, 49], + bgBlue: [44, 49], + bgMagenta: [45, 49], + bgCyan: [46, 49], + bgWhite: [47, 49], + + // Bright color + bgBlackBright: [100, 49], + bgRedBright: [101, 49], + bgGreenBright: [102, 49], + bgYellowBright: [103, 49], + bgBlueBright: [104, 49], + bgMagentaBright: [105, 49], + bgCyanBright: [106, 49], + bgWhiteBright: [107, 49] + } + }; + + // Alias bright black as gray (and grey) + styles.color.gray = styles.color.blackBright; + styles.bgColor.bgGray = styles.bgColor.bgBlackBright; + styles.color.grey = styles.color.blackBright; + styles.bgColor.bgGrey = styles.bgColor.bgBlackBright; + + for (const [groupName, group] of Object.entries(styles)) { + for (const [styleName, style] of Object.entries(group)) { + styles[styleName] = { + open: `\u001B[${style[0]}m`, + close: `\u001B[${style[1]}m` + }; + + group[styleName] = styles[styleName]; + + codes.set(style[0], style[1]); + } + + Object.defineProperty(styles, groupName, { + value: group, + enumerable: false + }); + } + + Object.defineProperty(styles, 'codes', { + value: codes, + enumerable: false + }); + + styles.color.close = '\u001B[39m'; + styles.bgColor.close = '\u001B[49m'; + + setLazyProperty(styles.color, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, false)); + setLazyProperty(styles.color, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, false)); + setLazyProperty(styles.color, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, false)); + setLazyProperty(styles.bgColor, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, true)); + setLazyProperty(styles.bgColor, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, true)); + setLazyProperty(styles.bgColor, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, true)); + + return styles; +} + +// Make the export immutable +Object.defineProperty(module, 'exports', { + enumerable: true, + get: assembleStyles +}); diff --git a/node_modules/ansi-styles/license b/node_modules/ansi-styles/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/ansi-styles/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ansi-styles/package.json b/node_modules/ansi-styles/package.json new file mode 100644 index 00000000..b73c2aa9 --- /dev/null +++ b/node_modules/ansi-styles/package.json @@ -0,0 +1,88 @@ +{ + "_from": "ansi-styles@^4.1.0", + "_id": "ansi-styles@4.3.0", + "_inBundle": false, + "_integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "_location": "/ansi-styles", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-styles@^4.1.0", + "name": "ansi-styles", + "escapedName": "ansi-styles", + "rawSpec": "^4.1.0", + "saveSpec": null, + "fetchSpec": "^4.1.0" + }, + "_requiredBy": [ + "/chalk" + ], + "_resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "_shasum": "edd803628ae71c04c85ae7a0906edad34b648937", + "_spec": "ansi-styles@^4.1.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/chalk", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/ansi-styles/issues" + }, + "bundleDependencies": false, + "dependencies": { + "color-convert": "^2.0.1" + }, + "deprecated": false, + "description": "ANSI escape codes for styling strings in the terminal", + "devDependencies": { + "@types/color-convert": "^1.9.0", + "ava": "^2.3.0", + "svg-term-cli": "^2.1.1", + "tsd": "^0.11.0", + "xo": "^0.25.3" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "funding": "https://github.com/chalk/ansi-styles?sponsor=1", + "homepage": "https://github.com/chalk/ansi-styles#readme", + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "name": "ansi-styles", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/ansi-styles.git" + }, + "scripts": { + "screenshot": "svg-term --command='node screenshot' --out=screenshot.svg --padding=3 --width=55 --height=3 --at=1000 --no-cursor", + "test": "xo && ava && tsd" + }, + "version": "4.3.0" +} diff --git a/node_modules/ansi-styles/readme.md b/node_modules/ansi-styles/readme.md new file mode 100644 index 00000000..24883de8 --- /dev/null +++ b/node_modules/ansi-styles/readme.md @@ -0,0 +1,152 @@ +# ansi-styles [![Build Status](https://travis-ci.org/chalk/ansi-styles.svg?branch=master)](https://travis-ci.org/chalk/ansi-styles) + +> [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) for styling strings in the terminal + +You probably want the higher-level [chalk](https://github.com/chalk/chalk) module for styling your strings. + + + +## Install + +``` +$ npm install ansi-styles +``` + +## Usage + +```js +const style = require('ansi-styles'); + +console.log(`${style.green.open}Hello world!${style.green.close}`); + + +// Color conversion between 16/256/truecolor +// NOTE: If conversion goes to 16 colors or 256 colors, the original color +// may be degraded to fit that color palette. This means terminals +// that do not support 16 million colors will best-match the +// original color. +console.log(style.bgColor.ansi.hsl(120, 80, 72) + 'Hello world!' + style.bgColor.close); +console.log(style.color.ansi256.rgb(199, 20, 250) + 'Hello world!' + style.color.close); +console.log(style.color.ansi16m.hex('#abcdef') + 'Hello world!' + style.color.close); +``` + +## API + +Each style has an `open` and `close` property. + +## Styles + +### Modifiers + +- `reset` +- `bold` +- `dim` +- `italic` *(Not widely supported)* +- `underline` +- `inverse` +- `hidden` +- `strikethrough` *(Not widely supported)* + +### Colors + +- `black` +- `red` +- `green` +- `yellow` +- `blue` +- `magenta` +- `cyan` +- `white` +- `blackBright` (alias: `gray`, `grey`) +- `redBright` +- `greenBright` +- `yellowBright` +- `blueBright` +- `magentaBright` +- `cyanBright` +- `whiteBright` + +### Background colors + +- `bgBlack` +- `bgRed` +- `bgGreen` +- `bgYellow` +- `bgBlue` +- `bgMagenta` +- `bgCyan` +- `bgWhite` +- `bgBlackBright` (alias: `bgGray`, `bgGrey`) +- `bgRedBright` +- `bgGreenBright` +- `bgYellowBright` +- `bgBlueBright` +- `bgMagentaBright` +- `bgCyanBright` +- `bgWhiteBright` + +## Advanced usage + +By default, you get a map of styles, but the styles are also available as groups. They are non-enumerable so they don't show up unless you access them explicitly. This makes it easier to expose only a subset in a higher-level module. + +- `style.modifier` +- `style.color` +- `style.bgColor` + +###### Example + +```js +console.log(style.color.green.open); +``` + +Raw escape codes (i.e. without the CSI escape prefix `\u001B[` and render mode postfix `m`) are available under `style.codes`, which returns a `Map` with the open codes as keys and close codes as values. + +###### Example + +```js +console.log(style.codes.get(36)); +//=> 39 +``` + +## [256 / 16 million (TrueColor) support](https://gist.github.com/XVilka/8346728) + +`ansi-styles` uses the [`color-convert`](https://github.com/Qix-/color-convert) package to allow for converting between various colors and ANSI escapes, with support for 256 and 16 million colors. + +The following color spaces from `color-convert` are supported: + +- `rgb` +- `hex` +- `keyword` +- `hsl` +- `hsv` +- `hwb` +- `ansi` +- `ansi256` + +To use these, call the associated conversion function with the intended output, for example: + +```js +style.color.ansi.rgb(100, 200, 15); // RGB to 16 color ansi foreground code +style.bgColor.ansi.rgb(100, 200, 15); // RGB to 16 color ansi background code + +style.color.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code +style.bgColor.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code + +style.color.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color foreground code +style.bgColor.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color background code +``` + +## Related + +- [ansi-escapes](https://github.com/sindresorhus/ansi-escapes) - ANSI escape codes for manipulating the terminal + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + +## For enterprise + +Available as part of the Tidelift Subscription. + +The maintainers of `ansi-styles` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-ansi-styles?utm_source=npm-ansi-styles&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) diff --git a/node_modules/anymatch/LICENSE b/node_modules/anymatch/LICENSE new file mode 100644 index 00000000..491766ca --- /dev/null +++ b/node_modules/anymatch/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) 2019 Elan Shanker, Paul Miller (https://paulmillr.com) + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/anymatch/README.md b/node_modules/anymatch/README.md new file mode 100644 index 00000000..1dd67f53 --- /dev/null +++ b/node_modules/anymatch/README.md @@ -0,0 +1,87 @@ +anymatch [![Build Status](https://travis-ci.org/micromatch/anymatch.svg?branch=master)](https://travis-ci.org/micromatch/anymatch) [![Coverage Status](https://img.shields.io/coveralls/micromatch/anymatch.svg?branch=master)](https://coveralls.io/r/micromatch/anymatch?branch=master) +====== +Javascript module to match a string against a regular expression, glob, string, +or function that takes the string as an argument and returns a truthy or falsy +value. The matcher can also be an array of any or all of these. Useful for +allowing a very flexible user-defined config to define things like file paths. + +__Note: This module has Bash-parity, please be aware that Windows-style backslashes are not supported as separators. See https://github.com/micromatch/micromatch#backslashes for more information.__ + + +Usage +----- +```sh +npm install anymatch +``` + +#### anymatch(matchers, testString, [returnIndex], [options]) +* __matchers__: (_Array|String|RegExp|Function_) +String to be directly matched, string with glob patterns, regular expression +test, function that takes the testString as an argument and returns a truthy +value if it should be matched, or an array of any number and mix of these types. +* __testString__: (_String|Array_) The string to test against the matchers. If +passed as an array, the first element of the array will be used as the +`testString` for non-function matchers, while the entire array will be applied +as the arguments for function matchers. +* __options__: (_Object_ [optional]_) Any of the [picomatch](https://github.com/micromatch/picomatch#options) options. + * __returnIndex__: (_Boolean [optional]_) If true, return the array index of +the first matcher that that testString matched, or -1 if no match, instead of a +boolean result. + +```js +const anymatch = require('anymatch'); + +const matchers = [ 'path/to/file.js', 'path/anyjs/**/*.js', /foo.js$/, string => string.includes('bar') && string.length > 10 ] ; + +anymatch(matchers, 'path/to/file.js'); // true +anymatch(matchers, 'path/anyjs/baz.js'); // true +anymatch(matchers, 'path/to/foo.js'); // true +anymatch(matchers, 'path/to/bar.js'); // true +anymatch(matchers, 'bar.js'); // false + +// returnIndex = true +anymatch(matchers, 'foo.js', {returnIndex: true}); // 2 +anymatch(matchers, 'path/anyjs/foo.js', {returnIndex: true}); // 1 + +// any picomatc + +// using globs to match directories and their children +anymatch('node_modules', 'node_modules'); // true +anymatch('node_modules', 'node_modules/somelib/index.js'); // false +anymatch('node_modules/**', 'node_modules/somelib/index.js'); // true +anymatch('node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // false +anymatch('**/node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // true + +const matcher = anymatch(matchers); +['foo.js', 'bar.js'].filter(matcher); // [ 'foo.js' ] +anymatch master* ❯ + +``` + +#### anymatch(matchers) +You can also pass in only your matcher(s) to get a curried function that has +already been bound to the provided matching criteria. This can be used as an +`Array#filter` callback. + +```js +var matcher = anymatch(matchers); + +matcher('path/to/file.js'); // true +matcher('path/anyjs/baz.js', true); // 1 + +['foo.js', 'bar.js'].filter(matcher); // ['foo.js'] +``` + +Changelog +---------- +[See release notes page on GitHub](https://github.com/micromatch/anymatch/releases) + +- **v3.0:** Removed `startIndex` and `endIndex` arguments. Node 8.x-only. +- **v2.0:** [micromatch](https://github.com/jonschlinkert/micromatch) moves away from minimatch-parity and inline with Bash. This includes handling backslashes differently (see https://github.com/micromatch/micromatch#backslashes for more information). +- **v1.2:** anymatch uses [micromatch](https://github.com/jonschlinkert/micromatch) +for glob pattern matching. Issues with glob pattern matching should be +reported directly to the [micromatch issue tracker](https://github.com/jonschlinkert/micromatch/issues). + +License +------- +[ISC](https://raw.github.com/micromatch/anymatch/master/LICENSE) diff --git a/node_modules/anymatch/index.d.ts b/node_modules/anymatch/index.d.ts new file mode 100644 index 00000000..196d0617 --- /dev/null +++ b/node_modules/anymatch/index.d.ts @@ -0,0 +1,19 @@ +type AnymatchFn = (testString: string) => boolean; +type AnymatchPattern = string|RegExp|AnymatchFn; +type AnymatchMatcher = AnymatchPattern|AnymatchPattern[] +type AnymatchTester = { + (testString: string|any[], returnIndex: true): number; + (testString: string|any[]): boolean; +} + +type PicomatchOptions = {dot: boolean}; + +declare const anymatch: { + (matchers: AnymatchMatcher): AnymatchTester; + (matchers: AnymatchMatcher, testString: string|any[], returnIndex: true | PicomatchOptions): number; + (matchers: AnymatchMatcher, testString: string|any[]): boolean; +} + +export {AnymatchMatcher as Matcher} +export {AnymatchTester as Tester} +export default anymatch diff --git a/node_modules/anymatch/index.js b/node_modules/anymatch/index.js new file mode 100644 index 00000000..9fb3ebb1 --- /dev/null +++ b/node_modules/anymatch/index.js @@ -0,0 +1,104 @@ +'use strict'; + +Object.defineProperty(exports, "__esModule", { value: true }); + +const picomatch = require('picomatch'); +const normalizePath = require('normalize-path'); + +/** + * @typedef {(testString: string) => boolean} AnymatchFn + * @typedef {string|RegExp|AnymatchFn} AnymatchPattern + * @typedef {AnymatchPattern|AnymatchPattern[]} AnymatchMatcher + */ +const BANG = '!'; +const DEFAULT_OPTIONS = {returnIndex: false}; +const arrify = (item) => Array.isArray(item) ? item : [item]; + +/** + * @param {AnymatchPattern} matcher + * @param {object} options + * @returns {AnymatchFn} + */ +const createPattern = (matcher, options) => { + if (typeof matcher === 'function') { + return matcher; + } + if (typeof matcher === 'string') { + const glob = picomatch(matcher, options); + return (string) => matcher === string || glob(string); + } + if (matcher instanceof RegExp) { + return (string) => matcher.test(string); + } + return (string) => false; +}; + +/** + * @param {Array} patterns + * @param {Array} negPatterns + * @param {String|Array} args + * @param {Boolean} returnIndex + * @returns {boolean|number} + */ +const matchPatterns = (patterns, negPatterns, args, returnIndex) => { + const isList = Array.isArray(args); + const _path = isList ? args[0] : args; + if (!isList && typeof _path !== 'string') { + throw new TypeError('anymatch: second argument must be a string: got ' + + Object.prototype.toString.call(_path)) + } + const path = normalizePath(_path); + + for (let index = 0; index < negPatterns.length; index++) { + const nglob = negPatterns[index]; + if (nglob(path)) { + return returnIndex ? -1 : false; + } + } + + const applied = isList && [path].concat(args.slice(1)); + for (let index = 0; index < patterns.length; index++) { + const pattern = patterns[index]; + if (isList ? pattern(...applied) : pattern(path)) { + return returnIndex ? index : true; + } + } + + return returnIndex ? -1 : false; +}; + +/** + * @param {AnymatchMatcher} matchers + * @param {Array|string} testString + * @param {object} options + * @returns {boolean|number|Function} + */ +const anymatch = (matchers, testString, options = DEFAULT_OPTIONS) => { + if (matchers == null) { + throw new TypeError('anymatch: specify first argument'); + } + const opts = typeof options === 'boolean' ? {returnIndex: options} : options; + const returnIndex = opts.returnIndex || false; + + // Early cache for matchers. + const mtchers = arrify(matchers); + const negatedGlobs = mtchers + .filter(item => typeof item === 'string' && item.charAt(0) === BANG) + .map(item => item.slice(1)) + .map(item => picomatch(item, opts)); + const patterns = mtchers + .filter(item => typeof item !== 'string' || (typeof item === 'string' && item.charAt(0) !== BANG)) + .map(matcher => createPattern(matcher, opts)); + + if (testString == null) { + return (testString, ri = false) => { + const returnIndex = typeof ri === 'boolean' ? ri : false; + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); + } + } + + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); +}; + +anymatch.default = anymatch; +module.exports = anymatch; diff --git a/node_modules/anymatch/package.json b/node_modules/anymatch/package.json new file mode 100644 index 00000000..7219e6ec --- /dev/null +++ b/node_modules/anymatch/package.json @@ -0,0 +1,76 @@ +{ + "_from": "anymatch@~3.1.1", + "_id": "anymatch@3.1.2", + "_inBundle": false, + "_integrity": "sha512-P43ePfOAIupkguHUycrc4qJ9kz8ZiuOUijaETwX7THt0Y/GNK7v0aa8rY816xWjZ7rJdA5XdMcpVFTKMq+RvWg==", + "_location": "/anymatch", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "anymatch@~3.1.1", + "name": "anymatch", + "escapedName": "anymatch", + "rawSpec": "~3.1.1", + "saveSpec": null, + "fetchSpec": "~3.1.1" + }, + "_requiredBy": [ + "/chokidar" + ], + "_resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.2.tgz", + "_shasum": "c0557c096af32f106198f4f4e2a383537e378716", + "_spec": "anymatch@~3.1.1", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/chokidar", + "author": { + "name": "Elan Shanker", + "url": "https://github.com/es128" + }, + "bugs": { + "url": "https://github.com/micromatch/anymatch/issues" + }, + "bundleDependencies": false, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "deprecated": false, + "description": "Matches strings against configurable strings, globs, regular expressions, and/or functions", + "devDependencies": { + "mocha": "^6.1.3", + "nyc": "^14.0.0" + }, + "engines": { + "node": ">= 8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/micromatch/anymatch", + "keywords": [ + "match", + "any", + "string", + "file", + "fs", + "list", + "glob", + "regex", + "regexp", + "regular", + "expression", + "function" + ], + "license": "ISC", + "name": "anymatch", + "repository": { + "type": "git", + "url": "git+https://github.com/micromatch/anymatch.git" + }, + "scripts": { + "mocha": "mocha", + "test": "nyc mocha" + }, + "version": "3.1.2" +} diff --git a/node_modules/aproba/LICENSE b/node_modules/aproba/LICENSE new file mode 100644 index 00000000..f4be44d8 --- /dev/null +++ b/node_modules/aproba/LICENSE @@ -0,0 +1,14 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + diff --git a/node_modules/aproba/README.md b/node_modules/aproba/README.md new file mode 100644 index 00000000..0bfc594c --- /dev/null +++ b/node_modules/aproba/README.md @@ -0,0 +1,94 @@ +aproba +====== + +A ridiculously light-weight function argument validator + +``` +var validate = require("aproba") + +function myfunc(a, b, c) { + // `a` must be a string, `b` a number, `c` a function + validate('SNF', arguments) // [a,b,c] is also valid +} + +myfunc('test', 23, function () {}) // ok +myfunc(123, 23, function () {}) // type error +myfunc('test', 23) // missing arg error +myfunc('test', 23, function () {}, true) // too many args error + +``` + +Valid types are: + +| type | description +| :--: | :---------- +| * | matches any type +| A | `Array.isArray` OR an `arguments` object +| S | typeof == string +| N | typeof == number +| F | typeof == function +| O | typeof == object and not type A and not type E +| B | typeof == boolean +| E | `instanceof Error` OR `null` **(special: see below)** +| Z | == `null` + +Validation failures throw one of three exception types, distinguished by a +`code` property of `EMISSINGARG`, `EINVALIDTYPE` or `ETOOMANYARGS`. + +If you pass in an invalid type then it will throw with a code of +`EUNKNOWNTYPE`. + +If an **error** argument is found and is not null then the remaining +arguments are optional. That is, if you say `ESO` then that's like using a +non-magical `E` in: `E|ESO|ZSO`. + +### But I have optional arguments?! + +You can provide more than one signature by separating them with pipes `|`. +If any signature matches the arguments then they'll be considered valid. + +So for example, say you wanted to write a signature for +`fs.createWriteStream`. The docs for it describe it thusly: + +``` +fs.createWriteStream(path[, options]) +``` + +This would be a signature of `SO|S`. That is, a string and and object, or +just a string. + +Now, if you read the full `fs` docs, you'll see that actually path can ALSO +be a buffer. And options can be a string, that is: +``` +path | +options | +``` + +To reproduce this you have to fully enumerate all of the possible +combinations and that implies a signature of `SO|SS|OO|OS|S|O`. The +awkwardness is a feature: It reminds you of the complexity you're adding to +your API when you do this sort of thing. + + +### Browser support + +This has no dependencies and should work in browsers, though you'll have +noisier stack traces. + +### Why this exists + +I wanted a very simple argument validator. It needed to do two things: + +1. Be more concise and easier to use than assertions + +2. Not encourage an infinite bikeshed of DSLs + +This is why types are specified by a single character and there's no such +thing as an optional argument. + +This is not intended to validate user data. This is specifically about +asserting the interface of your functions. + +If you need greater validation, I encourage you to write them by hand or +look elsewhere. + diff --git a/node_modules/aproba/index.js b/node_modules/aproba/index.js new file mode 100644 index 00000000..6f3f797c --- /dev/null +++ b/node_modules/aproba/index.js @@ -0,0 +1,105 @@ +'use strict' + +function isArguments (thingy) { + return thingy != null && typeof thingy === 'object' && thingy.hasOwnProperty('callee') +} + +var types = { + '*': {label: 'any', check: function () { return true }}, + A: {label: 'array', check: function (thingy) { return Array.isArray(thingy) || isArguments(thingy) }}, + S: {label: 'string', check: function (thingy) { return typeof thingy === 'string' }}, + N: {label: 'number', check: function (thingy) { return typeof thingy === 'number' }}, + F: {label: 'function', check: function (thingy) { return typeof thingy === 'function' }}, + O: {label: 'object', check: function (thingy) { return typeof thingy === 'object' && thingy != null && !types.A.check(thingy) && !types.E.check(thingy) }}, + B: {label: 'boolean', check: function (thingy) { return typeof thingy === 'boolean' }}, + E: {label: 'error', check: function (thingy) { return thingy instanceof Error }}, + Z: {label: 'null', check: function (thingy) { return thingy == null }} +} + +function addSchema (schema, arity) { + var group = arity[schema.length] = arity[schema.length] || [] + if (group.indexOf(schema) === -1) group.push(schema) +} + +var validate = module.exports = function (rawSchemas, args) { + if (arguments.length !== 2) throw wrongNumberOfArgs(['SA'], arguments.length) + if (!rawSchemas) throw missingRequiredArg(0, 'rawSchemas') + if (!args) throw missingRequiredArg(1, 'args') + if (!types.S.check(rawSchemas)) throw invalidType(0, ['string'], rawSchemas) + if (!types.A.check(args)) throw invalidType(1, ['array'], args) + var schemas = rawSchemas.split('|') + var arity = {} + + schemas.forEach(function (schema) { + for (var ii = 0; ii < schema.length; ++ii) { + var type = schema[ii] + if (!types[type]) throw unknownType(ii, type) + } + if (/E.*E/.test(schema)) throw moreThanOneError(schema) + addSchema(schema, arity) + if (/E/.test(schema)) { + addSchema(schema.replace(/E.*$/, 'E'), arity) + addSchema(schema.replace(/E/, 'Z'), arity) + if (schema.length === 1) addSchema('', arity) + } + }) + var matching = arity[args.length] + if (!matching) { + throw wrongNumberOfArgs(Object.keys(arity), args.length) + } + for (var ii = 0; ii < args.length; ++ii) { + var newMatching = matching.filter(function (schema) { + var type = schema[ii] + var typeCheck = types[type].check + return typeCheck(args[ii]) + }) + if (!newMatching.length) { + var labels = matching.map(function (schema) { + return types[schema[ii]].label + }).filter(function (schema) { return schema != null }) + throw invalidType(ii, labels, args[ii]) + } + matching = newMatching + } +} + +function missingRequiredArg (num) { + return newException('EMISSINGARG', 'Missing required argument #' + (num + 1)) +} + +function unknownType (num, type) { + return newException('EUNKNOWNTYPE', 'Unknown type ' + type + ' in argument #' + (num + 1)) +} + +function invalidType (num, expectedTypes, value) { + var valueType + Object.keys(types).forEach(function (typeCode) { + if (types[typeCode].check(value)) valueType = types[typeCode].label + }) + return newException('EINVALIDTYPE', 'Argument #' + (num + 1) + ': Expected ' + + englishList(expectedTypes) + ' but got ' + valueType) +} + +function englishList (list) { + return list.join(', ').replace(/, ([^,]+)$/, ' or $1') +} + +function wrongNumberOfArgs (expected, got) { + var english = englishList(expected) + var args = expected.every(function (ex) { return ex.length === 1 }) + ? 'argument' + : 'arguments' + return newException('EWRONGARGCOUNT', 'Expected ' + english + ' ' + args + ' but got ' + got) +} + +function moreThanOneError (schema) { + return newException('ETOOMANYERRORTYPES', + 'Only one error type per argument signature is allowed, more than one found in "' + schema + '"') +} + +function newException (code, msg) { + var e = new Error(msg) + e.code = code + if (Error.captureStackTrace) Error.captureStackTrace(e, validate) + return e +} diff --git a/node_modules/aproba/package.json b/node_modules/aproba/package.json new file mode 100644 index 00000000..3b5660a7 --- /dev/null +++ b/node_modules/aproba/package.json @@ -0,0 +1,62 @@ +{ + "_from": "aproba@^1.0.3", + "_id": "aproba@1.2.0", + "_inBundle": false, + "_integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==", + "_location": "/aproba", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "aproba@^1.0.3", + "name": "aproba", + "escapedName": "aproba", + "rawSpec": "^1.0.3", + "saveSpec": null, + "fetchSpec": "^1.0.3" + }, + "_requiredBy": [ + "/gauge" + ], + "_resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", + "_shasum": "6802e6264efd18c790a1b0d517f0f2627bf2c94a", + "_spec": "aproba@^1.0.3", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/gauge", + "author": { + "name": "Rebecca Turner", + "email": "me@re-becca.org" + }, + "bugs": { + "url": "https://github.com/iarna/aproba/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "A ridiculously light-weight argument validator (now browser friendly)", + "devDependencies": { + "standard": "^10.0.3", + "tap": "^10.0.2" + }, + "directories": { + "test": "test" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/iarna/aproba", + "keywords": [ + "argument", + "validate" + ], + "license": "ISC", + "main": "index.js", + "name": "aproba", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/aproba.git" + }, + "scripts": { + "test": "standard && tap -j3 test/*.js" + }, + "version": "1.2.0" +} diff --git a/node_modules/are-we-there-yet/CHANGES.md b/node_modules/are-we-there-yet/CHANGES.md new file mode 100644 index 00000000..21f3b1c1 --- /dev/null +++ b/node_modules/are-we-there-yet/CHANGES.md @@ -0,0 +1,37 @@ +Hi, figured we could actually use a changelog now: + +## 1.1.5 2018-05-24 + +* [#92](https://github.com/iarna/are-we-there-yet/pull/92) Fix bug where + `finish` would throw errors when including `TrackerStream` objects in + `TrackerGroup` collections. (@brianloveswords) + +## 1.1.4 2017-04-21 + +* Fix typo in package.json + +## 1.1.3 2017-04-21 + +* Improve documentation and limit files included in the distribution. + +## 1.1.2 2016-03-15 + +* Add tracker group cycle detection and tests for it + +## 1.1.1 2016-01-29 + +* Fix a typo in stream completion tracker + +## 1.1.0 2016-01-29 + +* Rewrote completion percent computation to be low impact– no more walking a + tree of completion groups every time we need this info. Previously, with + medium sized tree of completion groups, even a relatively modest number of + calls to the top level `completed()` method would result in absurd numbers + of calls overall as it walked down the tree. We now, instead, keep track as + we bubble up changes, so the computation is limited to when data changes and + to the depth of that one branch, instead of _every_ node. (Plus, we were already + incurring _this_ cost, since we already bubbled out changes.) +* Moved different tracker types out to their own files. +* Made tests test for TOO MANY events too. +* Standarized the source code formatting diff --git a/node_modules/are-we-there-yet/LICENSE b/node_modules/are-we-there-yet/LICENSE new file mode 100644 index 00000000..af458806 --- /dev/null +++ b/node_modules/are-we-there-yet/LICENSE @@ -0,0 +1,5 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/are-we-there-yet/README.md b/node_modules/are-we-there-yet/README.md new file mode 100644 index 00000000..7e2b42d8 --- /dev/null +++ b/node_modules/are-we-there-yet/README.md @@ -0,0 +1,195 @@ +are-we-there-yet +---------------- + +Track complex hiearchies of asynchronous task completion statuses. This is +intended to give you a way of recording and reporting the progress of the big +recursive fan-out and gather type workflows that are so common in async. + +What you do with this completion data is up to you, but the most common use case is to +feed it to one of the many progress bar modules. + +Most progress bar modules include a rudamentary version of this, but my +needs were more complex. + +Usage +===== + +```javascript +var TrackerGroup = require("are-we-there-yet").TrackerGroup + +var top = new TrackerGroup("program") + +var single = top.newItem("one thing", 100) +single.completeWork(20) + +console.log(top.completed()) // 0.2 + +fs.stat("file", function(er, stat) { + if (er) throw er + var stream = top.newStream("file", stat.size) + console.log(top.completed()) // now 0.1 as single is 50% of the job and is 20% complete + // and 50% * 20% == 10% + fs.createReadStream("file").pipe(stream).on("data", function (chunk) { + // do stuff with chunk + }) + top.on("change", function (name) { + // called each time a chunk is read from "file" + // top.completed() will start at 0.1 and fill up to 0.6 as the file is read + }) +}) +``` + +Shared Methods +============== + +* var completed = tracker.completed() + +Implemented in: `Tracker`, `TrackerGroup`, `TrackerStream` + +Returns the ratio of completed work to work to be done. Range of 0 to 1. + +* tracker.finish() + +Implemented in: `Tracker`, `TrackerGroup` + +Marks the tracker as completed. With a TrackerGroup this marks all of its +components as completed. + +Marks all of the components of this tracker as finished, which in turn means +that `tracker.completed()` for this will now be 1. + +This will result in one or more `change` events being emitted. + +Events +====== + +All tracker objects emit `change` events with the following arguments: + +``` +function (name, completed, tracker) +``` + +`name` is the name of the tracker that originally emitted the event, +or if it didn't have one, the first containing tracker group that had one. + +`completed` is the percent complete (as returned by `tracker.completed()` method). + +`tracker` is the tracker object that you are listening for events on. + +TrackerGroup +============ + +* var tracker = new TrackerGroup(**name**) + + * **name** *(optional)* - The name of this tracker group, used in change + notifications if the component updating didn't have a name. Defaults to undefined. + +Creates a new empty tracker aggregation group. These are trackers whose +completion status is determined by the completion status of other trackers. + +* tracker.addUnit(**otherTracker**, **weight**) + + * **otherTracker** - Any of the other are-we-there-yet tracker objects + * **weight** *(optional)* - The weight to give the tracker, defaults to 1. + +Adds the **otherTracker** to this aggregation group. The weight determines +how long you expect this tracker to take to complete in proportion to other +units. So for instance, if you add one tracker with a weight of 1 and +another with a weight of 2, you're saying the second will take twice as long +to complete as the first. As such, the first will account for 33% of the +completion of this tracker and the second will account for the other 67%. + +Returns **otherTracker**. + +* var subGroup = tracker.newGroup(**name**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subGroup = tracker.addUnit(new TrackerGroup(name), weight) +``` + +* var subItem = tracker.newItem(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subItem = tracker.addUnit(new Tracker(name, todo), weight) +``` + +* var subStream = tracker.newStream(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subStream = tracker.addUnit(new TrackerStream(name, todo), weight) +``` + +* console.log( tracker.debug() ) + +Returns a tree showing the completion of this tracker group and all of its +children, including recursively entering all of the children. + +Tracker +======= + +* var tracker = new Tracker(**name**, **todo**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **todo** *(optional)* The amount of work todo (a number). Defaults to 0. + +Ordinarily these are constructed as a part of a tracker group (via +`newItem`). + +* var completed = tracker.completed() + +Returns the ratio of completed work to work to be done. Range of 0 to 1. If +total work to be done is 0 then it will return 0. + +* tracker.addWork(**todo**) + + * **todo** A number to add to the amount of work to be done. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. + +* tracker.completeWork(**completed**) + + * **completed** A number to add to the work complete + +Increase the amount of work complete, thus increasing the completion percentage. +Will never increase the work completed past the amount of work todo. That is, +percentages > 100% are not allowed. Triggers a `change` event. + +* tracker.finish() + +Marks this tracker as finished, tracker.completed() will now be 1. Triggers +a `change` event. + +TrackerStream +============= + +* var tracker = new TrackerStream(**name**, **size**, **options**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **size** *(optional)* The number of bytes being sent through this stream. + * **options** *(optional)* A hash of stream options + +The tracker stream object is a pass through stream that updates an internal +tracker object each time a block passes through. It's intended to track +downloads, file extraction and other related activities. You use it by piping +your data source into it and then using it as your data source. + +If your data has a length attribute then that's used as the amount of work +completed when the chunk is passed through. If it does not (eg, object +streams) then each chunk counts as completing 1 unit of work, so your size +should be the total number of objects being streamed. + +* tracker.addWork(**todo**) + + * **todo** Increase the expected overall size by **todo** bytes. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. diff --git a/node_modules/are-we-there-yet/index.js b/node_modules/are-we-there-yet/index.js new file mode 100644 index 00000000..57d8743f --- /dev/null +++ b/node_modules/are-we-there-yet/index.js @@ -0,0 +1,4 @@ +'use strict' +exports.TrackerGroup = require('./tracker-group.js') +exports.Tracker = require('./tracker.js') +exports.TrackerStream = require('./tracker-stream.js') diff --git a/node_modules/are-we-there-yet/package.json b/node_modules/are-we-there-yet/package.json new file mode 100644 index 00000000..106bd594 --- /dev/null +++ b/node_modules/are-we-there-yet/package.json @@ -0,0 +1,63 @@ +{ + "_from": "are-we-there-yet@~1.1.2", + "_id": "are-we-there-yet@1.1.5", + "_inBundle": false, + "_integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==", + "_location": "/are-we-there-yet", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "are-we-there-yet@~1.1.2", + "name": "are-we-there-yet", + "escapedName": "are-we-there-yet", + "rawSpec": "~1.1.2", + "saveSpec": null, + "fetchSpec": "~1.1.2" + }, + "_requiredBy": [ + "/npmlog" + ], + "_resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz", + "_shasum": "4b35c2944f062a8bfcda66410760350fe9ddfc21", + "_spec": "are-we-there-yet@~1.1.2", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/npmlog", + "author": { + "name": "Rebecca Turner", + "url": "http://re-becca.org" + }, + "bugs": { + "url": "https://github.com/iarna/are-we-there-yet/issues" + }, + "bundleDependencies": false, + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" + }, + "deprecated": false, + "description": "Keep track of the overall completion of many disparate processes", + "devDependencies": { + "standard": "^11.0.1", + "tap": "^12.0.1" + }, + "files": [ + "index.js", + "tracker-base.js", + "tracker-group.js", + "tracker-stream.js", + "tracker.js", + "CHANGES.md" + ], + "homepage": "https://github.com/iarna/are-we-there-yet", + "license": "ISC", + "main": "index.js", + "name": "are-we-there-yet", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/are-we-there-yet.git" + }, + "scripts": { + "test": "standard && tap test/*.js" + }, + "version": "1.1.5" +} diff --git a/node_modules/are-we-there-yet/tracker-base.js b/node_modules/are-we-there-yet/tracker-base.js new file mode 100644 index 00000000..6f436875 --- /dev/null +++ b/node_modules/are-we-there-yet/tracker-base.js @@ -0,0 +1,11 @@ +'use strict' +var EventEmitter = require('events').EventEmitter +var util = require('util') + +var trackerId = 0 +var TrackerBase = module.exports = function (name) { + EventEmitter.call(this) + this.id = ++trackerId + this.name = name +} +util.inherits(TrackerBase, EventEmitter) diff --git a/node_modules/are-we-there-yet/tracker-group.js b/node_modules/are-we-there-yet/tracker-group.js new file mode 100644 index 00000000..9759e122 --- /dev/null +++ b/node_modules/are-we-there-yet/tracker-group.js @@ -0,0 +1,107 @@ +'use strict' +var util = require('util') +var TrackerBase = require('./tracker-base.js') +var Tracker = require('./tracker.js') +var TrackerStream = require('./tracker-stream.js') + +var TrackerGroup = module.exports = function (name) { + TrackerBase.call(this, name) + this.parentGroup = null + this.trackers = [] + this.completion = {} + this.weight = {} + this.totalWeight = 0 + this.finished = false + this.bubbleChange = bubbleChange(this) +} +util.inherits(TrackerGroup, TrackerBase) + +function bubbleChange (trackerGroup) { + return function (name, completed, tracker) { + trackerGroup.completion[tracker.id] = completed + if (trackerGroup.finished) return + trackerGroup.emit('change', name || trackerGroup.name, trackerGroup.completed(), trackerGroup) + } +} + +TrackerGroup.prototype.nameInTree = function () { + var names = [] + var from = this + while (from) { + names.unshift(from.name) + from = from.parentGroup + } + return names.join('/') +} + +TrackerGroup.prototype.addUnit = function (unit, weight) { + if (unit.addUnit) { + var toTest = this + while (toTest) { + if (unit === toTest) { + throw new Error( + 'Attempted to add tracker group ' + + unit.name + ' to tree that already includes it ' + + this.nameInTree(this)) + } + toTest = toTest.parentGroup + } + unit.parentGroup = this + } + this.weight[unit.id] = weight || 1 + this.totalWeight += this.weight[unit.id] + this.trackers.push(unit) + this.completion[unit.id] = unit.completed() + unit.on('change', this.bubbleChange) + if (!this.finished) this.emit('change', unit.name, this.completion[unit.id], unit) + return unit +} + +TrackerGroup.prototype.completed = function () { + if (this.trackers.length === 0) return 0 + var valPerWeight = 1 / this.totalWeight + var completed = 0 + for (var ii = 0; ii < this.trackers.length; ii++) { + var trackerId = this.trackers[ii].id + completed += valPerWeight * this.weight[trackerId] * this.completion[trackerId] + } + return completed +} + +TrackerGroup.prototype.newGroup = function (name, weight) { + return this.addUnit(new TrackerGroup(name), weight) +} + +TrackerGroup.prototype.newItem = function (name, todo, weight) { + return this.addUnit(new Tracker(name, todo), weight) +} + +TrackerGroup.prototype.newStream = function (name, todo, weight) { + return this.addUnit(new TrackerStream(name, todo), weight) +} + +TrackerGroup.prototype.finish = function () { + this.finished = true + if (!this.trackers.length) this.addUnit(new Tracker(), 1, true) + for (var ii = 0; ii < this.trackers.length; ii++) { + var tracker = this.trackers[ii] + tracker.finish() + tracker.removeListener('change', this.bubbleChange) + } + this.emit('change', this.name, 1, this) +} + +var buffer = ' ' +TrackerGroup.prototype.debug = function (depth) { + depth = depth || 0 + var indent = depth ? buffer.substr(0, depth) : '' + var output = indent + (this.name || 'top') + ': ' + this.completed() + '\n' + this.trackers.forEach(function (tracker) { + if (tracker instanceof TrackerGroup) { + output += tracker.debug(depth + 1) + } else { + output += indent + ' ' + tracker.name + ': ' + tracker.completed() + '\n' + } + }) + return output +} diff --git a/node_modules/are-we-there-yet/tracker-stream.js b/node_modules/are-we-there-yet/tracker-stream.js new file mode 100644 index 00000000..e1cf8505 --- /dev/null +++ b/node_modules/are-we-there-yet/tracker-stream.js @@ -0,0 +1,36 @@ +'use strict' +var util = require('util') +var stream = require('readable-stream') +var delegate = require('delegates') +var Tracker = require('./tracker.js') + +var TrackerStream = module.exports = function (name, size, options) { + stream.Transform.call(this, options) + this.tracker = new Tracker(name, size) + this.name = name + this.id = this.tracker.id + this.tracker.on('change', delegateChange(this)) +} +util.inherits(TrackerStream, stream.Transform) + +function delegateChange (trackerStream) { + return function (name, completion, tracker) { + trackerStream.emit('change', name, completion, trackerStream) + } +} + +TrackerStream.prototype._transform = function (data, encoding, cb) { + this.tracker.completeWork(data.length ? data.length : 1) + this.push(data) + cb() +} + +TrackerStream.prototype._flush = function (cb) { + this.tracker.finish() + cb() +} + +delegate(TrackerStream.prototype, 'tracker') + .method('completed') + .method('addWork') + .method('finish') diff --git a/node_modules/are-we-there-yet/tracker.js b/node_modules/are-we-there-yet/tracker.js new file mode 100644 index 00000000..68c2339b --- /dev/null +++ b/node_modules/are-we-there-yet/tracker.js @@ -0,0 +1,30 @@ +'use strict' +var util = require('util') +var TrackerBase = require('./tracker-base.js') + +var Tracker = module.exports = function (name, todo) { + TrackerBase.call(this, name) + this.workDone = 0 + this.workTodo = todo || 0 +} +util.inherits(Tracker, TrackerBase) + +Tracker.prototype.completed = function () { + return this.workTodo === 0 ? 0 : this.workDone / this.workTodo +} + +Tracker.prototype.addWork = function (work) { + this.workTodo += work + this.emit('change', this.name, this.completed(), this) +} + +Tracker.prototype.completeWork = function (work) { + this.workDone += work + if (this.workDone > this.workTodo) this.workDone = this.workTodo + this.emit('change', this.name, this.completed(), this) +} + +Tracker.prototype.finish = function () { + this.workTodo = this.workDone = 1 + this.emit('change', this.name, 1, this) +} diff --git a/node_modules/array-flatten/LICENSE b/node_modules/array-flatten/LICENSE new file mode 100644 index 00000000..983fbe8a --- /dev/null +++ b/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/array-flatten/README.md b/node_modules/array-flatten/README.md new file mode 100644 index 00000000..91fa5b63 --- /dev/null +++ b/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/node_modules/array-flatten/array-flatten.js b/node_modules/array-flatten/array-flatten.js new file mode 100644 index 00000000..089117b3 --- /dev/null +++ b/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/node_modules/array-flatten/package.json b/node_modules/array-flatten/package.json new file mode 100644 index 00000000..dffee911 --- /dev/null +++ b/node_modules/array-flatten/package.json @@ -0,0 +1,64 @@ +{ + "_from": "array-flatten@1.1.1", + "_id": "array-flatten@1.1.1", + "_inBundle": false, + "_integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=", + "_location": "/array-flatten", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "array-flatten@1.1.1", + "name": "array-flatten", + "escapedName": "array-flatten", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2", + "_spec": "array-flatten@1.1.1", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/express", + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Flatten an array of nested arrays into a single flat array", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + }, + "files": [ + "array-flatten.js", + "LICENSE" + ], + "homepage": "https://github.com/blakeembrey/array-flatten", + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "license": "MIT", + "main": "array-flatten.js", + "name": "array-flatten", + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "1.1.1" +} diff --git a/node_modules/balanced-match/.github/FUNDING.yml b/node_modules/balanced-match/.github/FUNDING.yml new file mode 100644 index 00000000..cea8b16e --- /dev/null +++ b/node_modules/balanced-match/.github/FUNDING.yml @@ -0,0 +1,2 @@ +tidelift: "npm/balanced-match" +patreon: juliangruber diff --git a/node_modules/balanced-match/LICENSE.md b/node_modules/balanced-match/LICENSE.md new file mode 100644 index 00000000..2cdc8e41 --- /dev/null +++ b/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/balanced-match/README.md b/node_modules/balanced-match/README.md new file mode 100644 index 00000000..d2a48b6b --- /dev/null +++ b/node_modules/balanced-match/README.md @@ -0,0 +1,97 @@ +# balanced-match + +Match balanced string pairs, like `{` and `}` or `` and ``. Supports regular expressions as well! + +[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match) +[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match) + +[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match) + +## Example + +Get the first matching pair of braces: + +```js +var balanced = require('balanced-match'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); +console.log(balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post')); +``` + +The matches are: + +```bash +$ node example.js +{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' } +{ start: 3, + end: 9, + pre: 'pre', + body: 'first', + post: 'between{second}post' } +{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' } +``` + +## API + +### var m = balanced(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +object with those keys: + +* **start** the index of the first match of `a` +* **end** the index of the matching `b` +* **pre** the preamble, `a` and `b` not included +* **body** the match, `a` and `b` not included +* **post** the postscript, `a` and `b` not included + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`. + +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ , ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install balanced-match +``` + +## Security contact information + +To report a security vulnerability, please use the +[Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/balanced-match/index.js b/node_modules/balanced-match/index.js new file mode 100644 index 00000000..c67a6460 --- /dev/null +++ b/node_modules/balanced-match/index.js @@ -0,0 +1,62 @@ +'use strict'; +module.exports = balanced; +function balanced(a, b, str) { + if (a instanceof RegExp) a = maybeMatch(a, str); + if (b instanceof RegExp) b = maybeMatch(b, str); + + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +function maybeMatch(reg, str) { + var m = str.match(reg); + return m ? m[0] : null; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + if(a===b) { + return [ai, bi]; + } + begs = []; + left = str.length; + + while (i >= 0 && !result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} diff --git a/node_modules/balanced-match/package.json b/node_modules/balanced-match/package.json new file mode 100644 index 00000000..f8af5984 --- /dev/null +++ b/node_modules/balanced-match/package.json @@ -0,0 +1,76 @@ +{ + "_from": "balanced-match@^1.0.0", + "_id": "balanced-match@1.0.2", + "_inBundle": false, + "_integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "_location": "/balanced-match", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "balanced-match@^1.0.0", + "name": "balanced-match", + "escapedName": "balanced-match", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "_shasum": "e83e3a7e3f300b34cb9d87f615fa0cbf357690ee", + "_spec": "balanced-match@^1.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/brace-expansion", + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/balanced-match/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Match balanced character pairs, like \"{\" and \"}\"", + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "homepage": "https://github.com/juliangruber/balanced-match", + "keywords": [ + "match", + "regexp", + "test", + "balanced", + "parse" + ], + "license": "MIT", + "main": "index.js", + "name": "balanced-match", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "scripts": { + "bench": "matcha test/bench.js", + "test": "tape test/test.js" + }, + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + }, + "version": "1.0.2" +} diff --git a/node_modules/basic-auth/HISTORY.md b/node_modules/basic-auth/HISTORY.md new file mode 100644 index 00000000..2c44a010 --- /dev/null +++ b/node_modules/basic-auth/HISTORY.md @@ -0,0 +1,52 @@ +2.0.1 / 2018-09-19 +================== + + * deps: safe-buffer@5.1.2 + +2.0.0 / 2017-09-12 +================== + + * Drop support for Node.js below 0.8 + * Remove `auth(ctx)` signature -- pass in header or `auth(ctx.req)` + * Use `safe-buffer` for improved Buffer API + +1.1.0 / 2016-11-18 +================== + + * Add `auth.parse` for low-level string parsing + +1.0.4 / 2016-05-10 +================== + + * Improve error message when `req` argument is not an object + * Improve error message when `req` missing `headers` property + +1.0.3 / 2015-07-01 +================== + + * Fix regression accepting a Koa context + +1.0.2 / 2015-06-12 +================== + + * Improve error message when `req` argument missing + * perf: enable strict mode + * perf: hoist regular expression + * perf: parse with regular expressions + * perf: remove argument reassignment + +1.0.1 / 2015-05-04 +================== + + * Update readme + +1.0.0 / 2014-07-01 +================== + + * Support empty password + * Support empty username + +0.0.1 / 2013-11-30 +================== + + * Initial release diff --git a/node_modules/basic-auth/LICENSE b/node_modules/basic-auth/LICENSE new file mode 100644 index 00000000..89041f61 --- /dev/null +++ b/node_modules/basic-auth/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2013 TJ Holowaychuk +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/basic-auth/README.md b/node_modules/basic-auth/README.md new file mode 100644 index 00000000..5f3d758b --- /dev/null +++ b/node_modules/basic-auth/README.md @@ -0,0 +1,113 @@ +# basic-auth + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Generic basic auth Authorization header field parser for whatever. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +``` +$ npm install basic-auth +``` + +## API + + + +```js +var auth = require('basic-auth') +``` + +### auth(req) + +Get the basic auth credentials from the given request. The `Authorization` +header is parsed and if the header is invalid, `undefined` is returned, +otherwise an object with `name` and `pass` properties. + +### auth.parse(string) + +Parse a basic auth authorization header string. This will return an object +with `name` and `pass` properties, or `undefined` if the string is invalid. + +## Example + +Pass a Node.js request object to the module export. If parsing fails +`undefined` is returned, otherwise an object with `.name` and `.pass`. + + + +```js +var auth = require('basic-auth') +var user = auth(req) +// => { name: 'something', pass: 'whatever' } +``` + +A header string from any other location can also be parsed with +`auth.parse`, for example a `Proxy-Authorization` header: + + + +```js +var auth = require('basic-auth') +var user = auth.parse(req.getHeader('Proxy-Authorization')) +``` + +### With vanilla node.js http server + +```js +var http = require('http') +var auth = require('basic-auth') +var compare = require('tsscmp') + +// Create server +var server = http.createServer(function (req, res) { + var credentials = auth(req) + + // Check credentials + // The "check" function will typically be against your user store + if (!credentials || !check(credentials.name, credentials.pass)) { + res.statusCode = 401 + res.setHeader('WWW-Authenticate', 'Basic realm="example"') + res.end('Access denied') + } else { + res.end('Access granted') + } +}) + +// Basic function to validate credentials for example +function check (name, pass) { + var valid = true + + // Simple method to prevent short-circut and use timing-safe compare + valid = compare(name, 'john') && valid + valid = compare(pass, 'secret') && valid + + return valid +} + +// Listen +server.listen(3000) +``` + +# License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/basic-auth/master +[coveralls-url]: https://coveralls.io/r/jshttp/basic-auth?branch=master +[downloads-image]: https://badgen.net/npm/dm/basic-auth +[downloads-url]: https://npmjs.org/package/basic-auth +[node-version-image]: https://badgen.net/npm/node/basic-auth +[node-version-url]: https://nodejs.org/en/download +[npm-image]: https://badgen.net/npm/v/basic-auth +[npm-url]: https://npmjs.org/package/basic-auth +[travis-image]: https://badgen.net/travis/jshttp/basic-auth/master +[travis-url]: https://travis-ci.org/jshttp/basic-auth diff --git a/node_modules/basic-auth/index.js b/node_modules/basic-auth/index.js new file mode 100644 index 00000000..9106e646 --- /dev/null +++ b/node_modules/basic-auth/index.js @@ -0,0 +1,133 @@ +/*! + * basic-auth + * Copyright(c) 2013 TJ Holowaychuk + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Buffer = require('safe-buffer').Buffer + +/** + * Module exports. + * @public + */ + +module.exports = auth +module.exports.parse = parse + +/** + * RegExp for basic auth credentials + * + * credentials = auth-scheme 1*SP token68 + * auth-scheme = "Basic" ; case insensitive + * token68 = 1*( ALPHA / DIGIT / "-" / "." / "_" / "~" / "+" / "/" ) *"=" + * @private + */ + +var CREDENTIALS_REGEXP = /^ *(?:[Bb][Aa][Ss][Ii][Cc]) +([A-Za-z0-9._~+/-]+=*) *$/ + +/** + * RegExp for basic auth user/pass + * + * user-pass = userid ":" password + * userid = * + * password = *TEXT + * @private + */ + +var USER_PASS_REGEXP = /^([^:]*):(.*)$/ + +/** + * Parse the Authorization header field of a request. + * + * @param {object} req + * @return {object} with .name and .pass + * @public + */ + +function auth (req) { + if (!req) { + throw new TypeError('argument req is required') + } + + if (typeof req !== 'object') { + throw new TypeError('argument req is required to be an object') + } + + // get header + var header = getAuthorization(req) + + // parse header + return parse(header) +} + +/** + * Decode base64 string. + * @private + */ + +function decodeBase64 (str) { + return Buffer.from(str, 'base64').toString() +} + +/** + * Get the Authorization header from request object. + * @private + */ + +function getAuthorization (req) { + if (!req.headers || typeof req.headers !== 'object') { + throw new TypeError('argument req is required to have headers property') + } + + return req.headers.authorization +} + +/** + * Parse basic auth to object. + * + * @param {string} string + * @return {object} + * @public + */ + +function parse (string) { + if (typeof string !== 'string') { + return undefined + } + + // parse header + var match = CREDENTIALS_REGEXP.exec(string) + + if (!match) { + return undefined + } + + // decode user pass + var userPass = USER_PASS_REGEXP.exec(decodeBase64(match[1])) + + if (!userPass) { + return undefined + } + + // return credentials object + return new Credentials(userPass[1], userPass[2]) +} + +/** + * Object to represent user credentials. + * @private + */ + +function Credentials (name, pass) { + this.name = name + this.pass = pass +} diff --git a/node_modules/basic-auth/package.json b/node_modules/basic-auth/package.json new file mode 100644 index 00000000..b5039d6a --- /dev/null +++ b/node_modules/basic-auth/package.json @@ -0,0 +1,73 @@ +{ + "_from": "basic-auth@~2.0.1", + "_id": "basic-auth@2.0.1", + "_inBundle": false, + "_integrity": "sha512-NF+epuEdnUYVlGuhaxbbq+dvJttwLnGY+YixlXlME5KpQ5W3CnXA5cVTneY3SPbPDRkcjMbifrwmFYcClgOZeg==", + "_location": "/basic-auth", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "basic-auth@~2.0.1", + "name": "basic-auth", + "escapedName": "basic-auth", + "rawSpec": "~2.0.1", + "saveSpec": null, + "fetchSpec": "~2.0.1" + }, + "_requiredBy": [ + "/morgan" + ], + "_resolved": "https://registry.npmjs.org/basic-auth/-/basic-auth-2.0.1.tgz", + "_shasum": "b998279bf47ce38344b4f3cf916d4679bbf51e3a", + "_spec": "basic-auth@~2.0.1", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/morgan", + "bugs": { + "url": "https://github.com/jshttp/basic-auth/issues" + }, + "bundleDependencies": false, + "dependencies": { + "safe-buffer": "5.1.2" + }, + "deprecated": false, + "description": "node.js basic auth parser", + "devDependencies": { + "eslint": "5.6.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/basic-auth#readme", + "keywords": [ + "basic", + "auth", + "authorization", + "basicauth" + ], + "license": "MIT", + "name": "basic-auth", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/basic-auth.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --check-leaks --reporter spec --bail", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "2.0.1" +} diff --git a/node_modules/bcrypt/.editorconfig b/node_modules/bcrypt/.editorconfig new file mode 100644 index 00000000..4e12f93b --- /dev/null +++ b/node_modules/bcrypt/.editorconfig @@ -0,0 +1,19 @@ +root = true + +[*] +indent_style = space +indent_size = 4 +end_of_line = lf +charset = utf-8 +trim_trailing_whitespace = true +insert_final_newline = true + +[{package.json,*.yml}] +indent_style = space +indent_size = 2 + +[appveyor.yml] +end_of_line = crlf + +[*.md] +trim_trailing_whitespace = false diff --git a/node_modules/bcrypt/.travis.yml b/node_modules/bcrypt/.travis.yml new file mode 100644 index 00000000..ea31b97e --- /dev/null +++ b/node_modules/bcrypt/.travis.yml @@ -0,0 +1,63 @@ +language: node_js + +services: +- docker + +env: +- LINUX_CXX=g++-4.8 + +os: +- linux +- osx + +arch: +- amd64 +- arm64 + +node_js: +- '10' +- '11' +- '12' +- '13' +- '14' +- '15' + +addons: + apt: + sources: + - ubuntu-toolchain-r-test + packages: + - g++-4.8 + - bc + +before_install: +- echo Building for Node $TRAVIS_NODE_VERSION +- if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then export CXX=$LINUX_CXX; $CXX --version; + fi; +- if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then c++ --version; fi; +- npm install -g npm@latest + +install: true + +script: +- npm test +- "./node_modules/.bin/node-pre-gyp configure" +- "./node_modules/.bin/node-pre-gyp build" +- "./node_modules/.bin/node-pre-gyp package" +- | + if [[ "$TRAVIS_OS_NAME" == "linux" ]] + then + docker run -w /src --entrypoint /bin/sh -v`pwd`:/src "node:${TRAVIS_NODE_VERSION}-alpine" test_alpine.sh + fi + +deploy: + provider: releases + skip_cleanup: true + api_key: + secure: j4gQ+m02izaw56EOd0gEStHAjCRfSCkohDWvpABiPzh1YPM9MvfEMSIvzzjV/0oMqi3Sy7eGyFv47EgQHZvouW0I8BIUzxuTCE5wP8z2SjABXCa/rz4WTppTc9d9ABq8JSdz80JxEwjmuwnYeMwWgOd7sT/VDiMxLYaXj0JWO7w= + file_glob: true + file: build/stage/kelektiv/node.bcrypt.js/releases/download/*/* + on: + node_js: '10' + repo: kelektiv/node.bcrypt.js + tags: true diff --git a/node_modules/bcrypt/CHANGELOG.md b/node_modules/bcrypt/CHANGELOG.md new file mode 100644 index 00000000..81404965 --- /dev/null +++ b/node_modules/bcrypt/CHANGELOG.md @@ -0,0 +1,171 @@ +# 5.0.1 (2021-02-22) + + * Update `node-pre-gyp` to 1.0.0 + +# 5.0.0 (2020-06-02) + + * Fix the bcrypt "wrap-around" bug. It affects passwords with lengths >= 255. + It is uncommon but it's a bug nevertheless. Previous attempts to fix the bug + was unsuccessful. + * Experimental support for z/OS + * Fix a bug related to NUL in password input + * Update `node-pre-gyp` to 0.15.0 + +# 4.0.1 (2020-02-27) + + * Fix compilation errors in Alpine linux + +# 4.0.0 (2020-02-17) + + * Switch to NAPI bcrypt + * Drop support for NodeJS 8 + +# 3.0.8 (2019-12-31) + + * Update `node-pre-gyp` to 0.14 + * Pre-built binaries for NodeJS 13 + +# 3.0.7 (2019-10-18) + + * Update `nan` to 2.14.0 + * Update `node-pre-gyp` to 0.13 + +# 3.0.6 (2019-04-11) + + * Update `nan` to 2.13.2 + +# 3.0.5 (2019-03-19) + + * Update `nan` to 2.13.1 + * NodeJS 12 compatibility + * Remove `node-pre-gyp` from bundled dependencies + +# 3.0.4-napi (2019-03-08) + + * Sync N-API bcrypt with NAN bcrypt + +# 3.0.4 (2019-02-07) + + * Fix GCC, NAN and V8 deprecation warnings + +# 3.0.3 (2018-12-19) + + * Update `nan` to 2.12.1 + +# 3.0.2 (2018-10-18) + + * Update `nan` to 2.11.1 + +# 3.0.1 (2018-09-20) + + * Update `nan` to 2.11.0 + +# 3.0.0 (2018-07-06) + + * Drop support for NodeJS <= 4 + +# 2.0.1 (2018-04-20) + + * Update `node-pre-gyp` to allow downloading prebuilt modules + +# 2.0.0 (2018-04-07) + + * Make `2b` the default bcrypt version + +# 1.1.0-napi (2018-01-21) + + * Initial support for [N-API](https://nodejs.org/api/n-api.html) + +# 1.0.3 (2016-08-23) + + * update to nan v2.6.2 for NodeJS 8 support + * Fix: use npm scripts instead of node-gyp directly. + +# 1.0.2 (2016-12-31) + + * Fix `compare` promise rejection with invalid arguments + +# 1.0.1 (2016-12-07) + + * Fix destructuring imports with promises + +# 1.0.0 (2016-12-04) + + * add Promise support (commit 2488473) + +# 0.8.7 (2016-06-09) + + * update nan to 2.3.5 for improved node v6 support + +# 0.8.6 (2016-04-20) + + * update nan for node v6 support + +# 0.8.5 (2015-08-12) + + * update to nan v2 (adds support for iojs 3) + +# 0.8.4 (2015-07-24) + + * fix deprecation warning for the Encode API + +# 0.8.3 (2015-05-06) + + * update nan to 1.8.4 for iojs 2.x support + +# 0.8.2 (2015-03-28) + + * always use callback for generating random bytes to avoid blocking + +# 0.8.1 (2015-01-18) + * update NaN to 1.5.0 for iojs support + +# 0.8.0 (2014-08-03) + * migrate to NAN for bindings + +# v0.5.0 + * Fix for issue around empty string params throwing Errors. + * Method deprecation. + * Upgrade from libeio/ev to libuv. (shtylman) + ** --- NOTE --- Breaks 0.4.x compatability + * EV_MULTIPLICITY compile flag. + +# v0.4.1 + * Thread safety fix around OpenSSL (GH-32). (bnoordhuis - through node) + * C++ code changes using delete and new instead of malloc and free. (shtylman) + * Compile options for speed, zoom. (shtylman) + * Move much of the type and variable checking to the JS. (shtylman) + +# v0.4.0 + * Added getRounds function that will tell you the number of rounds within a hash/salt + +# v0.3.2 + * Fix api issue with async salt gen first param + +# v0.3.1 + * Compile under node 0.5.x + +# v0.3.0 + * Internal Refactoring + * Remove pthread dependencies and locking + * Fix compiler warnings and a memory bug + +# v0.2.4 + * Use threadsafe functions instead of pthread mutexes + * salt validation to make sure the salt is of the correct size and format + +# v0.2.3 + * cygwin support + +# v0.2.2 + * Remove dependency on libbsd, use libssl instead + +# v0.2.0 + * Added async functionality + * API changes + * hashpw -> encrypt + * all old sync methods now end with _sync + * Removed libbsd(arc4random) dependency...now uses openssl which is more widely spread + +# v0.1.2 + * Security fix. Wasn't reading rounds in properly and was always only using 4 rounds diff --git a/node_modules/bcrypt/ISSUE_TEMPLATE.md b/node_modules/bcrypt/ISSUE_TEMPLATE.md new file mode 100644 index 00000000..b4baa008 --- /dev/null +++ b/node_modules/bcrypt/ISSUE_TEMPLATE.md @@ -0,0 +1,18 @@ +Thanks for reporting a new issue with the node bcrypt module! + +To help you resolve your issue faster please make sure you have done the following: + +* Searched existing issues (even closed ones) for your same problem +* Make sure you have installed the required dependencies listed on the readme +* Read your npm error log for lines telling you what failed, usually it is a problem with not having the correct dependencies installed to build the native module + +Once you have done the above and are still confident that the issue is with the module, please describe it below. Some things that really help get your issue resolved faster are: + +* What went wrong? +* What did you expect to happen? +* Which version of nodejs and OS? +* If you find a bug, please write a failing test. + +Thanks! + +P.S. If it doesn't look like you read the above then your issue will likely be closed without further explanation. Sorry, but there are just too many issues opened with no useful information or questions which have been previously addressed. diff --git a/node_modules/bcrypt/LICENSE b/node_modules/bcrypt/LICENSE new file mode 100644 index 00000000..94e2ba5f --- /dev/null +++ b/node_modules/bcrypt/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2010 Nicholas Campbell + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/bcrypt/Makefile b/node_modules/bcrypt/Makefile new file mode 100644 index 00000000..0b49b3db --- /dev/null +++ b/node_modules/bcrypt/Makefile @@ -0,0 +1,19 @@ +TESTS = test/*.js + +all: test + +build: clean compile + +compile: + npm install . + npm run install + +test: build + @./node_modules/nodeunit/bin/nodeunit \ + $(TESTS) + +clean: + rm -Rf lib/bindings/ + + +.PHONY: clean test build diff --git a/node_modules/bcrypt/README.md b/node_modules/bcrypt/README.md new file mode 100644 index 00000000..dfa800fe --- /dev/null +++ b/node_modules/bcrypt/README.md @@ -0,0 +1,374 @@ +# node.bcrypt.js +[![Build Status](https://travis-ci.org/kelektiv/node.bcrypt.js.svg?branch=master)](https://travis-ci.org/kelektiv/node.bcrypt.js) +[![Dependency Status](https://david-dm.org/kelektiv/node.bcrypt.js.svg)](https://david-dm.org/kelektiv/node.bcrypt.js) + +A library to help you hash passwords. + +You can read about [bcrypt in Wikipedia][bcryptwiki] as well as in the following article: +[How To Safely Store A Password][codahale] + +## If You Are Submitting Bugs or Issues + +Verify that the node version you are using is a _stable_ version; it has an even major release number. Unstable versions are currently not supported and issues created while using an unstable version will be closed. + +If you are on a stable version of node, please provide a sufficient code snippet or log files for installation issues. The code snippet does not require you to include confidential information. However, it must provide enough information such that the problem can be replicable. Issues which are closed without resolution often lack required information for replication. + + +## Version Compatibility + +| Node Version | Bcrypt Version | +| -------------- | ------------------| +| 0.4 | <= 0.4 | +| 0.6, 0.8, 0.10 | >= 0.5 | +| 0.11 | >= 0.8 | +| 4 | <= 2.1.0 | +| 8 | >= 1.0.3 < 4.0.0 | +| 10, 11 | >= 3 | +| 12 onwards | >= 3.0.6 | + +`node-gyp` only works with stable/released versions of node. Since the `bcrypt` module uses `node-gyp` to build and install, you'll need a stable version of node to use bcrypt. If you do not, you'll likely see an error that starts with: + +``` +gyp ERR! stack Error: "pre" versions of node cannot be installed, use the --nodedir flag instead +``` + +## Security Issues And Concerns + +> Per bcrypt implementation, only the first 72 bytes of a string are used. Any extra bytes are ignored when matching passwords. Note that this is not the first 72 *characters*. It is possible for a string to contain less than 72 characters, while taking up more than 72 bytes (e.g. a UTF-8 encoded string containing emojis). + +As should be the case with any security tool, this library should be scrutinized by anyone using it. If you find or suspect an issue with the code, please bring it to my attention and I'll spend some time trying to make sure that this tool is as secure as possible. + +To make it easier for people using this tool to analyze what has been surveyed, here is a list of BCrypt related security issues/concerns as they've come up. + +* An [issue with passwords][jtr] was found with a version of the Blowfish algorithm developed for John the Ripper. This is not present in the OpenBSD version and is thus not a problem for this module. HT [zooko][zooko]. +* Versions `< 5.0.0` suffer from bcrypt wrap-around bug and _will truncate passwords >= 255 characters leading to severely weakened passwords_. Please upgrade at earliest. See [this wiki page][wrap-around-bug] for more details. +* Versions `< 5.0.0` _do not handle NUL characters inside passwords properly leading to all subsequent characters being dropped and thus resulting in severely weakened passwords_. Please upgrade at earliest. See [this wiki page][improper-nuls] for more details. + +## Compatibility Note + +This library supports `$2a$` and `$2b$` prefix bcrypt hashes. `$2x$` and `$2y$` hashes are specific to bcrypt implementation developed for John the Ripper. In theory, they should be compatible with `$2b$` prefix. + +Compatibility with hashes generated by other languages is not 100% guaranteed due to difference in character encodings. However, it should not be an issue for most cases. + +### Migrating from v1.0.x + +Hashes generated in earlier version of `bcrypt` remain 100% supported in `v2.x.x` and later versions. In most cases, the migration should be a bump in the `package.json`. + +Hashes generated in `v2.x.x` using the defaults parameters will not work in earlier versions. + +## Dependencies + +* NodeJS +* `node-gyp` + * Please check the dependencies for this tool at: https://github.com/nodejs/node-gyp + * Windows users will need the options for c# and c++ installed with their visual studio instance. + * Python 2.x +* `OpenSSL` - This is only required to build the `bcrypt` project if you are using versions <= 0.7.7. Otherwise, we're using the builtin node crypto bindings for seed data (which use the same OpenSSL code paths we were, but don't have the external dependency). + +## Install via NPM + +``` +npm install bcrypt +``` +***Note:*** OS X users using Xcode 4.3.1 or above may need to run the following command in their terminal prior to installing if errors occur regarding xcodebuild: ```sudo xcode-select -switch /Applications/Xcode.app/Contents/Developer``` + +_Pre-built binaries for various NodeJS versions are made available on a best-effort basis._ + +Only the current stable and supported LTS releases are actively tested against. Please note that there may be an interval between the release of the module and the availabilty of the compiled modules. + +Currently, we have pre-built binaries that support the following platforms: + +1. Windows x32 and x64 +2. Linux x64 (GlibC targets only). Pre-built binaries for MUSL targets such as Apline Linux are not available. +3. macOS + +If you face an error like this: + +``` +node-pre-gyp ERR! Tried to download(404): https://github.com/kelektiv/node.bcrypt.js/releases/download/v1.0.2/bcrypt_lib-v1.0.2-node-v48-linux-x64.tar.gz +``` + +make sure you have the appropriate dependencies installed and configured for your platform. You can find installation instructions for the dependencies for some common platforms [in this page][depsinstall]. + +## Usage + +### async (recommended) + +```javascript +const bcrypt = require('bcrypt'); +const saltRounds = 10; +const myPlaintextPassword = 's0/\/\P4$$w0rD'; +const someOtherPlaintextPassword = 'not_bacon'; +``` + +#### To hash a password: + +Technique 1 (generate a salt and hash on separate function calls): + +```javascript +bcrypt.genSalt(saltRounds, function(err, salt) { + bcrypt.hash(myPlaintextPassword, salt, function(err, hash) { + // Store hash in your password DB. + }); +}); +``` + +Technique 2 (auto-gen a salt and hash): + +```javascript +bcrypt.hash(myPlaintextPassword, saltRounds, function(err, hash) { + // Store hash in your password DB. +}); +``` + +Note that both techniques achieve the same end-result. + +#### To check a password: + +```javascript +// Load hash from your password DB. +bcrypt.compare(myPlaintextPassword, hash, function(err, result) { + // result == true +}); +bcrypt.compare(someOtherPlaintextPassword, hash, function(err, result) { + // result == false +}); +``` + +[A Note on Timing Attacks](#a-note-on-timing-attacks) + +### with promises + +bcrypt uses whatever Promise implementation is available in `global.Promise`. NodeJS >= 0.12 has a native Promise implementation built in. However, this should work in any Promises/A+ compliant implementation. + +Async methods that accept a callback, return a `Promise` when callback is not specified if Promise support is available. + +```javascript +bcrypt.hash(myPlaintextPassword, saltRounds).then(function(hash) { + // Store hash in your password DB. +}); +``` +```javascript +// Load hash from your password DB. +bcrypt.compare(myPlaintextPassword, hash).then(function(result) { + // result == true +}); +bcrypt.compare(someOtherPlaintextPassword, hash).then(function(result) { + // result == false +}); +``` + +This is also compatible with `async/await` + +```javascript +async function checkUser(username, password) { + //... fetch user from a db etc. + + const match = await bcrypt.compare(password, user.passwordHash); + + if(match) { + //login + } + + //... +} +``` + +### sync + +```javascript +const bcrypt = require('bcrypt'); +const saltRounds = 10; +const myPlaintextPassword = 's0/\/\P4$$w0rD'; +const someOtherPlaintextPassword = 'not_bacon'; +``` + +#### To hash a password: + +Technique 1 (generate a salt and hash on separate function calls): + +```javascript +const salt = bcrypt.genSaltSync(saltRounds); +const hash = bcrypt.hashSync(myPlaintextPassword, salt); +// Store hash in your password DB. +``` + +Technique 2 (auto-gen a salt and hash): + +```javascript +const hash = bcrypt.hashSync(myPlaintextPassword, saltRounds); +// Store hash in your password DB. +``` + +As with async, both techniques achieve the same end-result. + +#### To check a password: + +```javascript +// Load hash from your password DB. +bcrypt.compareSync(myPlaintextPassword, hash); // true +bcrypt.compareSync(someOtherPlaintextPassword, hash); // false +``` + +[A Note on Timing Attacks](#a-note-on-timing-attacks) + +### Why is async mode recommended over sync mode? +If you are using bcrypt on a simple script, using the sync mode is perfectly fine. However, if you are using bcrypt on a server, the async mode is recommended. This is because the hashing done by bcrypt is CPU intensive, so the sync version will block the event loop and prevent your application from servicing any other inbound requests or events. The async version uses a thread pool which does not block the main event loop. + +## API + +`BCrypt.` + + * `genSaltSync(rounds, minor)` + * `rounds` - [OPTIONAL] - the cost of processing the data. (default - 10) + * `minor` - [OPTIONAL] - minor version of bcrypt to use. (default - b) + * `genSalt(rounds, minor, cb)` + * `rounds` - [OPTIONAL] - the cost of processing the data. (default - 10) + * `minor` - [OPTIONAL] - minor version of bcrypt to use. (default - b) + * `cb` - [OPTIONAL] - a callback to be fired once the salt has been generated. uses eio making it asynchronous. If `cb` is not specified, a `Promise` is returned if Promise support is available. + * `err` - First parameter to the callback detailing any errors. + * `salt` - Second parameter to the callback providing the generated salt. + * `hashSync(data, salt)` + * `data` - [REQUIRED] - the data to be encrypted. + * `salt` - [REQUIRED] - the salt to be used to hash the password. if specified as a number then a salt will be generated with the specified number of rounds and used (see example under **Usage**). + * `hash(data, salt, cb)` + * `data` - [REQUIRED] - the data to be encrypted. + * `salt` - [REQUIRED] - the salt to be used to hash the password. if specified as a number then a salt will be generated with the specified number of rounds and used (see example under **Usage**). + * `cb` - [OPTIONAL] - a callback to be fired once the data has been encrypted. uses eio making it asynchronous. If `cb` is not specified, a `Promise` is returned if Promise support is available. + * `err` - First parameter to the callback detailing any errors. + * `encrypted` - Second parameter to the callback providing the encrypted form. + * `compareSync(data, encrypted)` + * `data` - [REQUIRED] - data to compare. + * `encrypted` - [REQUIRED] - data to be compared to. + * `compare(data, encrypted, cb)` + * `data` - [REQUIRED] - data to compare. + * `encrypted` - [REQUIRED] - data to be compared to. + * `cb` - [OPTIONAL] - a callback to be fired once the data has been compared. uses eio making it asynchronous. If `cb` is not specified, a `Promise` is returned if Promise support is available. + * `err` - First parameter to the callback detailing any errors. + * `same` - Second parameter to the callback providing whether the data and encrypted forms match [true | false]. + * `getRounds(encrypted)` - return the number of rounds used to encrypt a given hash + * `encrypted` - [REQUIRED] - hash from which the number of rounds used should be extracted. + +## A Note on Rounds + +A note about the cost. When you are hashing your data the module will go through a series of rounds to give you a secure hash. The value you submit there is not just the number of rounds that the module will go through to hash your data. The module will use the value you enter and go through `2^rounds` iterations of processing. + +From @garthk, on a 2GHz core you can roughly expect: + + rounds=8 : ~40 hashes/sec + rounds=9 : ~20 hashes/sec + rounds=10: ~10 hashes/sec + rounds=11: ~5 hashes/sec + rounds=12: 2-3 hashes/sec + rounds=13: ~1 sec/hash + rounds=14: ~1.5 sec/hash + rounds=15: ~3 sec/hash + rounds=25: ~1 hour/hash + rounds=31: 2-3 days/hash + + +## A Note on Timing Attacks + +Because it's come up multiple times in this project, and other bcrypt projects, it needs to be said. The bcrypt comparison function is not susceptible to timing attacks. From codahale/bcrypt-ruby#42: + +> One of the desired properties of a cryptographic hash function is preimage attack resistance, which means there is no shortcut for generating a message which, when hashed, produces a specific digest. + +A great thread on this, in much more detail can be found @ codahale/bcrypt-ruby#43 + +If you're unfamiliar with timing attacks and want to learn more you can find a great writeup @ [A Lesson In Timing Attacks][timingatk] + +However, timing attacks are real. And, the comparison function is _not_ time safe. What that means is that it may exit the function early in the comparison process. This happens because of the above. We don't need to be careful that an attacker is going to learn anything, and our comparison function serves to provide a comparison of hashes, it is a utility to the overall purpose of the library. If you end up using it for something else we cannot guarantee the security of the comparator. Keep that in mind as you use the library. + +## Hash Info + +The characters that comprise the resultant hash are `./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$`. + +Resultant hashes will be 60 characters long and they will include the salt among other parameters, as follows: + +`$[algorithm]$[cost]$[salt][hash]` + +- 2 chars hash algorithm identifier prefix. `"$2a$" or "$2b$"` indicates BCrypt +- Cost-factor (n). Represents the exponent used to determine how many iterations 2^n +- 16-byte (128-bit) salt, base64 encoded to 22 characters +- 24-byte (192-bit) hash, base64 encoded to 31 characters + +Example: +``` +$2b$10$nOUIs5kJ7naTuTFkBy1veuK0kSxUFXfuaOKdOKf9xYT0KKIGSJwFa + | | | | + | | | hash-value = K0kSxUFXfuaOKdOKf9xYT0KKIGSJwFa + | | | + | | salt = nOUIs5kJ7naTuTFkBy1veu + | | + | cost-factor => 10 = 2^10 rounds + | + hash-algorithm identifier => 2b = BCrypt +``` + +## Testing + +If you create a pull request, tests better pass :) + +``` +npm install +npm test +``` + +## Credits + +The code for this comes from a few sources: + +* blowfish.cc - OpenBSD +* bcrypt.cc - OpenBSD +* bcrypt::gen_salt - [gen_salt inclusion to bcrypt][bcryptgs] +* bcrypt_node.cc - me + +## Contributors + +* [Antonio Salazar Cardozo][shadowfiend] - Early MacOS X support (when we used libbsd) +* [Ben Glow][pixelglow] - Fixes for thread safety with async calls +* [Van Nguyen][thegoleffect] - Found a timing attack in the comparator +* [NewITFarmer][newitfarmer] - Initial Cygwin support +* [David Trejo][dtrejo] - packaging fixes +* [Alfred Westerveld][alfredwesterveld] - packaging fixes +* [Vincent Côté-Roy][vincentr] - Testing around concurrency issues +* [Lloyd Hilaiel][lloyd] - Documentation fixes +* [Roman Shtylman][shtylman] - Code refactoring, general rot reduction, compile options, better memory management with delete and new, and an upgrade to libuv over eio/ev. +* [Vadim Graboys][vadimg] - Code changes to support 0.5.5+ +* [Ben Noordhuis][bnoordhuis] - Fixed a thread safety issue in nodejs that was perfectly mappable to this module. +* [Nate Rajlich][tootallnate] - Bindings and build process. +* [Sean McArthur][seanmonstar] - Windows Support +* [Fanie Oosthuysen][weareu] - Windows Support +* [Amitosh Swain Mahapatra][agathver] - $2b$ hash support, ES6 Promise support +* [Nicola Del Gobbo][NickNaso] - Initial implementation with N-API + +## License +Unless stated elsewhere, file headers or otherwise, the license as stated in the LICENSE file. + +[bcryptwiki]: https://en.wikipedia.org/wiki/Bcrypt +[bcryptgs]: http://mail-index.netbsd.org/tech-crypto/2002/05/24/msg000204.html +[codahale]: http://codahale.com/how-to-safely-store-a-password/ +[gh13]: https://github.com/ncb000gt/node.bcrypt.js/issues/13 +[jtr]: http://www.openwall.com/lists/oss-security/2011/06/20/2 +[depsinstall]: https://github.com/kelektiv/node.bcrypt.js/wiki/Installation-Instructions +[timingatk]: https://codahale.com/a-lesson-in-timing-attacks/ +[wrap-around-bug]: https://github.com/kelektiv/node.bcrypt.js/wiki/Security-Issues-and-Concerns#bcrypt-wrap-around-bug-medium-severity +[improper-nuls]: https://github.com/kelektiv/node.bcrypt.js/wiki/Security-Issues-and-Concerns#improper-nul-handling-medium-severity + +[shadowfiend]:https://github.com/Shadowfiend +[thegoleffect]:https://github.com/thegoleffect +[pixelglow]:https://github.com/pixelglow +[dtrejo]:https://github.com/dtrejo +[alfredwesterveld]:https://github.com/alfredwesterveld +[newitfarmer]:https://github.com/newitfarmer +[zooko]:https://twitter.com/zooko +[vincentr]:https://twitter.com/vincentcr +[lloyd]:https://github.com/lloyd +[shtylman]:https://github.com/shtylman +[vadimg]:https://github.com/vadimg +[bnoordhuis]:https://github.com/bnoordhuis +[tootallnate]:https://github.com/tootallnate +[seanmonstar]:https://github.com/seanmonstar +[weareu]:https://github.com/weareu +[agathver]:https://github.com/Agathver +[NickNaso]: https://github.com/NickNaso diff --git a/node_modules/bcrypt/SECURITY.md b/node_modules/bcrypt/SECURITY.md new file mode 100644 index 00000000..c132dc86 --- /dev/null +++ b/node_modules/bcrypt/SECURITY.md @@ -0,0 +1,15 @@ +# Security Policy + +As with any software, `bcrypt` is likely to have bugs. Please report any security vulnerabilities responsibly + +## Supported Versions + +| Version | Supported | +| ------- | ------------------ | +| 5.0.x | :white_check_mark: | +| < 5.0 | :x: | + +## Reporting a Vulnerability + +If you are reporting a security vulnerability, please refrain from opening a GitHub issue and instead mail it to +one of the maintainers listed in the README. diff --git a/node_modules/bcrypt/appveyor.yml b/node_modules/bcrypt/appveyor.yml new file mode 100644 index 00000000..5895b1a4 --- /dev/null +++ b/node_modules/bcrypt/appveyor.yml @@ -0,0 +1,50 @@ +environment: + matrix: + - nodejs_version: "10" + platform: x64 + - nodejs_version: "10" + platform: x86 + - nodejs_version: "11" + platform: x64 + - nodejs_version: "11" + platform: x86 + - nodejs_version: "12" + platform: x64 + - nodejs_version: "12" + platform: x86 + - nodejs_version: "13" + platform: x64 + - nodejs_version: "13" + platform: x86 + - nodejs_version: "14" + platform: x64 + - nodejs_version: "14" + platform: x86 + +install: + - where npm + - where node + - ps: Install-Product node $env:nodejs_version $env:platform + - 'npm install -g npm@latest' + +build: off + +artifacts: + - path: 'build/stage/**/bcrypt*.tar.gz' + +test_script: + - node --version + - npm --version + - npm test + +after_test: + - .\node_modules\.bin\node-pre-gyp package + +on_success: + - ps: > + if ($env:NODE_PRE_GYP_GITHUB_TOKEN -ne $null -and $env:APPVEYOR_REPO_TAG_NAME -match '^v(0|[1-9]+)\.(0|[1-9]+)\.(0|[1-9]+)(-\w)?$') { + echo "Publishing $env:APPVEYOR_REPO_TAG_NAME" + npm install node-pre-gyp-github@1.4.3 + ./node_modules/.bin/node-pre-gyp-github publish --release + } + diff --git a/node_modules/bcrypt/bcrypt.js b/node_modules/bcrypt/bcrypt.js new file mode 100644 index 00000000..612f9dcb --- /dev/null +++ b/node_modules/bcrypt/bcrypt.js @@ -0,0 +1,236 @@ +'use strict'; + +var nodePreGyp = require('@mapbox/node-pre-gyp'); +var path = require('path'); +var binding_path = nodePreGyp.find(path.resolve(path.join(__dirname, './package.json'))); +var bindings = require(binding_path); + +var crypto = require('crypto'); + +var promises = require('./promises'); + +/// generate a salt (sync) +/// @param {Number} [rounds] number of rounds (default 10) +/// @return {String} salt +module.exports.genSaltSync = function genSaltSync(rounds, minor) { + // default 10 rounds + if (!rounds) { + rounds = 10; + } else if (typeof rounds !== 'number') { + throw new Error('rounds must be a number'); + } + + if(!minor) { + minor = 'b'; + } else if(minor !== 'b' && minor !== 'a') { + throw new Error('minor must be either "a" or "b"'); + } + + return bindings.gen_salt_sync(minor, rounds, crypto.randomBytes(16)); +}; + +/// generate a salt +/// @param {Number} [rounds] number of rounds (default 10) +/// @param {Function} cb callback(err, salt) +module.exports.genSalt = function genSalt(rounds, minor, cb) { + var error; + + // if callback is first argument, then use defaults for others + if (typeof arguments[0] === 'function') { + // have to set callback first otherwise arguments are overriden + cb = arguments[0]; + rounds = 10; + minor = 'b'; + // callback is second argument + } else if (typeof arguments[1] === 'function') { + // have to set callback first otherwise arguments are overriden + cb = arguments[1]; + minor = 'b'; + } + + if (!cb) { + return promises.promise(genSalt, this, [rounds, minor]); + } + + // default 10 rounds + if (!rounds) { + rounds = 10; + } else if (typeof rounds !== 'number') { + // callback error asynchronously + error = new Error('rounds must be a number'); + return process.nextTick(function() { + cb(error); + }); + } + + if(!minor) { + minor = 'b' + } else if(minor !== 'b' && minor !== 'a') { + error = new Error('minor must be either "a" or "b"'); + return process.nextTick(function() { + cb(error); + }); + } + + crypto.randomBytes(16, function(error, randomBytes) { + if (error) { + cb(error); + return; + } + + bindings.gen_salt(minor, rounds, randomBytes, cb); + }); +}; + +/// hash data using a salt +/// @param {String|Buffer} data the data to encrypt +/// @param {String} salt the salt to use when hashing +/// @return {String} hash +module.exports.hashSync = function hashSync(data, salt) { + if (data == null || salt == null) { + throw new Error('data and salt arguments required'); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || (typeof salt !== 'string' && typeof salt !== 'number')) { + throw new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + } + + if (typeof salt === 'number') { + salt = module.exports.genSaltSync(salt); + } + + return bindings.encrypt_sync(data, salt); +}; + +/// hash data using a salt +/// @param {String|Buffer} data the data to encrypt +/// @param {String} salt the salt to use when hashing +/// @param {Function} cb callback(err, hash) +module.exports.hash = function hash(data, salt, cb) { + var error; + + if (typeof data === 'function') { + error = new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + return process.nextTick(function() { + data(error); + }); + } + + if (typeof salt === 'function') { + error = new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + return process.nextTick(function() { + salt(error); + }); + } + + // cb exists but is not a function + // return a rejecting promise + if (cb && typeof cb !== 'function') { + return promises.reject(new Error('cb must be a function or null to return a Promise')); + } + + if (!cb) { + return promises.promise(hash, this, [data, salt]); + } + + if (data == null || salt == null) { + error = new Error('data and salt arguments required'); + return process.nextTick(function() { + cb(error); + }); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || (typeof salt !== 'string' && typeof salt !== 'number')) { + error = new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + return process.nextTick(function() { + cb(error); + }); + } + + + if (typeof salt === 'number') { + return module.exports.genSalt(salt, function(err, salt) { + return bindings.encrypt(data, salt, cb); + }); + } + + return bindings.encrypt(data, salt, cb); +}; + +/// compare raw data to hash +/// @param {String|Buffer} data the data to hash and compare +/// @param {String} hash expected hash +/// @return {bool} true if hashed data matches hash +module.exports.compareSync = function compareSync(data, hash) { + if (data == null || hash == null) { + throw new Error('data and hash arguments required'); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || typeof hash !== 'string') { + throw new Error('data must be a string or Buffer and hash must be a string'); + } + + return bindings.compare_sync(data, hash); +}; + +/// compare raw data to hash +/// @param {String|Buffer} data the data to hash and compare +/// @param {String} hash expected hash +/// @param {Function} cb callback(err, matched) - matched is true if hashed data matches hash +module.exports.compare = function compare(data, hash, cb) { + var error; + + if (typeof data === 'function') { + error = new Error('data and hash arguments required'); + return process.nextTick(function() { + data(error); + }); + } + + if (typeof hash === 'function') { + error = new Error('data and hash arguments required'); + return process.nextTick(function() { + hash(error); + }); + } + + // cb exists but is not a function + // return a rejecting promise + if (cb && typeof cb !== 'function') { + return promises.reject(new Error('cb must be a function or null to return a Promise')); + } + + if (!cb) { + return promises.promise(compare, this, [data, hash]); + } + + if (data == null || hash == null) { + error = new Error('data and hash arguments required'); + return process.nextTick(function() { + cb(error); + }); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || typeof hash !== 'string') { + error = new Error('data and hash must be strings'); + return process.nextTick(function() { + cb(error); + }); + } + + return bindings.compare(data, hash, cb); +}; + +/// @param {String} hash extract rounds from this hash +/// @return {Number} the number of rounds used to encrypt a given hash +module.exports.getRounds = function getRounds(hash) { + if (hash == null) { + throw new Error('hash argument required'); + } + + if (typeof hash !== 'string') { + throw new Error('hash must be a string'); + } + + return bindings.get_rounds(hash); +}; diff --git a/node_modules/bcrypt/binding.gyp b/node_modules/bcrypt/binding.gyp new file mode 100644 index 00000000..986d7107 --- /dev/null +++ b/node_modules/bcrypt/binding.gyp @@ -0,0 +1,57 @@ +{ + 'targets': [ + { + 'target_name': 'bcrypt_lib', + 'sources': [ + 'src/blowfish.cc', + 'src/bcrypt.cc', + 'src/bcrypt_node.cc' + ], + 'defines': [ + '_GNU_SOURCE', + ], + 'cflags!': [ '-fno-exceptions' ], + 'cflags_cc!': [ '-fno-exceptions' ], + 'include_dirs' : [ + "ViJut_9WJ* zQL!ti0W49hv5O_<;u>2FcK7!_Gj|Kbe7>LL`96OAVfy?R`u`Aib`K{N@oQr?|@?Z18??= zjMT(V)JPfJ%JO^c#bJTt`JM9iJjt*2LYj3pGBR0{GBnv-RFGIDrKOl0iDnAowJNKN$6viu%w zVQhq!WDxjKzAO(8;n&E>l!OT*5{5;NNQg^BQCWUo2RPm}i3#QZ6F;&$A0R|V1}l3j zIW4>9Na;Z7UM5e?r$0--CX9|uo-}4?;^@e+nxwzwN4C#?IhF2|50_CMHVI?G2CkaNk$jH&r|4BaI9FF|hWXH%`^P}+<%u(1iGIC5Jb;1Zu zWL!!@%wO8;b(kZY+DmzBe$H0BC<(hOW5=cY!$;!R8hu4S%3Jf}rIu@Cv~|8T zzo?@erj}4B|DX7goe*whWN1i_?yBGrvyYM#mL@ThM*qY(o+qe;!3ydKLYgm2*|5Iz z0W=;6^K5Jc8u~uA$V1uloNa{G$WwDY@fYr5BaA>s^tTb_wGae3mEn(mbx=-!gzJrq zij}_qQsiqR%zO{18p^1iB^Q5f_QseZxH3u?3xnx`ZuH6J}(b&>q(o z<(1k3Wv=L{Eyxw!6xliD=+U6ges++Z{cJ_{^%*DV5n2oT6^iW3z(f|0((LS4C|gwU zJFG1v!ZW$WAUrnX7^8Ik+|Ct*dF2=#B@dTlG_JFQwMSa4kfBn)6WU8edHH>m`4-9} zCdw8IU5V`YKdi9D3b%h(TjhUOo9Dl)t@^*K&FkOQ=Kb$#^Z9qRHTie7`To1wTK>D* zTK~J++W))S0$FV>76#+4^-yZ73>jrG(&uZ`KoKd+5h;Xkj9+5A7Rjg7E>UK<)oVJxR{B-XFy^X_IqD7-furdh*XB%;t=}=lu9u4J_8qB4DbEPZ`P|>!a_`8T zUrTt-H#uZ2Dp{GYxtsP?x|ZAqy1l{ojg(Wp~hQff22Nu@f~ zHA<3}EjaNO9O^X*hx*-u6KugDJCbn75-m7h796r{35Ujp1?NqPSsof|5)O@43(h4A z4vl^Zhx~^HXNLuc{E>u19?gO?&w@i9Qo z-$WU_OvYFTFLPC=AF)->c>NAtk#s>~VCoZ?4CWUL{nI~9nplRzpptaUT#>Zqa=Hu` z3;mB)^f*n&Ter*=$^VW%$%-DQwM_I#mZncX>NZe0NI66q3A1P8kJ)=4SbVrrdr__Z zBSdTDMt{~&BljNc{T0l)jq`J*U;Ej{!xnq*8W-H=Fbw{zV%Jkec1u6wVM_rcu@vOq zbHm7SelB4;zmq^K{mvSe<*N$G*z;BA>E@RclK&I+l;1Ix-(5pL>kbPPFnE=UUFQ|q zl`AA*h0o1lKzuzNcvkh zMf!eJ6Q^qPEXfWvnAm}pb=fntsD*V|?rk?H!}+2K-}z~2D9Oc$oG<#FBDqout@)jV z(~?_LnD|(i!E?cJIUfg%;X9v^po*Dx&zkI*eJYbYal zi!0N_jJIUg|8FY8QBuY`D`oWJ{`r5hkM2(`_Q8fJw+|%$pVx{YY2}5LRt8!RpJ3sC z9zTtrSoFi(5Z4cqAM`{1MgG{LALeGcevthCm44LeM`bik43;K}vg;!@SA=MvtF^DO zd~+NjE#Jfqv6yePH$%1Wg0)XM6Pjs?*J5^6)Cy$#F`91}eVi(@L{p#7IEq?na7Th# zA7M}KTzf-Y_0VX<)Fq2k8c(JCX5n?jV$zoR>%ZXl1eX0@^HZ|v4hqT&u4|*n zR$ZWkEfVJ`VW(3SDhh(M;1L4N)7GfW7NF2K)DQ?1HQ#vV-b61^W+i>XL;7f^oS; zo`|errghF$DzbBPi)79Pfr{+Y&bivK^C;m6$4v-_83M{r5Q3?5vD7FOg$Lvc&Qp{R zy=z|=kvAr{B0CJd3%QX%?}nmx!wMD0g0!K$cSE%g;VY<<6*J$!SC{Q*^Y%zlt8{;3 zN8+i}o>Xg73ZP4EL8xBiW>lsheF3{X&)1_$U6+^43Xyor3{zShkvTrXh|;AN=05UN zW=(qulY>1fv%0*}4KBhY4&PknQde1&9}KYTBtg4dLM7VKMq^czb5 z8R+{M>9>?F@hwF19VMR!v$T=YFM@q@lv$1;>3J`xg~fF-xv6zw1%du;NO*sx4X9rE z53pro`-j+(*n$4z>`7?J6^F;6B@}0c> zv-;WQb+z+Wr{~)%(~D}U_3lY2f^ZPa1R+?P>z5;b8%=A-Ors)W5i5J4wz&jhT|)H^ z6M<>+mx}BbYB<8&`((tGA#C5bx%ceT@A;~YN7QYOBo9+$S5j+#QRhCghY^;jo!GZC+<6NI%6s{TAux6THU6^aJH&MPbY0G@?t-v%oVPPSF18@*G?!&p^*#Jrt{tY;%!_#QNIl~yiEcIg{jg^Y_+~6jI$NG`Y+|`Nu6~N_ z2%C(vlUxl`w;6eQVp7^mqh`z;d;j)EOgd7(GFun4g20DcGh6v9A|~3L)ul)XGC@jK?rV(3=or zzFPl{*CS{J8rgtZNu}6@qLh`$??tN-r6?9FVy;&nq_?O5g#-VV)Hn|qn2v%GS+d1i z1vw&PG~yF53f4Xj*4{cNDvf!WIhwO^`I(bJ1%~>Rt)cpFDHE!Fevsbs3f0~gdw@i% zO0zC%$BNJ>3ziQn%CatUXGL?Zi)>lZJnN!I24X*dUm#VdKR_)G)yJk;EH)145a`}s zdc{wihlq&rM9Kr0rz$N@F)c@%8<(3ai_?bvh>0&twJlE3wz6ug9c~^uHd(4&S+Us+ zu#*9HI5B{2mTF&C>|O@g!vMSG3}Ba~I+PWAkO2-bzfB=6P<_3NfCkNRt&PP= zWBc49`}87TtW{QV=Kz0vSUJbOGS;Py9nxqj_!54H9T^*gN+YGiMEWt)Dhy@b}0^P%Y)>yKk<=O>&SrfjzQsFS6(QK#qFbMz!F((eov zVF~~k4bEf}Su#Wp^GGr_a1T5$vCDdm-fr)HhVv9sOyxd!2XQOcr z(M|Ie{ZP9aaecM6vm5ROSm_q3wcWASume(x113s?eTZ&|uUdNvi#A_2Q>(T4q6Y}Y zk8m;kLfNLIy1(cH3()*L_zI&sKbLOeND%P-Lb!Oo4>){_3yYtb+DqGdhv8`?xRY8p z!A*^wdIhy^icG9dqULv|X+kjG4=T^^+?vn< zht3$>hr>O^a~$qPaC58TNLDmw2<{=;JgfrL;^W?6pa)0xigx-DPcro|P+^7;1Au6j zKO!6w%c!C%YVGT^>25-bOs#7t#`CHW$^s`^`3^opmAu3j%)B3^_WvEd&->~3l%+5A z{OFeuZ3&(t!4_5{NTSwOE?&R^oTU!Y{|&!fywu!CHTJB>bJ6UoR6s`rrZaYa_w8SonEWx9}TQmfu$r{$kG0 zxh%ipPk4L3vhW-0W#L!3EWgeYzb}9vs(p-SeK1kWlbS;`fW$grO5;JBk428SvWXxR zcLzQPIsmBFl1bxPp_opKvL}46+vhYx(gyyyeS* z!*qF5)FVkPtcANm{+Id4{JatItcjS`#R=fRcaovxxYMV5*(zq8V;h2GWLqhGvt!eQ@6S)GTm8n ziWh4sP4J{dp_C2>OH|WIXSz(T+SILB=j_G`kFul?u{vy}gh6f8x>U3!o90NJxlh6unZdwD zDQcYFebi7&u?c5rLwLSGZljaU2#qWVNswt9`mBN$aE?w^z;|LM0pGyrIq-fr;$=N%h7rP5Gr}wAkt-63e#o%8eEsJLV#c0P!)5N2j-@Vn48LDZgMfmFh|*Ajxu@h6F?*vI~aFs z4{nZ^)A^_w4+_yrEV1Fky%GN7J{0UO9S<{#!PR7ccoCi5@O)I#aaBhiWbBIg! zdvhV#TOSvl9GC67cVjTYhE~uJlvqXHrB49N|@2 zK!zpJrZBXLurSC7BUI0zWjuHzR-NW!-cy6re5TaxG#%&Urw;gB+|owp)$2qmW2_$xl|jg;bGXWR4_-h9jI zmY#!%u8m@LTR==vT}5US%28x@d{;a-Mn=%)p1Ym?qLyMdElSg0xhdw#I0Xyxs?Y!_ z$lFOV>ml$J**mG{155I3G&R(^13n~`Zl@P+Oynx)6(;gW>N5|~yebkv^Ba67Yl2=+ z$``8_Q}e&!9dT2<3W3m*Tt!$cF?U%Lg`~f`s2Ca`U`Zw^%qFFINhZl*lhO`jz$=m9 zy@IeajS+IA>?sRGrP@Vh7n&9sspcn1ez6G(!RB&;nT=+T7=}V_HuaFA zC8XZn9|3X6>+WxWq&^^a9NpYIVsA|5T@k1XIVXFllB^9w5ngo=BNcblwWb@79;e}c z1-OPhPM6K-uwrH2y`>k!e>;}da}fbws%Hb?f6eh{mBP2@_&;;}?@_&O%BK=u&hL!FX0T}ICylzNVg(ua4--jlND4lSwT}`(vUNe zdb%HSCJ}BK@Hhulyx-56`n@Gki12Y|62^MDZ1w!5jKAG68Z>OpZ1T4Y;XXojf9r1# zp%OCUt3dl-^0$HLV~f}MkN&o~RQo>Ej&Vvu=>Mj_-3v`(#Vq;T2SH{1Z5-yq;;xY8 zU;5j7@Yj}>m-V+ntae4_^8eD`zNq=%_*)&Um-*Y7lz_jTKGo!F

Yb^D<3kLp=Am z6QWGsHl;7~w64&BwWpoX30`(;Thn8-I{=#=qa}G;c~?coDjGGVJZ$kID$*~Iyrf@= zSRdqMTs_EX{|68GZUn*qD-T&qX&E**snG1@rMU{emnH%Yf|sTI zeUm$8=S?s^o#~~?@P>E+y!=Wsa{?9f5p^`RQ0#(Yv@e6^7w(J}1#)N1y`u*{s|f#f za}?d&cUR)xaV~I*^PwwF63a;P5CkPhJOGhv_*StoIv=FhIO*@mk>lz`q~xzSX(L8z z^2O__GLmteq?=S*P2d;?ar{@EtfiaC@s%9Es)YX#I2`*V!#4TiZXCN3$9_Zjr$rfHUIo-;74MBaJrasanw} zhY)EJT8(OG)XXDg=mzI7I&8L6i^SRhg=$~W3L^cek90(X_f}1SSWMh~JVL^3dVVMV z$_?;q8W?)_@2m4plLM6#6?ZTZ^|278)gtVGhMdT@0w=l%R6{dP_M=3`w?)2~WP$%O zo>g+zjpKg@9896q4P?1r5P3x@lR=rvyo*RFym7%OB{d6-@^9ulihp5;kp&HBBi9o>1j3l14iKEj=|0;h^h)nmo02IEcbEATf#yAOv;73F53v$zp+^ zS!SL_ah8PO2!yoMEQEmK{{v6fu}X<#KIe%tL_V}B^APWW1EKiON;Jz7pTRali6$&U zIA$f{KkLfu9v-wO5j9Pv{zr}m2FVKlvD5>eVk0U7a~sao#C*3@$yRo!=!-689=zIE zl0hGqBc?FMicB>%H$626k)OG?l$_$llxB(inAH_0kUy&QrbYrrap~leX5VbO(Y3PR~s2Cwugm}+8U~p z&XuI>&Qs-hh3FhZbUpBdQI)IKh8@dOoxw12pF{C={Z6WuM#uH)ly&$lmMV2Z2~MoU zvwj}f28U0yThbttD(ib1rX{KzKEeydp#X-!S%%=rp%}x&frCp^WKz6_$Z7ajlfc8Q4B=ZA^2SP5Y{@M|mJJFzkWz0JT$5>OhXC72b9 z9nH{zrARLmuo%ted^>U=RENIF7xxkLgc<4uD0_~8#lQ`5Ie=)u@EF#BKsm++I;}Er zIIpLzs7d^h&^vJ~u}U+ux=;!j0iY=`wXYPU4MC*9)T&aDS_F{-Q?pA!90(!>rpAMv30u z>1S{<5o-q*V)nR%r9>LWPN7%;<(i0W6*I4*M>#6uT=$RxQV}V2FQlc4ZlWUi(;~3d z{HWFrUIcC{@oWHNoaQ1vJ>;u)gOojs_ym%!qelani*}plA~2+95mAh%rX%mHF9WFi zXf6WJd{N;>l?PmkqMQ3R83AvKnLt8quzs5Hcx`$Rnkgq|iEsAU^W#YBs#UQ&shf#w&cj|~!s6=gUa@7 zKISySAZepTT)hx6u zOgCOeB9H+!kjhu193HW#1d}#f6|EDSfxbkQ##F%@=rc65z|2YPyVT@RM9m>9loI^mG)12o3rMb{nG~I^U@cA zmBmdJfG2hJEEHP1sWhpaMnoAmH5+W0z0qE7o;VTNzj0G3OaPOca_vImNoltUjx1J}w;wMEv-P3>|fG?Js~4M;arAHw7*h3P>5h4x9%|ySqbEPiC=(s2V(Dz8 zS)P1x;YF%F4TFiDPc`w6`V0R?5`Q-<{t7Gp-*Gr+UHqmoNs}+OX6!SF{a@b~W6=^P zW4ITHtlxgZtO9K+GV?%0J@GR!)6uHH*bAS%pje~$GgX)V;&E~+O;qVGK1#0GS#SR_ z&adOxeJ*W5eGDzba5^ddC%2IFUmu5RABoA}6QVtem04j(`p-6@+A%rU#~0v;9iFU* zYM+W(K6 z-$5C~fW2`Oqs~J_(=KKJ;D$inD=7`AE$tZFd{J8yxGj+>9tLFqgHDp=iFF8U60|!q z5Y&a});AZ_PU#6LS7{p*qmdY6IOdx#W>Z8+A27W)-Q4@XVTW17CPd4lj@6Jf zxU){M=6=P8Fm8%p<4#BHEYH)(BCs=a7~KmPIv`;~!P*K_FR^MaVk}Z~qfiA@oEi%G zvGitRzX1+!V{H#*1Tm;0a}I_Rb|(df@_4aHLQAuLgZv>3-(F+^G1u-O~ zQzw3PiPYgrIG3oMstAYEEzw`GGaA9QQw=FA?JT0%O&<^)K{xldueo;0o6#T8Gh!{D zh@nh6g9LPcjxGl}spuw<*s!-8P|QOS&2{~8hm$t@N9sL1J8>FpjFP?YeK9ox*ZE!D z&^kE7t}=diqTApjrt{?(k0wQTf+1k+;Y@r}h-_Mpuq_JQE1vGRgOWtC2vQL6BdATS zt48C~;DCf*3AU;t)8SKbCqqh^fOwJ!L%T%FN&<^X615&uz+eF!%z>FEhMjVn}uvBqNfKU1bUQC~kz)`0~ySEYCz5b`r*F-oMFpSjbH$s!|J=7NBp z;^d2~k+SSR`1h2k&*?C{^u-tQ{#5x(##MTJs87LYcrLo5vDDpRPO2MevkHbY_lPU*k3b6*S~-ibl}E7T}jm2Rl?!y>#e=$aH~~ z(_c6#W-kWkJtuKdtjSfR>!=z4bY7H>oA~f&Ry3LyX{qQcFM7j^Y>BV{ zMXY0kd0{r;ZAT$|4!yF1(8^SAUojQ_icZeQ;2xsWcr%Y!MVU4gtxsV%GVxD>ah05;U;&`QH{6;B2Pu^JqTN_1&w)CmET!%D0WPLG`@{&6MeJ}brXy9 z_?;EEA{U|qFT7t_^iFLofZ+JHgbj=#!i^#)dpt<}3RMA)LyOBG7tFdnf4j!?N;Dsu zKM-H?o*$D{H=*fVAMj@w>Dm3%pUA(9BsF7$HN{Q*2t}m2bG1oz=JR(ne_^=dn+ne<>Ztui^g%|3WL#-vAlB;{RH8*tU7DKmy0SrfwL7a6rCx-OI~$?6O9S+*rdFsv*)3Eb zRhc9ub^@2~-pQuO^++{E$6X+*&;lqL4wrp-hLkdsR4 z(p_qtht*<#56VOG9R>WzP|nsejU6>{lfIy5tv@&36s!Hp70^%>Idqq*u-;GfrK<7H zFMAoPcoW0U7sX?x`CFgY_YBeE9d2W&ZoDtn{~D(--DqzgLu`nyy*K#)S`6Vqcvyj0 z1+2+`ZzJ(_V+z8wK*Y?;oF&nw`2LmXE+inLh1Nvy%!MJ^U~gZ1yz6oDAY9o#B)F-d z%yPoJ&taLrr+6EDL-d2))aiE~Q+pp`$sD5Xiu?(i5N)k6Z6dvV0WGq1=zY;1^}A3Sib0oxzkXEgBF(tc>sjIz8L}nod2K?%|ME|Kr)}G zorDYx1Uc?(F;!;2hNs>5-XI&%Y>LE)?m_**Cmm@-&j&H-N1BpI(-`m1F{%fZf}~vf znqX%2c>owWL!coX-(n}f!I&T0;t15`c-3E*$- zAK02y`T$<2u0CIH{3ezIJ%)J?vcphqYz{5oLv?jc;D_J`aEJsh#&lI`8s~P@3&ga(BAwk6Pvav=CJ)=H6l5nLP|LKgq#gHukGRen1IMf$Ph`lz zHdLebz0W@s5HINH?Rv~Uz1&|n%28^DMieAH8z;kkGO;!t@m%F!vtLi)mB@A=~LFx*tWMP=8y!(3&fwR@*00+ zH9B}o0-JVlYH3mxX8@1)`v9b9X2nB(axE7zWukjmsHg(>iNEs+G}MgVh@n$VhKANU zjy;ZJcVpN_u_kbemq7wv!}BUsgNY=ClXT=HA4wzz;21_@)NS;miUSVfCLTWmBkU(l z+(t2%aH_&aNwqsDQ*;q_ul`AqE+EBNs z3Jtb?IbqsZ%vLHdWuD3h22$6wqbyAsAW_yRP3a5D)}Rc8>!9Q3UcD3Vdon$AAP{>*hxhA3^eVV^dweaYoDTJb>K)eN7KX2KEaKRm%S=SP z4_g4pCLp}O44rSqrwh?blSn1_-VQ#7L6%q_NX4|RIQdnGy zaPU$&;dm0x6prIXIApqCVZG0-&l&H)lR9m1XX|N-SLpE6KLmY*1zz4@KfgChj3 zrFb-jM|B}sb>{=a+J0Gl5f;M(N1foIir^UyC?-p+_A*v23_C(~E&Q$;ws9j^>P`ZY z_bMVqdeRiG54aV`tYELmz1L?zf@{fZOt%07Zerpg1S+0^C1=ySG@COttLX!la5l*j zo321A&N0(?nP^yWV>u@o&Pf6#lFCG484PKo0)8RBoPnaLxGl{@V7FHyNa&RECojw#JD7|kjsf7BarA3LT zp^qu*13Gjfq1-)iAeDT_ec;yvD@`xy?Vpy%uzW@4}gMKqxX z;7*GU=Fd&fH?|Tv)*G|a(0w)Ye&A%`dm5#t=K+@ZHiA*1`duWSBxQB zI(HL75Ij=DWOBp{70?RH8N3_F;*C&^cRal%l~Romu>i}*QF&#Fqm8C&m~IDaqM;J4 zoX1j7XCgsT?%^vgAv2CHLQRN;hH7t#CEKCOQb8!3xwcf5jH*cE&2hKh+*|3}YCZR| z4Y1#{o(n*W-nX9n16==RJ;y~fir%EMQtP>q644=2*MG5|Yl*MPnAdY}-FS^Z60y!f zEeZUW_1re#@!_LIihD%1o^zymRv&P>9f{?>?hYS6Q_bj~GIZ18>=MnJ`hZm&dosf| ziamg1wVrEGisV~PlE6v2N+i{Q!`5?G8&Jgo4{;M;?J2dMd!hi2X+3wBGHgBfjIhv& z6zb)R+82PCoLXO`nNyp|880Blt3bk?+Ad02)^n!uPXXcgj(>2o9{yLMkV6Wp`p#*#Vu@EWKD>>y&ujJG!-h*P(dyt!vhB>mY z+bJ?vP>$Y%On`9KUP3XOq66e9rURS31F0k}NgujnpWK|l$2Ar_)1_gJrIc<0#_@Cv zV=i=G8#+a}kO?il@Yr}Oy&{QG?toElK>TJGhq6~-Xti+`vSj8c74v7)=z?lOKBgOg zX~zvGbP3-a=n^-VvwntNDn6;^`!{Eao*uDT@849cB1Ixq`P7*7Tv;htq;VJ(PrAD}da7-iImNIOFS0pS949f`j0L(PPHF9Z$ujGuk<0c;3X&T`dC{=cU zj@=bB%68;ftK#`xGG`b@$G&Ng<`bfe89A9<$0_R{c?$xIbu4* zfJk^RtxPD|2LP`AOEmj^`zupu0-2WHz3UCG{%SzNlJhzu+|bQq+{8CKu;kniOX7a| zmJ4HJI$S-3vuVKD2ojs~Kq{ud1*h3unx+w_`GZVG?|$++uX-hruxs{a8Yc79QUUe~ zYymlyGVFocT*$-wfH(L{Kumq`*jeg>>bwEXsR8Xkz`blQr1=ZG*!(xB%C4Vu4>4Zh8rP!%gDG2`KiZ&Tf3HTSz@;bAp1Up+mD6Jhz zy+BUS9DJm^FS|ow)p7iRJtctRrAGuW#a|#iRMnq9SSlMajR2Gs#lt#hZexH-XXe|K zg6skW2AxJi;LX9Sq~4oiQ^L`A2trU6Ks9b+`5(zx%=>ExU>MqB*jPVy$aA7fZ;G4f z{+`DUK_IdUmktCPSO1x9Ci}CjpH1;<_<>H?_7<@HX&g9^ri-8&HqxM-8X-W?_qili zk$~eU0HSL^&!!9xNcf!%rK2O=WuXo6mCBbmYE7Z--)Ke}3K7hno;|l`6KHK^3NJ zW!QuZHpJ_>il11IE-rx-oRwSYn)RGlU(Tz!#LJF&9X8WkbC8^1D-!lo zPEwbXyupz>@*IW0DgN9{vc42a15WZ7wvYB5lSsY+jv$Azj}}9`45{90i1CccUk&k%MDSii{6Ye*g;@W+A(~`(zaiRyrDruilot*`Qr|waGg;4BqzIiGVmQaH!m*!T{g`x1%Hs2 z`WUa-yuiHr7*6qp2;YsB|53Nn2c}rOgr-}ZhI>A^xDjfzMv&q|Y`!0h6IW`T2N(mGi;{X)OjR;`ks}cwkB5L6vUL^0qz85-HnwxQ408u**FDGULj=7Q! z5#*)6wn?c?#_n@;7vmMTr|AgULc4+B25V0aOaKB*;r~mMu<}ShamY*a5$)% z-eBv8IkBrJ9;ZWpV4&|AAF3bjg?tp{agUeoUW`WH(^swS>BFD2(Q+MlFQ?5S1*cjF5-7n$9Bxzz3kj(47#Y}{oB2b_n^9N*U zycXzB>{^~(-PpAvyH;jb4|err z*Q)GVon33PD}86nSg#Jddb4YNcJ*P`M(j#wD~FlPlUR!o; z&#oQWHIQBDM5M7^FuQhPS2eqKW7kl2?ZK|$?D`42_GZ_^g*9=_IDH z-cWWO#;$Sf8qcmH*>yC#Ca~*Rc1>be4X*KbFwBa{;m5zDR1~GEke}&Gsm_!NrBn>1 zf+#hUQmrZV4W*hM0B)K7mpq zrSz1#K`DBPyO?Y;K95qzDRq-lIh3MP#q8yz_&Ss#+l%i+snwL~Pbu0R$4{cvXOvn@ zsSHZ(rPO3fU8U4mN|jJ5j#8CqbufrhA5-cRN`+BMO{qjmb)?i>N?}1S#P6h3BTAj8 zlozF*Qp$r;u2^6dV{<3O*P;|Oj9;j}#;tmYrbHO)+0++=dGUl=j6JR~elVr3QR)Xu zou!nKQU#QvPl^;Dq!fK=wHSLKW4uVI4V1E@{#!{Ya-GFrQ>r_q=29w_QZp%)N~wvI zT0*G=N}&pVq&mJTm3>NOKTs;1Qu&nXLaFnVYEP*a)E<9I1yjn0QW2D@i4?IDgzw~j zXEyD;x#()r+vdA&RxSK}%dOpCPpdytHE-(P#nYQS>AHB8_w&(TY`^`~M&|M6v&>6g zBVtDM=r?Z7yZ&pZb@=Mp=b8oO`e%QZ)c=!FO4usHctU zZawqUPTk6K^dz4h9p&&qqYjnb80KDy(anp<-xxc}0iyWfE;&9_X98Wh#% zk9vLX&EME(!_YM_H-XrO+0k;tJ*$s zC!H@vf3d#y>!?jr)&6M@1`i&b@n~C0X0dJE`q#3m#TsUG)YkoJ)7R(zNF1YR6Z9;7 zX0W`Oy;sKCZjTE_3|U%hc~E>_?Ioj&OQMu70=ZsXaNy++12?|sSVd&SplTJ+jD zTK*{EZoA2q!XLNWyQtCYX*FV>tQv2#rA@~H$K$ffcb-{g*2B3wRwSy9e4CMaaEPwm zrIf^?WUt)J6~R>lzZ;p`cj$(5Jsc-=`Z($4yJ{V5mj-$NQrJpe(WUU*eZ|$KIZr~4 zB}F(*skS)n(xmhCp5G8ls)oP2(=K#U_JN|&3->za*k|`#pL;ZFMd0D(gNDR-kF2sK z@pb&ph|wJlKenlq_~4UvwR*i7(`13~(qPq$lg=Wb z-H9B9ra;vuQhxU8>vMY!lek}e)gh{|J9ow zDec`yMZYbm8Qy&3Ck~rm?d;$mHM{Ox^%TE|nKy-w`}z%9zH)Bj@n(HzSG_voqnjn` zf-W2}PV>q0AHFHMPtUnq8w?y#(Es?p!E21SR#tetdr^m1ZoAWKza72vO}ByP&NQ8L zH)2Vw>P7bckk8J}Tll*Bm8aKlwU~Bdt+LYVp<>?MQ&*0AJ+cX%@bSCl(+YRgdeS)T z%GCvnzL@vJxX(7oyQv0j_+&3d(S!kt5MNr_6-nv6H(8H{8CnnRCk3y7j9Z-TGa^=G2?thwP4exGe6+ z-#;HW7yqB*qa`Coe=@A^t>xPee{1`3m4>0tDS?#+tnAp<^X`&Gy*tHz6EyJR-Ooo| z?DTxG)3URx{`3_e-D}-6EO&6d$Fsbyht@ZY&B!aB88hT$P1{bR;+>B@+S{?R=fd`@ z#*Q475imV|*6o#_I7BSl)ygS+L-h=&j)Q)Sw#3dh}~`rR~;ouHldEYgK=2 z+%DKw{nPb_A2mDM_n(|z??7$mYcDH(ai*mC`l-oX{pZ_s{j<)DUw>_T?aJX+EywRH z`2PAIOS(h{uP<*`sOXqq@IYBJW$oghTiXjm)cYoti z^S9mue!utm(^s#bENpUU@A8E9?ls4%?#$YjSbX1QNcmaY8+H7&`fs%+ymIW&W6!nN zhKd@$ExxGjm{zYK?vshfLYs};?zU`idH1}D_ixXSX#eKhXH8vde&6Hy(+-Vme5|P7 zrb^VL!&PM8*Zm~BVx{K^?=~CaY8|=1K(+r)dcl0$upT-An-_fZ3h2rIY&v)0(sUq*abn(i_+0zz3U$8E&1KfPy9CH&wepUb*dSUq%Zxt%i*d9m+e3I_H7n% zSAF?&AHV%$9z8Ymzi-TI8U4G@yX5v$A6~B9ZSb94!^Fyi-GYiLb@a-<{ZMs(Us?n}ztV8XemCGm9yo3{+vqpC9em8vRj1Es%4L#kZzJB1! z^sF~)vh#C~c)L&kQgdR2d`?E!%pbq(D;yf={EfQGX3e&tm4)&%>o(E{^}qjTAJ>l0 zHrI$A+o|rCkCR#`r+uY=@*wi!)pm784`_8`YLw>TiSM6g1}6AVIF*s+^xg9C7ghRP zdL#xcyd1sZ`w{C8JG%b#W~2S5*N)56noSN~p3zcu#9{b_x5t*(EPw85^3|WS`nXNH z5;;7u^YA;dEsy?msddM3%U}3(@G_2h@>}hW?%g_U{k-vtJNKS%PQM!eX@}zHfivb; zuOC{{vf+sN&%NB0&(GVAZ#L@L{&->a`ElN|^CO>mwb*rjSLZF!LU^;1HZ{AbyccSE z)~+0wr8`vP&4REkU+nz)-1TQ;Rn1q%J#gNCD0ATfyTUP>rrT$p@Y~+N@U^nd+dlWY z*1NLA<@m;W6T^L;HMEboGOLNp>oM8ILn~j47e=UmS({Tn{-J(VgVpak^_;tTw&++i zcW3s+XOpMaJhkCLWUF(F*GxPW)M!*-!18xqdousHyz!Sd4|P2%wtN2SSdG4(W4imr zt*QUx!aMghuM*n&cOH2C`ESbj*IpBk_xRK0^}_A%E^X=?sA{l4y|-=Kh(5FR>0Z0m zk9yaA!PkZRhp+3?e~J65n1<_5wzzt0ao=u@zI$2EuT%AD&xTC(YdFtVeDQW{^9J^V z-1nv3Y2xFccF$cZw^3DJ{eHZ{r33Xk96NIB_5hEd;8~R_x+FYsz1-;j#tS`$Zy6T3Zq}8o z;zI}D9l1NKU)ug}X5~D8{9?+)sIVxzs4nSm&up#Ly2Snm)r6C8KK`Y}sG#(58*4tE ztxVe*IYelGu;0oF-am*376*0d6Wy%;q0gW7@3H#r^{1^LX`UTEpq+i>Wn6^jv+V_a zo~G>BbNNk|==z4q88>U_CY2wVaeG1J7oQDC=rXq74zDlzT$mer!}i#%P4Yd34m0cCNQ_aW}Vj2{meT*i-f9+Hd8G zr?Xa#coOfEer4CScaClPEj@L6)hE+`?rAfmLinq6$M28sv|ZVt@LstFb6+e`&gwM5 zF*NGPPRDi8K9fIsTr}&?oDKb>grTX|e1BPfuR_fI)^+D!KOE80O=eKWU z=cabJbX2i9Y{;YVnlJ7}Z@XMMb9MVly+;3*eqeA|uYIAp~=B=uIa9hHUI}$z~*?gnA-=u{3`_GPFlUHy!B=+G8MMUZi zeU}<8$rti)&hYBKHVwnO>|HO`U$Dvk&X9wTFT7f{q*v3Cx92{Jsq=8wlHG^3IVH`! zJ8!V7`R&@mr_1(6=cI>?EM6M!{_E!#2M*i&a&>*5TW#BZKWoAI?!`m zpFAItXy0jo%c}|Q>+h!7%-TA8^F8OKU;Wy#-KTHo6)*gytWU>nYFKpd+bTtGH*M{@^wn3t>yMrj zPxfo)(=hJB3!i3{CVgQOIk8Vv%J0GDzkWV<$hkY`$2hp}9rG-!Ui2!v1CNI}xGy&x zS>115`v+AUENtY|cKy;ZovQs=JErFAxMhD<`QuuBpUW*${(ReK+su}I?e?|bJEy{g zUOq1_yBr?g>*U7BFE^j;^^q9%*)`wRL;HWz>Wi0NUmcz|`TnUX9bXSSRlAq}!JZSQ z-N|0pr9;CbBO-37)9zIo<|g}LwfB!>uD@-XIU=sMle0^gCEKs(sD_=sF}nW`1zy#! zKR-AyP~X4Wbepp$_ubhsYTC%v*Hy*=ZG&9`I$rpB$NqJv?kDZb820LiigEg`iR}-? z++BKh`QYZgt4%ok!`PS}CHivZHT^0L{B4{^(u={V5nE&@0s~Lp-qB-Zm$NN1wz%8) z*l)d6qwS&vJ67y=RIf}pHM3o(#F-nt0=n0zYV)E&QiE+#?$Oseef3-8Np1HXsHbXq zt4-F*?vqaS+I7so`LVsVR!%FZUQ}`>fB%sRHmCD9h^sT-i7brv3K^yZ%XxHn%Y>bcKf z8vWI;uMEqwPYoEh?(ms)dn*oc%FT8i>2N1D{H$BhTDueF6CM<`ySm8Z;L1gz!-^;R z`!A@q;^vp5;b)8;%Kzbwh6-s<*G??12D>5f#VPv9gf~NjhBu8Ij3WVh;w%WJ)#b5Z2fq1 z*LusmTJIfys>}1AR&ALO6_w)Ep6E?aZh&GKf1@Rfww1|x^wgMe)p1&w9OjX$@`paO=hz>RVoE1 zkF~4Q+IelE--?EdUNw_xNB4MeueOhBLZ!mir{j7b9PL`%a#zDmIoHFd9@}{#qti#u zU3Xr-;PGX(*ORmqOQ0VD3;*CJ*nHfob(^;B+IQ&KNg}hgvv+WGk~zD`UCWhMxK*fF zsj|DrN1j!xR^tfOYt*deRl81I?|Stc_%v+PxJlDy&3*m+TeJ*d@LpUDp__E?(XvPM z*bxD$q@=_omB4d;0X>I~jE&KJ5*rtr6q^teYXY<}mxT0)i2RsisZ=TYa){;CBz75P12;XQYI#G%-HCpSPmH;tBFiXOi37)Y$h>b3lgF* zCN?=adU&kBn$@;#kJt%90<;%Nw4f!~afuu-B018mm&mcP3ByJt47ZR( zCk%^>866v)BoUi6$oPAWNbpLC){Gb*>lG6{di2ofm{FWGCMh;r1F1Dh;1-#piECY| zoXKDkk#Q;oPBL|>ph}L39veM$bgUYJjE;?nNgNy7w(Yd{6-yjOCnm>6#+t|?;~8CK zG7$amaKDee zhECGNdIhD#!3G6?GmaJWkc9Ekqel$$qTX%h6@ja{0;oTB5b#p^+A_R++Si#TC-y-`6iG6%@a=h2rq{Q(fhM`3*&6rk_M8w7< zCj2+;7|N`#Ey=1Rd+e8(Gz!ft-2qlPYrU7!w!}!q&Doll1nJCe+ZxiWS@YzinC2WI zG9htTY_pgcLCTIEF;p-vtzx5SUwfI2&ET$ru-3+5qm2zBv+T!UwH>~+u?csWV`DSc zVWu^#oQ-`ohvp_^zmy5fDY?~AK2Ij>qvX$y^3P<#B}auI z{N^a1D-)hla)y(9j!c;Agyd2ud6rE0j*>f_dzUyb0K|8BxJ zXze#Pay%tlXM^WHDBEQt6e3()Xe;|nE?lx*j>iEd4zjs&;hn=NAfI%qxKb|MAhy3d zRa`C?jFkLLR&kkJSSdpdM`ZFPa^aK=G8W0?i{yAc0uLNBoMm6jg}KfsUG6NOFBjH3 zqx7(|>`S?DoJy}b%je03-zfRgSw2TDWVnFuS1$4_xv-p)n_c9y z-g1%8lnW1BLYVC7Ho{rRe%4m@t+Q~&wx=Mhx9gPSA{02d&T$d$IJjrI2rtl?=nJQc zubqYYP986vg$+)X1mS>_;;u7V=kbfPaGRR+#7Ta^S$N~*0h%vmC|D(v=Qsxn>na!FwWDH% zi!jFt=lxeW$@h~m9w^9h!o!7&P6|l}g7Gmlhdf)Mx9d?`A*ziaEVik*%U0NE z1M*Wg6*t%lMK&IQm)L+j(^kIDR+wk&0o?Cw+hat4$9)@NGxWRJR+jH7?6jq)%$pr# zKOyaqh9>QFtn|cHc z%vJc&1spE8$d9-RMO6CKMV<>G$T;T8<%e8_g>odnlgkgd3fm}|BbV=U6;4p{id??O zRrpoj0JyHQO|HUxR}ZvcgDX90LVNL{MlIT?wUzC1627p-O5(O{(@Qd8t)1(4GU2G5 z%N?0;#;(!{j6OTpgEAr0-g$#e_}bn9<=@-8{(tR#4SZZxnfE#O&LmS(AvJ95E{K6G zUjj`gA5E)(=|>8sB^{cU&&5eHnKmi;YBEXNU0g>fYypL!pp}9KMC@)sqEsy(TVoOI zD!v3{efzQ~(M6U8guJ>+MSgVu&ppp`=YCAuAnNb^nA4t|`#uXZlHmDTT#is z7OOAQ<*uTVhl|y>i^@^)zf!~tMI{dwtJjOlA;UG)Rc|RS`9?AN&q1_7K<+&`xu19B zzR!{SWk>F(9l0NKF1m{+N1*0Do4f7QN$}nC1b_vw?*ZU zL8hojiZMm8+}lspvuBhXqmO={Qm4fhs+w8UVVmt`s7NccgK-^4;2vqdJu7;FZ~i?i zn#kd^^xXH^r|Q2-DfO|~^IBb_vDh?<$E-3?_FI^5erd%%Wvkyf(KnFY$vt-TMO!~gUtUJ1#--Dp zP-h(bowTj^Rjc%ew%TK@Q|ilh87_C*OO<-tj@}Z{S4W^!Lm)X1LfuGPy5ts1U9V5T zo$J^?SZWvToIa~#Z)){(U5>N^8s83f^3PTor7|TLavw)uxlxzkXDmOjq4aQD|D`TH z|Ey1HeBV4euJyO6Ik{%eo9hP$^)XPLf{*RB)J+yzcU$TwGz-3}OYXAN8=9KjDno`53$65XD|*1v|6zIRrFyPKG1uynN42_{ zxFfpcI~udAsVA*3SNQV(hiBevtM!Y%YC{##yKViTUVte}$3ADPH>vUNuu87C)efs1 z+4flImg82*R$Kj>RSwFptuj!qrM7y|j{eNnd#J6Ru*-016mW2Rw@x{VoON|XJ*pRO zji@bTfMkai`>m};t#U*>PMzX8D~2yoz2HQ=X+hlU?2`Ym)h#xJ_?BJrtgZIilxS< ze_n4fq=Vc4T=-72O`WjS!lU4GTrEaszk!_UPf3H=7 z-)sD#RSwE8tTIpz&`hw?j{eBjqtyO;>@r;D?&mU9tyJ}~cy50*`iP}d6*z{WWA|I? z2I|Il>M}&`qRa2=7&`aUnjY~lQN-IiHe#u3QMsjVr&^x0qHkFG84I=i+$zJRsfF78 zME!oJ*=N8iawa;W^=5n<;b%H}K^C#;gMMAZMZ%E9@SRfc@m*r;o}9s6=beaS8d{Xyzv|HF=b zDWZOCQ@&Rz;uDeBoe_0iq#T8QF@k~nY$SSBR6kF>?w64=T#727i=1qA`y%QSdIrAz z@>xCekqFIDdm{Q(J>#K>`VGl;n-#k+g1dxlk69%n5sdG0a9**>kne385x3Z}FGSSs zb~)%@CsDp<$8L|PCvD323yOHtj@=efS4GNE=r)q=N0I37X?Q}m7b9i3^vD+16|-ix z*{2q*uq!bk55_P{eGFf1xlTv7;b}!rJ~S3Tp43d+87s%&d4`I0>?%t=smsv%I+nH6 z%g$Uzg&zx#$0WT{IxT%JLd>#iR!QW7R&CRg3xv=Y9Ivbkp1K&%X+VS;X&QO->@lS# zE9kMMR0}f4KZieXgvT2&@7|B=g-XRnF>zqVor7=;VJ$+n81*7-z$dns5LTe_w-8R8 zuhj0ZDV1nO+SgIe#pr4X8!lC9_5-M|1?BC+7kAPq3t_{0r8a#7*9h-MSaAg=I)qt- z-$gjwrBvjbNbiP>2uFI9x)NbUpHjCYEbWK?mQq!CZY@FBGKl9F;URDl4kH{v*tZcM z@(_+Ad;($BX51gbQM_c6WDD*CVd=HtAyn5R z|3kRn8;~Di%cr29hY{Y0?OtnZIt*OOS zQA4q^#*5Vqe3mJmELE}bS*jSnLmk6!50p&IR>i{~P}al;RAi(=Sz{IIi17*)89rXw z?p!}0mwCZFPoy6->OEv1RS30pkMOA~+BTI0-OxdH$PzS=Q^OQY&o{EkvSCR1* z(82jiPc|v5YNd+M?;4r7R9$AC7xKP;>7piCj+H&j?=;BgURC<}R5|<&* zPA`NXym!?$FXbSC<#`QW}uTwKhJ5m06l-Z>seQ3u?v|)AwbeU0BOGZT$ z+N@#-Whl!+Uq$cBxrx2zdYr>tivQ}LZZr544y!pllf$JPCOEv5!*&jPIP{kqM!PuQ zCJwLS@RJ;VmctPa_i(t6!>2jCdz&fys~qm;a4&~XaQI^mCpdhW!~f#&Z4P6fH|4#T z!(%x-iNh)mKg8h@4x2cyEq);Fw5cf9Nxm=7dYI(;nz8Qgu}-<9Ov*^4qxE# zH4YDOXt91~a`+sFFLF4^;Rxo7e6I9!Cboh@nn%ddJmPgUpOB;Zgxo~02^Hp*e2(TP zax_1Y8*gv|RcZoNe6JtBw$tDp+;1h{Nr8M5oR4y20I1!Z--;Q&^m|GpC*{;|IWj&> zYVI%1f8=Q1BPa42l>0mUcjkJG!;ro(FOsAAk=%6kr7&NTOK=!0m*!J)G@p{2cDY+k z{sf1iayg#nXL3`OE0fF*@Qfoz&mnR@V{B02Z$SeE4HPs`&_F>01q~E5P|!d@0|gBf zG*Hk$K?4O16f{uKKtTfq4HPs`&_F>01q~E5P|!d@0|gBfG*Hk$K?4O16f{uKKtTfq z4HPs`&_F>01q~E5P|!d@0|gBfG*Hk$K?4O16f{uKKtTfq4HPs`&_F>01q~E5P|!d@ z0|gC`24)=}TebL-B`wv9Rxez=sCi*uY}LZ79qTJywWxW~CG>A0EKDF@Lo#{k>I<9V zRmo&()27z8&Y^g`9@nsoIgrf27N}zuvr%2JVMny3bk}g6{MFzNbcQL}3ATNDP(PfP z7f&XKy7LjoT%yBkZ%quT?C|e7R=22;1A!b}$PtX}Y3&ZjZ4AZXzFU)hgD@yM)Y+dI zZ0%CnF`Md5uG_Q;)<63PdV657GP5~3RHd@JT`7j&OL+z|Fz}g7bzG5LH`vb>*g}fW)JN=?*d2^;FnT%JXq1svpI#Xi26oys1dwZ6xXp1*C zQtM|r`g=DfyV5=DG9AX4YU2VO&5On+-MYl-+h7gC@|eWgc7O1#JewWalCQW^5(iE6?gHw zFK$WP=&t467uDLFldMCE%US$gQf+GLbCS>lGwJ^BPS~zZJB_zZI~~03Z`1v~bZ;Y? z@;Rf0n+Qf_UE8S!>PjTLvno^el{_`9db;g~Z<`dBdCd4#xP z?{kye(_Lv;L-wm;Jecg0ZoixA*fLJDA!8D2!cAJ+nrZDaa}XuG@JqdHgc-~~3 zUc1eg?kXZ_EFYtQ5nl$H5?gzPhw10l#c0!hOyX$9xItVB3m+PjlO4O#^{Weik6mPYt%x# zRZ%f%k3>eTaosY3|5nzX&{Yi$lXf;*Q85-7*NMcWHEAaj6V`;CwX?`D9375URiHMD z4d(oNky6LO=*wgUNrm^uVuOe082k~&Ri_x-$vDCII>uv+A7VUun#unf9;Z-WqcoFvIj?QA7io$NA5o*opJ04mVdEHKiR=q$6g%8 zYz96O@{`>-a^GZ3_T$LC#+dBLkvplx@97H0VsGeH#$s3MY2mY7sY%9Sf9TlvnDWKW z)LD$h-qbqAWY><|4UEaY9l84$lbt(qKVVGu?#TU@q_f?pnMa!X$o?IdI5xf?m1?BbDofHB#}BlkS#7kg1;@tF8xH>#4cVmncnGj3qK6`1r(_Vvhpm+@%U zf$AXRamMFj+*1BY#-CwK_V~y>15EXcovDM2#op8hXL0+oovF(hi@mAq7^|&LacUQ1 zu`Bhw@HxHoy;RJcmf#x=KBkQG-(>J6#$+Fm+~bVZtp+bR z+SFIY_*cMGAK4Kk_vyc2{V;xtvDiO*m9f}CBU9!_MnK%|(A8Ot6FUuF4t!h$_rv(3 zjKz-Gm5jyC*$88?L-sA;Bcn=X?=|J^BaAthY)F!OmND6qB=;)gIgHdg=QN ze+j3bz?f`JlB;D*HYdrQ!85G1_hZInBa_^JGA3J@ z%XN$(AO$a~YFOO>&npc5G_`_b?_Ko8&&hm~3s5 zyM-~?+$8rE#$334I%TiH6^yft zYZ!}tzl#`){k}oQVxMm-P1=AOu_ENT1`u2Z6VkB>S^Vi7)S)v)*s?FIf1A z0N;y=FYl+-%ojXezP!&iGheXqM*{VGG1V{czaL}1;OX+^efcZQ7cBe)UBFS$gg;(P z^~?M9Gt3uE`KkY3Mi+1t5Z}ee;T<)C$nBJB(%U&N;o$hJNB(w7V7CxB-}sdG`&*Gt z<5Tc`z*~fjkg6j2O1Vx7NIoy7`;*THd$>Hol;7b8`gf@Z6JI`0>}S4U;g1ITw-*yX z+klGTUS+;u;V(4Fu6_j<;YS`wzw*99`46SvqmjRz%c9_~fl0rS!2CDfU@~2abkeWj zTY$HiBj z7vCfO~|i>W+WkJ$h|wWnZQI{m4EF5oC2dAykT zvVL<1^956Wh^Q*y$q^=g1pzq1#FzD+JuW`p`?v7cBfqx`3mA>i1%*U)Gam zo@DM{Fy(jZw}_qNS9mb-W&LR`^92jv+kRBP7ZYFBt5z^yu<*xC^{)J0?9@MGG7L)n zjD_D4;CnIgWj*Xu%oi;Di2&b=i7)GCW6T#Ud~bbCi1cFO%X-^><_mWDbOA?!!}nm~ z%lh0=C!6*YOxdXYvY!0J_hRD9dR{H_1q*)yWsoCG{0RbZgo!Wfe=W=xOzBjA6+Ah@ z#P?$2%X;Bf<_i{n1Cil`-{7EJ{j$C|%6!4o<;!~HPnj=R_}=kC@_RAKFYA{xPGSB3 zy%A9OS%0f8s-ZYe!>**-oFT&MSAUohpT{_pKC#P?$2%X;$>A2j+CEPU_%65or7FYD8F%ojXe{>WCy z0N28N!NPB$3pfg>elK?9zurk!H;ep?g+CGCdol54z5LtE7cBg2fbYe`m-Y46m@ioP zD!}(*htKQr^G`GSr{C)#Cwy;xO^EbjM}A(vzn%H?J3n6jaA5p+G4W-+|98w6EcJWy zQ~h2{eAyp3=XCBrxBBa^GSImn;(IaiWk2B|<_o5xssC04_+CtW*?$-~!_+TW_#*+n z7ZZPy|Q_=1K1KDvOTfaLdL;>-TVD&`BO{3L%VJUQWeG4W+Tq?`GI569n%{1r~g z=Fj#3elUQ462Pwqa8V`JGm3KiBeNOH{>TRz&lxrKoyl1CN17Nf;q(^9vOm(#SoTM* zVJ!P2+ZfCK$WF$xKeC6h?2kOfSoTL=U@ZG1Z!nhqkt3?i{mK5w`x(prNEKt*A6d*; z_D3#cEc+v!jAei1O2)E3auZ|OAGwRM?2mkdvFwlRV=Vh4|HfGMM_ywr`y)DT?nm}V zj%F|Q8O#1i3uD`?8O#32w;9X+$kU8v zf8-a8Wq;%VW7!`msW$f~`y`9W7!{B0_+_R9}VCQ0eou!KM=r=1@Qg=em#JT zY9Oy?zvK+YvR`r$W7#kH1Yys9361x5`ooT(4$gvN+>HVJ*#O3m z-J<+l{<|HVyMOuxYH$7cJx?EgHh^CVU~T*J|3v_w5Ww>dMk&Uf7r>VXa4LYWF!*iZ ze>{Lc6TsgLVEh~^-Ji?HueAE`?*o|j+P(Sb1n~R-UKzma1NiCy-X6dY1n~C*_@@Cp z8Ng*xzq}^~@P`BV`~Y4Tz}W!4Er53g@V)^4X#l?&z(?TO>DBLv0sP?rzC3^j1Nf5x z{KWv?8Nj;@cKhSr0RDaeKOMkxz&sKDB>0ozPk}!b{)6zR!JiIa1yAF;8oma;7QPOC z9(+CgeE1K+p9z09{72yF^V&lAMevK^m%ul|FNHq`{#^KF@aMrVhhG7IK714WO85l) z1@Nojo8ec(uYtc1{v!B`;V*%|6rSdozk$CT{-f|o_!jt9_%`?yd^>y^el7euc(?}m z>Z3x@_bUBgqNEuAw=9Dv9FXJPoo%23{z#`9-fdBy^9=8{DEB18 zyDi8$!|-kkaZfLpf&%9j5a~a$fQadwV+v=R>iANgoKqcGLRROD5`}aY2O%9kq5$WO zaA?9DqL}*h1gCh9O>k81yaY!C4oYyW@B9+SnJ+N|;%Uh>d=HYi|@`grK}>DKOQ z9ARotEbqu9GEREjO;2y?!&#fEDGDP>pg==7ME>ULq{FFi>sp(^=vJUKhoJF0ebqP%J3OtqyBRVEtHQ!HgZM6qt>IHc@t zPbUXjyE2JXq9c{*aAd1(b3{t6OZQMxsw2^nNKwi>laN@R>Ta$|nz(qqn>&;2@5RU* zKsx1aT3*}K+Sggv*x%pVU%RoRHG^Y=6z_?yTS~{S8o@w2A(0LP_pHM~KOCxaPZj1! z@%TbI0(TKkz@_`0V~B2f@%p8F2yaz-ZMq+~mUiDJoC@Q0E1lD9q2yZXzDB5;#-1TM zOFGYFZOqj?UrMiON^e}2Sc*(_7q)f{rg2h|4y0BuhRAI=(z~o@Z7+_WHj;wkRnE{& z_Y5VItCP4%^N4SXS0~R|v2xME70F~1&a%!sC*70o$M9)}wwrN(RHl*HU#ufefE;f$ zUF{w77Wa1dwf3jqA#cGs>C7spmEVbw)!sXN2gG{5xpzY0`#KaQj`uOAWvJzSt(1sY zI|=4t;>?OG@SZ1!&63>LyE@xKUD@B;Os`*3D7t`$fppFU$zdQQWo;4A9y|&b!mW`^}qF(_TCJKTI+-070R73ZIV9 zd9qF=bU5o_gbowDLYt;Cb5`}d)nv(H;lO#VL#@rJ{?5KkqgXgFqm18rd_#A76MJLR z@-bdy=blW z&gQUPQVFmNZk@MJH~>r3O)`XJl5!2OguIlVm79d%(TM#M^z}M zCKOW}im405%n!vZ2*t$1mBr)XT-D*IuuSo=Q1P%-@p<90>cdfCQLDqER)aYf@!*bPx<*EtG1@jugcCHD_RTGx0Cal7munKF#Lez$Zs0|li8!o;! zeA~6*+pY^sUl%UEE?j(FSo*rK?(4!r%nRSpylQ9YUYKXvFk_Tcyn}j~$$ZFR%Xy|4 z_?()rQ2#i`ri3$TnCU99^gcJ! z+K@2s=HGMeWqO9~*laKrAA8D1=^CH88%NfXjiaSg?B|Ep7cWt_`~J(+>ZCF!Ab7g@ThTn#f@Fag*p`Ie;DwqoIF?k0Tv;FQY2f&NNZ zQlvSkvnSOxh&d{C+G&+T@k*>?VG(IM6A?+wliq+c!<_+BaJ@ZeU|qYC7T?b3?CF}@ zq5f==_oO${MCE;q2~8nQVFN-|V*~H{p=A&M zdPz>5xsM03pb;1{@xlfKZL$VGCCNC*J(j$q1nPJ89ArhNumLgM9Sr|`9nbTrQy%xh zewr`qRBQR+ZH>dM<%bF04iFSN`~i4Mq4Q*&O6YLb!w4NFc!e%(Ky;d~j3twW4T!=9 z#56Z>{?FThkad3Vk|6IVggz>n6+2En6F|?{2UI-2^)aF^I4V4pK ve+{nz7j_T&GG@=FuzMhyDC{1rKFscc@Ap3N?kf4clZR|l{NJ;mpwxc@O^v<% literal 0 HcmV?d00001 diff --git a/node_modules/bcrypt/package.json b/node_modules/bcrypt/package.json new file mode 100644 index 00000000..d85bb243 --- /dev/null +++ b/node_modules/bcrypt/package.json @@ -0,0 +1,163 @@ +{ + "_from": "bcrypt", + "_id": "bcrypt@5.0.1", + "_inBundle": false, + "_integrity": "sha512-9BTgmrhZM2t1bNuDtrtIMVSmmxZBrJ71n8Wg+YgdjHuIWYF7SjjmCPZFB+/5i/o/PIeRpwVJR3P+NrpIItUjqw==", + "_location": "/bcrypt", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "bcrypt", + "name": "bcrypt", + "escapedName": "bcrypt", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/bcrypt/-/bcrypt-5.0.1.tgz", + "_shasum": "f1a2c20f208e2ccdceea4433df0c8b2c54ecdf71", + "_spec": "bcrypt", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1", + "author": { + "name": "Nick Campbell", + "url": "https://github.com/ncb000gt" + }, + "binary": { + "module_name": "bcrypt_lib", + "module_path": "./lib/binding/napi-v{napi_build_version}", + "package_name": "{module_name}-v{version}-napi-v{napi_build_version}-{platform}-{arch}-{libc}.tar.gz", + "host": "https://github.com", + "remote_path": "kelektiv/node.bcrypt.js/releases/download/v{version}", + "napi_versions": [ + 3 + ] + }, + "bugs": { + "url": "https://github.com/kelektiv/node.bcrypt.js/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Antonio Salazar Cardozo", + "email": "savedfastcool@gmail.com", + "url": "https://github.com/Shadowfiend" + }, + { + "name": "Van Nguyen", + "email": "the.gol.effect@gmail.com", + "url": "https://github.com/thegoleffect" + }, + { + "name": "David Trejo", + "email": "david@dtrejo.com", + "url": "https://github.com/dtrejo" + }, + { + "name": "Ben Glow", + "email": "glen.low@pixelglow.com", + "url": "https://github.com/pixelglow" + }, + { + "name": "NewITFarmer.com", + "url": "https://github.com/newitfarmer" + }, + { + "name": "Alfred Westerveld", + "email": "alfredwesterveld@gmail.com", + "url": "https://github.com/alfredwesterveld" + }, + { + "name": "Vincent Côté-Roy", + "email": "vincentcr@gmail.com", + "url": "https://github.com/vincentcr" + }, + { + "name": "Lloyd Hilaiel", + "email": "lloyd@hilaiel.com", + "url": "https://github.com/lloyd" + }, + { + "name": "Roman Shtylman", + "email": "shtylman@gmail.com", + "url": "https://github.com/shtylman" + }, + { + "name": "Vadim Graboys", + "email": "dimva13@gmail.com", + "url": "https://github.com/vadimg" + }, + { + "name": "Ben Noorduis", + "url": "https://github.com/bnoordhuis" + }, + { + "name": "Nate Rajlich", + "email": "nathan@tootallnate.net", + "url": "https://github.com/tootallnate" + }, + { + "name": "Sean McArthur", + "email": "sean.monstar@gmail.com", + "url": "https://github.com/seanmonstar" + }, + { + "name": "Fanie Oosthuysen", + "email": "fanie.oosthuysen@gmail.com", + "url": "https://github.com/weareu" + }, + { + "name": "Amitosh Swain Mahapatra", + "email": "amitosh.swain@gmail.com", + "url": "https://github.com/Agathver" + }, + { + "name": "Corbin Crutchley", + "email": "crutchcorn@gmail.com", + "url": "https://github.com/crutchcorn" + }, + { + "name": "Nicola Del Gobbo", + "email": "nicoladelgobbo@gmail.com", + "url": "https://github.com/NickNaso" + } + ], + "dependencies": { + "@mapbox/node-pre-gyp": "^1.0.0", + "node-addon-api": "^3.1.0" + }, + "deprecated": false, + "description": "A bcrypt library for NodeJS.", + "devDependencies": { + "nodeunit": "^0.11.3" + }, + "engines": { + "node": ">= 10.0.0" + }, + "homepage": "https://github.com/kelektiv/node.bcrypt.js#readme", + "keywords": [ + "bcrypt", + "password", + "auth", + "authentication", + "encryption", + "crypt", + "crypto" + ], + "license": "MIT", + "main": "./bcrypt", + "name": "bcrypt", + "repository": { + "type": "git", + "url": "git+https://github.com/kelektiv/node.bcrypt.js.git" + }, + "scripts": { + "install": "node-pre-gyp install --fallback-to-build", + "test": "npm install --build-from-source && nodeunit test" + }, + "version": "5.0.1" +} diff --git a/node_modules/bcrypt/promises.js b/node_modules/bcrypt/promises.js new file mode 100644 index 00000000..cd820142 --- /dev/null +++ b/node_modules/bcrypt/promises.js @@ -0,0 +1,42 @@ +'use strict'; + +var Promise = global.Promise; + +/// encapsulate a method with a node-style callback in a Promise +/// @param {object} 'this' of the encapsulated function +/// @param {function} function to be encapsulated +/// @param {Array-like} args to be passed to the called function +/// @return {Promise} a Promise encapsulating the function +module.exports.promise = function (fn, context, args) { + + if (!Array.isArray(args)) { + args = Array.prototype.slice.call(args); + } + + if (typeof fn !== 'function') { + return Promise.reject(new Error('fn must be a function')); + } + + return new Promise(function(resolve, reject) { + args.push(function(err, data) { + if (err) { + reject(err); + } else { + resolve(data); + } + }); + + fn.apply(context, args); + }); +}; + +/// @param {err} the error to be thrown +module.exports.reject = function (err) { + return Promise.reject(err); +}; + +/// changes the promise implementation that bcrypt uses +/// @param {Promise} the implementation to use +module.exports.use = function(promise) { + Promise = promise; +}; diff --git a/node_modules/bcrypt/src/bcrypt.cc b/node_modules/bcrypt/src/bcrypt.cc new file mode 100644 index 00000000..bd8c5735 --- /dev/null +++ b/node_modules/bcrypt/src/bcrypt.cc @@ -0,0 +1,315 @@ +/* $OpenBSD: bcrypt.c,v 1.31 2014/03/22 23:02:03 tedu Exp $ */ + +/* + * Copyright (c) 1997 Niels Provos + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +/* This password hashing algorithm was designed by David Mazieres + * and works as follows: + * + * 1. state := InitState () + * 2. state := ExpandKey (state, salt, password) + * 3. REPEAT rounds: + * state := ExpandKey (state, 0, password) + * state := ExpandKey (state, 0, salt) + * 4. ctext := "OrpheanBeholderScryDoubt" + * 5. REPEAT 64: + * ctext := Encrypt_ECB (state, ctext); + * 6. RETURN Concatenate (salt, ctext); + * + */ + +#include +#include +#include +#include + +#include "node_blf.h" + +#ifdef _WIN32 +#define snprintf _snprintf +#endif + +//#if !defined(__APPLE__) && !defined(__MACH__) +//#include "bsd/stdlib.h" +//#endif + +/* This implementation is adaptable to current computing power. + * You can have up to 2^31 rounds which should be enough for some + * time to come. + */ + +static void encode_base64(u_int8_t *, u_int8_t *, u_int16_t); +static void decode_base64(u_int8_t *, u_int16_t, u_int8_t *); + +const static char* error = ":"; + +const static u_int8_t Base64Code[] = +"./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789"; + +const static u_int8_t index_64[128] = { + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 0, 1, 54, 55, + 56, 57, 58, 59, 60, 61, 62, 63, 255, 255, + 255, 255, 255, 255, 255, 2, 3, 4, 5, 6, + 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, + 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, + 255, 255, 255, 255, 255, 255, 28, 29, 30, + 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, + 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, + 51, 52, 53, 255, 255, 255, 255, 255 +}; +#define CHAR64(c) ( (c) > 127 ? 255 : index_64[(c)]) + +static void +decode_base64(u_int8_t *buffer, u_int16_t len, u_int8_t *data) +{ + u_int8_t *bp = buffer; + u_int8_t *p = data; + u_int8_t c1, c2, c3, c4; + while (bp < buffer + len) { + c1 = CHAR64(*p); + c2 = CHAR64(*(p + 1)); + + /* Invalid data */ + if (c1 == 255 || c2 == 255) + break; + + *bp++ = (c1 << 2) | ((c2 & 0x30) >> 4); + if (bp >= buffer + len) + break; + + c3 = CHAR64(*(p + 2)); + if (c3 == 255) + break; + + *bp++ = ((c2 & 0x0f) << 4) | ((c3 & 0x3c) >> 2); + if (bp >= buffer + len) + break; + + c4 = CHAR64(*(p + 3)); + if (c4 == 255) + break; + *bp++ = ((c3 & 0x03) << 6) | c4; + + p += 4; + } +} + +void +encode_salt(char *salt, u_int8_t *csalt, char minor, u_int16_t clen, u_int8_t logr) +{ + salt[0] = '$'; + salt[1] = BCRYPT_VERSION; + salt[2] = minor; + salt[3] = '$'; + + // Max rounds are 31 + snprintf(salt + 4, 4, "%2.2u$", logr & 0x001F); + + encode_base64((u_int8_t *) salt + 7, csalt, clen); +} + + +/* Generates a salt for this version of crypt. + Since versions may change. Keeping this here + seems sensible. + from: http://mail-index.netbsd.org/tech-crypto/2002/05/24/msg000204.html +*/ +void +bcrypt_gensalt(char minor, u_int8_t log_rounds, u_int8_t *seed, char *gsalt) +{ + if (log_rounds < 4) + log_rounds = 4; + else if (log_rounds > 31) + log_rounds = 31; + + encode_salt(gsalt, seed, minor, BCRYPT_MAXSALT, log_rounds); +} + +/* We handle $Vers$log2(NumRounds)$salt+passwd$ + i.e. $2$04$iwouldntknowwhattosayetKdJ6iFtacBqJdKe6aW7ou */ + +void +bcrypt(const char *key, size_t key_len, const char *salt, char *encrypted) +{ + blf_ctx state; + u_int32_t rounds, i, k; + u_int16_t j; + u_int8_t salt_len, logr, minor; + u_int8_t ciphertext[4 * BCRYPT_BLOCKS+1] = "OrpheanBeholderScryDoubt"; + u_int8_t csalt[BCRYPT_MAXSALT]; + u_int32_t cdata[BCRYPT_BLOCKS]; + int n; + + /* Discard "$" identifier */ + salt++; + + if (*salt > BCRYPT_VERSION) { + /* How do I handle errors ? Return ':' */ + strcpy(encrypted, error); + return; + } + + /* Check for minor versions */ + if (salt[1] != '$') { + switch (salt[1]) { + case 'a': /* 'ab' should not yield the same as 'abab' */ + case 'b': /* cap input length at 72 bytes */ + minor = salt[1]; + salt++; + break; + default: + strcpy(encrypted, error); + return; + } + } else + minor = 0; + + /* Discard version + "$" identifier */ + salt += 2; + + if (salt[2] != '$') { + /* Out of sync with passwd entry */ + strcpy(encrypted, error); + return; + } + + /* Computer power doesn't increase linear, 2^x should be fine */ + n = atoi(salt); + if (n > 31 || n < 0) { + strcpy(encrypted, error); + return; + } + logr = (u_int8_t)n; + if ((rounds = (u_int32_t) 1 << logr) < BCRYPT_MINROUNDS) { + strcpy(encrypted, error); + return; + } + + /* Discard num rounds + "$" identifier */ + salt += 3; + + if (strlen(salt) * 3 / 4 < BCRYPT_MAXSALT) { + strcpy(encrypted, error); + return; + } + + /* We dont want the base64 salt but the raw data */ + decode_base64(csalt, BCRYPT_MAXSALT, (u_int8_t *) salt); + salt_len = BCRYPT_MAXSALT; + if (minor <= 'a') + key_len = (u_int8_t)(key_len + (minor >= 'a' ? 1 : 0)); + else + { + /* cap key_len at the actual maximum supported + * length here to avoid integer wraparound */ + if (key_len > 72) + key_len = 72; + key_len++; /* include the NUL */ + } + + + /* Setting up S-Boxes and Subkeys */ + Blowfish_initstate(&state); + Blowfish_expandstate(&state, csalt, salt_len, + (u_int8_t *) key, key_len); + for (k = 0; k < rounds; k++) { + Blowfish_expand0state(&state, (u_int8_t *) key, key_len); + Blowfish_expand0state(&state, csalt, salt_len); + } + + /* This can be precomputed later */ + j = 0; + for (i = 0; i < BCRYPT_BLOCKS; i++) + cdata[i] = Blowfish_stream2word(ciphertext, 4 * BCRYPT_BLOCKS, &j); + + /* Now do the encryption */ + for (k = 0; k < 64; k++) + blf_enc(&state, cdata, BCRYPT_BLOCKS / 2); + + for (i = 0; i < BCRYPT_BLOCKS; i++) { + ciphertext[4 * i + 3] = cdata[i] & 0xff; + cdata[i] = cdata[i] >> 8; + ciphertext[4 * i + 2] = cdata[i] & 0xff; + cdata[i] = cdata[i] >> 8; + ciphertext[4 * i + 1] = cdata[i] & 0xff; + cdata[i] = cdata[i] >> 8; + ciphertext[4 * i + 0] = cdata[i] & 0xff; + } + + i = 0; + encrypted[i++] = '$'; + encrypted[i++] = BCRYPT_VERSION; + if (minor) + encrypted[i++] = minor; + encrypted[i++] = '$'; + + snprintf(encrypted + i, 4, "%2.2u$", logr & 0x001F); + + encode_base64((u_int8_t *) encrypted + i + 3, csalt, BCRYPT_MAXSALT); + encode_base64((u_int8_t *) encrypted + strlen(encrypted), ciphertext, + 4 * BCRYPT_BLOCKS - 1); + memset(&state, 0, sizeof(state)); + memset(ciphertext, 0, sizeof(ciphertext)); + memset(csalt, 0, sizeof(csalt)); + memset(cdata, 0, sizeof(cdata)); +} + +u_int32_t bcrypt_get_rounds(const char * hash) +{ + /* skip past the leading "$" */ + if (!hash || *(hash++) != '$') return 0; + + /* skip past version */ + if (0 == (*hash++)) return 0; + if (*hash && *hash != '$') hash++; + if (*hash++ != '$') return 0; + + return atoi(hash); +} + +static void +encode_base64(u_int8_t *buffer, u_int8_t *data, u_int16_t len) +{ + u_int8_t *bp = buffer; + u_int8_t *p = data; + u_int8_t c1, c2; + while (p < data + len) { + c1 = *p++; + *bp++ = Base64Code[(c1 >> 2)]; + c1 = (c1 & 0x03) << 4; + if (p >= data + len) { + *bp++ = Base64Code[c1]; + break; + } + c2 = *p++; + c1 |= (c2 >> 4) & 0x0f; + *bp++ = Base64Code[c1]; + c1 = (c2 & 0x0f) << 2; + if (p >= data + len) { + *bp++ = Base64Code[c1]; + break; + } + c2 = *p++; + c1 |= (c2 >> 6) & 0x03; + *bp++ = Base64Code[c1]; + *bp++ = Base64Code[c2 & 0x3f]; + } + *bp = '\0'; +} diff --git a/node_modules/bcrypt/src/bcrypt_node.cc b/node_modules/bcrypt/src/bcrypt_node.cc new file mode 100644 index 00000000..ce1c62c1 --- /dev/null +++ b/node_modules/bcrypt/src/bcrypt_node.cc @@ -0,0 +1,286 @@ +#include + +#include +#include +#include +#include // atoi + +#include "node_blf.h" + +#define NODE_LESS_THAN (!(NODE_VERSION_AT_LEAST(0, 5, 4))) + +namespace { + + bool ValidateSalt(const char* salt) { + + if (!salt || *salt != '$') { + return false; + } + + // discard $ + salt++; + + if (*salt > BCRYPT_VERSION) { + return false; + } + + if (salt[1] != '$') { + switch (salt[1]) { + case 'a': + case 'b': + salt++; + break; + default: + return false; + } + } + + // discard version + $ + salt += 2; + + if (salt[2] != '$') { + return false; + } + + int n = atoi(salt); + if (n > 31 || n < 0) { + return false; + } + + if (((uint8_t)1 << (uint8_t)n) < BCRYPT_MINROUNDS) { + return false; + } + + salt += 3; + if (strlen(salt) * 3 / 4 < BCRYPT_MAXSALT) { + return false; + } + + return true; + } + + inline char ToCharVersion(const std::string& str) { + return str[0]; + } + + /* SALT GENERATION */ + + class SaltAsyncWorker : public Napi::AsyncWorker { + public: + SaltAsyncWorker(const Napi::Function& callback, const std::string& seed, ssize_t rounds, char minor_ver) + : Napi::AsyncWorker(callback, "bcrypt:SaltAsyncWorker"), seed(seed), rounds(rounds), minor_ver(minor_ver) { + } + + ~SaltAsyncWorker() {} + + void Execute() { + bcrypt_gensalt(minor_ver, rounds, (u_int8_t *)&seed[0], salt); + } + + void OnOK() { + Napi::HandleScope scope(Env()); + Callback().Call({Env().Undefined(), Napi::String::New(Env(), salt)}); + } + + private: + std::string seed; + ssize_t rounds; + char minor_ver; + char salt[_SALT_LEN]; + }; + + Napi::Value GenerateSalt(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 4) { + throw Napi::TypeError::New(env, "4 arguments expected"); + } + if (!info[0].IsString()) { + throw Napi::TypeError::New(env, "First argument must be a string"); + } + if (!info[2].IsBuffer() || (info[2].As>()).Length() != 16) { + throw Napi::TypeError::New(env, "Second argument must be a 16 byte Buffer"); + } + + const char minor_ver = ToCharVersion(info[0].As()); + const int32_t rounds = info[1].As(); + Napi::Buffer seed = info[2].As>(); + Napi::Function callback = info[3].As(); + SaltAsyncWorker* saltWorker = new SaltAsyncWorker(callback, std::string(seed.Data(), 16), rounds, minor_ver); + saltWorker->Queue(); + return env.Undefined(); + } + + Napi::Value GenerateSaltSync(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 3) { + throw Napi::TypeError::New(env, "3 arguments expected"); + } + if (!info[0].IsString()) { + throw Napi::TypeError::New(env, "First argument must be a string"); + } + if (!info[2].IsBuffer() || (info[2].As>()).Length() != 16) { + throw Napi::TypeError::New(env, "Third argument must be a 16 byte Buffer"); + } + const char minor_ver = ToCharVersion(info[0].As()); + const int32_t rounds = info[1].As(); + Napi::Buffer buffer = info[2].As>(); + u_int8_t* seed = (u_int8_t*) buffer.Data(); + char salt[_SALT_LEN]; + bcrypt_gensalt(minor_ver, rounds, seed, salt); + return Napi::String::New(env, salt, strlen(salt)); + } + + inline std::string BufferToString(const Napi::Buffer &buf) { + return std::string(buf.Data(), buf.Length()); + } + + /* ENCRYPT DATA - USED TO BE HASHPW */ + + class EncryptAsyncWorker : public Napi::AsyncWorker { + public: + EncryptAsyncWorker(const Napi::Function& callback, const std::string& input, const std::string& salt) + : Napi::AsyncWorker(callback, "bcrypt:EncryptAsyncWorker"), input(input), salt(salt) { + } + + ~EncryptAsyncWorker() {} + + void Execute() { + if (!(ValidateSalt(salt.c_str()))) { + SetError("Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + } + bcrypt(input.c_str(), input.length(), salt.c_str(), bcrypted); + } + + void OnOK() { + Napi::HandleScope scope(Env()); + Callback().Call({Env().Undefined(),Napi::String::New(Env(), bcrypted)}); + } + private: + std::string input; + std::string salt; + char bcrypted[_PASSWORD_LEN]; + }; + + Napi::Value Encrypt(const Napi::CallbackInfo& info) { + if (info.Length() < 3) { + throw Napi::TypeError::New(info.Env(), "3 arguments expected"); + } + std::string data = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string salt = info[1].As(); + Napi::Function callback = info[2].As(); + EncryptAsyncWorker* encryptWorker = new EncryptAsyncWorker(callback, data, salt); + encryptWorker->Queue(); + return info.Env().Undefined(); + } + + Napi::Value EncryptSync(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 2) { + throw Napi::TypeError::New(info.Env(), "2 arguments expected"); + } + std::string data = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string salt = info[1].As(); + if (!(ValidateSalt(salt.c_str()))) { + throw Napi::Error::New(env, "Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + } + char bcrypted[_PASSWORD_LEN]; + bcrypt(data.c_str(), data.length(), salt.c_str(), bcrypted); + return Napi::String::New(env, bcrypted, strlen(bcrypted)); + } + + /* COMPARATOR */ + inline bool CompareStrings(const char* s1, const char* s2) { + return strcmp(s1, s2) == 0; + } + + class CompareAsyncWorker : public Napi::AsyncWorker { + public: + CompareAsyncWorker(const Napi::Function& callback, const std::string& input, const std::string& encrypted) + : Napi::AsyncWorker(callback, "bcrypt:CompareAsyncWorker"), input(input), encrypted(encrypted) { + result = false; + } + + ~CompareAsyncWorker() {} + + void Execute() { + char bcrypted[_PASSWORD_LEN]; + if (ValidateSalt(encrypted.c_str())) { + bcrypt(input.c_str(), input.length(), encrypted.c_str(), bcrypted); + result = CompareStrings(bcrypted, encrypted.c_str()); + } + } + + void OnOK() { + Napi::HandleScope scope(Env()); + Callback().Call({Env().Undefined(), Napi::Boolean::New(Env(), result)}); + } + + private: + std::string input; + std::string encrypted; + bool result; + }; + + Napi::Value Compare(const Napi::CallbackInfo& info) { + if (info.Length() < 3) { + throw Napi::TypeError::New(info.Env(), "3 arguments expected"); + } + std::string input = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string encrypted = info[1].As(); + Napi::Function callback = info[2].As(); + CompareAsyncWorker* compareWorker = new CompareAsyncWorker(callback, input, encrypted); + compareWorker->Queue(); + return info.Env().Undefined(); + } + + Napi::Value CompareSync(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 2) { + throw Napi::TypeError::New(info.Env(), "2 arguments expected"); + } + std::string pw = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string hash = info[1].As(); + char bcrypted[_PASSWORD_LEN]; + if (ValidateSalt(hash.c_str())) { + bcrypt(pw.c_str(), pw.length(), hash.c_str(), bcrypted); + return Napi::Boolean::New(env, CompareStrings(bcrypted, hash.c_str())); + } else { + return Napi::Boolean::New(env, false); + } + } + + Napi::Value GetRounds(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 1) { + throw Napi::TypeError::New(env, "1 argument expected"); + } + std::string hash = info[0].As(); + u_int32_t rounds; + if (!(rounds = bcrypt_get_rounds(hash.c_str()))) { + throw Napi::Error::New(env, "invalid hash provided"); + } + return Napi::Number::New(env, rounds); + } + +} // anonymous namespace + +Napi::Object init(Napi::Env env, Napi::Object exports) { + exports.Set(Napi::String::New(env, "gen_salt_sync"), Napi::Function::New(env, GenerateSaltSync)); + exports.Set(Napi::String::New(env, "encrypt_sync"), Napi::Function::New(env, EncryptSync)); + exports.Set(Napi::String::New(env, "compare_sync"), Napi::Function::New(env, CompareSync)); + exports.Set(Napi::String::New(env, "get_rounds"), Napi::Function::New(env, GetRounds)); + exports.Set(Napi::String::New(env, "gen_salt"), Napi::Function::New(env, GenerateSalt)); + exports.Set(Napi::String::New(env, "encrypt"), Napi::Function::New(env, Encrypt)); + exports.Set(Napi::String::New(env, "compare"), Napi::Function::New(env, Compare)); + return exports; +} + +NODE_API_MODULE(NODE_GYP_MODULE_NAME, init) diff --git a/node_modules/bcrypt/src/blowfish.cc b/node_modules/bcrypt/src/blowfish.cc new file mode 100644 index 00000000..1fc6cf19 --- /dev/null +++ b/node_modules/bcrypt/src/blowfish.cc @@ -0,0 +1,679 @@ +/* $OpenBSD: blowfish.c,v 1.18 2004/11/02 17:23:26 hshoexer Exp $ */ +/* + * Blowfish block cipher for OpenBSD + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Implementation advice by David Mazieres . + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * This product includes software developed by Niels Provos. + * 4. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * This code is derived from section 14.3 and the given source + * in section V of Applied Cryptography, second edition. + * Blowfish is an unpatented fast block cipher designed by + * Bruce Schneier. + */ + +#include "node_blf.h" + +#undef inline +#ifdef __GNUC__ +#define inline __inline +#else /* !__GNUC__ */ +#define inline +#endif /* !__GNUC__ */ + +/* Function for Feistel Networks */ + +#define F(s, x) ((((s)[ (((x)>>24)&0xFF)] \ + + (s)[0x100 + (((x)>>16)&0xFF)]) \ + ^ (s)[0x200 + (((x)>> 8)&0xFF)]) \ + + (s)[0x300 + ( (x) &0xFF)]) + +#define BLFRND(s,p,i,j,n) (i ^= F(s,j) ^ (p)[n]) + +void +Blowfish_encipher(blf_ctx *c, u_int32_t *xl, u_int32_t *xr) +{ + u_int32_t Xl; + u_int32_t Xr; + u_int32_t *s = c->S[0]; + u_int32_t *p = c->P; + + Xl = *xl; + Xr = *xr; + + Xl ^= p[0]; + BLFRND(s, p, Xr, Xl, 1); BLFRND(s, p, Xl, Xr, 2); + BLFRND(s, p, Xr, Xl, 3); BLFRND(s, p, Xl, Xr, 4); + BLFRND(s, p, Xr, Xl, 5); BLFRND(s, p, Xl, Xr, 6); + BLFRND(s, p, Xr, Xl, 7); BLFRND(s, p, Xl, Xr, 8); + BLFRND(s, p, Xr, Xl, 9); BLFRND(s, p, Xl, Xr, 10); + BLFRND(s, p, Xr, Xl, 11); BLFRND(s, p, Xl, Xr, 12); + BLFRND(s, p, Xr, Xl, 13); BLFRND(s, p, Xl, Xr, 14); + BLFRND(s, p, Xr, Xl, 15); BLFRND(s, p, Xl, Xr, 16); + + *xl = Xr ^ p[17]; + *xr = Xl; +} + +void +Blowfish_decipher(blf_ctx *c, u_int32_t *xl, u_int32_t *xr) +{ + u_int32_t Xl; + u_int32_t Xr; + u_int32_t *s = c->S[0]; + u_int32_t *p = c->P; + + Xl = *xl; + Xr = *xr; + + Xl ^= p[17]; + BLFRND(s, p, Xr, Xl, 16); BLFRND(s, p, Xl, Xr, 15); + BLFRND(s, p, Xr, Xl, 14); BLFRND(s, p, Xl, Xr, 13); + BLFRND(s, p, Xr, Xl, 12); BLFRND(s, p, Xl, Xr, 11); + BLFRND(s, p, Xr, Xl, 10); BLFRND(s, p, Xl, Xr, 9); + BLFRND(s, p, Xr, Xl, 8); BLFRND(s, p, Xl, Xr, 7); + BLFRND(s, p, Xr, Xl, 6); BLFRND(s, p, Xl, Xr, 5); + BLFRND(s, p, Xr, Xl, 4); BLFRND(s, p, Xl, Xr, 3); + BLFRND(s, p, Xr, Xl, 2); BLFRND(s, p, Xl, Xr, 1); + + *xl = Xr ^ p[0]; + *xr = Xl; +} + +void +Blowfish_initstate(blf_ctx *c) +{ + /* P-box and S-box tables initialized with digits of Pi */ + + static const blf_ctx initstate = + { { + { + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, + 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, + 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, + 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, + 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, + 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, + 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, + 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, + 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, + 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, + 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, + 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, + 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, + 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, + 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, + 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, + 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, + 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, + 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, + 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, + 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, + 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, + 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, + 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, + 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, + 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, + 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, + 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, + 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, + 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, + 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, + 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, + 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, + 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, + 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, + 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, + 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, + 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, + 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, + 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, + 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, + 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, + 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a}, + { + 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, + 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, + 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, + 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, + 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, + 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, + 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, + 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, + 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, + 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, + 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, + 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, + 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, + 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, + 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, + 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, + 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, + 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, + 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, + 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, + 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, + 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, + 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, + 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, + 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, + 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, + 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, + 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, + 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, + 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, + 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, + 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, + 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, + 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, + 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, + 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, + 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, + 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, + 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, + 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, + 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, + 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, + 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7}, + { + 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, + 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, + 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, + 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, + 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, + 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, + 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, + 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, + 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, + 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, + 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, + 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, + 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, + 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, + 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, + 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, + 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, + 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, + 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, + 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, + 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, + 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, + 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, + 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, + 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, + 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, + 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, + 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, + 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, + 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, + 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, + 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, + 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, + 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, + 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, + 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, + 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, + 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, + 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, + 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, + 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, + 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, + 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0}, + { + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, + 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, + 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, + 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, + 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, + 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, + 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, + 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, + 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, + 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, + 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, + 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, + 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, + 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, + 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, + 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, + 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, + 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, + 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, + 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, + 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, + 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, + 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, + 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, + 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, + 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, + 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, + 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, + 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, + 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, + 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, + 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, + 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, + 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, + 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, + 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, + 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, + 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, + 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, + 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, + 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, + 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, + 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6} + }, + { + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, + 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, + 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, + 0x9216d5d9, 0x8979fb1b + } }; + + *c = initstate; +} + +u_int32_t +Blowfish_stream2word(const u_int8_t *data, u_int16_t databytes, + u_int16_t *current) +{ + u_int8_t i; + u_int16_t j; + u_int32_t temp; + + temp = 0x00000000; + j = *current; + + for (i = 0; i < 4; i++, j++) { + if (j >= databytes) + j = 0; + temp = (temp << 8) | data[j]; + } + + *current = j; + return temp; +} + +void +Blowfish_expand0state(blf_ctx *c, const u_int8_t *key, u_int16_t keybytes) +{ + u_int16_t i; + u_int16_t j; + u_int16_t k; + u_int32_t temp; + u_int32_t datal; + u_int32_t datar; + + j = 0; + for (i = 0; i < BLF_N + 2; i++) { + /* Extract 4 int8 to 1 int32 from keystream */ + temp = Blowfish_stream2word(key, keybytes, &j); + c->P[i] = c->P[i] ^ temp; + } + + j = 0; + datal = 0x00000000; + datar = 0x00000000; + for (i = 0; i < BLF_N + 2; i += 2) { + Blowfish_encipher(c, &datal, &datar); + + c->P[i] = datal; + c->P[i + 1] = datar; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + Blowfish_encipher(c, &datal, &datar); + + c->S[i][k] = datal; + c->S[i][k + 1] = datar; + } + } +} + + +void +Blowfish_expandstate(blf_ctx *c, const u_int8_t *data, u_int16_t databytes, + const u_int8_t *key, u_int16_t keybytes) +{ + u_int16_t i; + u_int16_t j; + u_int16_t k; + u_int32_t temp; + u_int32_t datal; + u_int32_t datar; + + j = 0; + for (i = 0; i < BLF_N + 2; i++) { + /* Extract 4 int8 to 1 int32 from keystream */ + temp = Blowfish_stream2word(key, keybytes, &j); + c->P[i] = c->P[i] ^ temp; + } + + j = 0; + datal = 0x00000000; + datar = 0x00000000; + for (i = 0; i < BLF_N + 2; i += 2) { + datal ^= Blowfish_stream2word(data, databytes, &j); + datar ^= Blowfish_stream2word(data, databytes, &j); + Blowfish_encipher(c, &datal, &datar); + + c->P[i] = datal; + c->P[i + 1] = datar; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + datal ^= Blowfish_stream2word(data, databytes, &j); + datar ^= Blowfish_stream2word(data, databytes, &j); + Blowfish_encipher(c, &datal, &datar); + + c->S[i][k] = datal; + c->S[i][k + 1] = datar; + } + } + +} + +void +blf_key(blf_ctx *c, const u_int8_t *k, u_int16_t len) +{ + /* Initialize S-boxes and subkeys with Pi */ + Blowfish_initstate(c); + + /* Transform S-boxes and subkeys with key */ + Blowfish_expand0state(c, k, len); +} + +void +blf_enc(blf_ctx *c, u_int32_t *data, u_int16_t blocks) +{ + u_int32_t *d; + u_int16_t i; + + d = data; + for (i = 0; i < blocks; i++) { + Blowfish_encipher(c, d, d + 1); + d += 2; + } +} + +void +blf_dec(blf_ctx *c, u_int32_t *data, u_int16_t blocks) +{ + u_int32_t *d; + u_int16_t i; + + d = data; + for (i = 0; i < blocks; i++) { + Blowfish_decipher(c, d, d + 1); + d += 2; + } +} + +void +blf_ecb_encrypt(blf_ctx *c, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int32_t i; + + for (i = 0; i < len; i += 8) { + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_encipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + data += 8; + } +} + +void +blf_ecb_decrypt(blf_ctx *c, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int32_t i; + + for (i = 0; i < len; i += 8) { + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_decipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + data += 8; + } +} + +void +blf_cbc_encrypt(blf_ctx *c, u_int8_t *iv, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int32_t i, j; + + for (i = 0; i < len; i += 8) { + for (j = 0; j < 8; j++) + data[j] ^= iv[j]; + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_encipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + iv = data; + data += 8; + } +} + +void +blf_cbc_decrypt(blf_ctx *c, u_int8_t *iva, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int8_t *iv; + u_int32_t i, j; + + iv = data + len - 16; + data = data + len - 8; + for (i = len - 8; i >= 8; i -= 8) { + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_decipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + for (j = 0; j < 8; j++) + data[j] ^= iv[j]; + iv -= 8; + data -= 8; + } + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_decipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + for (j = 0; j < 8; j++) + data[j] ^= iva[j]; +} + +#if 0 +void +report(u_int32_t data[], u_int16_t len) +{ + u_int16_t i; + for (i = 0; i < len; i += 2) + printf("Block %0hd: %08lx %08lx.\n", + i / 2, data[i], data[i + 1]); +} +void +main(void) +{ + + blf_ctx c; + char key[] = "AAAAA"; + char key2[] = "abcdefghijklmnopqrstuvwxyz"; + + u_int32_t data[10]; + u_int32_t data2[] = + {0x424c4f57l, 0x46495348l}; + + u_int16_t i; + + /* First test */ + for (i = 0; i < 10; i++) + data[i] = i; + + blf_key(&c, (u_int8_t *) key, 5); + blf_enc(&c, data, 5); + blf_dec(&c, data, 1); + blf_dec(&c, data + 2, 4); + printf("Should read as 0 - 9.\n"); + report(data, 10); + + /* Second test */ + blf_key(&c, (u_int8_t *) key2, strlen(key2)); + blf_enc(&c, data2, 1); + printf("\nShould read as: 0x324ed0fe 0xf413a203.\n"); + report(data2, 2); + blf_dec(&c, data2, 1); + report(data2, 2); +} +#endif diff --git a/node_modules/bcrypt/src/node_blf.h b/node_modules/bcrypt/src/node_blf.h new file mode 100644 index 00000000..2d50a39b --- /dev/null +++ b/node_modules/bcrypt/src/node_blf.h @@ -0,0 +1,132 @@ +/* $OpenBSD: blf.h,v 1.7 2007/03/14 17:59:41 grunk Exp $ */ +/* + * Blowfish - a fast block cipher designed by Bruce Schneier + * + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * This product includes software developed by Niels Provos. + * 4. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NODE_BLF_H_ +#define _NODE_BLF_H_ + +#include + +/* Solaris compatibility */ +#ifdef __sun +#define u_int8_t uint8_t +#define u_int16_t uint16_t +#define u_int32_t uint32_t +#define u_int64_t uint64_t +#endif + +#ifdef _WIN32 +#define u_int8_t unsigned __int8 +#define u_int16_t unsigned __int16 +#define u_int32_t unsigned __int32 +#define u_int64_t unsigned __int64 +#endif + +/* Windows ssize_t compatibility */ +#if defined(_WIN32) || defined(_WIN64) +# if defined(_WIN64) + typedef __int64 LONG_PTR; +# else + typedef long LONG_PTR; +# endif + typedef LONG_PTR SSIZE_T; + typedef SSIZE_T ssize_t; +#endif + +/* z/OS compatibility */ +#ifdef __MVS__ +typedef unsigned char u_int8_t; +typedef unsigned short u_int16_t; +typedef unsigned int u_int32_t; +typedef unsigned long long u_int64_t; +#endif + +#define BCRYPT_VERSION '2' +#define BCRYPT_MAXSALT 16 /* Precomputation is just so nice */ +#define BCRYPT_BLOCKS 6 /* Ciphertext blocks */ +#define BCRYPT_MINROUNDS 16 /* we have log2(rounds) in salt */ + +/* Schneier specifies a maximum key length of 56 bytes. + * This ensures that every key bit affects every cipher + * bit. However, the subkeys can hold up to 72 bytes. + * Warning: For normal blowfish encryption only 56 bytes + * of the key affect all cipherbits. + */ + +#define BLF_N 16 /* Number of Subkeys */ +#define BLF_MAXKEYLEN ((BLF_N-2)*4) /* 448 bits */ +#define BLF_MAXUTILIZED ((BLF_N+2)*4) /* 576 bits */ + +#define _PASSWORD_LEN 128 /* max length, not counting NUL */ +#define _SALT_LEN 32 /* max length */ + +/* Blowfish context */ +typedef struct BlowfishContext { + u_int32_t S[4][256]; /* S-Boxes */ + u_int32_t P[BLF_N + 2]; /* Subkeys */ +} blf_ctx; + +/* Raw access to customized Blowfish + * blf_key is just: + * Blowfish_initstate( state ) + * Blowfish_expand0state( state, key, keylen ) + */ + +void Blowfish_encipher(blf_ctx *, u_int32_t *, u_int32_t *); +void Blowfish_decipher(blf_ctx *, u_int32_t *, u_int32_t *); +void Blowfish_initstate(blf_ctx *); +void Blowfish_expand0state(blf_ctx *, const u_int8_t *, u_int16_t); +void Blowfish_expandstate +(blf_ctx *, const u_int8_t *, u_int16_t, const u_int8_t *, u_int16_t); + +/* Standard Blowfish */ + +void blf_key(blf_ctx *, const u_int8_t *, u_int16_t); +void blf_enc(blf_ctx *, u_int32_t *, u_int16_t); +void blf_dec(blf_ctx *, u_int32_t *, u_int16_t); + +void blf_ecb_encrypt(blf_ctx *, u_int8_t *, u_int32_t); +void blf_ecb_decrypt(blf_ctx *, u_int8_t *, u_int32_t); + +void blf_cbc_encrypt(blf_ctx *, u_int8_t *, u_int8_t *, u_int32_t); +void blf_cbc_decrypt(blf_ctx *, u_int8_t *, u_int8_t *, u_int32_t); + +/* Converts u_int8_t to u_int32_t */ +u_int32_t Blowfish_stream2word(const u_int8_t *, u_int16_t , u_int16_t *); + +/* bcrypt functions*/ +void bcrypt_gensalt(char, u_int8_t, u_int8_t*, char *); +void bcrypt(const char *, size_t key_len, const char *, char *); +void encode_salt(char *, u_int8_t *, char, u_int16_t, u_int8_t); +u_int32_t bcrypt_get_rounds(const char *); + +#endif diff --git a/node_modules/bcrypt/test/async.js b/node_modules/bcrypt/test/async.js new file mode 100644 index 00000000..1e10321e --- /dev/null +++ b/node_modules/bcrypt/test/async.js @@ -0,0 +1,181 @@ +var bcrypt = require('../bcrypt'); + +module.exports = { + test_salt_length: function(assert) { + assert.expect(1); + bcrypt.genSalt(10, function(err, salt) { + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + assert.done(); + }); + }, + test_salt_only_cb: function(assert) { + assert.doesNotThrow(function() {bcrypt.genSalt(function(err, salt) {});}, "Should not throw an Error. Rounds and seed length are optional."); + assert.done(); + }, + test_salt_rounds_is_string_number: function(assert) { + bcrypt.genSalt('10', void 0, function (err, salt) { + assert.ok((err instanceof Error), "Should be an Error. genSalt requires round to be of type number."); + assert.done(); + }); + }, + test_salt_rounds_is_string_non_number: function(assert) { + bcrypt.genSalt('z', function (err, salt) { + assert.ok((err instanceof Error), "Should throw an Error. genSalt requires rounds to of type number."); + assert.done(); + }); + }, + test_salt_minor: function(assert) { + assert.expect(3); + bcrypt.genSalt(10, 'a', function(err, salt) { + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2a'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }); + }, + test_salt_minor_b: function(assert) { + assert.expect(3); + bcrypt.genSalt(10, 'b', function(err, salt) { + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }); + }, + test_hash: function(assert) { + assert.expect(1); + bcrypt.genSalt(10, function(err, salt) { + bcrypt.hash('password', salt, function(err, res) { + assert.ok(res, "Res should be defined."); + assert.done(); + }); + }); + }, + test_hash_rounds: function(assert) { + assert.expect(1); + bcrypt.hash('bacon', 8, function(err, hash) { + assert.strictEqual(bcrypt.getRounds(hash), 8, "Number of rounds should be that specified in the function call."); + assert.done(); + }); + }, + test_hash_empty_strings: function(assert) { + assert.expect(2); + bcrypt.genSalt(10, function(err, salt) { + bcrypt.hash('', salt, function(err, res) { + assert.ok(res, "Res should be defined even with an empty pw."); + bcrypt.hash('', '', function(err, res) { + if (err) { + assert.ok(err); + } else { + assert.fail(); + } + + assert.done(); + }); + }); + }); + }, + test_hash_no_params: function(assert) { + bcrypt.hash(function (err, hash) { + assert.ok(err, "Should be an error. No params."); + assert.done(); + }); + }, + test_hash_one_param: function(assert) { + bcrypt.hash('password', function (err, hash) { + assert.ok(err, "Should be an Error. No salt."); + assert.done(); + }); + }, + test_hash_salt_validity: function(assert) { + assert.expect(3); + bcrypt.hash('password', '$2a$10$somesaltyvaluertsetrse', function(err, enc) { + assert.strictEqual(err, undefined); + bcrypt.hash('password', 'some$value', function(err, enc) { + assert.notEqual(err, undefined); + assert.strictEqual(err.message, "Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + assert.done(); + }); + }); + }, + test_verify_salt: function(assert) { + assert.expect(2); + bcrypt.genSalt(10, function(err, salt) { + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }); + }, + test_verify_salt_min_rounds: function(assert) { + assert.expect(2); + bcrypt.genSalt(1, function(err, salt) { + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '04'); + assert.done(); + }); + }, + test_verify_salt_max_rounds: function(assert) { + assert.expect(2); + bcrypt.genSalt(100, function(err, salt) { + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '31'); + assert.done(); + }); + }, + test_hash_compare: function(assert) { + assert.expect(3); + bcrypt.genSalt(10, function(err, salt) { + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + bcrypt.hash("test", salt, function(err, hash) { + bcrypt.compare("test", hash, function(err, res) { + assert.strictEqual(res, true, "These hashes should be equal."); + bcrypt.compare("blah", hash, function(err, res) { + assert.strictEqual(res, false, "These hashes should not be equal."); + assert.done(); + }); + }); + }); + }); + }, + test_hash_compare_empty_strings: function(assert) { + assert.expect(2); + var hash = bcrypt.hashSync("test", bcrypt.genSaltSync(10)); + + bcrypt.compare("", hash, function(err, res) { + assert.strictEqual(res, false, "These hashes should not be equal."); + bcrypt.compare("", "", function(err, res) { + assert.strictEqual(res, false, "These hashes should not be equal."); + assert.done(); + }); + }); + }, + test_hash_compare_invalid_strings: function(assert) { + var fullString = 'envy1362987212538'; + var hash = '$2a$10$XOPbrlUPQdwdJUpSrIF6X.LbE14qsMmKGhM1A8W9iqaG3vv1BD7WC'; + var wut = ':'; + bcrypt.compare(fullString, hash, function(err, res) { + assert.ok(res); + bcrypt.compare(fullString, wut, function(err, res) { + assert.ok(!res); + assert.done(); + }); + }); + }, + test_compare_no_params: function(assert) { + bcrypt.compare(function(err, hash) { + assert.ok(err, 'Should be an error. No params.'); + assert.done(); + }); + }, + test_hash_compare_one_param: function(assert) { + bcrypt.compare('password', function(err, hash) { + assert.ok(err, 'Should be an Error. No hash.'); + assert.done(); + }); + } +}; diff --git a/node_modules/bcrypt/test/implementation.js b/node_modules/bcrypt/test/implementation.js new file mode 100644 index 00000000..ad884bfc --- /dev/null +++ b/node_modules/bcrypt/test/implementation.js @@ -0,0 +1,53 @@ +var bcrypt = require('../bcrypt'); + +// some tests were adapted from https://github.com/riverrun/bcrypt_elixir/blob/master/test/base_test.exs +// which are under the BSD LICENSE +module.exports = { + openwall_bcrypt_tests: function(assert) { + assert.strictEqual(bcrypt.hashSync("U*U", "$2a$05$CCCCCCCCCCCCCCCCCCCCC."), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.E5YPO9kmyuRGyh0XouQYb4YMJKvyOeW"); + assert.strictEqual(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCC."), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.VGOzA784oUp/Z0DY336zx7pLYAy0lwK"); + assert.strictEqual(bcrypt.hashSync("U*U*U", "$2a$05$XXXXXXXXXXXXXXXXXXXXXO"), "$2a$05$XXXXXXXXXXXXXXXXXXXXXOAcXxm9kjPGEMsLznoKqmqw7tc8WCx4a"); + assert.strictEqual(bcrypt.hashSync("", "$2a$05$CCCCCCCCCCCCCCCCCCCCC."), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.7uG0VCzI2bS7j6ymqJi9CdcdxiRTWNy"); + assert.strictEqual(bcrypt.hashSync("0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789", "$2a$05$abcdefghijklmnopqrstuu"), "$2a$05$abcdefghijklmnopqrstuu5s2v8.iXieOjg/.AySBTTZIIVFJeBui"); + assert.done(); + }, + openbsd_bcrypt_tests: function(assert) { + assert.strictEqual(bcrypt.hashSync("000000000000000000000000000000000000000000000000000000000000000000000000", "$2a$05$CCCCCCCCCCCCCCCCCCCCC."), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS"); + assert.strictEqual(bcrypt.hashSync("000000000000000000000000000000000000000000000000000000000000000000000000", "$2b$05$CCCCCCCCCCCCCCCCCCCCC."), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS"); + assert.done(); + }, + test_long_passwords: function(assert) { + // bcrypt wrap-around bug in $2a$ + assert.strictEqual(bcrypt.hashSync("012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234", "$2a$05$CCCCCCCCCCCCCCCCCCCCC."), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS"); + assert.strictEqual(bcrypt.hashSync("01XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX", "$2a$05$CCCCCCCCCCCCCCCCCCCCC."), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS"); + + // tests for $2b$ which fixes wrap-around bugs + assert.strictEqual(bcrypt.hashSync("012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234", "$2b$05$CCCCCCCCCCCCCCCCCCCCC."), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.XxrQqgBi/5Sxuq9soXzDtjIZ7w5pMfK"); + assert.strictEqual(bcrypt.hashSync("0123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345", "$2b$05$CCCCCCCCCCCCCCCCCCCCC."), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.XxrQqgBi/5Sxuq9soXzDtjIZ7w5pMfK"); + assert.done(); + }, + test_embedded_nulls: function(assert) { + assert.strictEqual(bcrypt.hashSync("Passw\0rd123", "$2b$05$CCCCCCCCCCCCCCCCCCCCC."), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.VHy/kzL4sCcX3Ib3wN5rNGiRt.TpfxS"); + assert.strictEqual(bcrypt.hashSync("Passw\0 you can literally write anything after the NUL character", "$2b$05$CCCCCCCCCCCCCCCCCCCCC."), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.4vJLJQ6nZ/70INTjjSZWQ0iyUek92tu"); + assert.strictEqual(bcrypt.hashSync(Buffer.from("Passw\0 you can literally write anything after the NUL character"), "$2b$05$CCCCCCCCCCCCCCCCCCCCC."), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.4vJLJQ6nZ/70INTjjSZWQ0iyUek92tu"); + assert.done(); + }, + test_shorten_salt_to_128_bits: function(assert) { + assert.strictEqual(bcrypt.hashSync("test", "$2a$10$1234567899123456789012"), "$2a$10$123456789912345678901u.OtL1A1eGK5wmvBKUDYKvuVKI7h2XBu"); + assert.strictEqual(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCCh"), "$2a$05$CCCCCCCCCCCCCCCCCCCCCeUQ7VjYZ2hd4bLYZdhuPpZMUpEUJDw1S"); + assert.strictEqual(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCCM"), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.VGOzA784oUp/Z0DY336zx7pLYAy0lwK"); + assert.strictEqual(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCCA"), "$2a$05$CCCCCCCCCCCCCCCCCCCCC.VGOzA784oUp/Z0DY336zx7pLYAy0lwK"); + assert.done(); + }, + test_consistency: function(assert) { + assert.strictEqual(bcrypt.hashSync("ππππππππ", "$2a$10$.TtQJ4Jr6isd4Hp.mVfZeu"), "$2a$10$.TtQJ4Jr6isd4Hp.mVfZeuh6Gws4rOQ/vdBczhDx.19NFK0Y84Dle"); + assert.strictEqual(bcrypt.hashSync("p@5sw0rd", "$2b$12$zQ4CooEXdGqcwi0PHsgc8e"), "$2b$12$zQ4CooEXdGqcwi0PHsgc8eAf0DLXE/XHoBE8kCSGQ97rXwuClaPam"); + assert.strictEqual(bcrypt.hashSync("C'est bon, la vie!", "$2b$12$cbo7LZ.wxgW4yxAA5Vqlv."), "$2b$12$cbo7LZ.wxgW4yxAA5Vqlv.KR6QFPt4qCdc9RYJNXxa/rbUOp.1sw."); + assert.strictEqual(bcrypt.hashSync("ἓν οἶδα ὅτι οὐδὲν οἶδα", "$2b$12$LeHKWR2bmrazi/6P22Jpau"), "$2b$12$LeHKWR2bmrazi/6P22JpauX5my/eKwwKpWqL7L5iEByBnxNc76FRW"); + assert.strictEqual(bcrypt.hashSync(Buffer.from("ἓν οἶδα ὅτι οὐδὲν οἶδα"), "$2b$12$LeHKWR2bmrazi/6P22Jpau"), "$2b$12$LeHKWR2bmrazi/6P22JpauX5my/eKwwKpWqL7L5iEByBnxNc76FRW"); + bcrypt.hash(Buffer.from("ἓν οἶδα ὅτι οὐδὲν οἶδα"), "$2b$12$LeHKWR2bmrazi/6P22Jpau", function(err, hash) { + assert.strictEqual(hash, "$2b$12$LeHKWR2bmrazi/6P22JpauX5my/eKwwKpWqL7L5iEByBnxNc76FRW"); + assert.done(); + }); + } +} diff --git a/node_modules/bcrypt/test/promise.js b/node_modules/bcrypt/test/promise.js new file mode 100644 index 00000000..f6409926 --- /dev/null +++ b/node_modules/bcrypt/test/promise.js @@ -0,0 +1,252 @@ +var bcrypt = require('../bcrypt'); +var promises = require('../promises'); + +var fail = function(assert, error) { + assert.ok(false, error); + assert.done(); +}; + +// only run these tests if Promise is available +if (typeof Promise !== 'undefined') { + module.exports = { + test_salt_returns_promise_on_no_args: function(assert) { + // make sure test passes with non-native implementations such as bluebird + // http://stackoverflow.com/questions/27746304/how-do-i-tell-if-an-object-is-a-promise + assert.strictEqual(typeof bcrypt.genSalt().then, 'function', "Should return a promise"); + assert.done(); + }, + test_salt_returns_promise_on_null_callback: function(assert) { + assert.strictEqual(typeof bcrypt.genSalt(13, null, null).then,'function', "Should return a promise"); + assert.done(); + }, + test_salt_length: function(assert) { + assert.expect(2); + bcrypt.genSalt(10).then(function(salt) { + assert.ok(salt,'salt must be defined'); + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + assert.done(); + }); + }, + test_salt_rounds_is_string_number: function(assert) { + assert.expect(1); + bcrypt.genSalt('10').then(function() { + fail(assert, "should not be resolved"); + }).catch(function(err) { + assert.ok((err instanceof Error), "Should be an Error. genSalt requires round to be of type number."); + }).then(function() { + assert.done(); + }); + }, + test_salt_rounds_is_string_non_number: function(assert) { + assert.expect(1); + bcrypt.genSalt('b').then(function() { + fail(assert, "should not be resolved"); + }).catch(function(err) { + assert.ok((err instanceof Error), "Should be an Error. genSalt requires round to be of type number."); + }).then(function() { + assert.done(); + }); + }, + test_hash_returns_promise_on_null_callback: function(assert) { + assert.strictEqual(typeof bcrypt.hash('password', 10, null).then,'function', "Should return a promise"); + assert.done(); + }, + test_hash: function(assert) { + assert.expect(1); + bcrypt.genSalt(10).then(function(salt) { + return bcrypt.hash('password', salt); + }).then(function(res) { + assert.ok(res, "Res should be defined."); + assert.done(); + }); + }, + test_hash_rounds: function(assert) { + assert.expect(1); + bcrypt.hash('bacon', 8).then(function(hash) { + assert.strictEqual(bcrypt.getRounds(hash), 8, "Number of rounds should be that specified in the function call."); + assert.done(); + }); + }, + test_hash_empty_strings: function(assert) { + assert.expect(2); + Promise.all([ + bcrypt.genSalt(10).then(function(salt) { + return bcrypt.hash('', salt); + }).then(function(res) { + assert.ok(res, "Res should be defined even with an empty pw."); + }), + bcrypt.hash('', '').then(function() { + fail(assert, "should not be resolved") + }).catch(function(err) { + assert.ok(err); + }), + ]).then(function() { + assert.done(); + }); + }, + test_hash_no_params: function(assert) { + assert.expect(1); + bcrypt.hash().then(function() { + fail(assert, "should not be resolved"); + }).catch(function(err) { + assert.ok(err, "Should be an error. No params."); + }).then(function() { + assert.done(); + }); + }, + test_hash_one_param: function(assert) { + assert.expect(1); + bcrypt.hash('password').then(function() { + fail(assert, "should not be resolved"); + }).catch(function(err) { + assert.ok(err, "Should be an error. No salt."); + }).then(function() { + assert.done(); + }); + }, + test_hash_salt_validity: function(assert) { + assert.expect(3); + Promise.all( + [ + bcrypt.hash('password', '$2a$10$somesaltyvaluertsetrse').then(function(enc) { + assert.ok(enc, "should be resolved with a value"); + }), + bcrypt.hash('password', 'some$value').then(function() { + fail(assert, "should not resolve"); + }).catch(function(err) { + assert.notEqual(err, undefined); + assert.strictEqual(err.message, "Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + }) + ]).then(function() { + assert.done(); + }); + }, + test_verify_salt: function(assert) { + assert.expect(2); + bcrypt.genSalt(10).then(function(salt) { + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }); + }, + test_verify_salt_min_rounds: function(assert) { + assert.expect(2); + bcrypt.genSalt(1).then(function(salt) { + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '04'); + assert.done(); + }); + }, + test_verify_salt_max_rounds: function(assert) { + assert.expect(2); + bcrypt.genSalt(100).then(function(salt) { + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '31'); + assert.done(); + }); + }, + test_hash_compare_returns_promise_on_null_callback: function(assert) { + assert.strictEqual(typeof bcrypt.compare('password', 'something', null).then, 'function', "Should return a promise"); + assert.done(); + }, + test_hash_compare: function(assert) { + assert.expect(3); + bcrypt.genSalt(10).then(function(salt) { + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + return bcrypt.hash("test", salt); + }).then(function(hash) { + return Promise.all( + [ + bcrypt.compare("test", hash).then(function(res) { + assert.strictEqual(res, true, "These hashes should be equal."); + }), + bcrypt.compare("blah", hash).then(function(res) { + assert.strictEqual(res, false, "These hashes should not be equal."); + }) + ]).then(function() { + assert.done(); + }); + }); + }, + test_hash_compare_empty_strings: function(assert) { + assert.expect(2); + var hash = bcrypt.hashSync("test", bcrypt.genSaltSync(10)); + bcrypt.compare("", hash).then(function(res) { + assert.strictEqual(res, false, "These hashes should not be equal."); + return bcrypt.compare("", ""); + }).then(function(res) { + assert.strictEqual(res, false, "These hashes should not be equal."); + assert.done(); + }); + }, + test_hash_compare_invalid_strings: function(assert) { + var fullString = 'envy1362987212538'; + var hash = '$2a$10$XOPbrlUPQdwdJUpSrIF6X.LbE14qsMmKGhM1A8W9iqaG3vv1BD7WC'; + var wut = ':'; + Promise.all([ + bcrypt.compare(fullString, hash).then(function(res) { + assert.ok(res); + }), + bcrypt.compare(fullString, wut).then(function(res) { + assert.ok(!res); + }) + ]).then(function() { + assert.done(); + }); + }, + test_hash_compare_no_params: function(assert) { + assert.expect(1); + bcrypt.compare().then(function() { + fail(assert, 'Should not resolve'); + }).catch(function(err) { + assert.strictEqual(err.message, 'data and hash arguments required', 'Promise should be rejected when no parameters are supplied'); + }).then(function() { + assert.done(); + }); + }, + test_hash_compare_one_param: function(assert) { + assert.expect(1); + bcrypt.compare('password').then(function() { + fail(assert, 'Should not resolve'); + }).catch(function(err) { + assert.strictEqual(err.message, 'data and hash arguments required', 'Promise should be rejected when no parameters are supplied'); + }).then(function() { + assert.done(); + }); + }, + test_change_promise_impl_reject: function(assert) { + + promises.use({ + reject: function() { + return 'mock'; + } + }); + + assert.equal(promises.reject(), 'mock'); + + // need to reset the promise implementation because of require cache + promises.use(global.Promise); + assert.done(); + + }, + test_change_promise_impl_promise: function(assert) { + + promises.use({ + reject: function(err) { + assert.equal(err.message, 'fn must be a function'); + return 'mock'; + } + }); + + assert.equal(promises.promise('', '', ''), 'mock'); + + // need to reset the promise implementation because of require cache + promises.use(global.Promise); + assert.done(); + + } + }; +} diff --git a/node_modules/bcrypt/test/repetitions.js b/node_modules/bcrypt/test/repetitions.js new file mode 100644 index 00000000..f05b7168 --- /dev/null +++ b/node_modules/bcrypt/test/repetitions.js @@ -0,0 +1,118 @@ +var bcrypt = require('../bcrypt'); + +var EXPECTED = 2500; //number of times to iterate these tests... + +module.exports = { + test_salt_length: function(assert) { + assert.expect(EXPECTED); + var n = 0; + for (var i = 0; i < EXPECTED; i++) { + bcrypt.genSalt(10, function(err, salt) { + assert.equals(29, salt.length, "Salt ("+salt+") isn't the correct length. It is: " + salt.length); + n++; + }); + } + + function checkVal() { + if (n == EXPECTED) { + assert.done(); + } else { + setTimeout(checkVal, 100); + } + } + setTimeout(checkVal, 100); + }, + test_hash_length: function(assert) { + assert.expect(EXPECTED); + var SALT = '$2a$04$TnjywYklQbbZjdjBgBoA4e'; + var n = 0; + for (var i = 0; i < EXPECTED; i++) { + bcrypt.hash('test', SALT, function(err, crypted) { + assert.equals(60, crypted.length, "Encrypted ("+crypted+") isn't the correct length. It is: " + crypted.length); + n++; + }); + } + + function checkVal() { + if (n == EXPECTED) { + assert.done(); + } else { + setTimeout(checkVal, 100); + } + } + setTimeout(checkVal, 100); + }, + test_compare: function(assert) { + assert.expect(EXPECTED); + var HASH = '$2a$04$TnjywYklQbbZjdjBgBoA4e9G7RJt9blgMgsCvUvus4Iv4TENB5nHy'; + var n = 0; + for (var i = 0; i < EXPECTED; i++) { + bcrypt.compare('test', HASH, function(err, match) { + assert.equal(true, match, "No match."); + n++; + }); + } + + function checkVal() { + if (n == EXPECTED) { + assert.done(); + } else { + setTimeout(checkVal, 100); + } + } + setTimeout(checkVal, 100); + }, + test_hash_and_compare: function(assert) { + assert.expect((EXPECTED-1)*3); + var salt = bcrypt.genSaltSync(4), + idx = 0, + good_done = false, + bad_done = false; + + function next() { + return test('secret' + Math.random()); + } + + function test(password) { + idx += 1; + return bcrypt.hash(password, salt, function(err, hash) { + if (err) throw err; + //console.log('\nbcrypt iter ' + idx); + + assert.ok(hash); + + bcrypt.compare(password, hash, function(err, res) { + //if (err) throw err; + assert.ok(res); + if (idx >= (EXPECTED-1)) { + good_done = true; + } + }); + + bcrypt.compare('bad' + password, hash, function(err, res) { + //if (err) throw err; + assert.ok(!res); + if (idx >= (EXPECTED-1)) { + bad_done = true; + } + }); + + if (idx < ((EXPECTED)-1)) { + next(); + } else { + function checkDone() { + if (idx >= (EXPECTED-1) && good_done && bad_done) { + assert.done(); + } else { + setTimeout(checkDone, 100); + } + } + + setTimeout(checkDone, 100); + } + }); + } + + next(); + } +}; diff --git a/node_modules/bcrypt/test/sync.js b/node_modules/bcrypt/test/sync.js new file mode 100644 index 00000000..04998237 --- /dev/null +++ b/node_modules/bcrypt/test/sync.js @@ -0,0 +1,137 @@ +var bcrypt = require('../bcrypt'); + +module.exports = { + test_salt_length: function(assert) { + var salt = bcrypt.genSaltSync(10); + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }, + test_salt_no_params: function(assert) { + // same as test_verify_salt except using default rounds of 10 + var salt = bcrypt.genSaltSync(); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }, + test_salt_rounds_is_string_number: function(assert) { + assert.throws(function() {bcrypt.genSaltSync('10');}, "Should throw an Error. No params."); + assert.done(); + }, + test_salt_rounds_is_NaN: function(assert) { + assert.throws(function() {bcrypt.genSaltSync('b');}, "Should throw an Error. gen_salt requires rounds to be a number."); + assert.done(); + }, + test_salt_minor_a: function(assert) { + var salt = bcrypt.genSaltSync(10, 'a'); + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2a'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }, + test_salt_minor_b: function(assert) { + var salt = bcrypt.genSaltSync(10, 'b'); + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }, + test_hash: function(assert) { + assert.ok(bcrypt.hashSync('password', bcrypt.genSaltSync(10)), "Shouldn't throw an Error."); + assert.done(); + }, + test_hash_rounds: function(assert) { + var hash = bcrypt.hashSync('password', 8); + assert.strictEqual(bcrypt.getRounds(hash), 8, "Number of rounds should equal 8."); + assert.done(); + }, + test_hash_empty_string: function(assert) { + assert.ok(bcrypt.hashSync('', bcrypt.genSaltSync(10)), "Shouldn't throw an Error."); + assert.throws(function() {bcrypt.hashSync('password', '')}, "Should have thrown an Error related to the salt."); + assert.throws(function() {bcrypt.hashSync('', '')}, "Should have thrown an Error related to the salt."); + assert.done(); + }, + test_hash_pw_no_params: function(assert) { + assert.throws(function() {bcrypt.hashSync();}, "Should throw an Error. No Params."); + assert.done(); + }, + test_hash_pw_one_param: function(assert) { + assert.throws(function() {bcrypt.hashSync('password');}, "Should throw an Error. No salt."); + assert.done(); + }, + test_hash_pw_not_hash_str: function(assert) { + assert.throws(function() {bcrypt.hashSync('password', {});}, "Should throw an Error. hash should be a string or number."); + assert.done(); + }, + test_hash_salt_validity: function(assert) { + assert.expect(2); + assert.ok(bcrypt.hashSync('password', '$2a$10$somesaltyvaluertsetrse')); + assert.throws(function() { + bcrypt.hashSync('password', 'some$value'); + }); + assert.done(); + }, + test_verify_salt: function(assert) { + var salt = bcrypt.genSaltSync(10); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '10'); + assert.done(); + }, + test_verify_salt_min_rounds: function(assert) { + var salt = bcrypt.genSaltSync(1); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '04'); + assert.done(); + }, + test_verify_salt_max_rounds: function(assert) { + var salt = bcrypt.genSaltSync(100); + var split_salt = salt.split('$'); + assert.strictEqual(split_salt[1], '2b'); + assert.strictEqual(split_salt[2], '31'); + assert.done(); + }, + test_hash_compare: function(assert) { + var salt = bcrypt.genSaltSync(10); + assert.strictEqual(29, salt.length, "Salt isn't the correct length."); + var hash = bcrypt.hashSync("test", salt); + assert.ok(bcrypt.compareSync("test", hash), "These hashes should be equal."); + assert.ok(!(bcrypt.compareSync("blah", hash)), "These hashes should not be equal."); + assert.done(); + }, + test_hash_compare_empty_strings: function(assert) { + assert.ok(!(bcrypt.compareSync("", "password")), "These hashes should not be equal."); + assert.ok(!(bcrypt.compareSync("", "")), "These hashes should not be equal."); + assert.ok(!(bcrypt.compareSync("password", "")), "These hashes should not be equal."); + assert.done(); + }, + test_hash_compare_invalid_strings: function(assert) { + var fullString = 'envy1362987212538'; + var hash = '$2a$10$XOPbrlUPQdwdJUpSrIF6X.LbE14qsMmKGhM1A8W9iqaG3vv1BD7WC'; + var wut = ':'; + bcrypt.compareSync(fullString, hash, function(err, res) { + assert.ok(res); + }); + bcrypt.compareSync(fullString, wut, function(err, res) { + assert.ok(!res) + }); + assert.done(); + }, + test_getRounds: function(assert) { + var hash = bcrypt.hashSync("test", bcrypt.genSaltSync(9)); + assert.strictEqual(9, bcrypt.getRounds(hash), "getRounds can't extract rounds"); + assert.done(); + }, + test_getRounds: function(assert) { + var hash = bcrypt.hashSync("test", bcrypt.genSaltSync(9)); + assert.strictEqual(9, bcrypt.getRounds(hash), "getRounds can't extract rounds"); + assert.throws(function() {bcrypt.getRounds(''); }, "Must pass a valid hash to getRounds"); + assert.done(); + } +}; diff --git a/node_modules/bcrypt/test_alpine.sh b/node_modules/bcrypt/test_alpine.sh new file mode 100755 index 00000000..f23af5c8 --- /dev/null +++ b/node_modules/bcrypt/test_alpine.sh @@ -0,0 +1,12 @@ +#!/bin/sh + +set -xe + +echo "Running on $(node -v)" + +apk add make g++ python +npm test --unsafe-perm + +./node_modules/.bin/node-pre-gyp configure +./node_modules/.bin/node-pre-gyp build +./node_modules/.bin/node-pre-gyp package diff --git a/node_modules/binary-extensions/binary-extensions.json b/node_modules/binary-extensions/binary-extensions.json new file mode 100644 index 00000000..4aab3837 --- /dev/null +++ b/node_modules/binary-extensions/binary-extensions.json @@ -0,0 +1,260 @@ +[ + "3dm", + "3ds", + "3g2", + "3gp", + "7z", + "a", + "aac", + "adp", + "ai", + "aif", + "aiff", + "alz", + "ape", + "apk", + "appimage", + "ar", + "arj", + "asf", + "au", + "avi", + "bak", + "baml", + "bh", + "bin", + "bk", + "bmp", + "btif", + "bz2", + "bzip2", + "cab", + "caf", + "cgm", + "class", + "cmx", + "cpio", + "cr2", + "cur", + "dat", + "dcm", + "deb", + "dex", + "djvu", + "dll", + "dmg", + "dng", + "doc", + "docm", + "docx", + "dot", + "dotm", + "dra", + "DS_Store", + "dsk", + "dts", + "dtshd", + "dvb", + "dwg", + "dxf", + "ecelp4800", + "ecelp7470", + "ecelp9600", + "egg", + "eol", + "eot", + "epub", + "exe", + "f4v", + "fbs", + "fh", + "fla", + "flac", + "flatpak", + "fli", + "flv", + "fpx", + "fst", + "fvt", + "g3", + "gh", + "gif", + "graffle", + "gz", + "gzip", + "h261", + "h263", + "h264", + "icns", + "ico", + "ief", + "img", + "ipa", + "iso", + "jar", + "jpeg", + "jpg", + "jpgv", + "jpm", + "jxr", + "key", + "ktx", + "lha", + "lib", + "lvp", + "lz", + "lzh", + "lzma", + "lzo", + "m3u", + "m4a", + "m4v", + "mar", + "mdi", + "mht", + "mid", + "midi", + "mj2", + "mka", + "mkv", + "mmr", + "mng", + "mobi", + "mov", + "movie", + "mp3", + "mp4", + "mp4a", + "mpeg", + "mpg", + "mpga", + "mxu", + "nef", + "npx", + "numbers", + "nupkg", + "o", + "odp", + "ods", + "odt", + "oga", + "ogg", + "ogv", + "otf", + "ott", + "pages", + "pbm", + "pcx", + "pdb", + "pdf", + "pea", + "pgm", + "pic", + "png", + "pnm", + "pot", + "potm", + "potx", + "ppa", + "ppam", + "ppm", + "pps", + "ppsm", + "ppsx", + "ppt", + "pptm", + "pptx", + "psd", + "pya", + "pyc", + "pyo", + "pyv", + "qt", + "rar", + "ras", + "raw", + "resources", + "rgb", + "rip", + "rlc", + "rmf", + "rmvb", + "rpm", + "rtf", + "rz", + "s3m", + "s7z", + "scpt", + "sgi", + "shar", + "snap", + "sil", + "sketch", + "slk", + "smv", + "snk", + "so", + "stl", + "suo", + "sub", + "swf", + "tar", + "tbz", + "tbz2", + "tga", + "tgz", + "thmx", + "tif", + "tiff", + "tlz", + "ttc", + "ttf", + "txz", + "udf", + "uvh", + "uvi", + "uvm", + "uvp", + "uvs", + "uvu", + "viv", + "vob", + "war", + "wav", + "wax", + "wbmp", + "wdp", + "weba", + "webm", + "webp", + "whl", + "wim", + "wm", + "wma", + "wmv", + "wmx", + "woff", + "woff2", + "wrm", + "wvx", + "xbm", + "xif", + "xla", + "xlam", + "xls", + "xlsb", + "xlsm", + "xlsx", + "xlt", + "xltm", + "xltx", + "xm", + "xmind", + "xpi", + "xpm", + "xwd", + "xz", + "z", + "zip", + "zipx" +] diff --git a/node_modules/binary-extensions/binary-extensions.json.d.ts b/node_modules/binary-extensions/binary-extensions.json.d.ts new file mode 100644 index 00000000..94a248c2 --- /dev/null +++ b/node_modules/binary-extensions/binary-extensions.json.d.ts @@ -0,0 +1,3 @@ +declare const binaryExtensionsJson: readonly string[]; + +export = binaryExtensionsJson; diff --git a/node_modules/binary-extensions/index.d.ts b/node_modules/binary-extensions/index.d.ts new file mode 100644 index 00000000..f469ac5f --- /dev/null +++ b/node_modules/binary-extensions/index.d.ts @@ -0,0 +1,14 @@ +/** +List of binary file extensions. + +@example +``` +import binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` +*/ +declare const binaryExtensions: readonly string[]; + +export = binaryExtensions; diff --git a/node_modules/binary-extensions/index.js b/node_modules/binary-extensions/index.js new file mode 100644 index 00000000..d46e4688 --- /dev/null +++ b/node_modules/binary-extensions/index.js @@ -0,0 +1 @@ +module.exports = require('./binary-extensions.json'); diff --git a/node_modules/binary-extensions/license b/node_modules/binary-extensions/license new file mode 100644 index 00000000..401b1c73 --- /dev/null +++ b/node_modules/binary-extensions/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) 2019 Sindre Sorhus (https://sindresorhus.com), Paul Miller (https://paulmillr.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/binary-extensions/package.json b/node_modules/binary-extensions/package.json new file mode 100644 index 00000000..a97d3ebc --- /dev/null +++ b/node_modules/binary-extensions/package.json @@ -0,0 +1,70 @@ +{ + "_from": "binary-extensions@^2.0.0", + "_id": "binary-extensions@2.2.0", + "_inBundle": false, + "_integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", + "_location": "/binary-extensions", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "binary-extensions@^2.0.0", + "name": "binary-extensions", + "escapedName": "binary-extensions", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/is-binary-path" + ], + "_resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", + "_shasum": "75f502eeaf9ffde42fc98829645be4ea76bd9e2d", + "_spec": "binary-extensions@^2.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/is-binary-path", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/binary-extensions/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "List of binary file extensions", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts", + "binary-extensions.json", + "binary-extensions.json.d.ts" + ], + "homepage": "https://github.com/sindresorhus/binary-extensions#readme", + "keywords": [ + "binary", + "extensions", + "extension", + "file", + "json", + "list", + "array" + ], + "license": "MIT", + "name": "binary-extensions", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/binary-extensions.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "2.2.0" +} diff --git a/node_modules/binary-extensions/readme.md b/node_modules/binary-extensions/readme.md new file mode 100644 index 00000000..3e25dd83 --- /dev/null +++ b/node_modules/binary-extensions/readme.md @@ -0,0 +1,41 @@ +# binary-extensions + +> List of binary file extensions + +The list is just a [JSON file](binary-extensions.json) and can be used anywhere. + + +## Install + +``` +$ npm install binary-extensions +``` + + +## Usage + +```js +const binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` + + +## Related + +- [is-binary-path](https://github.com/sindresorhus/is-binary-path) - Check if a filepath is a binary file +- [text-extensions](https://github.com/sindresorhus/text-extensions) - List of text file extensions + + +--- + +

diff --git a/node_modules/body-parser/HISTORY.md b/node_modules/body-parser/HISTORY.md new file mode 100644 index 00000000..a1d3fbfb --- /dev/null +++ b/node_modules/body-parser/HISTORY.md @@ -0,0 +1,609 @@ +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/node_modules/body-parser/LICENSE b/node_modules/body-parser/LICENSE new file mode 100644 index 00000000..386b7b69 --- /dev/null +++ b/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/body-parser/README.md b/node_modules/body-parser/README.md new file mode 100644 index 00000000..aba6297a --- /dev/null +++ b/node_modules/body-parser/README.md @@ -0,0 +1,443 @@ +# body-parser + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + + + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +## Errors + +The middlewares provided by this module create errors depending on the error +condition during parsing. The errors will typically have a `status`/`statusCode` +property that contains the suggested HTTP response code, an `expose` property +to determine if the `message` property should be displayed to the client, a +`type` property to determine the type of error without matching against the +`message`, and a `body` property containing the read body, if available. + +The following are the common errors emitted, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/body-parser.svg +[npm-url]: https://npmjs.org/package/body-parser +[travis-image]: https://img.shields.io/travis/expressjs/body-parser/master.svg +[travis-url]: https://travis-ci.org/expressjs/body-parser +[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg +[downloads-url]: https://npmjs.org/package/body-parser diff --git a/node_modules/body-parser/index.js b/node_modules/body-parser/index.js new file mode 100644 index 00000000..93c3a1ff --- /dev/null +++ b/node_modules/body-parser/index.js @@ -0,0 +1,157 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + var opts = {} + + // exclude type option + if (options) { + for (var prop in options) { + if (prop !== 'type') { + opts[prop] = options[prop] + } + } + } + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/node_modules/body-parser/lib/read.js b/node_modules/body-parser/lib/read.js new file mode 100644 index 00000000..c1026095 --- /dev/null +++ b/node_modules/body-parser/lib/read.js @@ -0,0 +1,181 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // read off entire request + stream.resume() + onFinished(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} diff --git a/node_modules/body-parser/lib/types/json.js b/node_modules/body-parser/lib/types/json.js new file mode 100644 index 00000000..2971dc14 --- /dev/null +++ b/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,230 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*(.)/ // eslint-disable-line no-control-regex + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.substr(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = str.substring(0, index) + '#' + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace('#', char), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + return FIRST_CHAR_REGEXP.exec(str)[1] +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/raw.js b/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 00000000..f5d1b674 --- /dev/null +++ b/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/text.js b/node_modules/body-parser/lib/types/text.js new file mode 100644 index 00000000..083a0090 --- /dev/null +++ b/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/urlencoded.js b/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 00000000..b2ca8f16 --- /dev/null +++ b/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,284 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: Infinity, + parameterLimit: parameterLimit + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/package.json b/node_modules/body-parser/package.json new file mode 100644 index 00000000..739738fb --- /dev/null +++ b/node_modules/body-parser/package.json @@ -0,0 +1,91 @@ +{ + "_from": "body-parser@1.19.0", + "_id": "body-parser@1.19.0", + "_inBundle": false, + "_integrity": "sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw==", + "_location": "/body-parser", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "body-parser@1.19.0", + "name": "body-parser", + "escapedName": "body-parser", + "rawSpec": "1.19.0", + "saveSpec": null, + "fetchSpec": "1.19.0" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.0.tgz", + "_shasum": "96b2709e57c9c4e09a6fd66a8fd979844f69f08a", + "_spec": "body-parser@1.19.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/express", + "bugs": { + "url": "https://github.com/expressjs/body-parser/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "bytes": "3.1.0", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "~1.1.2", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "on-finished": "~2.3.0", + "qs": "6.7.0", + "raw-body": "2.4.0", + "type-is": "~1.6.17" + }, + "deprecated": false, + "description": "Node.js body parsing middleware", + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "methods": "1.1.2", + "mocha": "6.1.4", + "safe-buffer": "5.1.2", + "supertest": "4.0.2" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/expressjs/body-parser#readme", + "license": "MIT", + "name": "body-parser", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/body-parser.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/" + }, + "version": "1.19.0" +} diff --git a/node_modules/boxen/index.d.ts b/node_modules/boxen/index.d.ts new file mode 100644 index 00000000..60c13100 --- /dev/null +++ b/node_modules/boxen/index.d.ts @@ -0,0 +1,175 @@ +import {LiteralUnion} from 'type-fest'; +import cliBoxes, {BoxStyle} from 'cli-boxes'; + +declare namespace boxen { + /** + Characters used for custom border. + + @example + ``` + // affffb + // e e + // dffffc + + const border: CustomBorderStyle = { + topLeft: 'a', + topRight: 'b', + bottomRight: 'c', + bottomLeft: 'd', + vertical: 'e', + horizontal: 'f' + }; + ``` + */ + interface CustomBorderStyle extends BoxStyle {} + + /** + Spacing used for `padding` and `margin`. + */ + interface Spacing { + readonly top: number; + readonly right: number; + readonly bottom: number; + readonly left: number; + } + + interface Options { + /** + Color of the box border. + */ + readonly borderColor?: LiteralUnion< + | 'black' + | 'red' + | 'green' + | 'yellow' + | 'blue' + | 'magenta' + | 'cyan' + | 'white' + | 'gray' + | 'grey' + | 'blackBright' + | 'redBright' + | 'greenBright' + | 'yellowBright' + | 'blueBright' + | 'magentaBright' + | 'cyanBright' + | 'whiteBright', + string + >; + + /** + Style of the box border. + + @default BorderStyle.Single + */ + readonly borderStyle?: BorderStyle | CustomBorderStyle; + + /** + Reduce opacity of the border. + + @default false + */ + readonly dimBorder?: boolean; + + /** + Space between the text and box border. + + @default 0 + */ + readonly padding?: number | Spacing; + + /** + Space around the box. + + @default 0 + */ + readonly margin?: number | Spacing; + + /** + Float the box on the available terminal screen space. + + @default 'left' + */ + readonly float?: 'left' | 'right' | 'center'; + + /** + Color of the background. + */ + readonly backgroundColor?: LiteralUnion< + | 'black' + | 'red' + | 'green' + | 'yellow' + | 'blue' + | 'magenta' + | 'cyan' + | 'white' + | 'blackBright' + | 'redBright' + | 'greenBright' + | 'yellowBright' + | 'blueBright' + | 'magentaBright' + | 'cyanBright' + | 'whiteBright', + string + >; + + /** + Align the text in the box based on the widest line. + + @default 'left' + */ + readonly align?: 'left' | 'right' | 'center'; + } +} + +declare const enum BorderStyle { + Single = 'single', + Double = 'double', + Round = 'round', + Bold = 'bold', + SingleDouble = 'singleDouble', + DoubleSingle = 'doubleSingle', + Classic = 'classic' +} + +declare const boxen: { + /** + Creates a box in the terminal. + + @param text - The text inside the box. + @returns The box. + + @example + ``` + import boxen = require('boxen'); + + console.log(boxen('unicorn', {padding: 1})); + // ┌─────────────┐ + // │ │ + // │ unicorn │ + // │ │ + // └─────────────┘ + + console.log(boxen('unicorn', {padding: 1, margin: 1, borderStyle: 'double'})); + // + // ╔═════════════╗ + // ║ ║ + // ║ unicorn ║ + // ║ ║ + // ╚═════════════╝ + // + ``` + */ + (text: string, options?: boxen.Options): string; + + /** + Border styles from [`cli-boxes`](https://github.com/sindresorhus/cli-boxes). + */ + BorderStyle: typeof BorderStyle; +}; + +export = boxen; diff --git a/node_modules/boxen/index.js b/node_modules/boxen/index.js new file mode 100644 index 00000000..a54524cf --- /dev/null +++ b/node_modules/boxen/index.js @@ -0,0 +1,139 @@ +'use strict'; +const stringWidth = require('string-width'); +const chalk = require('chalk'); +const widestLine = require('widest-line'); +const cliBoxes = require('cli-boxes'); +const camelCase = require('camelcase'); +const ansiAlign = require('ansi-align'); +const termSize = require('term-size'); + +const getObject = detail => { + let object; + + if (typeof detail === 'number') { + object = { + top: detail, + right: detail * 3, + bottom: detail, + left: detail * 3 + }; + } else { + object = { + top: 0, + right: 0, + bottom: 0, + left: 0, + ...detail + }; + } + + return object; +}; + +const getBorderChars = borderStyle => { + const sides = [ + 'topLeft', + 'topRight', + 'bottomRight', + 'bottomLeft', + 'vertical', + 'horizontal' + ]; + + let chararacters; + + if (typeof borderStyle === 'string') { + chararacters = cliBoxes[borderStyle]; + + if (!chararacters) { + throw new TypeError(`Invalid border style: ${borderStyle}`); + } + } else { + for (const side of sides) { + if (!borderStyle[side] || typeof borderStyle[side] !== 'string') { + throw new TypeError(`Invalid border style: ${side}`); + } + } + + chararacters = borderStyle; + } + + return chararacters; +}; + +const isHex = color => color.match(/^#[0-f]{3}(?:[0-f]{3})?$/i); +const isColorValid = color => typeof color === 'string' && ((chalk[color]) || isHex(color)); +const getColorFn = color => isHex(color) ? chalk.hex(color) : chalk[color]; +const getBGColorFn = color => isHex(color) ? chalk.bgHex(color) : chalk[camelCase(['bg', color])]; + +module.exports = (text, options) => { + options = { + padding: 0, + borderStyle: 'single', + dimBorder: false, + align: 'left', + float: 'left', + ...options + }; + + if (options.borderColor && !isColorValid(options.borderColor)) { + throw new Error(`${options.borderColor} is not a valid borderColor`); + } + + if (options.backgroundColor && !isColorValid(options.backgroundColor)) { + throw new Error(`${options.backgroundColor} is not a valid backgroundColor`); + } + + const chars = getBorderChars(options.borderStyle); + const padding = getObject(options.padding); + const margin = getObject(options.margin); + + const colorizeBorder = border => { + const newBorder = options.borderColor ? getColorFn(options.borderColor)(border) : border; + return options.dimBorder ? chalk.dim(newBorder) : newBorder; + }; + + const colorizeContent = content => options.backgroundColor ? getBGColorFn(options.backgroundColor)(content) : content; + + text = ansiAlign(text, {align: options.align}); + + const NL = '\n'; + const PAD = ' '; + + let lines = text.split(NL); + + if (padding.top > 0) { + lines = new Array(padding.top).fill('').concat(lines); + } + + if (padding.bottom > 0) { + lines = lines.concat(new Array(padding.bottom).fill('')); + } + + const contentWidth = widestLine(text) + padding.left + padding.right; + const paddingLeft = PAD.repeat(padding.left); + const {columns} = termSize(); + let marginLeft = PAD.repeat(margin.left); + + if (options.float === 'center') { + const padWidth = Math.max((columns - contentWidth) / 2, 0); + marginLeft = PAD.repeat(padWidth); + } else if (options.float === 'right') { + const padWidth = Math.max(columns - contentWidth - margin.right - 2, 0); + marginLeft = PAD.repeat(padWidth); + } + + const horizontal = chars.horizontal.repeat(contentWidth); + const top = colorizeBorder(NL.repeat(margin.top) + marginLeft + chars.topLeft + horizontal + chars.topRight); + const bottom = colorizeBorder(marginLeft + chars.bottomLeft + horizontal + chars.bottomRight + NL.repeat(margin.bottom)); + const side = colorizeBorder(chars.vertical); + + const middle = lines.map(line => { + const paddingRight = PAD.repeat(contentWidth - stringWidth(line) - padding.left); + return marginLeft + side + colorizeContent(paddingLeft + line + paddingRight) + side; + }).join(NL); + + return top + NL + middle + NL + bottom; +}; + +module.exports._borderStyles = cliBoxes; diff --git a/node_modules/boxen/license b/node_modules/boxen/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/boxen/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/boxen/package.json b/node_modules/boxen/package.json new file mode 100644 index 00000000..7425d17a --- /dev/null +++ b/node_modules/boxen/package.json @@ -0,0 +1,83 @@ +{ + "_from": "boxen@^4.2.0", + "_id": "boxen@4.2.0", + "_inBundle": false, + "_integrity": "sha512-eB4uT9RGzg2odpER62bBwSLvUeGC+WbRjjyyFhGsKnc8wp/m0+hQsMUvUe3H2V0D5vw0nBdO1hCJoZo5mKeuIQ==", + "_location": "/boxen", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "boxen@^4.2.0", + "name": "boxen", + "escapedName": "boxen", + "rawSpec": "^4.2.0", + "saveSpec": null, + "fetchSpec": "^4.2.0" + }, + "_requiredBy": [ + "/update-notifier" + ], + "_resolved": "https://registry.npmjs.org/boxen/-/boxen-4.2.0.tgz", + "_shasum": "e411b62357d6d6d36587c8ac3d5d974daa070e64", + "_spec": "boxen@^4.2.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/update-notifier", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/boxen/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-align": "^3.0.0", + "camelcase": "^5.3.1", + "chalk": "^3.0.0", + "cli-boxes": "^2.2.0", + "string-width": "^4.1.0", + "term-size": "^2.1.0", + "type-fest": "^0.8.1", + "widest-line": "^3.1.0" + }, + "deprecated": false, + "description": "Create boxes in the terminal", + "devDependencies": { + "ava": "^2.1.0", + "nyc": "^14.1.1", + "tsd": "^0.11.0", + "xo": "^0.25.3" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "funding": "https://github.com/sponsors/sindresorhus", + "homepage": "https://github.com/sindresorhus/boxen#readme", + "keywords": [ + "cli", + "box", + "boxes", + "terminal", + "term", + "console", + "ascii", + "unicode", + "border", + "text" + ], + "license": "MIT", + "name": "boxen", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/boxen.git" + }, + "scripts": { + "test": "xo && nyc ava && tsd" + }, + "version": "4.2.0" +} diff --git a/node_modules/boxen/readme.md b/node_modules/boxen/readme.md new file mode 100644 index 00000000..dbfbd5ae --- /dev/null +++ b/node_modules/boxen/readme.md @@ -0,0 +1,187 @@ +# boxen [![Build Status](https://travis-ci.org/sindresorhus/boxen.svg?branch=master)](https://travis-ci.org/sindresorhus/boxen) + +> Create boxes in the terminal + +![](screenshot.png) + +## Install + +``` +$ npm install boxen +``` + +## Usage + +```js +const boxen = require('boxen'); + +console.log(boxen('unicorn', {padding: 1})); +/* +┌─────────────┐ +│ │ +│ unicorn │ +│ │ +└─────────────┘ +*/ + +console.log(boxen('unicorn', {padding: 1, margin: 1, borderStyle: 'double'})); +/* + + ╔═════════════╗ + ║ ║ + ║ unicorn ║ + ║ ║ + ╚═════════════╝ + +*/ +``` + +## API + +### boxen(text, options?) + +#### text + +Type: `string` + +Text inside the box. + +#### options + +Type: `object` + +##### borderColor + +Type: `string`\ +Values: `'black'` `'red'` `'green'` `'yellow'` `'blue'` `'magenta'` `'cyan'` `'white'` `'gray'` or a hex value like `'#ff0000'` + +Color of the box border. + +##### borderStyle + +Type: `string | object`\ +Default: `'single'`\ +Values: +- `'single'` +``` +┌───┐ +│foo│ +└───┘ +``` +- `'double'` +``` +╔═══╗ +║foo║ +╚═══╝ +``` +- `'round'` (`'single'` sides with round corners) +``` +╭───╮ +│foo│ +╰───╯ +``` +- `'bold'` +``` +┏━━━┓ +┃foo┃ +┗━━━┛ +``` +- `'singleDouble'` (`'single'` on top and bottom, `'double'` on right and left) +``` +╓───╖ +║foo║ +╙───╜ +``` +- `'doubleSingle'` (`'double'` on top and bottom, `'single'` on right and left) +``` +╒═══╕ +│foo│ +╘═══╛ +``` +- `'classic'` +``` ++---+ +|foo| ++---+ +``` + +Style of the box border. + +Can be any of the above predefined styles or an object with the following keys: + +```js +{ + topLeft: '+', + topRight: '+', + bottomLeft: '+', + bottomRight: '+', + horizontal: '-', + vertical: '|' +} +``` + +##### dimBorder + +Type: `boolean`\ +Default: `false` + +Reduce opacity of the border. + +##### padding + +Type: `number | object`\ +Default: `0` + +Space between the text and box border. + +Accepts a number or an object with any of the `top`, `right`, `bottom`, `left` properties. When a number is specified, the left/right padding is 3 times the top/bottom to make it look nice. + +##### margin + +Type: `number | object`\ +Default: `0` + +Space around the box. + +Accepts a number or an object with any of the `top`, `right`, `bottom`, `left` properties. When a number is specified, the left/right margin is 3 times the top/bottom to make it look nice. + +##### float + +Type: `string`\ +Default: `'left'`\ +Values: `'right'` `'center'` `'left'` + +Float the box on the available terminal screen space. + +##### backgroundColor + +Type: `string`\ +Values: `'black'` `'red'` `'green'` `'yellow'` `'blue'` `'magenta'` `'cyan'` `'white'` `'gray'` or a hex value like `'#ff0000'` + +Color of the background. + +##### align + +Type: `string`\ +Default: `'left'`\ +Values: `'left'` `'center'` `'right'` + +Align the text in the box based on the widest line. + +## Related + +- [boxen-cli](https://github.com/sindresorhus/boxen-cli) - CLI for this module +- [cli-boxes](https://github.com/sindresorhus/cli-boxes) - Boxes for use in the terminal +- [ink-box](https://github.com/sindresorhus/ink-box) - Box component for Ink that uses this package + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
diff --git a/node_modules/brace-expansion/LICENSE b/node_modules/brace-expansion/LICENSE new file mode 100644 index 00000000..de322667 --- /dev/null +++ b/node_modules/brace-expansion/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2013 Julian Gruber + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/brace-expansion/README.md b/node_modules/brace-expansion/README.md new file mode 100644 index 00000000..6b4e0e16 --- /dev/null +++ b/node_modules/brace-expansion/README.md @@ -0,0 +1,129 @@ +# brace-expansion + +[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html), +as known from sh/bash, in JavaScript. + +[![build status](https://secure.travis-ci.org/juliangruber/brace-expansion.svg)](http://travis-ci.org/juliangruber/brace-expansion) +[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion) +[![Greenkeeper badge](https://badges.greenkeeper.io/juliangruber/brace-expansion.svg)](https://greenkeeper.io/) + +[![testling badge](https://ci.testling.com/juliangruber/brace-expansion.png)](https://ci.testling.com/juliangruber/brace-expansion) + +## Example + +```js +var expand = require('brace-expansion'); + +expand('file-{a,b,c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('-v{,,}') +// => ['-v', '-v', '-v'] + +expand('file{0..2}.jpg') +// => ['file0.jpg', 'file1.jpg', 'file2.jpg'] + +expand('file-{a..c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('file{2..0}.jpg') +// => ['file2.jpg', 'file1.jpg', 'file0.jpg'] + +expand('file{0..4..2}.jpg') +// => ['file0.jpg', 'file2.jpg', 'file4.jpg'] + +expand('file-{a..e..2}.jpg') +// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg'] + +expand('file{00..10..5}.jpg') +// => ['file00.jpg', 'file05.jpg', 'file10.jpg'] + +expand('{{A..C},{a..c}}') +// => ['A', 'B', 'C', 'a', 'b', 'c'] + +expand('ppp{,config,oe{,conf}}') +// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf'] +``` + +## API + +```js +var expand = require('brace-expansion'); +``` + +### var expanded = expand(str) + +Return an array of all possible and valid expansions of `str`. If none are +found, `[str]` is returned. + +Valid expansions are: + +```js +/^(.*,)+(.+)?$/ +// {a,b,...} +``` + +A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +A numeric sequence from `x` to `y` inclusive, with optional increment. +If `x` or `y` start with a leading `0`, all the numbers will be padded +to have equal length. Negative numbers and backwards iteration work too. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +An alphabetic sequence from `x` to `y` inclusive, with optional increment. +`x` and `y` must be exactly one character, and if given, `incr` must be a +number. + +For compatibility reasons, the string `${` is not eligible for brace expansion. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install brace-expansion +``` + +## Contributors + +- [Julian Gruber](https://github.com/juliangruber) +- [Isaac Z. Schlueter](https://github.com/isaacs) + +## Sponsors + +This module is proudly supported by my [Sponsors](https://github.com/juliangruber/sponsors)! + +Do you want to support modules like this to improve their quality, stability and weigh in on new features? Then please consider donating to my [Patreon](https://www.patreon.com/juliangruber). Not sure how much of my modules you're using? Try [feross/thanks](https://github.com/feross/thanks)! + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/brace-expansion/index.js b/node_modules/brace-expansion/index.js new file mode 100644 index 00000000..0478be81 --- /dev/null +++ b/node_modules/brace-expansion/index.js @@ -0,0 +1,201 @@ +var concatMap = require('concat-map'); +var balanced = require('balanced-match'); + +module.exports = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + // I don't know why Bash 4.3 does this, but it does. + // Anything starting with {} will have the first two bytes preserved + // but *only* at the top level, so {},a}b will not expand to anything, + // but a{},b}c will be expanded to [a}c,abc]. + // One could argue that this is a bug in Bash, but since the goal of + // this module is to match Bash's rules, we escape a leading {} + if (str.substr(0, 2) === '{}') { + str = '\\{\\}' + str.substr(2); + } + + return expand(escapeBraces(str), true).map(unescapeBraces); +} + +function identity(e) { + return e; +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = m.body.indexOf(',') >= 0; + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*\}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length) + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} + diff --git a/node_modules/brace-expansion/package.json b/node_modules/brace-expansion/package.json new file mode 100644 index 00000000..0424f1c1 --- /dev/null +++ b/node_modules/brace-expansion/package.json @@ -0,0 +1,75 @@ +{ + "_from": "brace-expansion@^1.1.7", + "_id": "brace-expansion@1.1.11", + "_inBundle": false, + "_integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "_location": "/brace-expansion", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "brace-expansion@^1.1.7", + "name": "brace-expansion", + "escapedName": "brace-expansion", + "rawSpec": "^1.1.7", + "saveSpec": null, + "fetchSpec": "^1.1.7" + }, + "_requiredBy": [ + "/minimatch" + ], + "_resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "_shasum": "3c7fcbf529d87226f3d2f52b966ff5271eb441dd", + "_spec": "brace-expansion@^1.1.7", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/minimatch", + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/brace-expansion/issues" + }, + "bundleDependencies": false, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + }, + "deprecated": false, + "description": "Brace expansion as known from sh/bash", + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "homepage": "https://github.com/juliangruber/brace-expansion", + "keywords": [], + "license": "MIT", + "main": "index.js", + "name": "brace-expansion", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" + }, + "scripts": { + "bench": "matcha test/perf/bench.js", + "gentest": "bash test/generate.sh", + "test": "tape test/*.js" + }, + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + }, + "version": "1.1.11" +} diff --git a/node_modules/braces/CHANGELOG.md b/node_modules/braces/CHANGELOG.md new file mode 100644 index 00000000..36f798b0 --- /dev/null +++ b/node_modules/braces/CHANGELOG.md @@ -0,0 +1,184 @@ +# Release history + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html). + +
+ Guiding Principles + +- Changelogs are for humans, not machines. +- There should be an entry for every single version. +- The same types of changes should be grouped. +- Versions and sections should be linkable. +- The latest version comes first. +- The release date of each versions is displayed. +- Mention whether you follow Semantic Versioning. + +
+ +
+ Types of changes + +Changelog entries are classified using the following labels _(from [keep-a-changelog](http://keepachangelog.com/)_): + +- `Added` for new features. +- `Changed` for changes in existing functionality. +- `Deprecated` for soon-to-be removed features. +- `Removed` for now removed features. +- `Fixed` for any bug fixes. +- `Security` in case of vulnerabilities. + +
+ +## [3.0.0] - 2018-04-08 + +v3.0 is a complete refactor, resulting in a faster, smaller codebase, with fewer deps, and a more accurate parser and compiler. + +**Breaking Changes** + +- The undocumented `.makeRe` method was removed + +**Non-breaking changes** + +- Caching was removed + +## [2.3.2] - 2018-04-08 + +- start refactoring +- cover sets +- better range handling + +## [2.3.1] - 2018-02-17 + +- Remove unnecessary escape in Regex. (#14) + +## [2.3.0] - 2017-10-19 + +- minor code reorganization +- optimize regex +- expose `maxLength` option + +## [2.2.1] - 2017-05-30 + +- don't condense when braces contain extglobs + +## [2.2.0] - 2017-05-28 + +- ensure word boundaries are preserved +- fixes edge case where extglob characters precede a brace pattern + +## [2.1.1] - 2017-04-27 + +- use snapdragon-node +- handle edge case +- optimizations, lint + +## [2.0.4] - 2017-04-11 + +- pass opts to compiler +- minor optimization in create method +- re-write parser handlers to remove negation regex + +## [2.0.3] - 2016-12-10 + +- use split-string +- clear queue at the end +- adds sequences example +- add unit tests + +## [2.0.2] - 2016-10-21 + +- fix comma handling in nested extglobs + +## [2.0.1] - 2016-10-20 + +- add comments +- more tests, ensure quotes are stripped + +## [2.0.0] - 2016-10-19 + +- don't expand braces inside character classes +- add quantifier pattern + +## [1.8.5] - 2016-05-21 + +- Refactor (#10) + +## [1.8.4] - 2016-04-20 + +- fixes https://github.com/jonschlinkert/micromatch/issues/66 + +## [1.8.0] - 2015-03-18 + +- adds exponent examples, tests +- fixes the first example in https://github.com/jonschlinkert/micromatch/issues/38 + +## [1.6.0] - 2015-01-30 + +- optimizations, `bash` mode: +- improve path escaping + +## [1.5.0] - 2015-01-28 + +- Merge pull request #5 from eush77/lib-files + +## [1.4.0] - 2015-01-24 + +- add extglob tests +- externalize exponent function +- better whitespace handling + +## [1.3.0] - 2015-01-24 + +- make regex patterns explicity + +## [1.1.0] - 2015-01-11 + +- don't create a match group with `makeRe` + +## [1.0.0] - 2014-12-23 + +- Merge commit '97b05f5544f8348736a8efaecf5c32bbe3e2ad6e' +- support empty brace syntax +- better bash coverage +- better support for regex strings + +## [0.1.4] - 2014-11-14 + +- improve recognition of bad args, recognize mismatched argument types +- support escaping +- remove pathname-expansion +- support whitespace in patterns + +## [0.1.0] + +- first commit + +[2.3.2]: https://github.com/micromatch/braces/compare/2.3.1...2.3.2 +[2.3.1]: https://github.com/micromatch/braces/compare/2.3.0...2.3.1 +[2.3.0]: https://github.com/micromatch/braces/compare/2.2.1...2.3.0 +[2.2.1]: https://github.com/micromatch/braces/compare/2.2.0...2.2.1 +[2.2.0]: https://github.com/micromatch/braces/compare/2.1.1...2.2.0 +[2.1.1]: https://github.com/micromatch/braces/compare/2.1.0...2.1.1 +[2.1.0]: https://github.com/micromatch/braces/compare/2.0.4...2.1.0 +[2.0.4]: https://github.com/micromatch/braces/compare/2.0.3...2.0.4 +[2.0.3]: https://github.com/micromatch/braces/compare/2.0.2...2.0.3 +[2.0.2]: https://github.com/micromatch/braces/compare/2.0.1...2.0.2 +[2.0.1]: https://github.com/micromatch/braces/compare/2.0.0...2.0.1 +[2.0.0]: https://github.com/micromatch/braces/compare/1.8.5...2.0.0 +[1.8.5]: https://github.com/micromatch/braces/compare/1.8.4...1.8.5 +[1.8.4]: https://github.com/micromatch/braces/compare/1.8.0...1.8.4 +[1.8.0]: https://github.com/micromatch/braces/compare/1.6.0...1.8.0 +[1.6.0]: https://github.com/micromatch/braces/compare/1.5.0...1.6.0 +[1.5.0]: https://github.com/micromatch/braces/compare/1.4.0...1.5.0 +[1.4.0]: https://github.com/micromatch/braces/compare/1.3.0...1.4.0 +[1.3.0]: https://github.com/micromatch/braces/compare/1.2.0...1.3.0 +[1.2.0]: https://github.com/micromatch/braces/compare/1.1.0...1.2.0 +[1.1.0]: https://github.com/micromatch/braces/compare/1.0.0...1.1.0 +[1.0.0]: https://github.com/micromatch/braces/compare/0.1.4...1.0.0 +[0.1.4]: https://github.com/micromatch/braces/compare/0.1.0...0.1.4 + +[Unreleased]: https://github.com/micromatch/braces/compare/0.1.0...HEAD +[keep-a-changelog]: https://github.com/olivierlacan/keep-a-changelog \ No newline at end of file diff --git a/node_modules/braces/LICENSE b/node_modules/braces/LICENSE new file mode 100644 index 00000000..d32ab442 --- /dev/null +++ b/node_modules/braces/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014-2018, Jon Schlinkert. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/braces/README.md b/node_modules/braces/README.md new file mode 100644 index 00000000..cba2f600 --- /dev/null +++ b/node_modules/braces/README.md @@ -0,0 +1,593 @@ +# braces [![Donate](https://img.shields.io/badge/Donate-PayPal-green.svg)](https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=W8YFZ425KND68) [![NPM version](https://img.shields.io/npm/v/braces.svg?style=flat)](https://www.npmjs.com/package/braces) [![NPM monthly downloads](https://img.shields.io/npm/dm/braces.svg?style=flat)](https://npmjs.org/package/braces) [![NPM total downloads](https://img.shields.io/npm/dt/braces.svg?style=flat)](https://npmjs.org/package/braces) [![Linux Build Status](https://img.shields.io/travis/micromatch/braces.svg?style=flat&label=Travis)](https://travis-ci.org/micromatch/braces) + +> Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed. + +Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support. + +## Install + +Install with [npm](https://www.npmjs.com/): + +```sh +$ npm install --save braces +``` + +## v3.0.0 Released!! + +See the [changelog](CHANGELOG.md) for details. + +## Why use braces? + +Brace patterns make globs more powerful by adding the ability to match specific ranges and sequences of characters. + +* **Accurate** - complete support for the [Bash 4.3 Brace Expansion](www.gnu.org/software/bash/) specification (passes all of the Bash braces tests) +* **[fast and performant](#benchmarks)** - Starts fast, runs fast and [scales well](#performance) as patterns increase in complexity. +* **Organized code base** - The parser and compiler are easy to maintain and update when edge cases crop up. +* **Well-tested** - Thousands of test assertions, and passes all of the Bash, minimatch, and [brace-expansion](https://github.com/juliangruber/brace-expansion) unit tests (as of the date this was written). +* **Safer** - You shouldn't have to worry about users defining aggressive or malicious brace patterns that can break your application. Braces takes measures to prevent malicious regex that can be used for DDoS attacks (see [catastrophic backtracking](https://www.regular-expressions.info/catastrophic.html)). +* [Supports lists](#lists) - (aka "sets") `a/{b,c}/d` => `['a/b/d', 'a/c/d']` +* [Supports sequences](#sequences) - (aka "ranges") `{01..03}` => `['01', '02', '03']` +* [Supports steps](#steps) - (aka "increments") `{2..10..2}` => `['2', '4', '6', '8', '10']` +* [Supports escaping](#escaping) - To prevent evaluation of special characters. + +## Usage + +The main export is a function that takes one or more brace `patterns` and `options`. + +```js +const braces = require('braces'); +// braces(patterns[, options]); + +console.log(braces(['{01..05}', '{a..e}'])); +//=> ['(0[1-5])', '([a-e])'] + +console.log(braces(['{01..05}', '{a..e}'], { expand: true })); +//=> ['01', '02', '03', '04', '05', 'a', 'b', 'c', 'd', 'e'] +``` + +### Brace Expansion vs. Compilation + +By default, brace patterns are compiled into strings that are optimized for creating regular expressions and matching. + +**Compiled** + +```js +console.log(braces('a/{x,y,z}/b')); +//=> ['a/(x|y|z)/b'] +console.log(braces(['a/{01..20}/b', 'a/{1..5}/b'])); +//=> [ 'a/(0[1-9]|1[0-9]|20)/b', 'a/([1-5])/b' ] +``` + +**Expanded** + +Enable brace expansion by setting the `expand` option to true, or by using [braces.expand()](#expand) (returns an array similar to what you'd expect from Bash, or `echo {1..5}`, or [minimatch](https://github.com/isaacs/minimatch)): + +```js +console.log(braces('a/{x,y,z}/b', { expand: true })); +//=> ['a/x/b', 'a/y/b', 'a/z/b'] + +console.log(braces.expand('{01..10}')); +//=> ['01','02','03','04','05','06','07','08','09','10'] +``` + +### Lists + +Expand lists (like Bash "sets"): + +```js +console.log(braces('a/{foo,bar,baz}/*.js')); +//=> ['a/(foo|bar|baz)/*.js'] + +console.log(braces.expand('a/{foo,bar,baz}/*.js')); +//=> ['a/foo/*.js', 'a/bar/*.js', 'a/baz/*.js'] +``` + +### Sequences + +Expand ranges of characters (like Bash "sequences"): + +```js +console.log(braces.expand('{1..3}')); // ['1', '2', '3'] +console.log(braces.expand('a/{1..3}/b')); // ['a/1/b', 'a/2/b', 'a/3/b'] +console.log(braces('{a..c}', { expand: true })); // ['a', 'b', 'c'] +console.log(braces('foo/{a..c}', { expand: true })); // ['foo/a', 'foo/b', 'foo/c'] + +// supports zero-padded ranges +console.log(braces('a/{01..03}/b')); //=> ['a/(0[1-3])/b'] +console.log(braces('a/{001..300}/b')); //=> ['a/(0{2}[1-9]|0[1-9][0-9]|[12][0-9]{2}|300)/b'] +``` + +See [fill-range](https://github.com/jonschlinkert/fill-range) for all available range-expansion options. + +### Steppped ranges + +Steps, or increments, may be used with ranges: + +```js +console.log(braces.expand('{2..10..2}')); +//=> ['2', '4', '6', '8', '10'] + +console.log(braces('{2..10..2}')); +//=> ['(2|4|6|8|10)'] +``` + +When the [.optimize](#optimize) method is used, or [options.optimize](#optionsoptimize) is set to true, sequences are passed to [to-regex-range](https://github.com/jonschlinkert/to-regex-range) for expansion. + +### Nesting + +Brace patterns may be nested. The results of each expanded string are not sorted, and left to right order is preserved. + +**"Expanded" braces** + +```js +console.log(braces.expand('a{b,c,/{x,y}}/e')); +//=> ['ab/e', 'ac/e', 'a/x/e', 'a/y/e'] + +console.log(braces.expand('a/{x,{1..5},y}/c')); +//=> ['a/x/c', 'a/1/c', 'a/2/c', 'a/3/c', 'a/4/c', 'a/5/c', 'a/y/c'] +``` + +**"Optimized" braces** + +```js +console.log(braces('a{b,c,/{x,y}}/e')); +//=> ['a(b|c|/(x|y))/e'] + +console.log(braces('a/{x,{1..5},y}/c')); +//=> ['a/(x|([1-5])|y)/c'] +``` + +### Escaping + +**Escaping braces** + +A brace pattern will not be expanded or evaluted if _either the opening or closing brace is escaped_: + +```js +console.log(braces.expand('a\\{d,c,b}e')); +//=> ['a{d,c,b}e'] + +console.log(braces.expand('a{d,c,b\\}e')); +//=> ['a{d,c,b}e'] +``` + +**Escaping commas** + +Commas inside braces may also be escaped: + +```js +console.log(braces.expand('a{b\\,c}d')); +//=> ['a{b,c}d'] + +console.log(braces.expand('a{d\\,c,b}e')); +//=> ['ad,ce', 'abe'] +``` + +**Single items** + +Following bash conventions, a brace pattern is also not expanded when it contains a single character: + +```js +console.log(braces.expand('a{b}c')); +//=> ['a{b}c'] +``` + +## Options + +### options.maxLength + +**Type**: `Number` + +**Default**: `65,536` + +**Description**: Limit the length of the input string. Useful when the input string is generated or your application allows users to pass a string, et cetera. + +```js +console.log(braces('a/{b,c}/d', { maxLength: 3 })); //=> throws an error +``` + +### options.expand + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Generate an "expanded" brace pattern (alternatively you can use the `braces.expand()` method, which does the same thing). + +```js +console.log(braces('a/{b,c}/d', { expand: true })); +//=> [ 'a/b/d', 'a/c/d' ] +``` + +### options.nodupes + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Remove duplicates from the returned array. + +### options.rangeLimit + +**Type**: `Number` + +**Default**: `1000` + +**Description**: To prevent malicious patterns from being passed by users, an error is thrown when `braces.expand()` is used or `options.expand` is true and the generated range will exceed the `rangeLimit`. + +You can customize `options.rangeLimit` or set it to `Inifinity` to disable this altogether. + +**Examples** + +```js +// pattern exceeds the "rangeLimit", so it's optimized automatically +console.log(braces.expand('{1..1000}')); +//=> ['([1-9]|[1-9][0-9]{1,2}|1000)'] + +// pattern does not exceed "rangeLimit", so it's NOT optimized +console.log(braces.expand('{1..100}')); +//=> ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12', '13', '14', '15', '16', '17', '18', '19', '20', '21', '22', '23', '24', '25', '26', '27', '28', '29', '30', '31', '32', '33', '34', '35', '36', '37', '38', '39', '40', '41', '42', '43', '44', '45', '46', '47', '48', '49', '50', '51', '52', '53', '54', '55', '56', '57', '58', '59', '60', '61', '62', '63', '64', '65', '66', '67', '68', '69', '70', '71', '72', '73', '74', '75', '76', '77', '78', '79', '80', '81', '82', '83', '84', '85', '86', '87', '88', '89', '90', '91', '92', '93', '94', '95', '96', '97', '98', '99', '100'] +``` + +### options.transform + +**Type**: `Function` + +**Default**: `undefined` + +**Description**: Customize range expansion. + +**Example: Transforming non-numeric values** + +```js +const alpha = braces.expand('x/{a..e}/y', { + transform(value, index) { + // When non-numeric values are passed, "value" is a character code. + return 'foo/' + String.fromCharCode(value) + '-' + index; + } +}); +console.log(alpha); +//=> [ 'x/foo/a-0/y', 'x/foo/b-1/y', 'x/foo/c-2/y', 'x/foo/d-3/y', 'x/foo/e-4/y' ] +``` + +**Example: Transforming numeric values** + +```js +const numeric = braces.expand('{1..5}', { + transform(value) { + // when numeric values are passed, "value" is a number + return 'foo/' + value * 2; + } +}); +console.log(numeric); +//=> [ 'foo/2', 'foo/4', 'foo/6', 'foo/8', 'foo/10' ] +``` + +### options.quantifiers + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: In regular expressions, quanitifiers can be used to specify how many times a token can be repeated. For example, `a{1,3}` will match the letter `a` one to three times. + +Unfortunately, regex quantifiers happen to share the same syntax as [Bash lists](#lists) + +The `quantifiers` option tells braces to detect when [regex quantifiers](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp#quantifiers) are defined in the given pattern, and not to try to expand them as lists. + +**Examples** + +```js +const braces = require('braces'); +console.log(braces('a/b{1,3}/{x,y,z}')); +//=> [ 'a/b(1|3)/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', {quantifiers: true})); +//=> [ 'a/b{1,3}/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', {quantifiers: true, expand: true})); +//=> [ 'a/b{1,3}/x', 'a/b{1,3}/y', 'a/b{1,3}/z' ] +``` + +### options.unescape + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Strip backslashes that were used for escaping from the result. + +## What is "brace expansion"? + +Brace expansion is a type of parameter expansion that was made popular by unix shells for generating lists of strings, as well as regex-like matching when used alongside wildcards (globs). + +In addition to "expansion", braces are also used for matching. In other words: + +* [brace expansion](#brace-expansion) is for generating new lists +* [brace matching](#brace-matching) is for filtering existing lists + +
+More about brace expansion (click to expand) + +There are two main types of brace expansion: + +1. **lists**: which are defined using comma-separated values inside curly braces: `{a,b,c}` +2. **sequences**: which are defined using a starting value and an ending value, separated by two dots: `a{1..3}b`. Optionally, a third argument may be passed to define a "step" or increment to use: `a{1..100..10}b`. These are also sometimes referred to as "ranges". + +Here are some example brace patterns to illustrate how they work: + +**Sets** + +``` +{a,b,c} => a b c +{a,b,c}{1,2} => a1 a2 b1 b2 c1 c2 +``` + +**Sequences** + +``` +{1..9} => 1 2 3 4 5 6 7 8 9 +{4..-4} => 4 3 2 1 0 -1 -2 -3 -4 +{1..20..3} => 1 4 7 10 13 16 19 +{a..j} => a b c d e f g h i j +{j..a} => j i h g f e d c b a +{a..z..3} => a d g j m p s v y +``` + +**Combination** + +Sets and sequences can be mixed together or used along with any other strings. + +``` +{a,b,c}{1..3} => a1 a2 a3 b1 b2 b3 c1 c2 c3 +foo/{a,b,c}/bar => foo/a/bar foo/b/bar foo/c/bar +``` + +The fact that braces can be "expanded" from relatively simple patterns makes them ideal for quickly generating test fixtures, file paths, and similar use cases. + +## Brace matching + +In addition to _expansion_, brace patterns are also useful for performing regular-expression-like matching. + +For example, the pattern `foo/{1..3}/bar` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +``` + +But not: + +``` +baz/1/qux +baz/2/qux +baz/3/qux +``` + +Braces can also be combined with [glob patterns](https://github.com/jonschlinkert/micromatch) to perform more advanced wildcard matching. For example, the pattern `*/{1..3}/*` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +baz/1/qux +baz/2/qux +baz/3/qux +``` + +## Brace matching pitfalls + +Although brace patterns offer a user-friendly way of matching ranges or sets of strings, there are also some major disadvantages and potential risks you should be aware of. + +### tldr + +**"brace bombs"** + +* brace expansion can eat up a huge amount of processing resources +* as brace patterns increase _linearly in size_, the system resources required to expand the pattern increase exponentially +* users can accidentally (or intentially) exhaust your system's resources resulting in the equivalent of a DoS attack (bonus: no programming knowledge is required!) + +For a more detailed explanation with examples, see the [geometric complexity](#geometric-complexity) section. + +### The solution + +Jump to the [performance section](#performance) to see how Braces solves this problem in comparison to other libraries. + +### Geometric complexity + +At minimum, brace patterns with sets limited to two elements have quadradic or `O(n^2)` complexity. But the complexity of the algorithm increases exponentially as the number of sets, _and elements per set_, increases, which is `O(n^c)`. + +For example, the following sets demonstrate quadratic (`O(n^2)`) complexity: + +``` +{1,2}{3,4} => (2X2) => 13 14 23 24 +{1,2}{3,4}{5,6} => (2X2X2) => 135 136 145 146 235 236 245 246 +``` + +But add an element to a set, and we get a n-fold Cartesian product with `O(n^c)` complexity: + +``` +{1,2,3}{4,5,6}{7,8,9} => (3X3X3) => 147 148 149 157 158 159 167 168 169 247 248 + 249 257 258 259 267 268 269 347 348 349 357 + 358 359 367 368 369 +``` + +Now, imagine how this complexity grows given that each element is a n-tuple: + +``` +{1..100}{1..100} => (100X100) => 10,000 elements (38.4 kB) +{1..100}{1..100}{1..100} => (100X100X100) => 1,000,000 elements (5.76 MB) +``` + +Although these examples are clearly contrived, they demonstrate how brace patterns can quickly grow out of control. + +**More information** + +Interested in learning more about brace expansion? + +* [linuxjournal/bash-brace-expansion](http://www.linuxjournal.com/content/bash-brace-expansion) +* [rosettacode/Brace_expansion](https://rosettacode.org/wiki/Brace_expansion) +* [cartesian product](https://en.wikipedia.org/wiki/Cartesian_product) + +
+ +## Performance + +Braces is not only screaming fast, it's also more accurate the other brace expansion libraries. + +### Better algorithms + +Fortunately there is a solution to the ["brace bomb" problem](#brace-matching-pitfalls): _don't expand brace patterns into an array when they're used for matching_. + +Instead, convert the pattern into an optimized regular expression. This is easier said than done, and braces is the only library that does this currently. + +**The proof is in the numbers** + +Minimatch gets exponentially slower as patterns increase in complexity, braces does not. The following results were generated using `braces()` and `minimatch.braceExpand()`, respectively. + +| **Pattern** | **braces** | **[minimatch][]** | +| --- | --- | --- | +| `{1..9007199254740991}`[^1] | `298 B` (5ms 459μs)| N/A (freezes) | +| `{1..1000000000000000}` | `41 B` (1ms 15μs) | N/A (freezes) | +| `{1..100000000000000}` | `40 B` (890μs) | N/A (freezes) | +| `{1..10000000000000}` | `39 B` (2ms 49μs) | N/A (freezes) | +| `{1..1000000000000}` | `38 B` (608μs) | N/A (freezes) | +| `{1..100000000000}` | `37 B` (397μs) | N/A (freezes) | +| `{1..10000000000}` | `35 B` (983μs) | N/A (freezes) | +| `{1..1000000000}` | `34 B` (798μs) | N/A (freezes) | +| `{1..100000000}` | `33 B` (733μs) | N/A (freezes) | +| `{1..10000000}` | `32 B` (5ms 632μs) | `78.89 MB` (16s 388ms 569μs) | +| `{1..1000000}` | `31 B` (1ms 381μs) | `6.89 MB` (1s 496ms 887μs) | +| `{1..100000}` | `30 B` (950μs) | `588.89 kB` (146ms 921μs) | +| `{1..10000}` | `29 B` (1ms 114μs) | `48.89 kB` (14ms 187μs) | +| `{1..1000}` | `28 B` (760μs) | `3.89 kB` (1ms 453μs) | +| `{1..100}` | `22 B` (345μs) | `291 B` (196μs) | +| `{1..10}` | `10 B` (533μs) | `20 B` (37μs) | +| `{1..3}` | `7 B` (190μs) | `5 B` (27μs) | + +### Faster algorithms + +When you need expansion, braces is still much faster. + +_(the following results were generated using `braces.expand()` and `minimatch.braceExpand()`, respectively)_ + +| **Pattern** | **braces** | **[minimatch][]** | +| --- | --- | --- | +| `{1..10000000}` | `78.89 MB` (2s 698ms 642μs) | `78.89 MB` (18s 601ms 974μs) | +| `{1..1000000}` | `6.89 MB` (458ms 576μs) | `6.89 MB` (1s 491ms 621μs) | +| `{1..100000}` | `588.89 kB` (20ms 728μs) | `588.89 kB` (156ms 919μs) | +| `{1..10000}` | `48.89 kB` (2ms 202μs) | `48.89 kB` (13ms 641μs) | +| `{1..1000}` | `3.89 kB` (1ms 796μs) | `3.89 kB` (1ms 958μs) | +| `{1..100}` | `291 B` (424μs) | `291 B` (211μs) | +| `{1..10}` | `20 B` (487μs) | `20 B` (72μs) | +| `{1..3}` | `5 B` (166μs) | `5 B` (27μs) | + +If you'd like to run these comparisons yourself, see [test/support/generate.js](test/support/generate.js). + +## Benchmarks + +### Running benchmarks + +Install dev dependencies: + +```bash +npm i -d && npm benchmark +``` + +### Latest results + +Braces is more accurate, without sacrificing performance. + +```bash +# range (expanded) + braces x 29,040 ops/sec ±3.69% (91 runs sampled)) + minimatch x 4,735 ops/sec ±1.28% (90 runs sampled) + +# range (optimized for regex) + braces x 382,878 ops/sec ±0.56% (94 runs sampled) + minimatch x 1,040 ops/sec ±0.44% (93 runs sampled) + +# nested ranges (expanded) + braces x 19,744 ops/sec ±2.27% (92 runs sampled)) + minimatch x 4,579 ops/sec ±0.50% (93 runs sampled) + +# nested ranges (optimized for regex) + braces x 246,019 ops/sec ±2.02% (93 runs sampled) + minimatch x 1,028 ops/sec ±0.39% (94 runs sampled) + +# set (expanded) + braces x 138,641 ops/sec ±0.53% (95 runs sampled) + minimatch x 219,582 ops/sec ±0.98% (94 runs sampled) + +# set (optimized for regex) + braces x 388,408 ops/sec ±0.41% (95 runs sampled) + minimatch x 44,724 ops/sec ±0.91% (89 runs sampled) + +# nested sets (expanded) + braces x 84,966 ops/sec ±0.48% (94 runs sampled) + minimatch x 140,720 ops/sec ±0.37% (95 runs sampled) + +# nested sets (optimized for regex) + braces x 263,340 ops/sec ±2.06% (92 runs sampled) + minimatch x 28,714 ops/sec ±0.40% (90 runs sampled) +``` + +## About + +
+Contributing + +Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new). + +
+ +
+Running Tests + +Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command: + +```sh +$ npm install && npm test +``` + +
+ +
+Building docs + +_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_ + +To generate the readme, run the following command: + +```sh +$ npm install -g verbose/verb#dev verb-generate-readme && verb +``` + +
+ +### Contributors + +| **Commits** | **Contributor** | +| --- | --- | +| 197 | [jonschlinkert](https://github.com/jonschlinkert) | +| 4 | [doowb](https://github.com/doowb) | +| 1 | [es128](https://github.com/es128) | +| 1 | [eush77](https://github.com/eush77) | +| 1 | [hemanth](https://github.com/hemanth) | +| 1 | [wtgtybhertgeghgtwtg](https://github.com/wtgtybhertgeghgtwtg) | + +### Author + +**Jon Schlinkert** + +* [GitHub Profile](https://github.com/jonschlinkert) +* [Twitter Profile](https://twitter.com/jonschlinkert) +* [LinkedIn Profile](https://linkedin.com/in/jonschlinkert) + +### License + +Copyright © 2019, [Jon Schlinkert](https://github.com/jonschlinkert). +Released under the [MIT License](LICENSE). + +*** + +_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.8.0, on April 08, 2019._ \ No newline at end of file diff --git a/node_modules/braces/index.js b/node_modules/braces/index.js new file mode 100644 index 00000000..0eee0f56 --- /dev/null +++ b/node_modules/braces/index.js @@ -0,0 +1,170 @@ +'use strict'; + +const stringify = require('./lib/stringify'); +const compile = require('./lib/compile'); +const expand = require('./lib/expand'); +const parse = require('./lib/parse'); + +/** + * Expand the given pattern or create a regex-compatible string. + * + * ```js + * const braces = require('braces'); + * console.log(braces('{a,b,c}', { compile: true })); //=> ['(a|b|c)'] + * console.log(braces('{a,b,c}')); //=> ['a', 'b', 'c'] + * ``` + * @param {String} `str` + * @param {Object} `options` + * @return {String} + * @api public + */ + +const braces = (input, options = {}) => { + let output = []; + + if (Array.isArray(input)) { + for (let pattern of input) { + let result = braces.create(pattern, options); + if (Array.isArray(result)) { + output.push(...result); + } else { + output.push(result); + } + } + } else { + output = [].concat(braces.create(input, options)); + } + + if (options && options.expand === true && options.nodupes === true) { + output = [...new Set(output)]; + } + return output; +}; + +/** + * Parse the given `str` with the given `options`. + * + * ```js + * // braces.parse(pattern, [, options]); + * const ast = braces.parse('a/{b,c}/d'); + * console.log(ast); + * ``` + * @param {String} pattern Brace pattern to parse + * @param {Object} options + * @return {Object} Returns an AST + * @api public + */ + +braces.parse = (input, options = {}) => parse(input, options); + +/** + * Creates a braces string from an AST, or an AST node. + * + * ```js + * const braces = require('braces'); + * let ast = braces.parse('foo/{a,b}/bar'); + * console.log(stringify(ast.nodes[2])); //=> '{a,b}' + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.stringify = (input, options = {}) => { + if (typeof input === 'string') { + return stringify(braces.parse(input, options), options); + } + return stringify(input, options); +}; + +/** + * Compiles a brace pattern into a regex-compatible, optimized string. + * This method is called by the main [braces](#braces) function by default. + * + * ```js + * const braces = require('braces'); + * console.log(braces.compile('a/{b,c}/d')); + * //=> ['a/(b|c)/d'] + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.compile = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + return compile(input, options); +}; + +/** + * Expands a brace pattern into an array. This method is called by the + * main [braces](#braces) function when `options.expand` is true. Before + * using this method it's recommended that you read the [performance notes](#performance)) + * and advantages of using [.compile](#compile) instead. + * + * ```js + * const braces = require('braces'); + * console.log(braces.expand('a/{b,c}/d')); + * //=> ['a/b/d', 'a/c/d']; + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.expand = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + + let result = expand(input, options); + + // filter out empty strings if specified + if (options.noempty === true) { + result = result.filter(Boolean); + } + + // filter out duplicates if specified + if (options.nodupes === true) { + result = [...new Set(result)]; + } + + return result; +}; + +/** + * Processes a brace pattern and returns either an expanded array + * (if `options.expand` is true), a highly optimized regex-compatible string. + * This method is called by the main [braces](#braces) function. + * + * ```js + * const braces = require('braces'); + * console.log(braces.create('user-{200..300}/project-{a,b,c}-{1..10}')) + * //=> 'user-(20[0-9]|2[1-9][0-9]|300)/project-(a|b|c)-([1-9]|10)' + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.create = (input, options = {}) => { + if (input === '' || input.length < 3) { + return [input]; + } + + return options.expand !== true + ? braces.compile(input, options) + : braces.expand(input, options); +}; + +/** + * Expose "braces" + */ + +module.exports = braces; diff --git a/node_modules/braces/lib/compile.js b/node_modules/braces/lib/compile.js new file mode 100644 index 00000000..3e984a4b --- /dev/null +++ b/node_modules/braces/lib/compile.js @@ -0,0 +1,57 @@ +'use strict'; + +const fill = require('fill-range'); +const utils = require('./utils'); + +const compile = (ast, options = {}) => { + let walk = (node, parent = {}) => { + let invalidBlock = utils.isInvalidBrace(parent); + let invalidNode = node.invalid === true && options.escapeInvalid === true; + let invalid = invalidBlock === true || invalidNode === true; + let prefix = options.escapeInvalid === true ? '\\' : ''; + let output = ''; + + if (node.isOpen === true) { + return prefix + node.value; + } + if (node.isClose === true) { + return prefix + node.value; + } + + if (node.type === 'open') { + return invalid ? (prefix + node.value) : '('; + } + + if (node.type === 'close') { + return invalid ? (prefix + node.value) : ')'; + } + + if (node.type === 'comma') { + return node.prev.type === 'comma' ? '' : (invalid ? node.value : '|'); + } + + if (node.value) { + return node.value; + } + + if (node.nodes && node.ranges > 0) { + let args = utils.reduce(node.nodes); + let range = fill(...args, { ...options, wrap: false, toRegex: true }); + + if (range.length !== 0) { + return args.length > 1 && range.length > 1 ? `(${range})` : range; + } + } + + if (node.nodes) { + for (let child of node.nodes) { + output += walk(child, node); + } + } + return output; + }; + + return walk(ast); +}; + +module.exports = compile; diff --git a/node_modules/braces/lib/constants.js b/node_modules/braces/lib/constants.js new file mode 100644 index 00000000..a9379436 --- /dev/null +++ b/node_modules/braces/lib/constants.js @@ -0,0 +1,57 @@ +'use strict'; + +module.exports = { + MAX_LENGTH: 1024 * 64, + + // Digits + CHAR_0: '0', /* 0 */ + CHAR_9: '9', /* 9 */ + + // Alphabet chars. + CHAR_UPPERCASE_A: 'A', /* A */ + CHAR_LOWERCASE_A: 'a', /* a */ + CHAR_UPPERCASE_Z: 'Z', /* Z */ + CHAR_LOWERCASE_Z: 'z', /* z */ + + CHAR_LEFT_PARENTHESES: '(', /* ( */ + CHAR_RIGHT_PARENTHESES: ')', /* ) */ + + CHAR_ASTERISK: '*', /* * */ + + // Non-alphabetic chars. + CHAR_AMPERSAND: '&', /* & */ + CHAR_AT: '@', /* @ */ + CHAR_BACKSLASH: '\\', /* \ */ + CHAR_BACKTICK: '`', /* ` */ + CHAR_CARRIAGE_RETURN: '\r', /* \r */ + CHAR_CIRCUMFLEX_ACCENT: '^', /* ^ */ + CHAR_COLON: ':', /* : */ + CHAR_COMMA: ',', /* , */ + CHAR_DOLLAR: '$', /* . */ + CHAR_DOT: '.', /* . */ + CHAR_DOUBLE_QUOTE: '"', /* " */ + CHAR_EQUAL: '=', /* = */ + CHAR_EXCLAMATION_MARK: '!', /* ! */ + CHAR_FORM_FEED: '\f', /* \f */ + CHAR_FORWARD_SLASH: '/', /* / */ + CHAR_HASH: '#', /* # */ + CHAR_HYPHEN_MINUS: '-', /* - */ + CHAR_LEFT_ANGLE_BRACKET: '<', /* < */ + CHAR_LEFT_CURLY_BRACE: '{', /* { */ + CHAR_LEFT_SQUARE_BRACKET: '[', /* [ */ + CHAR_LINE_FEED: '\n', /* \n */ + CHAR_NO_BREAK_SPACE: '\u00A0', /* \u00A0 */ + CHAR_PERCENT: '%', /* % */ + CHAR_PLUS: '+', /* + */ + CHAR_QUESTION_MARK: '?', /* ? */ + CHAR_RIGHT_ANGLE_BRACKET: '>', /* > */ + CHAR_RIGHT_CURLY_BRACE: '}', /* } */ + CHAR_RIGHT_SQUARE_BRACKET: ']', /* ] */ + CHAR_SEMICOLON: ';', /* ; */ + CHAR_SINGLE_QUOTE: '\'', /* ' */ + CHAR_SPACE: ' ', /* */ + CHAR_TAB: '\t', /* \t */ + CHAR_UNDERSCORE: '_', /* _ */ + CHAR_VERTICAL_LINE: '|', /* | */ + CHAR_ZERO_WIDTH_NOBREAK_SPACE: '\uFEFF' /* \uFEFF */ +}; diff --git a/node_modules/braces/lib/expand.js b/node_modules/braces/lib/expand.js new file mode 100644 index 00000000..376c748a --- /dev/null +++ b/node_modules/braces/lib/expand.js @@ -0,0 +1,113 @@ +'use strict'; + +const fill = require('fill-range'); +const stringify = require('./stringify'); +const utils = require('./utils'); + +const append = (queue = '', stash = '', enclose = false) => { + let result = []; + + queue = [].concat(queue); + stash = [].concat(stash); + + if (!stash.length) return queue; + if (!queue.length) { + return enclose ? utils.flatten(stash).map(ele => `{${ele}}`) : stash; + } + + for (let item of queue) { + if (Array.isArray(item)) { + for (let value of item) { + result.push(append(value, stash, enclose)); + } + } else { + for (let ele of stash) { + if (enclose === true && typeof ele === 'string') ele = `{${ele}}`; + result.push(Array.isArray(ele) ? append(item, ele, enclose) : (item + ele)); + } + } + } + return utils.flatten(result); +}; + +const expand = (ast, options = {}) => { + let rangeLimit = options.rangeLimit === void 0 ? 1000 : options.rangeLimit; + + let walk = (node, parent = {}) => { + node.queue = []; + + let p = parent; + let q = parent.queue; + + while (p.type !== 'brace' && p.type !== 'root' && p.parent) { + p = p.parent; + q = p.queue; + } + + if (node.invalid || node.dollar) { + q.push(append(q.pop(), stringify(node, options))); + return; + } + + if (node.type === 'brace' && node.invalid !== true && node.nodes.length === 2) { + q.push(append(q.pop(), ['{}'])); + return; + } + + if (node.nodes && node.ranges > 0) { + let args = utils.reduce(node.nodes); + + if (utils.exceedsLimit(...args, options.step, rangeLimit)) { + throw new RangeError('expanded array length exceeds range limit. Use options.rangeLimit to increase or disable the limit.'); + } + + let range = fill(...args, options); + if (range.length === 0) { + range = stringify(node, options); + } + + q.push(append(q.pop(), range)); + node.nodes = []; + return; + } + + let enclose = utils.encloseBrace(node); + let queue = node.queue; + let block = node; + + while (block.type !== 'brace' && block.type !== 'root' && block.parent) { + block = block.parent; + queue = block.queue; + } + + for (let i = 0; i < node.nodes.length; i++) { + let child = node.nodes[i]; + + if (child.type === 'comma' && node.type === 'brace') { + if (i === 1) queue.push(''); + queue.push(''); + continue; + } + + if (child.type === 'close') { + q.push(append(q.pop(), queue, enclose)); + continue; + } + + if (child.value && child.type !== 'open') { + queue.push(append(queue.pop(), child.value)); + continue; + } + + if (child.nodes) { + walk(child, node); + } + } + + return queue; + }; + + return utils.flatten(walk(ast)); +}; + +module.exports = expand; diff --git a/node_modules/braces/lib/parse.js b/node_modules/braces/lib/parse.js new file mode 100644 index 00000000..145ea264 --- /dev/null +++ b/node_modules/braces/lib/parse.js @@ -0,0 +1,333 @@ +'use strict'; + +const stringify = require('./stringify'); + +/** + * Constants + */ + +const { + MAX_LENGTH, + CHAR_BACKSLASH, /* \ */ + CHAR_BACKTICK, /* ` */ + CHAR_COMMA, /* , */ + CHAR_DOT, /* . */ + CHAR_LEFT_PARENTHESES, /* ( */ + CHAR_RIGHT_PARENTHESES, /* ) */ + CHAR_LEFT_CURLY_BRACE, /* { */ + CHAR_RIGHT_CURLY_BRACE, /* } */ + CHAR_LEFT_SQUARE_BRACKET, /* [ */ + CHAR_RIGHT_SQUARE_BRACKET, /* ] */ + CHAR_DOUBLE_QUOTE, /* " */ + CHAR_SINGLE_QUOTE, /* ' */ + CHAR_NO_BREAK_SPACE, + CHAR_ZERO_WIDTH_NOBREAK_SPACE +} = require('./constants'); + +/** + * parse + */ + +const parse = (input, options = {}) => { + if (typeof input !== 'string') { + throw new TypeError('Expected a string'); + } + + let opts = options || {}; + let max = typeof opts.maxLength === 'number' ? Math.min(MAX_LENGTH, opts.maxLength) : MAX_LENGTH; + if (input.length > max) { + throw new SyntaxError(`Input length (${input.length}), exceeds max characters (${max})`); + } + + let ast = { type: 'root', input, nodes: [] }; + let stack = [ast]; + let block = ast; + let prev = ast; + let brackets = 0; + let length = input.length; + let index = 0; + let depth = 0; + let value; + let memo = {}; + + /** + * Helpers + */ + + const advance = () => input[index++]; + const push = node => { + if (node.type === 'text' && prev.type === 'dot') { + prev.type = 'text'; + } + + if (prev && prev.type === 'text' && node.type === 'text') { + prev.value += node.value; + return; + } + + block.nodes.push(node); + node.parent = block; + node.prev = prev; + prev = node; + return node; + }; + + push({ type: 'bos' }); + + while (index < length) { + block = stack[stack.length - 1]; + value = advance(); + + /** + * Invalid chars + */ + + if (value === CHAR_ZERO_WIDTH_NOBREAK_SPACE || value === CHAR_NO_BREAK_SPACE) { + continue; + } + + /** + * Escaped chars + */ + + if (value === CHAR_BACKSLASH) { + push({ type: 'text', value: (options.keepEscaping ? value : '') + advance() }); + continue; + } + + /** + * Right square bracket (literal): ']' + */ + + if (value === CHAR_RIGHT_SQUARE_BRACKET) { + push({ type: 'text', value: '\\' + value }); + continue; + } + + /** + * Left square bracket: '[' + */ + + if (value === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + + let closed = true; + let next; + + while (index < length && (next = advance())) { + value += next; + + if (next === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + continue; + } + + if (next === CHAR_BACKSLASH) { + value += advance(); + continue; + } + + if (next === CHAR_RIGHT_SQUARE_BRACKET) { + brackets--; + + if (brackets === 0) { + break; + } + } + } + + push({ type: 'text', value }); + continue; + } + + /** + * Parentheses + */ + + if (value === CHAR_LEFT_PARENTHESES) { + block = push({ type: 'paren', nodes: [] }); + stack.push(block); + push({ type: 'text', value }); + continue; + } + + if (value === CHAR_RIGHT_PARENTHESES) { + if (block.type !== 'paren') { + push({ type: 'text', value }); + continue; + } + block = stack.pop(); + push({ type: 'text', value }); + block = stack[stack.length - 1]; + continue; + } + + /** + * Quotes: '|"|` + */ + + if (value === CHAR_DOUBLE_QUOTE || value === CHAR_SINGLE_QUOTE || value === CHAR_BACKTICK) { + let open = value; + let next; + + if (options.keepQuotes !== true) { + value = ''; + } + + while (index < length && (next = advance())) { + if (next === CHAR_BACKSLASH) { + value += next + advance(); + continue; + } + + if (next === open) { + if (options.keepQuotes === true) value += next; + break; + } + + value += next; + } + + push({ type: 'text', value }); + continue; + } + + /** + * Left curly brace: '{' + */ + + if (value === CHAR_LEFT_CURLY_BRACE) { + depth++; + + let dollar = prev.value && prev.value.slice(-1) === '$' || block.dollar === true; + let brace = { + type: 'brace', + open: true, + close: false, + dollar, + depth, + commas: 0, + ranges: 0, + nodes: [] + }; + + block = push(brace); + stack.push(block); + push({ type: 'open', value }); + continue; + } + + /** + * Right curly brace: '}' + */ + + if (value === CHAR_RIGHT_CURLY_BRACE) { + if (block.type !== 'brace') { + push({ type: 'text', value }); + continue; + } + + let type = 'close'; + block = stack.pop(); + block.close = true; + + push({ type, value }); + depth--; + + block = stack[stack.length - 1]; + continue; + } + + /** + * Comma: ',' + */ + + if (value === CHAR_COMMA && depth > 0) { + if (block.ranges > 0) { + block.ranges = 0; + let open = block.nodes.shift(); + block.nodes = [open, { type: 'text', value: stringify(block) }]; + } + + push({ type: 'comma', value }); + block.commas++; + continue; + } + + /** + * Dot: '.' + */ + + if (value === CHAR_DOT && depth > 0 && block.commas === 0) { + let siblings = block.nodes; + + if (depth === 0 || siblings.length === 0) { + push({ type: 'text', value }); + continue; + } + + if (prev.type === 'dot') { + block.range = []; + prev.value += value; + prev.type = 'range'; + + if (block.nodes.length !== 3 && block.nodes.length !== 5) { + block.invalid = true; + block.ranges = 0; + prev.type = 'text'; + continue; + } + + block.ranges++; + block.args = []; + continue; + } + + if (prev.type === 'range') { + siblings.pop(); + + let before = siblings[siblings.length - 1]; + before.value += prev.value + value; + prev = before; + block.ranges--; + continue; + } + + push({ type: 'dot', value }); + continue; + } + + /** + * Text + */ + + push({ type: 'text', value }); + } + + // Mark imbalanced braces and brackets as invalid + do { + block = stack.pop(); + + if (block.type !== 'root') { + block.nodes.forEach(node => { + if (!node.nodes) { + if (node.type === 'open') node.isOpen = true; + if (node.type === 'close') node.isClose = true; + if (!node.nodes) node.type = 'text'; + node.invalid = true; + } + }); + + // get the location of the block on parent.nodes (block's siblings) + let parent = stack[stack.length - 1]; + let index = parent.nodes.indexOf(block); + // replace the (invalid) block with it's nodes + parent.nodes.splice(index, 1, ...block.nodes); + } + } while (stack.length > 0); + + push({ type: 'eos' }); + return ast; +}; + +module.exports = parse; diff --git a/node_modules/braces/lib/stringify.js b/node_modules/braces/lib/stringify.js new file mode 100644 index 00000000..414b7bcc --- /dev/null +++ b/node_modules/braces/lib/stringify.js @@ -0,0 +1,32 @@ +'use strict'; + +const utils = require('./utils'); + +module.exports = (ast, options = {}) => { + let stringify = (node, parent = {}) => { + let invalidBlock = options.escapeInvalid && utils.isInvalidBrace(parent); + let invalidNode = node.invalid === true && options.escapeInvalid === true; + let output = ''; + + if (node.value) { + if ((invalidBlock || invalidNode) && utils.isOpenOrClose(node)) { + return '\\' + node.value; + } + return node.value; + } + + if (node.value) { + return node.value; + } + + if (node.nodes) { + for (let child of node.nodes) { + output += stringify(child); + } + } + return output; + }; + + return stringify(ast); +}; + diff --git a/node_modules/braces/lib/utils.js b/node_modules/braces/lib/utils.js new file mode 100644 index 00000000..e3551a67 --- /dev/null +++ b/node_modules/braces/lib/utils.js @@ -0,0 +1,112 @@ +'use strict'; + +exports.isInteger = num => { + if (typeof num === 'number') { + return Number.isInteger(num); + } + if (typeof num === 'string' && num.trim() !== '') { + return Number.isInteger(Number(num)); + } + return false; +}; + +/** + * Find a node of the given type + */ + +exports.find = (node, type) => node.nodes.find(node => node.type === type); + +/** + * Find a node of the given type + */ + +exports.exceedsLimit = (min, max, step = 1, limit) => { + if (limit === false) return false; + if (!exports.isInteger(min) || !exports.isInteger(max)) return false; + return ((Number(max) - Number(min)) / Number(step)) >= limit; +}; + +/** + * Escape the given node with '\\' before node.value + */ + +exports.escapeNode = (block, n = 0, type) => { + let node = block.nodes[n]; + if (!node) return; + + if ((type && node.type === type) || node.type === 'open' || node.type === 'close') { + if (node.escaped !== true) { + node.value = '\\' + node.value; + node.escaped = true; + } + } +}; + +/** + * Returns true if the given brace node should be enclosed in literal braces + */ + +exports.encloseBrace = node => { + if (node.type !== 'brace') return false; + if ((node.commas >> 0 + node.ranges >> 0) === 0) { + node.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a brace node is invalid. + */ + +exports.isInvalidBrace = block => { + if (block.type !== 'brace') return false; + if (block.invalid === true || block.dollar) return true; + if ((block.commas >> 0 + block.ranges >> 0) === 0) { + block.invalid = true; + return true; + } + if (block.open !== true || block.close !== true) { + block.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a node is an open or close node + */ + +exports.isOpenOrClose = node => { + if (node.type === 'open' || node.type === 'close') { + return true; + } + return node.open === true || node.close === true; +}; + +/** + * Reduce an array of text nodes. + */ + +exports.reduce = nodes => nodes.reduce((acc, node) => { + if (node.type === 'text') acc.push(node.value); + if (node.type === 'range') node.type = 'text'; + return acc; +}, []); + +/** + * Flatten an array + */ + +exports.flatten = (...args) => { + const result = []; + const flat = arr => { + for (let i = 0; i < arr.length; i++) { + let ele = arr[i]; + Array.isArray(ele) ? flat(ele, result) : ele !== void 0 && result.push(ele); + } + return result; + }; + flat(args); + return result; +}; diff --git a/node_modules/braces/package.json b/node_modules/braces/package.json new file mode 100644 index 00000000..87d45a0e --- /dev/null +++ b/node_modules/braces/package.json @@ -0,0 +1,123 @@ +{ + "_from": "braces@~3.0.2", + "_id": "braces@3.0.2", + "_inBundle": false, + "_integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "_location": "/braces", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "braces@~3.0.2", + "name": "braces", + "escapedName": "braces", + "rawSpec": "~3.0.2", + "saveSpec": null, + "fetchSpec": "~3.0.2" + }, + "_requiredBy": [ + "/chokidar" + ], + "_resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "_shasum": "3454e1a462ee8d599e236df336cd9ea4f8afe107", + "_spec": "braces@~3.0.2", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/chokidar", + "author": { + "name": "Jon Schlinkert", + "url": "https://github.com/jonschlinkert" + }, + "bugs": { + "url": "https://github.com/micromatch/braces/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Brian Woodward", + "url": "https://twitter.com/doowb" + }, + { + "name": "Elan Shanker", + "url": "https://github.com/es128" + }, + { + "name": "Eugene Sharygin", + "url": "https://github.com/eush77" + }, + { + "name": "hemanth.hm", + "url": "http://h3manth.com" + }, + { + "name": "Jon Schlinkert", + "url": "http://twitter.com/jonschlinkert" + } + ], + "dependencies": { + "fill-range": "^7.0.1" + }, + "deprecated": false, + "description": "Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed.", + "devDependencies": { + "ansi-colors": "^3.2.4", + "bash-path": "^2.0.1", + "gulp-format-md": "^2.0.0", + "mocha": "^6.1.1" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "lib" + ], + "homepage": "https://github.com/micromatch/braces", + "keywords": [ + "alpha", + "alphabetical", + "bash", + "brace", + "braces", + "expand", + "expansion", + "filepath", + "fill", + "fs", + "glob", + "globbing", + "letter", + "match", + "matches", + "matching", + "number", + "numerical", + "path", + "range", + "ranges", + "sh" + ], + "license": "MIT", + "main": "index.js", + "name": "braces", + "repository": { + "type": "git", + "url": "git+https://github.com/micromatch/braces.git" + }, + "scripts": { + "benchmark": "node benchmark", + "test": "mocha" + }, + "verb": { + "toc": false, + "layout": "default", + "tasks": [ + "readme" + ], + "lint": { + "reflinks": true + }, + "plugins": [ + "gulp-format-md" + ] + }, + "version": "3.0.2" +} diff --git a/node_modules/buffer-equal-constant-time/.npmignore b/node_modules/buffer-equal-constant-time/.npmignore new file mode 100644 index 00000000..34e4f5c2 --- /dev/null +++ b/node_modules/buffer-equal-constant-time/.npmignore @@ -0,0 +1,2 @@ +.*.sw[mnop] +node_modules/ diff --git a/node_modules/buffer-equal-constant-time/.travis.yml b/node_modules/buffer-equal-constant-time/.travis.yml new file mode 100644 index 00000000..78e1c014 --- /dev/null +++ b/node_modules/buffer-equal-constant-time/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: +- "0.11" +- "0.10" diff --git a/node_modules/buffer-equal-constant-time/LICENSE.txt b/node_modules/buffer-equal-constant-time/LICENSE.txt new file mode 100644 index 00000000..9a064f3f --- /dev/null +++ b/node_modules/buffer-equal-constant-time/LICENSE.txt @@ -0,0 +1,12 @@ +Copyright (c) 2013, GoInstant Inc., a salesforce.com company +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. + +* Neither the name of salesforce.com, nor GoInstant, nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/buffer-equal-constant-time/README.md b/node_modules/buffer-equal-constant-time/README.md new file mode 100644 index 00000000..4f227f58 --- /dev/null +++ b/node_modules/buffer-equal-constant-time/README.md @@ -0,0 +1,50 @@ +# buffer-equal-constant-time + +Constant-time `Buffer` comparison for node.js. Should work with browserify too. + +[![Build Status](https://travis-ci.org/goinstant/buffer-equal-constant-time.png?branch=master)](https://travis-ci.org/goinstant/buffer-equal-constant-time) + +```sh + npm install buffer-equal-constant-time +``` + +# Usage + +```js + var bufferEq = require('buffer-equal-constant-time'); + + var a = new Buffer('asdf'); + var b = new Buffer('asdf'); + if (bufferEq(a,b)) { + // the same! + } else { + // different in at least one byte! + } +``` + +If you'd like to install an `.equal()` method onto the node.js `Buffer` and +`SlowBuffer` prototypes: + +```js + require('buffer-equal-constant-time').install(); + + var a = new Buffer('asdf'); + var b = new Buffer('asdf'); + if (a.equal(b)) { + // the same! + } else { + // different in at least one byte! + } +``` + +To get rid of the installed `.equal()` method, call `.restore()`: + +```js + require('buffer-equal-constant-time').restore(); +``` + +# Legal + +© 2013 GoInstant Inc., a salesforce.com company + +Licensed under the BSD 3-clause license. diff --git a/node_modules/buffer-equal-constant-time/index.js b/node_modules/buffer-equal-constant-time/index.js new file mode 100644 index 00000000..5462c1f8 --- /dev/null +++ b/node_modules/buffer-equal-constant-time/index.js @@ -0,0 +1,41 @@ +/*jshint node:true */ +'use strict'; +var Buffer = require('buffer').Buffer; // browserify +var SlowBuffer = require('buffer').SlowBuffer; + +module.exports = bufferEq; + +function bufferEq(a, b) { + + // shortcutting on type is necessary for correctness + if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) { + return false; + } + + // buffer sizes should be well-known information, so despite this + // shortcutting, it doesn't leak any information about the *contents* of the + // buffers. + if (a.length !== b.length) { + return false; + } + + var c = 0; + for (var i = 0; i < a.length; i++) { + /*jshint bitwise:false */ + c |= a[i] ^ b[i]; // XOR + } + return c === 0; +} + +bufferEq.install = function() { + Buffer.prototype.equal = SlowBuffer.prototype.equal = function equal(that) { + return bufferEq(this, that); + }; +}; + +var origBufEqual = Buffer.prototype.equal; +var origSlowBufEqual = SlowBuffer.prototype.equal; +bufferEq.restore = function() { + Buffer.prototype.equal = origBufEqual; + SlowBuffer.prototype.equal = origSlowBufEqual; +}; diff --git a/node_modules/buffer-equal-constant-time/package.json b/node_modules/buffer-equal-constant-time/package.json new file mode 100644 index 00000000..d339fd61 --- /dev/null +++ b/node_modules/buffer-equal-constant-time/package.json @@ -0,0 +1,55 @@ +{ + "_from": "buffer-equal-constant-time@1.0.1", + "_id": "buffer-equal-constant-time@1.0.1", + "_inBundle": false, + "_integrity": "sha1-+OcRMvf/5uAaXJaXpMbz5I1cyBk=", + "_location": "/buffer-equal-constant-time", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "buffer-equal-constant-time@1.0.1", + "name": "buffer-equal-constant-time", + "escapedName": "buffer-equal-constant-time", + "rawSpec": "1.0.1", + "saveSpec": null, + "fetchSpec": "1.0.1" + }, + "_requiredBy": [ + "/jwa" + ], + "_resolved": "https://registry.npmjs.org/buffer-equal-constant-time/-/buffer-equal-constant-time-1.0.1.tgz", + "_shasum": "f8e71132f7ffe6e01a5c9697a4c6f3e48d5cc819", + "_spec": "buffer-equal-constant-time@1.0.1", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/jwa", + "author": { + "name": "GoInstant Inc., a salesforce.com company" + }, + "bugs": { + "url": "https://github.com/goinstant/buffer-equal-constant-time/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Constant-time comparison of Buffers", + "devDependencies": { + "mocha": "~1.15.1" + }, + "homepage": "https://github.com/goinstant/buffer-equal-constant-time#readme", + "keywords": [ + "buffer", + "equal", + "constant-time", + "crypto" + ], + "license": "BSD-3-Clause", + "main": "index.js", + "name": "buffer-equal-constant-time", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/goinstant/buffer-equal-constant-time.git" + }, + "scripts": { + "test": "mocha test.js" + }, + "version": "1.0.1" +} diff --git a/node_modules/buffer-equal-constant-time/test.js b/node_modules/buffer-equal-constant-time/test.js new file mode 100644 index 00000000..0bc972d8 --- /dev/null +++ b/node_modules/buffer-equal-constant-time/test.js @@ -0,0 +1,42 @@ +/*jshint node:true */ +'use strict'; + +var bufferEq = require('./index'); +var assert = require('assert'); + +describe('buffer-equal-constant-time', function() { + var a = new Buffer('asdfasdf123456'); + var b = new Buffer('asdfasdf123456'); + var c = new Buffer('asdfasdf'); + + describe('bufferEq', function() { + it('says a == b', function() { + assert.strictEqual(bufferEq(a, b), true); + }); + + it('says a != c', function() { + assert.strictEqual(bufferEq(a, c), false); + }); + }); + + describe('install/restore', function() { + before(function() { + bufferEq.install(); + }); + after(function() { + bufferEq.restore(); + }); + + it('installed an .equal method', function() { + var SlowBuffer = require('buffer').SlowBuffer; + assert.ok(Buffer.prototype.equal); + assert.ok(SlowBuffer.prototype.equal); + }); + + it('infected existing Buffers', function() { + assert.strictEqual(a.equal(b), true); + assert.strictEqual(a.equal(c), false); + }); + }); + +}); diff --git a/node_modules/bytes/History.md b/node_modules/bytes/History.md new file mode 100644 index 00000000..cf6a5bb9 --- /dev/null +++ b/node_modules/bytes/History.md @@ -0,0 +1,87 @@ +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/node_modules/bytes/LICENSE b/node_modules/bytes/LICENSE new file mode 100644 index 00000000..63e95a96 --- /dev/null +++ b/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/bytes/Readme.md b/node_modules/bytes/Readme.md new file mode 100644 index 00000000..6ad1ec6e --- /dev/null +++ b/node_modules/bytes/Readme.md @@ -0,0 +1,126 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes.format(number value, [options]): string|null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`|`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`|`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`|`null` | Example of values: `' '`, `','` and `.`... Default value to `''`. | +| unit | `string`|`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`|`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`|`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes(1000); +// output: '1000B' + +bytes(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes(1024, {unitSeparator: ' '}); +// output: '1 KB' + +``` + +#### bytes.parse(string|number value): number|null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`|`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`|`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes('1KB'); +// output: 1024 + +bytes('1024'); +// output: 1024 + +bytes(1024); +// output: 1KB +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/node/bytes +[npm-url]: https://npmjs.org/package/bytes +[travis-image]: https://badgen.net/travis/visionmedia/bytes.js/master +[travis-url]: https://travis-ci.org/visionmedia/bytes.js diff --git a/node_modules/bytes/index.js b/node_modules/bytes/index.js new file mode 100644 index 00000000..4975bfb0 --- /dev/null +++ b/node_modules/bytes/index.js @@ -0,0 +1,162 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.replace(formatThousandsRegExp, thousandsSeparator); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/node_modules/bytes/package.json b/node_modules/bytes/package.json new file mode 100644 index 00000000..9cd2e287 --- /dev/null +++ b/node_modules/bytes/package.json @@ -0,0 +1,84 @@ +{ + "_from": "bytes@3.1.0", + "_id": "bytes@3.1.0", + "_inBundle": false, + "_integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==", + "_location": "/bytes", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "bytes@3.1.0", + "name": "bytes", + "escapedName": "bytes", + "rawSpec": "3.1.0", + "saveSpec": null, + "fetchSpec": "3.1.0" + }, + "_requiredBy": [ + "/body-parser", + "/raw-body" + ], + "_resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", + "_shasum": "f6cf7933a360e0588fa9fde85651cdc7f805d1f6", + "_spec": "bytes@3.1.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/body-parser", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/bytes.js/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jed Watson", + "email": "jed.watson@me.com" + }, + { + "name": "Théo FIDRY", + "email": "theo.fidry@gmail.com" + } + ], + "deprecated": false, + "description": "Utility to parse a string bytes to bytes and vice-versa", + "devDependencies": { + "eslint": "5.12.1", + "mocha": "5.2.0", + "nyc": "13.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "homepage": "https://github.com/visionmedia/bytes.js#readme", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "license": "MIT", + "name": "bytes", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/bytes.js.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "3.1.0" +} diff --git a/node_modules/cacheable-request/LICENSE b/node_modules/cacheable-request/LICENSE new file mode 100644 index 00000000..f27ee9b4 --- /dev/null +++ b/node_modules/cacheable-request/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2017 Luke Childs + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/cacheable-request/README.md b/node_modules/cacheable-request/README.md new file mode 100644 index 00000000..725e7e0d --- /dev/null +++ b/node_modules/cacheable-request/README.md @@ -0,0 +1,206 @@ +# cacheable-request + +> Wrap native HTTP requests with RFC compliant cache support + +[![Build Status](https://travis-ci.org/lukechilds/cacheable-request.svg?branch=master)](https://travis-ci.org/lukechilds/cacheable-request) +[![Coverage Status](https://coveralls.io/repos/github/lukechilds/cacheable-request/badge.svg?branch=master)](https://coveralls.io/github/lukechilds/cacheable-request?branch=master) +[![npm](https://img.shields.io/npm/dm/cacheable-request.svg)](https://www.npmjs.com/package/cacheable-request) +[![npm](https://img.shields.io/npm/v/cacheable-request.svg)](https://www.npmjs.com/package/cacheable-request) + +[RFC 7234](http://httpwg.org/specs/rfc7234.html) compliant HTTP caching for native Node.js HTTP/HTTPS requests. Caching works out of the box in memory or is easily pluggable with a wide range of storage adapters. + +**Note:** This is a low level wrapper around the core HTTP modules, it's not a high level request library. + +## Features + +- Only stores cacheable responses as defined by RFC 7234 +- Fresh cache entries are served directly from cache +- Stale cache entries are revalidated with `If-None-Match`/`If-Modified-Since` headers +- 304 responses from revalidation requests use cached body +- Updates `Age` header on cached responses +- Can completely bypass cache on a per request basis +- In memory cache by default +- Official support for Redis, MongoDB, SQLite, PostgreSQL and MySQL storage adapters +- Easily plug in your own or third-party storage adapters +- If DB connection fails, cache is automatically bypassed ([disabled by default](#optsautomaticfailover)) +- Adds cache support to any existing HTTP code with minimal changes +- Uses [http-cache-semantics](https://github.com/pornel/http-cache-semantics) internally for HTTP RFC 7234 compliance + +## Install + +```shell +npm install cacheable-request +``` + +## Usage + +```js +const http = require('http'); +const CacheableRequest = require('cacheable-request'); + +// Then instead of +const req = http.request('http://example.com', cb); +req.end(); + +// You can do +const cacheableRequest = new CacheableRequest(http.request); +const cacheReq = cacheableRequest('http://example.com', cb); +cacheReq.on('request', req => req.end()); +// Future requests to 'example.com' will be returned from cache if still valid + +// You pass in any other http.request API compatible method to be wrapped with cache support: +const cacheableRequest = new CacheableRequest(https.request); +const cacheableRequest = new CacheableRequest(electron.net); +``` + +## Storage Adapters + +`cacheable-request` uses [Keyv](https://github.com/lukechilds/keyv) to support a wide range of storage adapters. + +For example, to use Redis as a cache backend, you just need to install the official Redis Keyv storage adapter: + +``` +npm install @keyv/redis +``` + +And then you can pass `CacheableRequest` your connection string: + +```js +const cacheableRequest = new CacheableRequest(http.request, 'redis://user:pass@localhost:6379'); +``` + +[View all official Keyv storage adapters.](https://github.com/lukechilds/keyv#official-storage-adapters) + +Keyv also supports anything that follows the Map API so it's easy to write your own storage adapter or use a third-party solution. + +e.g The following are all valid storage adapters + +```js +const storageAdapter = new Map(); +// or +const storageAdapter = require('./my-storage-adapter'); +// or +const QuickLRU = require('quick-lru'); +const storageAdapter = new QuickLRU({ maxSize: 1000 }); + +const cacheableRequest = new CacheableRequest(http.request, storageAdapter); +``` + +View the [Keyv docs](https://github.com/lukechilds/keyv) for more information on how to use storage adapters. + +## API + +### new cacheableRequest(request, [storageAdapter]) + +Returns the provided request function wrapped with cache support. + +#### request + +Type: `function` + +Request function to wrap with cache support. Should be [`http.request`](https://nodejs.org/api/http.html#http_http_request_options_callback) or a similar API compatible request function. + +#### storageAdapter + +Type: `Keyv storage adapter`
+Default: `new Map()` + +A [Keyv](https://github.com/lukechilds/keyv) storage adapter instance, or connection string if using with an official Keyv storage adapter. + +### Instance + +#### cacheableRequest(opts, [cb]) + +Returns an event emitter. + +##### opts + +Type: `object`, `string` + +- Any of the default request functions options. +- Any [`http-cache-semantics`](https://github.com/kornelski/http-cache-semantics#constructor-options) options. +- Any of the following: + +###### opts.cache + +Type: `boolean`
+Default: `true` + +If the cache should be used. Setting this to false will completely bypass the cache for the current request. + +###### opts.strictTtl + +Type: `boolean`
+Default: `false` + +If set to `true` once a cached resource has expired it is deleted and will have to be re-requested. + +If set to `false` (default), after a cached resource's TTL expires it is kept in the cache and will be revalidated on the next request with `If-None-Match`/`If-Modified-Since` headers. + +###### opts.maxTtl + +Type: `number`
+Default: `undefined` + +Limits TTL. The `number` represents milliseconds. + +###### opts.automaticFailover + +Type: `boolean`
+Default: `false` + +When set to `true`, if the DB connection fails we will automatically fallback to a network request. DB errors will still be emitted to notify you of the problem even though the request callback may succeed. + +###### opts.forceRefresh + +Type: `boolean`
+Default: `false` + +Forces refreshing the cache. If the response could be retrieved from the cache, it will perform a new request and override the cache instead. + +##### cb + +Type: `function` + +The callback function which will receive the response as an argument. + +The response can be either a [Node.js HTTP response stream](https://nodejs.org/api/http.html#http_class_http_incomingmessage) or a [responselike object](https://github.com/lukechilds/responselike). The response will also have a `fromCache` property set with a boolean value. + +##### .on('request', request) + +`request` event to get the request object of the request. + +**Note:** This event will only fire if an HTTP request is actually made, not when a response is retrieved from cache. However, you should always handle the `request` event to end the request and handle any potential request errors. + +##### .on('response', response) + +`response` event to get the response object from the HTTP request or cache. + +##### .on('error', error) + +`error` event emitted in case of an error with the cache. + +Errors emitted here will be an instance of `CacheableRequest.RequestError` or `CacheableRequest.CacheError`. You will only ever receive a `RequestError` if the request function throws (normally caused by invalid user input). Normal request errors should be handled inside the `request` event. + +To properly handle all error scenarios you should use the following pattern: + +```js +cacheableRequest('example.com', cb) + .on('error', err => { + if (err instanceof CacheableRequest.CacheError) { + handleCacheError(err); // Cache error + } else if (err instanceof CacheableRequest.RequestError) { + handleRequestError(err); // Request function thrown + } + }) + .on('request', req => { + req.on('error', handleRequestError); // Request error emitted + req.end(); + }); +``` + +**Note:** Database connection errors are emitted here, however `cacheable-request` will attempt to re-request the resource and bypass the cache on a connection error. Therefore a database connection error doesn't necessarily mean the request won't be fulfilled. + +## License + +MIT © Luke Childs diff --git a/node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js b/node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js new file mode 100644 index 00000000..2dd75745 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js @@ -0,0 +1,52 @@ +'use strict'; +const {PassThrough: PassThroughStream} = require('stream'); + +module.exports = options => { + options = {...options}; + + const {array} = options; + let {encoding} = options; + const isBuffer = encoding === 'buffer'; + let objectMode = false; + + if (array) { + objectMode = !(encoding || isBuffer); + } else { + encoding = encoding || 'utf8'; + } + + if (isBuffer) { + encoding = null; + } + + const stream = new PassThroughStream({objectMode}); + + if (encoding) { + stream.setEncoding(encoding); + } + + let length = 0; + const chunks = []; + + stream.on('data', chunk => { + chunks.push(chunk); + + if (objectMode) { + length = chunks.length; + } else { + length += chunk.length; + } + }); + + stream.getBufferedValue = () => { + if (array) { + return chunks; + } + + return isBuffer ? Buffer.concat(chunks, length) : chunks.join(''); + }; + + stream.getBufferedLength = () => length; + + return stream; +}; diff --git a/node_modules/cacheable-request/node_modules/get-stream/index.d.ts b/node_modules/cacheable-request/node_modules/get-stream/index.d.ts new file mode 100644 index 00000000..7b98134d --- /dev/null +++ b/node_modules/cacheable-request/node_modules/get-stream/index.d.ts @@ -0,0 +1,108 @@ +/// +import {Stream} from 'stream'; + +declare class MaxBufferErrorClass extends Error { + readonly name: 'MaxBufferError'; + constructor(); +} + +declare namespace getStream { + interface Options { + /** + Maximum length of the returned string. If it exceeds this value before the stream ends, the promise will be rejected with a `MaxBufferError` error. + + @default Infinity + */ + readonly maxBuffer?: number; + } + + interface OptionsWithEncoding extends Options { + /** + [Encoding](https://nodejs.org/api/buffer.html#buffer_buffer) of the incoming stream. + + @default 'utf8' + */ + readonly encoding?: EncodingType; + } + + type MaxBufferError = MaxBufferErrorClass; +} + +declare const getStream: { + /** + Get the `stream` as a string. + + @returns A promise that resolves when the end event fires on the stream, indicating that there is no more data to be read. The stream is switched to flowing mode. + + @example + ``` + import * as fs from 'fs'; + import getStream = require('get-stream'); + + (async () => { + const stream = fs.createReadStream('unicorn.txt'); + + console.log(await getStream(stream)); + // ,,))))))));, + // __)))))))))))))), + // \|/ -\(((((''''((((((((. + // -*-==//////(('' . `)))))), + // /|\ ))| o ;-. '((((( ,(, + // ( `| / ) ;))))' ,_))^;(~ + // | | | ,))((((_ _____------~~~-. %,;(;(>';'~ + // o_); ; )))(((` ~---~ `:: \ %%~~)(v;(`('~ + // ; ''''```` `: `:::|\,__,%% );`'; ~ + // | _ ) / `:|`----' `-' + // ______/\/~ | / / + // /~;;.____/;;' / ___--,-( `;;;/ + // / // _;______;'------~~~~~ /;;/\ / + // // | | / ; \;;,\ + // (<_ | ; /',/-----' _> + // \_| ||_ //~;~~~~~~~~~ + // `\_| (,~~ + // \~\ + // ~~ + })(); + ``` + */ + (stream: Stream, options?: getStream.OptionsWithEncoding): Promise; + + /** + Get the `stream` as a buffer. + + It honors the `maxBuffer` option as above, but it refers to byte length rather than string length. + */ + buffer( + stream: Stream, + options?: getStream.OptionsWithEncoding + ): Promise; + + /** + Get the `stream` as an array of values. + + It honors both the `maxBuffer` and `encoding` options. The behavior changes slightly based on the encoding chosen: + + - When `encoding` is unset, it assumes an [object mode stream](https://nodesource.com/blog/understanding-object-streams/) and collects values emitted from `stream` unmodified. In this case `maxBuffer` refers to the number of items in the array (not the sum of their sizes). + - When `encoding` is set to `buffer`, it collects an array of buffers. `maxBuffer` refers to the summed byte lengths of every buffer in the array. + - When `encoding` is set to anything else, it collects an array of strings. `maxBuffer` refers to the summed character lengths of every string in the array. + */ + array( + stream: Stream, + options?: getStream.Options + ): Promise; + array( + stream: Stream, + options: getStream.OptionsWithEncoding<'buffer'> + ): Promise; + array( + stream: Stream, + options: getStream.OptionsWithEncoding + ): Promise; + + MaxBufferError: typeof MaxBufferErrorClass; + + // TODO: Remove this for the next major release + default: typeof getStream; +}; + +export = getStream; diff --git a/node_modules/cacheable-request/node_modules/get-stream/index.js b/node_modules/cacheable-request/node_modules/get-stream/index.js new file mode 100644 index 00000000..71f39919 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/get-stream/index.js @@ -0,0 +1,60 @@ +'use strict'; +const {constants: BufferConstants} = require('buffer'); +const pump = require('pump'); +const bufferStream = require('./buffer-stream'); + +class MaxBufferError extends Error { + constructor() { + super('maxBuffer exceeded'); + this.name = 'MaxBufferError'; + } +} + +async function getStream(inputStream, options) { + if (!inputStream) { + return Promise.reject(new Error('Expected a stream')); + } + + options = { + maxBuffer: Infinity, + ...options + }; + + const {maxBuffer} = options; + + let stream; + await new Promise((resolve, reject) => { + const rejectPromise = error => { + // Don't retrieve an oversized buffer. + if (error && stream.getBufferedLength() <= BufferConstants.MAX_LENGTH) { + error.bufferedData = stream.getBufferedValue(); + } + + reject(error); + }; + + stream = pump(inputStream, bufferStream(options), error => { + if (error) { + rejectPromise(error); + return; + } + + resolve(); + }); + + stream.on('data', () => { + if (stream.getBufferedLength() > maxBuffer) { + rejectPromise(new MaxBufferError()); + } + }); + }); + + return stream.getBufferedValue(); +} + +module.exports = getStream; +// TODO: Remove this for the next major release +module.exports.default = getStream; +module.exports.buffer = (stream, options) => getStream(stream, {...options, encoding: 'buffer'}); +module.exports.array = (stream, options) => getStream(stream, {...options, array: true}); +module.exports.MaxBufferError = MaxBufferError; diff --git a/node_modules/cacheable-request/node_modules/get-stream/license b/node_modules/cacheable-request/node_modules/get-stream/license new file mode 100644 index 00000000..fa7ceba3 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/get-stream/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/cacheable-request/node_modules/get-stream/package.json b/node_modules/cacheable-request/node_modules/get-stream/package.json new file mode 100644 index 00000000..1cfa87b0 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/get-stream/package.json @@ -0,0 +1,82 @@ +{ + "_from": "get-stream@^5.1.0", + "_id": "get-stream@5.2.0", + "_inBundle": false, + "_integrity": "sha512-nBF+F1rAZVCu/p7rjzgA+Yb4lfYXrpl7a6VmJrU8wF9I1CKvP/QwPNZHnOlwbTkY6dvtFIzFMSyQXbLoTQPRpA==", + "_location": "/cacheable-request/get-stream", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "get-stream@^5.1.0", + "name": "get-stream", + "escapedName": "get-stream", + "rawSpec": "^5.1.0", + "saveSpec": null, + "fetchSpec": "^5.1.0" + }, + "_requiredBy": [ + "/cacheable-request" + ], + "_resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.2.0.tgz", + "_shasum": "4966a1795ee5ace65e706c4b7beb71257d6e22d3", + "_spec": "get-stream@^5.1.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/cacheable-request", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/get-stream/issues" + }, + "bundleDependencies": false, + "dependencies": { + "pump": "^3.0.0" + }, + "deprecated": false, + "description": "Get a stream as a string, buffer, or array", + "devDependencies": { + "@types/node": "^12.0.7", + "ava": "^2.0.0", + "into-stream": "^5.0.0", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts", + "buffer-stream.js" + ], + "funding": "https://github.com/sponsors/sindresorhus", + "homepage": "https://github.com/sindresorhus/get-stream#readme", + "keywords": [ + "get", + "stream", + "promise", + "concat", + "string", + "text", + "buffer", + "read", + "data", + "consume", + "readable", + "readablestream", + "array", + "object" + ], + "license": "MIT", + "name": "get-stream", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/get-stream.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "5.2.0" +} diff --git a/node_modules/cacheable-request/node_modules/get-stream/readme.md b/node_modules/cacheable-request/node_modules/get-stream/readme.md new file mode 100644 index 00000000..7d7565dc --- /dev/null +++ b/node_modules/cacheable-request/node_modules/get-stream/readme.md @@ -0,0 +1,124 @@ +# get-stream [![Build Status](https://travis-ci.com/sindresorhus/get-stream.svg?branch=master)](https://travis-ci.com/github/sindresorhus/get-stream) + +> Get a stream as a string, buffer, or array + +## Install + +``` +$ npm install get-stream +``` + +## Usage + +```js +const fs = require('fs'); +const getStream = require('get-stream'); + +(async () => { + const stream = fs.createReadStream('unicorn.txt'); + + console.log(await getStream(stream)); + /* + ,,))))))));, + __)))))))))))))), + \|/ -\(((((''''((((((((. + -*-==//////(('' . `)))))), + /|\ ))| o ;-. '((((( ,(, + ( `| / ) ;))))' ,_))^;(~ + | | | ,))((((_ _____------~~~-. %,;(;(>';'~ + o_); ; )))(((` ~---~ `:: \ %%~~)(v;(`('~ + ; ''''```` `: `:::|\,__,%% );`'; ~ + | _ ) / `:|`----' `-' + ______/\/~ | / / + /~;;.____/;;' / ___--,-( `;;;/ + / // _;______;'------~~~~~ /;;/\ / + // | | / ; \;;,\ + (<_ | ; /',/-----' _> + \_| ||_ //~;~~~~~~~~~ + `\_| (,~~ + \~\ + ~~ + */ +})(); +``` + +## API + +The methods returns a promise that resolves when the `end` event fires on the stream, indicating that there is no more data to be read. The stream is switched to flowing mode. + +### getStream(stream, options?) + +Get the `stream` as a string. + +#### options + +Type: `object` + +##### encoding + +Type: `string`\ +Default: `'utf8'` + +[Encoding](https://nodejs.org/api/buffer.html#buffer_buffer) of the incoming stream. + +##### maxBuffer + +Type: `number`\ +Default: `Infinity` + +Maximum length of the returned string. If it exceeds this value before the stream ends, the promise will be rejected with a `getStream.MaxBufferError` error. + +### getStream.buffer(stream, options?) + +Get the `stream` as a buffer. + +It honors the `maxBuffer` option as above, but it refers to byte length rather than string length. + +### getStream.array(stream, options?) + +Get the `stream` as an array of values. + +It honors both the `maxBuffer` and `encoding` options. The behavior changes slightly based on the encoding chosen: + +- When `encoding` is unset, it assumes an [object mode stream](https://nodesource.com/blog/understanding-object-streams/) and collects values emitted from `stream` unmodified. In this case `maxBuffer` refers to the number of items in the array (not the sum of their sizes). + +- When `encoding` is set to `buffer`, it collects an array of buffers. `maxBuffer` refers to the summed byte lengths of every buffer in the array. + +- When `encoding` is set to anything else, it collects an array of strings. `maxBuffer` refers to the summed character lengths of every string in the array. + +## Errors + +If the input stream emits an `error` event, the promise will be rejected with the error. The buffered data will be attached to the `bufferedData` property of the error. + +```js +(async () => { + try { + await getStream(streamThatErrorsAtTheEnd('unicorn')); + } catch (error) { + console.log(error.bufferedData); + //=> 'unicorn' + } +})() +``` + +## FAQ + +### How is this different from [`concat-stream`](https://github.com/maxogden/concat-stream)? + +This module accepts a stream instead of being one and returns a promise instead of using a callback. The API is simpler and it only supports returning a string, buffer, or array. It doesn't have a fragile type inference. You explicitly choose what you want. And it doesn't depend on the huge `readable-stream` package. + +## Related + +- [get-stdin](https://github.com/sindresorhus/get-stdin) - Get stdin as a string or buffer + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
diff --git a/node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts b/node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts new file mode 100644 index 00000000..dc90a751 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts @@ -0,0 +1,16 @@ +/** +Lowercase the keys of an object. + +@returns A new object with the keys lowercased. + +@example +``` +import lowercaseKeys = require('lowercase-keys'); + +lowercaseKeys({FOO: true, bAr: false}); +//=> {foo: true, bar: false} +``` +*/ +declare function lowercaseKeys(object: {[key: string]: T}): {[key: string]: T}; + +export = lowercaseKeys; diff --git a/node_modules/cacheable-request/node_modules/lowercase-keys/index.js b/node_modules/cacheable-request/node_modules/lowercase-keys/index.js new file mode 100644 index 00000000..357fb8f4 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/lowercase-keys/index.js @@ -0,0 +1,10 @@ +'use strict'; +module.exports = object => { + const result = {}; + + for (const [key, value] of Object.entries(object)) { + result[key.toLowerCase()] = value; + } + + return result; +}; diff --git a/node_modules/cacheable-request/node_modules/lowercase-keys/license b/node_modules/cacheable-request/node_modules/lowercase-keys/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/lowercase-keys/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/cacheable-request/node_modules/lowercase-keys/package.json b/node_modules/cacheable-request/node_modules/lowercase-keys/package.json new file mode 100644 index 00000000..6a9b47c7 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/lowercase-keys/package.json @@ -0,0 +1,70 @@ +{ + "_from": "lowercase-keys@^2.0.0", + "_id": "lowercase-keys@2.0.0", + "_inBundle": false, + "_integrity": "sha512-tqNXrS78oMOE73NMxK4EMLQsQowWf8jKooH9g7xPavRT706R6bkQJ6DY2Te7QukaZsulxa30wQ7bk0pm4XiHmA==", + "_location": "/cacheable-request/lowercase-keys", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "lowercase-keys@^2.0.0", + "name": "lowercase-keys", + "escapedName": "lowercase-keys", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/cacheable-request" + ], + "_resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-2.0.0.tgz", + "_shasum": "2603e78b7b4b0006cbca2fbcc8a3202558ac9479", + "_spec": "lowercase-keys@^2.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/cacheable-request", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/lowercase-keys/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Lowercase the keys of an object", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/lowercase-keys#readme", + "keywords": [ + "object", + "assign", + "extend", + "properties", + "lowercase", + "lower-case", + "case", + "keys", + "key" + ], + "license": "MIT", + "name": "lowercase-keys", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/lowercase-keys.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "2.0.0" +} diff --git a/node_modules/cacheable-request/node_modules/lowercase-keys/readme.md b/node_modules/cacheable-request/node_modules/lowercase-keys/readme.md new file mode 100644 index 00000000..b1ed0610 --- /dev/null +++ b/node_modules/cacheable-request/node_modules/lowercase-keys/readme.md @@ -0,0 +1,32 @@ +# lowercase-keys [![Build Status](https://travis-ci.org/sindresorhus/lowercase-keys.svg?branch=master)](https://travis-ci.org/sindresorhus/lowercase-keys) + +> Lowercase the keys of an object + + +## Install + +``` +$ npm install lowercase-keys +``` + + +## Usage + +```js +const lowercaseKeys = require('lowercase-keys'); + +lowercaseKeys({FOO: true, bAr: false}); +//=> {foo: true, bar: false} +``` + + +## API + +### lowercaseKeys(object) + +Returns a new object with the keys lowercased. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/cacheable-request/package.json b/node_modules/cacheable-request/package.json new file mode 100644 index 00000000..0040d4c4 --- /dev/null +++ b/node_modules/cacheable-request/package.json @@ -0,0 +1,94 @@ +{ + "_from": "cacheable-request@^6.0.0", + "_id": "cacheable-request@6.1.0", + "_inBundle": false, + "_integrity": "sha512-Oj3cAGPCqOZX7Rz64Uny2GYAZNliQSqfbePrgAQ1wKAihYmCUnraBtJtKcGR4xz7wF+LoJC+ssFZvv5BgF9Igg==", + "_location": "/cacheable-request", + "_phantomChildren": { + "pump": "3.0.0" + }, + "_requested": { + "type": "range", + "registry": true, + "raw": "cacheable-request@^6.0.0", + "name": "cacheable-request", + "escapedName": "cacheable-request", + "rawSpec": "^6.0.0", + "saveSpec": null, + "fetchSpec": "^6.0.0" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/cacheable-request/-/cacheable-request-6.1.0.tgz", + "_shasum": "20ffb8bd162ba4be11e9567d823db651052ca912", + "_spec": "cacheable-request@^6.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/got", + "author": { + "name": "Luke Childs", + "email": "lukechilds123@gmail.com", + "url": "http://lukechilds.co.uk" + }, + "bugs": { + "url": "https://github.com/lukechilds/cacheable-request/issues" + }, + "bundleDependencies": false, + "dependencies": { + "clone-response": "^1.0.2", + "get-stream": "^5.1.0", + "http-cache-semantics": "^4.0.0", + "keyv": "^3.0.0", + "lowercase-keys": "^2.0.0", + "normalize-url": "^4.1.0", + "responselike": "^1.0.2" + }, + "deprecated": false, + "description": "Wrap native HTTP requests with RFC compliant cache support", + "devDependencies": { + "@keyv/sqlite": "^2.0.0", + "ava": "^1.1.0", + "coveralls": "^3.0.0", + "create-test-server": "3.0.0", + "delay": "^4.0.0", + "eslint-config-xo-lukechilds": "^1.0.0", + "nyc": "^14.1.1", + "pify": "^4.0.0", + "sqlite3": "^4.0.2", + "this": "^1.0.2", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "src" + ], + "homepage": "https://github.com/lukechilds/cacheable-request#readme", + "keywords": [ + "HTTP", + "HTTPS", + "cache", + "caching", + "layer", + "cacheable", + "RFC 7234", + "RFC", + "7234", + "compliant" + ], + "license": "MIT", + "main": "src/index.js", + "name": "cacheable-request", + "repository": { + "type": "git", + "url": "git+https://github.com/lukechilds/cacheable-request.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "test": "xo && nyc ava" + }, + "version": "6.1.0", + "xo": { + "extends": "xo-lukechilds" + } +} diff --git a/node_modules/cacheable-request/src/index.js b/node_modules/cacheable-request/src/index.js new file mode 100644 index 00000000..3fcea3f9 --- /dev/null +++ b/node_modules/cacheable-request/src/index.js @@ -0,0 +1,251 @@ +'use strict'; + +const EventEmitter = require('events'); +const urlLib = require('url'); +const normalizeUrl = require('normalize-url'); +const getStream = require('get-stream'); +const CachePolicy = require('http-cache-semantics'); +const Response = require('responselike'); +const lowercaseKeys = require('lowercase-keys'); +const cloneResponse = require('clone-response'); +const Keyv = require('keyv'); + +class CacheableRequest { + constructor(request, cacheAdapter) { + if (typeof request !== 'function') { + throw new TypeError('Parameter `request` must be a function'); + } + + this.cache = new Keyv({ + uri: typeof cacheAdapter === 'string' && cacheAdapter, + store: typeof cacheAdapter !== 'string' && cacheAdapter, + namespace: 'cacheable-request' + }); + + return this.createCacheableRequest(request); + } + + createCacheableRequest(request) { + return (opts, cb) => { + let url; + if (typeof opts === 'string') { + url = normalizeUrlObject(urlLib.parse(opts)); + opts = {}; + } else if (opts instanceof urlLib.URL) { + url = normalizeUrlObject(urlLib.parse(opts.toString())); + opts = {}; + } else { + const [pathname, ...searchParts] = (opts.path || '').split('?'); + const search = searchParts.length > 0 ? + `?${searchParts.join('?')}` : + ''; + url = normalizeUrlObject({ ...opts, pathname, search }); + } + + opts = { + headers: {}, + method: 'GET', + cache: true, + strictTtl: false, + automaticFailover: false, + ...opts, + ...urlObjectToRequestOptions(url) + }; + opts.headers = lowercaseKeys(opts.headers); + + const ee = new EventEmitter(); + const normalizedUrlString = normalizeUrl( + urlLib.format(url), + { + stripWWW: false, + removeTrailingSlash: false, + stripAuthentication: false + } + ); + const key = `${opts.method}:${normalizedUrlString}`; + let revalidate = false; + let madeRequest = false; + + const makeRequest = opts => { + madeRequest = true; + let requestErrored = false; + let requestErrorCallback; + + const requestErrorPromise = new Promise(resolve => { + requestErrorCallback = () => { + if (!requestErrored) { + requestErrored = true; + resolve(); + } + }; + }); + + const handler = response => { + if (revalidate && !opts.forceRefresh) { + response.status = response.statusCode; + const revalidatedPolicy = CachePolicy.fromObject(revalidate.cachePolicy).revalidatedPolicy(opts, response); + if (!revalidatedPolicy.modified) { + const headers = revalidatedPolicy.policy.responseHeaders(); + response = new Response(revalidate.statusCode, headers, revalidate.body, revalidate.url); + response.cachePolicy = revalidatedPolicy.policy; + response.fromCache = true; + } + } + + if (!response.fromCache) { + response.cachePolicy = new CachePolicy(opts, response, opts); + response.fromCache = false; + } + + let clonedResponse; + if (opts.cache && response.cachePolicy.storable()) { + clonedResponse = cloneResponse(response); + + (async () => { + try { + const bodyPromise = getStream.buffer(response); + + await Promise.race([ + requestErrorPromise, + new Promise(resolve => response.once('end', resolve)) + ]); + + if (requestErrored) { + return; + } + + const body = await bodyPromise; + + const value = { + cachePolicy: response.cachePolicy.toObject(), + url: response.url, + statusCode: response.fromCache ? revalidate.statusCode : response.statusCode, + body + }; + + let ttl = opts.strictTtl ? response.cachePolicy.timeToLive() : undefined; + if (opts.maxTtl) { + ttl = ttl ? Math.min(ttl, opts.maxTtl) : opts.maxTtl; + } + + await this.cache.set(key, value, ttl); + } catch (error) { + ee.emit('error', new CacheableRequest.CacheError(error)); + } + })(); + } else if (opts.cache && revalidate) { + (async () => { + try { + await this.cache.delete(key); + } catch (error) { + ee.emit('error', new CacheableRequest.CacheError(error)); + } + })(); + } + + ee.emit('response', clonedResponse || response); + if (typeof cb === 'function') { + cb(clonedResponse || response); + } + }; + + try { + const req = request(opts, handler); + req.once('error', requestErrorCallback); + req.once('abort', requestErrorCallback); + ee.emit('request', req); + } catch (error) { + ee.emit('error', new CacheableRequest.RequestError(error)); + } + }; + + (async () => { + const get = async opts => { + await Promise.resolve(); + + const cacheEntry = opts.cache ? await this.cache.get(key) : undefined; + if (typeof cacheEntry === 'undefined') { + return makeRequest(opts); + } + + const policy = CachePolicy.fromObject(cacheEntry.cachePolicy); + if (policy.satisfiesWithoutRevalidation(opts) && !opts.forceRefresh) { + const headers = policy.responseHeaders(); + const response = new Response(cacheEntry.statusCode, headers, cacheEntry.body, cacheEntry.url); + response.cachePolicy = policy; + response.fromCache = true; + + ee.emit('response', response); + if (typeof cb === 'function') { + cb(response); + } + } else { + revalidate = cacheEntry; + opts.headers = policy.revalidationHeaders(opts); + makeRequest(opts); + } + }; + + const errorHandler = error => ee.emit('error', new CacheableRequest.CacheError(error)); + this.cache.once('error', errorHandler); + ee.on('response', () => this.cache.removeListener('error', errorHandler)); + + try { + await get(opts); + } catch (error) { + if (opts.automaticFailover && !madeRequest) { + makeRequest(opts); + } + + ee.emit('error', new CacheableRequest.CacheError(error)); + } + })(); + + return ee; + }; + } +} + +function urlObjectToRequestOptions(url) { + const options = { ...url }; + options.path = `${url.pathname || '/'}${url.search || ''}`; + delete options.pathname; + delete options.search; + return options; +} + +function normalizeUrlObject(url) { + // If url was parsed by url.parse or new URL: + // - hostname will be set + // - host will be hostname[:port] + // - port will be set if it was explicit in the parsed string + // Otherwise, url was from request options: + // - hostname or host may be set + // - host shall not have port encoded + return { + protocol: url.protocol, + auth: url.auth, + hostname: url.hostname || url.host || 'localhost', + port: url.port, + pathname: url.pathname, + search: url.search + }; +} + +CacheableRequest.RequestError = class extends Error { + constructor(error) { + super(error.message); + this.name = 'RequestError'; + Object.assign(this, error); + } +}; + +CacheableRequest.CacheError = class extends Error { + constructor(error) { + super(error.message); + this.name = 'CacheError'; + Object.assign(this, error); + } +}; + +module.exports = CacheableRequest; diff --git a/node_modules/camelcase/index.d.ts b/node_modules/camelcase/index.d.ts new file mode 100644 index 00000000..58f2069a --- /dev/null +++ b/node_modules/camelcase/index.d.ts @@ -0,0 +1,63 @@ +declare namespace camelcase { + interface Options { + /** + Uppercase the first character: `foo-bar` → `FooBar`. + + @default false + */ + readonly pascalCase?: boolean; + } +} + +declare const camelcase: { + /** + Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar`. + + @param input - String to convert to camel case. + + @example + ``` + import camelCase = require('camelcase'); + + camelCase('foo-bar'); + //=> 'fooBar' + + camelCase('foo_bar'); + //=> 'fooBar' + + camelCase('Foo-Bar'); + //=> 'fooBar' + + camelCase('Foo-Bar', {pascalCase: true}); + //=> 'FooBar' + + camelCase('--foo.bar', {pascalCase: false}); + //=> 'fooBar' + + camelCase('foo bar'); + //=> 'fooBar' + + console.log(process.argv[3]); + //=> '--foo-bar' + camelCase(process.argv[3]); + //=> 'fooBar' + + camelCase(['foo', 'bar']); + //=> 'fooBar' + + camelCase(['__foo__', '--bar'], {pascalCase: true}); + //=> 'FooBar' + ``` + */ + (input: string | ReadonlyArray, options?: camelcase.Options): string; + + // TODO: Remove this for the next major release, refactor the whole definition to: + // declare function camelcase( + // input: string | ReadonlyArray, + // options?: camelcase.Options + // ): string; + // export = camelcase; + default: typeof camelcase; +}; + +export = camelcase; diff --git a/node_modules/camelcase/index.js b/node_modules/camelcase/index.js new file mode 100644 index 00000000..579f99b4 --- /dev/null +++ b/node_modules/camelcase/index.js @@ -0,0 +1,76 @@ +'use strict'; + +const preserveCamelCase = string => { + let isLastCharLower = false; + let isLastCharUpper = false; + let isLastLastCharUpper = false; + + for (let i = 0; i < string.length; i++) { + const character = string[i]; + + if (isLastCharLower && /[a-zA-Z]/.test(character) && character.toUpperCase() === character) { + string = string.slice(0, i) + '-' + string.slice(i); + isLastCharLower = false; + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = true; + i++; + } else if (isLastCharUpper && isLastLastCharUpper && /[a-zA-Z]/.test(character) && character.toLowerCase() === character) { + string = string.slice(0, i - 1) + '-' + string.slice(i - 1); + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = false; + isLastCharLower = true; + } else { + isLastCharLower = character.toLowerCase() === character && character.toUpperCase() !== character; + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = character.toUpperCase() === character && character.toLowerCase() !== character; + } + } + + return string; +}; + +const camelCase = (input, options) => { + if (!(typeof input === 'string' || Array.isArray(input))) { + throw new TypeError('Expected the input to be `string | string[]`'); + } + + options = Object.assign({ + pascalCase: false + }, options); + + const postProcess = x => options.pascalCase ? x.charAt(0).toUpperCase() + x.slice(1) : x; + + if (Array.isArray(input)) { + input = input.map(x => x.trim()) + .filter(x => x.length) + .join('-'); + } else { + input = input.trim(); + } + + if (input.length === 0) { + return ''; + } + + if (input.length === 1) { + return options.pascalCase ? input.toUpperCase() : input.toLowerCase(); + } + + const hasUpperCase = input !== input.toLowerCase(); + + if (hasUpperCase) { + input = preserveCamelCase(input); + } + + input = input + .replace(/^[_.\- ]+/, '') + .toLowerCase() + .replace(/[_.\- ]+(\w|$)/g, (_, p1) => p1.toUpperCase()) + .replace(/\d+(\w|$)/g, m => m.toUpperCase()); + + return postProcess(input); +}; + +module.exports = camelCase; +// TODO: Remove this for the next major release +module.exports.default = camelCase; diff --git a/node_modules/camelcase/license b/node_modules/camelcase/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/camelcase/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/camelcase/package.json b/node_modules/camelcase/package.json new file mode 100644 index 00000000..a3330833 --- /dev/null +++ b/node_modules/camelcase/package.json @@ -0,0 +1,75 @@ +{ + "_from": "camelcase@^5.3.1", + "_id": "camelcase@5.3.1", + "_inBundle": false, + "_integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "_location": "/camelcase", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "camelcase@^5.3.1", + "name": "camelcase", + "escapedName": "camelcase", + "rawSpec": "^5.3.1", + "saveSpec": null, + "fetchSpec": "^5.3.1" + }, + "_requiredBy": [ + "/boxen" + ], + "_resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "_shasum": "e3c9b31569e106811df242f715725a1f4c494320", + "_spec": "camelcase@^5.3.1", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/boxen", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/camelcase/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar`", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.1", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/camelcase#readme", + "keywords": [ + "camelcase", + "camel-case", + "camel", + "case", + "dash", + "hyphen", + "dot", + "underscore", + "separator", + "string", + "text", + "convert", + "pascalcase", + "pascal-case" + ], + "license": "MIT", + "name": "camelcase", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/camelcase.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "5.3.1" +} diff --git a/node_modules/camelcase/readme.md b/node_modules/camelcase/readme.md new file mode 100644 index 00000000..fde27261 --- /dev/null +++ b/node_modules/camelcase/readme.md @@ -0,0 +1,99 @@ +# camelcase [![Build Status](https://travis-ci.org/sindresorhus/camelcase.svg?branch=master)](https://travis-ci.org/sindresorhus/camelcase) + +> Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar` + +--- + +
+ + Get professional support for 'camelcase' with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
+ +--- + +## Install + +``` +$ npm install camelcase +``` + + +## Usage + +```js +const camelCase = require('camelcase'); + +camelCase('foo-bar'); +//=> 'fooBar' + +camelCase('foo_bar'); +//=> 'fooBar' + +camelCase('Foo-Bar'); +//=> 'fooBar' + +camelCase('Foo-Bar', {pascalCase: true}); +//=> 'FooBar' + +camelCase('--foo.bar', {pascalCase: false}); +//=> 'fooBar' + +camelCase('foo bar'); +//=> 'fooBar' + +console.log(process.argv[3]); +//=> '--foo-bar' +camelCase(process.argv[3]); +//=> 'fooBar' + +camelCase(['foo', 'bar']); +//=> 'fooBar' + +camelCase(['__foo__', '--bar'], {pascalCase: true}); +//=> 'FooBar' +``` + + +## API + +### camelCase(input, [options]) + +#### input + +Type: `string` `string[]` + +String to convert to camel case. + +#### options + +Type: `Object` + +##### pascalCase + +Type: `boolean`
+Default: `false` + +Uppercase the first character: `foo-bar` → `FooBar` + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## Related + +- [decamelize](https://github.com/sindresorhus/decamelize) - The inverse of this module +- [uppercamelcase](https://github.com/SamVerschueren/uppercamelcase) - Like this module, but to PascalCase instead of camelCase +- [titleize](https://github.com/sindresorhus/titleize) - Capitalize every word in string +- [humanize-string](https://github.com/sindresorhus/humanize-string) - Convert a camelized/dasherized/underscored string into a humanized one + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/chalk/index.d.ts b/node_modules/chalk/index.d.ts new file mode 100644 index 00000000..7e22c45e --- /dev/null +++ b/node_modules/chalk/index.d.ts @@ -0,0 +1,411 @@ +declare const enum LevelEnum { + /** + All colors disabled. + */ + None = 0, + + /** + Basic 16 colors support. + */ + Basic = 1, + + /** + ANSI 256 colors support. + */ + Ansi256 = 2, + + /** + Truecolor 16 million colors support. + */ + TrueColor = 3 +} + +/** +Basic foreground colors. + +[More colors here.](https://github.com/chalk/chalk/blob/master/readme.md#256-and-truecolor-color-support) +*/ +declare type ForegroundColor = + | 'black' + | 'red' + | 'green' + | 'yellow' + | 'blue' + | 'magenta' + | 'cyan' + | 'white' + | 'gray' + | 'grey' + | 'blackBright' + | 'redBright' + | 'greenBright' + | 'yellowBright' + | 'blueBright' + | 'magentaBright' + | 'cyanBright' + | 'whiteBright'; + +/** +Basic background colors. + +[More colors here.](https://github.com/chalk/chalk/blob/master/readme.md#256-and-truecolor-color-support) +*/ +declare type BackgroundColor = + | 'bgBlack' + | 'bgRed' + | 'bgGreen' + | 'bgYellow' + | 'bgBlue' + | 'bgMagenta' + | 'bgCyan' + | 'bgWhite' + | 'bgGray' + | 'bgGrey' + | 'bgBlackBright' + | 'bgRedBright' + | 'bgGreenBright' + | 'bgYellowBright' + | 'bgBlueBright' + | 'bgMagentaBright' + | 'bgCyanBright' + | 'bgWhiteBright'; + +/** +Basic colors. + +[More colors here.](https://github.com/chalk/chalk/blob/master/readme.md#256-and-truecolor-color-support) +*/ +declare type Color = ForegroundColor | BackgroundColor; + +declare type Modifiers = + | 'reset' + | 'bold' + | 'dim' + | 'italic' + | 'underline' + | 'inverse' + | 'hidden' + | 'strikethrough' + | 'visible'; + +declare namespace chalk { + type Level = LevelEnum; + + interface Options { + /** + Specify the color support for Chalk. + By default, color support is automatically detected based on the environment. + */ + level?: Level; + } + + interface Instance { + /** + Return a new Chalk instance. + */ + new (options?: Options): Chalk; + } + + /** + Detect whether the terminal supports color. + */ + interface ColorSupport { + /** + The color level used by Chalk. + */ + level: Level; + + /** + Return whether Chalk supports basic 16 colors. + */ + hasBasic: boolean; + + /** + Return whether Chalk supports ANSI 256 colors. + */ + has256: boolean; + + /** + Return whether Chalk supports Truecolor 16 million colors. + */ + has16m: boolean; + } + + interface ChalkFunction { + /** + Use a template string. + + @remarks Template literals are unsupported for nested calls (see [issue #341](https://github.com/chalk/chalk/issues/341)) + + @example + ``` + import chalk = require('chalk'); + + log(chalk` + CPU: {red ${cpu.totalPercent}%} + RAM: {green ${ram.used / ram.total * 100}%} + DISK: {rgb(255,131,0) ${disk.used / disk.total * 100}%} + `); + ``` + */ + (text: TemplateStringsArray, ...placeholders: unknown[]): string; + + (...text: unknown[]): string; + } + + interface Chalk extends ChalkFunction { + /** + Return a new Chalk instance. + */ + Instance: Instance; + + /** + The color support for Chalk. + By default, color support is automatically detected based on the environment. + */ + level: Level; + + /** + Use HEX value to set text color. + + @param color - Hexadecimal value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.hex('#DEADED'); + ``` + */ + hex(color: string): Chalk; + + /** + Use keyword color value to set text color. + + @param color - Keyword value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.keyword('orange'); + ``` + */ + keyword(color: string): Chalk; + + /** + Use RGB values to set text color. + */ + rgb(red: number, green: number, blue: number): Chalk; + + /** + Use HSL values to set text color. + */ + hsl(hue: number, saturation: number, lightness: number): Chalk; + + /** + Use HSV values to set text color. + */ + hsv(hue: number, saturation: number, value: number): Chalk; + + /** + Use HWB values to set text color. + */ + hwb(hue: number, whiteness: number, blackness: number): Chalk; + + /** + Use a [Select/Set Graphic Rendition](https://en.wikipedia.org/wiki/ANSI_escape_code#SGR_parameters) (SGR) [color code number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4_bit) to set text color. + + 30 <= code && code < 38 || 90 <= code && code < 98 + For example, 31 for red, 91 for redBright. + */ + ansi(code: number): Chalk; + + /** + Use a [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set text color. + */ + ansi256(index: number): Chalk; + + /** + Use HEX value to set background color. + + @param color - Hexadecimal value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.bgHex('#DEADED'); + ``` + */ + bgHex(color: string): Chalk; + + /** + Use keyword color value to set background color. + + @param color - Keyword value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.bgKeyword('orange'); + ``` + */ + bgKeyword(color: string): Chalk; + + /** + Use RGB values to set background color. + */ + bgRgb(red: number, green: number, blue: number): Chalk; + + /** + Use HSL values to set background color. + */ + bgHsl(hue: number, saturation: number, lightness: number): Chalk; + + /** + Use HSV values to set background color. + */ + bgHsv(hue: number, saturation: number, value: number): Chalk; + + /** + Use HWB values to set background color. + */ + bgHwb(hue: number, whiteness: number, blackness: number): Chalk; + + /** + Use a [Select/Set Graphic Rendition](https://en.wikipedia.org/wiki/ANSI_escape_code#SGR_parameters) (SGR) [color code number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4_bit) to set background color. + + 30 <= code && code < 38 || 90 <= code && code < 98 + For example, 31 for red, 91 for redBright. + Use the foreground code, not the background code (for example, not 41, nor 101). + */ + bgAnsi(code: number): Chalk; + + /** + Use a [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set background color. + */ + bgAnsi256(index: number): Chalk; + + /** + Modifier: Resets the current color chain. + */ + readonly reset: Chalk; + + /** + Modifier: Make text bold. + */ + readonly bold: Chalk; + + /** + Modifier: Emitting only a small amount of light. + */ + readonly dim: Chalk; + + /** + Modifier: Make text italic. (Not widely supported) + */ + readonly italic: Chalk; + + /** + Modifier: Make text underline. (Not widely supported) + */ + readonly underline: Chalk; + + /** + Modifier: Inverse background and foreground colors. + */ + readonly inverse: Chalk; + + /** + Modifier: Prints the text, but makes it invisible. + */ + readonly hidden: Chalk; + + /** + Modifier: Puts a horizontal line through the center of the text. (Not widely supported) + */ + readonly strikethrough: Chalk; + + /** + Modifier: Prints the text only when Chalk has a color support level > 0. + Can be useful for things that are purely cosmetic. + */ + readonly visible: Chalk; + + readonly black: Chalk; + readonly red: Chalk; + readonly green: Chalk; + readonly yellow: Chalk; + readonly blue: Chalk; + readonly magenta: Chalk; + readonly cyan: Chalk; + readonly white: Chalk; + + /* + Alias for `blackBright`. + */ + readonly gray: Chalk; + + /* + Alias for `blackBright`. + */ + readonly grey: Chalk; + + readonly blackBright: Chalk; + readonly redBright: Chalk; + readonly greenBright: Chalk; + readonly yellowBright: Chalk; + readonly blueBright: Chalk; + readonly magentaBright: Chalk; + readonly cyanBright: Chalk; + readonly whiteBright: Chalk; + + readonly bgBlack: Chalk; + readonly bgRed: Chalk; + readonly bgGreen: Chalk; + readonly bgYellow: Chalk; + readonly bgBlue: Chalk; + readonly bgMagenta: Chalk; + readonly bgCyan: Chalk; + readonly bgWhite: Chalk; + + /* + Alias for `bgBlackBright`. + */ + readonly bgGray: Chalk; + + /* + Alias for `bgBlackBright`. + */ + readonly bgGrey: Chalk; + + readonly bgBlackBright: Chalk; + readonly bgRedBright: Chalk; + readonly bgGreenBright: Chalk; + readonly bgYellowBright: Chalk; + readonly bgBlueBright: Chalk; + readonly bgMagentaBright: Chalk; + readonly bgCyanBright: Chalk; + readonly bgWhiteBright: Chalk; + } +} + +/** +Main Chalk object that allows to chain styles together. +Call the last one as a method with a string argument. +Order doesn't matter, and later styles take precedent in case of a conflict. +This simply means that `chalk.red.yellow.green` is equivalent to `chalk.green`. +*/ +declare const chalk: chalk.Chalk & chalk.ChalkFunction & { + supportsColor: chalk.ColorSupport | false; + Level: typeof LevelEnum; + Color: Color; + ForegroundColor: ForegroundColor; + BackgroundColor: BackgroundColor; + Modifiers: Modifiers; + stderr: chalk.Chalk & {supportsColor: chalk.ColorSupport | false}; +}; + +export = chalk; diff --git a/node_modules/chalk/license b/node_modules/chalk/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/chalk/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/chalk/node_modules/has-flag/index.d.ts b/node_modules/chalk/node_modules/has-flag/index.d.ts new file mode 100644 index 00000000..a0a48c89 --- /dev/null +++ b/node_modules/chalk/node_modules/has-flag/index.d.ts @@ -0,0 +1,39 @@ +/** +Check if [`argv`](https://nodejs.org/docs/latest/api/process.html#process_process_argv) has a specific flag. + +@param flag - CLI flag to look for. The `--` prefix is optional. +@param argv - CLI arguments. Default: `process.argv`. +@returns Whether the flag exists. + +@example +``` +// $ ts-node foo.ts -f --unicorn --foo=bar -- --rainbow + +// foo.ts +import hasFlag = require('has-flag'); + +hasFlag('unicorn'); +//=> true + +hasFlag('--unicorn'); +//=> true + +hasFlag('f'); +//=> true + +hasFlag('-f'); +//=> true + +hasFlag('foo=bar'); +//=> true + +hasFlag('foo'); +//=> false + +hasFlag('rainbow'); +//=> false +``` +*/ +declare function hasFlag(flag: string, argv?: string[]): boolean; + +export = hasFlag; diff --git a/node_modules/chalk/node_modules/has-flag/index.js b/node_modules/chalk/node_modules/has-flag/index.js new file mode 100644 index 00000000..b6f80b1f --- /dev/null +++ b/node_modules/chalk/node_modules/has-flag/index.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = (flag, argv = process.argv) => { + const prefix = flag.startsWith('-') ? '' : (flag.length === 1 ? '-' : '--'); + const position = argv.indexOf(prefix + flag); + const terminatorPosition = argv.indexOf('--'); + return position !== -1 && (terminatorPosition === -1 || position < terminatorPosition); +}; diff --git a/node_modules/chalk/node_modules/has-flag/license b/node_modules/chalk/node_modules/has-flag/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/chalk/node_modules/has-flag/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/chalk/node_modules/has-flag/package.json b/node_modules/chalk/node_modules/has-flag/package.json new file mode 100644 index 00000000..fb17b130 --- /dev/null +++ b/node_modules/chalk/node_modules/has-flag/package.json @@ -0,0 +1,78 @@ +{ + "_from": "has-flag@^4.0.0", + "_id": "has-flag@4.0.0", + "_inBundle": false, + "_integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "_location": "/chalk/has-flag", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "has-flag@^4.0.0", + "name": "has-flag", + "escapedName": "has-flag", + "rawSpec": "^4.0.0", + "saveSpec": null, + "fetchSpec": "^4.0.0" + }, + "_requiredBy": [ + "/chalk/supports-color" + ], + "_resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "_shasum": "944771fd9c81c81265c4d6941860da06bb59479b", + "_spec": "has-flag@^4.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/chalk/node_modules/supports-color", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/has-flag/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Check if argv has a specific flag", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/has-flag#readme", + "keywords": [ + "has", + "check", + "detect", + "contains", + "find", + "flag", + "cli", + "command-line", + "argv", + "process", + "arg", + "args", + "argument", + "arguments", + "getopt", + "minimist", + "optimist" + ], + "license": "MIT", + "name": "has-flag", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/has-flag.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "4.0.0" +} diff --git a/node_modules/chalk/node_modules/has-flag/readme.md b/node_modules/chalk/node_modules/has-flag/readme.md new file mode 100644 index 00000000..3f72dff2 --- /dev/null +++ b/node_modules/chalk/node_modules/has-flag/readme.md @@ -0,0 +1,89 @@ +# has-flag [![Build Status](https://travis-ci.org/sindresorhus/has-flag.svg?branch=master)](https://travis-ci.org/sindresorhus/has-flag) + +> Check if [`argv`](https://nodejs.org/docs/latest/api/process.html#process_process_argv) has a specific flag + +Correctly stops looking after an `--` argument terminator. + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
+ +--- + + +## Install + +``` +$ npm install has-flag +``` + + +## Usage + +```js +// foo.js +const hasFlag = require('has-flag'); + +hasFlag('unicorn'); +//=> true + +hasFlag('--unicorn'); +//=> true + +hasFlag('f'); +//=> true + +hasFlag('-f'); +//=> true + +hasFlag('foo=bar'); +//=> true + +hasFlag('foo'); +//=> false + +hasFlag('rainbow'); +//=> false +``` + +``` +$ node foo.js -f --unicorn --foo=bar -- --rainbow +``` + + +## API + +### hasFlag(flag, [argv]) + +Returns a boolean for whether the flag exists. + +#### flag + +Type: `string` + +CLI flag to look for. The `--` prefix is optional. + +#### argv + +Type: `string[]`
+Default: `process.argv` + +CLI arguments. + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/chalk/node_modules/supports-color/browser.js b/node_modules/chalk/node_modules/supports-color/browser.js new file mode 100644 index 00000000..62afa3a7 --- /dev/null +++ b/node_modules/chalk/node_modules/supports-color/browser.js @@ -0,0 +1,5 @@ +'use strict'; +module.exports = { + stdout: false, + stderr: false +}; diff --git a/node_modules/chalk/node_modules/supports-color/index.js b/node_modules/chalk/node_modules/supports-color/index.js new file mode 100644 index 00000000..6fada390 --- /dev/null +++ b/node_modules/chalk/node_modules/supports-color/index.js @@ -0,0 +1,135 @@ +'use strict'; +const os = require('os'); +const tty = require('tty'); +const hasFlag = require('has-flag'); + +const {env} = process; + +let forceColor; +if (hasFlag('no-color') || + hasFlag('no-colors') || + hasFlag('color=false') || + hasFlag('color=never')) { + forceColor = 0; +} else if (hasFlag('color') || + hasFlag('colors') || + hasFlag('color=true') || + hasFlag('color=always')) { + forceColor = 1; +} + +if ('FORCE_COLOR' in env) { + if (env.FORCE_COLOR === 'true') { + forceColor = 1; + } else if (env.FORCE_COLOR === 'false') { + forceColor = 0; + } else { + forceColor = env.FORCE_COLOR.length === 0 ? 1 : Math.min(parseInt(env.FORCE_COLOR, 10), 3); + } +} + +function translateLevel(level) { + if (level === 0) { + return false; + } + + return { + level, + hasBasic: true, + has256: level >= 2, + has16m: level >= 3 + }; +} + +function supportsColor(haveStream, streamIsTTY) { + if (forceColor === 0) { + return 0; + } + + if (hasFlag('color=16m') || + hasFlag('color=full') || + hasFlag('color=truecolor')) { + return 3; + } + + if (hasFlag('color=256')) { + return 2; + } + + if (haveStream && !streamIsTTY && forceColor === undefined) { + return 0; + } + + const min = forceColor || 0; + + if (env.TERM === 'dumb') { + return min; + } + + if (process.platform === 'win32') { + // Windows 10 build 10586 is the first Windows release that supports 256 colors. + // Windows 10 build 14931 is the first release that supports 16m/TrueColor. + const osRelease = os.release().split('.'); + if ( + Number(osRelease[0]) >= 10 && + Number(osRelease[2]) >= 10586 + ) { + return Number(osRelease[2]) >= 14931 ? 3 : 2; + } + + return 1; + } + + if ('CI' in env) { + if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI', 'GITHUB_ACTIONS', 'BUILDKITE'].some(sign => sign in env) || env.CI_NAME === 'codeship') { + return 1; + } + + return min; + } + + if ('TEAMCITY_VERSION' in env) { + return /^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0; + } + + if (env.COLORTERM === 'truecolor') { + return 3; + } + + if ('TERM_PROGRAM' in env) { + const version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10); + + switch (env.TERM_PROGRAM) { + case 'iTerm.app': + return version >= 3 ? 3 : 2; + case 'Apple_Terminal': + return 2; + // No default + } + } + + if (/-256(color)?$/i.test(env.TERM)) { + return 2; + } + + if (/^screen|^xterm|^vt100|^vt220|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) { + return 1; + } + + if ('COLORTERM' in env) { + return 1; + } + + return min; +} + +function getSupportLevel(stream) { + const level = supportsColor(stream, stream && stream.isTTY); + return translateLevel(level); +} + +module.exports = { + supportsColor: getSupportLevel, + stdout: translateLevel(supportsColor(true, tty.isatty(1))), + stderr: translateLevel(supportsColor(true, tty.isatty(2))) +}; diff --git a/node_modules/chalk/node_modules/supports-color/license b/node_modules/chalk/node_modules/supports-color/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/node_modules/chalk/node_modules/supports-color/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/chalk/node_modules/supports-color/package.json b/node_modules/chalk/node_modules/supports-color/package.json new file mode 100644 index 00000000..d2cb7b72 --- /dev/null +++ b/node_modules/chalk/node_modules/supports-color/package.json @@ -0,0 +1,85 @@ +{ + "_from": "supports-color@^7.1.0", + "_id": "supports-color@7.2.0", + "_inBundle": false, + "_integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "_location": "/chalk/supports-color", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "supports-color@^7.1.0", + "name": "supports-color", + "escapedName": "supports-color", + "rawSpec": "^7.1.0", + "saveSpec": null, + "fetchSpec": "^7.1.0" + }, + "_requiredBy": [ + "/chalk" + ], + "_resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "_shasum": "1b7dcdcb32b8138801b3e478ba6a51caa89648da", + "_spec": "supports-color@^7.1.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/chalk", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "browser": "browser.js", + "bugs": { + "url": "https://github.com/chalk/supports-color/issues" + }, + "bundleDependencies": false, + "dependencies": { + "has-flag": "^4.0.0" + }, + "deprecated": false, + "description": "Detect whether a terminal supports color", + "devDependencies": { + "ava": "^1.4.1", + "import-fresh": "^3.0.0", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "browser.js" + ], + "homepage": "https://github.com/chalk/supports-color#readme", + "keywords": [ + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "ansi", + "styles", + "tty", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "support", + "supports", + "capability", + "detect", + "truecolor", + "16m" + ], + "license": "MIT", + "name": "supports-color", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/supports-color.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "7.2.0" +} diff --git a/node_modules/chalk/node_modules/supports-color/readme.md b/node_modules/chalk/node_modules/supports-color/readme.md new file mode 100644 index 00000000..36542285 --- /dev/null +++ b/node_modules/chalk/node_modules/supports-color/readme.md @@ -0,0 +1,76 @@ +# supports-color [![Build Status](https://travis-ci.org/chalk/supports-color.svg?branch=master)](https://travis-ci.org/chalk/supports-color) + +> Detect whether a terminal supports color + + +## Install + +``` +$ npm install supports-color +``` + + +## Usage + +```js +const supportsColor = require('supports-color'); + +if (supportsColor.stdout) { + console.log('Terminal stdout supports color'); +} + +if (supportsColor.stdout.has256) { + console.log('Terminal stdout supports 256 colors'); +} + +if (supportsColor.stderr.has16m) { + console.log('Terminal stderr supports 16 million colors (truecolor)'); +} +``` + + +## API + +Returns an `Object` with a `stdout` and `stderr` property for testing either streams. Each property is an `Object`, or `false` if color is not supported. + +The `stdout`/`stderr` objects specifies a level of support for color through a `.level` property and a corresponding flag: + +- `.level = 1` and `.hasBasic = true`: Basic color support (16 colors) +- `.level = 2` and `.has256 = true`: 256 color support +- `.level = 3` and `.has16m = true`: Truecolor support (16 million colors) + + +## Info + +It obeys the `--color` and `--no-color` CLI flags. + +For situations where using `--color` is not possible, use the environment variable `FORCE_COLOR=1` (level 1), `FORCE_COLOR=2` (level 2), or `FORCE_COLOR=3` (level 3) to forcefully enable color, or `FORCE_COLOR=0` to forcefully disable. The use of `FORCE_COLOR` overrides all other color support checks. + +Explicit 256/Truecolor mode can be enabled using the `--color=256` and `--color=16m` flags, respectively. + + +## Related + +- [supports-color-cli](https://github.com/chalk/supports-color-cli) - CLI for this module +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
+ +--- diff --git a/node_modules/chalk/package.json b/node_modules/chalk/package.json new file mode 100644 index 00000000..2cafcaf5 --- /dev/null +++ b/node_modules/chalk/package.json @@ -0,0 +1,96 @@ +{ + "_from": "chalk@^3.0.0", + "_id": "chalk@3.0.0", + "_inBundle": false, + "_integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", + "_location": "/chalk", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "chalk@^3.0.0", + "name": "chalk", + "escapedName": "chalk", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/boxen", + "/update-notifier" + ], + "_resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", + "_shasum": "3f73c2bf526591f574cc492c51e2456349f844e4", + "_spec": "chalk@^3.0.0", + "_where": "/Users/azizrourou/Desktop/medtech/2021Spring/CS425/assignment-1/Assignment-1/node_modules/update-notifier", + "bugs": { + "url": "https://github.com/chalk/chalk/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "deprecated": false, + "description": "Terminal string styling done right", + "devDependencies": { + "ava": "^2.4.0", + "coveralls": "^3.0.7", + "execa": "^3.2.0", + "import-fresh": "^3.1.0", + "matcha": "^0.7.0", + "nyc": "^14.1.1", + "resolve-from": "^5.0.0", + "tsd": "^0.7.4", + "xo": "^0.25.3" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "source", + "index.d.ts" + ], + "homepage": "https://github.com/chalk/chalk#readme", + "keywords": [ + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "str", + "ansi", + "style", + "styles", + "tty", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "main": "source", + "name": "chalk", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/chalk.git" + }, + "scripts": { + "bench": "matcha benchmark.js", + "test": "xo && nyc ava && tsd" + }, + "version": "3.0.0", + "xo": { + "rules": { + "unicorn/prefer-string-slice": "off", + "unicorn/prefer-includes": "off" + } + } +} diff --git a/node_modules/chalk/readme.md b/node_modules/chalk/readme.md new file mode 100644 index 00000000..877cb93b --- /dev/null +++ b/node_modules/chalk/readme.md @@ -0,0 +1,304 @@ +

+
+
+ Chalk +
+
+
+

+ +> Terminal string styling done right + +[![Build Status](https://travis-ci.org/chalk/chalk.svg?branch=master)](https://travis-ci.org/chalk/chalk) [![Coverage Status](https://coveralls.io/repos/github/chalk/chalk/badge.svg?branch=master)](https://coveralls.io/github/chalk/chalk?branch=master) [![npm dependents](https://badgen.net/npm/dependents/chalk)](https://www.npmjs.com/package/chalk?activeTab=dependents) [![Downloads](https://badgen.net/npm/dt/chalk)](https://www.npmjs.com/package/chalk) [![](https://img.shields.io/badge/unicorn-approved-ff69b4.svg)](https://www.youtube.com/watch?v=9auOCbH5Ns4) [![XO code style](https://img.shields.io/badge/code_style-XO-5ed9c7.svg)](https://github.com/xojs/xo) ![TypeScript-ready](https://img.shields.io/npm/types/chalk.svg) + + + + +## Highlights + +- Expressive API +- Highly performant +- Ability to nest styles +- [256/Truecolor color support](#256-and-truecolor-color-support) +- Auto-detects color support +- Doesn't extend `String.prototype` +- Clean and focused +- Actively maintained +- [Used by ~46,000 packages](https://www.npmjs.com/browse/depended/chalk) as of October 1, 2019 + + +## Install + +```console +$ npm install chalk +``` + + +## Usage + +```js +const chalk = require('chalk'); + +console.log(chalk.blue('Hello world!')); +``` + +Chalk comes with an easy to use composable API where you just chain and nest the styles you want. + +```js +const chalk = require('chalk'); +const log = console.log; + +// Combine styled and normal strings +log(chalk.blue('Hello') + ' World' + chalk.red('!')); + +// Compose multiple styles using the chainable API +log(chalk.blue.bgRed.bold('Hello world!')); + +// Pass in multiple arguments +log(chalk.blue('Hello', 'World!', 'Foo', 'bar', 'biz', 'baz')); + +// Nest styles +log(chalk.red('Hello', chalk.underline.bgBlue('world') + '!')); + +// Nest styles of the same type even (color, underline, background) +log(chalk.green( + 'I am a green line ' + + chalk.blue.underline.bold('with a blue substring') + + ' that becomes green again!' +)); + +// ES2015 template literal +log(` +CPU: ${chalk.red('90%')} +RAM: ${chalk.green('40%')} +DISK: ${chalk.yellow('70%')} +`); + +// ES2015 tagged template literal +log(chalk` +CPU: {red ${cpu.totalPercent}%} +RAM: {green ${ram.used / ram.total * 100}%} +DISK: {rgb(255,131,0) ${disk.used / disk.total * 100}%} +`); + +// Use RGB colors in terminal emulators that support it. +log(chalk.keyword('orange')('Yay for orange colored text!')); +log(chalk.rgb(123, 45, 67).underline('Underlined reddish color')); +log(chalk.hex('#DEADED').bold('Bold gray!')); +``` + +Easily define your own themes: + +```js +const chalk = require('chalk'); + +const error = chalk.bold.red; +const warning = chalk.keyword('orange'); + +console.log(error('Error!')); +console.log(warning('Warning!')); +``` + +Take advantage of console.log [string substitution](https://nodejs.org/docs/latest/api/console.html#console_console_log_data_args): + +```js +const name = 'Sindre'; +console.log(chalk.green('Hello %s'), name); +//=> 'Hello Sindre' +``` + + +## API + +### chalk.`
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+