diff --git a/Bayesian optimization of 5 decarboxylative olefination reactions.txtpb b/Bayesian optimization of 5 decarboxylative olefination reactions.txtpb new file mode 100644 index 0000000..55d2668 --- /dev/null +++ b/Bayesian optimization of 5 decarboxylative olefination reactions.txtpb @@ -0,0 +1,30482 @@ +name: "Bayesian optimization of 5 decarboxylative olefination reactions" +description: "The decarboxylative olefination between 5 pairings of aldehydes and malonic acid half-thioesters were studied in a Bayesian optimization campaign of 120 reaction datapoints. For each pairing, the catalyst, solvent, temperature and equivalents were optimized across 4 rounds of 6 experiments. Reactions performed by the Alan R. Healy group at New York University Abu Dhabi, and the pre-print publication is available on ChemRxiv at https://doi.org/10.26434/chemrxiv.15001213/v1. This dataset was used as training data for a subsequent transfer learning optimization of similar aldehydes and malonic acid derivatives (Dataset ID: )." +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 68.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2ee27ada16194210b7bda87dc94b3adf" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 79.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "08fcda31e8274cc49c17c0d75510176b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 71.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "40feafd1d54249eb90c6a5fbd4781c20" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 71.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e4637fb74be041e0960ce11adc5e8d4e" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 13.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a43a6c2e8ef64504881ed7d10b04637f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 68.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "79f1922e7bc147aca78d29a66b6ad3ee" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 58.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "48bf30d0f56c438694319ced7fd1be5b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 85.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "461f232fa0d64f5ba6328cd8b13f6edd" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 19.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "87ff63a987b549338d4de180f8006313" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 19.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7365fea94f224f53806d5e34f516da53" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "dbf6efe9bc8c4bdb9a24c34dc2d00344" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 43.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e1c412a74e7f49d3923b19b935d68f83" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 89.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2f2d0a9619b04e94b0233e0498d6704c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 81.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "505920a5335349548fd2a0f757a4eed5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 67.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "284a87eb14994ffe9cf14dc7ede3e703" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 91.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "76ba8c4b19ed49be9378e9f5a21fb439" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 59.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "295fba09257c4c548417ec6fa9497130" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 81.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2c6fb95448154dcaa8ef9e822c7c274b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 84.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "edcc9d3a91eb43188a9f5c723f3d26b3" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 87.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "20b50169e4b74f189b30fd78707de1bc" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 42.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a9ebcac88529455f961cbed3ab5ae6af" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 89.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6fe8fed99f704a5db9fb8f0bfdc03bab" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 46.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "483e43b8986442f0b0a110ed7b0678c3" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C([N+]([O-])=O)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 39.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "19b83a832ad24a55b0e54dfa7f1f3b61" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 17.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "452c1cbb8f344ccf8db130c462e8c121" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 80.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e3896d58b21e48ebba482a0f2cb2f279" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 83.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "323930671a0a4d3990b9f44d47c74ab1" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d868ab5b04264700b12703026b6fef22" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8908926ee9f746839ff62a93d61550e6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 48.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "719f3ec9947141cfb1ccc0e83d99a284" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 24.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6ffc78623e82443fbee4beed5799813b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 74.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "91431803190340b2ba47b1569368e74b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 20.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "10760b1ab24a44bf831c6015038d053c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 16.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b1f978c496484e3c9a41cc26b3ecc980" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 87.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "0c48967bf60742acbe917881ef14eff6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 42.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4b013f39436a4dcea9fadae53c59acb7" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 93.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "575113fb562b4cc1b84c3a2a434ec6f4" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 74.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "10c6ac71445240dbbf338915447119a9" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 60.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9e4fdcf5c67b4bb7ba971e7abd9cf6e6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 13.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ee613671c857498b8e8ab2e4b4d273e8" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 94.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "77918e1a71894e8db89340b527c352e8" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "770029fb27a14a2f839c9f54e58295c1" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 62.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "5403417c0da346d8bb11cbbc08b056f5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 82.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "513e51fd38df40c7aa4ff7096ffb6401" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 45.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "901c6f55aaea4cfda5b26b6cad83fcc9" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 7.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ad1e4c4c33774cee8d15c4c4ca077eb5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 67.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "0acd89f1f37d438a889c91797f947b45" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2A" + value: "O=C(SCC)/C=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 75.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "688a222b014843e7815a87da01c7ebd2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 29.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9c9abcef01a0408f95cc2b1f7f3cd64f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 65.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9e2b65b509d04616bb081d772f08bf7a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 72.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d502350d78a844bb975b8a1668f089c4" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 51.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "92357f2d5b5343eb97b59a374cdfb239" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 10.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9827dc91354148d1bd046c13a800e831" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 36.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e700137e67934f73a61c8c8b18978a23" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 86.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "693b8d45f7794ab2a190cf6f74c22183" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 77.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "5edbf99e14004b4f80a7856989e5e827" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 22.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "841cc269865d45749f3efc04471c46c9" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 47.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9bec3f6677114dca92a1d5d5b2c0da1a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 70.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6ecead94e5be4074857c3a4e4e8ec60b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7f78a4c11fbb44608c03253262894628" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 92.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "f0bdbc7546e54d9f8fe7fe8172bc6134" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 72.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2c0e1a49a49441219fd234c68c50bbdf" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 43.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9d123aede17c42ada3dd6a522cd9cf33" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 56.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9d7b0c32bc844e6faf61d9067d123407" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 57.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6df15b85503e4e8da995c21f770cb915" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 34.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "dcfd44c95c6649289fb2759353892311" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d0e23c5fd2a3447ea48d87852089bd6d" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8ca0da8edef443d881cfa61735c62702" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 49.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a1004f2dc3a54dd0b50590ba62224514" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 84.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e7ed9b53832c4ba883b7364ea4412fbd" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 27.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "0741b603832443eea2b5e0b0b00ade9b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclohexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3C" + value: "F/C(C(SCC)=O)=C\\C1CCCCC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 89.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "95eacb76e67c4f838f0cc48e49e1b48e" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 36.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3ddb379b61f74cd3a7556a4215bcfdd9" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 41.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "06af8432d5a8450490b768d7bf582c3f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 83.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d648f0ff284f465ab5b1b595266bb937" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 35.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6be3a3ae597c4bc1a62d7c58ad0071c7" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 28.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "1134dbdc635345eba26ed342737e4eb6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 16.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2390ade16504402fb0e15a82c50fb373" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 22.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d5130e473f4647f0849208be9d148d56" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 39.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9598b4c9920d436986e1e33381c8c7f2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 34.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d97b5863fc9a484783c4002b0176e056" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 37.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b8f3dfadc6484391834d3f7825bff318" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 34.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "026a8c70e48241d3ba35e5d86c39e047" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 32.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4d31732f41c14aeca3816dbfc55bf5b5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 70.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9c50cd5d8c3e4fcfbd97407c7d192dda" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 65.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ef5a000872e14aa4be3a1d3ba91075ab" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 35.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2ab33e25fa9b46a29ab0c2d5297d3e80" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 6.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4bcd8a0571674d33b3b517693dcebeb9" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 47.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3f87d68edb2e4b7facda6c252ee9b01a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 23.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d21c27cb1a234d9b846afd8462eae699" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 83.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2b9d51b276c447f18f3f76609084a4cb" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 77.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b10670bec4be4119aa6d85e1871790ff" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 4.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "da69a460600b4b3e8716b0052a2f6b00" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 34.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "fe6756cbae2a4aa6936eb5db9813310e" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 6.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "98c8579b7d4344fb8ddd74bea9bdd594" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(NC(C1=CC=CC=C1)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/CCC2=CC=CC=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 82.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3e51f8b737cc4012a19e369d4f460e88" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 60.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "c18ede68d0924cabbb01023b10b9d464" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 31.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e05665c444004ceeb84295112c8837c2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 41.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6b2feda928724a7282aeb0cbc3570ea8" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 73.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "28f48bf2c5d84ae3af1b75f6c5089c47" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "dd9158073d5b48a09141649e6da0ce62" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "c6228d2ffc8d409b9153fac1a5415e6b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3124df81d66349f195f93d817ab1b95b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 44.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8964ea4e7ba840d689c6c316a520e97c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 46.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ce0ff5b27bbf4d90b7f0e289fe9af4d8" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 43.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7094a9ce62f44a86bd598ff7e6340854" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 78.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a2730e5c28bd4c36aaa7a8e76111f034" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 50.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7be3d3ff0804444caf8c1e8409b4a591" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 46.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6285e00548d44bc5a67d98c6a5fcc2b6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 48.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "61f5820ec01e4abcacd58781e5325ab2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 72.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "749bfb88167b484b97d01fa74fc02726" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 68.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b27a689c7ec84c3a9ad367e5da1a3caf" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 48.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "1f918754c5fe4f1e878339d5fa76052f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 80.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b39b16a6106840ed85de4f373de84d16" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 58.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "42100a44815848d89762acc3c3562cf2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 56.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "70ba9bc9c2624196802172bb12cd71fa" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 50.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "71027ba1afad4e6d9541e2b1119de856" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 70.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "027b7f59a8f349f7adc4e7e4c8f4a300" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "C1=CC=C(C=C1)CN.C(=O)(O)C(F)(F)F" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 54.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "1f891b55a9374b239e6cb1f61f244845" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5B" + value: "C/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 39.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e7544e16099840079401f1dbbca88f4a" +} diff --git a/Transfer Learning Optimization of 26 decarboxylative olefination reactions.txtpb b/Transfer Learning Optimization of 26 decarboxylative olefination reactions.txtpb new file mode 100644 index 0000000..dd8985d --- /dev/null +++ b/Transfer Learning Optimization of 26 decarboxylative olefination reactions.txtpb @@ -0,0 +1,34546 @@ +name: "Transfer Learning Optimization of 26 decarboxylative olefination reactions" +description: "The decarboxylative olefination between 26 pairings of aldehydes and malonic acid derivatives were studied in a transfer learning optimization campaign of 136 reaction datapoints. For each pairing, the catalyst, solvent, temperature and equivalents were optimized across several iterations of 2 experiments. Reactions performed by the Alan R. Healy group at New York University Abu Dhabi, and the pre-print publication is available on ChemRxiv at https://doi.org/10.26434/chemrxiv.15001213/v1. This transfer learning dataset was trained with the 120-experiment dataset generated from Bayesian optimization (Reaction ID)." +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1A" + value: "O=C(SCC)/C=C/C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 71.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "5cf8909ebe5046228e6181f706a1e53f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1A" + value: "O=C(SCC)/C=C/C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 91.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7a17e013333844e4a3015b1ef5497466" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(OCC1=CC=CC=C1)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C(OC)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 85.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6ba3162a15064e68ae92261981307f09" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(OCC1=CC=CC=C1)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=C(OC)C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 67.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "fa031cde8cb7470a9e186d58796b1a4b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2CCCCC2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 10.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "177353338be04d0b97dee5abcfda39c2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2CCCCC2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 28.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3183f39b66ac4930b7db39aac6dedf34" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2CCCCC2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 17.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "73b5bde1f5f34ded8155d6f4e8e5a575" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2CCCCC2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 5.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6acb47f1094e4ca4a9f9899b5f80860c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2CCCCC2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 65.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9f153b3413384ed09d29c5572929cd38" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2CCCCC2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 92.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ba292f729a47420187ee613df1620f8c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4B" + value: "C/C(C(SCC)=O)=C\\CCC1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 4.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "49c6907fed5548b6b5a755d55f158e96" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4B" + value: "C/C(C(SCC)=O)=C\\CCC1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 7.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9be16abc32c84ff5ac6a551e8ba913c1" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4B" + value: "C/C(C(SCC)=O)=C\\CCC1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 77.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "dbe04dce8d4e4736a5a8d05ff216c4b5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "hydrocinnamaldehyde" + value: "[H]C(CCC1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "4B" + value: "C/C(C(SCC)=O)=C\\CCC1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 84.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "039cba1847ad4c67a714f4542edae4bc" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 22.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "fc447406c46d4a3baccfe794b0e0e01f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 19.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "359cf5de1efd414fa93ad6a31634c54f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 63.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "fd6fe4afe7f6454c99a1c7f9d5a7c722" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 53.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "73c582437e1e4511888ef6843b4f7372" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 14.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "05fefa95eb974c86b5fd3a6e26be71ba" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7b92c7c7a88143b59ef47c80ebd460dd" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 62.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "f881f969edb7460084ae0af46a8e348a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 60.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "09fef3b5fe95431ba70d042bc5958afa" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 71.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ac2b75bbcae348bb833d1f848bbe7127" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cinnamaldehyde" + value: "[H]C(/C=C/C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "5C" + value: "F/C(C(SCC)=O)=C\\C=C\\C1=CC=CC=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 29.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d50abd96240645f79a666c0cf03ed5eb" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "3-acetylbenzaldehyde" + value: "[H]C(C1=CC(C(C)=O)=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "7A" + value: "CC(C1=CC=CC(/C=C/C(SCC)=O)=C1)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 78.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3a538bd89b664d75ba5bfa9b85d34711" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "3-acetylbenzaldehyde" + value: "[H]C(C1=CC(C(C)=O)=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "7A" + value: "CC(C1=CC=CC(/C=C/C(SCC)=O)=C1)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 87.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "c8009b4d74244b47bd3e3bc4266bc5f7" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "3-acetylbenzaldehyde" + value: "[H]C(C1=CC(C(C)=O)=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "7A" + value: "CC(C1=CC=CC(/C=C/C(SCC)=O)=C1)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 85.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a3f7d396338b4edaa41bdb3db8af007d" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "3-acetylbenzaldehyde" + value: "[H]C(C1=CC(C(C)=O)=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "7A" + value: "CC(C1=CC=CC(/C=C/C(SCC)=O)=C1)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 64.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9fc26546764f422684de0d2463bf8600" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "3-acetylbenzaldehyde" + value: "[H]C(C1=CC(C(C)=O)=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "7A" + value: "CC(C1=CC=CC(/C=C/C(SCC)=O)=C1)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 91.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9807576a3b9444fc9fd05b387130c4df" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "3-acetylbenzaldehyde" + value: "[H]C(C1=CC(C(C)=O)=CC=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "7A" + value: "CC(C1=CC=CC(/C=C/C(SCC)=O)=C1)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 93.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4ad5e0a26ab14068b14217460aecddad" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "furfural" + value: "O=C([H])C1=CC=CO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(OCC1=CC=CC=C1)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "8D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=CO2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 81.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3e5e881c619c4880a6f9c19734bc0061" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "furfural" + value: "O=C([H])C1=CC=CO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(OCC1=CC=CC=C1)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "8D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=CO2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 85.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b7311087c0b54b689d12cc29d529323a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "furfural" + value: "O=C([H])C1=CC=CO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(OCC1=CC=CC=C1)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "8D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=CO2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 83.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "47e2cc1c0ced4c498572383efd9d1565" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "furfural" + value: "O=C([H])C1=CC=CO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(OCC1=CC=CC=C1)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "8D" + value: "O=C(SCC)/C(OCC1=CC=CC=C1)=C/C2=CC=CO2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 92.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d8d5d3156c214d39b9dfd6c06709777c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-naphthaldehyde" + value: "[H]C(C1=CC2=CC=CC=C2C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "9E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2=CC3=CC=CC=C3C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "de302fae44d54c1d882e195aef225b05" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-naphthaldehyde" + value: "[H]C(C1=CC2=CC=CC=C2C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "9E" + value: "O=C(SCC)/C(NC(C1=CC=CC=C1)=O)=C/C2=CC3=CC=CC=C3C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 13.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "30ce58db20fe450ea5cf889004ea930d" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclopropanecarboxaldehyde" + value: "[H]C(C1CC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "10B" + value: "C/C(C(SCC)=O)=C\\C1CC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 57.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2d19ad990fc441c09f8af434238812e5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cyclopropanecarboxaldehyde" + value: "[H]C(C1CC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "CC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "10B" + value: "C/C(C(SCC)=O)=C\\C1CC1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 35.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9735aae44d19411e81fde6969141389f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 26.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8948c9169640463c81861923fee00141" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 15.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "fba2e26d66a04d93b3b6b864ad4bba40" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 60.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3b513f9bf5a444c1a32c9b5d576c682a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 39.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3de9fbeae5ce4684b5745ecc2316e741" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 65.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "618016489e8c4f3bbd15404cda481080" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 70.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6790cb7d3cac4f1bb4625a41c7edd1a2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 19.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3b7136234dd34d52910da17ffb3c6a6c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "2-octynal" + value: "CCCCCC#CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "11C" + value: "CCCCCC#C/C=C(F)/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 84.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "99e6152b9b864122afa10f405a373515" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 22.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e89ffb6cc72a472db25157473f3ec2e6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 6.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2c546d138f0b4678a2595639a885d022" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "df9ccb6266c74811a77e2b6cf3cfe0c8" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d97f81a496ee4ac7906045182ca12403" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 5.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7b412c4f515342bd8ae695c5bf72f384" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e62bb51d3eba4deb9ef4606e270559c4" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 60.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4df608b7b440460a9683fc118ff4f877" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-nitrobenzaldehyde" + value: "[H]C(C1=CC=C([N+]([O-])=O)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "ClC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "1F" + value: "Cl/C(C(SCC)=O)=C\\C1=CC=C([N+]([O-])=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 39.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a5f250ef3ffe4e439ccb04ee5d290977" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 37.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "69731f78e1014a3d87c66a8f7e13b2d1" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 7.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "3010e921eaa945f7b89f831e2e1759ea" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 15.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "5c5b8ffe4b124447a3e159a08ffb8abb" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 13.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2d3237b81bb74bfc964c491aabc37346" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 24.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "1b42b0a09f5f4a4387005331a941af30" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 25.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "f4890285e2734df3b3b06d466b8edf4b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 49.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a201a5b14b5a4a73806db4579c0c6390" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 19.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "68810058c4644794a9d13541eacf90b3" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 82.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d52a5fbe18114129a4db0ac0779da455" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)C" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2G" + value: "COC1=CC=C(/C=C(C)/C(OCC)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "af1ba958139946ecbf3465635ae2a2ad" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)C(C(O)=O)Cl" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2H" + value: "O=C(OC)/C(Cl)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 77.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2bbccb80638549afaff0d6556c2d053b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)C(C(O)=O)Cl" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2H" + value: "O=C(OC)/C(Cl)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 82.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "94dc3a0ba8f6466d8949ccf4fb760827" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)C(C(O)=O)Cl" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2H" + value: "O=C(OC)/C(Cl)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 58.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "5ca12d74344a437a8460ebdcddba9b7e" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)C(C(O)=O)Cl" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2H" + value: "O=C(OC)/C(Cl)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9163df5694644102858cebbbafefe0b9" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)C(C(O)=O)Cl" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2H" + value: "O=C(OC)/C(Cl)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 70.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7842b0f4d84b487fa7334614097a6fae" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)C(C(O)=O)Cl" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2H" + value: "O=C(OC)/C(Cl)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 9.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "0ad0e15d8f824276ac9d749636e7e2ed" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 31.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "5f7cb5bf3f954b2a8c9068070e49ba01" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 70.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ac77f6e770c54b02903189b74f08c9c7" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 60.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4eeed1eeb9bd40909eb18de9d4b540ff" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 24.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7af2bc5d6aca4a648ddc667864cf584f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 80.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2e31b6d12c604ca2809d81bf4b330584" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 45.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ee683b3ebb6b489d96da3ee0f2e9a350" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 64.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4e96c00957a14bf0b22b75ba1b0df86d" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "cychexanecarboxaldehyde" + value: "[H]C(C1CCCCC1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "3I" + value: "O=C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)/C=C/C3CCCCC3" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 28.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "16e091cfa384467bb9d378e92469a314" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 68.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "37efd410c15244fab2c81dc5565dd936" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 72.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "87ceb21abb2a4105a58114280dbeb9ce" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "af51f10994f24377b22a88bf52486567" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7fc82cbe401145cf976b59a9d96ccaf3" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b51241bf39fc4e48916a493e07a05fbe" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "c91f6893f6a541c598cf38c4bf8c0ec2" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 73.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8a0bf934d787462a8820484b2ef537d0" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-methoxybenzaldehyde" + value: "[H]C(C1=CC=C(OC)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(C(O)=O)F" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "2J" + value: "O=C(OCC)/C(F)=C/C1=CC=C(OC)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 93.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b90a3775431d4b4d938555290139faa4" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-iodobenzaldehyde" + value: "IC1=CC=C(C([H])=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(Cl)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "12K" + value: "O=C(OCC)/C(Cl)=C/C1=CC=C(I)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 80.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4285bf0c8ad44bec9b34a327cf024674" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-iodobenzaldehyde" + value: "IC1=CC=C(C([H])=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(Cl)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "12K" + value: "O=C(OCC)/C(Cl)=C/C1=CC=C(I)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 38.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "54358e64641244c9bd9700cabe68f896" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-iodobenzaldehyde" + value: "IC1=CC=C(C([H])=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(Cl)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "12K" + value: "O=C(OCC)/C(Cl)=C/C1=CC=C(I)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 82.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "81119e6d5c7b455e998334dd3614e52b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-iodobenzaldehyde" + value: "IC1=CC=C(C([H])=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OCC)C(Cl)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "12K" + value: "O=C(OCC)/C(Cl)=C/C1=CC=C(I)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 8.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "2435fba7e1244b16a631c26aa18a823c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-trifluoromethylbenzaldehyde" + value: "[H]C(C1=CC=C(C(F)(F)F)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(C)OC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "13L" + value: "O=C(N(C)OC)/C=C/C1=CC=C(C(F)(F)F)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 22.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9e4959ef53674b73ad2f7d9159055257" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-trifluoromethylbenzaldehyde" + value: "[H]C(C1=CC=C(C(F)(F)F)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(C)OC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "13L" + value: "O=C(N(C)OC)/C=C/C1=CC=C(C(F)(F)F)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 71.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "607b5ff9525146fb98885e94dc141f67" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-trifluoromethylbenzaldehyde" + value: "[H]C(C1=CC=C(C(F)(F)F)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(C)OC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "13L" + value: "O=C(N(C)OC)/C=C/C1=CC=C(C(F)(F)F)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 84.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "f003bca5894f45eeb07d824ec3579f19" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "4-trifluoromethylbenzaldehyde" + value: "[H]C(C1=CC=C(C(F)(F)F)C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(C)OC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "13L" + value: "O=C(N(C)OC)/C=C/C1=CC=C(C(F)(F)F)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 67.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "cfdd73ca54e34ba0aa5552d5088ab21f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "piperonal" + value: "[H]C(C1=CC(OCO2)=C2C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N1CCCCC1)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "14M" + value: "O=C(N1CCCCC1)/C=C/C2=CC(OCO3)=C3C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 23.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7311421011ac44149a12d96d6cb1de5a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "piperonal" + value: "[H]C(C1=CC(OCO2)=C2C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N1CCCCC1)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "14M" + value: "O=C(N1CCCCC1)/C=C/C2=CC(OCO3)=C3C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 13.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "30b645448d3a41719d446a5f3acc12c6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "piperonal" + value: "[H]C(C1=CC(OCO2)=C2C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N1CCCCC1)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "14M" + value: "O=C(N1CCCCC1)/C=C/C2=CC(OCO3)=C3C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "f8653d3305dd4e28b7808f50a8555138" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "piperonal" + value: "[H]C(C1=CC(OCO2)=C2C=C1)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N1CCCCC1)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "14M" + value: "O=C(N1CCCCC1)/C=C/C2=CC(OCO3)=C3C=C2" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 80.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "9d5006bbf95845548f4af95a2a24116c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "5-(4-((3-chloro-4-((3-fluorobenzyl)oxy)phenyl)amino)quinazolin-6-yl)furan-2-carbaldehyde" + value: "FC1=CC=CC(COC2=C(Cl)C=C(NC3=C(C=C(C4=CC=C(C([H])=O)O4)C=C5)C5=NC=N3)C=C2)=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(OC)C)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "15L" + value: "FC1=CC=CC(COC2=C(Cl)C=C(NC3=C(C=C(C4=CC=C(/C=C/C(N(OC)C)=O)O4)C=C5)C5=NC=N3)C=C2)=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 90.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "a0414a3678254df0b7c19fc696223939" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "5-(4-((3-chloro-4-((3-fluorobenzyl)oxy)phenyl)amino)quinazolin-6-yl)furan-2-carbaldehyde" + value: "FC1=CC=CC(COC2=C(Cl)C=C(NC3=C(C=C(C4=CC=C(C([H])=O)O4)C=C5)C5=NC=N3)C=C2)=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(N(OC)C)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "15L" + value: "FC1=CC=CC(COC2=C(Cl)C=C(NC3=C(C=C(C4=CC=C(/C=C/C(N(OC)C)=O)O4)C=C5)C5=NC=N3)C=C2)=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 88.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "828c7d796c334abab0ba24206b3bdbbd" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of telmisartan" + value: "CC1=C2C(N(CC3=CC=C(C4=CC=CC=C4C([H])=O)C=C3)C(CCC)=N2)=CC(C5=NC(C=CC=C6)=C6N5C)=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "16C" + value: "CC1=C2C(N(CC3=CC=C(C4=CC=CC=C4/C=C(F)/C(SCC)=O)C=C3)C(CCC)=N2)=CC(C5=NC(C=CC=C6)=C6N5C)=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 100.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "acaff00c6f674bca9b920ff9f472a178" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of telmisartan" + value: "CC1=C2C(N(CC3=CC=C(C4=CC=CC=C4C([H])=O)C=C3)C(CCC)=N2)=CC(C5=NC(C=CC=C6)=C6N5C)=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(O)=O)C(SCC)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "16C" + value: "CC1=C2C(N(CC3=CC=C(C4=CC=CC=C4/C=C(F)/C(SCC)=O)C=C3)C(CCC)=N2)=CC(C5=NC(C=CC=C6)=C6N5C)=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 95.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "34cd04f27eee47fe92b710a06b7d74a6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Tafamidis" + value: "ClC1=CC(Cl)=CC(C(O2)=NC3=C2C=C(C([H])=O)C=C3)=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "17D" + value: "ClC1=CC(Cl)=CC(C(O2)=NC3=C2C=C(/C=C(OCC4=CC=CC=C4)/C(SCC)=O)C=C3)=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 96.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "689f51bd4b65493aa520ec7aff4e9fad" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Tafamidis" + value: "ClC1=CC(Cl)=CC(C(O2)=NC3=C2C=C(C([H])=O)C=C3)=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)OCC1=CC=CC=C1" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "17D" + value: "ClC1=CC(Cl)=CC(C(O2)=NC3=C2C=C(/C=C(OCC4=CC=CC=C4)/C(SCC)=O)C=C3)=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 34.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "f6fca08439e44ae48b7b309e30d7a528" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d37d9f281f6048b2afb7a623ee5a58fb" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 57.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6a247eea7e2e4fcd81056a4e7843924a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 46.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "28678dfef2264e5bac708179650e25ac" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ce6338127bda4e69b23a6c7d7ea4d402" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 51.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8bd07fa74ba14dca95197a79ab5ddddc" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 22.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "8344e90a2e1b4567bed9cfcf8892dd11" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 56.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "ecba793c7d4641829622d31fcde05b6b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "(S)-(-)-citronellal" + value: "C/C(C)=C/CC[C@H](C)CC([H])=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "18A" + value: "C/C(C)=C/CC[C@H](C)C/C=C/C(SCC)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 78.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "7cf49fd8ed5f4fbe83582927c00d9b6a" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of 3-oxolithocholic acid" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC([H])=O)C)([H])C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "19E" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CC/C=C(NC(C5=CC=CC=C5)=O)/C(SCC)=O)C)([H])C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 82.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d02dc0879231405d83ef95d85d41a7d6" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of 3-oxolithocholic acid" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC([H])=O)C)([H])C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "19E" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CC/C=C(NC(C5=CC=CC=C5)=O)/C(SCC)=O)C)([H])C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 77.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4dd4c4bfc08f43af93fad1a6d7a3b81c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of 3-oxolithocholic acid" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC([H])=O)C)([H])C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "19E" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CC/C=C(NC(C5=CC=CC=C5)=O)/C(SCC)=O)C)([H])C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 63.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "97c690da96054cd0aa177ac23f526cea" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of 3-oxolithocholic acid" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC([H])=O)C)([H])C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "19E" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CC/C=C(NC(C5=CC=CC=C5)=O)/C(SCC)=O)C)([H])C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 84.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "d724dcb17fea4fd7b8e6d1fcde4a315b" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of 3-oxolithocholic acid" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC([H])=O)C)([H])C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "19E" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CC/C=C(NC(C5=CC=CC=C5)=O)/C(SCC)=O)C)([H])C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 61.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b8e4510004264f4daff7ce6eb1285064" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of 3-oxolithocholic acid" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC([H])=O)C)([H])C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(SCC)C(C(O)=O)NC(C1=CC=CC=C1)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "19E" + value: "O=C1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CC/C=C(NC(C5=CC=CC=C5)=O)/C(SCC)=O)C)([H])C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 59.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "c2388d4de46f4537a4799f31f3ef257f" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Indomethacin" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(CC([H])=O)=C2C)=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "20N" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(C/C=C/C(OC)=O)=C2C)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "145697162ae54ab49e9bd6a0e883b407" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Indomethacin" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(CC([H])=O)=C2C)=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "20N" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(C/C=C/C(OC)=O)=C2C)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 56.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "e40a81d3ed81430f9f10ca003122b774" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Indomethacin" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(CC([H])=O)=C2C)=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)CC(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "20N" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(C/C=C/C(OC)=O)=C2C)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 18.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "4888713242554e4b8289ac1e5aa3e282" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Indomethacin" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(CC([H])=O)=C2C)=O)C=C1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "O=C(OC)CC(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "20N" + value: "ClC1=CC=C(C(N2C(C=CC(OC)=C3)=C3C(C/C=C/C(OC)=O)=C2C)=O)C=C1" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 80.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "62c8a6e9f6fb4b418d275321089c9a0d" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Gemfibrozil" + value: "CC1=CC=C(C=C1OCCCC(C)(C([H])=O)C)C" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "OC(CC(N(C)OC)=O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "21L" + value: "O=C(N(OC)C)/C=C/C(C)(C)CCCOC1=CC(C)=CC=C1C" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "25bbe7c27a3e4cd6b99a83446b488e7c" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Gemfibrozil" + value: "CC1=CC=C(C=C1OCCCC(C)(C([H])=O)C)C" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "OC(CC(N(C)OC)=O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "21L" + value: "O=C(N(OC)C)/C=C/C(C)(C)CCCOC1=CC(C)=CC=C1C" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 12.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "cea142ade1f44d75bff8b9eb956e6891" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Gemfibrozil" + value: "CC1=CC=C(C=C1OCCCC(C)(C([H])=O)C)C" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "OC(CC(N(C)OC)=O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "21L" + value: "O=C(N(OC)C)/C=C/C(C)(C)CCCOC1=CC(C)=CC=C1C" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "218a7d1626b24c2fa81e99167112cf5e" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Gemfibrozil" + value: "CC1=CC=C(C=C1OCCCC(C)(C([H])=O)C)C" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "OC(CC(N(C)OC)=O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "21L" + value: "O=C(N(OC)C)/C=C/C(C)(C)CCCOC1=CC(C)=CC=C1C" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "976caaaac8dc4eac86c5a4410871d2b5" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Gemfibrozil" + value: "CC1=CC=C(C=C1OCCCC(C)(C([H])=O)C)C" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "OC(CC(N(C)OC)=O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "21L" + value: "O=C(N(OC)C)/C=C/C(C)(C)CCCOC1=CC(C)=CC=C1C" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 19.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "240ee6d6017d46729b5b4c7e0935d865" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "Aldehyde of Gemfibrozil" + value: "CC1=CC=C(C=C1OCCCC(C)(C([H])=O)C)C" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "OC(CC(N(C)OC)=O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "21L" + value: "O=C(N(OC)C)/C=C/C(C)(C)CCCOC1=CC(C)=CC=C1C" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "26d9eec9426e40348095ed95d59f51c0" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 50.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 23.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "6cde6c29effb4eef9514adde234ac4d8" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "BnNH2-TFA" + value: "NCC1=CC=CC=C1.O=C(C(F)(F)F)O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "412e16a18f6b4a9e801770ae4a30f0d1" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 15.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "25c0d784fe864a39a924f6e8c5222ba0" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "DMF" + value: "CN(C=O)C" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "piperidine" + value: "C1CNCCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 41.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "c8fa2f57cf7d412184e5f78422aae134" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 14.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "53d96097657a444788482dba81f4389e" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "Toluene" + value: "CC1=CC=CC=C1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "morpholine" + value: "C1CNCCO1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "86ea437e4ea14bdd9fa99e280742f3c0" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "THF" + value: "C1COCC1" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.0 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.12 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 44.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "b040b5bfa4ad49609406af69f0ca2892" +} +reactions { + inputs { + key: "Reaction Mixture" + value { + components { + identifiers { + type: SMILES + details: "tert-butyl (2-oxoethyl)carbamate" + value: "[H]C(CNC(OC(C)(C)C)=O)=O" + } + amount { + moles { + value: 0.1 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: true + } + components { + identifiers { + type: SMILES + details: "acetonitrile" + value: "CC#N" + } + amount { + volume { + value: 0.5 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + components { + identifiers { + type: SMILES + details: "DMAP" + value: "CN(C)c1ccncc1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: REAGENT + } + components { + identifiers { + type: SMILES + details: "pyrrolidine" + value: "C1CNCC1" + } + amount { + moles { + value: 0.01 + units: MILLIMOLE + } + } + reaction_role: CATALYST + } + components { + identifiers { + type: SMILES + value: "FC(C(SCC)=O)C(O)=O" + } + amount { + moles { + value: 0.2 + units: MILLIMOLE + } + } + reaction_role: REACTANT + is_limiting: false + } + components { + identifiers { + type: CAS_NUMBER + value: " 70955-01-0" + } + identifiers { + type: NAME + value: "4\303\205 Molecular Sieve" + } + amount { + mass { + value: 25.0 + units: MILLIGRAM + } + } + reaction_role: REAGENT + } + addition_order: 1 + } + } + setup { + vessel { + type: VIAL + material { + type: GLASS + } + volume { + value: 8.0 + units: MILLILITER + } + } + is_automated: false + environment { + type: FUME_HOOD + } + } + conditions { + temperature { + control { + type: DRY_ALUMINUM_PLATE + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: TEMPERATURE + details: "The product mixture was cooled to 25 \302\260C." + temperature { + control { + type: AMBIENT + } + setpoint { + value: 25.0 + units: CELSIUS + } + } + } + workups { + type: FILTRATION + details: "Filtered through a pad of celite" + keep_phase: "Organic" + is_automated: false + } + workups { + type: WASH + details: "\"The celite was washed with ethyl acetate (3 x 1 mL).\"" + input { + components { + identifiers { + type: SMILES + details: "ethyl acetate" + value: "CCOC(C)=O" + } + amount { + volume { + value: 3.0 + units: MILLILITER + } + } + reaction_role: WORKUP + } + } + } + workups { + type: CONCENTRATION + details: "The filtrate was concentrated under reduced pressure" + } + workups { + type: ADDITION + details: "A 0.07 M stock solution of the internal standard ethylene carbonate (0.70 mL in CDCl3) was added." + input { + components { + identifiers { + type: SMILES + details: "ethylene carbonate" + value: "O=C1OCCO1" + } + amount { + moles { + value: 0.05 + units: MILLIMOLE + } + } + reaction_role: INTERNAL_STANDARD + } + components { + identifiers { + type: SMILES + details: "CDCl3" + value: "[2H]C(Cl)(Cl)Cl" + } + amount { + volume { + value: 0.7 + units: MILLILITER + } + volume_includes_solutes: true + } + reaction_role: SOLVENT + } + } + } + outcomes { + reaction_time { + value: 24.0 + units: HOUR + } + products { + identifiers { + type: SMILES + details: "22C" + value: "F/C(C(SCC)=O)=C\\CNC(OC(C)(C)C)=O" + } + is_desired_product: true + measurements { + analysis_key: "1H NMR with internal standard" + type: YIELD + uses_internal_standard: true + is_normalized: true + percentage { + value: 0.0 + } + } + reaction_role: PRODUCT + } + analyses { + key: "1H NMR with internal standard" + value { + type: NMR_1H + is_of_isolated_species: false + } + } + } + provenance { + experimenter { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + doi: "10.26434/chemrxiv.15001213" + record_created { + time { + value: "2026-03-18T12:21:54" + } + person { + username: "auth0|69b6748d925a477aa3fd374a" + name: "sp4767@nyu.edu" + orcid: "0000-0002-7054-4914" + email: "sp4767@nyu.edu" + } + } + } + reaction_id: "cedb1d53940147a2be76fe2a1d09dc3f" +}